DE817554C - Verfahren zur Erzeugung von Phenazoniumfarbstoffbildern - Google Patents
Verfahren zur Erzeugung von PhenazoniumfarbstoffbildernInfo
- Publication number
- DE817554C DE817554C DEP24685D DEP0024685D DE817554C DE 817554 C DE817554 C DE 817554C DE P24685 D DEP24685 D DE P24685D DE P0024685 D DEP0024685 D DE P0024685D DE 817554 C DE817554 C DE 817554C
- Authority
- DE
- Germany
- Prior art keywords
- color
- acid
- dye images
- developer
- phenazonium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 7
- 239000000839 emulsion Substances 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 2
- 239000001257 hydrogen Substances 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 238000004040 coloring Methods 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- 150000003672 ureas Chemical group 0.000 claims 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 14
- 239000002253 acid Substances 0.000 description 13
- -1 chlorine or bromine Chemical class 0.000 description 12
- 150000001875 compounds Chemical class 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 7
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 4
- LJGHYPLBDBRCRZ-UHFFFAOYSA-N 3-(3-aminophenyl)sulfonylaniline Chemical group NC1=CC=CC(S(=O)(=O)C=2C=C(N)C=CC=2)=C1 LJGHYPLBDBRCRZ-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 238000000411 transmission spectrum Methods 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 2
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- GBOPXAULXQSECQ-UHFFFAOYSA-N 2-(octadecylamino)ethanesulfonic acid Chemical compound CCCCCCCCCCCCCCCCCCNCCS(O)(=O)=O GBOPXAULXQSECQ-UHFFFAOYSA-N 0.000 description 1
- UNSAJINGUOTTRA-UHFFFAOYSA-N 3-(3-bromophenyl)prop-2-yn-1-ol Chemical compound OCC#CC1=CC=CC(Br)=C1 UNSAJINGUOTTRA-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000011938 amidation process Methods 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- WCKKWABZCCKDTN-UHFFFAOYSA-N decane-1-sulfonyl chloride Chemical compound CCCCCCCCCCS(Cl)(=O)=O WCKKWABZCCKDTN-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 description 1
- PBULHKIPTBIZHO-UHFFFAOYSA-N dodecane-1-sulfonyl chloride Chemical compound CCCCCCCCCCCCS(Cl)(=O)=O PBULHKIPTBIZHO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229940076133 sodium carbonate monohydrate Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000002834 transmittance Methods 0.000 description 1
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C7/00—Multicolour photographic processes or agents therefor; Regeneration of such processing agents; Photosensitive materials for multicolour processes
- G03C7/30—Colour processes using colour-coupling substances; Materials therefor; Preparing or processing such materials
- G03C7/32—Colour coupling substances
- G03C7/3244—Couplers forming azinic dyes; Specific developers therefor
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US640382A US2486440A (en) | 1946-01-10 | 1946-01-10 | Production of phenazonium dyestuff images |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE817554C true DE817554C (de) | 1951-10-18 |
Family
ID=41210569
Family Applications (6)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP24685D Expired DE817554C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Erzeugung von Phenazoniumfarbstoffbildern |
| DEP24682A Expired DE837959C (de) | 1946-01-10 | 1948-12-14 | Photographischer Entwickler, insbesondere zur Erzeugung von Phenazonium-Farbstoffbildern |
| DEP24686D Expired DE851163C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung blaeulicher Phenazonium-Farbstoffbilder |
| DEP24684D Expired DE854889C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung von Phenazonium-Farbstoffbildern |
| DEP24683A Expired DE850385C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung von Phenazonium-Farbstoffbildern durch Farbentwicklung |
| DEP29268A Expired DE848155C (de) | 1946-01-10 | 1949-01-01 | Verfahren zur Herstellung von Farbstoffbildern in photographischen Schichten durch farbgebende Entwicklung |
Family Applications After (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP24682A Expired DE837959C (de) | 1946-01-10 | 1948-12-14 | Photographischer Entwickler, insbesondere zur Erzeugung von Phenazonium-Farbstoffbildern |
| DEP24686D Expired DE851163C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung blaeulicher Phenazonium-Farbstoffbilder |
| DEP24684D Expired DE854889C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung von Phenazonium-Farbstoffbildern |
| DEP24683A Expired DE850385C (de) | 1946-01-10 | 1948-12-14 | Verfahren zur Herstellung von Phenazonium-Farbstoffbildern durch Farbentwicklung |
| DEP29268A Expired DE848155C (de) | 1946-01-10 | 1949-01-01 | Verfahren zur Herstellung von Farbstoffbildern in photographischen Schichten durch farbgebende Entwicklung |
Country Status (6)
| Country | Link |
|---|---|
| US (6) | US2486440A (online.php) |
| BE (6) | BE470459A (online.php) |
| CH (5) | CH280516A (online.php) |
| DE (6) | DE817554C (online.php) |
| FR (6) | FR939497A (online.php) |
| GB (5) | GB644863A (online.php) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2611785A (en) * | 1952-09-23 | N-substituted x | ||
| CH277023A (de) * | 1949-05-03 | 1951-08-15 | Ciba Geigy | Verfahren zur Herstellung eines Zwischenproduktes. |
| US2575027A (en) * | 1949-10-29 | 1951-11-13 | Gen Aniline & Film Corp | N-substituted 4, 6-diamino metanilic acids |
| US2594917A (en) * | 1949-12-16 | 1952-04-29 | Gen Aniline & Film Corp | Suppression of proximity development with azine color developers |
| US2596926A (en) * | 1949-12-16 | 1952-05-13 | Gen Aniline & Film Corp | Preparation of azine dye images |
| US2618559A (en) * | 1950-03-21 | 1952-11-18 | Gen Aniline & Film Corp | Stain preventing shortstop bath for photographic azine dye images |
| US2623823A (en) * | 1950-03-21 | 1952-12-30 | Gen Aniline & Film Corp | Energizers for aromatic triamino developing agents and suppression of proximity development in azine color developers |
| US2687431A (en) * | 1950-12-20 | 1954-08-24 | Gen Aniline & Film Corp | Process of preparing nitro phenylenediamines |
| BE508676A (online.php) * | 1951-01-26 | |||
| US2691588A (en) * | 1952-03-14 | 1954-10-12 | Eastman Kodak Co | Photographic developers containing 8-hydroxyquinolines |
| US2701766A (en) * | 1952-06-14 | 1955-02-08 | Gen Aniline & Film Corp | Developers for and method of producing phenazonium dyestuff images with p-dialkylaminoaniline developing agents |
| BE526742A (online.php) * | 1953-02-24 | |||
| GB802553A (en) * | 1955-11-18 | 1958-10-08 | Gen Aniline & Film Corp | Improvements in or relating to colour photographic materials and processes |
| US2945761A (en) * | 1957-07-29 | 1960-07-19 | Eastman Kodak Co | Reactivity of couplers incorporated in photographic emulsions |
| BE576817A (online.php) * | 1958-04-03 | |||
| US3099559A (en) * | 1959-08-31 | 1963-07-30 | Gen Aniline & Film Corp | Silver-free color reproduction process and composition therefor |
| NL255792A (online.php) * | 1959-09-11 | |||
| US3050394A (en) * | 1959-09-30 | 1962-08-21 | Gen Aniline & Film Corp | Method of incorporating color couplers in hydrophlic colloids |
| US3077403A (en) * | 1960-05-31 | 1963-02-12 | Gen Aniline & Film Corp | Color former containing bis coupling functions |
| US4511569A (en) * | 1982-08-26 | 1985-04-16 | Schering Corporation | Tricyclic lactams and derivatives useful in increasing cardiac contractility |
| JPS59177554A (ja) * | 1983-03-28 | 1984-10-08 | Fuji Photo Film Co Ltd | ハロゲン化銀カラ−写真感光材料 |
| SE8302361D0 (sv) * | 1983-04-27 | 1983-04-27 | Astra Laekemedel Ab | New tricyclic amines |
| US4680299A (en) * | 1984-04-30 | 1987-07-14 | E.I. Du Pont De Nemours And Company | 2-phenyl-4-quinolinecarboxylic acids and pharmaceutical compositions thereof |
| US4847381A (en) * | 1987-08-31 | 1989-07-11 | American Cyanamid Company | 2-Phenyl-4-quinoline carboxylic acids |
| US5260177A (en) * | 1988-03-16 | 1993-11-09 | Fuji Photo Film Co., Ltd. | Silver halide color photographic light-sensitive material |
| EP0386931A1 (en) * | 1989-03-04 | 1990-09-12 | Konica Corporation | A novel cyan coupler |
| US5223386A (en) * | 1989-03-04 | 1993-06-29 | Konica Corporation | Cyan coupler |
| US4990436A (en) * | 1990-01-23 | 1991-02-05 | Eastman Kodak Company | Cyan dye-forming couplers and photographic recording materials containing same |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB178986A (en) * | 1921-02-11 | 1922-05-04 | John Augustus Ward | Improvements in and relating to advertising apparatus |
| US1782356A (en) * | 1927-11-14 | 1930-11-18 | Firm J R Geigy S A | Manufacture of acid dyestuffs of the phenonaphthosafranine series |
| US1886809A (en) * | 1929-09-04 | 1932-11-08 | Gen Aniline Works Inc | Arylated safranines and process of preparing them |
| BE369421A (online.php) * | 1929-09-09 | |||
| GB458664A (en) * | 1935-03-21 | 1936-12-21 | Eastman Kodak Co | Improvements in and relating to colour forming developers and processes of colour development |
| DE767652C (de) * | 1936-05-27 | 1953-03-02 | Ig Farbenindustrie Ag | Verfahren zur farbigen Entwicklung von Halogensilberemulsionen |
| US2306410A (en) * | 1936-07-07 | 1942-12-29 | Eastman Kodak Co | Color development |
| US2356475A (en) * | 1936-07-07 | 1944-08-22 | Eastman Kodak Co | Phenolic and naphtholic couplers containing sulphonamide groups |
| US2196739A (en) * | 1938-09-23 | 1940-04-09 | Eastman Kodak Co | Photographic developer for color photography |
| GB531312A (en) * | 1939-03-31 | 1941-01-01 | Eastman Kodak Co | Improvements in and relating to colour forming developers and processes of colour development |
| US2193015A (en) * | 1939-05-24 | 1940-03-12 | Eastman Kodak Co | Developer containing sulphonamide groups |
| GB536939A (en) * | 1939-08-24 | 1941-06-03 | Eastman Kodak Co | Improvements in and relating to photographic colour development |
| BE442586A (online.php) * | 1940-07-31 | |||
| FR956696A (online.php) * | 1941-08-08 | 1950-02-02 | ||
| FR956698A (online.php) * | 1941-09-11 | 1950-02-02 | ||
| GB553064A (en) * | 1941-09-25 | 1943-05-06 | Eastman Kodak Co | Improvements in photographic developers |
| US2364350A (en) * | 1941-11-06 | 1944-12-05 | Eastman Kodak Co | Photographic developer |
| US2400872A (en) * | 1942-09-01 | 1946-05-28 | Eastman Kodak Co | Diamino-nu-alkyl phenazinium salts |
| US2394527A (en) * | 1942-11-04 | 1946-02-05 | Du Pont | Color photography |
| GB576891A (en) * | 1944-05-12 | 1946-04-25 | John David Kendall | Improvements in or relating to colour photography |
| BE465025A (online.php) * | 1945-01-27 | |||
| US2489440A (en) * | 1945-05-03 | 1949-11-29 | Naylor Brothers Ltd | Conveyer |
| US2445252A (en) * | 1947-04-10 | 1948-07-13 | Gen Aniline & Film Corp | Photographic elements containing urethanes of nu-substituted j acids as color formers |
-
1946
- 1946-01-10 US US640382A patent/US2486440A/en not_active Expired - Lifetime
- 1946-12-11 GB GB36617/46A patent/GB644863A/en not_active Expired
-
1947
- 1947-01-03 FR FR939497D patent/FR939497A/fr not_active Expired
- 1947-01-10 BE BE470459D patent/BE470459A/xx unknown
- 1947-12-23 US US793535A patent/US2525503A/en not_active Expired - Lifetime
- 1947-12-23 US US793533A patent/US2524741A/en not_active Expired - Lifetime
- 1947-12-23 US US793536A patent/US2524725A/en not_active Expired - Lifetime
- 1947-12-23 US US793534A patent/US2525502A/en not_active Expired - Lifetime
-
1948
- 1948-12-10 FR FR61004D patent/FR61004E/fr not_active Expired
- 1948-12-10 FR FR61005D patent/FR61005E/fr not_active Expired
- 1948-12-10 FR FR61007D patent/FR61007E/fr not_active Expired
- 1948-12-10 FR FR61006D patent/FR61006E/fr not_active Expired
- 1948-12-10 FR FR58855D patent/FR58855E/fr not_active Expired
- 1948-12-14 GB GB32321/48A patent/GB647638A/en not_active Expired
- 1948-12-14 DE DEP24685D patent/DE817554C/de not_active Expired
- 1948-12-14 DE DEP24682A patent/DE837959C/de not_active Expired
- 1948-12-14 DE DEP24686D patent/DE851163C/de not_active Expired
- 1948-12-14 DE DEP24684D patent/DE854889C/de not_active Expired
- 1948-12-14 DE DEP24683A patent/DE850385C/de not_active Expired
- 1948-12-14 GB GB32257/48A patent/GB646348A/en not_active Expired
- 1948-12-14 GB GB32258/48A patent/GB649811A/en not_active Expired
- 1948-12-14 GB GB32322/48A patent/GB646490A/en not_active Expired
- 1948-12-20 CH CH280516D patent/CH280516A/fr unknown
- 1948-12-21 BE BE486430D patent/BE486430A/xx unknown
- 1948-12-21 BE BE486433D patent/BE486433A/xx unknown
- 1948-12-21 BE BE486434D patent/BE486434A/xx unknown
- 1948-12-22 CH CH280517D patent/CH280517A/fr unknown
- 1948-12-22 CH CH283788D patent/CH283788A/de unknown
- 1948-12-22 CH CH283787D patent/CH283787A/de unknown
- 1948-12-22 CH CH280518D patent/CH280518A/fr unknown
-
1949
- 1949-01-01 DE DEP29268A patent/DE848155C/de not_active Expired
- 1949-01-15 BE BE486432D patent/BE486432A/xx unknown
- 1949-01-15 BE BE486431D patent/BE486431A/xx unknown
- 1949-06-28 US US101913A patent/US2570116A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE486431A (online.php) | 1948-12-21 |
| FR939497A (fr) | 1948-11-16 |
| CH280516A (fr) | 1952-01-31 |
| DE837959C (de) | 1952-05-05 |
| FR61007E (fr) | 1955-03-23 |
| FR61005E (fr) | 1955-03-23 |
| GB646348A (en) | 1950-11-22 |
| CH283787A (de) | 1952-06-30 |
| CH283788A (de) | 1952-06-30 |
| GB644863A (en) | 1950-10-18 |
| US2525502A (en) | 1950-10-10 |
| FR61006E (fr) | 1955-03-23 |
| DE851163C (de) | 1952-10-02 |
| FR61004E (fr) | 1955-03-23 |
| BE470459A (online.php) | 1947-02-28 |
| CH280518A (fr) | 1952-01-31 |
| US2524725A (en) | 1950-10-03 |
| BE486433A (online.php) | 1949-01-15 |
| US2525503A (en) | 1950-10-10 |
| GB646490A (en) | 1950-11-22 |
| DE850385C (de) | 1952-09-25 |
| GB647638A (en) | 1950-12-20 |
| BE486432A (online.php) | 1949-01-15 |
| US2570116A (en) | 1951-10-02 |
| US2524741A (en) | 1950-10-03 |
| BE486430A (online.php) | 1949-01-16 |
| BE486434A (online.php) | 1949-01-15 |
| CH280517A (fr) | 1952-01-31 |
| FR58855E (fr) | 1954-04-06 |
| US2486440A (en) | 1949-11-01 |
| DE848155C (de) | 1952-11-04 |
| GB649811A (en) | 1951-01-31 |
| DE854889C (de) | 1952-11-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE817554C (de) | Verfahren zur Erzeugung von Phenazoniumfarbstoffbildern | |
| DE3333227A1 (de) | Verfahren zur behandlung bzw. entwicklung von lichtempfindlichen photographischen silberhalogenidmaterialien | |
| DE3032684A1 (de) | Verfahren zur behandlung von farbphotographischen silberhalogenidmaterialien | |
| DE2054060A1 (de) | Photographische Bleichfixierzu sammensetzung | |
| DE2502820A1 (de) | Verfahren zur herstellung von cyanbildern | |
| DE966410C (de) | Verfahren zum Bleichfixieren von photographischen Silberbildern | |
| CH646534A5 (de) | Unbelichtete, nicht entwickelte farbphotographische silberhalogenidemulsion und farbentwicklerbad. | |
| DE69315534T2 (de) | Zusatz für eine wässrige photographische stabilisierungslösung | |
| DE2515771A1 (de) | Verfahren zur erzeugung eines farbphotographischen bildes | |
| DE2263863A1 (de) | Fuer die schnellentwicklung geeignetes lichtempfindliches, silberhalogenidhaltiges farbfotografisches material | |
| DE1547876A1 (de) | Verfahren zur Behandlung eines farbenphotographischen lichtempfindlichen Materials | |
| DE1814834A1 (de) | Photographische Verarbeitungsfluessigkeit | |
| DE1772123C2 (de) | Verfahren zur Entwicklung silberhalogenidhaltiger Aufzeichnungsmaterialien | |
| DE2716136A1 (de) | Verfahren zur verarbeitung von silberfarbbleichmaterialien | |
| DE2205115A1 (de) | Zusammensetzung für die Behandlung eines lichtempfindlichen photographischen Silberhalogenidelements | |
| DE1472850A1 (de) | Verwendung von 5-Mercaptotetrazolen bei der Entwicklung von mehrschichtigem farbphotographischem Material | |
| DE827901C (de) | Verfahren zur Herstellung von gelben Farbstoffbildern durch farbbildende Entwicklung | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE968447C (de) | Verfahren zur gleichmaessigen Entwicklung von belichteten, mehrschichtigen Farbumkehrfilmen | |
| DE1931122B2 (de) | Photographischer Farbentwickler | |
| DE2146668A1 (de) | Verfahren zur Stabilisierung eines Farbbildes in der Silberhalogenidfarbphotographie | |
| CH516818A (de) | Verfahren zur Herstellung photographischer Kopien nach dem Silbersalzdiffusionsverfahren | |
| DE954311C (de) | Verfahren zur Herstellung von farbigen Bildern durch chromogene Entwicklung | |
| DE1547906A1 (de) | Photographischer Entwickler | |
| DE2102713A1 (de) | Härtende Bleichfixierbäder |