FI88291C - Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara foereningar och mellanprodukter vid deras framstaellning - Google Patents
Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara foereningar och mellanprodukter vid deras framstaellning Download PDFInfo
- Publication number
- FI88291C FI88291C FI871898A FI871898A FI88291C FI 88291 C FI88291 C FI 88291C FI 871898 A FI871898 A FI 871898A FI 871898 A FI871898 A FI 871898A FI 88291 C FI88291 C FI 88291C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- alk
- group
- methyl
- alkyl
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 title claims abstract description 103
- 238000000034 method Methods 0.000 title claims description 37
- 238000002360 preparation method Methods 0.000 title claims description 31
- 230000008569 process Effects 0.000 title claims description 17
- 239000000543 intermediate Substances 0.000 title abstract description 11
- -1 piperidino, morpholino Chemical group 0.000 claims abstract description 50
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims abstract description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 9
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 8
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 7
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 7
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 claims abstract description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 4
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 claims abstract description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 38
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 claims description 32
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 23
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 19
- 239000000460 chlorine Substances 0.000 claims description 18
- 239000002253 acid Substances 0.000 claims description 16
- 235000017557 sodium bicarbonate Nutrition 0.000 claims description 16
- 229910000030 sodium bicarbonate Inorganic materials 0.000 claims description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 12
- IZDROVVXIHRYMH-UHFFFAOYSA-N methanesulfonic anhydride Chemical compound CS(=O)(=O)OS(C)(=O)=O IZDROVVXIHRYMH-UHFFFAOYSA-N 0.000 claims description 11
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 11
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 claims description 10
- 239000002516 radical scavenger Substances 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 7
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 150000002367 halogens Chemical class 0.000 claims description 5
- 230000010933 acylation Effects 0.000 claims description 4
- 238000005917 acylation reaction Methods 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- IXTMWRCNAAVVAI-UHFFFAOYSA-N dofetilide Chemical compound C=1C=C(NS(C)(=O)=O)C=CC=1CCN(C)CCOC1=CC=C(NS(C)(=O)=O)C=C1 IXTMWRCNAAVVAI-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- 150000008064 anhydrides Chemical class 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims description 2
- RSQWCMABKYFNIZ-UHFFFAOYSA-N n-[4-[2-[2-(4-aminophenyl)ethyl-methylamino]ethoxy]phenyl]methanesulfonamide Chemical compound C=1C=C(N)C=CC=1CCN(C)CCOC1=CC=C(NS(C)(=O)=O)C=C1 RSQWCMABKYFNIZ-UHFFFAOYSA-N 0.000 claims description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 claims description 2
- QZYRUZJJDBUKII-UHFFFAOYSA-N 4-[2-[2-(4-aminophenoxy)ethyl-methylamino]ethyl]aniline Chemical compound C=1C=C(N)C=CC=1CCN(C)CCOC1=CC=C(N)C=C1 QZYRUZJJDBUKII-UHFFFAOYSA-N 0.000 claims 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims 1
- 239000005977 Ethylene Substances 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- ITYJDNHFRZSTJY-UHFFFAOYSA-N methanesulfonyl bromide Chemical compound CS(Br)(=O)=O ITYJDNHFRZSTJY-UHFFFAOYSA-N 0.000 claims 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims 1
- NBNBICNWNFQDDD-UHFFFAOYSA-N sulfuryl dibromide Chemical compound BrS(Br)(=O)=O NBNBICNWNFQDDD-UHFFFAOYSA-N 0.000 claims 1
- 239000003416 antiarrhythmic agent Substances 0.000 abstract description 8
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 abstract description 3
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 126
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 102
- 239000000243 solution Substances 0.000 description 60
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 56
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 43
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 239000007787 solid Substances 0.000 description 36
- 238000004458 analytical method Methods 0.000 description 31
- 239000003921 oil Substances 0.000 description 29
- 235000019198 oils Nutrition 0.000 description 29
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- 238000001704 evaporation Methods 0.000 description 25
- 230000008020 evaporation Effects 0.000 description 25
- 239000000203 mixture Substances 0.000 description 25
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 24
- 238000010992 reflux Methods 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 239000000377 silicon dioxide Substances 0.000 description 15
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 235000011181 potassium carbonates Nutrition 0.000 description 14
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 12
- 238000005481 NMR spectroscopy Methods 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 12
- 239000007858 starting material Substances 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 238000000605 extraction Methods 0.000 description 10
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 10
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 10
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- 206010003119 arrhythmia Diseases 0.000 description 8
- 239000012267 brine Substances 0.000 description 8
- 238000001816 cooling Methods 0.000 description 8
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 7
- 230000001746 atrial effect Effects 0.000 description 7
- 238000002425 crystallisation Methods 0.000 description 7
- 230000008025 crystallization Effects 0.000 description 7
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 6
- 238000004587 chromatography analysis Methods 0.000 description 6
- 239000003814 drug Substances 0.000 description 6
- 238000001914 filtration Methods 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- NTURQZFFJDCTMZ-UHFFFAOYSA-N 1-(2-bromoethyl)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(CCBr)C=C1 NTURQZFFJDCTMZ-UHFFFAOYSA-N 0.000 description 5
- 241000700199 Cavia porcellus Species 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 5
- 235000019502 Orange oil Nutrition 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 5
- PTPPVTUXJDJAGY-UHFFFAOYSA-N n-methyl-2-(4-nitrophenyl)ethanamine Chemical compound CNCCC1=CC=C([N+]([O-])=O)C=C1 PTPPVTUXJDJAGY-UHFFFAOYSA-N 0.000 description 5
- 239000010502 orange oil Substances 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- 235000009518 sodium iodide Nutrition 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- 229910000564 Raney nickel Inorganic materials 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 230000003288 anthiarrhythmic effect Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 4
- 238000000338 in vitro Methods 0.000 description 4
- 235000015320 potassium carbonate Nutrition 0.000 description 4
- 230000002861 ventricular Effects 0.000 description 4
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 3
- 238000007792 addition Methods 0.000 description 3
- 230000006793 arrhythmia Effects 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000007796 conventional method Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000012153 distilled water Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 238000003328 mesylation reaction Methods 0.000 description 3
- 210000003205 muscle Anatomy 0.000 description 3
- XJJXMLGYSDKGEZ-UHFFFAOYSA-N n-methyl-2-(4-nitrophenyl)-n-[2-(4-nitrophenyl)ethyl]ethanamine Chemical compound C=1C=C([N+]([O-])=O)C=CC=1CCN(C)CCC1=CC=C([N+]([O-])=O)C=C1 XJJXMLGYSDKGEZ-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 3
- 210000001519 tissue Anatomy 0.000 description 3
- AQROBZNMFWEHDM-UHFFFAOYSA-N 1-[methyl-[2-(4-nitrophenyl)ethyl]amino]propan-2-ol Chemical compound CC(O)CN(C)CCC1=CC=C([N+]([O-])=O)C=C1 AQROBZNMFWEHDM-UHFFFAOYSA-N 0.000 description 2
- YDPMNBHBYBUBMD-UHFFFAOYSA-N 2-chloro-n-methyl-n-[2-(4-nitrophenyl)ethyl]propan-1-amine Chemical compound CC(Cl)CN(C)CCC1=CC=C([N+]([O-])=O)C=C1 YDPMNBHBYBUBMD-UHFFFAOYSA-N 0.000 description 2
- CIIGWOXXOUVEAD-UHFFFAOYSA-N 2-chloroethyl benzenesulfonate Chemical compound ClCCOS(=O)(=O)C1=CC=CC=C1 CIIGWOXXOUVEAD-UHFFFAOYSA-N 0.000 description 2
- ZSNMDJBLRIOITA-UHFFFAOYSA-N 4-[2-[2-(4-aminophenyl)ethyl-methylamino]ethoxy]benzamide Chemical compound C=1C=C(N)C=CC=1CCN(C)CCOC1=CC=C(C(N)=O)C=C1 ZSNMDJBLRIOITA-UHFFFAOYSA-N 0.000 description 2
- ULFMGHLKPSQGDY-UHFFFAOYSA-N 4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]benzamide Chemical compound C=1C=C([N+]([O-])=O)C=CC=1CCN(C)CCOC1=CC=C(C(N)=O)C=C1 ULFMGHLKPSQGDY-UHFFFAOYSA-N 0.000 description 2
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 2
- 206010003658 Atrial Fibrillation Diseases 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 206010042600 Supraventricular arrhythmias Diseases 0.000 description 2
- 206010047281 Ventricular arrhythmia Diseases 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- JECOSSASMXAXFV-UHFFFAOYSA-N chloroethane;hydrochloride Chemical compound Cl.CCCl JECOSSASMXAXFV-UHFFFAOYSA-N 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 150000003840 hydrochlorides Chemical class 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- SRSRGGYRIOZFAT-UHFFFAOYSA-N methyl 4-(2-chloroethoxy)benzoate Chemical compound COC(=O)C1=CC=C(OCCCl)C=C1 SRSRGGYRIOZFAT-UHFFFAOYSA-N 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- HUSUTKNOYKBODA-UHFFFAOYSA-N n-[4-[2-[methyl-[2-(4-nitrophenoxy)ethyl]amino]ethyl]phenyl]methanesulfonamide Chemical compound C=1C=C(NS(C)(=O)=O)C=CC=1CCN(C)CCOC1=CC=C([N+]([O-])=O)C=C1 HUSUTKNOYKBODA-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 239000008194 pharmaceutical composition Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 239000002504 physiological saline solution Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 230000002028 premature Effects 0.000 description 2
- 230000002265 prevention Effects 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 208000003663 ventricular fibrillation Diseases 0.000 description 2
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 1
- AHOFWSHLRKOJBS-UHFFFAOYSA-N 1-(2-bromoethoxy)-2-nitrobenzene Chemical class [O-][N+](=O)C1=CC=CC=C1OCCBr AHOFWSHLRKOJBS-UHFFFAOYSA-N 0.000 description 1
- YQWCBDNNEZHPMA-UHFFFAOYSA-N 1-(2-bromoethoxy)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(OCCBr)C=C1 YQWCBDNNEZHPMA-UHFFFAOYSA-N 0.000 description 1
- OBCFOPGCTNULTG-UHFFFAOYSA-N 1-(2-chloroethoxy)-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(OCCCl)C=C1 OBCFOPGCTNULTG-UHFFFAOYSA-N 0.000 description 1
- BHKKSKOHRFHHIN-MRVPVSSYSA-N 1-[[2-[(1R)-1-aminoethyl]-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one Chemical compound N[C@H](C)C1=C(CN2C(NC(C3=C2C=CN3)=O)=S)C=CC(=C1)Cl BHKKSKOHRFHHIN-MRVPVSSYSA-N 0.000 description 1
- YFZHODLXYNDBSM-UHFFFAOYSA-N 1-ethenyl-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(C=C)C=C1 YFZHODLXYNDBSM-UHFFFAOYSA-N 0.000 description 1
- AWOXUNCNGSHHSP-UHFFFAOYSA-N 1-nitro-4-propoxybenzene Chemical compound CCCOC1=CC=C([N+]([O-])=O)C=C1 AWOXUNCNGSHHSP-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- DWRCRRGPSNRDFV-UHFFFAOYSA-N 2-(2-chloroethoxy)-5-methylbenzamide Chemical compound CC1=CC=C(OCCCl)C(C(N)=O)=C1 DWRCRRGPSNRDFV-UHFFFAOYSA-N 0.000 description 1
- QXHDYMUPPXAMPQ-UHFFFAOYSA-N 2-(4-aminophenyl)ethanol Chemical compound NC1=CC=C(CCO)C=C1 QXHDYMUPPXAMPQ-UHFFFAOYSA-N 0.000 description 1
- SONHEJIGRVFZHK-UHFFFAOYSA-N 2-(4-nitrophenyl)-n-[2-(4-nitrophenyl)ethyl]ethanamine Chemical compound C1=CC([N+](=O)[O-])=CC=C1CCNCCC1=CC=C([N+]([O-])=O)C=C1 SONHEJIGRVFZHK-UHFFFAOYSA-N 0.000 description 1
- IOXOZOPLBFXYLM-UHFFFAOYSA-N 2-(4-nitrophenyl)ethanamine Chemical compound NCCC1=CC=C([N+]([O-])=O)C=C1 IOXOZOPLBFXYLM-UHFFFAOYSA-N 0.000 description 1
- JGTZFNHRHJAEMA-UHFFFAOYSA-N 2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethanol Chemical compound OCCN(C)CCC1=CC=C([N+]([O-])=O)C=C1 JGTZFNHRHJAEMA-UHFFFAOYSA-N 0.000 description 1
- 125000006012 2-chloroethoxy group Chemical group 0.000 description 1
- ZXNMIUJDTOMBPV-UHFFFAOYSA-N 2-chloroethyl 4-methylbenzenesulfonate Chemical compound CC1=CC=C(S(=O)(=O)OCCCl)C=C1 ZXNMIUJDTOMBPV-UHFFFAOYSA-N 0.000 description 1
- KZZMRVNBQQMFCQ-UHFFFAOYSA-N 3-(2-chloroethoxy)benzamide Chemical compound NC(=O)C1=CC=CC(OCCCl)=C1 KZZMRVNBQQMFCQ-UHFFFAOYSA-N 0.000 description 1
- CVQWYCCXJPYZQI-UHFFFAOYSA-N 4-(2-chloroethoxy)benzamide Chemical compound NC(=O)C1=CC=C(OCCCl)C=C1 CVQWYCCXJPYZQI-UHFFFAOYSA-N 0.000 description 1
- XPMZFKWAFWMRGF-UHFFFAOYSA-N 4-(2-chloroethoxy)benzoyl chloride Chemical compound ClCCOC1=CC=C(C(Cl)=O)C=C1 XPMZFKWAFWMRGF-UHFFFAOYSA-N 0.000 description 1
- NNIPOYNUFNLQMO-UHFFFAOYSA-N 4-[2-(methylamino)ethyl]aniline Chemical compound CNCCC1=CC=C(N)C=C1 NNIPOYNUFNLQMO-UHFFFAOYSA-N 0.000 description 1
- ZQAQLFCXTWCSPW-UHFFFAOYSA-N 4-[2-[2-(4-aminophenyl)ethyl-ethylamino]ethyl]aniline Chemical compound C=1C=C(N)C=CC=1CCN(CC)CCC1=CC=C(N)C=C1 ZQAQLFCXTWCSPW-UHFFFAOYSA-N 0.000 description 1
- MLSDRJAYBKIOPY-UHFFFAOYSA-N 4-[2-[2-(4-aminophenyl)ethyl-methylamino]ethyl]aniline Chemical compound C=1C=C(N)C=CC=1CCN(C)CCC1=CC=C(N)C=C1 MLSDRJAYBKIOPY-UHFFFAOYSA-N 0.000 description 1
- VWQARCBMWOJWOA-WLHGVMLRSA-N 4-amino-n-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]-2-ethoxy-5-nitrobenzamide;(e)-but-2-enedioic acid Chemical compound OC(=O)\C=C\C(O)=O.CCOC1=CC(N)=C([N+]([O-])=O)C=C1C(=O)NC1CCN(CC2CC=CCC2)CC1 VWQARCBMWOJWOA-WLHGVMLRSA-N 0.000 description 1
- AZEIRPAUJXANCS-UHFFFAOYSA-N 4-ethoxybenzamide Chemical compound CCOC1=CC=C(C(N)=O)C=C1 AZEIRPAUJXANCS-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- BOFRXDMCQRTGII-UHFFFAOYSA-N 619-08-9 Chemical compound OC1=CC=C([N+]([O-])=O)C=C1Cl BOFRXDMCQRTGII-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- LOCYDGBRHOXXSD-LLVKDONJSA-N CC[C@@H](O)NCCC1=CC=C(C=C1)[N+](=O)[O-] Chemical compound CC[C@@H](O)NCCC1=CC=C(C=C1)[N+](=O)[O-] LOCYDGBRHOXXSD-LLVKDONJSA-N 0.000 description 1
- UIKPNQOJHZYZIT-UHFFFAOYSA-N CN(C1=CC=C(C=C1)[N+](=O)[O-])C(COC1=CC=C(C=C1)[N+](=O)[O-])C Chemical compound CN(C1=CC=C(C=C1)[N+](=O)[O-])C(COC1=CC=C(C=C1)[N+](=O)[O-])C UIKPNQOJHZYZIT-UHFFFAOYSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- 208000020446 Cardiac disease Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- FURODZOLFBNSOO-UHFFFAOYSA-N Cl.Cl.NC1=CC=C(OCCN(CCC2=CC=C(C=C2)NS(=O)(=O)C)C)C=C1 Chemical compound Cl.Cl.NC1=CC=C(OCCN(CCC2=CC=C(C=C2)NS(=O)(=O)C)C)C=C1 FURODZOLFBNSOO-UHFFFAOYSA-N 0.000 description 1
- 102100036883 Cyclin-H Human genes 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 101000713120 Homo sapiens Cyclin-H Proteins 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 241000370541 Idia Species 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-L Phosphate ion(2-) Chemical compound OP([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-L 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 229910006124 SOCl2 Inorganic materials 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000004422 alkyl sulphonamide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- MMCPOSDMTGQNKG-UHFFFAOYSA-N anilinium chloride Chemical compound Cl.NC1=CC=CC=C1 MMCPOSDMTGQNKG-UHFFFAOYSA-N 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 238000003556 assay Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- SNIABFMMCKVXSY-UHFFFAOYSA-N benzoylazanium;chloride Chemical compound Cl.NC(=O)C1=CC=CC=C1 SNIABFMMCKVXSY-UHFFFAOYSA-N 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- MXWRJMIKMODSCY-UHFFFAOYSA-N ethane;dihydrochloride Chemical compound Cl.Cl.CC MXWRJMIKMODSCY-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 208000019622 heart disease Diseases 0.000 description 1
- 230000004217 heart function Effects 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 229960004592 isopropanol Drugs 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- OPWXJASBLYLBIH-UHFFFAOYSA-N n-[4-(2-chloroethoxy)phenyl]methanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=C(OCCCl)C=C1 OPWXJASBLYLBIH-UHFFFAOYSA-N 0.000 description 1
- MSZBIHITHNHHTL-UHFFFAOYSA-N n-[4-[2-(methylamino)ethyl]phenyl]methanesulfonamide Chemical compound CNCCC1=CC=C(NS(C)(=O)=O)C=C1 MSZBIHITHNHHTL-UHFFFAOYSA-N 0.000 description 1
- UCVBQUGRYKDHKP-UHFFFAOYSA-N n-[4-[2-[2-[4-(methanesulfonamido)phenyl]ethyl-methylamino]ethyl]phenyl]methanesulfonamide Chemical compound C=1C=C(NS(C)(=O)=O)C=CC=1CCN(C)CCC1=CC=C(NS(C)(=O)=O)C=C1 UCVBQUGRYKDHKP-UHFFFAOYSA-N 0.000 description 1
- FQIGLZCWEICMCI-UHFFFAOYSA-N n-[4-[2-[methyl-[2-(4-nitrophenyl)ethyl]amino]ethoxy]phenyl]methanesulfonamide Chemical compound C=1C=C([N+]([O-])=O)C=CC=1CCN(C)CCOC1=CC=C(NS(C)(=O)=O)C=C1 FQIGLZCWEICMCI-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- LBTPIFQNEKOAIM-UHFFFAOYSA-N n-phenylmethanesulfonamide Chemical compound CS(=O)(=O)NC1=CC=CC=C1 LBTPIFQNEKOAIM-UHFFFAOYSA-N 0.000 description 1
- 230000000926 neurological effect Effects 0.000 description 1
- 210000002445 nipple Anatomy 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 238000011176 pooling Methods 0.000 description 1
- 230000009090 positive inotropic effect Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 229910052705 radium Inorganic materials 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 210000005241 right ventricle Anatomy 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- 229910052701 rubidium Inorganic materials 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000004611 spectroscopical analysis Methods 0.000 description 1
- 235000013599 spices Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000004936 stimulating effect Effects 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
- C07C311/21—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings having the nitrogen atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/182—Radicals derived from carboxylic acids
- C07D295/192—Radicals derived from carboxylic acids from aromatic carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C235/00—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms
- C07C235/02—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton
- C07C235/04—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated
- C07C235/18—Carboxylic acid amides, the carbon skeleton of the acid part being further substituted by oxygen atoms having carbon atoms of carboxamide groups bound to acyclic carbon atoms and singly-bound oxygen atoms bound to the same carbon skeleton the carbon skeleton being acyclic and saturated having at least one of the singly-bound oxygen atoms further bound to a carbon atom of a six-membered aromatic ring, e.g. phenoxyacetamides
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Hydrogenated Pyridines (AREA)
- Steroid Compounds (AREA)
- Pyrrole Compounds (AREA)
- Saccharide Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Polyamides (AREA)
- Vehicle Interior And Exterior Ornaments, Soundproofing, And Insulation (AREA)
- Medicines Containing Plant Substances (AREA)
- Cephalosporin Compounds (AREA)
- Lubricants (AREA)
- Manufacturing Of Micro-Capsules (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Fats And Perfumes (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB868610668A GB8610668D0 (en) | 1986-05-01 | 1986-05-01 | Anti-arrhythmia agents |
| GB8610668 | 1986-05-01 | ||
| GB8630059 | 1986-12-17 | ||
| GB868630059A GB8630059D0 (en) | 1986-12-17 | 1986-12-17 | Antiarrhythmic agents |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI871898A0 FI871898A0 (fi) | 1987-04-29 |
| FI871898A7 FI871898A7 (fi) | 1987-11-02 |
| FI88291B FI88291B (fi) | 1993-01-15 |
| FI88291C true FI88291C (fi) | 1993-04-26 |
Family
ID=26290703
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI871898A FI88291C (fi) | 1986-05-01 | 1987-04-29 | Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara foereningar och mellanprodukter vid deras framstaellning |
Country Status (27)
| Country | Link |
|---|---|
| US (2) | US4959366A (OSRAM) |
| EP (1) | EP0245997B1 (OSRAM) |
| KR (2) | KR870011084A (OSRAM) |
| CN (1) | CN1019801B (OSRAM) |
| AT (1) | ATE74906T1 (OSRAM) |
| AU (1) | AU578557B2 (OSRAM) |
| BA (2) | BA98211B1 (OSRAM) |
| CA (1) | CA1289140C (OSRAM) |
| DE (2) | DE10075004I2 (OSRAM) |
| DK (1) | DK175096B1 (OSRAM) |
| EG (1) | EG18188A (OSRAM) |
| ES (1) | ES2033840T3 (OSRAM) |
| FI (1) | FI88291C (OSRAM) |
| GR (1) | GR3004457T3 (OSRAM) |
| HU (1) | HU196743B (OSRAM) |
| IE (1) | IE59366B1 (OSRAM) |
| IL (1) | IL82373A (OSRAM) |
| LU (1) | LU90519I2 (OSRAM) |
| LV (1) | LV5715B4 (OSRAM) |
| MY (1) | MY111142A (OSRAM) |
| NL (1) | NL300002I2 (OSRAM) |
| NO (2) | NO168527C (OSRAM) |
| NZ (1) | NZ220151A (OSRAM) |
| PH (1) | PH23425A (OSRAM) |
| PL (1) | PL149924B1 (OSRAM) |
| PT (1) | PT84782B (OSRAM) |
| YU (2) | YU46195B (OSRAM) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5602174A (en) * | 1986-02-15 | 1997-02-11 | Beecham Wuefling Gmbh & Co. | Treatment |
| NL8700842A (OSRAM) * | 1987-04-10 | 1988-11-01 | Duphar Int Res | |
| SE8705150D0 (sv) * | 1987-12-23 | 1987-12-23 | Haessle Ab | Novel antiarrhythmic agents |
| US4906634A (en) * | 1988-03-08 | 1990-03-06 | Schering A.G. | Novel N-[4-(aminosubstituted)phenyl]methanesulfonamides and their use as cardiovascular agents |
| GB8809314D0 (en) * | 1988-04-20 | 1988-05-25 | Wellcome Found | Anti-hypertensive sulfonanilides |
| GB8819307D0 (en) * | 1988-08-13 | 1988-09-14 | Pfizer Ltd | Antiarrhythmic agents |
| US5166209A (en) * | 1989-04-21 | 1992-11-24 | Burroughs Wellcome Co. | Pharmacologically active compounds |
| AU641394B2 (en) * | 1989-06-02 | 1993-09-23 | John Wyeth & Brother Limited | Amines |
| US5084463A (en) * | 1989-12-11 | 1992-01-28 | American Home Products Corporation | N-quinolinyl alkyl-substituted 1-aryloxy-2-propanolamine and propylamine derivatives possessing class III antiarrhythmic activity |
| IL106549A0 (en) * | 1992-07-31 | 1993-12-08 | Syntex Inc | Heterocyclic derivatives,their preparation and pharmaceutical compositions containing them |
| US5451677A (en) * | 1993-02-09 | 1995-09-19 | Merck & Co., Inc. | Substituted phenyl sulfonamides as selective β 3 agonists for the treatment of diabetes and obesity |
| GB9404485D0 (en) * | 1994-03-09 | 1994-04-20 | Cancer Res Campaign Tech | Benzamide analogues |
| DE4422517A1 (de) * | 1994-06-28 | 1996-01-04 | Dresden Arzneimittel | Neue (2-(3,4-Dimethoxy-phenyl)-ethyl)-(2-phenoxy-ethyl)-amine, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE69531691T2 (de) * | 1994-08-04 | 2004-07-08 | C & C Research Labs | Neues amin-derivat, verfahren zur herstellung und dessen verwendung als anti-arrhythmisches mittel |
| EP0697407B1 (en) | 1994-08-19 | 1997-06-25 | MITSUI TOATSU CHEMICALS, Inc. | Pyrimidinedione derivatives and antiarrhythmic compositions containing same |
| US5679706A (en) * | 1994-09-30 | 1997-10-21 | Bristol-Myers Squibb Company | Combination of a potassium channel activator and an antiarrhythmic agent |
| FR2726267B1 (fr) * | 1994-10-26 | 1998-01-02 | Smithkline Beecham Lab | Nouveaux agents anti-arythmiques, compositions pharmaceutiques les contenant, et procede pour les preparer |
| CN1055679C (zh) * | 1995-12-06 | 2000-08-23 | 中国药科大学 | 具有心血管活性的苯乙胺衍生物 |
| CN1055682C (zh) * | 1995-12-06 | 2000-08-23 | 中国药科大学 | 甲磺酰胺基苯乙胺衍生物的新制备方法 |
| GB9722662D0 (en) * | 1997-10-27 | 1997-12-24 | Pfizer Ltd | Polymorphs |
| HUP9702411A2 (hu) * | 1997-12-11 | 2000-03-28 | Gyógyszerkutató Intézet Kft. | Fenoxi-alkil-amin-származékok és a vegyületeket tartalmazó antiaritmiás hatású gyógyszerkészítmények |
| WO2002072542A2 (en) * | 2001-03-08 | 2002-09-19 | Emory University | Ph-dependent nmda receptor antagonists |
| CN100358865C (zh) * | 2001-07-30 | 2008-01-02 | 中国科学院上海药物研究所 | 一类磺酰胺苯烷胺类化合物及其制备方法和用途 |
| DE10201550A1 (de) * | 2002-01-17 | 2003-07-31 | Merck Patent Gmbh | Phenoxy-Piperidine |
| AU2002357560A1 (en) * | 2002-04-26 | 2003-11-10 | Shanghai Institute Of Materia Medica, Chinese Academy Of Sciences | Sulfamidophenylalkylamines and their production and use |
| US7704993B2 (en) * | 2003-06-17 | 2010-04-27 | Arena Pharmaceuticals, Inc. | Benzazepine derivatives and methods of prophylaxis or treatment of 5ht2c receptor associated diseases |
| MXPA05013364A (es) * | 2003-06-17 | 2006-03-17 | Arena Pharm Inc | Procedimiento para preparar 3-benzazepinas. |
| DE102004025726B4 (de) * | 2004-05-26 | 2006-07-06 | Roder, Hanno, Dr. | Verwendung eines spezifischen K252a-Derivats zur Verhinderung oder Behandlung der Alzheimerschen Krankheit |
| ATE544455T1 (de) * | 2006-12-14 | 2012-02-15 | Tautatis Inc | Zusammensetzungen und verfahren für die krebsbehandlung |
| CN103058957A (zh) | 2007-06-29 | 2013-04-24 | 埃莫里大学 | 用于神经保护的nmda受体拮抗剂 |
| CN101372467B (zh) * | 2007-08-23 | 2011-09-14 | 明德国际仓储贸易(上海)有限公司 | 具有n,n-二烷氨基的桥基化合物及所应用的染料化合物 |
| US8822727B2 (en) | 2008-03-04 | 2014-09-02 | Arena Pharmaceuticals, Inc. | Processes for the preparation of intermediates related to the 5-HT2C agonist (R)-8-chloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
| WO2010148207A2 (en) | 2009-06-18 | 2010-12-23 | Arena Pharmaceuticals, Inc. | Processes for the preparation of 5-ht2c receptor agonists |
| KR20130112848A (ko) | 2010-06-02 | 2013-10-14 | 아레나 파마슈티칼스, 인크. | 5-ht2c 수용체 아고니스트의 제조 방법 |
| SG188361A1 (en) | 2010-09-01 | 2013-04-30 | Arena Pharm Inc | Non-hygroscopic salts of 5-ht2c agonists |
| KR20130138770A (ko) | 2010-09-01 | 2013-12-19 | 아레나 파마슈티칼스, 인크. | 광학적으로 활성 산을 갖는 로르카세린의 염 |
| US8999970B2 (en) | 2010-09-01 | 2015-04-07 | Arena Pharmaceuticals, Inc. | Administration of an anti-obesity compound to individuals with renal impairment |
| CN102531946A (zh) * | 2012-01-05 | 2012-07-04 | 山东大学 | 3-甲氧基苯甲酰胺衍生物及其制备方法与应用 |
| CA2886875A1 (en) | 2012-10-09 | 2014-04-17 | Arena Pharmaceuticals, Inc. | Method of weight management |
| FR3029113A1 (fr) | 2014-12-02 | 2016-06-03 | Univ Paris-Sud | Composes pour le traitement des maladies mitochondriales |
| CZ307826B6 (cs) * | 2017-12-01 | 2019-05-29 | Farmak, A.S. | Způsob přípravy N-[4-(2-{[2-(4-methansulfonamidofenoxy)ethyl](methyl)amino}ethyl)fenyl]methansulfonamidu (Dofetilidu) |
| US10888524B2 (en) | 2018-02-05 | 2021-01-12 | Enaltec Pharma Research Pvt. Ltd. | Immediate release tablet of dofetilide |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR977261A (fr) * | 1948-11-04 | 1951-03-29 | équilibrage des masses dans les moteurs à combustion interne | |
| US3478149A (en) * | 1962-01-24 | 1969-11-11 | Mead Johnson & Co | Therapeutic compositions and methods employing sulfonamidophenethanolamines |
| GB993584A (OSRAM) * | 1962-01-24 | |||
| US3852468A (en) * | 1967-02-27 | 1974-12-03 | Ici Ltd | Alkanolamine derivatives as {62 -adrenergic blocking agents |
| US3574741A (en) * | 1969-04-14 | 1971-04-13 | Mead Johnson & Co | Sulfonamidophenalkylamines |
| US3758692A (en) * | 1969-04-14 | 1973-09-11 | Mead Johnson & Co | Ylamines sympathomimetic process and compositions employing sulfonamidophenalk |
| GB1263987A (en) * | 1969-05-30 | 1972-02-16 | Allen & Hanburys Ltd | Phenethylamine derivatives |
| BE757005A (fr) * | 1969-10-02 | 1971-04-02 | Bristol Myers Co | Phenethanolamines substituees et procede pour leur preparation |
| GB1301134A (en) * | 1970-07-18 | 1972-12-29 | Pfizer Ltd | SUBSTITUTED 1-PHENYL-2-ALLYLAMINO-ALKANOLS, 1-PHENYL-2-ALLYLAMINO-ALKANES AND alpha-AMINOALKYLPHENYL KETONES |
| DE2965655D1 (en) * | 1978-06-28 | 1983-07-21 | Beecham Group Plc | Secondary amines, their preparation, pharmaceutical compositions containing them and their use |
| DK268579A (da) * | 1978-07-03 | 1980-01-04 | Lilly Co Eli | Fremgangsmaade til fremstilling af phenetamolaminer |
| DE3061205D1 (en) * | 1979-06-16 | 1983-01-05 | Beecham Group Plc | Secondary amines, their preparation and use in pharmaceutical compositions |
| DD202692A5 (de) * | 1979-12-04 | 1983-09-28 | Ciba Geigy | Verfahren zur herstellung neuer derivate des 2-amino-aethanols |
| FR2541999B1 (fr) * | 1983-03-04 | 1986-09-19 | Bristol Myers Co | Phenethanolamines et leurs utilisations |
| DE3566886D1 (en) * | 1984-05-04 | 1989-01-26 | Upjohn Co | N-(aminoalkylphenyl)sulfonamides their preparation and therapeutic use |
| US4569801A (en) * | 1984-10-15 | 1986-02-11 | Eli Lilly And Company | Alkylsulfonamidophenylalkylamines |
-
1987
- 1987-04-19 EG EG230/87A patent/EG18188A/xx active
- 1987-04-24 PH PH35179A patent/PH23425A/en unknown
- 1987-04-27 MY MYPI87000548A patent/MY111142A/en unknown
- 1987-04-29 AT AT87303782T patent/ATE74906T1/de active
- 1987-04-29 US US07/044,086 patent/US4959366A/en not_active Expired - Lifetime
- 1987-04-29 DE DE2000175004 patent/DE10075004I2/de active Active
- 1987-04-29 EP EP87303782A patent/EP0245997B1/en not_active Expired - Lifetime
- 1987-04-29 PL PL1987265418A patent/PL149924B1/pl unknown
- 1987-04-29 ES ES198787303782T patent/ES2033840T3/es not_active Expired - Lifetime
- 1987-04-29 CA CA000535897A patent/CA1289140C/en not_active Expired - Lifetime
- 1987-04-29 DE DE8787303782T patent/DE3778201D1/de not_active Expired - Lifetime
- 1987-04-29 FI FI871898A patent/FI88291C/fi not_active IP Right Cessation
- 1987-04-29 IL IL82373A patent/IL82373A/xx not_active IP Right Cessation
- 1987-04-29 PT PT84782A patent/PT84782B/pt unknown
- 1987-04-30 NZ NZ220151A patent/NZ220151A/xx unknown
- 1987-04-30 AU AU72260/87A patent/AU578557B2/en not_active Expired
- 1987-04-30 DK DK198702202A patent/DK175096B1/da active Protection Beyond IP Right Term
- 1987-04-30 HU HU871971A patent/HU196743B/hu unknown
- 1987-04-30 YU YU78387A patent/YU46195B/sh unknown
- 1987-04-30 KR KR870004213A patent/KR870011084A/ko not_active Ceased
- 1987-04-30 NO NO871820A patent/NO168527C/no not_active IP Right Cessation
- 1987-05-01 CN CN87103300A patent/CN1019801B/zh not_active Expired
- 1987-05-11 IE IE116587A patent/IE59366B1/en not_active IP Right Cessation
-
1988
- 1988-04-12 YU YU73588A patent/YU46541B/sh unknown
-
1990
- 1990-06-20 US US07/541,232 patent/US5079248A/en not_active Expired - Lifetime
- 1990-12-07 KR KR1019900020068A patent/KR930001339B1/ko not_active Expired - Lifetime
-
1992
- 1992-04-29 GR GR920400823T patent/GR3004457T3/el unknown
-
1995
- 1995-03-15 LV LV950058A patent/LV5715B4/xx unknown
-
1998
- 1998-03-30 BA BA980211A patent/BA98211B1/bs active
- 1998-03-30 BA BA980301A patent/BA98301A/bs unknown
-
2000
- 2000-02-01 NL NL300002C patent/NL300002I2/nl unknown
- 2000-02-09 LU LU90519C patent/LU90519I2/fr unknown
-
2001
- 2001-06-26 NO NO2001011C patent/NO2001011I1/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI88291B (fi) | Analogifoerfarande foer framstaellning av terapeutiskt anvaendbara foereningar och mellanprodukter vid deras framstaellning | |
| EP0158775B1 (en) | Substituted sulfonamidobenzamides, antiarrythmic agents and compositions thereof | |
| US4122255A (en) | Substituted amides and sulfonamides containing a heterocyclic group having antiinflammatory activity | |
| EP0164865B1 (en) | N-(aminoalkylphenyl)sulfonamides their preparation and therapeutic use | |
| ES2288988T3 (es) | Antagonistas de benzamida-neurokinina ciclados para su uso en terapia. | |
| RU2052452C1 (ru) | Амидиновые производные бензола и их фармацевтически приемлемые соли | |
| IL98029A (en) | Guanidine analogs process for their preparation and pharmaceutical compositions containing them | |
| JP2006022106A (ja) | Hivプロテアーゼ阻害剤としてのn−(3−アミノ−2−ヒドロキシブチル)スルホンアミド誘導体 | |
| NO882554L (no) | Fremgangsmaate ved fremstilling av n-(aryl-, aryloxy-, arylthio-arylsulfinyl- og arylsulfonyl-)alkyl-n,n'-(eller n'n')-aklylamino-alkylureaer og cyanoguanidiner. | |
| JPH0360814B2 (OSRAM) | ||
| JPH0694448B2 (ja) | 新規なナフタレンアミドおよびナフタレンスルホンアミド化合物 | |
| KR20010043546A (ko) | 도파민 수용체로서 유용한 페닐술폰아미드-페닐에틸아민 | |
| US5023378A (en) | Amine derivatives | |
| KR20030024919A (ko) | N-(3,5-디클로로-2-메톡시페닐)-4-메톡시-3-피페라진-1-일-벤젠술폰아미드 | |
| WO2007052831A1 (en) | Preventives/remedies for urinary disturbance | |
| US4597902A (en) | N-(arylthioalkyl)-N'-(aminoalkyl)ureas | |
| EP0132267B1 (en) | Aromatic amines | |
| NZ200668A (en) | N-(aryloxyalkyl)-n'-(aminoalkyl)-thioureas and ureas;pharmaceutical compositions containing them | |
| KR890001811B1 (ko) | N-(아릴티오알킬)-n'-(아미노알킬)우레아 및 이의 제조방법 | |
| DK169328B1 (da) | Indolcarboxamidderivater, deres fremstilling samt farmaceutiske præparater med indhold deraf | |
| KR960005793B1 (ko) | 부정맥 치료제 | |
| EP0223598B1 (en) | Catecholamine derivatives, processes for their preparation and pharmaceutical compositions thereof | |
| HUP0001189A2 (hu) | Heteroaril-oxi-etil-amin-származékok, eljárás előállításukra, alkalmazásuk gyógyszerek előállítására és ilyen származékokat tartalmazó gyógyászati készítmények | |
| EP0559569A1 (en) | Central nervous system antiischemic agents | |
| HK1002276A1 (en) | Diaminocyclobutene-3, 4-diones |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BB | Publication of examined application | ||
| SPCG | Supplementary protection certificate granted |
Spc suppl protection certif: L166 Extension date: 20120428 |
|
| FG | Patent granted |
Owner name: PFIZER LIMITED |
|
| MA | Patent expired |