DK169476B1 - Carbapenemderivater og fremgangsmåde til fremstilling deraf samt midler indeholdende dem - Google Patents
Carbapenemderivater og fremgangsmåde til fremstilling deraf samt midler indeholdende dem Download PDFInfo
- Publication number
- DK169476B1 DK169476B1 DK138885A DK138885A DK169476B1 DK 169476 B1 DK169476 B1 DK 169476B1 DK 138885 A DK138885 A DK 138885A DK 138885 A DK138885 A DK 138885A DK 169476 B1 DK169476 B1 DK 169476B1
- Authority
- DK
- Denmark
- Prior art keywords
- compound
- formula
- group
- defined above
- compounds
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 24
- 238000002360 preparation method Methods 0.000 title claims description 7
- YZBQHRLRFGPBSL-RXMQYKEDSA-N carbapenem Chemical class C1C=CN2C(=O)C[C@H]21 YZBQHRLRFGPBSL-RXMQYKEDSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 184
- 150000003839 salts Chemical class 0.000 claims abstract description 29
- 150000002148 esters Chemical class 0.000 claims abstract description 24
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- -1 pyrrolidylmethyl group Chemical group 0.000 claims description 53
- 125000006239 protecting group Chemical group 0.000 claims description 24
- 125000001424 substituent group Chemical group 0.000 claims description 17
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 15
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 13
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical class OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 claims description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 11
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 5
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 239000003242 anti bacterial agent Substances 0.000 claims description 5
- 125000002837 carbocyclic group Chemical group 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 229910052757 nitrogen Inorganic materials 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 3
- 125000004423 acyloxy group Chemical group 0.000 claims description 3
- 125000006615 aromatic heterocyclic group Chemical group 0.000 claims description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 3
- 125000004076 pyridyl group Chemical group 0.000 claims description 3
- 238000009938 salting Methods 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 230000032050 esterification Effects 0.000 claims description 2
- 238000005886 esterification reaction Methods 0.000 claims description 2
- 150000002912 oxalic acid derivatives Chemical class 0.000 claims description 2
- 238000007911 parenteral administration Methods 0.000 claims description 2
- 125000004986 diarylamino group Chemical group 0.000 claims 1
- 239000008177 pharmaceutical agent Substances 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract description 5
- 230000003115 biocidal effect Effects 0.000 abstract description 2
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 2
- 125000000962 organic group Chemical group 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 57
- 239000000203 mixture Substances 0.000 description 14
- 239000000047 product Substances 0.000 description 14
- 239000002904 solvent Substances 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 238000000862 absorption spectrum Methods 0.000 description 12
- 239000002253 acid Substances 0.000 description 11
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 10
- WKDDRNSBRWANNC-ATRFCDNQSA-N Thienamycin Chemical compound C1C(SCCN)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 WKDDRNSBRWANNC-ATRFCDNQSA-N 0.000 description 10
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 230000000844 anti-bacterial effect Effects 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 6
- 150000007513 acids Chemical class 0.000 description 6
- 230000002411 adverse Effects 0.000 description 6
- 125000003710 aryl alkyl group Chemical group 0.000 description 6
- 150000004820 halides Chemical class 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 5
- 238000007086 side reaction Methods 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- OKKJLVBELUTLKV-MZCSYVLQSA-N Deuterated methanol Chemical compound [2H]OC([2H])([2H])[2H] OKKJLVBELUTLKV-MZCSYVLQSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 125000001188 haloalkyl group Chemical group 0.000 description 4
- 125000006503 p-nitrobenzyl group Chemical class [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- VNDWQCSOSCCWIP-UHFFFAOYSA-N 2-tert-butyl-9-fluoro-1,6-dihydrobenzo[h]imidazo[4,5-f]isoquinolin-7-one Chemical compound C1=2C=CNC(=O)C=2C2=CC(F)=CC=C2C2=C1NC(C(C)(C)C)=N2 VNDWQCSOSCCWIP-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- 241000588747 Klebsiella pneumoniae Species 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- BHIIGRBMZRSDRI-UHFFFAOYSA-N [chloro(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(Cl)OC1=CC=CC=C1 BHIIGRBMZRSDRI-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 3
- 125000003460 beta-lactamyl group Chemical group 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 229910052799 carbon Inorganic materials 0.000 description 3
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 150000002431 hydrogen Chemical class 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000000039 preparative column chromatography Methods 0.000 description 3
- 238000012746 preparative thin layer chromatography Methods 0.000 description 3
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 3
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 238000011084 recovery Methods 0.000 description 3
- 230000002829 reductive effect Effects 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- GUGYCHHWTVUBLV-MSECNUKYSA-N (4-nitrophenyl)methyl (4r,5r,6s)-6-[(1r)-1-hydroxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C([C@H](C)[C@@H]1[C@H](C(N11)=O)[C@H](O)C)C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 GUGYCHHWTVUBLV-MSECNUKYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 2
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-Dimethylaminopyridine Chemical compound CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 241000588914 Enterobacter Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 2
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 2
- 241000607715 Serratia marcescens Species 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 241000191940 Staphylococcus Species 0.000 description 2
- 125000000783 acetimidoyl group Chemical group C(C)(=N)* 0.000 description 2
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 2
- 150000008041 alkali metal carbonates Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003125 aqueous solvent Substances 0.000 description 2
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 2
- 244000000010 microbial pathogen Species 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 231100000989 no adverse effect Toxicity 0.000 description 2
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam Chemical compound S1CCN2C(=O)C[C@H]21 WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 2
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000001226 reprecipitation Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- YDNLYFHCOQCNAX-NSHDSACASA-N (4-nitrophenyl)methyl (2s)-2-sulfanylpyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1[C@@H](S)CCC1 YDNLYFHCOQCNAX-NSHDSACASA-N 0.000 description 1
- GUGYCHHWTVUBLV-YMSISWDFSA-N (4-nitrophenyl)methyl (4s,5r,6s)-6-[(1r)-1-hydroxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C([C@@H](C)[C@@H]1[C@H](C(N11)=O)[C@H](O)C)C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 GUGYCHHWTVUBLV-YMSISWDFSA-N 0.000 description 1
- OMNBOJZYEQDPET-SPFKKGSWSA-N (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[(3S)-pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O[C@H](C)[C@@H]1[C@H]2N(C(=C([C@@H]2C)S[C@@H]2CNCC2)C(=O)O)C1=O OMNBOJZYEQDPET-SPFKKGSWSA-N 0.000 description 1
- WKDDRNSBRWANNC-NAJVVJGSSA-N (5R)-3-(2-aminoethylsulfanyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical group NCCSC=1C[C@H]2N(C=1C(=O)O)C(C2C(C)O)=O WKDDRNSBRWANNC-NAJVVJGSSA-N 0.000 description 1
- NZOABRUICAKEBQ-ZCANUTGISA-N (5S)-3-(1-ethanimidoylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(C)(=N)N1CC(CC1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C NZOABRUICAKEBQ-ZCANUTGISA-N 0.000 description 1
- CZTNBAQKRCYUNJ-BIOWIUNJSA-N (5S)-3-(5-carbamoyl-1-methanimidoylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(N)(=O)C1CC(CN1C=N)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C CZTNBAQKRCYUNJ-BIOWIUNJSA-N 0.000 description 1
- NBHAGEJNXNTILI-ZHSWCQHASA-N (5S)-3-[1-(C,N-dimethylcarbonimidoyl)pyrrolidin-3-yl]sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(C)C1[C@@H]2N(C(=C(C2C)SC2CN(CC2)C(C)=NC)C(=O)O)C1=O NBHAGEJNXNTILI-ZHSWCQHASA-N 0.000 description 1
- YAEPLZUUZBOKBA-LZTKIECASA-N (5S)-6-(1-hydroxyethyl)-3-(1-methanimidoylpyrrolidin-3-yl)sulfanyl-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(=N)N1CC(CC1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C YAEPLZUUZBOKBA-LZTKIECASA-N 0.000 description 1
- HAJPZDAQTUTSOG-MGEHAVSKSA-N (5S)-6-(1-hydroxyethyl)-4-methyl-3-[1-(methyliminomethyl)pyrrolidin-3-yl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(C)C1[C@@H]2N(C(=C(C2C)SC2CN(CC2)C=NC)C(=O)O)C1=O HAJPZDAQTUTSOG-MGEHAVSKSA-N 0.000 description 1
- AFDWHHLMBXUFMS-YXOKVQKXSA-N (5S)-6-(1-hydroxyethyl)-4-methyl-7-oxo-3-(1-propanimidoylpyrrolidin-3-yl)sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(C)C1[C@@H]2N(C(=C(C2C)SC2CN(CC2)C(CC)=N)C(=O)O)C1=O AFDWHHLMBXUFMS-YXOKVQKXSA-N 0.000 description 1
- FJHCCIDZXFURDK-NYDSMTGUSA-N (5S)-6-(1-hydroxyethyl)-4-methyl-7-oxo-3-[1-(pyridine-3-carboximidoyl)pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound OC(C)C1[C@@H]2N(C(=C(C2C)SC2CN(CC2)C(C2=CN=CC=C2)=N)C(=O)O)C1=O FJHCCIDZXFURDK-NYDSMTGUSA-N 0.000 description 1
- KGENPKAWPRUNIG-UHFFFAOYSA-N 1-[chloro(ethyl)phosphoryl]ethane Chemical compound CCP(Cl)(=O)CC KGENPKAWPRUNIG-UHFFFAOYSA-N 0.000 description 1
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607762 Shigella flexneri Species 0.000 description 1
- 241000147000 Shigella flexneri 2a Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000191967 Staphylococcus aureus Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- OMOPIAOKQJWPEF-UHFFFAOYSA-N [bromo(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(Br)C1=CC=CC=C1 OMOPIAOKQJWPEF-UHFFFAOYSA-N 0.000 description 1
- CVNMBKFJYRAHPO-UHFFFAOYSA-N [chloro(methyl)phosphoryl]methane Chemical compound CP(C)(Cl)=O CVNMBKFJYRAHPO-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000005042 acyloxymethyl group Chemical group 0.000 description 1
- 125000001980 alanyl group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 238000002512 chemotherapy Methods 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical compound [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical class C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 230000001351 cycling effect Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 125000004216 fluoromethyl group Chemical group [H]C([H])(F)* 0.000 description 1
- 125000003630 glycyl group Chemical group [H]N([H])C([H])([H])C(*)=O 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005179 haloacetyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000004468 heterocyclylthio group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 239000008194 pharmaceutical composition Substances 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- 239000008055 phosphate buffer solution Substances 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 150000003018 phosphorus compounds Chemical class 0.000 description 1
- 125000005633 phthalidyl group Chemical group 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 238000004237 preparative chromatography Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000005389 trialkylsiloxy group Chemical group 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- SJHCUXCOGGKFAI-UHFFFAOYSA-N tripropan-2-yl phosphite Chemical compound CC(C)OP(OC(C)C)OC(C)C SJHCUXCOGGKFAI-UHFFFAOYSA-N 0.000 description 1
- QOPBTFMUVTXWFF-UHFFFAOYSA-N tripropyl phosphite Chemical compound CCCOP(OCCC)OCCC QOPBTFMUVTXWFF-UHFFFAOYSA-N 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 150000003952 β-lactams Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/10—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D477/12—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6
- C07D477/16—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6 with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 3
- C07D477/20—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/26—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 4
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Compounds Of Unknown Constitution (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5927984 | 1984-03-27 | ||
| JP59059279A JPS60202886A (ja) | 1984-03-27 | 1984-03-27 | 1―置換カルバペネム―3―カルボン酸誘導体 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK138885D0 DK138885D0 (da) | 1985-03-27 |
| DK138885A DK138885A (da) | 1985-09-28 |
| DK169476B1 true DK169476B1 (da) | 1994-11-07 |
Family
ID=13108786
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK138885A DK169476B1 (da) | 1984-03-27 | 1985-03-27 | Carbapenemderivater og fremgangsmåde til fremstilling deraf samt midler indeholdende dem |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US5102997A (enExample) |
| EP (1) | EP0160391B1 (enExample) |
| JP (1) | JPS60202886A (enExample) |
| KR (1) | KR910010049B1 (enExample) |
| AT (1) | ATE86255T1 (enExample) |
| AU (1) | AU582148B2 (enExample) |
| DE (1) | DE3587126T2 (enExample) |
| DK (1) | DK169476B1 (enExample) |
| ES (2) | ES8702912A1 (enExample) |
| FI (1) | FI83419C (enExample) |
| HU (1) | HU196800B (enExample) |
| IE (1) | IE59708B1 (enExample) |
| NO (1) | NO164980C (enExample) |
| NZ (1) | NZ211604A (enExample) |
| PH (1) | PH25057A (enExample) |
| SU (2) | SU1501922A3 (enExample) |
| ZA (1) | ZA852251B (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1283906C (en) * | 1983-05-09 | 1991-05-07 | Makoto Sunagawa | .beta.-LACTAM COMPOUNDS AND PRODUCTION THEREOF |
| US4696923A (en) * | 1984-04-23 | 1987-09-29 | Merck & Co., Inc. | 6-[1-hydroxyethyl]-2-SR8 -1-methyl-1-carbadethiapen-2-em-3-carboxylic acids |
| US4665169A (en) * | 1985-09-11 | 1987-05-12 | Bristol-Myers Company | Carbapenem antibiotics |
| JPS6363680A (ja) * | 1986-09-05 | 1988-03-22 | Nippon Redarii Kk | (1r)−1−メチルカルバペネム−3−カルボン酸誘導体 |
| KR880006244A (ko) * | 1986-11-24 | 1988-07-22 | 후지사와 도모 기찌 로 | 3-피롤리디닐티오-1-아자바이스클로[3.2.0]햅트2-엔-2-카르복실산 화합물 및 이의 제조방법 |
| ES2053508T3 (es) * | 1986-11-24 | 1994-08-01 | Fujisawa Pharmaceutical Co | Compuestos de acidos 3-pirrolidinil-tio-1-azabiciclo(3.2.0)hept-2-eno-2-carboxilicos. |
| JPS63255280A (ja) * | 1987-04-11 | 1988-10-21 | Nippon Redarii Kk | (1r,5s,6s)−2−置換−6−〔(r)−1−ヒドロキシエチル〕−1−メチル−カルバペネム−3−カルボン酸誘導体 |
| US4925838A (en) * | 1988-03-18 | 1990-05-15 | Fujisawa Pharmaceutical Company, Ltd. | 3-pyrrolidinylthio-1-azabicyclo[3.2.0]-hept-2-ene-2-carboxylic acid compounds |
| US5242914A (en) * | 1988-04-01 | 1993-09-07 | Sankyo Company, Limited | 2-(heterocyclylthio) carbapenem derivatives, their preparation and their use as antibiotics |
| ES2067534T3 (es) * | 1988-04-01 | 1995-04-01 | Sankyo Co | Derivados de 2-(heterocicliltio)carbapenemo, su preparacion y su aplicacion como antibioticos. |
| GB8811237D0 (en) * | 1988-05-12 | 1988-06-15 | Fujisawa Pharmaceutical Co | 3-pyrrolidinylthio-1-azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid derivatives |
| US4963544A (en) * | 1988-05-23 | 1990-10-16 | Fujisawa Pharmaceutical Company, Ltd. | 3-pyrrolidinylthio-1-azabicyclo[3.2.0]-hept-2-ene-2-carboxylic acid compounds |
| CA2022382A1 (en) * | 1989-08-02 | 1991-02-03 | Susumu Nakagawa | Piperidylthiocarbapenem derivatives |
| GB8923844D0 (en) * | 1989-10-23 | 1989-12-13 | Fujisawa Pharmaceutical Co | Carbapenem compounds |
| FI96311C (fi) * | 1989-12-04 | 1996-06-10 | Squibb Bristol Myers Co | Menetelmä farmaseuttisesti käyttökelpoisten 6-(1-hydroksietyyli)-3-(substituoitu tio)-7-okso-1-atsabisyklo/3.2.0/hept-2-eeni-2-karboksyylihappojohdannaisten valmistamiseksi |
| WO1991009860A1 (fr) * | 1989-12-28 | 1991-07-11 | Banyu Pharmaceutical Co., Ltd. | Nouveau derive de carbapenem |
| US5672701A (en) * | 1990-01-16 | 1997-09-30 | Bristol-Myers Squibb Company | 4-substituted alkyl carbapenem antibiotics |
| US5554606A (en) * | 1990-03-12 | 1996-09-10 | Zeneca Limited | Antibiotic compounds |
| US5208348A (en) * | 1990-09-07 | 1993-05-04 | Tanabe Seiyaku Co., Ltd. | Mercaptan compound |
| CA2050255C (en) * | 1990-09-07 | 1997-02-04 | Tameo Iwasaki | 1-methylcarbapenem derivatives and process for preparation thereof |
| GB9107341D0 (en) * | 1991-04-08 | 1991-05-22 | Ici Plc | Antibiotic compounds |
| GB9202298D0 (en) * | 1992-02-04 | 1992-03-18 | Ici Plc | Antibiotic compounds |
| GB9304156D0 (en) * | 1992-03-26 | 1993-04-21 | Zeneca Ltd | Antibiotic compounds |
| CA2091309A1 (en) * | 1992-03-26 | 1993-09-27 | Frederic H. Jung | Antibiotic compounds |
| EP0937725A3 (en) | 1992-04-28 | 2004-12-01 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for hydroxy group |
| US5587474A (en) * | 1992-06-18 | 1996-12-24 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for carboxyl group |
| CA2099818A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| CA2099817A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| CA2099811A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| JP2696807B2 (ja) * | 1992-08-06 | 1998-01-14 | 田辺製薬株式会社 | カルバペネム誘導体の製法 |
| KR940007029A (ko) * | 1992-09-02 | 1994-04-26 | 손정삼 | 새로운 카바페넴 유도체 및 그의 제조방법 |
| CA2106141A1 (en) * | 1992-09-28 | 1994-03-29 | Michael J. Betts | Antibiotic compounds |
| US6011150A (en) * | 1992-11-13 | 2000-01-04 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5631363A (en) * | 1992-11-13 | 1997-05-20 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5442055A (en) * | 1992-11-13 | 1995-08-15 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5602118A (en) * | 1993-03-16 | 1997-02-11 | American Cyanamid Company | 2-thiosubstituted carbapenems |
| US5550229A (en) * | 1993-06-23 | 1996-08-27 | Tanabe Seiyaku Co., Ltd. | Alkylation process for preparing azetidinone compound and starting compound therefor |
| US5783703A (en) * | 1993-07-01 | 1998-07-21 | Lederle (Japan), Ltd. | Sulfur-containing compounds method for their use and prodction |
| AU682510B2 (en) * | 1993-07-01 | 1997-10-09 | Pfizer Japan Inc. | 2-(1-(1,3-thiazolin-2-yl)azetidin-3-yl)thio-carbapenem derivatives |
| US5688786A (en) * | 1994-04-01 | 1997-11-18 | Microcide Pharmaceuticals, Inc. | β-lactam antibiotics |
| AU4844896A (en) * | 1995-03-02 | 1996-09-18 | Takeda Chemical Industries Ltd. | Carbapenem compounds, their production and use |
| WO1996038450A1 (en) * | 1995-05-31 | 1996-12-05 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| TW420681B (en) * | 1995-12-08 | 2001-02-01 | Lederle Japan Ltd | Carbapenem-3-carboxylic acid ester derivatives |
| AU740327C (en) * | 1997-02-07 | 2002-05-09 | Kyoto Pharmaceutical Industries, Ltd. | Carbapenem compounds, use thereof and intermediate compound therefor |
| US8729260B2 (en) * | 2010-05-19 | 2014-05-20 | Savior Lifetec Corporation | Process for the preparation of carbapenem using cabapenem intermediates and recovery of cabapenem |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1696923A (en) | 1929-01-01 | new jebsey | ||
| US4206219A (en) * | 1978-10-24 | 1980-06-03 | Merck & Co., Inc. | 6- and 1-Substituted-1-carbadethiapen-2-em-3-carboxylic acid |
| IE51861B1 (en) * | 1978-10-24 | 1987-04-15 | Merck & Co Inc | 6-,1-and 2-substituted-1-carbapen-2-em-3-carboxylic acids,processes for the preparation of such compounds and pharmaceutical compositions comprising such compounds |
| US4260627A (en) * | 1978-10-24 | 1981-04-07 | Merck & Co., Inc. | 1-, 6- And 2-substituted-1-carba-2-penem-3-carboxylic acids |
| US4208422A (en) * | 1978-10-24 | 1980-06-17 | Merck & Co., Inc. | 1-Substituted-pen-2-em-3-carboxylic acids |
| US4312871A (en) * | 1979-12-03 | 1982-01-26 | Merck & Co., Inc. | 6-, 1- And 2-substituted-1-carbadethiapen-2-em-3-carboxylic acids |
| EP0060077A1 (en) * | 1981-03-04 | 1982-09-15 | Beecham Group Plc | Beta-lactam antibiotics, their preparation and use |
| ES514240A0 (es) * | 1981-08-03 | 1984-04-16 | Merck & Co Inc | Un procedimiento para la prepracion de nuevos derivados de acidos 2-carbamimidoil-1-,carbadestiapen-2-en-3-carboxilados. |
| US4552873A (en) * | 1981-08-19 | 1985-11-12 | Sankyo Company Limited | Carbapenem compounds, and compositions containing them |
| US4650794A (en) * | 1982-04-29 | 1987-03-17 | Merck & Co., Inc. | 6-(1-hydroxyethyl)-2-carbamimidoyl-pen-2-em-3-carboxylic acids |
| EP0089139A2 (en) * | 1982-03-16 | 1983-09-21 | Beecham Group Plc | Antibiotics, their preparation and use |
| JPS5916892A (ja) * | 1982-07-19 | 1984-01-28 | Sankyo Co Ltd | カルバペネム−3−カルボン酸誘導体およびその製法 |
| JPS5951286A (ja) * | 1982-09-10 | 1984-03-24 | Sankyo Co Ltd | カルバペネム誘導体の製造法 |
| EP0113101A1 (en) * | 1982-12-30 | 1984-07-11 | Merck & Co. Inc. | 6-(1-Hydroxyethyl)-2-SR8-1-methyl-1-carbadethiapen-2-em-3-carboxylic acid esters |
| CA1283906C (en) * | 1983-05-09 | 1991-05-07 | Makoto Sunagawa | .beta.-LACTAM COMPOUNDS AND PRODUCTION THEREOF |
| JPS60104088A (ja) * | 1983-11-11 | 1985-06-08 | Sumitomo Chem Co Ltd | 新規なβ−ラクタム化合物およびその製造法 |
| CH662117A5 (de) * | 1983-10-03 | 1987-09-15 | Sanraku Inc | Carbapenemderivate und verfahren zu ihrer herstellung. |
| JPS60178888A (ja) * | 1984-02-22 | 1985-09-12 | Sankyo Co Ltd | ペネムまたはカルバペネム誘導体およびその製法 |
| US4696923A (en) * | 1984-04-23 | 1987-09-29 | Merck & Co., Inc. | 6-[1-hydroxyethyl]-2-SR8 -1-methyl-1-carbadethiapen-2-em-3-carboxylic acids |
| CA1281720C (en) * | 1984-11-08 | 1991-03-19 | Makoto Sunagawa | Carbapenem compounds and production thereof |
| JPS61275279A (ja) * | 1984-12-25 | 1986-12-05 | Sankyo Co Ltd | カルバペネム化合物 |
-
1984
- 1984-03-27 JP JP59059279A patent/JPS60202886A/ja active Granted
-
1985
- 1985-03-26 SU SU853878791A patent/SU1501922A3/ru active
- 1985-03-26 AT AT85302106T patent/ATE86255T1/de not_active IP Right Cessation
- 1985-03-26 EP EP85302106A patent/EP0160391B1/en not_active Expired - Lifetime
- 1985-03-26 ZA ZA852251A patent/ZA852251B/xx unknown
- 1985-03-26 HU HU851142A patent/HU196800B/hu not_active IP Right Cessation
- 1985-03-26 DE DE85302106T patent/DE3587126T2/de not_active Expired - Fee Related
- 1985-03-27 ES ES541638A patent/ES8702912A1/es not_active Expired
- 1985-03-27 DK DK138885A patent/DK169476B1/da active
- 1985-03-27 KR KR1019850002037A patent/KR910010049B1/ko not_active Expired
- 1985-03-27 IE IE77685A patent/IE59708B1/en not_active IP Right Cessation
- 1985-03-27 NZ NZ211604A patent/NZ211604A/xx unknown
- 1985-03-27 PH PH32061A patent/PH25057A/en unknown
- 1985-03-27 AU AU40431/85A patent/AU582148B2/en not_active Ceased
- 1985-03-27 FI FI851240A patent/FI83419C/fi not_active IP Right Cessation
- 1985-03-27 NO NO851227A patent/NO164980C/no unknown
-
1986
- 1986-01-15 ES ES550907A patent/ES8703473A1/es not_active Expired
- 1986-10-27 SU SU864028361A patent/SU1591810A3/ru active
-
1990
- 1990-01-05 US US07/463,773 patent/US5102997A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ATE86255T1 (de) | 1993-03-15 |
| NO164980C (no) | 1990-12-05 |
| DK138885A (da) | 1985-09-28 |
| HU196800B (en) | 1989-01-30 |
| IE850776L (en) | 1985-09-27 |
| NO851227L (no) | 1985-09-30 |
| JPS60202886A (ja) | 1985-10-14 |
| FI83419C (fi) | 1991-07-10 |
| DE3587126T2 (de) | 1993-10-07 |
| EP0160391B1 (en) | 1993-03-03 |
| IE59708B1 (en) | 1994-03-23 |
| ES550907A0 (es) | 1987-02-16 |
| KR850006418A (ko) | 1985-10-05 |
| AU582148B2 (en) | 1989-03-16 |
| DK138885D0 (da) | 1985-03-27 |
| PH25057A (en) | 1991-01-28 |
| DE3587126D1 (de) | 1993-04-08 |
| HUT38351A (en) | 1986-05-28 |
| JPH0367068B2 (enExample) | 1991-10-21 |
| AU4043185A (en) | 1985-10-03 |
| ES541638A0 (es) | 1987-01-16 |
| EP0160391A1 (en) | 1985-11-06 |
| ZA852251B (en) | 1985-12-24 |
| FI851240A0 (fi) | 1985-03-27 |
| ES8702912A1 (es) | 1987-01-16 |
| NZ211604A (en) | 1989-01-06 |
| KR910010049B1 (ko) | 1991-12-12 |
| US5102997A (en) | 1992-04-07 |
| FI851240L (fi) | 1985-09-28 |
| ES8703473A1 (es) | 1987-02-16 |
| FI83419B (fi) | 1991-03-28 |
| SU1501922A3 (ru) | 1989-08-15 |
| SU1591810A3 (ru) | 1990-09-07 |
| NO164980B (no) | 1990-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK169476B1 (da) | Carbapenemderivater og fremgangsmåde til fremstilling deraf samt midler indeholdende dem | |
| DK169820B1 (da) | Analogifremgangsmåde til fremstilling af carbapenemderivater | |
| FI95470C (fi) | Menetelmä valmistaa kaavan /I/ mukaista 1-metyylikarbapeneemijohdosta | |
| CZ286878B6 (en) | Carbapenems, process of their preparation, intermediates for their preparation, those carbapenems used for treating infections and pharmaceutical preparations | |
| DK169384B1 (da) | Carbapenemforbindelser, deres fremstilling og anvendelse | |
| FI89490C (fi) | Foerfarande foer framstaellning av 2-metoximetyl-penemderivat | |
| RU2162088C2 (ru) | 1-метилкарбапенем или его фармакологически приемлемые соли, композиция, способ предупреждения или лечения бактериальных инфекций | |
| KR920010076B1 (ko) | 카르바페넴 유도체의 제조방법 | |
| US4613595A (en) | Penem derivatives, and composition containing them | |
| US5449672A (en) | Alkylaminoalkylpyrrolidinylthiocarbapenem derivatives | |
| JP3367126B2 (ja) | アミノアルキルピロリジニルチオカルバペネム誘導体 | |
| JPH0471913B2 (enExample) | ||
| JPH0310627B2 (enExample) | ||
| KR100246950B1 (ko) | 신규 카바페넴계 항생제 및 그의 제조방법 | |
| JP2832742B2 (ja) | カルバペネム誘導体 | |
| KR100246953B1 (ko) | 신규 카바페넴계 항생제 | |
| KR100246951B1 (ko) | 신규 카바페넴계 항생제 및 그의 제조방법 | |
| KR100246948B1 (ko) | 신규카바페넴계 항생제 | |
| KR100233232B1 (ko) | 신규 카바페넴계 항생제 | |
| KR100246952B1 (ko) | 신규 카바페넴계 항생제 | |
| FI92487B (fi) | Menetelmä lääkeaineina käyttökelpoisten 2-(heterosyklyylitio)karbapeneemijohdannaisten valmistamiseksi | |
| KR100233233B1 (ko) | 신규 카바페넴계 항생제 | |
| JPH0757756B2 (ja) | ペネム誘導体、その製造法および用途 | |
| JPH05255330A (ja) | 2−(置換ピロリジニルチオ)カルバペネム誘導体 | |
| JPH0426688A (ja) | 2‐アルケニルカルバペネム誘導体 |