SK9062003A3 - Substituted triazole diamine derivatives as kinase inhibitors - Google Patents
Substituted triazole diamine derivatives as kinase inhibitors Download PDFInfo
- Publication number
- SK9062003A3 SK9062003A3 SK906-2003A SK9062003A SK9062003A3 SK 9062003 A3 SK9062003 A3 SK 9062003A3 SK 9062003 A SK9062003 A SK 9062003A SK 9062003 A3 SK9062003 A3 SK 9062003A3
- Authority
- SK
- Slovakia
- Prior art keywords
- alkyl
- group
- amino
- substituted
- substituents independently
- Prior art date
Links
- -1 triazole diamine Chemical class 0.000 title claims abstract description 141
- 229940043355 kinase inhibitor Drugs 0.000 title abstract description 10
- 239000003757 phosphotransferase inhibitor Substances 0.000 title description 3
- 108091000080 Phosphotransferase Proteins 0.000 claims abstract description 95
- 102000020233 phosphotransferase Human genes 0.000 claims abstract description 95
- 238000000034 method Methods 0.000 claims abstract description 70
- 230000001404 mediated effect Effects 0.000 claims abstract description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 730
- 125000001424 substituent group Chemical group 0.000 claims description 496
- 150000001875 compounds Chemical class 0.000 claims description 325
- 229910052739 hydrogen Inorganic materials 0.000 claims description 289
- 239000001257 hydrogen Substances 0.000 claims description 262
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 242
- 125000001072 heteroaryl group Chemical group 0.000 claims description 222
- 125000003118 aryl group Chemical group 0.000 claims description 221
- 125000000623 heterocyclic group Chemical group 0.000 claims description 201
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 165
- 229910052799 carbon Inorganic materials 0.000 claims description 164
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 146
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 145
- 125000001475 halogen functional group Chemical group 0.000 claims description 120
- 125000003545 alkoxy group Chemical group 0.000 claims description 112
- 150000002431 hydrogen Chemical class 0.000 claims description 101
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 100
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 100
- 125000003277 amino group Chemical group 0.000 claims description 92
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 89
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 88
- 125000003342 alkenyl group Chemical group 0.000 claims description 83
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 65
- 125000000304 alkynyl group Chemical group 0.000 claims description 51
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 45
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 35
- 125000003282 alkyl amino group Chemical group 0.000 claims description 34
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 27
- 201000010099 disease Diseases 0.000 claims description 24
- 150000003839 salts Chemical class 0.000 claims description 24
- 238000011282 treatment Methods 0.000 claims description 22
- 108010034798 CDC2 Protein Kinase Proteins 0.000 claims description 21
- 102100032857 Cyclin-dependent kinase 1 Human genes 0.000 claims description 21
- 102000016549 Vascular Endothelial Growth Factor Receptor-2 Human genes 0.000 claims description 21
- 108010053099 Vascular Endothelial Growth Factor Receptor-2 Proteins 0.000 claims description 21
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 21
- 206010028980 Neoplasm Diseases 0.000 claims description 18
- 230000005764 inhibitory process Effects 0.000 claims description 18
- 239000008194 pharmaceutical composition Substances 0.000 claims description 18
- 229910002091 carbon monoxide Inorganic materials 0.000 claims description 17
- 230000009977 dual effect Effects 0.000 claims description 17
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims description 16
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims description 16
- 125000004076 pyridyl group Chemical group 0.000 claims description 16
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 claims description 15
- 239000002246 antineoplastic agent Substances 0.000 claims description 15
- 125000001544 thienyl group Chemical group 0.000 claims description 15
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 14
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 229940127089 cytotoxic agent Drugs 0.000 claims description 11
- 108010024986 Cyclin-Dependent Kinase 2 Proteins 0.000 claims description 10
- 102100036239 Cyclin-dependent kinase 2 Human genes 0.000 claims description 10
- 230000001419 dependent effect Effects 0.000 claims description 9
- 125000000335 thiazolyl group Chemical group 0.000 claims description 9
- 102000003903 Cyclin-dependent kinases Human genes 0.000 claims description 8
- 108090000266 Cyclin-dependent kinases Proteins 0.000 claims description 8
- 239000003937 drug carrier Substances 0.000 claims description 8
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 claims description 8
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 7
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 6
- 108010025464 Cyclin-Dependent Kinase 4 Proteins 0.000 claims description 6
- 102100036252 Cyclin-dependent kinase 4 Human genes 0.000 claims description 6
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 claims description 6
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 claims description 6
- 125000004193 piperazinyl group Chemical group 0.000 claims description 6
- 102000005962 receptors Human genes 0.000 claims description 6
- 108020003175 receptors Proteins 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 5
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 125000003386 piperidinyl group Chemical group 0.000 claims description 5
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 5
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 4
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 claims description 4
- 230000033115 angiogenesis Effects 0.000 claims description 4
- 125000004628 isothiazolidinyl group Chemical group S1N(CCC1)* 0.000 claims description 4
- 208000037803 restenosis Diseases 0.000 claims description 4
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 4
- 125000001425 triazolyl group Chemical group 0.000 claims description 4
- 230000004614 tumor growth Effects 0.000 claims description 4
- 206010059245 Angiopathy Diseases 0.000 claims description 3
- 125000005605 benzo group Chemical group 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 2
- ANRUFEHVGOBQPO-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]-n-methylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NN(C(=O)C=2C(=C(C)C=CC=2F)F)C(N)=N1 ANRUFEHVGOBQPO-UHFFFAOYSA-N 0.000 claims description 2
- VVGOTCALTHQXFY-UHFFFAOYSA-N 4-[[5-amino-1-(2-chloro-6-fluorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=CC=CC=2F)Cl)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 VVGOTCALTHQXFY-UHFFFAOYSA-N 0.000 claims description 2
- YWMVKBOCDJSIMY-UHFFFAOYSA-N 4-[[5-amino-1-(3-methylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]-n-methylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NN(C(=O)C2=C(C=CS2)C)C(N)=N1 YWMVKBOCDJSIMY-UHFFFAOYSA-N 0.000 claims description 2
- ARIOBGGRZJITQX-UHFFFAOYSA-N 5-amino-3-{[4-(aminosulfonyl)phenyl]amino}-n-(2,6-difluorophenyl)-1h-1,2,4-triazole-1-carbothioamide Chemical compound N=1N(C(=S)NC=2C(=CC=CC=2F)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 ARIOBGGRZJITQX-UHFFFAOYSA-N 0.000 claims description 2
- JBOXDNIWQACYPW-UHFFFAOYSA-N 5-amino-n-(2,6-difluorophenyl)-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carboxamide Chemical compound N=1N(C(=O)NC=2C(=CC=CC=2F)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 JBOXDNIWQACYPW-UHFFFAOYSA-N 0.000 claims description 2
- CWDWFSXUQODZGW-UHFFFAOYSA-N 5-thiazolyl Chemical group [C]1=CN=CS1 CWDWFSXUQODZGW-UHFFFAOYSA-N 0.000 claims description 2
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 claims description 2
- 238000002512 chemotherapy Methods 0.000 claims description 2
- 208000022605 chemotherapy-induced alopecia Diseases 0.000 claims description 2
- 125000003626 1,2,4-triazol-1-yl group Chemical group [*]N1N=C([H])N=C1[H] 0.000 claims 4
- 108010034265 Vascular Endothelial Growth Factor Receptors Proteins 0.000 claims 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- ZUNASHLZAWVKEM-UHFFFAOYSA-N 4-[[5-amino-1-(2-chloro-6-fluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(NC=3C=CC(=CC=3)S(N)(=O)=O)=N2)N)=C1Cl ZUNASHLZAWVKEM-UHFFFAOYSA-N 0.000 claims 1
- 102000009024 Epidermal Growth Factor Human genes 0.000 claims 1
- 101800003838 Epidermal growth factor Proteins 0.000 claims 1
- KUANYBUVVODAIC-UHFFFAOYSA-N NC1=NC(=NN1C(=O)OC=1SC=CC1C)NC1=CC=C(C=C1)S(=O)(=O)NC1=NC=CC=C1 Chemical compound NC1=NC(=NN1C(=O)OC=1SC=CC1C)NC1=CC=C(C=C1)S(=O)(=O)NC1=NC=CC=C1 KUANYBUVVODAIC-UHFFFAOYSA-N 0.000 claims 1
- 229940116977 epidermal growth factor Drugs 0.000 claims 1
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 claims 1
- 238000001959 radiotherapy Methods 0.000 claims 1
- VBEQCZHXXJYVRD-GACYYNSASA-N uroanthelone Chemical compound C([C@@H](C(=O)N[C@H](C(=O)N[C@@H](CS)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CS)C(=O)N[C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H](CC=1C=CC(O)=CC=1)C(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)C(C)C)[C@@H](C)O)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CO)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@@H](NC(=O)[C@H](CC=1NC=NC=1)NC(=O)[C@H](CCSC)NC(=O)[C@H](CS)NC(=O)[C@@H](NC(=O)CNC(=O)CNC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CS)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@H]1N(CCC1)C(=O)[C@H](CS)NC(=O)CNC(=O)[C@H]1N(CCC1)C(=O)[C@H](CC=1C=CC(O)=CC=1)NC(=O)[C@H](CO)NC(=O)[C@@H](N)CC(N)=O)C(C)C)[C@@H](C)CC)C1=CC=C(O)C=C1 VBEQCZHXXJYVRD-GACYYNSASA-N 0.000 claims 1
- 229940127263 dual kinase inhibitor Drugs 0.000 abstract description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 152
- 125000005843 halogen group Chemical group 0.000 description 130
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 92
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 88
- 239000011734 sodium Substances 0.000 description 76
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 74
- BGRWYRAHAFMIBJ-UHFFFAOYSA-N diisopropylcarbodiimide Natural products CC(C)NC(=O)NC(C)C BGRWYRAHAFMIBJ-UHFFFAOYSA-N 0.000 description 74
- NPZTUJOABDZTLV-UHFFFAOYSA-N hydroxybenzotriazole Substances O=C1C=CC=C2NNN=C12 NPZTUJOABDZTLV-UHFFFAOYSA-N 0.000 description 71
- 210000000941 bile Anatomy 0.000 description 48
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 46
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 34
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 33
- 239000007858 starting material Substances 0.000 description 33
- IFLKEBSJTZGCJG-UHFFFAOYSA-N 3-methylthiophene-2-carboxylic acid Chemical compound CC=1C=CSC=1C(O)=O IFLKEBSJTZGCJG-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 30
- YBJHBAHKTGYVGT-ZKWXMUAHSA-N (+)-Biotin Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 YBJHBAHKTGYVGT-ZKWXMUAHSA-N 0.000 description 28
- 239000000543 intermediate Substances 0.000 description 26
- 238000006243 chemical reaction Methods 0.000 description 25
- 239000000243 solution Substances 0.000 description 25
- 239000007787 solid Substances 0.000 description 23
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 22
- QGQBKGYXFUDGDQ-UHFFFAOYSA-N 3,5-dimethylthiophene-2-carboxylic acid Chemical compound CC1=CC(C)=C(C(O)=O)S1 QGQBKGYXFUDGDQ-UHFFFAOYSA-N 0.000 description 18
- 239000003153 chemical reaction reagent Substances 0.000 description 18
- QRHUZEVERIHEPT-UHFFFAOYSA-N 2,6-difluorobenzoyl chloride Chemical compound FC1=CC=CC(F)=C1C(Cl)=O QRHUZEVERIHEPT-UHFFFAOYSA-N 0.000 description 16
- 239000011541 reaction mixture Substances 0.000 description 16
- 239000002904 solvent Substances 0.000 description 16
- 108091008606 PDGF receptors Proteins 0.000 description 15
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 15
- 238000012360 testing method Methods 0.000 description 15
- 229960002685 biotin Drugs 0.000 description 14
- 235000020958 biotin Nutrition 0.000 description 14
- 239000011616 biotin Substances 0.000 description 14
- 239000000203 mixture Substances 0.000 description 14
- 238000002360 preparation method Methods 0.000 description 14
- ZVBNGIDVTPTFCL-UHFFFAOYSA-N 5-ethylthiophene-2-carboxylic acid Chemical compound CCC1=CC=C(C(O)=O)S1 ZVBNGIDVTPTFCL-UHFFFAOYSA-N 0.000 description 12
- 108010049812 Casein Kinase I Proteins 0.000 description 12
- 102000008122 Casein Kinase I Human genes 0.000 description 12
- 102000052052 Casein Kinase II Human genes 0.000 description 12
- 108010010919 Casein Kinase II Proteins 0.000 description 12
- 108091007911 GSKs Proteins 0.000 description 12
- 102000004103 Glycogen Synthase Kinases Human genes 0.000 description 12
- 102000003746 Insulin Receptor Human genes 0.000 description 12
- 108010001127 Insulin Receptor Proteins 0.000 description 12
- 102100024193 Mitogen-activated protein kinase 1 Human genes 0.000 description 12
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 12
- 210000004027 cell Anatomy 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- LXCIIPPXRHOCQN-UHFFFAOYSA-N 2,6-difluoro-3-methylbenzoyl chloride Chemical compound CC1=CC=C(F)C(C(Cl)=O)=C1F LXCIIPPXRHOCQN-UHFFFAOYSA-N 0.000 description 11
- YEDUAINPPJYDJZ-UHFFFAOYSA-N 2-hydroxybenzothiazole Chemical compound C1=CC=C2SC(O)=NC2=C1 YEDUAINPPJYDJZ-UHFFFAOYSA-N 0.000 description 11
- KHBQMWCZKVMBLN-UHFFFAOYSA-N Benzenesulfonamide Chemical compound NS(=O)(=O)C1=CC=CC=C1 KHBQMWCZKVMBLN-UHFFFAOYSA-N 0.000 description 11
- 102000000584 Calmodulin Human genes 0.000 description 11
- 108010041952 Calmodulin Proteins 0.000 description 11
- 101000876610 Dictyostelium discoideum Extracellular signal-regulated kinase 2 Proteins 0.000 description 11
- 101001052493 Homo sapiens Mitogen-activated protein kinase 1 Proteins 0.000 description 11
- 102000008130 Cyclic AMP-Dependent Protein Kinases Human genes 0.000 description 10
- 239000003814 drug Substances 0.000 description 10
- 108090000765 processed proteins & peptides Proteins 0.000 description 10
- 102000001708 Protein Isoforms Human genes 0.000 description 9
- 108010029485 Protein Isoforms Proteins 0.000 description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 125000001305 1,2,4-triazol-3-yl group Chemical group [H]N1N=C([*])N=C1[H] 0.000 description 7
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 7
- 102000003923 Protein Kinase C Human genes 0.000 description 7
- 108090000315 Protein Kinase C Proteins 0.000 description 7
- 125000002723 alicyclic group Chemical group 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- 229940043378 cyclin-dependent kinase inhibitor Drugs 0.000 description 7
- SLIKWVTWIGHFJE-UHFFFAOYSA-N diphenoxymethylidenecyanamide Chemical compound C=1C=CC=CC=1OC(=NC#N)OC1=CC=CC=C1 SLIKWVTWIGHFJE-UHFFFAOYSA-N 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 125000002950 monocyclic group Chemical group 0.000 description 7
- 229910052760 oxygen Inorganic materials 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000758 substrate Substances 0.000 description 7
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 6
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical class C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 241001465754 Metazoa Species 0.000 description 6
- 238000003556 assay Methods 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 125000001624 naphthyl group Chemical group 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- 239000000825 pharmaceutical preparation Substances 0.000 description 6
- 108090000623 proteins and genes Proteins 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 229910052717 sulfur Inorganic materials 0.000 description 6
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 5
- 108091007914 CDKs Proteins 0.000 description 5
- 102000019025 Calcium-Calmodulin-Dependent Protein Kinases Human genes 0.000 description 5
- 108010026870 Calcium-Calmodulin-Dependent Protein Kinases Proteins 0.000 description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 125000003710 aryl alkyl group Chemical group 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 201000011510 cancer Diseases 0.000 description 5
- 230000022131 cell cycle Effects 0.000 description 5
- 230000004663 cell proliferation Effects 0.000 description 5
- 229940125904 compound 1 Drugs 0.000 description 5
- 239000002875 cyclin dependent kinase inhibitor Substances 0.000 description 5
- PKWIYNIDEDLDCJ-UHFFFAOYSA-N guanazole Chemical class NC1=NNC(N)=N1 PKWIYNIDEDLDCJ-UHFFFAOYSA-N 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 230000002401 inhibitory effect Effects 0.000 description 5
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 5
- 125000003367 polycyclic group Chemical group 0.000 description 5
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 229940002612 prodrug Drugs 0.000 description 5
- 239000000651 prodrug Substances 0.000 description 5
- 235000018102 proteins Nutrition 0.000 description 5
- 102000004169 proteins and genes Human genes 0.000 description 5
- STCUTYSTNUFUHJ-UHFFFAOYSA-N (3,5-diamino-5-methyl-1H-1,2,4-triazol-2-yl)-(3-methylthiophen-2-yl)methanone Chemical compound CC1(NN(C(=N1)N)C(=O)C=1SC=CC=1C)N STCUTYSTNUFUHJ-UHFFFAOYSA-N 0.000 description 4
- UOXJNGFFPMOZDM-UHFFFAOYSA-N 2-[di(propan-2-yl)amino]ethylsulfanyl-methylphosphinic acid Chemical compound CC(C)N(C(C)C)CCSP(C)(O)=O UOXJNGFFPMOZDM-UHFFFAOYSA-N 0.000 description 4
- UQHBKVJLUVNIAY-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]-n-methylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC1=NN(C(=O)C=2C(=CC=CC=2F)F)C(N)=N1 UQHBKVJLUVNIAY-UHFFFAOYSA-N 0.000 description 4
- 201000004384 Alopecia Diseases 0.000 description 4
- BQXUPNKLZNSUMC-YUQWMIPFSA-N CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 Chemical compound CCN(CCCCCOCC(=O)N[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)N[C@@H](C)c1ccc(cc1)-c1scnc1C)C(C)(C)C)CCOc1ccc(cc1)C(=O)c1c(sc2cc(O)ccc12)-c1ccc(O)cc1 BQXUPNKLZNSUMC-YUQWMIPFSA-N 0.000 description 4
- 102000004190 Enzymes Human genes 0.000 description 4
- 108090000790 Enzymes Proteins 0.000 description 4
- 241000238631 Hexapoda Species 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 241000699670 Mus sp. Species 0.000 description 4
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 125000002837 carbocyclic group Chemical group 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 230000010261 cell growth Effects 0.000 description 4
- 230000002349 favourable effect Effects 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine hydrate Chemical compound O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 4
- 238000010348 incorporation Methods 0.000 description 4
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 description 4
- HNQIVZYLYMDVSB-UHFFFAOYSA-N methanesulfonimidic acid Chemical compound CS(N)(=O)=O HNQIVZYLYMDVSB-UHFFFAOYSA-N 0.000 description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 239000003921 oil Substances 0.000 description 4
- 235000019198 oils Nutrition 0.000 description 4
- 239000012044 organic layer Substances 0.000 description 4
- 229920002704 polyhistidine Polymers 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 4
- QERYCTSHXKAMIS-UHFFFAOYSA-N thiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=CS1 QERYCTSHXKAMIS-UHFFFAOYSA-N 0.000 description 4
- 210000004881 tumor cell Anatomy 0.000 description 4
- FNHHVPPSBFQMEL-KQHDFZBMSA-N (3S)-5-N-[(1S,5R)-3-hydroxy-6-bicyclo[3.1.0]hexanyl]-7-N,3-dimethyl-3-phenyl-2H-1-benzofuran-5,7-dicarboxamide Chemical compound CNC(=O)c1cc(cc2c1OC[C@@]2(C)c1ccccc1)C(=O)NC1[C@H]2CC(O)C[C@@H]12 FNHHVPPSBFQMEL-KQHDFZBMSA-N 0.000 description 3
- UNILWMWFPHPYOR-KXEYIPSPSA-M 1-[6-[2-[3-[3-[3-[2-[2-[3-[[2-[2-[[(2r)-1-[[2-[[(2r)-1-[3-[2-[2-[3-[[2-(2-amino-2-oxoethoxy)acetyl]amino]propoxy]ethoxy]ethoxy]propylamino]-3-hydroxy-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-3-[(2r)-2,3-di(hexadecanoyloxy)propyl]sulfanyl-1-oxopropan-2-yl Chemical compound O=C1C(SCCC(=O)NCCCOCCOCCOCCCNC(=O)COCC(=O)N[C@@H](CSC[C@@H](COC(=O)CCCCCCCCCCCCCCC)OC(=O)CCCCCCCCCCCCCCC)C(=O)NCC(=O)N[C@H](CO)C(=O)NCCCOCCOCCOCCCNC(=O)COCC(N)=O)CC(=O)N1CCNC(=O)CCCCCN\1C2=CC=C(S([O-])(=O)=O)C=C2CC/1=C/C=C/C=C/C1=[N+](CC)C2=CC=C(S([O-])(=O)=O)C=C2C1 UNILWMWFPHPYOR-KXEYIPSPSA-M 0.000 description 3
- JAQMUWGXHFXODM-UHFFFAOYSA-N 1-[amino-(3,5-dimethylpyrazol-1-yl)methylidene]-3-[4-(methylsulfamoyl)phenyl]thiourea Chemical compound C1=CC(S(=O)(=O)NC)=CC=C1NC(=S)\N=C(/N)N1C(C)=CC(C)=N1 JAQMUWGXHFXODM-UHFFFAOYSA-N 0.000 description 3
- RPFUCBPCSIJVSM-UHFFFAOYSA-N 3-n-(3-chlorophenyl)-1h-1,2,4-triazole-3,5-diamine Chemical compound N1C(N)=NC(NC=2C=C(Cl)C=CC=2)=N1 RPFUCBPCSIJVSM-UHFFFAOYSA-N 0.000 description 3
- XFJBGINZIMNZBW-CRAIPNDOSA-N 5-chloro-2-[4-[(1r,2s)-2-[2-(5-methylsulfonylpyridin-2-yl)oxyethyl]cyclopropyl]piperidin-1-yl]pyrimidine Chemical compound N1=CC(S(=O)(=O)C)=CC=C1OCC[C@H]1[C@@H](C2CCN(CC2)C=2N=CC(Cl)=CN=2)C1 XFJBGINZIMNZBW-CRAIPNDOSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- 108010049894 Cyclic AMP-Dependent Protein Kinases Proteins 0.000 description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 3
- 102000001301 EGF receptor Human genes 0.000 description 3
- 108060006698 EGF receptor Proteins 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 229910002651 NO3 Inorganic materials 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 108010090804 Streptavidin Proteins 0.000 description 3
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 3
- 231100000360 alopecia Toxicity 0.000 description 3
- 230000000259 anti-tumor effect Effects 0.000 description 3
- 238000013459 approach Methods 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940126540 compound 41 Drugs 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- VZFUCHSFHOYXIS-UHFFFAOYSA-N cycloheptane carboxylic acid Natural products OC(=O)C1CCCCCC1 VZFUCHSFHOYXIS-UHFFFAOYSA-N 0.000 description 3
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 208000035475 disorder Diseases 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- GWNFQAKCJYEJEW-UHFFFAOYSA-N ethyl 3-[8-[[4-methyl-5-[(3-methyl-4-oxophthalazin-1-yl)methyl]-1,2,4-triazol-3-yl]sulfanyl]octanoylamino]benzoate Chemical compound CCOC(=O)C1=CC(NC(=O)CCCCCCCSC2=NN=C(CC3=NN(C)C(=O)C4=CC=CC=C34)N2C)=CC=C1 GWNFQAKCJYEJEW-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- UVECLJDRPFNRRQ-UHFFFAOYSA-N ethyl trifluoromethanesulfonate Chemical compound CCOS(=O)(=O)C(F)(F)F UVECLJDRPFNRRQ-UHFFFAOYSA-N 0.000 description 3
- 125000001153 fluoro group Chemical group F* 0.000 description 3
- 238000009472 formulation Methods 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- RENRQMCACQEWFC-UGKGYDQZSA-N lnp023 Chemical compound C1([C@H]2N(CC=3C=4C=CNC=4C(C)=CC=3OC)CC[C@@H](C2)OCC)=CC=C(C(O)=O)C=C1 RENRQMCACQEWFC-UGKGYDQZSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 125000002971 oxazolyl group Chemical group 0.000 description 3
- 125000004430 oxygen atom Chemical group O* 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 230000004044 response Effects 0.000 description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 3
- 239000003826 tablet Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- 230000000699 topical effect Effects 0.000 description 3
- 239000003981 vehicle Substances 0.000 description 3
- GCTFTMWXZFLTRR-GFCCVEGCSA-N (2r)-2-amino-n-[3-(difluoromethoxy)-4-(1,3-oxazol-5-yl)phenyl]-4-methylpentanamide Chemical compound FC(F)OC1=CC(NC(=O)[C@H](N)CC(C)C)=CC=C1C1=CN=CO1 GCTFTMWXZFLTRR-GFCCVEGCSA-N 0.000 description 2
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 2
- QXOGPTXQGKQSJT-UHFFFAOYSA-N 1-amino-4-[4-(3,4-dimethylphenyl)sulfanylanilino]-9,10-dioxoanthracene-2-sulfonic acid Chemical compound Cc1ccc(Sc2ccc(Nc3cc(c(N)c4C(=O)c5ccccc5C(=O)c34)S(O)(=O)=O)cc2)cc1C QXOGPTXQGKQSJT-UHFFFAOYSA-N 0.000 description 2
- AGYXIUAGBLMBGV-UHFFFAOYSA-N 3,5-dimethylpyrazole-1-carboximidamide;nitric acid Chemical compound O[N+]([O-])=O.CC=1C=C(C)N(C(N)=N)N=1 AGYXIUAGBLMBGV-UHFFFAOYSA-N 0.000 description 2
- QENGPZGAWFQWCZ-UHFFFAOYSA-N 3-Methylthiophene Chemical compound CC=1C=CSC=1 QENGPZGAWFQWCZ-UHFFFAOYSA-N 0.000 description 2
- MCFBUIIRFZBRCU-UHFFFAOYSA-N 4-[1-[5-[6-(trifluoromethyl)-1h-benzimidazol-2-yl]pyridin-2-yl]piperidin-4-yl]oxycyclohexane-1-carboxylic acid Chemical compound C1CC(C(=O)O)CCC1OC1CCN(C=2N=CC(=CC=2)C=2NC3=CC(=CC=C3N=2)C(F)(F)F)CC1 MCFBUIIRFZBRCU-UHFFFAOYSA-N 0.000 description 2
- KQWTXAWKBUUOMU-UHFFFAOYSA-N 4-[[5-amino-1-(3-methylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(=CC=3)S(N)(=O)=O)=N2)N)=C1C KQWTXAWKBUUOMU-UHFFFAOYSA-N 0.000 description 2
- DOHNVHMVXAVHPI-UHFFFAOYSA-N 4-[[5-amino-1-(5-tert-butylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound S1C(C(C)(C)C)=CC=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 DOHNVHMVXAVHPI-UHFFFAOYSA-N 0.000 description 2
- QTDXSEZXAPHVBI-UHFFFAOYSA-N 4-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCC(C(O)=O)CC1 QTDXSEZXAPHVBI-UHFFFAOYSA-N 0.000 description 2
- LIKIMWYKJUFVJP-UHFFFAOYSA-N 5-acetylthiophene-2-carboxylic acid Chemical compound CC(=O)C1=CC=C(C(O)=O)S1 LIKIMWYKJUFVJP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 102000005403 Casein Kinases Human genes 0.000 description 2
- 108010031425 Casein Kinases Proteins 0.000 description 2
- 108010068150 Cyclin B Proteins 0.000 description 2
- 102000002427 Cyclin B Human genes 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- 102000009465 Growth Factor Receptors Human genes 0.000 description 2
- 108010009202 Growth Factor Receptors Proteins 0.000 description 2
- 108010033040 Histones Proteins 0.000 description 2
- 102000004877 Insulin Human genes 0.000 description 2
- 108090001061 Insulin Proteins 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- 101100382953 Mus musculus Ccnd1 gene Proteins 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- POFVJRKJJBFPII-UHFFFAOYSA-N N-cyclopentyl-5-[2-[[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]amino]-5-fluoropyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine Chemical compound C1(CCCC1)NC=1SC(=C(N=1)C)C1=NC(=NC=C1F)NC1=NC=C(C=C1)CN1CCN(CC1)CC POFVJRKJJBFPII-UHFFFAOYSA-N 0.000 description 2
- QOVYHDHLFPKQQG-NDEPHWFRSA-N N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O Chemical compound N[C@@H](CCC(=O)N1CCC(CC1)NC1=C2C=CC=CC2=NC(NCC2=CN(CCCNCCCNC3CCCCC3)N=N2)=N1)C(O)=O QOVYHDHLFPKQQG-NDEPHWFRSA-N 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 102000001253 Protein Kinase Human genes 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- IQFYYKKMVGJFEH-XLPZGREQSA-N Thymidine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](O)C1 IQFYYKKMVGJFEH-XLPZGREQSA-N 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 108091008605 VEGF receptors Proteins 0.000 description 2
- 102000005789 Vascular Endothelial Growth Factors Human genes 0.000 description 2
- 108010019530 Vascular Endothelial Growth Factors Proteins 0.000 description 2
- ODAHFXPKPNLWON-UHFFFAOYSA-N [5-amino-3-(4-imidazol-1-ylanilino)-1,2,4-triazol-1-yl]-(3,5-dimethylthiophen-2-yl)methanone Chemical compound S1C(C)=CC(C)=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)N2C=NC=C2)=N1 ODAHFXPKPNLWON-UHFFFAOYSA-N 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 2
- 239000004037 angiogenesis inhibitor Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 2
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 125000002619 bicyclic group Chemical group 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 2
- JCKYGMPEJWAADB-UHFFFAOYSA-N chlorambucil Chemical compound OC(=O)CCCC1=CC=C(N(CCCl)CCCl)C=C1 JCKYGMPEJWAADB-UHFFFAOYSA-N 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 238000013375 chromatographic separation Methods 0.000 description 2
- DQLATGHUWYMOKM-UHFFFAOYSA-L cisplatin Chemical compound N[Pt](N)(Cl)Cl DQLATGHUWYMOKM-UHFFFAOYSA-L 0.000 description 2
- 238000004440 column chromatography Methods 0.000 description 2
- 229940125900 compound 59 Drugs 0.000 description 2
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- NZNMSOFKMUBTKW-UHFFFAOYSA-N cyclohexanecarboxylic acid Chemical compound OC(=O)C1CCCCC1 NZNMSOFKMUBTKW-UHFFFAOYSA-N 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 231100000433 cytotoxic Toxicity 0.000 description 2
- 230000001472 cytotoxic effect Effects 0.000 description 2
- 238000013461 design Methods 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 210000002889 endothelial cell Anatomy 0.000 description 2
- 108020001507 fusion proteins Proteins 0.000 description 2
- 102000037865 fusion proteins Human genes 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 210000004013 groin Anatomy 0.000 description 2
- 230000012010 growth Effects 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000000592 heterocycloalkyl group Chemical group 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- 238000001802 infusion Methods 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 229940125396 insulin Drugs 0.000 description 2
- 238000001990 intravenous administration Methods 0.000 description 2
- 239000012948 isocyanate Substances 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 239000001630 malic acid Substances 0.000 description 2
- 235000011090 malic acid Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 201000001441 melanoma Diseases 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000035407 negative regulation of cell proliferation Effects 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000004344 phenylpropyl group Chemical group 0.000 description 2
- 230000026731 phosphorylation Effects 0.000 description 2
- 238000006366 phosphorylation reaction Methods 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 108060006633 protein kinase Proteins 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 239000000565 sealant Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- XYARUYHGTRIFSR-UHFFFAOYSA-M sodium;4-isothiocyanatobenzenesulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC=C(N=C=S)C=C1 XYARUYHGTRIFSR-UHFFFAOYSA-M 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 238000007920 subcutaneous administration Methods 0.000 description 2
- 125000003107 substituted aryl group Chemical group 0.000 description 2
- 229940124530 sulfonamide Drugs 0.000 description 2
- 125000004434 sulfur atom Chemical group 0.000 description 2
- 230000002195 synergetic effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010189 synthetic method Methods 0.000 description 2
- 125000003831 tetrazolyl group Chemical group 0.000 description 2
- 150000003568 thioethers Chemical class 0.000 description 2
- 150000003573 thiols Chemical class 0.000 description 2
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000011269 treatment regimen Methods 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 239000002691 unilamellar liposome Substances 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- FDKXTQMXEQVLRF-ZHACJKMWSA-N (E)-dacarbazine Chemical compound CN(C)\N=N\c1[nH]cnc1C(N)=O FDKXTQMXEQVLRF-ZHACJKMWSA-N 0.000 description 1
- JMUOYANNVIFGFN-SNAWJCMRSA-N (e)-3-(2,6-difluorophenyl)prop-2-enoic acid Chemical compound OC(=O)\C=C\C1=C(F)C=CC=C1F JMUOYANNVIFGFN-SNAWJCMRSA-N 0.000 description 1
- 125000004512 1,2,3-thiadiazol-4-yl group Chemical group S1N=NC(=C1)* 0.000 description 1
- MIIQJAUWHSUTIT-UHFFFAOYSA-N 1,2-oxazole-5-carboxylic acid Chemical compound OC(=O)C1=CC=NO1 MIIQJAUWHSUTIT-UHFFFAOYSA-N 0.000 description 1
- YXHDLKWTPVMIOH-UHFFFAOYSA-N 1,3-difluoro-2-isocyanatobenzene Chemical compound FC1=CC=CC(F)=C1N=C=O YXHDLKWTPVMIOH-UHFFFAOYSA-N 0.000 description 1
- DBSXNGIBAKYMSS-UHFFFAOYSA-N 1,3-difluoro-2-isothiocyanatobenzene Chemical compound FC1=CC=CC(F)=C1N=C=S DBSXNGIBAKYMSS-UHFFFAOYSA-N 0.000 description 1
- QHHHLHCCVDMOJI-UHFFFAOYSA-N 1,3-thiazol-4-amine Chemical class NC1=CSC=N1 QHHHLHCCVDMOJI-UHFFFAOYSA-N 0.000 description 1
- KUBJARHKXBDGAA-UHFFFAOYSA-N 1-(2,4-difluorophenyl)ethanol Chemical compound CC(O)C1=CC=C(F)C=C1F KUBJARHKXBDGAA-UHFFFAOYSA-N 0.000 description 1
- QEWHNJPLPZOEKU-UHFFFAOYSA-N 1-(2,4-difluorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(F)C=C1F QEWHNJPLPZOEKU-UHFFFAOYSA-N 0.000 description 1
- DXXKATNBNNUIAW-UHFFFAOYSA-N 1-(4-isothiocyanatophenyl)-4-methylpiperazine Chemical compound C1CN(C)CCN1C1=CC=C(N=C=S)C=C1 DXXKATNBNNUIAW-UHFFFAOYSA-N 0.000 description 1
- PMPSZAXEUCIVDC-UHFFFAOYSA-N 1-(4-isothiocyanatophenyl)sulfonylpiperidine Chemical compound C=1C=C(N=C=S)C=CC=1S(=O)(=O)N1CCCCC1 PMPSZAXEUCIVDC-UHFFFAOYSA-N 0.000 description 1
- GIGRWGTZFONRKA-UHFFFAOYSA-N 1-(bromomethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CBr)C=C1 GIGRWGTZFONRKA-UHFFFAOYSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- IQFYYKKMVGJFEH-OYDXRQHMSA-N 1-[(2r,4s,5s)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H]([14CH2]O)[C@@H](O)C1 IQFYYKKMVGJFEH-OYDXRQHMSA-N 0.000 description 1
- JJYDYGGOTWCYHD-UHFFFAOYSA-N 1-[4-[[5-amino-1-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]phenyl]imidazolidin-2-one Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(NC=3C=CC(=CC=3)N3C(NCC3)=O)=N2)N)=C1F JJYDYGGOTWCYHD-UHFFFAOYSA-N 0.000 description 1
- CNMQXCIURLBRBJ-UHFFFAOYSA-N 1-[4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]phenyl]imidazolidin-2-one Chemical compound NC1=NC(=NN1C(C1=C(C=CC=C1F)F)=O)NC1=CC=C(C=C1)N1C(NCC1)=O CNMQXCIURLBRBJ-UHFFFAOYSA-N 0.000 description 1
- DYSJMQABFPKAQM-UHFFFAOYSA-N 1-benzothiophene-2-carboxylic acid Chemical compound C1=CC=C2SC(C(=O)O)=CC2=C1 DYSJMQABFPKAQM-UHFFFAOYSA-N 0.000 description 1
- WLXGQMVCYPUOLM-UHFFFAOYSA-N 1-hydroxyethanesulfonic acid Chemical compound CC(O)S(O)(=O)=O WLXGQMVCYPUOLM-UHFFFAOYSA-N 0.000 description 1
- 125000001637 1-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C(*)=C([H])C([H])=C([H])C2=C1[H] 0.000 description 1
- 102100026205 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Human genes 0.000 description 1
- 125000000579 2,2-diphenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(C1=C([H])C([H])=C([H])C([H])=C1[H])C([H])([H])* 0.000 description 1
- DMUGJQMADYEWSQ-UHFFFAOYSA-N 2,3,6-trifluorobenzoyl chloride Chemical compound FC1=CC=C(F)C(C(Cl)=O)=C1F DMUGJQMADYEWSQ-UHFFFAOYSA-N 0.000 description 1
- OZGSEIVTQLXWRO-UHFFFAOYSA-N 2,4,6-trichlorobenzoyl chloride Chemical compound ClC(=O)C1=C(Cl)C=C(Cl)C=C1Cl OZGSEIVTQLXWRO-UHFFFAOYSA-N 0.000 description 1
- UKRQMDIFLKHCRO-UHFFFAOYSA-N 2,4,6-trimethylbenzoyl chloride Chemical compound CC1=CC(C)=C(C(Cl)=O)C(C)=C1 UKRQMDIFLKHCRO-UHFFFAOYSA-N 0.000 description 1
- PIECNZKJUFATCM-UHFFFAOYSA-N 2,4-bis(fluoromethyl)benzoyl chloride Chemical compound FCC1=CC=C(C(Cl)=O)C(CF)=C1 PIECNZKJUFATCM-UHFFFAOYSA-N 0.000 description 1
- MQGBARXPCXAFRZ-UHFFFAOYSA-N 2,4-dimethyl-1,3-thiazole-5-carboxylic acid Chemical compound CC1=NC(C)=C(C(O)=O)S1 MQGBARXPCXAFRZ-UHFFFAOYSA-N 0.000 description 1
- JBLIDPPHFGWTKU-UHFFFAOYSA-N 2,6-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=C(Cl)C=CC=C1Cl JBLIDPPHFGWTKU-UHFFFAOYSA-N 0.000 description 1
- WGFNXGPBPIJYLI-UHFFFAOYSA-N 2,6-difluoro-3-[(3-fluorophenyl)sulfonylamino]-n-(3-methoxy-1h-pyrazolo[3,4-b]pyridin-5-yl)benzamide Chemical compound C1=C2C(OC)=NNC2=NC=C1NC(=O)C(C=1F)=C(F)C=CC=1NS(=O)(=O)C1=CC=CC(F)=C1 WGFNXGPBPIJYLI-UHFFFAOYSA-N 0.000 description 1
- PDDHSNODMFIIRV-UHFFFAOYSA-N 2,6-difluoro-3-nitrobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC([N+]([O-])=O)=C1F PDDHSNODMFIIRV-UHFFFAOYSA-N 0.000 description 1
- QXWAUQMMMIMLTO-UHFFFAOYSA-N 2,6-difluorobenzenesulfonyl chloride Chemical compound FC1=CC=CC(F)=C1S(Cl)(=O)=O QXWAUQMMMIMLTO-UHFFFAOYSA-N 0.000 description 1
- NDXRPDJVAUCBOH-UHFFFAOYSA-N 2,6-dimethoxybenzoyl chloride Chemical compound COC1=CC=CC(OC)=C1C(Cl)=O NDXRPDJVAUCBOH-UHFFFAOYSA-N 0.000 description 1
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 1
- FUGDCKXBUZFEON-UHFFFAOYSA-N 2-(2,6-difluorophenyl)acetic acid Chemical compound OC(=O)CC1=C(F)C=CC=C1F FUGDCKXBUZFEON-UHFFFAOYSA-N 0.000 description 1
- UENGBOCGGKLVJJ-UHFFFAOYSA-N 2-chloro-1-(2,4-difluorophenyl)ethanone Chemical compound FC1=CC=C(C(=O)CCl)C(F)=C1 UENGBOCGGKLVJJ-UHFFFAOYSA-N 0.000 description 1
- XJFKTIHKOKWAEF-UHFFFAOYSA-N 2-chloro-6-fluoro-3-methylbenzoyl chloride Chemical compound CC1=CC=C(F)C(C(Cl)=O)=C1Cl XJFKTIHKOKWAEF-UHFFFAOYSA-N 0.000 description 1
- GFNAJZAKJGKJCS-UHFFFAOYSA-N 2-chloro-6-fluorobenzoyl chloride Chemical compound FC1=CC=CC(Cl)=C1C(Cl)=O GFNAJZAKJGKJCS-UHFFFAOYSA-N 0.000 description 1
- RAAGZOYMEQDCTD-UHFFFAOYSA-N 2-fluorobenzoyl chloride Chemical compound FC1=CC=CC=C1C(Cl)=O RAAGZOYMEQDCTD-UHFFFAOYSA-N 0.000 description 1
- OFTKFKYVSBNYEC-UHFFFAOYSA-N 2-furoyl chloride Chemical compound ClC(=O)C1=CC=CO1 OFTKFKYVSBNYEC-UHFFFAOYSA-N 0.000 description 1
- LFOIDLOIBZFWDO-UHFFFAOYSA-N 2-methoxy-6-[6-methoxy-4-[(3-phenylmethoxyphenyl)methoxy]-1-benzofuran-2-yl]imidazo[2,1-b][1,3,4]thiadiazole Chemical compound N1=C2SC(OC)=NN2C=C1C(OC1=CC(OC)=C2)=CC1=C2OCC(C=1)=CC=CC=1OCC1=CC=CC=C1 LFOIDLOIBZFWDO-UHFFFAOYSA-N 0.000 description 1
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical compound CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 1
- VSKXJRZPVDLHFY-UHFFFAOYSA-N 2-methylcyclohexane-1-carboxylic acid Chemical compound CC1CCCCC1C(O)=O VSKXJRZPVDLHFY-UHFFFAOYSA-N 0.000 description 1
- BWWHTIHDQBHTHP-UHFFFAOYSA-N 2-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC=C1C(Cl)=O BWWHTIHDQBHTHP-UHFFFAOYSA-N 0.000 description 1
- SMJRBWINMFUUDS-UHFFFAOYSA-N 2-thienylacetic acid Chemical compound OC(=O)CC1=CC=CS1 SMJRBWINMFUUDS-UHFFFAOYSA-N 0.000 description 1
- OPQCYTNFPJELSW-UHFFFAOYSA-N 3,5-diethylthiophene-2-carboxylic acid Chemical compound CCC1=CC(CC)=C(C(O)=O)S1 OPQCYTNFPJELSW-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- HMRFXFGZMICZFM-UHFFFAOYSA-N 3-[4-(1,2,4-triazol-1-yl)phenyl]-1,2-dihydro-1,2,4-triazole-3,5-diamine Chemical compound N1(N=CN=C1)C1=CC=C(C=C1)C1(NNC(=N1)N)N HMRFXFGZMICZFM-UHFFFAOYSA-N 0.000 description 1
- LLKLTQJOEPWBOE-UHFFFAOYSA-N 3-acetamidothiophene-2-carboxylic acid Chemical compound CC(=O)NC=1C=CSC=1C(O)=O LLKLTQJOEPWBOE-UHFFFAOYSA-N 0.000 description 1
- UPNMPXFYMWBVBA-UHFFFAOYSA-N 3-amino-n-(2,6-difluorophenyl)-5-(4-sulfamoylanilino)-1,2,4-triazole-1-carbothioamide Chemical compound FC=1C=CC=C(F)C=1NC(=S)N1N=C(N)N=C1NC1=CC=C(S(N)(=O)=O)C=C1 UPNMPXFYMWBVBA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- VQQLWBUTTMNMFT-UHFFFAOYSA-N 3-bromothiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1Br VQQLWBUTTMNMFT-UHFFFAOYSA-N 0.000 description 1
- APQTVWJSXBBNEI-UHFFFAOYSA-N 3-chloro-2,6-difluorobenzoic acid Chemical compound OC(=O)C1=C(F)C=CC(Cl)=C1F APQTVWJSXBBNEI-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- BXEAAHIHFFIMIE-UHFFFAOYSA-N 3-chlorothiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1Cl BXEAAHIHFFIMIE-UHFFFAOYSA-N 0.000 description 1
- FTKDCOINUAYGTC-UHFFFAOYSA-N 3-ethoxythiophene-2-carboxylic acid Chemical compound CCOC=1C=CSC=1C(O)=O FTKDCOINUAYGTC-UHFFFAOYSA-N 0.000 description 1
- SLDBAXYJAIRQMX-UHFFFAOYSA-N 3-ethylthiophene Chemical compound CCC=1C=CSC=1 SLDBAXYJAIRQMX-UHFFFAOYSA-N 0.000 description 1
- BSMFSESXBONEOI-UHFFFAOYSA-N 3-ethylthiophene-2-carboxylic acid Chemical compound CCC=1C=CSC=1C(O)=O BSMFSESXBONEOI-UHFFFAOYSA-N 0.000 description 1
- WPHRBUAOSDHRDS-UHFFFAOYSA-N 3-fluorothiophene-2-carboxylic acid Chemical compound OC(=O)C=1SC=CC=1F WPHRBUAOSDHRDS-UHFFFAOYSA-N 0.000 description 1
- KCHBQRDMXQOLSR-UHFFFAOYSA-N 3-hydroxy-4-(2-hydroxyethoxy)butan-2-one Chemical compound C(C)(=O)C(COCCO)O KCHBQRDMXQOLSR-UHFFFAOYSA-N 0.000 description 1
- RGNVQMGVHZTIBN-UHFFFAOYSA-N 3-n-[3-(4-methylpiperazin-1-yl)phenyl]-1h-1,2,4-triazole-3,5-diamine Chemical compound C1CN(C)CCN1C1=CC=CC(NC=2N=C(N)NN=2)=C1 RGNVQMGVHZTIBN-UHFFFAOYSA-N 0.000 description 1
- SFXBTXYONCDQJY-UHFFFAOYSA-N 3-n-phenyl-1h-1,2,4-triazole-3,5-diamine Chemical compound N1C(N)=NC(NC=2C=CC=CC=2)=N1 SFXBTXYONCDQJY-UHFFFAOYSA-N 0.000 description 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 description 1
- KKMZQOIASVGJQE-UHFFFAOYSA-N 3-thiophen-2-ylprop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=CS1 KKMZQOIASVGJQE-UHFFFAOYSA-N 0.000 description 1
- AOJJSUZBOXZQNB-VTZDEGQISA-N 4'-epidoxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-VTZDEGQISA-N 0.000 description 1
- BLNPEJXSNSBBNM-UHFFFAOYSA-N 4-(1,2,4-triazol-1-yl)aniline Chemical compound C1=CC(N)=CC=C1N1N=CN=C1 BLNPEJXSNSBBNM-UHFFFAOYSA-N 0.000 description 1
- IIPIRJPTGGFWIE-UHFFFAOYSA-N 4-(1,2,4-triazol-4-yl)aniline Chemical compound C1=CC(N)=CC=C1N1C=NN=C1 IIPIRJPTGGFWIE-UHFFFAOYSA-N 0.000 description 1
- PTFAHECOMVRYLS-UHFFFAOYSA-N 4-[(5-amino-1-benzoyl-1,2,4-triazol-3-yl)amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C=CC=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 PTFAHECOMVRYLS-UHFFFAOYSA-N 0.000 description 1
- QYCBRQTYTPRXBA-UHFFFAOYSA-N 4-[[5-amino-1-(1,2-oxazole-5-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2ON=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 QYCBRQTYTPRXBA-UHFFFAOYSA-N 0.000 description 1
- BNYGGUDOWVFAQH-UHFFFAOYSA-N 4-[[5-amino-1-(2,3,6-trifluorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=C(F)C=CC=2F)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 BNYGGUDOWVFAQH-UHFFFAOYSA-N 0.000 description 1
- SBFROQSMUBGHPJ-UHFFFAOYSA-N 4-[[5-amino-1-(2,4,6-trichlorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=CC(Cl)=CC=2Cl)Cl)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 SBFROQSMUBGHPJ-UHFFFAOYSA-N 0.000 description 1
- YVNVQLLEESZZEU-UHFFFAOYSA-N 4-[[5-amino-1-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound S1C(C)=NC(C)=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 YVNVQLLEESZZEU-UHFFFAOYSA-N 0.000 description 1
- VRXTULAHWRBBET-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]-n,n-dimethylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)N(C)C)=CC=C1NC1=NN(C(=O)C=2C(=C(C)C=CC=2F)F)C(N)=N1 VRXTULAHWRBBET-UHFFFAOYSA-N 0.000 description 1
- PFQMZAANMYMAEF-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]-n-[2-(dimethylamino)ethyl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCN(C)C)=CC=C1NC1=NN(C(=O)C=2C(=C(C)C=CC=2F)F)C(N)=N1 PFQMZAANMYMAEF-UHFFFAOYSA-N 0.000 description 1
- IEWLQUDDCQIINQ-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(NC=3C=CC(=CC=3)S(N)(=O)=O)=N2)N)=C1F IEWLQUDDCQIINQ-UHFFFAOYSA-N 0.000 description 1
- PALOCMRJIXJTBF-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluoro-3-nitrobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=C(C=CC=2F)[N+]([O-])=O)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 PALOCMRJIXJTBF-UHFFFAOYSA-N 0.000 description 1
- TXGHXFFMXUFWII-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]-n,n-dimethylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)N(C)C)=CC=C1NC1=NN(C(=O)C=2C(=CC=CC=2F)F)C(N)=N1 TXGHXFFMXUFWII-UHFFFAOYSA-N 0.000 description 1
- LFQIWJLAFCSXKJ-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]-n-[2-(dimethylamino)ethyl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCN(C)C)=CC=C1NC1=NN(C(=O)C=2C(=CC=CC=2F)F)C(N)=N1 LFQIWJLAFCSXKJ-UHFFFAOYSA-N 0.000 description 1
- DGKNWIFEIJGWAB-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]-n-pyridin-2-ylbenzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=CC=CC=2F)F)C(N)=NC=1NC(C=C1)=CC=C1S(=O)(=O)NC1=CC=CC=N1 DGKNWIFEIJGWAB-UHFFFAOYSA-N 0.000 description 1
- LBOMQKVBTCWWHG-UHFFFAOYSA-N 4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonic acid Chemical compound N=1N(C(=O)C=2C(=CC=CC=2F)F)C(N)=NC=1NC1=CC=C(S(O)(=O)=O)C=C1 LBOMQKVBTCWWHG-UHFFFAOYSA-N 0.000 description 1
- YNUVXDPTIUBUGN-UHFFFAOYSA-N 4-[[5-amino-1-(2-methylbenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound CC1=CC=CC=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)S(N)(=O)=O)=N1 YNUVXDPTIUBUGN-UHFFFAOYSA-N 0.000 description 1
- JVTRHFHSCBPHCH-UHFFFAOYSA-N 4-[[5-amino-1-(2-nitrobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=CC=CC=2)[N+]([O-])=O)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 JVTRHFHSCBPHCH-UHFFFAOYSA-N 0.000 description 1
- CNRKADITWGOSKI-UHFFFAOYSA-N 4-[[5-amino-1-(2-thiophen-2-ylacetyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)CC=2SC=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 CNRKADITWGOSKI-UHFFFAOYSA-N 0.000 description 1
- ZZSJXNLACQRNGC-UHFFFAOYSA-N 4-[[5-amino-1-(3-chloro-2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C(=C(Cl)C=CC=2F)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 ZZSJXNLACQRNGC-UHFFFAOYSA-N 0.000 description 1
- QPQPCKPZCWKFDE-UHFFFAOYSA-N 4-[[5-amino-1-(3-fluorothiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C2=C(C=CS2)F)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 QPQPCKPZCWKFDE-UHFFFAOYSA-N 0.000 description 1
- QCQABPYCPNDAFH-UHFFFAOYSA-N 4-[[5-amino-1-(3-methylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]-n,n-dimethylbenzenesulfonamide Chemical compound C1=CC(S(=O)(=O)N(C)C)=CC=C1NC1=NN(C(=O)C2=C(C=CS2)C)C(N)=N1 QCQABPYCPNDAFH-UHFFFAOYSA-N 0.000 description 1
- BBRMXAGHLDDUDM-UHFFFAOYSA-N 4-[[5-amino-1-(3-methylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]-n-[2-(dimethylamino)ethyl]benzenesulfonamide Chemical compound C1=CC(S(=O)(=O)NCCN(C)C)=CC=C1NC1=NN(C(=O)C2=C(C=CS2)C)C(N)=N1 BBRMXAGHLDDUDM-UHFFFAOYSA-N 0.000 description 1
- AZJQSUGNQBCAAR-UHFFFAOYSA-N 4-[[5-amino-1-(5-ethylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]-n-methylbenzenesulfonamide Chemical compound S1C(CC)=CC=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)S(=O)(=O)NC)=N1 AZJQSUGNQBCAAR-UHFFFAOYSA-N 0.000 description 1
- PJYGFTNDAOGELX-UHFFFAOYSA-N 4-[[5-amino-1-(5-pyridin-2-ylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2SC(=CC=2)C=2N=CC=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 PJYGFTNDAOGELX-UHFFFAOYSA-N 0.000 description 1
- RPYOMLMZFPIDLN-UHFFFAOYSA-N 4-[[5-amino-1-(cycloheptanecarbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C2CCCCCC2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 RPYOMLMZFPIDLN-UHFFFAOYSA-N 0.000 description 1
- OMPKXOFNHVCNPK-UHFFFAOYSA-N 4-[[5-amino-1-(cyclohexanecarbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C2CCCCC2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 OMPKXOFNHVCNPK-UHFFFAOYSA-N 0.000 description 1
- NJFFZSKHTVWRRK-UHFFFAOYSA-N 4-[[5-amino-1-(cyclopentanecarbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C2CCCC2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 NJFFZSKHTVWRRK-UHFFFAOYSA-N 0.000 description 1
- YPPZAASRJXCYNN-UHFFFAOYSA-N 4-[[5-amino-1-(pyridine-3-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2C=NC=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 YPPZAASRJXCYNN-UHFFFAOYSA-N 0.000 description 1
- IVBMBWLGBXAPDT-UHFFFAOYSA-N 4-[[5-amino-1-(thiadiazole-4-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2N=NSC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 IVBMBWLGBXAPDT-UHFFFAOYSA-N 0.000 description 1
- DXKGSLMPGXZMRN-UHFFFAOYSA-N 4-[[5-amino-1-(thiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound N=1N(C(=O)C=2SC=CC=2)C(N)=NC=1NC1=CC=C(S(N)(=O)=O)C=C1 DXKGSLMPGXZMRN-UHFFFAOYSA-N 0.000 description 1
- ZPGLUUJFWLJKLN-UHFFFAOYSA-N 4-[[5-amino-2-(2,6-difluoro-3-methylbenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(N)=N2)NC=2C=CC(=CC=2)S(N)(=O)=O)=C1F ZPGLUUJFWLJKLN-UHFFFAOYSA-N 0.000 description 1
- JCLNHSZANVRQRT-UHFFFAOYSA-N 4-[[5-amino-2-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]benzenesulfonamide Chemical compound FC=1C=CC=C(F)C=1C(=O)N1N=C(N)N=C1NC1=CC=C(S(N)(=O)=O)C=C1 JCLNHSZANVRQRT-UHFFFAOYSA-N 0.000 description 1
- HERALKCUSVEQOM-UHFFFAOYSA-N 4-amino-n-[2-(dimethylamino)ethyl]benzenesulfonamide Chemical compound CN(C)CCNS(=O)(=O)C1=CC=C(N)C=C1 HERALKCUSVEQOM-UHFFFAOYSA-N 0.000 description 1
- RFNSXSSACWHHMN-UHFFFAOYSA-N 4-benzyl-1,2-dihydrotriazol-5-one Chemical compound N1N=NC(CC=2C=CC=CC=2)=C1O RFNSXSSACWHHMN-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- LVOASPZGXNAHJI-UHFFFAOYSA-N 4-imidazol-1-ylaniline Chemical compound C1=CC(N)=CC=C1N1C=NC=C1 LVOASPZGXNAHJI-UHFFFAOYSA-N 0.000 description 1
- ZAIFZABYMYTEAX-UHFFFAOYSA-N 4-isothiocyanato-n,n-dimethylbenzenesulfonamide Chemical compound CN(C)S(=O)(=O)C1=CC=C(N=C=S)C=C1 ZAIFZABYMYTEAX-UHFFFAOYSA-N 0.000 description 1
- RWAPCVBNVCMXDF-UHFFFAOYSA-N 4-isothiocyanato-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(N=C=S)C=C1 RWAPCVBNVCMXDF-UHFFFAOYSA-N 0.000 description 1
- NHHQOYLPBUYHQU-UHFFFAOYSA-N 4-methylthiadiazole-5-carboxylic acid Chemical compound CC=1N=NSC=1C(O)=O NHHQOYLPBUYHQU-UHFFFAOYSA-N 0.000 description 1
- YFMUACLZRVJOBK-UHFFFAOYSA-N 5-(2-phenylethynyl)thiophene-2-carbaldehyde Chemical compound S1C(C=O)=CC=C1C#CC1=CC=CC=C1 YFMUACLZRVJOBK-UHFFFAOYSA-N 0.000 description 1
- MIOGAEMLGAPYFB-UHFFFAOYSA-N 5-(2-phenylethynyl)thiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C#CC1=CC=CC=C1 MIOGAEMLGAPYFB-UHFFFAOYSA-N 0.000 description 1
- LLIANSAISVOLHR-GBCQHVBFSA-N 5-[(3as,4s,6ar)-2-oxidanylidene-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid Chemical compound N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21.N1C(=O)N[C@@H]2[C@H](CCCCC(=O)O)SC[C@@H]21 LLIANSAISVOLHR-GBCQHVBFSA-N 0.000 description 1
- TUQZFXCYOVYPQD-UHFFFAOYSA-N 5-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enyl]thiophene-2-carboxylic acid Chemical compound CC(C)(C)OC(=O)C=CC1=CC=C(C(O)=O)S1 TUQZFXCYOVYPQD-UHFFFAOYSA-N 0.000 description 1
- KNUBLBZSYZLDJB-UHFFFAOYSA-N 5-amino-3-anilino-n-phenyl-1,2,4-triazole-1-carboxamide Chemical compound N=1N(C(=O)NC=2C=CC=CC=2)C(N)=NC=1NC1=CC=CC=C1 KNUBLBZSYZLDJB-UHFFFAOYSA-N 0.000 description 1
- COWZPSUDTMGBAT-UHFFFAOYSA-N 5-bromothiophene-2-carboxylic acid Chemical compound OC(=O)C1=CC=C(Br)S1 COWZPSUDTMGBAT-UHFFFAOYSA-N 0.000 description 1
- VCNGNQLPFHVODE-UHFFFAOYSA-N 5-methylthiophene-2-carboxylic acid Chemical compound CC1=CC=C(C(O)=O)S1 VCNGNQLPFHVODE-UHFFFAOYSA-N 0.000 description 1
- HQULGJDHOPDURG-UHFFFAOYSA-N 5-pyridin-2-ylthiophene-2-carboxylic acid Chemical compound S1C(C(=O)O)=CC=C1C1=CC=CC=N1 HQULGJDHOPDURG-UHFFFAOYSA-N 0.000 description 1
- RVDLHGSZWAELAU-UHFFFAOYSA-N 5-tert-butylthiophene-2-carbonyl chloride Chemical compound CC(C)(C)C1=CC=C(C(Cl)=O)S1 RVDLHGSZWAELAU-UHFFFAOYSA-N 0.000 description 1
- SFHYNDMGZXWXBU-LIMNOBDPSA-N 6-amino-2-[[(e)-(3-formylphenyl)methylideneamino]carbamoylamino]-1,3-dioxobenzo[de]isoquinoline-5,8-disulfonic acid Chemical compound O=C1C(C2=3)=CC(S(O)(=O)=O)=CC=3C(N)=C(S(O)(=O)=O)C=C2C(=O)N1NC(=O)N\N=C\C1=CC=CC(C=O)=C1 SFHYNDMGZXWXBU-LIMNOBDPSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- ADHFMENDOUEJRK-UHFFFAOYSA-N 9-[(4-fluorophenyl)methyl]-n-hydroxypyrido[3,4-b]indole-3-carboxamide Chemical compound C1=NC(C(=O)NO)=CC(C2=CC=CC=C22)=C1N2CC1=CC=C(F)C=C1 ADHFMENDOUEJRK-UHFFFAOYSA-N 0.000 description 1
- 208000036832 Adenocarcinoma of ovary Diseases 0.000 description 1
- 206010001197 Adenocarcinoma of the cervix Diseases 0.000 description 1
- 208000034246 Adenocarcinoma of the cervix uteri Diseases 0.000 description 1
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- DWRXFEITVBNRMK-UHFFFAOYSA-N Beta-D-1-Arabinofuranosylthymine Natural products O=C1NC(=O)C(C)=CN1C1C(O)C(O)C(CO)O1 DWRXFEITVBNRMK-UHFFFAOYSA-N 0.000 description 1
- 108010006654 Bleomycin Proteins 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 description 1
- RBUVCCIYIOZTIX-UHFFFAOYSA-N CCCCC(C(C)C1=C(C=C(C=C1)F)F)[Si](C)(C)O[Si](C)(C)C(CCCC)C(C)C2=C(C=C(C=C2)F)F Chemical compound CCCCC(C(C)C1=C(C=C(C=C1)F)F)[Si](C)(C)O[Si](C)(C)C(CCCC)C(C)C2=C(C=C(C=C2)F)F RBUVCCIYIOZTIX-UHFFFAOYSA-N 0.000 description 1
- BALGERHMIXFENA-MGCOHNPYSA-N CCCC[C@H]1CC[C@H](C(O)=O)CC1 Chemical compound CCCC[C@H]1CC[C@H](C(O)=O)CC1 BALGERHMIXFENA-MGCOHNPYSA-N 0.000 description 1
- 102000043139 CK2 family Human genes 0.000 description 1
- 108091054872 CK2 family Proteins 0.000 description 1
- 101100365877 Caenorhabditis elegans cdl-1 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PTOAARAWEBMLNO-KVQBGUIXSA-N Cladribine Chemical compound C1=NC=2C(N)=NC(Cl)=NC=2N1[C@H]1C[C@H](O)[C@@H](CO)O1 PTOAARAWEBMLNO-KVQBGUIXSA-N 0.000 description 1
- 208000003322 Coinfection Diseases 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 229940126639 Compound 33 Drugs 0.000 description 1
- 208000001778 Coronary Occlusion Diseases 0.000 description 1
- 206010011086 Coronary artery occlusion Diseases 0.000 description 1
- 108050006400 Cyclin Proteins 0.000 description 1
- 102000016736 Cyclin Human genes 0.000 description 1
- 108010068192 Cyclin A Proteins 0.000 description 1
- 102000002554 Cyclin A Human genes 0.000 description 1
- 102100036329 Cyclin-dependent kinase 3 Human genes 0.000 description 1
- CMSMOCZEIVJLDB-UHFFFAOYSA-N Cyclophosphamide Chemical compound ClCCN(CCCl)P1(=O)NCCCO1 CMSMOCZEIVJLDB-UHFFFAOYSA-N 0.000 description 1
- 239000012624 DNA alkylating agent Substances 0.000 description 1
- 229940126161 DNA alkylating agent Drugs 0.000 description 1
- 102100031480 Dual specificity mitogen-activated protein kinase kinase 1 Human genes 0.000 description 1
- 101710146526 Dual specificity mitogen-activated protein kinase kinase 1 Proteins 0.000 description 1
- 108010041308 Endothelial Growth Factors Proteins 0.000 description 1
- HTIJFSOGRVMCQR-UHFFFAOYSA-N Epirubicin Natural products COc1cccc2C(=O)c3c(O)c4CC(O)(CC(OC5CC(N)C(=O)C(C)O5)c4c(O)c3C(=O)c12)C(=O)CO HTIJFSOGRVMCQR-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 101150048336 Flt1 gene Proteins 0.000 description 1
- GHASVSINZRGABV-UHFFFAOYSA-N Fluorouracil Chemical compound FC1=CNC(=O)NC1=O GHASVSINZRGABV-UHFFFAOYSA-N 0.000 description 1
- 230000010337 G2 phase Effects 0.000 description 1
- 102000006947 Histones Human genes 0.000 description 1
- 101000691599 Homo sapiens 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Proteins 0.000 description 1
- 101000868333 Homo sapiens Cyclin-dependent kinase 1 Proteins 0.000 description 1
- 101000715946 Homo sapiens Cyclin-dependent kinase 3 Proteins 0.000 description 1
- 101000852815 Homo sapiens Insulin receptor Proteins 0.000 description 1
- 108090000144 Human Proteins Proteins 0.000 description 1
- 102000003839 Human Proteins Human genes 0.000 description 1
- 101150088608 Kdr gene Proteins 0.000 description 1
- FBOZXECLQNJBKD-ZDUSSCGKSA-N L-methotrexate Chemical compound C=1N=C2N=C(N)N=C(N)C2=NC=1CN(C)C1=CC=C(C(=O)N[C@@H](CCC(O)=O)C(O)=O)C=C1 FBOZXECLQNJBKD-ZDUSSCGKSA-N 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 108040008097 MAP kinase activity proteins Proteins 0.000 description 1
- 102000019149 MAP kinase activity proteins Human genes 0.000 description 1
- 102000043136 MAP kinase family Human genes 0.000 description 1
- 108091054455 MAP kinase family Proteins 0.000 description 1
- 229940124647 MEK inhibitor Drugs 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 101001052524 Medicago sativa Mitogen-activated protein kinase homolog MMK1 Proteins 0.000 description 1
- 108700027649 Mitogen-Activated Protein Kinase 3 Proteins 0.000 description 1
- 108700015928 Mitogen-activated protein kinase 13 Proteins 0.000 description 1
- 102100024192 Mitogen-activated protein kinase 3 Human genes 0.000 description 1
- 102000007474 Multiprotein Complexes Human genes 0.000 description 1
- 108010085220 Multiprotein Complexes Proteins 0.000 description 1
- 101100005791 Mus musculus Cdk4 gene Proteins 0.000 description 1
- SUKXKLNDBLNTSW-UHFFFAOYSA-N N-(4-hydroxycyclohexyl)-6-phenylhexanamide Chemical compound OC1CCC(CC1)NC(CCCCCC1=CC=CC=C1)=O SUKXKLNDBLNTSW-UHFFFAOYSA-N 0.000 description 1
- NSGDYZCDUPSTQT-UHFFFAOYSA-N N-[5-bromo-1-[(4-fluorophenyl)methyl]-4-methyl-2-oxopyridin-3-yl]cycloheptanecarboxamide Chemical compound Cc1c(Br)cn(Cc2ccc(F)cc2)c(=O)c1NC(=O)C1CCCCCC1 NSGDYZCDUPSTQT-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- REYJJPSVUYRZGE-UHFFFAOYSA-N Octadecylamine Chemical compound CCCCCCCCCCCCCCCCCCN REYJJPSVUYRZGE-UHFFFAOYSA-N 0.000 description 1
- 206010061328 Ovarian epithelial cancer Diseases 0.000 description 1
- 208000034038 Pathologic Neovascularization Diseases 0.000 description 1
- 241001482237 Pica Species 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 108090000244 Rat Proteins Proteins 0.000 description 1
- 101000994640 Rattus norvegicus Casein kinase I isoform alpha Proteins 0.000 description 1
- 101001052495 Rattus norvegicus Mitogen-activated protein kinase 1 Proteins 0.000 description 1
- 201000000582 Retinoblastoma Diseases 0.000 description 1
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- 229940124674 VEGF-R inhibitor Drugs 0.000 description 1
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 241000021375 Xenogenes Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- YQZYEUYXLWKLGW-UHFFFAOYSA-N [3,5-diamino-3-(3-chlorophenyl)-1H-1,2,4-triazol-2-yl]-(2,6-difluorophenyl)methanone Chemical compound ClC=1C=C(C=CC1)C1(N=C(NN1C(C1=C(C=CC=C1F)F)=O)N)N YQZYEUYXLWKLGW-UHFFFAOYSA-N 0.000 description 1
- QXYPMOKQIMNGPR-UHFFFAOYSA-N [3,5-diamino-5-(3-chlorophenyl)-1H-1,2,4-triazol-2-yl]-(2,6-difluorophenyl)methanone Chemical compound ClC=1C=C(C=CC=1)C1(NN(C(=N1)N)C(C1=C(C=CC=C1F)F)=O)N QXYPMOKQIMNGPR-UHFFFAOYSA-N 0.000 description 1
- BTHXIKDUGLHGHK-UHFFFAOYSA-N [3,5-diamino-5-(4-imidazol-1-ylphenyl)-1H-1,2,4-triazol-2-yl]-(3-methylthiophen-2-yl)methanone Chemical compound N1(C=NC=C1)C1=CC=C(C=C1)C1(NN(C(=N1)N)C(=O)C=1SC=CC1C)N BTHXIKDUGLHGHK-UHFFFAOYSA-N 0.000 description 1
- PBSWGNRKAMUQQS-UHFFFAOYSA-N [3,5-diamino-5-(4-piperidin-1-ylsulfonylphenyl)-1H-1,2,4-triazol-2-yl]-thiophen-2-ylmethanone Chemical compound N1(CCCCC1)S(=O)(=O)C1=CC=C(C=C1)C1(NN(C(=N1)N)C(=O)C=1SC=CC1)N PBSWGNRKAMUQQS-UHFFFAOYSA-N 0.000 description 1
- MASZSHOJBLYWQH-UHFFFAOYSA-N [3,5-diamino-5-[4-(4-methylpiperazin-1-yl)phenyl]-1H-1,2,4-triazol-2-yl]-(3-methylthiophen-2-yl)methanone Chemical compound CN1CCN(CC1)C1=CC=C(C=C1)C1(NN(C(=N1)N)C(=O)C=1SC=CC1C)N MASZSHOJBLYWQH-UHFFFAOYSA-N 0.000 description 1
- HHIYYYVGQWWSND-UHFFFAOYSA-N [3-amino-5-(3-chloroanilino)-1,2,4-triazol-1-yl]-phenylmethanone Chemical compound C=1C=CC=CC=1C(=O)N1N=C(N)N=C1NC1=CC=CC(Cl)=C1 HHIYYYVGQWWSND-UHFFFAOYSA-N 0.000 description 1
- YOBFQFVDJYOLKJ-UHFFFAOYSA-N [5-amino-3-(4-imidazol-1-ylanilino)-1,2,4-triazol-1-yl]-(2,6-difluoro-3-methylphenyl)methanone Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(NC=3C=CC(=CC=3)N3C=NC=C3)=N2)N)=C1F YOBFQFVDJYOLKJ-UHFFFAOYSA-N 0.000 description 1
- KSQMRANQUZLUAG-UHFFFAOYSA-N [5-amino-3-(4-imidazol-1-ylanilino)-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone Chemical compound FC1=C(C(=O)N2N=C(N=C2N)NC2=CC=C(C=C2)N2C=NC=C2)C(=CC=C1)F KSQMRANQUZLUAG-UHFFFAOYSA-N 0.000 description 1
- BVMNWGKLPHKZAV-UHFFFAOYSA-N [5-amino-3-(4-imidazol-1-ylanilino)-1,2,4-triazol-1-yl]-(5-ethylthiophen-2-yl)methanone Chemical compound S1C(CC)=CC=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)N2C=NC=C2)=N1 BVMNWGKLPHKZAV-UHFFFAOYSA-N 0.000 description 1
- JTWIKFBESHSQDH-UHFFFAOYSA-N [5-amino-3-(4-piperidin-1-ylsulfonylanilino)-1,2,4-triazol-1-yl]-(3-methylthiophen-2-yl)methanone Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(=CC=3)S(=O)(=O)N3CCCCC3)=N2)N)=C1C JTWIKFBESHSQDH-UHFFFAOYSA-N 0.000 description 1
- JKVDRJNJLHUROB-UHFFFAOYSA-N [5-amino-3-[4-(1,2,4-triazol-1-yl)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone Chemical compound N=1N(C(=O)C=2C(=CC=CC=2F)F)C(N)=NC=1NC(C=C1)=CC=C1N1C=NC=N1 JKVDRJNJLHUROB-UHFFFAOYSA-N 0.000 description 1
- OWAKLEKFSBDKLG-UHFFFAOYSA-N [5-amino-3-[4-(1,2,4-triazol-1-yl)anilino]-1,2,4-triazol-1-yl]-(3,5-dimethylthiophen-2-yl)methanone Chemical compound S1C(C)=CC(C)=C1C(=O)N1C(N)=NC(NC=2C=CC(=CC=2)N2N=CN=C2)=N1 OWAKLEKFSBDKLG-UHFFFAOYSA-N 0.000 description 1
- HODKDRHBRQOTQY-UHFFFAOYSA-N [5-amino-3-[4-(1,2,4-triazol-1-yl)anilino]-1,2,4-triazol-1-yl]-(3-methylthiophen-2-yl)methanone Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(=CC=3)N3N=CN=C3)=N2)N)=C1C HODKDRHBRQOTQY-UHFFFAOYSA-N 0.000 description 1
- TZUYQYOXFHQHET-UHFFFAOYSA-N [5-amino-3-[4-(1,2,4-triazol-4-yl)anilino]-1,2,4-triazol-1-yl]-(2,6-difluoro-3-methylphenyl)methanone Chemical compound CC1=CC=C(F)C(C(=O)N2C(=NC(NC=3C=CC(=CC=3)N3C=NN=C3)=N2)N)=C1F TZUYQYOXFHQHET-UHFFFAOYSA-N 0.000 description 1
- RVZJOOGWMLVUMY-UHFFFAOYSA-N [5-amino-3-[4-(1,2,4-triazol-4-yl)anilino]-1,2,4-triazol-1-yl]-(3-methylthiophen-2-yl)methanone Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(=CC=3)N3C=NN=C3)=N2)N)=C1C RVZJOOGWMLVUMY-UHFFFAOYSA-N 0.000 description 1
- RDHHFKOQWNKHGZ-UHFFFAOYSA-N [5-amino-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazol-1-yl]-(2,6-difluorophenyl)methanone Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NN(C(=O)C=2C(=CC=CC=2F)F)C(N)=N1 RDHHFKOQWNKHGZ-UHFFFAOYSA-N 0.000 description 1
- URARFEXKWLMNJZ-UHFFFAOYSA-N [5-amino-3-[4-(4-methylpiperazin-1-yl)anilino]-1,2,4-triazol-1-yl]-(3,5-dimethylthiophen-2-yl)methanone Chemical compound C1CN(C)CCN1C(C=C1)=CC=C1NC1=NN(C(=O)C2=C(C=C(C)S2)C)C(N)=N1 URARFEXKWLMNJZ-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000000641 acridinyl group Chemical group C1(=CC=CC2=NC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 230000006978 adaptation Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000004448 alkyl carbonyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 230000001668 ameliorated effect Effects 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- NRWBBYXZLGNRBM-UHFFFAOYSA-N amino 3-amino-1h-1,2,4-triazole-5-carboxylate Chemical class NOC(=O)C1=NNC(N)=N1 NRWBBYXZLGNRBM-UHFFFAOYSA-N 0.000 description 1
- 125000002178 anthracenyl group Chemical group C1(=CC=CC2=CC3=CC=CC=C3C=C12)* 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 229960004365 benzoic acid Drugs 0.000 description 1
- IQFYYKKMVGJFEH-UHFFFAOYSA-N beta-L-thymidine Natural products O=C1NC(=O)C(C)=CN1C1OC(CO)C(O)C1 IQFYYKKMVGJFEH-UHFFFAOYSA-N 0.000 description 1
- SUMDYPCJJOFFON-UHFFFAOYSA-N beta-hydroxyethanesulfonic acid Natural products OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 229960001561 bleomycin Drugs 0.000 description 1
- OYVAGSVQBOHSSS-UAPAGMARSA-O bleomycin A2 Chemical compound N([C@H](C(=O)N[C@H](C)[C@@H](O)[C@H](C)C(=O)N[C@@H]([C@H](O)C)C(=O)NCCC=1SC=C(N=1)C=1SC=C(N=1)C(=O)NCCC[S+](C)C)[C@@H](O[C@H]1[C@H]([C@@H](O)[C@H](O)[C@H](CO)O1)O[C@@H]1[C@H]([C@@H](OC(N)=O)[C@H](O)[C@@H](CO)O1)O)C=1N=CNC=1)C(=O)C1=NC([C@H](CC(N)=O)NC[C@H](N)C(N)=O)=NC(N)=C1C OYVAGSVQBOHSSS-UAPAGMARSA-O 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- YDVJBLJCSLVMSY-UHFFFAOYSA-N carbamoyl cyanide Chemical compound NC(=O)C#N YDVJBLJCSLVMSY-UHFFFAOYSA-N 0.000 description 1
- 238000001460 carbon-13 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 230000021164 cell adhesion Effects 0.000 description 1
- 230000006369 cell cycle progression Effects 0.000 description 1
- 201000006662 cervical adenocarcinoma Diseases 0.000 description 1
- 238000004296 chiral HPLC Methods 0.000 description 1
- 229960004630 chlorambucil Drugs 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 238000011097 chromatography purification Methods 0.000 description 1
- 229960004316 cisplatin Drugs 0.000 description 1
- 229960004106 citric acid Drugs 0.000 description 1
- 229960002436 cladribine Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000013066 combination product Substances 0.000 description 1
- 229940127555 combination product Drugs 0.000 description 1
- 238000002648 combination therapy Methods 0.000 description 1
- 238000004891 communication Methods 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 239000012059 conventional drug carrier Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000007887 coronary angioplasty Methods 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 208000035250 cutaneous malignant susceptibility to 1 melanoma Diseases 0.000 description 1
- 125000006165 cyclic alkyl group Chemical group 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 229960004397 cyclophosphamide Drugs 0.000 description 1
- 239000002254 cytotoxic agent Substances 0.000 description 1
- 231100000599 cytotoxic agent Toxicity 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 1
- UXGNZZKBCMGWAZ-UHFFFAOYSA-N dimethylformamide dmf Chemical compound CN(C)C=O.CN(C)C=O UXGNZZKBCMGWAZ-UHFFFAOYSA-N 0.000 description 1
- 125000005879 dioxolanyl group Chemical group 0.000 description 1
- 239000007884 disintegrant Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 230000003511 endothelial effect Effects 0.000 description 1
- 210000003038 endothelium Anatomy 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 229960001904 epirubicin Drugs 0.000 description 1
- 210000002919 epithelial cell Anatomy 0.000 description 1
- 230000008029 eradication Effects 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- VJJPUSNTGOMMGY-MRVIYFEKSA-N etoposide Chemical compound COC1=C(O)C(OC)=CC([C@@H]2C3=CC=4OCOC=4C=C3[C@@H](O[C@H]3[C@@H]([C@@H](O)[C@@H]4O[C@H](C)OC[C@H]4O3)O)[C@@H]3[C@@H]2C(OC3)=O)=C1 VJJPUSNTGOMMGY-MRVIYFEKSA-N 0.000 description 1
- 229960005420 etoposide Drugs 0.000 description 1
- 210000003527 eukaryotic cell Anatomy 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000013020 final formulation Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229960002949 fluorouracil Drugs 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013355 food flavoring agent Nutrition 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 230000004927 fusion Effects 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 210000003780 hair follicle Anatomy 0.000 description 1
- 208000024963 hair loss Diseases 0.000 description 1
- 230000003676 hair loss Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004475 heteroaralkyl group Chemical group 0.000 description 1
- 102000056838 human CDK1 Human genes 0.000 description 1
- 102000047882 human INSR Human genes 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 125000002636 imidazolinyl group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 238000002513 implantation Methods 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000006301 indolyl methyl group Chemical group 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000003834 intracellular effect Effects 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000007912 intraperitoneal administration Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- TWBYWOBDOCUKOW-UHFFFAOYSA-N isonicotinic acid Natural products OC(=O)C1=CC=NC=C1 TWBYWOBDOCUKOW-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000001786 isothiazolyl group Chemical group 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 208000032839 leukemia Diseases 0.000 description 1
- 239000002502 liposome Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 239000002207 metabolite Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 229960000485 methotrexate Drugs 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- ZGZFEDUYJFEJAW-UHFFFAOYSA-N n-(4-aminophenyl)methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(N)C=C1 ZGZFEDUYJFEJAW-UHFFFAOYSA-N 0.000 description 1
- VDKVTHUOSCSJII-UHFFFAOYSA-N n-[2-[5-amino-3-(4-sulfamoylanilino)-1,2,4-triazole-1-carbonyl]thiophen-3-yl]acetamide Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(=CC=3)S(N)(=O)=O)=N2)N)=C1NC(=O)C VDKVTHUOSCSJII-UHFFFAOYSA-N 0.000 description 1
- BDKDGTMMZHIPTF-UHFFFAOYSA-N n-[4-[[5-amino-1-(2,6-difluorobenzoyl)-1,2,4-triazol-3-yl]amino]phenyl]methanesulfonamide Chemical compound C1=CC(NS(=O)(=O)C)=CC=C1NC1=NN(C(=O)C=2C(=CC=CC=2F)F)C(N)=N1 BDKDGTMMZHIPTF-UHFFFAOYSA-N 0.000 description 1
- STQHJJFBIMZUDV-UHFFFAOYSA-N n-[4-[[5-amino-1-(3-methylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]phenyl]methanesulfonamide Chemical compound C1=CSC(C(=O)N2C(=NC(NC=3C=CC(NS(C)(=O)=O)=CC=3)=N2)N)=C1C STQHJJFBIMZUDV-UHFFFAOYSA-N 0.000 description 1
- SYHOXPUVDRCNAN-UHFFFAOYSA-N n-[4-[[5-amino-1-(5-ethylthiophene-2-carbonyl)-1,2,4-triazol-3-yl]amino]phenyl]methanesulfonamide Chemical compound S1C(CC)=CC=C1C(=O)N1C(N)=NC(NC=2C=CC(NS(C)(=O)=O)=CC=2)=N1 SYHOXPUVDRCNAN-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 229920001206 natural gum Polymers 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 230000004987 nonapoptotic effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 239000000346 nonvolatile oil Substances 0.000 description 1
- 239000002773 nucleotide Substances 0.000 description 1
- 125000003729 nucleotide group Chemical group 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 208000013371 ovarian adenocarcinoma Diseases 0.000 description 1
- 201000006588 ovary adenocarcinoma Diseases 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229940124641 pain reliever Drugs 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical compound [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000008177 pharmaceutical agent Substances 0.000 description 1
- DGTNSSLYPYDJGL-UHFFFAOYSA-N phenyl isocyanate Chemical compound O=C=NC1=CC=CC=C1 DGTNSSLYPYDJGL-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000008105 phosphatidylcholines Chemical class 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- 230000002335 preservative effect Effects 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 201000005825 prostate adenocarcinoma Diseases 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 125000002755 pyrazolinyl group Chemical group 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- 125000001422 pyrrolinyl group Chemical group 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000002901 radioactive waste Substances 0.000 description 1
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 1
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000008929 regeneration Effects 0.000 description 1
- 238000011069 regeneration method Methods 0.000 description 1
- 230000022983 regulation of cell cycle Effects 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 230000011664 signaling Effects 0.000 description 1
- 238000010898 silica gel chromatography Methods 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- RNVYQYLELCKWAN-UHFFFAOYSA-N solketal Chemical compound CC1(C)OCC(CO)O1 RNVYQYLELCKWAN-UHFFFAOYSA-N 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000011301 standard therapy Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 239000007940 sugar coated tablet Substances 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 229940042055 systemic antimycotics triazole derivative Drugs 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- WHRNULOCNSKMGB-UHFFFAOYSA-N tetrahydrofuran thf Chemical compound C1CCOC1.C1CCOC1 WHRNULOCNSKMGB-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- WROMPOXWARCANT-UHFFFAOYSA-N tfa trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F.OC(=O)C(F)(F)F WROMPOXWARCANT-UHFFFAOYSA-N 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- HJZYBDPHAHGHAZ-UHFFFAOYSA-N thiadiazole-4-carboxylic acid Chemical compound OC(=O)C1=CSN=N1 HJZYBDPHAHGHAZ-UHFFFAOYSA-N 0.000 description 1
- 125000004305 thiazinyl group Chemical group S1NC(=CC=C1)* 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 description 1
- YNVOMSDITJMNET-UHFFFAOYSA-N thiophene-3-carboxylic acid Chemical compound OC(=O)C=1C=CSC=1 YNVOMSDITJMNET-UHFFFAOYSA-N 0.000 description 1
- 229940104230 thymidine Drugs 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 229940100640 transdermal system Drugs 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- 241000701447 unidentified baculovirus Species 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 230000006444 vascular growth Effects 0.000 description 1
- 210000004509 vascular smooth muscle cell Anatomy 0.000 description 1
- 239000013598 vector Substances 0.000 description 1
- 235000015112 vegetable and seed oil Nutrition 0.000 description 1
- 239000008158 vegetable oil Substances 0.000 description 1
- OGWKCGZFUXNPDA-XQKSVPLYSA-N vincristine Chemical compound C([N@]1C[C@@H](C[C@]2(C(=O)OC)C=3C(=CC4=C([C@]56[C@H]([C@@]([C@H](OC(C)=O)[C@]7(CC)C=CCN([C@H]67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)C[C@@](C1)(O)CC)CC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-XQKSVPLYSA-N 0.000 description 1
- 229960004528 vincristine Drugs 0.000 description 1
- OGWKCGZFUXNPDA-UHFFFAOYSA-N vincristine Natural products C1C(CC)(O)CC(CC2(C(=O)OC)C=3C(=CC4=C(C56C(C(C(OC(C)=O)C7(CC)C=CCN(C67)CC5)(O)C(=O)OC)N4C=O)C=3)OC)CN1CCC1=C2NC2=CC=CC=C12 OGWKCGZFUXNPDA-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/4164—1,3-Diazoles
- A61K31/4178—1,3-Diazoles not condensed 1,3-diazoles and containing further heterocyclic rings, e.g. pilocarpine, nitrofurantoin
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/4196—1,2,4-Triazoles
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/41—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having five-membered rings with two or more ring hetero atoms, at least one of which being nitrogen, e.g. tetrazole
- A61K31/425—Thiazoles
- A61K31/427—Thiazoles not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/435—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with one nitrogen as the only ring hetero atom
- A61K31/44—Non condensed pyridines; Hydrogenated derivatives thereof
- A61K31/4427—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems
- A61K31/4439—Non condensed pyridines; Hydrogenated derivatives thereof containing further heterocyclic ring systems containing a five-membered ring with nitrogen as a ring hetero atom, e.g. omeprazole
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
- C07D249/10—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D249/14—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/06—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/06—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Veterinary Medicine (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Medicinal Chemistry (AREA)
- Public Health (AREA)
- Epidemiology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US25770300P | 2000-12-22 | 2000-12-22 | |
| PCT/US2001/050559 WO2002057240A1 (en) | 2000-12-22 | 2001-12-21 | Substituted triazole diamine derivatives as kinase inhibitors |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SK9062003A3 true SK9062003A3 (en) | 2004-04-06 |
Family
ID=22977396
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SK906-2003A SK9062003A3 (en) | 2000-12-22 | 2001-12-21 | Substituted triazole diamine derivatives as kinase inhibitors |
Country Status (23)
| Country | Link |
|---|---|
| US (2) | US6924302B2 (cs) |
| EP (1) | EP1355889B1 (cs) |
| CN (1) | CN100357278C (cs) |
| AT (1) | ATE328874T1 (cs) |
| BG (2) | BG107959A (cs) |
| BR (1) | BR0116792A (cs) |
| CA (1) | CA2432870A1 (cs) |
| CZ (1) | CZ20031941A3 (cs) |
| DE (1) | DE60120494T2 (cs) |
| DK (1) | DK1355889T3 (cs) |
| ES (1) | ES2266313T3 (cs) |
| HU (1) | HUP0303868A3 (cs) |
| IL (1) | IL156584A0 (cs) |
| MX (1) | MXPA03005777A (cs) |
| NO (1) | NO20032848L (cs) |
| NZ (1) | NZ526624A (cs) |
| PL (1) | PL363316A1 (cs) |
| PT (1) | PT1355889E (cs) |
| RU (1) | RU2274639C2 (cs) |
| SK (1) | SK9062003A3 (cs) |
| WO (1) | WO2002057240A1 (cs) |
| YU (1) | YU51803A (cs) |
| ZA (1) | ZA200305619B (cs) |
Families Citing this family (52)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JP4483581B2 (ja) * | 2002-08-06 | 2010-06-16 | 東レ株式会社 | 腎疾患治療又は予防剤及び腎疾患の診断方法 |
| MY139563A (en) * | 2002-09-04 | 2009-10-30 | Bristol Myers Squibb Co | Heterocyclic aromatic compounds useful as growth hormone secretagogues |
| AR042052A1 (es) * | 2002-11-15 | 2005-06-08 | Vertex Pharma | Diaminotriazoles utiles como inhibidores de proteinquinasas |
| US7429378B2 (en) | 2003-05-13 | 2008-09-30 | Depuy Spine, Inc. | Transdiscal administration of high affinity anti-MMP inhibitors |
| US7344716B2 (en) | 2003-05-13 | 2008-03-18 | Depuy Spine, Inc. | Transdiscal administration of specific inhibitors of pro-inflammatory cytokines |
| US7553827B2 (en) | 2003-08-13 | 2009-06-30 | Depuy Spine, Inc. | Transdiscal administration of cycline compounds |
| US8273347B2 (en) | 2003-05-13 | 2012-09-25 | Depuy Spine, Inc. | Autologous treatment of degenerated disc with cells |
| BRPI0410331A (pt) | 2003-05-13 | 2006-05-30 | Depuy Spine Inc | método para tratar doença de disco degenerativa |
| US8361467B2 (en) | 2003-07-30 | 2013-01-29 | Depuy Spine, Inc. | Trans-capsular administration of high specificity cytokine inhibitors into orthopedic joints |
| CA2534921C (en) | 2003-08-06 | 2011-06-14 | Vertex Pharmaceuticals Incorporated | Aminotriazole compounds useful as inhibitors of protein kinases |
| US8895540B2 (en) | 2003-11-26 | 2014-11-25 | DePuy Synthes Products, LLC | Local intraosseous administration of bone forming agents and anti-resorptive agents, and devices therefor |
| DE10356579A1 (de) * | 2003-12-04 | 2005-07-07 | Merck Patent Gmbh | Aminderivate |
| WO2005070042A2 (en) * | 2004-01-09 | 2005-08-04 | Smithkline Beecham Corporation | Novel chemical compounds |
| EP2260849A1 (en) | 2004-01-21 | 2010-12-15 | Emory University | Compositions and methods of use for tyrosine kinase inhibitors to treat pathogenic infection |
| WO2005077922A2 (en) * | 2004-02-11 | 2005-08-25 | Janssen Pharmaceutica, N.V. | Process for the preparation of substituted triazole compounds |
| WO2006042215A1 (en) * | 2004-10-08 | 2006-04-20 | Janssen Pharmaceutica, N.V. | 1,2,4-triazolylaminoaryl (heteroaryl) sulfonamide derivatives |
| BRPI0517435A (pt) * | 2004-10-21 | 2008-10-07 | Vertex Pharma | triazóis úteis como inibidores de proteìna cinase |
| DE102004055998A1 (de) * | 2004-11-19 | 2006-05-24 | Rheinische Friedrich-Wilhelms-Universität Bonn | Niedermolekulare Inhibitoren von Guaninnucleotid-Austauschfaktoren der Cytohesin-Familie |
| US20090036435A1 (en) | 2005-01-21 | 2009-02-05 | Astex Therapeutics Limited | Pharmaceutical Compounds |
| US7884119B2 (en) * | 2005-09-07 | 2011-02-08 | Rigel Pharmaceuticals, Inc. | Triazole derivatives useful as Axl inhibitors |
| EP2045253A4 (en) | 2006-06-29 | 2013-01-23 | Nissan Chemical Ind Ltd | alpha-amino acid derivative and pharmaceutical agent containing it as an active ingredient |
| JP5528806B2 (ja) | 2006-10-12 | 2014-06-25 | アステックス、セラピューティックス、リミテッド | 複合薬剤 |
| JP5528807B2 (ja) | 2006-10-12 | 2014-06-25 | アステックス、セラピューティックス、リミテッド | 複合薬剤 |
| DE102006054205A1 (de) * | 2006-11-15 | 2008-05-29 | Rheinische Friedrich-Wilhelms Universität | Verwendung von Cytohesin-Inhibitoren zur chemischen Induktion von Langlebigkeit |
| WO2008075353A1 (en) | 2006-12-19 | 2008-06-26 | Pharmos Corporation | Sulfonamide derivatives with therapeutic indications |
| AU2007342005A1 (en) | 2006-12-29 | 2008-07-10 | Rigel Pharmaceuticals, Inc. | N3-heteroaryl substituted triazoles and N5-heteroaryl substituted triazoles useful as Axl inhibitors |
| WO2008083353A1 (en) | 2006-12-29 | 2008-07-10 | Rigel Pharmaceuticals, Inc. | Bicyclic aryl and bicyclic heteroaryl substituted triazoles useful as axl inhibitors |
| DK2114955T3 (da) | 2006-12-29 | 2013-05-06 | Rigel Pharmaceuticals Inc | Broforbundet, bicyklisk aryl og broforbundet, bicyklisk heteroaryl subsitiuerede triazoler, der er anvendelige som axl-inhibitorer |
| AU2007341937B2 (en) | 2006-12-29 | 2013-07-11 | Rigel Pharmaceuticals, Inc. | Polycyclic heteroaryl substituted triazoles useful as Axl inhibitors |
| CN101622252B (zh) | 2006-12-29 | 2015-04-22 | 里格尔制药公司 | 用作axl抑制剂的取代三唑 |
| JO2784B1 (en) | 2007-10-18 | 2014-03-15 | شركة جانسين فارماسوتيكا ان. في | 5,3,1 - Triazole substitute derivative |
| EP2212309B1 (en) * | 2007-10-18 | 2013-06-19 | Janssen Pharmaceutica N.V. | Trisubstituted 1,2,4-triazoles |
| SI2205592T1 (sl) * | 2007-10-26 | 2013-09-30 | Rigel Pharmaceuticals, Inc. | Triazoli substituirani s policikličnim arilom in triazoli substituirani s policikličnim heteroarilom uporabni kot Axl inhibitorji |
| US8986696B2 (en) | 2007-12-21 | 2015-03-24 | Depuy Mitek, Inc. | Trans-capsular administration of p38 map kinase inhibitors into orthopedic joints |
| EP2257541B1 (en) | 2008-02-22 | 2013-08-14 | F. Hoffmann-La Roche AG | Modulators for amyloid beta |
| US8778974B2 (en) | 2008-03-19 | 2014-07-15 | Janssen Pharmaceutica Nv | Trisubstituted 1,2,4 triazoles |
| AR071763A1 (es) | 2008-05-09 | 2010-07-14 | Janssen Pharmaceutica Nv | Pirazoles trisustituidos, composiciones farmaceuticas que los contienen, y usos de los mismos en el tratamiento de trastornos neurologicos y psiquiatricos |
| ES2537480T3 (es) | 2008-07-09 | 2015-06-08 | Rigel Pharmaceuticals, Inc. | Triazoles sustituidos con heteroarilo policíclicos útiles como inhibidores de Axl |
| SI2328888T1 (sl) * | 2008-07-09 | 2013-03-29 | Rigel Pharmaceuticals, Inc. | Premoščeni biciklični heteroaril substituirani triazoli, uporabni kot inhibitorji Axl |
| JP5502089B2 (ja) | 2008-10-09 | 2014-05-28 | エフ.ホフマン−ラ ロシュ アーゲー | アミロイドβのモジュレーター |
| KR101293421B1 (ko) * | 2008-11-10 | 2013-08-05 | 에프. 호프만-라 로슈 아게 | 헤테로사이클릭 감마 분비효소 조절제 |
| ES2528032T3 (es) | 2009-01-16 | 2015-02-03 | Rigel Pharmaceuticals, Inc. | Inhibidores de Axl para su uso en terapia de combinación para prevenir, tratar o manejar cáncer metastásico |
| US8486967B2 (en) | 2010-02-17 | 2013-07-16 | Hoffmann-La Roche Inc. | Heteroaryl substituted piperidines |
| US20140010783A1 (en) * | 2012-07-06 | 2014-01-09 | Hoffmann-La Roche Inc. | Antiviral compounds |
| US9499539B2 (en) | 2012-11-05 | 2016-11-22 | Nantbioscience, Inc. | Cyclic sulfonamide containing derivatives as inhibitors of hedgehog signaling pathway |
| MX2015011125A (es) * | 2013-03-05 | 2015-11-11 | Hoffmann La Roche | Compuestos antivirales. |
| JP6163214B2 (ja) * | 2013-03-06 | 2017-07-12 | エフ.ホフマン−ラ ロシュ アーゲーF. Hoffmann−La Roche Aktiengesellschaft | 抗ウイルス化合物 |
| WO2018175670A1 (en) | 2017-03-22 | 2018-09-27 | The Research Foundation For The State University Of New York | Matrix metalloproteinase-9 hemopexin domain inhibitors and methods of treatment using same |
| US12110278B2 (en) * | 2020-10-13 | 2024-10-08 | Yale University | Selective JAK2 pseudokinase ligands and methods of use |
| CN118475583A (zh) * | 2021-10-26 | 2024-08-09 | 瓦索卡地亚公司 | Gpr39蛋白的拮抗剂 |
| CN114292243B (zh) * | 2022-01-12 | 2023-11-21 | 中山大学 | 一种三唑类衍生物或其药学上可接受的盐及其制备方法和应用 |
| CN115433222A (zh) * | 2022-09-20 | 2022-12-06 | 五邑大学 | 一种2-(偕二氟丙烯)苯甲酰胺类化合物的制备方法及其应用 |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2352944A (en) * | 1942-07-04 | 1944-07-04 | Gen Electric | Triazole derivatives |
| NL301383A (cs) | 1962-12-06 | |||
| US4727022A (en) * | 1984-03-14 | 1988-02-23 | Syntex (U.S.A.) Inc. | Methods for modulating ligand-receptor interactions and their application |
| US5196351A (en) * | 1987-09-30 | 1993-03-23 | Beckman Instruments, Inc. | Bidentate conjugate and method of use thereof |
| HU206095B (en) * | 1989-10-25 | 1992-08-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing triazolylcarboxylc acid hydrazie and semicarbazide derivatives and pharmaceutical compositions comprising same |
| HU206096B (en) * | 1989-11-24 | 1992-08-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing triazolylcarboxylic acid thioamide derivatives and pharmaceutical compositions comprising same |
| US5683867A (en) * | 1990-06-11 | 1997-11-04 | Nexstar Pharmaceuticals, Inc. | Systematic evolution of ligands by exponential enrichment: blended SELEX |
| DE69233750D1 (de) * | 1991-04-10 | 2009-01-02 | Scripps Research Inst | Bibliotheken heterodimerer Rezeptoren mittels Phagemiden |
| DE69230225T2 (de) * | 1991-09-02 | 2000-05-31 | Yamanouchi Pharmaceutical Co., Ltd. | Triazolylierte tertiäre aminverbindungen oder ihre salze |
| US5543507A (en) * | 1992-03-05 | 1996-08-06 | Isis Pharmaceuticals, Inc. | Covalently cross-linked oligonucleotides |
| US5362859A (en) * | 1992-07-27 | 1994-11-08 | Sepracor, Inc. | High-capacity affinity supports and methods for the preparation and use of same |
| US5512435A (en) * | 1993-02-05 | 1996-04-30 | Renschler; Markus F. | Receptor-binding antiproliferative peptides |
| WO1995003286A1 (en) | 1993-07-23 | 1995-02-02 | The Green Cross Corporation | Triazole derivative and pharmaceutical use thereof |
| US5698401A (en) * | 1995-11-14 | 1997-12-16 | Abbott Laboratories | Use of nuclear magnetic resonance to identify ligands to target biomolecules |
| DE69835241T2 (de) * | 1997-10-27 | 2007-05-31 | Agouron Pharmaceuticals, Inc., La Jolla | 4-Aminothiazol Derivate, deren Herstellung und deren Verwendung als Inhibitoren Cyclin-abhängiger Kinasen |
| GB9918180D0 (en) * | 1999-08-02 | 1999-10-06 | Smithkline Beecham Plc | Novel compositions |
-
2001
- 2001-12-21 PT PT01998116T patent/PT1355889E/pt unknown
- 2001-12-21 IL IL15658401A patent/IL156584A0/xx unknown
- 2001-12-21 AT AT01998116T patent/ATE328874T1/de active
- 2001-12-21 PL PL01363316A patent/PL363316A1/xx not_active Application Discontinuation
- 2001-12-21 WO PCT/US2001/050559 patent/WO2002057240A1/en not_active Ceased
- 2001-12-21 MX MXPA03005777A patent/MXPA03005777A/es active IP Right Grant
- 2001-12-21 NZ NZ526624A patent/NZ526624A/en not_active IP Right Cessation
- 2001-12-21 CZ CZ20031941A patent/CZ20031941A3/cs unknown
- 2001-12-21 US US10/029,750 patent/US6924302B2/en not_active Expired - Lifetime
- 2001-12-21 BR BR0116792-8A patent/BR0116792A/pt not_active IP Right Cessation
- 2001-12-21 DK DK01998116T patent/DK1355889T3/da active
- 2001-12-21 DE DE60120494T patent/DE60120494T2/de not_active Expired - Lifetime
- 2001-12-21 CN CNB018226450A patent/CN100357278C/zh not_active Expired - Fee Related
- 2001-12-21 YU YU51803A patent/YU51803A/sh unknown
- 2001-12-21 RU RU2003118448/04A patent/RU2274639C2/ru not_active IP Right Cessation
- 2001-12-21 HU HU0303868A patent/HUP0303868A3/hu unknown
- 2001-12-21 EP EP01998116A patent/EP1355889B1/en not_active Expired - Lifetime
- 2001-12-21 CA CA002432870A patent/CA2432870A1/en not_active Abandoned
- 2001-12-21 ES ES01998116T patent/ES2266313T3/es not_active Expired - Lifetime
- 2001-12-21 SK SK906-2003A patent/SK9062003A3/sk not_active Application Discontinuation
-
2003
- 2003-06-20 NO NO20032848A patent/NO20032848L/no not_active Application Discontinuation
- 2003-07-01 BG BG107959A patent/BG107959A/bg unknown
- 2003-07-08 BG BG107985A patent/BG107985A/bg unknown
- 2003-07-21 ZA ZA200305619A patent/ZA200305619B/en unknown
-
2005
- 2005-02-01 US US11/047,800 patent/US7317031B2/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BG107985A (bg) | 2004-11-30 |
| CN100357278C (zh) | 2007-12-26 |
| NO20032848L (no) | 2003-08-20 |
| BG107959A (bg) | 2004-12-30 |
| DK1355889T3 (da) | 2006-10-09 |
| NZ526624A (en) | 2005-07-29 |
| US20050182116A1 (en) | 2005-08-18 |
| CA2432870A1 (en) | 2002-07-25 |
| BR0116792A (pt) | 2004-02-17 |
| HUP0303868A2 (hu) | 2004-03-01 |
| NO20032848D0 (no) | 2003-06-20 |
| DE60120494T2 (de) | 2006-12-21 |
| WO2002057240A1 (en) | 2002-07-25 |
| MXPA03005777A (es) | 2005-02-14 |
| ATE328874T1 (de) | 2006-06-15 |
| RU2003118448A (ru) | 2005-01-27 |
| RU2274639C2 (ru) | 2006-04-20 |
| HK1057373A1 (en) | 2004-04-02 |
| IL156584A0 (en) | 2004-01-04 |
| PL363316A1 (en) | 2004-11-15 |
| US7317031B2 (en) | 2008-01-08 |
| EP1355889A1 (en) | 2003-10-29 |
| ZA200305619B (en) | 2004-10-21 |
| EP1355889B1 (en) | 2006-06-07 |
| US20040077699A1 (en) | 2004-04-22 |
| CN1575284A (zh) | 2005-02-02 |
| US6924302B2 (en) | 2005-08-02 |
| YU51803A (sh) | 2006-05-25 |
| DE60120494D1 (de) | 2006-07-20 |
| PT1355889E (pt) | 2006-09-29 |
| CZ20031941A3 (cs) | 2004-08-18 |
| HUP0303868A3 (en) | 2008-03-28 |
| ES2266313T3 (es) | 2007-03-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SK9062003A3 (en) | Substituted triazole diamine derivatives as kinase inhibitors | |
| AU2016206247B2 (en) | Multisubstituted aromatic compounds as inhibitors of thrombin | |
| AU763356B2 (en) | Fused-ring compounds and use thereof as drugs | |
| US8273738B2 (en) | Imidazole derivatives | |
| JP4911866B2 (ja) | ファルネシルトランスフェラーゼ阻害剤としてのファルネシルトランスフェラーゼを阻害するキノリンおよびキナゾリン誘導体 | |
| KR20030036735A (ko) | 축합환 화합물 및 그 의약 용도 | |
| WO2001068585A1 (en) | Novel amide compounds | |
| BG65207B1 (bg) | Производни на хетероциклен карбамид и използването им за инхибиране на raf киназа | |
| JP2011526616A (ja) | 化学化合物 | |
| KR20140124398A (ko) | 오렉신 수용체 길항제로서 치환된 프롤린 / 피페리딘 | |
| JP2007509173A (ja) | インドリノン誘導体類及び疾病状態、例えば癌の処理へのそれらの使用 | |
| EP2107054A1 (en) | Antiproliferative compounds and therapeutic uses thereof | |
| CN105814037B (zh) | 作为丙酮酸脱氢酶激酶的抑制剂的n1-(3,3,3-三氟-2-羟基-2-甲基丙酰基)-哌啶衍生物 | |
| US20090156646A1 (en) | Pyridylphenol compound and use thereof | |
| CN101233128B (zh) | 在糖尿病治疗中用作glk激活剂的杂芳基苯甲酰胺衍生物 | |
| TW202031644A (zh) | 苯并咪唑衍生物 | |
| AU2002249872B2 (en) | Substituted triazole diamine derivatives as kinase inhibitors | |
| EP1712550A2 (en) | Substituted triazole diamine derivatives as kinase inhibitors | |
| AU2002249872A1 (en) | Substituted triazole diamine derivatives as kinase inhibitors | |
| KR100501424B1 (ko) | 축합환 화합물 및 그 의약 용도 | |
| HK1057373B (en) | Substituted triazole diamine derivatives as kinase inhibitors |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FC9A | Refused patent application |