HU196800B - Process for producing carbepeneme derivatives and pharmaceutical compositions containing them as active component - Google Patents
Process for producing carbepeneme derivatives and pharmaceutical compositions containing them as active component Download PDFInfo
- Publication number
- HU196800B HU196800B HU851142A HU114285A HU196800B HU 196800 B HU196800 B HU 196800B HU 851142 A HU851142 A HU 851142A HU 114285 A HU114285 A HU 114285A HU 196800 B HU196800 B HU 196800B
- Authority
- HU
- Hungary
- Prior art keywords
- formula
- carboxylic acid
- hydroxyethyl
- compound
- ylthio
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 38
- 239000008194 pharmaceutical composition Substances 0.000 title claims description 6
- 150000001875 compounds Chemical class 0.000 claims abstract description 178
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 29
- 239000001257 hydrogen Substances 0.000 claims abstract description 29
- 150000003839 salts Chemical class 0.000 claims abstract description 21
- 150000002148 esters Chemical class 0.000 claims abstract description 15
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 13
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- -1 p-nitrobenzyloxycarbonyl Chemical group 0.000 claims description 104
- 238000002360 preparation method Methods 0.000 claims description 44
- 125000004066 1-hydroxyethyl group Chemical group [H]OC([H])([*])C([H])([H])[H] 0.000 claims description 32
- 125000006239 protecting group Chemical group 0.000 claims description 28
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 21
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 19
- 150000002431 hydrogen Chemical class 0.000 claims description 19
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 13
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 13
- 239000007858 starting material Substances 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 11
- 125000001424 substituent group Chemical group 0.000 claims description 11
- BSIMZHVOQZIAOY-SCSAIBSYSA-N 1-carbapenem-3-carboxylic acid Chemical class OC(=O)C1=CC[C@@H]2CC(=O)N12 BSIMZHVOQZIAOY-SCSAIBSYSA-N 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 9
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 8
- 125000000783 acetimidoyl group Chemical group C(C)(=N)* 0.000 claims description 8
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 8
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 8
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 7
- 125000003118 aryl group Chemical group 0.000 claims description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 6
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 6
- 125000001153 fluoro group Chemical group F* 0.000 claims description 6
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 6
- 239000011734 sodium Substances 0.000 claims description 6
- 229910052708 sodium Inorganic materials 0.000 claims description 6
- 125000004575 3-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 150000001721 carbon Chemical group 0.000 claims description 5
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 5
- 125000001246 bromo group Chemical group Br* 0.000 claims description 4
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 3
- 239000003814 drug Substances 0.000 claims description 3
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 3
- 159000000001 potassium salts Chemical class 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000005103 alkyl silyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- TUNVVRYKJJLJLZ-OLALTRDSSA-N (4-nitrophenyl)methyl (5S)-6-(1-hydroxyethyl)-4,4-dimethyl-3-[1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound OC(C)C1[C@@H]2N(C(=C(C2(C)C)SC2CN(CC2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O TUNVVRYKJJLJLZ-OLALTRDSSA-N 0.000 claims 1
- OMNBOJZYEQDPET-SPFKKGSWSA-N (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-[(3S)-pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O[C@H](C)[C@@H]1[C@H]2N(C(=C([C@@H]2C)S[C@@H]2CNCC2)C(=O)O)C1=O OMNBOJZYEQDPET-SPFKKGSWSA-N 0.000 claims 1
- KBSGOEAJHLNVCL-VSDORWFKSA-N (5S)-3-(1-ethanimidoylpyrrolidin-3-yl)sulfanyl-4-fluoro-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(C)(=N)N1CC(CC1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)F KBSGOEAJHLNVCL-VSDORWFKSA-N 0.000 claims 1
- UKIPZHLRKPKIBG-KITVCJRQSA-N (5S)-3-(1-ethanimidoylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methoxy-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(C)(=N)N1CC(CC1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)OC UKIPZHLRKPKIBG-KITVCJRQSA-N 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 125000004890 (C1-C6) alkylamino group Chemical group 0.000 claims 1
- QPHLFSGMBIJFRA-UHFFFAOYSA-N 4-(4-nitrophenyl)butan-1-amine Chemical compound NCCCCC1=CC=C([N+]([O-])=O)C=C1 QPHLFSGMBIJFRA-UHFFFAOYSA-N 0.000 claims 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 claims 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims 1
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- 125000002102 aryl alkyloxo group Chemical group 0.000 claims 1
- 125000001769 aryl amino group Chemical group 0.000 claims 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract description 4
- 230000003115 biocidal effect Effects 0.000 abstract 1
- 125000000962 organic group Chemical group 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 description 58
- 238000000862 absorption spectrum Methods 0.000 description 31
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 28
- 239000000047 product Substances 0.000 description 28
- 239000002904 solvent Substances 0.000 description 21
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 19
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 14
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 10
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 230000000844 anti-bacterial effect Effects 0.000 description 8
- 239000002585 base Substances 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 6
- 239000003960 organic solvent Substances 0.000 description 6
- 239000000376 reactant Substances 0.000 description 6
- 230000035484 reaction time Effects 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- WKDDRNSBRWANNC-ATRFCDNQSA-N Thienamycin Chemical group C1C(SCCN)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 WKDDRNSBRWANNC-ATRFCDNQSA-N 0.000 description 5
- WKDDRNSBRWANNC-UHFFFAOYSA-N Thienamycin Natural products C1C(SCCN)=C(C(O)=O)N2C(=O)C(C(O)C)C21 WKDDRNSBRWANNC-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 239000003638 chemical reducing agent Substances 0.000 description 5
- 150000004820 halides Chemical class 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 238000001953 recrystallisation Methods 0.000 description 5
- 238000004809 thin layer chromatography Methods 0.000 description 5
- SOVAZWBKYILMFE-AKGZTFGVSA-N (5s)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound CC1C=C(C(O)=O)N2C(=O)C[C@@H]12 SOVAZWBKYILMFE-AKGZTFGVSA-N 0.000 description 4
- 229930182555 Penicillin Natural products 0.000 description 4
- 239000004480 active ingredient Substances 0.000 description 4
- 238000004587 chromatography analysis Methods 0.000 description 4
- 238000004440 column chromatography Methods 0.000 description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- 239000008055 phosphate buffer solution Substances 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 241000191967 Staphylococcus aureus Species 0.000 description 3
- BHIIGRBMZRSDRI-UHFFFAOYSA-N [chloro(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(Cl)OC1=CC=CC=C1 BHIIGRBMZRSDRI-UHFFFAOYSA-N 0.000 description 3
- 125000004423 acyloxy group Chemical group 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001408 amides Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 150000001768 cations Chemical class 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 150000008282 halocarbons Chemical class 0.000 description 3
- ZSKVGTPCRGIANV-ZXFLCMHBSA-N imipenem Chemical compound C1C(SCC\N=C\N)=C(C(O)=O)N2C(=O)[C@H]([C@H](O)C)[C@H]21 ZSKVGTPCRGIANV-ZXFLCMHBSA-N 0.000 description 3
- 229960002182 imipenem Drugs 0.000 description 3
- 239000002198 insoluble material Substances 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 3
- 244000005700 microbiome Species 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Substances [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 230000003389 potentiating effect Effects 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000005389 trialkylsiloxy group Chemical group 0.000 description 3
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- GUGYCHHWTVUBLV-MSECNUKYSA-N (4-nitrophenyl)methyl (4r,5r,6s)-6-[(1r)-1-hydroxyethyl]-4-methyl-3,7-dioxo-1-azabicyclo[3.2.0]heptane-2-carboxylate Chemical compound O=C([C@H](C)[C@@H]1[C@H](C(N11)=O)[C@H](O)C)C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 GUGYCHHWTVUBLV-MSECNUKYSA-N 0.000 description 2
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 2
- 241000588724 Escherichia coli Species 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 241000588748 Klebsiella Species 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 241000588767 Proteus vulgaris Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 241000607720 Serratia Species 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 2
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003242 anti bacterial agent Substances 0.000 description 2
- 229940088710 antibiotic agent Drugs 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 238000010531 catalytic reduction reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 238000010511 deprotection reaction Methods 0.000 description 2
- 229940113088 dimethylacetamide Drugs 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 125000001188 haloalkyl group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 238000010253 intravenous injection Methods 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 244000000010 microbial pathogen Species 0.000 description 2
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 2
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical compound O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- WSHJJCPTKWSMRR-RXMQYKEDSA-N penam Chemical compound S1CCN2C(=O)C[C@H]21 WSHJJCPTKWSMRR-RXMQYKEDSA-N 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 238000000039 preparative column chromatography Methods 0.000 description 2
- 238000012746 preparative thin layer chromatography Methods 0.000 description 2
- 229940007042 proteus vulgaris Drugs 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 2
- YDNLYFHCOQCNAX-NSHDSACASA-N (4-nitrophenyl)methyl (2s)-2-sulfanylpyrrolidine-1-carboxylate Chemical compound C1=CC([N+](=O)[O-])=CC=C1COC(=O)N1[C@@H](S)CCC1 YDNLYFHCOQCNAX-NSHDSACASA-N 0.000 description 1
- VYUYEHODOWKOEX-JWGROBQHSA-N (4-nitrophenyl)methyl (4R,5R,6S)-3-[1,3-bis[(4-nitrophenyl)methoxycarbonylamino]propan-2-ylsulfanyl]-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound C[C@H]1C(=C(N2[C@@H]1[C@H](C2=O)[C@@H](C)O)C(=O)OCC1=CC=C(C=C1)[N+](=O)[O-])SC(CNC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-])CNC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-] VYUYEHODOWKOEX-JWGROBQHSA-N 0.000 description 1
- OEWNRCFDODESNC-HYRINLPZSA-N (4-nitrophenyl)methyl (4R,5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-3-[(3S)-1-[(4-nitrophenyl)methoxycarbonyl]pyrrolidin-3-yl]sulfanyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound O[C@H](C)[C@@H]1[C@H]2N(C(=C([C@@H]2C)S[C@@H]2CN(CC2)C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])C1=O OEWNRCFDODESNC-HYRINLPZSA-N 0.000 description 1
- WKDDRNSBRWANNC-NAJVVJGSSA-N (5R)-3-(2-aminoethylsulfanyl)-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound NCCSC=1C[C@H]2N(C=1C(=O)O)C(C2C(C)O)=O WKDDRNSBRWANNC-NAJVVJGSSA-N 0.000 description 1
- YMCGBWHLJKHLRM-PKIKSRDPSA-N (5R,6S)-6-[(1R)-1-hydroxyethyl]-4,4-dimethyl-7-oxo-3-[(3S)-pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O[C@H](C)[C@@H]1[C@H]2N(C(=C(C2(C)C)S[C@@H]2CNCC2)C(=O)O)C1=O YMCGBWHLJKHLRM-PKIKSRDPSA-N 0.000 description 1
- BWHRTUGANVBEBW-NWADKGONSA-N (5R,6S)-6-[(1R)-1-hydroxyethyl]-4-methoxy-7-oxo-3-[(3S)-pyrrolidin-3-yl]sulfanyl-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound O[C@H](C)[C@@H]1[C@H]2N(C(=C(C2OC)S[C@@H]2CNCC2)C(=O)O)C1=O BWHRTUGANVBEBW-NWADKGONSA-N 0.000 description 1
- KGURMYQHQNPJBN-LZTKIECASA-N (5S)-3-(1-formylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(=O)N1CC(CC1)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C KGURMYQHQNPJBN-LZTKIECASA-N 0.000 description 1
- NTDVMCAFVUGKDZ-ISLOCRICSA-N (5S)-3-(5-carbamoyl-1-ethanimidoylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound C(C)(=N)N1CC(CC1C(N)=O)SC=1C([C@H]2N(C=1C(=O)O)C(C2C(C)O)=O)C NTDVMCAFVUGKDZ-ISLOCRICSA-N 0.000 description 1
- PYMGGHYWYIWWQW-XFXATASKSA-N (5s)-3-(5-carbamoylpyrrolidin-3-yl)sulfanyl-6-(1-hydroxyethyl)-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid Chemical compound CC([C@@H]1C(C(N1C=1C(O)=O)=O)C(O)C)C=1SC1CNC(C(N)=O)C1 PYMGGHYWYIWWQW-XFXATASKSA-N 0.000 description 1
- 125000006273 (C1-C3) alkyl group Chemical group 0.000 description 1
- 125000004739 (C1-C6) alkylsulfonyl group Chemical group 0.000 description 1
- KGENPKAWPRUNIG-UHFFFAOYSA-N 1-[chloro(ethyl)phosphoryl]ethane Chemical compound CCP(Cl)(=O)CC KGENPKAWPRUNIG-UHFFFAOYSA-N 0.000 description 1
- JQCSUVJDBHJKNG-UHFFFAOYSA-N 1-methoxy-ethyl Chemical group C[CH]OC JQCSUVJDBHJKNG-UHFFFAOYSA-N 0.000 description 1
- UTQNKKSJPHTPBS-UHFFFAOYSA-N 2,2,2-trichloroethanone Chemical group ClC(Cl)(Cl)[C]=O UTQNKKSJPHTPBS-UHFFFAOYSA-N 0.000 description 1
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- SCVJRXQHFJXZFZ-KVQBGUIXSA-N 2-amino-9-[(2r,4s,5r)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3h-purine-6-thione Chemical compound C1=2NC(N)=NC(=S)C=2N=CN1[C@H]1C[C@H](O)[C@@H](CO)O1 SCVJRXQHFJXZFZ-KVQBGUIXSA-N 0.000 description 1
- XWKFPIODWVPXLX-UHFFFAOYSA-N 2-methyl-5-methylpyridine Natural products CC1=CC=C(C)N=C1 XWKFPIODWVPXLX-UHFFFAOYSA-N 0.000 description 1
- 125000004485 2-pyrrolidinyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])C1([H])* 0.000 description 1
- BKJXEZGPZLLYHX-UHFFFAOYSA-N 3,4-dihydro-2h-pyrrole-5-carbaldehyde Chemical compound O=CC1=NCCC1 BKJXEZGPZLLYHX-UHFFFAOYSA-N 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 208000035143 Bacterial infection Diseases 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000282465 Canis Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- NOTFZGFABLVTIG-UHFFFAOYSA-N Cyclohexylethyl acetate Chemical compound CC(=O)OCCC1CCCCC1 NOTFZGFABLVTIG-UHFFFAOYSA-N 0.000 description 1
- 241000588914 Enterobacter Species 0.000 description 1
- 241000588697 Enterobacter cloacae Species 0.000 description 1
- 241000305071 Enterobacterales Species 0.000 description 1
- 241000588722 Escherichia Species 0.000 description 1
- IBTCILABCSIKOY-ZACOFERISA-N FC([C@H]1[C@H](C(N11)=O)[C@H](O)C)C(=O)C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 Chemical compound FC([C@H]1[C@H](C(N11)=O)[C@H](O)C)C(=O)C1C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 IBTCILABCSIKOY-ZACOFERISA-N 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- 241000282412 Homo Species 0.000 description 1
- 241000588747 Klebsiella pneumoniae Species 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- HPKJGHVHQWJOOT-ZJOUEHCJSA-N N-[(2S)-3-cyclohexyl-1-oxo-1-({(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl}amino)propan-2-yl]-1H-indole-2-carboxamide Chemical compound C1C(CCCC1)C[C@H](NC(=O)C=1NC2=CC=CC=C2C=1)C(=O)N[C@@H](C[C@H]1C(=O)NCC1)C=O HPKJGHVHQWJOOT-ZJOUEHCJSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- WPHFJMVRBJNJMZ-DOUTUIGOSA-N O=C([C@H]([C@@H](C)O)[C@@H]1C(C2=O)OC)N1C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 Chemical compound O=C([C@H]([C@@H](C)O)[C@@H]1C(C2=O)OC)N1C2C(=O)OCC1=CC=C([N+]([O-])=O)C=C1 WPHFJMVRBJNJMZ-DOUTUIGOSA-N 0.000 description 1
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 1
- 241000607715 Serratia marcescens Species 0.000 description 1
- 241000607762 Shigella flexneri Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- AJKWAIULERTKCG-DBQPCTHGSA-N [N+](=O)([O-])C1=CC=C(COC(=O)C2=CC([C@H]3N2C(C3[C@@H](C)O)=O)C)C=C1 Chemical compound [N+](=O)([O-])C1=CC=C(COC(=O)C2=CC([C@H]3N2C(C3[C@@H](C)O)=O)C)C=C1 AJKWAIULERTKCG-DBQPCTHGSA-N 0.000 description 1
- OMOPIAOKQJWPEF-UHFFFAOYSA-N [bromo(phenyl)phosphoryl]benzene Chemical compound C=1C=CC=CC=1P(=O)(Br)C1=CC=CC=C1 OMOPIAOKQJWPEF-UHFFFAOYSA-N 0.000 description 1
- CVNMBKFJYRAHPO-UHFFFAOYSA-N [chloro(methyl)phosphoryl]methane Chemical compound CP(C)(Cl)=O CVNMBKFJYRAHPO-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- AXJDEHNQPMZKOS-UHFFFAOYSA-N acetylazanium;chloride Chemical compound [Cl-].CC([NH3+])=O AXJDEHNQPMZKOS-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 208000022362 bacterial infectious disease Diseases 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000003460 beta-lactamyl group Chemical group 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 210000000481 breast Anatomy 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- XQVVLJSNTJWBMG-UHFFFAOYSA-N ethyl 2-methoxyethanimidate;hydrochloride Chemical compound Cl.CCOC(=N)COC XQVVLJSNTJWBMG-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000005179 haloacetyl group Chemical group 0.000 description 1
- 125000004468 heterocyclylthio group Chemical group 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- AGJSNMGHAVDLRQ-IWFBPKFRSA-N methyl (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-IWFBPKFRSA-N 0.000 description 1
- QVZGUPVAMOTYEB-RXMQYKEDSA-N methyl (5R)-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate Chemical compound COC(=O)C1=CC[C@H]2N1C(C2)=O QVZGUPVAMOTYEB-RXMQYKEDSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- LSCYTCMNCWMCQE-UHFFFAOYSA-N n-methylpyridin-4-amine Chemical compound CNC1=CC=NC=C1 LSCYTCMNCWMCQE-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005146 naphthylsulfonyl group Chemical group C1(=CC=CC2=CC=CC=C12)S(=O)(=O)* 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 229940049954 penicillin Drugs 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- AQSJGOWTSHOLKH-UHFFFAOYSA-N phosphite(3-) Chemical class [O-]P([O-])[O-] AQSJGOWTSHOLKH-UHFFFAOYSA-N 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 238000011403 purification operation Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000005055 short column chromatography Methods 0.000 description 1
- 125000004469 siloxy group Chemical group [SiH3]O* 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 description 1
- SJHCUXCOGGKFAI-UHFFFAOYSA-N tripropan-2-yl phosphite Chemical compound CC(C)OP(OC(C)C)OC(C)C SJHCUXCOGGKFAI-UHFFFAOYSA-N 0.000 description 1
- QOPBTFMUVTXWFF-UHFFFAOYSA-N tripropyl phosphite Chemical compound CCCOP(OCCC)OCCC QOPBTFMUVTXWFF-UHFFFAOYSA-N 0.000 description 1
- 210000002700 urine Anatomy 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 150000003952 β-lactams Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D487/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00
- C07D487/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, not provided for by groups C07D451/00 - C07D477/00 in which the condensed system contains two hetero rings
- C07D487/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/10—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2
- C07D477/12—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6
- C07D477/16—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 4, and with a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 2 with hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached in position 6 with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 3
- C07D477/20—Sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D477/00—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring
- C07D477/26—Heterocyclic compounds containing 1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. carbapenicillins, thienamycins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulphur-containing hetero ring with hetero atoms or carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. an ester or nitrile radical, directly attached in position 4
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Oncology (AREA)
- Pharmacology & Pharmacy (AREA)
- Communicable Diseases (AREA)
- Animal Behavior & Ethology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Compounds Of Unknown Constitution (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Saccharide Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP59059279A JPS60202886A (ja) | 1984-03-27 | 1984-03-27 | 1―置換カルバペネム―3―カルボン酸誘導体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT38351A HUT38351A (en) | 1986-05-28 |
| HU196800B true HU196800B (en) | 1989-01-30 |
Family
ID=13108786
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU851142A HU196800B (en) | 1984-03-27 | 1985-03-26 | Process for producing carbepeneme derivatives and pharmaceutical compositions containing them as active component |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US5102997A (enExample) |
| EP (1) | EP0160391B1 (enExample) |
| JP (1) | JPS60202886A (enExample) |
| KR (1) | KR910010049B1 (enExample) |
| AT (1) | ATE86255T1 (enExample) |
| AU (1) | AU582148B2 (enExample) |
| DE (1) | DE3587126T2 (enExample) |
| DK (1) | DK169476B1 (enExample) |
| ES (2) | ES8702912A1 (enExample) |
| FI (1) | FI83419C (enExample) |
| HU (1) | HU196800B (enExample) |
| IE (1) | IE59708B1 (enExample) |
| NO (1) | NO164980C (enExample) |
| NZ (1) | NZ211604A (enExample) |
| PH (1) | PH25057A (enExample) |
| SU (2) | SU1501922A3 (enExample) |
| ZA (1) | ZA852251B (enExample) |
Families Citing this family (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1283906C (en) * | 1983-05-09 | 1991-05-07 | Makoto Sunagawa | .beta.-LACTAM COMPOUNDS AND PRODUCTION THEREOF |
| US4696923A (en) * | 1984-04-23 | 1987-09-29 | Merck & Co., Inc. | 6-[1-hydroxyethyl]-2-SR8 -1-methyl-1-carbadethiapen-2-em-3-carboxylic acids |
| US4665169A (en) * | 1985-09-11 | 1987-05-12 | Bristol-Myers Company | Carbapenem antibiotics |
| JPS6363680A (ja) * | 1986-09-05 | 1988-03-22 | Nippon Redarii Kk | (1r)−1−メチルカルバペネム−3−カルボン酸誘導体 |
| KR880006244A (ko) * | 1986-11-24 | 1988-07-22 | 후지사와 도모 기찌 로 | 3-피롤리디닐티오-1-아자바이스클로[3.2.0]햅트2-엔-2-카르복실산 화합물 및 이의 제조방법 |
| ES2053508T3 (es) * | 1986-11-24 | 1994-08-01 | Fujisawa Pharmaceutical Co | Compuestos de acidos 3-pirrolidinil-tio-1-azabiciclo(3.2.0)hept-2-eno-2-carboxilicos. |
| JPS63255280A (ja) * | 1987-04-11 | 1988-10-21 | Nippon Redarii Kk | (1r,5s,6s)−2−置換−6−〔(r)−1−ヒドロキシエチル〕−1−メチル−カルバペネム−3−カルボン酸誘導体 |
| US4925838A (en) * | 1988-03-18 | 1990-05-15 | Fujisawa Pharmaceutical Company, Ltd. | 3-pyrrolidinylthio-1-azabicyclo[3.2.0]-hept-2-ene-2-carboxylic acid compounds |
| US5242914A (en) * | 1988-04-01 | 1993-09-07 | Sankyo Company, Limited | 2-(heterocyclylthio) carbapenem derivatives, their preparation and their use as antibiotics |
| ES2067534T3 (es) * | 1988-04-01 | 1995-04-01 | Sankyo Co | Derivados de 2-(heterocicliltio)carbapenemo, su preparacion y su aplicacion como antibioticos. |
| GB8811237D0 (en) * | 1988-05-12 | 1988-06-15 | Fujisawa Pharmaceutical Co | 3-pyrrolidinylthio-1-azabicyclo(3.2.0)hept-2-ene-2-carboxylic acid derivatives |
| US4963544A (en) * | 1988-05-23 | 1990-10-16 | Fujisawa Pharmaceutical Company, Ltd. | 3-pyrrolidinylthio-1-azabicyclo[3.2.0]-hept-2-ene-2-carboxylic acid compounds |
| CA2022382A1 (en) * | 1989-08-02 | 1991-02-03 | Susumu Nakagawa | Piperidylthiocarbapenem derivatives |
| GB8923844D0 (en) * | 1989-10-23 | 1989-12-13 | Fujisawa Pharmaceutical Co | Carbapenem compounds |
| FI96311C (fi) * | 1989-12-04 | 1996-06-10 | Squibb Bristol Myers Co | Menetelmä farmaseuttisesti käyttökelpoisten 6-(1-hydroksietyyli)-3-(substituoitu tio)-7-okso-1-atsabisyklo/3.2.0/hept-2-eeni-2-karboksyylihappojohdannaisten valmistamiseksi |
| WO1991009860A1 (fr) * | 1989-12-28 | 1991-07-11 | Banyu Pharmaceutical Co., Ltd. | Nouveau derive de carbapenem |
| US5672701A (en) * | 1990-01-16 | 1997-09-30 | Bristol-Myers Squibb Company | 4-substituted alkyl carbapenem antibiotics |
| US5554606A (en) * | 1990-03-12 | 1996-09-10 | Zeneca Limited | Antibiotic compounds |
| US5208348A (en) * | 1990-09-07 | 1993-05-04 | Tanabe Seiyaku Co., Ltd. | Mercaptan compound |
| CA2050255C (en) * | 1990-09-07 | 1997-02-04 | Tameo Iwasaki | 1-methylcarbapenem derivatives and process for preparation thereof |
| GB9107341D0 (en) * | 1991-04-08 | 1991-05-22 | Ici Plc | Antibiotic compounds |
| GB9202298D0 (en) * | 1992-02-04 | 1992-03-18 | Ici Plc | Antibiotic compounds |
| GB9304156D0 (en) * | 1992-03-26 | 1993-04-21 | Zeneca Ltd | Antibiotic compounds |
| CA2091309A1 (en) * | 1992-03-26 | 1993-09-27 | Frederic H. Jung | Antibiotic compounds |
| EP0937725A3 (en) | 1992-04-28 | 2004-12-01 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for hydroxy group |
| US5587474A (en) * | 1992-06-18 | 1996-12-24 | Tanabe Seiyaku Co., Ltd. | Method for removing the protecting group for carboxyl group |
| CA2099818A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| CA2099817A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| CA2099811A1 (en) * | 1992-07-21 | 1994-01-22 | Frederic H. Jung | Antibiotic compounds |
| JP2696807B2 (ja) * | 1992-08-06 | 1998-01-14 | 田辺製薬株式会社 | カルバペネム誘導体の製法 |
| KR940007029A (ko) * | 1992-09-02 | 1994-04-26 | 손정삼 | 새로운 카바페넴 유도체 및 그의 제조방법 |
| CA2106141A1 (en) * | 1992-09-28 | 1994-03-29 | Michael J. Betts | Antibiotic compounds |
| US6011150A (en) * | 1992-11-13 | 2000-01-04 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5631363A (en) * | 1992-11-13 | 1997-05-20 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5442055A (en) * | 1992-11-13 | 1995-08-15 | Tanabe Seiyaku Co., Ltd. | Azetidinone compound and process for preparation thereof |
| US5602118A (en) * | 1993-03-16 | 1997-02-11 | American Cyanamid Company | 2-thiosubstituted carbapenems |
| US5550229A (en) * | 1993-06-23 | 1996-08-27 | Tanabe Seiyaku Co., Ltd. | Alkylation process for preparing azetidinone compound and starting compound therefor |
| US5783703A (en) * | 1993-07-01 | 1998-07-21 | Lederle (Japan), Ltd. | Sulfur-containing compounds method for their use and prodction |
| AU682510B2 (en) * | 1993-07-01 | 1997-10-09 | Pfizer Japan Inc. | 2-(1-(1,3-thiazolin-2-yl)azetidin-3-yl)thio-carbapenem derivatives |
| US5688786A (en) * | 1994-04-01 | 1997-11-18 | Microcide Pharmaceuticals, Inc. | β-lactam antibiotics |
| AU4844896A (en) * | 1995-03-02 | 1996-09-18 | Takeda Chemical Industries Ltd. | Carbapenem compounds, their production and use |
| WO1996038450A1 (en) * | 1995-05-31 | 1996-12-05 | Microcide Pharmaceuticals, Inc. | Cephalosporin antibiotics |
| TW420681B (en) * | 1995-12-08 | 2001-02-01 | Lederle Japan Ltd | Carbapenem-3-carboxylic acid ester derivatives |
| AU740327C (en) * | 1997-02-07 | 2002-05-09 | Kyoto Pharmaceutical Industries, Ltd. | Carbapenem compounds, use thereof and intermediate compound therefor |
| US8729260B2 (en) * | 2010-05-19 | 2014-05-20 | Savior Lifetec Corporation | Process for the preparation of carbapenem using cabapenem intermediates and recovery of cabapenem |
Family Cites Families (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1696923A (en) | 1929-01-01 | new jebsey | ||
| US4206219A (en) * | 1978-10-24 | 1980-06-03 | Merck & Co., Inc. | 6- and 1-Substituted-1-carbadethiapen-2-em-3-carboxylic acid |
| IE51861B1 (en) * | 1978-10-24 | 1987-04-15 | Merck & Co Inc | 6-,1-and 2-substituted-1-carbapen-2-em-3-carboxylic acids,processes for the preparation of such compounds and pharmaceutical compositions comprising such compounds |
| US4260627A (en) * | 1978-10-24 | 1981-04-07 | Merck & Co., Inc. | 1-, 6- And 2-substituted-1-carba-2-penem-3-carboxylic acids |
| US4208422A (en) * | 1978-10-24 | 1980-06-17 | Merck & Co., Inc. | 1-Substituted-pen-2-em-3-carboxylic acids |
| US4312871A (en) * | 1979-12-03 | 1982-01-26 | Merck & Co., Inc. | 6-, 1- And 2-substituted-1-carbadethiapen-2-em-3-carboxylic acids |
| EP0060077A1 (en) * | 1981-03-04 | 1982-09-15 | Beecham Group Plc | Beta-lactam antibiotics, their preparation and use |
| ES514240A0 (es) * | 1981-08-03 | 1984-04-16 | Merck & Co Inc | Un procedimiento para la prepracion de nuevos derivados de acidos 2-carbamimidoil-1-,carbadestiapen-2-en-3-carboxilados. |
| US4552873A (en) * | 1981-08-19 | 1985-11-12 | Sankyo Company Limited | Carbapenem compounds, and compositions containing them |
| US4650794A (en) * | 1982-04-29 | 1987-03-17 | Merck & Co., Inc. | 6-(1-hydroxyethyl)-2-carbamimidoyl-pen-2-em-3-carboxylic acids |
| EP0089139A2 (en) * | 1982-03-16 | 1983-09-21 | Beecham Group Plc | Antibiotics, their preparation and use |
| JPS5916892A (ja) * | 1982-07-19 | 1984-01-28 | Sankyo Co Ltd | カルバペネム−3−カルボン酸誘導体およびその製法 |
| JPS5951286A (ja) * | 1982-09-10 | 1984-03-24 | Sankyo Co Ltd | カルバペネム誘導体の製造法 |
| EP0113101A1 (en) * | 1982-12-30 | 1984-07-11 | Merck & Co. Inc. | 6-(1-Hydroxyethyl)-2-SR8-1-methyl-1-carbadethiapen-2-em-3-carboxylic acid esters |
| CA1283906C (en) * | 1983-05-09 | 1991-05-07 | Makoto Sunagawa | .beta.-LACTAM COMPOUNDS AND PRODUCTION THEREOF |
| JPS60104088A (ja) * | 1983-11-11 | 1985-06-08 | Sumitomo Chem Co Ltd | 新規なβ−ラクタム化合物およびその製造法 |
| CH662117A5 (de) * | 1983-10-03 | 1987-09-15 | Sanraku Inc | Carbapenemderivate und verfahren zu ihrer herstellung. |
| JPS60178888A (ja) * | 1984-02-22 | 1985-09-12 | Sankyo Co Ltd | ペネムまたはカルバペネム誘導体およびその製法 |
| US4696923A (en) * | 1984-04-23 | 1987-09-29 | Merck & Co., Inc. | 6-[1-hydroxyethyl]-2-SR8 -1-methyl-1-carbadethiapen-2-em-3-carboxylic acids |
| CA1281720C (en) * | 1984-11-08 | 1991-03-19 | Makoto Sunagawa | Carbapenem compounds and production thereof |
| JPS61275279A (ja) * | 1984-12-25 | 1986-12-05 | Sankyo Co Ltd | カルバペネム化合物 |
-
1984
- 1984-03-27 JP JP59059279A patent/JPS60202886A/ja active Granted
-
1985
- 1985-03-26 SU SU853878791A patent/SU1501922A3/ru active
- 1985-03-26 AT AT85302106T patent/ATE86255T1/de not_active IP Right Cessation
- 1985-03-26 EP EP85302106A patent/EP0160391B1/en not_active Expired - Lifetime
- 1985-03-26 ZA ZA852251A patent/ZA852251B/xx unknown
- 1985-03-26 HU HU851142A patent/HU196800B/hu not_active IP Right Cessation
- 1985-03-26 DE DE85302106T patent/DE3587126T2/de not_active Expired - Fee Related
- 1985-03-27 ES ES541638A patent/ES8702912A1/es not_active Expired
- 1985-03-27 DK DK138885A patent/DK169476B1/da active
- 1985-03-27 KR KR1019850002037A patent/KR910010049B1/ko not_active Expired
- 1985-03-27 IE IE77685A patent/IE59708B1/en not_active IP Right Cessation
- 1985-03-27 NZ NZ211604A patent/NZ211604A/xx unknown
- 1985-03-27 PH PH32061A patent/PH25057A/en unknown
- 1985-03-27 AU AU40431/85A patent/AU582148B2/en not_active Ceased
- 1985-03-27 FI FI851240A patent/FI83419C/fi not_active IP Right Cessation
- 1985-03-27 NO NO851227A patent/NO164980C/no unknown
-
1986
- 1986-01-15 ES ES550907A patent/ES8703473A1/es not_active Expired
- 1986-10-27 SU SU864028361A patent/SU1591810A3/ru active
-
1990
- 1990-01-05 US US07/463,773 patent/US5102997A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| ATE86255T1 (de) | 1993-03-15 |
| NO164980C (no) | 1990-12-05 |
| DK138885A (da) | 1985-09-28 |
| IE850776L (en) | 1985-09-27 |
| NO851227L (no) | 1985-09-30 |
| JPS60202886A (ja) | 1985-10-14 |
| FI83419C (fi) | 1991-07-10 |
| DE3587126T2 (de) | 1993-10-07 |
| EP0160391B1 (en) | 1993-03-03 |
| IE59708B1 (en) | 1994-03-23 |
| ES550907A0 (es) | 1987-02-16 |
| KR850006418A (ko) | 1985-10-05 |
| AU582148B2 (en) | 1989-03-16 |
| DK138885D0 (da) | 1985-03-27 |
| PH25057A (en) | 1991-01-28 |
| DE3587126D1 (de) | 1993-04-08 |
| HUT38351A (en) | 1986-05-28 |
| DK169476B1 (da) | 1994-11-07 |
| JPH0367068B2 (enExample) | 1991-10-21 |
| AU4043185A (en) | 1985-10-03 |
| ES541638A0 (es) | 1987-01-16 |
| EP0160391A1 (en) | 1985-11-06 |
| ZA852251B (en) | 1985-12-24 |
| FI851240A0 (fi) | 1985-03-27 |
| ES8702912A1 (es) | 1987-01-16 |
| NZ211604A (en) | 1989-01-06 |
| KR910010049B1 (ko) | 1991-12-12 |
| US5102997A (en) | 1992-04-07 |
| FI851240L (fi) | 1985-09-28 |
| ES8703473A1 (es) | 1987-02-16 |
| FI83419B (fi) | 1991-03-28 |
| SU1501922A3 (ru) | 1989-08-15 |
| SU1591810A3 (ru) | 1990-09-07 |
| NO164980B (no) | 1990-08-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU196800B (en) | Process for producing carbepeneme derivatives and pharmaceutical compositions containing them as active component | |
| DK169820B1 (da) | Analogifremgangsmåde til fremstilling af carbapenemderivater | |
| CZ286878B6 (en) | Carbapenems, process of their preparation, intermediates for their preparation, those carbapenems used for treating infections and pharmaceutical preparations | |
| FI95470C (fi) | Menetelmä valmistaa kaavan /I/ mukaista 1-metyylikarbapeneemijohdosta | |
| US5654318A (en) | Bicyclic amine derivatives | |
| FI81576C (fi) | Foerfarande foer framstaellning av derivat av 6-(1-hydroxietyl)-2-(1,2-disubstituerade-4-pyrrolidinyltio)-2- karbapenem-3-karboxylsyra, vilka aer anvaendbara som laekemedel. | |
| WO1997023483A1 (fr) | Derives de 1-methylcarbapenem | |
| RU2162088C2 (ru) | 1-метилкарбапенем или его фармакологически приемлемые соли, композиция, способ предупреждения или лечения бактериальных инфекций | |
| US4771046A (en) | Carbapenem derivatives | |
| US4613595A (en) | Penem derivatives, and composition containing them | |
| EP1340756B1 (en) | Novel beta-lactam compounds and process for producing the same | |
| JP2955276B2 (ja) | 1−メチルカルバペネム誘導体を含有する抗菌剤 | |
| US4565808A (en) | 3-Phosphonate carbapenems | |
| JP2965922B2 (ja) | 1−メチルカルバペネム誘導体 | |
| AU651505B2 (en) | Aminoalkylpyrrolidinylthiocarbapenem derivatives | |
| JP3384768B2 (ja) | 1−メチルカルバペネム誘導体を含有する医薬 | |
| KR20000048687A (ko) | 피리도벤족사진 유도체 | |
| JPH08134075A (ja) | 新規なカルバペネム誘導体 | |
| JP2003183280A (ja) | カルバペネム化合物 | |
| WO1994005667A1 (en) | Carbapenem derivatives and processes for preparing the same | |
| HK1122800A (en) | Novel beta-lactam compounds and process for producing the same |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |