DE3309516A1 - Verfahren zur herstellung therapeutischer praeparate mit anhaltender freisetzung auf der basis von hydroxypropylmethylzellulose mit hohem molekulargewicht - Google Patents
Verfahren zur herstellung therapeutischer praeparate mit anhaltender freisetzung auf der basis von hydroxypropylmethylzellulose mit hohem molekulargewichtInfo
- Publication number
- DE3309516A1 DE3309516A1 DE3309516A DE3309516A DE3309516A1 DE 3309516 A1 DE3309516 A1 DE 3309516A1 DE 3309516 A DE3309516 A DE 3309516A DE 3309516 A DE3309516 A DE 3309516A DE 3309516 A1 DE3309516 A1 DE 3309516A1
- Authority
- DE
- Germany
- Prior art keywords
- tablets
- methocel
- weight
- cellulose
- release
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 title claims description 41
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 title claims description 38
- 238000004519 manufacturing process Methods 0.000 title claims description 18
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 title claims description 17
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 title claims description 16
- 238000002360 preparation method Methods 0.000 title claims description 8
- 230000001225 therapeutic effect Effects 0.000 title description 7
- 230000002045 lasting effect Effects 0.000 title description 3
- 239000000203 mixture Substances 0.000 claims description 51
- 239000000126 substance Substances 0.000 claims description 39
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 claims description 39
- 239000003814 drug Substances 0.000 claims description 35
- 229940079593 drug Drugs 0.000 claims description 27
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical group CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 claims description 19
- 229960001138 acetylsalicylic acid Drugs 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 19
- 229960000278 theophylline Drugs 0.000 claims description 17
- XGZVUEUWXADBQD-UHFFFAOYSA-L lithium carbonate Chemical compound [Li+].[Li+].[O-]C([O-])=O XGZVUEUWXADBQD-UHFFFAOYSA-L 0.000 claims description 16
- 229910052808 lithium carbonate Inorganic materials 0.000 claims description 16
- MOYKHGMNXAOIAT-JGWLITMVSA-N isosorbide dinitrate Chemical compound [O-][N+](=O)O[C@H]1CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 MOYKHGMNXAOIAT-JGWLITMVSA-N 0.000 claims description 13
- 229960000201 isosorbide dinitrate Drugs 0.000 claims description 13
- -1 hydroxypropoxyl Chemical group 0.000 claims description 12
- GRVDJDISBSALJP-UHFFFAOYSA-N methyloxidanyl Chemical group [O]C GRVDJDISBSALJP-UHFFFAOYSA-N 0.000 claims description 12
- SNIOPGDIGTZGOP-UHFFFAOYSA-N Nitroglycerin Chemical compound [O-][N+](=O)OCC(O[N+]([O-])=O)CO[N+]([O-])=O SNIOPGDIGTZGOP-UHFFFAOYSA-N 0.000 claims description 11
- 239000000006 Nitroglycerin Substances 0.000 claims description 7
- 229960003711 glyceryl trinitrate Drugs 0.000 claims description 7
- 239000007787 solid Substances 0.000 claims description 7
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 claims description 6
- 229920003086 cellulose ether Polymers 0.000 claims description 6
- 239000003795 chemical substances by application Substances 0.000 claims description 6
- 230000008569 process Effects 0.000 claims description 6
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 claims description 4
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 claims description 4
- RYYVLZVUVIJVGH-UHFFFAOYSA-N caffeine Chemical compound CN1C(=O)N(C)C(=O)C2=C1N=CN2C RYYVLZVUVIJVGH-UHFFFAOYSA-N 0.000 claims description 4
- OROGSEYTTFOCAN-DNJOTXNNSA-N codeine Chemical compound C([C@H]1[C@H](N(CC[C@@]112)C)C3)=C[C@H](O)[C@@H]1OC1=C2C3=CC=C1OC OROGSEYTTFOCAN-DNJOTXNNSA-N 0.000 claims description 4
- 229960002390 flurbiprofen Drugs 0.000 claims description 4
- SYTBZMRGLBWNTM-UHFFFAOYSA-N flurbiprofen Chemical compound FC1=CC(C(C(O)=O)C)=CC=C1C1=CC=CC=C1 SYTBZMRGLBWNTM-UHFFFAOYSA-N 0.000 claims description 4
- 229920000609 methyl cellulose Polymers 0.000 claims description 4
- 239000001923 methylcellulose Substances 0.000 claims description 4
- 235000010981 methylcellulose Nutrition 0.000 claims description 4
- UCSJYZPVAKXKNQ-HZYVHMACSA-N streptomycin Chemical compound CN[C@H]1[C@H](O)[C@@H](O)[C@H](CO)O[C@H]1O[C@@H]1[C@](C=O)(O)[C@H](C)O[C@H]1O[C@@H]1[C@@H](NC(N)=N)[C@H](O)[C@@H](NC(N)=N)[C@H](O)[C@H]1O UCSJYZPVAKXKNQ-HZYVHMACSA-N 0.000 claims description 4
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 3
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 3
- 229960001259 diclofenac Drugs 0.000 claims description 3
- DCOPUUMXTXDBNB-UHFFFAOYSA-N diclofenac Chemical compound OC(=O)CC1=CC=CC=C1NC1=C(Cl)C=CC=C1Cl DCOPUUMXTXDBNB-UHFFFAOYSA-N 0.000 claims description 3
- DLNKOYKMWOXYQA-UHFFFAOYSA-N dl-pseudophenylpropanolamine Natural products CC(N)C(O)C1=CC=CC=C1 DLNKOYKMWOXYQA-UHFFFAOYSA-N 0.000 claims description 3
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 claims description 3
- DLNKOYKMWOXYQA-APPZFPTMSA-N phenylpropanolamine Chemical compound C[C@@H](N)[C@H](O)C1=CC=CC=C1 DLNKOYKMWOXYQA-APPZFPTMSA-N 0.000 claims description 3
- 229960000395 phenylpropanolamine Drugs 0.000 claims description 3
- 239000001103 potassium chloride Substances 0.000 claims description 3
- 235000011164 potassium chloride Nutrition 0.000 claims description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 3
- 230000002459 sustained effect Effects 0.000 claims description 3
- 229930000680 A04AD01 - Scopolamine Natural products 0.000 claims description 2
- 108010072661 Angiotensin Amide Proteins 0.000 claims description 2
- STECJAGHUSJQJN-GAUPFVANSA-N Hyoscine Natural products C1([C@H](CO)C(=O)OC2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-GAUPFVANSA-N 0.000 claims description 2
- XQFRJNBWHJMXHO-RRKCRQDMSA-N IDUR Chemical compound C1[C@H](O)[C@@H](CO)O[C@H]1N1C(=O)NC(=O)C(I)=C1 XQFRJNBWHJMXHO-RRKCRQDMSA-N 0.000 claims description 2
- LPHGQDQBBGAPDZ-UHFFFAOYSA-N Isocaffeine Natural products CN1C(=O)N(C)C(=O)C2=C1N(C)C=N2 LPHGQDQBBGAPDZ-UHFFFAOYSA-N 0.000 claims description 2
- XADCESSVHJOZHK-UHFFFAOYSA-N Meperidine Chemical compound C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 XADCESSVHJOZHK-UHFFFAOYSA-N 0.000 claims description 2
- STECJAGHUSJQJN-UHFFFAOYSA-N N-Methyl-scopolamin Natural products C1C(C2C3O2)N(C)C3CC1OC(=O)C(CO)C1=CC=CC=C1 STECJAGHUSJQJN-UHFFFAOYSA-N 0.000 claims description 2
- CMWTZPSULFXXJA-UHFFFAOYSA-N Naproxen Natural products C1=C(C(C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-UHFFFAOYSA-N 0.000 claims description 2
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 claims description 2
- 229930013930 alkaloid Natural products 0.000 claims description 2
- FFMONIZWAPKQCW-CGHBYZBKSA-N angiotensinamide Chemical compound C([C@H](NC(=O)[C@@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](N)CC(N)=O)C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC=1[N]C=NC=1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](CC=1C=CC=CC=1)C(O)=O)C1=CC=C(O)C=C1 FFMONIZWAPKQCW-CGHBYZBKSA-N 0.000 claims description 2
- 229960001119 angiotensinamide Drugs 0.000 claims description 2
- 229960005070 ascorbic acid Drugs 0.000 claims description 2
- 235000010323 ascorbic acid Nutrition 0.000 claims description 2
- 239000011668 ascorbic acid Substances 0.000 claims description 2
- 229960005274 benzocaine Drugs 0.000 claims description 2
- ZDIGNSYAACHWNL-UHFFFAOYSA-N brompheniramine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Br)C=C1 ZDIGNSYAACHWNL-UHFFFAOYSA-N 0.000 claims description 2
- 229960000725 brompheniramine Drugs 0.000 claims description 2
- 229960001948 caffeine Drugs 0.000 claims description 2
- VJEONQKOZGKCAK-UHFFFAOYSA-N caffeine Natural products CN1C(=O)N(C)C(=O)C2=C1C=CN2C VJEONQKOZGKCAK-UHFFFAOYSA-N 0.000 claims description 2
- SOYKEARSMXGVTM-UHFFFAOYSA-N chlorphenamine Chemical compound C=1C=CC=NC=1C(CCN(C)C)C1=CC=C(Cl)C=C1 SOYKEARSMXGVTM-UHFFFAOYSA-N 0.000 claims description 2
- 229960003291 chlorphenamine Drugs 0.000 claims description 2
- 229960004126 codeine Drugs 0.000 claims description 2
- RCKMWOKWVGPNJF-UHFFFAOYSA-N diethylcarbamazine Chemical compound CCN(CC)C(=O)N1CCN(C)CC1 RCKMWOKWVGPNJF-UHFFFAOYSA-N 0.000 claims description 2
- 229960003974 diethylcarbamazine Drugs 0.000 claims description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical compound C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 2
- 229960000520 diphenhydramine Drugs 0.000 claims description 2
- 150000001469 hydantoins Chemical class 0.000 claims description 2
- OROGSEYTTFOCAN-UHFFFAOYSA-N hydrocodone Natural products C1C(N(CCC234)C)C2C=CC(O)C3OC2=C4C1=CC=C2OC OROGSEYTTFOCAN-UHFFFAOYSA-N 0.000 claims description 2
- 229960004716 idoxuridine Drugs 0.000 claims description 2
- 229960002009 naproxen Drugs 0.000 claims description 2
- CMWTZPSULFXXJA-VIFPVBQESA-N naproxen Chemical compound C1=C([C@H](C)C(O)=O)C=CC2=CC(OC)=CC=C21 CMWTZPSULFXXJA-VIFPVBQESA-N 0.000 claims description 2
- NCYVXEGFNDZQCU-UHFFFAOYSA-N nikethamide Chemical compound CCN(CC)C(=O)C1=CC=CN=C1 NCYVXEGFNDZQCU-UHFFFAOYSA-N 0.000 claims description 2
- 229960003226 nikethamide Drugs 0.000 claims description 2
- 229960000482 pethidine Drugs 0.000 claims description 2
- CPJSUEIXXCENMM-UHFFFAOYSA-N phenacetin Chemical compound CCOC1=CC=C(NC(C)=O)C=C1 CPJSUEIXXCENMM-UHFFFAOYSA-N 0.000 claims description 2
- 229960003893 phenacetin Drugs 0.000 claims description 2
- SONNWYBIRXJNDC-VIFPVBQESA-N phenylephrine Chemical compound CNC[C@H](O)C1=CC=CC(O)=C1 SONNWYBIRXJNDC-VIFPVBQESA-N 0.000 claims description 2
- 229960001802 phenylephrine Drugs 0.000 claims description 2
- REQCZEXYDRLIBE-UHFFFAOYSA-N procainamide Chemical compound CCN(CC)CCNC(=O)C1=CC=C(N)C=C1 REQCZEXYDRLIBE-UHFFFAOYSA-N 0.000 claims description 2
- 229960000244 procainamide Drugs 0.000 claims description 2
- STECJAGHUSJQJN-FWXGHANASA-N scopolamine Chemical compound C1([C@@H](CO)C(=O)O[C@H]2C[C@@H]3N([C@H](C2)[C@@H]2[C@H]3O2)C)=CC=CC=C1 STECJAGHUSJQJN-FWXGHANASA-N 0.000 claims description 2
- 229960002646 scopolamine Drugs 0.000 claims description 2
- 229960005322 streptomycin Drugs 0.000 claims description 2
- 229940124530 sulfonamide Drugs 0.000 claims description 2
- 150000003456 sulfonamides Chemical class 0.000 claims description 2
- 229960005371 tolbutamide Drugs 0.000 claims description 2
- BQJCRHHNABKAKU-KBQPJGBKSA-N morphine Chemical compound O([C@H]1[C@H](C=C[C@H]23)O)C4=C5[C@@]12CCN(C)[C@@H]3CC5=CC=C4O BQJCRHHNABKAKU-KBQPJGBKSA-N 0.000 claims 2
- 229930182555 Penicillin Natural products 0.000 claims 1
- 239000003470 adrenal cortex hormone Chemical class 0.000 claims 1
- 150000007656 barbituric acids Chemical class 0.000 claims 1
- UREBDLICKHMUKA-CXSFZGCWSA-N dexamethasone Chemical compound C1CC2=CC(=O)C=C[C@]2(C)[C@]2(F)[C@@H]1[C@@H]1C[C@@H](C)[C@@](C(=O)CO)(O)[C@@]1(C)C[C@@H]2O UREBDLICKHMUKA-CXSFZGCWSA-N 0.000 claims 1
- 229960003957 dexamethasone Drugs 0.000 claims 1
- HESHRHUZIWVEAJ-JGRZULCMSA-N dihydroergotamine Chemical compound C([C@H]1C(=O)N2CCC[C@H]2[C@]2(O)O[C@@](C(N21)=O)(C)NC(=O)[C@H]1CN([C@H]2[C@@H](C3=CC=CC4=NC=C([C]34)C2)C1)C)C1=CC=CC=C1 HESHRHUZIWVEAJ-JGRZULCMSA-N 0.000 claims 1
- 229960004704 dihydroergotamine Drugs 0.000 claims 1
- 150000002148 esters Chemical class 0.000 claims 1
- 229960000905 indomethacin Drugs 0.000 claims 1
- 229960005181 morphine Drugs 0.000 claims 1
- 150000002960 penicillins Chemical class 0.000 claims 1
- CYHOMWAPJJPNMW-JIGDXULJSA-N tropine Chemical class C1[C@@H](O)C[C@H]2CC[C@@H]1N2C CYHOMWAPJJPNMW-JIGDXULJSA-N 0.000 claims 1
- 239000003826 tablet Substances 0.000 description 158
- 239000004615 ingredient Substances 0.000 description 59
- 229920003094 Methocel™ K4M Polymers 0.000 description 55
- 229920003091 Methocel™ Polymers 0.000 description 36
- 229920002678 cellulose Polymers 0.000 description 36
- 239000001913 cellulose Substances 0.000 description 34
- 235000010980 cellulose Nutrition 0.000 description 33
- 229920003095 Methocel™ K15M Polymers 0.000 description 28
- 239000004480 active ingredient Substances 0.000 description 24
- 238000013270 controlled release Methods 0.000 description 24
- 230000001186 cumulative effect Effects 0.000 description 23
- 235000021355 Stearic acid Nutrition 0.000 description 14
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 14
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 14
- 239000008117 stearic acid Substances 0.000 description 14
- 238000013268 sustained release Methods 0.000 description 14
- 239000012730 sustained-release form Substances 0.000 description 14
- 239000002552 dosage form Substances 0.000 description 11
- 239000007937 lozenge Substances 0.000 description 11
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 10
- 229920003102 Methocel™ E4M Polymers 0.000 description 7
- 230000006835 compression Effects 0.000 description 7
- 238000007906 compression Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 239000006189 buccal tablet Substances 0.000 description 5
- 239000012530 fluid Substances 0.000 description 5
- 235000019359 magnesium stearate Nutrition 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- 239000007891 compressed tablet Substances 0.000 description 4
- 239000000470 constituent Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 210000001035 gastrointestinal tract Anatomy 0.000 description 4
- 210000001519 tissue Anatomy 0.000 description 4
- GUBGYTABKSRVRQ-DCSYEGIMSA-N Beta-Lactose Chemical compound OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-DCSYEGIMSA-N 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000008366 buffered solution Substances 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000007939 sustained release tablet Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- HEFNNWSXXWATRW-UHFFFAOYSA-N Ibuprofen Chemical compound CC(C)CC1=CC=C(C(C)C(O)=O)C=C1 HEFNNWSXXWATRW-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000007958 cherry flavor Substances 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000003172 expectorant agent Substances 0.000 description 2
- 229960001680 ibuprofen Drugs 0.000 description 2
- 230000005923 long-lasting effect Effects 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000002085 persistent effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000000506 psychotropic effect Effects 0.000 description 2
- 239000006215 rectal suppository Substances 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 239000007909 solid dosage form Substances 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 239000006216 vaginal suppository Substances 0.000 description 2
- 230000002792 vascular Effects 0.000 description 2
- UBVSIAHUTXHQTD-UHFFFAOYSA-N 2-n-(4-bromophenyl)-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC=NC(NC=2C=CC(Br)=CC=2)=N1 UBVSIAHUTXHQTD-UHFFFAOYSA-N 0.000 description 1
- 102220487426 Actin-related protein 2/3 complex subunit 3_K15M_mutation Human genes 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- 206010002383 Angina Pectoris Diseases 0.000 description 1
- 208000020925 Bipolar disease Diseases 0.000 description 1
- 229920013683 Celanese Polymers 0.000 description 1
- BGSOJVFOEQLVMH-UHFFFAOYSA-N Hydrocortisone phosphate Natural products O=C1CCC2(C)C3C(O)CC(C)(C(CC4)(O)C(=O)COP(O)(O)=O)C4C3CCC2=C1 BGSOJVFOEQLVMH-UHFFFAOYSA-N 0.000 description 1
- 206010020601 Hyperchlorhydria Diseases 0.000 description 1
- 235000014749 Mentha crispa Nutrition 0.000 description 1
- 244000078639 Mentha spicata Species 0.000 description 1
- 208000019695 Migraine disease Diseases 0.000 description 1
- 239000000866 Neuromuscular Agent Substances 0.000 description 1
- 108010040201 Polymyxins Proteins 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical class C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 description 1
- 208000025865 Ulcer Diseases 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000003263 anabolic agent Substances 0.000 description 1
- 229940070021 anabolic steroids Drugs 0.000 description 1
- 229940035676 analgesics Drugs 0.000 description 1
- 230000000954 anitussive effect Effects 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 239000000730 antalgic agent Substances 0.000 description 1
- 239000004004 anti-anginal agent Substances 0.000 description 1
- 230000001088 anti-asthma Effects 0.000 description 1
- 230000003474 anti-emetic effect Effects 0.000 description 1
- 230000002924 anti-infective effect Effects 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- 230000001062 anti-nausea Effects 0.000 description 1
- 239000000883 anti-obesity agent Substances 0.000 description 1
- 230000002921 anti-spasmodic effect Effects 0.000 description 1
- 230000002785 anti-thrombosis Effects 0.000 description 1
- 229940124345 antianginal agent Drugs 0.000 description 1
- 239000000924 antiasthmatic agent Substances 0.000 description 1
- 229940127219 anticoagulant drug Drugs 0.000 description 1
- 239000003472 antidiabetic agent Substances 0.000 description 1
- 239000003793 antidiarrheal agent Substances 0.000 description 1
- 229940125683 antiemetic agent Drugs 0.000 description 1
- 239000002111 antiemetic agent Substances 0.000 description 1
- 229960003965 antiepileptics Drugs 0.000 description 1
- 239000000739 antihistaminic agent Substances 0.000 description 1
- 229940125715 antihistaminic agent Drugs 0.000 description 1
- 229960005475 antiinfective agent Drugs 0.000 description 1
- 239000000228 antimanic agent Substances 0.000 description 1
- 229940125710 antiobesity agent Drugs 0.000 description 1
- 229940124575 antispasmodic agent Drugs 0.000 description 1
- 229940043671 antithyroid preparations Drugs 0.000 description 1
- 239000003434 antitussive agent Substances 0.000 description 1
- 229940124584 antitussives Drugs 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- HNYOPLTXPVRDBG-UHFFFAOYSA-N barbituric acid Chemical compound O=C1CC(=O)NC(=O)N1 HNYOPLTXPVRDBG-UHFFFAOYSA-N 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 208000028683 bipolar I disease Diseases 0.000 description 1
- 230000036772 blood pressure Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000011365 complex material Substances 0.000 description 1
- 208000029078 coronary artery disease Diseases 0.000 description 1
- 239000003218 coronary vasodilator agent Substances 0.000 description 1
- BGSOJVFOEQLVMH-VWUMJDOOSA-N cortisol phosphate Chemical compound O=C1CC[C@]2(C)[C@H]3[C@@H](O)C[C@](C)([C@@](CC4)(O)C(=O)COP(O)(O)=O)[C@@H]4[C@@H]3CCC2=C1 BGSOJVFOEQLVMH-VWUMJDOOSA-N 0.000 description 1
- 230000000593 degrading effect Effects 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000001066 destructive effect Effects 0.000 description 1
- 229960001193 diclofenac sodium Drugs 0.000 description 1
- 229940079920 digestives acid preparations Drugs 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000035475 disorder Diseases 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 239000002934 diuretic Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 239000002702 enteric coating Substances 0.000 description 1
- 238000009505 enteric coating Methods 0.000 description 1
- 230000000913 erythropoietic effect Effects 0.000 description 1
- 235000012732 erythrosine Nutrition 0.000 description 1
- 230000003419 expectorant effect Effects 0.000 description 1
- 229940066493 expectorants Drugs 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229940127022 high-dose drug Drugs 0.000 description 1
- 229950000785 hydrocortisone phosphate Drugs 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 230000003345 hyperglycaemic effect Effects 0.000 description 1
- 239000003326 hypnotic agent Substances 0.000 description 1
- 230000000147 hypnotic effect Effects 0.000 description 1
- 229940126904 hypoglycaemic agent Drugs 0.000 description 1
- 230000000415 inactivating effect Effects 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 239000008141 laxative Substances 0.000 description 1
- 229940125722 laxative agent Drugs 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 206010027599 migraine Diseases 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000008368 mint flavor Substances 0.000 description 1
- 230000000510 mucolytic effect Effects 0.000 description 1
- 229940066491 mucolytics Drugs 0.000 description 1
- 230000009854 mucosal lesion Effects 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- 239000004081 narcotic agent Substances 0.000 description 1
- PZCAZWWYYBZBPV-UHFFFAOYSA-N o-(1-phenylpropyl)hydroxylamine Chemical compound CCC(ON)C1=CC=CC=C1 PZCAZWWYYBZBPV-UHFFFAOYSA-N 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 239000007967 peppermint flavor Substances 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 229940001470 psychoactive drug Drugs 0.000 description 1
- 239000004089 psychotropic agent Substances 0.000 description 1
- 230000001047 pyretic effect Effects 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- JGMJQSFLQWGYMQ-UHFFFAOYSA-M sodium;2,6-dichloro-n-phenylaniline;acetate Chemical compound [Na+].CC([O-])=O.ClC1=CC=CC(Cl)=C1NC1=CC=CC=C1 JGMJQSFLQWGYMQ-UHFFFAOYSA-M 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 229940101521 theophylline 300 mg Drugs 0.000 description 1
- 210000001685 thyroid gland Anatomy 0.000 description 1
- 229940043672 thyroid preparations Drugs 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 230000004580 weight loss Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2004—Excipients; Inactive ingredients
- A61K9/2022—Organic macromolecular compounds
- A61K9/205—Polysaccharides, e.g. alginate, gums; Cyclodextrin
- A61K9/2054—Cellulose; Cellulose derivatives, e.g. hydroxypropyl methylcellulose
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/362,104 US4389393A (en) | 1982-03-26 | 1982-03-26 | Sustained release therapeutic compositions based on high molecular weight hydroxypropylmethylcellulose |
| BR8300260A BR8300260A (pt) | 1982-03-26 | 1983-01-19 | Processo para a preparacao de hidroxipropilmetilcelulose |
| AU56761/86A AU583616B2 (en) | 1982-03-26 | 1986-04-28 | Sustained release therapeutic compositions based on high molecular weight hydroxypropylmethylcellulose |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3309516A1 true DE3309516A1 (de) | 1983-12-01 |
| DE3309516C2 DE3309516C2 (enExample) | 1988-03-24 |
Family
ID=36910975
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE3309516A Granted DE3309516A1 (de) | 1982-03-26 | 1983-03-17 | Verfahren zur herstellung therapeutischer praeparate mit anhaltender freisetzung auf der basis von hydroxypropylmethylzellulose mit hohem molekulargewicht |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4389393A (enExample) |
| JP (2) | JPS58174311A (enExample) |
| AR (1) | AR230569A1 (enExample) |
| AU (1) | AU583616B2 (enExample) |
| BE (1) | BE896136A (enExample) |
| BR (1) | BR8300260A (enExample) |
| CA (1) | CA1188614A (enExample) |
| CH (1) | CH655241A5 (enExample) |
| DE (1) | DE3309516A1 (enExample) |
| DK (1) | DK161014C (enExample) |
| ES (1) | ES520994A0 (enExample) |
| FR (1) | FR2523845B1 (enExample) |
| GB (1) | GB2117239B (enExample) |
| IL (1) | IL68233A (enExample) |
| IT (1) | IT1171119B (enExample) |
| MX (1) | MX155695A (enExample) |
| NL (1) | NL8301042A (enExample) |
| SE (1) | SE453797B (enExample) |
| ZA (1) | ZA831817B (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3603564A1 (de) * | 1985-02-08 | 1986-08-14 | Ciba-Geigy GmbH, 7867 Wehr | Pharmazeutische praeparate mit analgetrischer wirksamkeit, sowie deren herstellung und verwendung |
| DE4329794A1 (de) * | 1993-09-03 | 1995-03-09 | Gruenenthal Gmbh | Tramadolsalz enthaltende Arzneimittel mit verzögerter Wirkstofffreisetzung |
| DE10224108A1 (de) * | 2002-05-29 | 2004-01-29 | Grünenthal GmbH | 1-Dimethylamino-3-(3-methoxy-phenyl)-2-methyl-pentan-3-ol enthaltendes Arzneimiitel mit verzögerter Wirkstofffreisetzung |
| US7410965B2 (en) | 2002-05-29 | 2008-08-12 | Gruenenthal Gmbh | Delayed release pharmaceutical composition containing 1-dimethyl-amino-3-(3-methoxyphenyl)-2-methyl-pentan-3-ol |
| US7786160B2 (en) | 2002-11-22 | 2010-08-31 | Gruenenthal Gmbh | Combination of selected analgesics and COX-II inhibitors |
| US11007156B2 (en) | 2001-10-24 | 2021-05-18 | Gruenenthal Gmbh | Prolonged release pharmaceutical composition containing 3-(3-dimethylamino-1-ethyl-2-methyl-propyl)phenol |
Families Citing this family (317)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4468465A (en) * | 1982-09-07 | 1984-08-28 | Sato Clifford S | Diagnosing cancer by observing marker glycosaminoglycans extracted from patient |
| US4591500A (en) * | 1983-04-25 | 1986-05-27 | Microencapsulation S.A. | Tablet having the shape of a capsule, process and device for its preparation |
| US4571333A (en) * | 1983-06-14 | 1986-02-18 | Syntex (U.S.A.) Inc. | Controlled release naproxen and naproxen sodium tablets |
| JPH0662404B2 (ja) * | 1983-06-14 | 1994-08-17 | シンテックス・ファーマシユーテイカルズ・インターナシヨナル・リミテツド | 制御放出性ナプロキセンおよびナプロキセンナトリウム錠 |
| JPS6032714A (ja) * | 1983-08-01 | 1985-02-19 | Teijin Ltd | 鼻腔粘膜に適用するための安定化された粉末状薬学的組成物 |
| JPS6038322A (ja) * | 1983-08-11 | 1985-02-27 | Fujisawa Pharmaceut Co Ltd | ジヒドロピリジンa物質含有易溶性固形製剤 |
| US4533674A (en) * | 1983-10-24 | 1985-08-06 | Basf Wyandotte Corporation | Process for preparing a sugar and starch free spray-dried vitamin C powder containing 90 percent ascorbic acid |
| JPS61500435A (ja) * | 1983-10-24 | 1986-03-13 | バスフ・コーポレーション | 水溶性ビタミンを含有する噴霧乾燥された粉末及びこの方法により製造された粉末 |
| US4605666A (en) * | 1983-10-24 | 1986-08-12 | Basf Corporation | Process for preparing spray-dried powders containing a water-soluble vitamin and powders prepared thereby |
| US4680323A (en) * | 1983-12-01 | 1987-07-14 | Hans Lowey | Method and composition for the preparation of controlled long-acting pharmaceuticals for oral administration |
| KR850700212A (ko) * | 1984-03-21 | 1985-12-26 | 죠지 드모트 | 서방성 약제학적 캼셀제 |
| EP0178299A4 (en) * | 1984-03-21 | 1987-04-28 | Key Pharma | Sustained release oral dosage form for naproxyn. |
| US4795327A (en) * | 1984-03-26 | 1989-01-03 | Forest Laboratories, Inc. | Controlled release solid drug dosage forms based on mixtures of water soluble nonionic cellulose ethers and anionic surfactants |
| US4540566A (en) * | 1984-04-02 | 1985-09-10 | Forest Laboratories, Inc. | Prolonged release drug dosage forms based on modified low viscosity grade hydroxypropylmethylcellulose |
| US5855908A (en) * | 1984-05-01 | 1999-01-05 | University Of Utah Research Foundation | Non-dissolvable drug-containing dosage-forms for use in the transmucosal delivery of a drug to a patient |
| GB8414220D0 (en) * | 1984-06-04 | 1984-07-11 | Sterwin Ag | Medicaments in unit dose form |
| GB8414221D0 (en) * | 1984-06-04 | 1984-07-11 | Sterwin Ag | Unit dosage form |
| US4532244A (en) * | 1984-09-06 | 1985-07-30 | Innes Margaret N | Method of treating migraine headaches |
| US4610870A (en) * | 1984-10-05 | 1986-09-09 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| US5069911A (en) * | 1985-02-05 | 1991-12-03 | Sandoz Ltd. | Pharmaceutical 9,10-dihydrogenated ergot alkaloid containing compositions |
| GB8524135D0 (en) * | 1985-10-01 | 1985-11-06 | Sandoz Ltd | Darodipine compositions |
| DE3674234D1 (de) * | 1985-02-28 | 1990-10-25 | Dow Chemical Co | Hydroxypropylmethylcellulose verwendbar als suspendierungsmittel fuer die perlpolymerisation von vinylchlorid. |
| US4612345A (en) * | 1985-02-28 | 1986-09-16 | The Dow Chemical Company | Hydroxypropyl methyl cellulose ethers useful as suspending agents for suspension polymerization of vinyl chloride |
| US4601894A (en) * | 1985-03-29 | 1986-07-22 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4657757A (en) * | 1985-03-29 | 1987-04-14 | Schering Corporation | Controlled release dosage form comprising acetaminophen, pseudoephedrine sulfate and dexbrompheniramine maleate |
| US4695591A (en) * | 1985-03-29 | 1987-09-22 | Schering Corporation | Controlled release dosage forms comprising hydroxypropylmethylcellulose |
| US4885173A (en) * | 1985-05-01 | 1989-12-05 | University Of Utah | Methods and compositions for noninvasive dose-to-effect administration of drugs with cardiovascular or renal vascular activities |
| US5785989A (en) * | 1985-05-01 | 1998-07-28 | University Utah Research Foundation | Compositions and methods of manufacturing of oral dissolvable medicaments |
| US5783207A (en) * | 1985-05-01 | 1998-07-21 | University Of Utah Research Foundation | Selectively removable nicotine-containing dosage form for use in the transmucosal delivery of nicotine |
| US4666705A (en) * | 1985-06-03 | 1987-05-19 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| CH666405A5 (de) * | 1985-06-24 | 1988-07-29 | Ciba Geigy Ag | Feste, haltbare darreichungsformen mit elastischem filmueberzug. |
| WO1987000044A1 (en) * | 1985-07-02 | 1987-01-15 | The Upjohn Company | Therapeutic formulations with bimodal release characteristics |
| GB2181053B (en) * | 1985-10-01 | 1990-05-23 | Sandoz Ltd | Pharmaceutical formulations with controlled release of the active substance |
| US4734285A (en) * | 1985-10-28 | 1988-03-29 | The Dow Chemical Company | Sustained release compositions |
| US4704285A (en) * | 1985-11-18 | 1987-11-03 | The Dow Chemical Company | Sustained release compositions comprising hydroxypropyl cellulose ethers |
| IT1188212B (it) * | 1985-12-20 | 1988-01-07 | Paolo Colombo | Sistema per il rilascio a velocita' controllata di sostanze attive |
| IE63321B1 (en) * | 1986-02-03 | 1995-04-05 | Elan Corp Plc | Drug delivery system |
| US4837032A (en) * | 1986-02-04 | 1989-06-06 | Farval Ag | Theophylline sustained release tablet |
| GB8608080D0 (en) * | 1986-04-02 | 1986-05-08 | Fujisawa Pharmaceutical Co | Solid dispersion composition |
| US4775535A (en) * | 1986-04-04 | 1988-10-04 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4855143A (en) * | 1986-04-04 | 1989-08-08 | Hans Lowey | Method of preparing controlled long-acting pharmaceutical formulations in unit dosage form having uniform and comparable bioavailability characteristics |
| US4756911A (en) * | 1986-04-16 | 1988-07-12 | E. R. Squibb & Sons, Inc. | Controlled release formulation |
| US4816264A (en) * | 1986-06-06 | 1989-03-28 | Warner-Lambert Company | Sustained release formulations |
| EP0249343B1 (en) * | 1986-06-13 | 1992-01-08 | Alza Corporation | Moisture activation of transdermal drug delivery system |
| US4983400A (en) * | 1986-06-16 | 1991-01-08 | Merck & Co., Inc. | Controlled release combination of carbidopa/levodopa |
| US4832957A (en) * | 1987-12-11 | 1989-05-23 | Merck & Co., Inc. | Controlled release combination of carbidopa/levodopa |
| US4859467A (en) * | 1986-09-25 | 1989-08-22 | Colgate-Palmotive Company | Sustained release fluoride composition |
| US4851233A (en) * | 1986-10-06 | 1989-07-25 | Warner-Lambert Company | Sustained release formulations |
| GB8624213D0 (en) * | 1986-10-09 | 1986-11-12 | Sandoz Canada Inc | Sustained release pharmaceutical compositions |
| US4752470A (en) * | 1986-11-24 | 1988-06-21 | Mehta Atul M | Controlled release indomethacin |
| US5015479A (en) * | 1987-02-02 | 1991-05-14 | Seamus Mulligan | Sustained release capsule or tablet formulation comprising a pharmaceutically acceptable dihydropyridine |
| US4851232A (en) * | 1987-02-13 | 1989-07-25 | Alza Corporation | Drug delivery system with means for obtaining desirable in vivo release rate pattern |
| US4968508A (en) * | 1987-02-27 | 1990-11-06 | Eli Lilly And Company | Sustained release matrix |
| DE3887179T2 (de) * | 1987-03-02 | 1994-06-16 | Brocades Pharma Bv | Pharmazeutische Zusammensetzung, pharmazeutisches Granulat und Verfahren zu ihrer Herstellung. |
| US5071656A (en) * | 1987-03-05 | 1991-12-10 | Alza Corporation | Delayed onset transdermal delivery device |
| US4789549A (en) * | 1987-03-09 | 1988-12-06 | Warner-Lambert Company | Sustained release dosage forms |
| US4777050A (en) * | 1987-03-23 | 1988-10-11 | Schering Corporation | Controlled-release dosage form comprising acetaminophen, pseudoephedrine and dexbrompheniramine |
| US4786503A (en) * | 1987-04-06 | 1988-11-22 | Alza Corporation | Dosage form comprising parallel lamine |
| EP0297866A3 (en) * | 1987-07-01 | 1989-12-13 | The Boots Company PLC | Therapeutic agents |
| IT1222414B (it) * | 1987-07-31 | 1990-09-05 | Chiesi Farma Spa | Composizioni farmaceutiche contenenti trapidil,loro procedimento di preparazione e relaticvo impiego terapeutico |
| US4994276A (en) * | 1988-09-19 | 1991-02-19 | Edward Mendell Co., Inc. | Directly compressible sustained release excipient |
| IE60311B1 (en) * | 1987-09-24 | 1994-06-29 | American Home Prod | Sustained release etodolac |
| US4861797A (en) * | 1987-10-15 | 1989-08-29 | Oratech Pharmaceutical Development Corporation | Liquid ibuprofen compositions and methods of making them |
| US4859704A (en) * | 1987-10-15 | 1989-08-22 | Oratech Pharmaceutical Development Corporation | Water soluble ibuprofen compositions and methods of making them |
| US4983398A (en) * | 1987-12-21 | 1991-01-08 | Forest Laboratories, Inc. | Sustained release drug dosage forms containing hydroxypropylmethylcellulose and alkali metal carboxylates |
| US5096714A (en) * | 1988-06-28 | 1992-03-17 | Hauser-Kuhrts, Inc. | Prolonged release drug tablet formulations |
| US5169639A (en) * | 1988-09-19 | 1992-12-08 | Edward Mendell Co., Inc. | Controlled release verapamil tablets |
| US5128143A (en) * | 1988-09-19 | 1992-07-07 | Edward Mendell Co., Inc. | Sustained release excipient and tablet formulation |
| US5135757A (en) * | 1988-09-19 | 1992-08-04 | Edward Mendell Co., Inc. | Compressible sustained release solid dosage forms |
| US4970081A (en) * | 1989-01-03 | 1990-11-13 | Sterling Drug Inc. | Controlled-release, low-dose aspirin formulation and method of treating vascular occlusive disease therewith |
| US5268181A (en) * | 1989-04-13 | 1993-12-07 | Upsher-Smith Laboratories, Inc. | Method of using niacin to control nocturnal cholesterol synthesis |
| US5126145A (en) * | 1989-04-13 | 1992-06-30 | Upsher Smith Laboratories Inc | Controlled release tablet containing water soluble medicament |
| US4973470A (en) * | 1989-06-26 | 1990-11-27 | Warner-Lambert Company | Sustained release pharmaceutical compositions |
| US4992277A (en) * | 1989-08-25 | 1991-02-12 | Schering Corporation | Immediate release diltiazem formulation |
| US5000962A (en) * | 1989-08-25 | 1991-03-19 | Schering Corporation | Long acting diltiazem formulation |
| ES2079485T3 (es) * | 1989-08-25 | 1996-01-16 | Bioglan Ireland R & D Ltd | Composiciones farmaceuticas y un dispositivo para administrar las mismas. |
| US5824334A (en) * | 1989-09-05 | 1998-10-20 | University Of Utah Research Foundation | Tobacco substitute |
| US5009895A (en) * | 1990-02-02 | 1991-04-23 | Merck & Co., Inc. | Sustained release with high and low viscosity HPMC |
| US5232704A (en) * | 1990-12-19 | 1993-08-03 | G. D. Searle & Co. | Sustained release, bilayer buoyant dosage form |
| US5403593A (en) * | 1991-03-04 | 1995-04-04 | Sandoz Ltd. | Melt granulated compositions for preparing sustained release dosage forms |
| US5721221A (en) * | 1991-03-08 | 1998-02-24 | Regents Of The University Of Minnesota | Lowering blood cholesterol levels using water soluble cellulose ethers |
| US5204116A (en) * | 1991-05-01 | 1993-04-20 | Alza Corporation | Dosage form providing immediate therapy followed by prolonged therapy |
| IT1251114B (it) * | 1991-07-26 | 1995-05-04 | Farcon Ag | Forme farmaceutiche antivirali per applicazione vaginale |
| US5811447A (en) | 1993-01-28 | 1998-09-22 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US6515009B1 (en) | 1991-09-27 | 2003-02-04 | Neorx Corporation | Therapeutic inhibitor of vascular smooth muscle cells |
| US5266331A (en) * | 1991-11-27 | 1993-11-30 | Euroceltique, S.A. | Controlled release oxycodone compositions |
| US5478577A (en) * | 1993-11-23 | 1995-12-26 | Euroceltique, S.A. | Method of treating pain by administering 24 hour oral opioid formulations exhibiting rapid rate of initial rise of plasma drug level |
| US5958459A (en) * | 1991-12-24 | 1999-09-28 | Purdue Pharma L.P. | Opioid formulations having extended controlled released |
| US5968551A (en) * | 1991-12-24 | 1999-10-19 | Purdue Pharma L.P. | Orally administrable opioid formulations having extended duration of effect |
| DE69224809T2 (de) * | 1991-12-30 | 1998-07-09 | Akzo Nobel Nv | Thyroaktive Zusammensetzung mit kontrollierter Freigabe |
| ATE135214T1 (de) * | 1992-02-17 | 1996-03-15 | Siegfried Ag Pharma | Darreichungsformen mit verlaengerter wirkstoffreigabe |
| US5252577A (en) * | 1992-03-06 | 1993-10-12 | Gillette Canada, Inc. | Methods of desensitizing teeth |
| US5472711A (en) * | 1992-07-30 | 1995-12-05 | Edward Mendell Co., Inc. | Agglomerated hydrophilic complexes with multi-phasic release characteristics |
| EP1826280A3 (en) | 1992-09-25 | 2007-12-05 | Boston Scientific Limited | Therapeutic conjugates inhibiting vascular smooth muscle cells |
| US20080075781A1 (en) * | 1992-11-25 | 2008-03-27 | Purdue Pharma Lp | Controlled release oxycodone compositions |
| NZ260408A (en) | 1993-05-10 | 1996-05-28 | Euro Celtique Sa | Controlled release preparation comprising tramadol |
| US5993860A (en) * | 1993-06-17 | 1999-11-30 | Venture Lending | NSADI delivery employing a powdered hydrocolloid gum obtainable from higher plants |
| US20070275062A1 (en) * | 1993-06-18 | 2007-11-29 | Benjamin Oshlack | Controlled release oxycodone compositions |
| US7740881B1 (en) | 1993-07-01 | 2010-06-22 | Purdue Pharma Lp | Method of treating humans with opioid formulations having extended controlled release |
| IL110014A (en) * | 1993-07-01 | 1999-11-30 | Euro Celtique Sa | Solid controlled-release oral dosage forms of opioid analgesics |
| US5879705A (en) * | 1993-07-27 | 1999-03-09 | Euro-Celtique S.A. | Sustained release compositions of morphine and a method of preparing pharmaceutical compositions |
| US6746691B2 (en) | 1993-09-20 | 2004-06-08 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia having unique biopharmaceutical characteristics |
| US6818229B1 (en) | 1993-09-20 | 2004-11-16 | Kos Pharmaceuticals, Inc. | Intermediate release nicotinic acid compositions for treating hyperlipidemia |
| US6129930A (en) * | 1993-09-20 | 2000-10-10 | Bova; David J. | Methods and sustained release nicotinic acid compositions for treating hyperlipidemia at night |
| US6676967B1 (en) * | 1993-09-20 | 2004-01-13 | Kos Pharmaceuticals, Inc. | Methods for reducing flushing in individuals being treated with nicotinic acid for hyperlipidemia |
| US6080428A (en) | 1993-09-20 | 2000-06-27 | Bova; David J. | Nicotinic acid compositions for treating hyperlipidemia and related methods therefor |
| US5484607A (en) * | 1993-10-13 | 1996-01-16 | Horacek; H. Joseph | Extended release clonidine formulation |
| KR100354702B1 (ko) * | 1993-11-23 | 2002-12-28 | 유로-셀티크 소시에떼 아노뉨 | 약학조성물의제조방법및서방형조성물 |
| US5891471A (en) * | 1993-11-23 | 1999-04-06 | Euro-Celtique, S.A. | Pharmaceutical multiparticulates |
| US5393765A (en) * | 1993-12-13 | 1995-02-28 | Hoffmann-La Roche Inc. | Pharmaceutical compositions with constant erosion volume for zero order controlled release |
| US5843480A (en) * | 1994-03-14 | 1998-12-01 | Euro-Celtique, S.A. | Controlled release diamorphine formulation |
| US5478572A (en) * | 1994-09-06 | 1995-12-26 | Bristol-Myers Squibb Co. | Gepirone dosage form |
| US6239172B1 (en) * | 1997-04-10 | 2001-05-29 | Nitrosystems, Inc. | Formulations for treating disease and methods of using same |
| US20110196039A9 (en) * | 1994-10-05 | 2011-08-11 | Kaesemeyer Wayne H | Controlled release arginine formulations |
| US5968983A (en) * | 1994-10-05 | 1999-10-19 | Nitrosystems, Inc | Method and formulation for treating vascular disease |
| US6425881B1 (en) * | 1994-10-05 | 2002-07-30 | Nitrosystems, Inc. | Therapeutic mixture useful in inhibiting lesion formation after vascular injury |
| GB9422154D0 (en) * | 1994-11-03 | 1994-12-21 | Euro Celtique Sa | Pharmaceutical compositions and method of producing the same |
| US5965161A (en) * | 1994-11-04 | 1999-10-12 | Euro-Celtique, S.A. | Extruded multi-particulates |
| US5660817A (en) * | 1994-11-09 | 1997-08-26 | Gillette Canada, Inc. | Desensitizing teeth with degradable particles |
| US5728402A (en) * | 1994-11-16 | 1998-03-17 | Andrx Pharmaceuticals Inc. | Controlled release formulation of captopril or a prodrug of captopril |
| US6103263A (en) * | 1994-11-17 | 2000-08-15 | Andrx Pharmaceuticals, Inc. | Delayed pulse release hydrogel matrix tablet |
| US5703073A (en) * | 1995-04-19 | 1997-12-30 | Nitromed, Inc. | Compositions and methods to prevent toxicity induced by nonsteroidal antiinflammatory drugs |
| US5558879A (en) * | 1995-04-28 | 1996-09-24 | Andrx Pharmaceuticals, Inc. | Controlled release formulation for water soluble drugs in which a passageway is formed in situ |
| US5736159A (en) * | 1995-04-28 | 1998-04-07 | Andrx Pharmaceuticals, Inc. | Controlled release formulation for water insoluble drugs in which a passageway is formed in situ |
| SI9500173B (sl) * | 1995-05-19 | 2002-02-28 | Lek, | Trofazna farmacevtska oblika s konstantnim in kontroliranim sproščanjem amorfne učinkovine za enkrat dnevno aplikacijo |
| US5656294A (en) * | 1995-06-07 | 1997-08-12 | Cibus Pharmaceutical, Inc. | Colonic delivery of drugs |
| US5811388A (en) * | 1995-06-07 | 1998-09-22 | Cibus Pharmaceutical, Inc. | Delivery of drugs to the lower GI tract |
| WO1997004752A1 (en) * | 1995-07-26 | 1997-02-13 | Duramed Pharmaceuticals, Inc. | Pharmaceutical compositions of conjugated estrogens and methods for their use |
| GB9523833D0 (en) * | 1995-11-22 | 1996-01-24 | Boots Co Plc | Medical treatment |
| US6274171B1 (en) | 1996-03-25 | 2001-08-14 | American Home Products Corporation | Extended release formulation of venlafaxine hydrochloride |
| US20060068018A1 (en) * | 1996-03-25 | 2006-03-30 | Wyeth | Extended release formulation |
| US20030215507A1 (en) * | 1996-03-25 | 2003-11-20 | Wyeth | Extended release formulation |
| CA2173818A1 (fr) * | 1996-04-10 | 1997-10-11 | Francois Chouinard | Comprime pharmaceutique a liberation controlee contenant un support a base d'amylose reticule et d'hydroxypropylmethylcellulose |
| US5948437A (en) * | 1996-05-23 | 1999-09-07 | Zeneca Limited | Pharmaceutical compositions using thiazepine |
| US8071128B2 (en) | 1996-06-14 | 2011-12-06 | Kyowa Hakko Kirin Co., Ltd. | Intrabuccally rapidly disintegrating tablet and a production method of the tablets |
| US5968895A (en) | 1996-12-11 | 1999-10-19 | Praecis Pharmaceuticals, Inc. | Pharmaceutical formulations for sustained drug delivery |
| US20070185032A1 (en) * | 1996-12-11 | 2007-08-09 | Praecis Pharmaceuticals, Inc. | Pharmaceutical formulations for sustained drug delivery |
| US7179486B1 (en) | 1997-04-01 | 2007-02-20 | Nostrum Pharmaceuticals, Inc. | Process for preparing sustained release tablets |
| CA2216215A1 (en) | 1997-04-05 | 1998-10-05 | Isa Odidi | Controlled release formulations using intelligent polymers having opposing wettability characteristics of hydrophobicity and hydrophilicity |
| US6551616B1 (en) | 1997-04-11 | 2003-04-22 | Abbott Laboratories | Extended release formulations of erythromycin derivatives |
| US6210710B1 (en) | 1997-04-28 | 2001-04-03 | Hercules Incorporated | Sustained release polymer blend for pharmaceutical applications |
| GB9710521D0 (en) * | 1997-05-22 | 1997-07-16 | Boots Co Plc | Process |
| US5895663A (en) * | 1997-07-31 | 1999-04-20 | L. Perrigo Company | Pseudoephedrine hydrochloride extended-release tablets |
| US5851555A (en) * | 1997-08-15 | 1998-12-22 | Fuisz Technologies Ltd. | Controlled release dosage forms containing water soluble drugs |
| US6248358B1 (en) | 1998-08-25 | 2001-06-19 | Columbia Laboratories, Inc. | Bioadhesive progressive hydration tablets and methods of making and using the same |
| US6624200B2 (en) | 1998-08-25 | 2003-09-23 | Columbia Laboratories, Inc. | Bioadhesive progressive hydration tablets |
| US8765177B2 (en) * | 1997-09-12 | 2014-07-01 | Columbia Laboratories, Inc. | Bioadhesive progressive hydration tablets |
| US7153845B2 (en) * | 1998-08-25 | 2006-12-26 | Columbia Laboratories, Inc. | Bioadhesive progressive hydration tablets |
| IN186245B (enExample) | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| US6197339B1 (en) * | 1997-09-30 | 2001-03-06 | Pharmacia & Upjohn Company | Sustained release tablet formulation to treat Parkinson's disease |
| AU759018B2 (en) * | 1997-10-03 | 2003-04-03 | Warner-Lambert Company | Compressed nitroglycerin tablet and its method of manufacture |
| US6099859A (en) * | 1998-03-20 | 2000-08-08 | Andrx Pharmaceuticals, Inc. | Controlled release oral tablet having a unitary core |
| KR100440553B1 (ko) | 1998-03-26 | 2004-07-15 | 후지사와 야꾸힝 고교 가부시키가이샤 | 서방성 제제 |
| DE69917618T2 (de) * | 1998-04-03 | 2005-06-23 | Egalet A/S | Zusammensetzung mit kontrollierter wirkstoff-freisetzung |
| DE19819012A1 (de) * | 1998-04-29 | 1999-11-25 | Dynamit Nobel Ag | Feuersichere, nicht explosionsfähige, Nitroglycerin und wasserfreie Lactose enthaltende Feststoffmischungen |
| US6197340B1 (en) * | 1998-05-28 | 2001-03-06 | Medical Research Institute | Controlled release lipoic acid |
| US6106862A (en) * | 1998-08-13 | 2000-08-22 | Andrx Corporation | Once daily analgesic tablet |
| US6214381B1 (en) | 1998-09-08 | 2001-04-10 | Effcon, Inc. | Methazolamide composition and method of use |
| DE19842753A1 (de) * | 1998-09-18 | 2000-03-23 | Bayer Ag | Agitationsunabhängige pharmazeutische Retardzubereitungen und Verfahren zu ihrer Herstellung |
| US20020169145A1 (en) * | 1998-10-14 | 2002-11-14 | Rajen Shah | Sustained release pharmaceutical composition and method of releasing pharmaceutically active agent |
| US6806294B2 (en) | 1998-10-15 | 2004-10-19 | Euro-Celtique S.A. | Opioid analgesic |
| CA2346656A1 (en) | 1998-10-20 | 2000-04-27 | The University Of North Carolina At Chapel Hill | Methods of hydrating mucosal surfaces |
| US6319510B1 (en) | 1999-04-20 | 2001-11-20 | Alayne Yates | Gum pad for delivery of medication to mucosal tissues |
| DE19918325A1 (de) | 1999-04-22 | 2000-10-26 | Euro Celtique Sa | Verfahren zur Herstellung von Arzneiformen mit regulierter Wirkstofffreisetzung mittels Extrusion |
| WO2001015668A1 (en) | 1999-09-02 | 2001-03-08 | Nostrum Pharmaceuticals, Inc. | Controlled release pellet formulation |
| US10179130B2 (en) | 1999-10-29 | 2019-01-15 | Purdue Pharma L.P. | Controlled release hydrocodone formulations |
| JP4806507B2 (ja) | 1999-10-29 | 2011-11-02 | ユーロ−セルティーク エス.エイ. | 制御放出ヒドロコドン処方 |
| US7771746B2 (en) * | 1999-12-03 | 2010-08-10 | Polichem Sa | Methods for making sustained-release pharmaceutical compositions of ergot alkaloids having improved bioavailability and compositions thereof |
| US6627223B2 (en) * | 2000-02-11 | 2003-09-30 | Eurand Pharmaceuticals Ltd. | Timed pulsatile drug delivery systems |
| US6242003B1 (en) | 2000-04-13 | 2001-06-05 | Novartis Ag | Organic compounds |
| AR030557A1 (es) | 2000-04-14 | 2003-08-27 | Jagotec Ag | Una tableta en multicapa de liberacion controlada y metodo de tratamiento |
| US7985420B2 (en) * | 2000-04-28 | 2011-07-26 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US7838032B2 (en) * | 2000-04-28 | 2010-11-23 | Reckitt Benckiser Inc. | Sustained release of guaifenesin |
| US6372252B1 (en) | 2000-04-28 | 2002-04-16 | Adams Laboratories, Inc. | Guaifenesin sustained release formulation and tablets |
| US8012504B2 (en) * | 2000-04-28 | 2011-09-06 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US6955821B2 (en) * | 2000-04-28 | 2005-10-18 | Adams Laboratories, Inc. | Sustained release formulations of guaifenesin and additional drug ingredients |
| JP5049450B2 (ja) * | 2000-09-29 | 2012-10-17 | アボツト・ヘルスケア・プロダクツ・ベー・ブイ | イオン強度に依存しない徐放性製薬組成物 |
| US6855333B1 (en) * | 2000-10-03 | 2005-02-15 | Mutual Pharmaceutical Co., Inc. | Stabilization of solid thyroid drug formulations |
| US6979462B1 (en) * | 2000-10-03 | 2005-12-27 | Mutual Pharmaceutical Co., Inc. | Stabilization of solid drug formulations |
| CN101653411A (zh) | 2000-10-30 | 2010-02-24 | 欧罗赛铁克股份有限公司 | 控释氢可酮制剂 |
| GB0106953D0 (en) * | 2001-03-20 | 2001-05-09 | Univ Aberdeen | Neufofibrillary labels |
| US20060127474A1 (en) * | 2001-04-11 | 2006-06-15 | Oskar Kalb | Pharmaceutical compositions comprising fluvastatin |
| UA81224C2 (uk) * | 2001-05-02 | 2007-12-25 | Euro Celtic S A | Дозована форма оксикодону та її застосування |
| US7052706B2 (en) * | 2001-06-08 | 2006-05-30 | Nostrum Pharmaceuticals, Inc. | Control release formulation containing a hydrophobic material as the sustained release agent |
| US20030017175A1 (en) * | 2001-07-05 | 2003-01-23 | R.T. Alamo Ventures I, Inc. | Sublingual administration of dihydroergotamine for the treatment of migraine |
| US20030198669A1 (en) * | 2001-07-05 | 2003-10-23 | R.T. Alamo Ventures I, Llc | Compositions and methods for rapid dissolving formulations of dihydroergotamine and caffeine for the treatment of migraine |
| US6685951B2 (en) | 2001-07-05 | 2004-02-03 | R. T. Alamo Ventures I, Inc. | Administration of dihydroergotamine as a sublingual spray or aerosol for the treatment of migraine |
| US20030068375A1 (en) | 2001-08-06 | 2003-04-10 | Curtis Wright | Pharmaceutical formulation containing gelling agent |
| US6673369B2 (en) | 2001-08-29 | 2004-01-06 | Ranbaxy Laboratories Limited | Controlled release formulation |
| BR0212259A (pt) * | 2001-08-29 | 2004-10-19 | Ranbaxy Lab Ltd | Formulação de liberação controlada de claritromicina ou tinidazol |
| WO2003024430A1 (en) | 2001-09-21 | 2003-03-27 | Egalet A/S | Morphine polymer release system |
| EP2957281A1 (en) * | 2001-09-21 | 2015-12-23 | Egalet Ltd. | Polymer release system |
| US9358214B2 (en) * | 2001-10-04 | 2016-06-07 | Adare Pharmaceuticals, Inc. | Timed, sustained release systems for propranolol |
| DE10152469A1 (de) * | 2001-10-24 | 2003-06-26 | Gruenenthal Gmbh | 3-(3-Dimethylamino-1-ethyl-2-methyl-propyl)phenol enthaltendes Arzneimittel mit verzögerter Wirkstofffreisetzung |
| IL146462A (en) * | 2001-11-13 | 2015-02-26 | Lycored Bio Ltd | Prolonged-release preparations containing as an active compound and analapaxin hydrochloride |
| US6858615B2 (en) | 2002-02-19 | 2005-02-22 | Parion Sciences, Inc. | Phenyl guanidine sodium channel blockers |
| EP1496868A1 (en) * | 2002-04-11 | 2005-01-19 | Ranbaxy Laboratories, Ltd. | Controlled release pharmaceutical compositions of carbidopa and levodopa |
| PE20040134A1 (es) * | 2002-07-25 | 2004-03-06 | Pharmacia Corp | Forma de dosificacion de una vez al dia de pramipexol |
| EP1546120A4 (en) * | 2002-10-04 | 2006-11-22 | Pharmacia Corp | PHARMACEUTICAL COMPOSITIONS FOR THE TREATMENT OF PARKINSON'S DISEASE |
| US6703044B1 (en) | 2002-10-25 | 2004-03-09 | Dexcel Pharma Tech, Ltd | Venlafaxine formulations |
| WO2004041252A1 (en) * | 2002-11-08 | 2004-05-21 | Egalet A/S | Controlled release carvedilol compositions |
| US8367111B2 (en) | 2002-12-31 | 2013-02-05 | Aptalis Pharmatech, Inc. | Extended release dosage forms of propranolol hydrochloride |
| US20040185097A1 (en) * | 2003-01-31 | 2004-09-23 | Glenmark Pharmaceuticals Ltd. | Controlled release modifying complex and pharmaceutical compositions thereof |
| EP2186510B1 (en) * | 2003-03-26 | 2013-07-10 | Egalet Ltd. | Matrix compositions for controlled delivery of drug substances |
| US8877241B2 (en) * | 2003-03-26 | 2014-11-04 | Egalet Ltd. | Morphine controlled release system |
| US20060193825A1 (en) * | 2003-04-29 | 2006-08-31 | Praecis Phamaceuticals, Inc. | Pharmaceutical formulations for sustained drug delivery |
| US20050112087A1 (en) * | 2003-04-29 | 2005-05-26 | Musso Gary F. | Pharmaceutical formulations for sustained drug delivery |
| EP2112920B1 (en) * | 2003-06-26 | 2018-07-25 | Intellipharmaceutics Corp. | Proton pump-inhibitor-containing capsules which comprise subunits differently structured for a delayed release of the active ingredient |
| US20050025825A1 (en) * | 2003-07-31 | 2005-02-03 | Xanodyne Pharmacal, Inc. | Tranexamic acid formulations with reduced adverse effects |
| AU2004266704B2 (en) | 2003-08-18 | 2012-02-23 | Parion Sciences, Inc. | Capped pyrazinoylguanidine sodium channel blockers |
| US7745442B2 (en) | 2003-08-20 | 2010-06-29 | Parion Sciences, Inc. | Methods of reducing risk of infection from pathogens |
| US20050089558A1 (en) * | 2003-10-28 | 2005-04-28 | Alamo Pharmaceuticals, Llc | Compositions and methods for the co-formulation and administration of tramadol and propoxyphene |
| US7201920B2 (en) * | 2003-11-26 | 2007-04-10 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse of opioid containing dosage forms |
| US9492541B2 (en) * | 2004-09-14 | 2016-11-15 | Sovereign Pharmaceuticals, Llc | Phenylepherine containing dosage form |
| US7943585B2 (en) | 2003-12-22 | 2011-05-17 | Sandoz, Inc. | Extended release antibiotic composition |
| US7947739B2 (en) | 2004-03-04 | 2011-05-24 | Ferring B.V. | Tranexamic acid formulations |
| US20090215898A1 (en) * | 2004-03-04 | 2009-08-27 | Xanodyne Pharmaceuticals, Inc. | Tranexamic acid formulations |
| US20050244495A1 (en) | 2004-03-04 | 2005-11-03 | Xanodyne Pharmaceuticals, Inc. | Tranexamic acid formulations |
| DK1765292T3 (en) | 2004-06-12 | 2018-01-02 | Collegium Pharmaceutical Inc | ABUSE PREVENTIONAL PHARMACEUTICAL FORMULATIONS |
| US8394409B2 (en) * | 2004-07-01 | 2013-03-12 | Intellipharmaceutics Corp. | Controlled extended drug release technology |
| NZ553645A (en) * | 2004-08-13 | 2010-09-30 | Boehringer Ingelheim Int | Extended release pellet formulation containing pramipexole or a pharmaceutically acceptable salt thereof, method for manufacturing the same and use thereof |
| NZ553561A (en) * | 2004-08-13 | 2010-12-24 | Boehringer Ingelheim Int | Extended release tablet formulation containing pramipexole or a pharmaceutically acceptable salt thereof, method for manufacturing the same and use thereof |
| US10624858B2 (en) | 2004-08-23 | 2020-04-21 | Intellipharmaceutics Corp | Controlled release composition using transition coating, and method of preparing same |
| US8747895B2 (en) * | 2004-09-13 | 2014-06-10 | Aptalis Pharmatech, Inc. | Orally disintegrating tablets of atomoxetine |
| US20070212415A1 (en) * | 2004-09-15 | 2007-09-13 | Gl Pharmtech Corp. | Sustained-release tablet containing doxazosin mesylate |
| US20070077297A1 (en) | 2004-09-30 | 2007-04-05 | Scolr Pharma, Inc. | Modified release ibuprofen dosage form |
| US9884014B2 (en) | 2004-10-12 | 2018-02-06 | Adare Pharmaceuticals, Inc. | Taste-masked pharmaceutical compositions |
| NZ589750A (en) | 2004-10-21 | 2012-07-27 | Aptalis Pharmatech Inc | Taste-masked pharmaceutical compositions with gastrosoluble pore-formers |
| US20060105038A1 (en) * | 2004-11-12 | 2006-05-18 | Eurand Pharmaceuticals Limited | Taste-masked pharmaceutical compositions prepared by coacervation |
| US20080152595A1 (en) * | 2004-11-24 | 2008-06-26 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse of orally administered pharmaceutical products |
| US20070231268A1 (en) * | 2004-11-24 | 2007-10-04 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse of orally administered pharmaceutical products |
| US20060177380A1 (en) * | 2004-11-24 | 2006-08-10 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse of orally administered pharmaceutical products |
| US20060110327A1 (en) * | 2004-11-24 | 2006-05-25 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse of orally administered pharmaceutical products |
| EA014249B1 (ru) * | 2005-01-27 | 2010-10-29 | Алембик Лимитед | Формуляция леветирацетама длительного высвобождения |
| US20060183724A1 (en) * | 2005-02-03 | 2006-08-17 | Diliberti Charles E | Compositions of unconjugated estrogens and methods for their use |
| US9161918B2 (en) | 2005-05-02 | 2015-10-20 | Adare Pharmaceuticals, Inc. | Timed, pulsatile release systems |
| KR101275660B1 (ko) * | 2005-05-23 | 2013-06-17 | 내츄럴 얼터너티브즈 인터내셔날, 인크. | 베타-알라닌의 지속적 방출을 위한 조성물 및 방법 |
| WO2006128471A2 (en) * | 2005-06-03 | 2006-12-07 | Egalet A/S | A solid pharmaceutical composition with a first fraction of a dispersion medium and a second fraction of a matrix, the latter being at least partially first exposed to gastrointestinal fluids |
| DE102005028696A1 (de) * | 2005-06-21 | 2006-12-28 | Pulmotec Gmbh | Verwendung eines Hilfsstoffs zur Einstellung der Abrasionsfestigkeit eines verfestigten Wirkstoffpräparats |
| US10064828B1 (en) | 2005-12-23 | 2018-09-04 | Intellipharmaceutics Corp. | Pulsed extended-pulsed and extended-pulsed pulsed drug delivery systems |
| KR100753480B1 (ko) * | 2006-01-27 | 2007-08-31 | 씨제이 주식회사 | 잘토프로펜 함유 서방성 정제 및 그 제조방법 |
| US20090098202A1 (en) * | 2006-02-10 | 2009-04-16 | Boehringer Ingelheim International Gmbh | Extended Release Formulation |
| US20090041844A1 (en) * | 2006-02-10 | 2009-02-12 | Boehringer Ingelheim International Gmbh | Modified Release Formulation |
| WO2007112581A1 (en) * | 2006-04-03 | 2007-10-11 | Isa Odidi | Controlled release delivery device comprising an organosol coat |
| US10960077B2 (en) | 2006-05-12 | 2021-03-30 | Intellipharmaceutics Corp. | Abuse and alcohol resistant drug composition |
| AU2007254826B2 (en) * | 2006-06-01 | 2013-10-24 | Merck Sharp & Dohme Corp. | Pharmaceutical compositions for sustained release of phenyephrine |
| NZ573174A (en) | 2006-06-01 | 2012-01-12 | Msd Consumer Care Inc | Sustained release pharmaceutical dosage form containing phenylephrine |
| ES2391585T3 (es) | 2006-06-01 | 2012-11-28 | Msd Consumer Care, Inc. | Formulación farmacéutica de liberación sostenida que comprende fenilefrina |
| US20080014264A1 (en) * | 2006-07-13 | 2008-01-17 | Ucb, S.A. | Novel pharmaceutical compositions comprising levetiracetam |
| US20080075771A1 (en) * | 2006-07-21 | 2008-03-27 | Vaughn Jason M | Hydrophilic opioid abuse deterrent delivery system using opioid antagonists |
| PT103884A (pt) * | 2006-11-17 | 2008-05-19 | Astrazeneca Ab | Composições de libertação prolongada e métodos para a sua preparação |
| US7749537B2 (en) * | 2006-12-04 | 2010-07-06 | Scolr Pharma, Inc. | Method of forming a tablet |
| US20080220064A1 (en) * | 2006-12-06 | 2008-09-11 | Ramesh Ketkar Anant | Extended release matrix formulations of morphine |
| CA2674536C (en) * | 2007-01-16 | 2016-07-26 | Egalet A/S | Use of i) a polyglycol and ii) an active drug substance for the preparation of a pharmaceutical composition for i) mitigating the risk of alcohol induced dose dumping and/or ii) reducing the risk of drug abuse |
| US20090197824A1 (en) * | 2008-01-31 | 2009-08-06 | Methylation Sciences International Srl | Extended Release Pharmaceutical Formulations of S-Adenosylmethionine |
| AU2008210327B2 (en) * | 2007-01-31 | 2011-06-16 | Methylation Sciences International Srl | Extended release pharmaceutical formulations of S-adenosylmethionine |
| US20090088404A1 (en) * | 2007-01-31 | 2009-04-02 | Methylation Sciences International Srl | Extended Release Pharmaceutical Formulations of S-Adenosylmethionine |
| NZ580972A (en) | 2007-06-04 | 2012-02-24 | Egalet Ltd | Controlled release pharmaceutical compositions for prolonged effect |
| US20100172991A1 (en) * | 2007-06-08 | 2010-07-08 | Henry Joseph Horacek | Extended Release Formulation and Methods of Treating Adrenergic Dysregulation |
| AU2008261957A1 (en) * | 2007-06-08 | 2008-12-18 | Addrenex Pharmaceuticals, Inc. | Extended release formulation and method of treating adrenergic dysregulation |
| US9763989B2 (en) | 2007-08-03 | 2017-09-19 | Shaklee Corporation | Nutritional supplement system |
| WO2009020595A2 (en) * | 2007-08-03 | 2009-02-12 | Shaklee Corporation | Nutritional supplement system |
| KR100836960B1 (ko) * | 2007-09-07 | 2008-06-10 | 주식회사 서울제약 | 새로운 나이아신 제어방출형 제제 |
| EP2257296B1 (en) | 2008-02-26 | 2014-05-07 | Parion Sciences, Inc. | Poly aromatic sodium channel blockers |
| US20100003322A1 (en) * | 2008-07-03 | 2010-01-07 | Lai Felix S | Enteric coated hydrophobic matrix formulation |
| US20100190752A1 (en) | 2008-09-05 | 2010-07-29 | Gruenenthal Gmbh | Pharmaceutical Combination |
| HUE043278T2 (hu) | 2008-09-05 | 2019-08-28 | Gruenenthal Gmbh | 3-(3-dimetilamino-1-etil-2-metil-propil)-fenolt és pregabalint vagy gabapentint tartalmazó gyógyszerkombináció |
| US20100233259A1 (en) * | 2008-12-12 | 2010-09-16 | Pascal Grenier | Dosage form of ropinirole |
| WO2010089132A1 (en) | 2009-02-06 | 2010-08-12 | Egalet A/S | Immediate release composition resistant to abuse by intake of alcohol |
| US20100280117A1 (en) * | 2009-04-30 | 2010-11-04 | Xanodyne Pharmaceuticals, Inc. | Menorrhagia Instrument and Method for the Treatment of Menstrual Bleeding Disorders |
| EP2445487A2 (en) | 2009-06-24 | 2012-05-02 | Egalet Ltd. | Controlled release formulations |
| US8329208B2 (en) * | 2009-07-28 | 2012-12-11 | Methylation Sciences International Srl | Pharmacokinetics of S-adenosylmethionine formulations |
| US20110027342A1 (en) * | 2009-07-28 | 2011-02-03 | Msi Methylation Sciences, Inc. | S-adenosylmethionine formulations with enhanced bioavailability |
| US20110053914A1 (en) | 2009-08-28 | 2011-03-03 | Gruenenthal Gmbh | Pharmaceutical Combination Comprising 6-Dimethylaminomethyl-1-(3-methoxy-phenyl)-cyclohexane-1,3-diol or 6-Dimethylaminomethyl-1-(3-hydroxy-phenyl)-cyclohexane-1,3-diol and an Antiepileptic |
| US8901113B2 (en) | 2009-09-30 | 2014-12-02 | Acura Pharmaceuticals, Inc. | Methods and compositions for deterring abuse |
| SG10201407965XA (en) | 2009-12-02 | 2015-02-27 | Aptalis Pharma Ltd | Fexofenadine microcapsules and compositions containing them |
| US10668060B2 (en) | 2009-12-10 | 2020-06-02 | Collegium Pharmaceutical, Inc. | Tamper-resistant pharmaceutical compositions of opioids and other drugs |
| JP6133772B2 (ja) | 2010-06-15 | 2017-05-24 | グリュネンタール・ゲゼルシャフト・ミト・ベシュレンクテル・ハフツング | 痛み治療用の医薬配合物 |
| KR101829646B1 (ko) | 2010-07-28 | 2018-02-19 | 다우 글로벌 테크놀로지스 엘엘씨 | 투여형으로부터의 활성 성분의 방출을 제어하는 방법 |
| US9527037B2 (en) | 2010-11-10 | 2016-12-27 | Siemens Aktiengesellschaft | Preparation of an amine based solvent contaminated by the introduction of sulfur oxides |
| CA2991216C (en) | 2010-12-22 | 2020-04-28 | Purdue Pharma L.P. | Encased tamper resistant controlled release dosage forms |
| PH12013501345A1 (en) | 2010-12-23 | 2022-10-24 | Purdue Pharma Lp | Tamper resistant solid oral dosage forms |
| RU2013135224A (ru) | 2011-01-20 | 2015-03-10 | Бионевиа Фармасьютикалс Инк. | Композиции с модифицированным высвобождением эпалрестата или его производных и способы их использования |
| CA2826649C (en) | 2011-02-25 | 2016-07-26 | Merck Sharp & Dohme Corp. | Novel cyclic azabenzimidazole derivatives useful as anti-diabetic agents |
| US9072738B2 (en) | 2011-06-27 | 2015-07-07 | Parion Sciences, Inc. | Chemically and metabolically stable dipeptide possessing potent sodium channel blocker activity |
| AR086745A1 (es) | 2011-06-27 | 2014-01-22 | Parion Sciences Inc | 3,5-diamino-6-cloro-n-(n-(4-(4-(2-(hexil(2,3,4,5,6-pentahidroxihexil)amino)etoxi)fenil)butil)carbamimidoil)pirazina-2-carboxamida |
| WO2013122260A1 (en) * | 2012-02-15 | 2013-08-22 | Takeda Pharmaceutical Company Limited | Tablet |
| US20130310385A1 (en) | 2012-05-18 | 2013-11-21 | Gruenenthal Gmbh | Pharmaceutical Composition Comprising (1r,4r)-6'-fluoro-N,N-dimethyl-4-phenyl-4',9'-dihydro-3'H-spiro[cyclohexane-1,1'-pyrano[3,4,b]indol]-4-amine and Antidepressants |
| US9308196B2 (en) | 2012-05-18 | 2016-04-12 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1 r,4r) -6'-fluoro-N ,N-dimethyl-4-phenyl-4',9'-d ihydro-3'H-spiro[cyclohexane-1,1'-pyrano-[3,4,b]indol]-4-amine and an oxicam |
| US9320729B2 (en) | 2012-05-18 | 2016-04-26 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1r,4r)-6′-flouro-N,N-dimethyl-4-phenyl-4′,9′-dihydro-3′H-spiro[cyclohexane-1,1′-pyrano-[3,4,b]indol]-4-amine and a propionic acid derivative |
| US9320725B2 (en) | 2012-05-18 | 2016-04-26 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1r,4r)-6′-fluoro-N,N-dimethyl-4-phenyl-4′9′-dihydro-3′H-spiro[cyclohexane-1,1′-pyrano[3,4,b]indol]-4-amine and a gabapentinoid |
| US9345689B2 (en) | 2012-05-18 | 2016-05-24 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1r,4r)-6′-fluoro-N, N-dimethyl-4-phenyl-4,9′-dihydro-3′H-spiro[cyclohexane-1,1′-pyrano[3,4,b]indol]-4-amine and an anticonvulsant |
| US20130310435A1 (en) | 2012-05-18 | 2013-11-21 | Gruenenthal Gmbh | Pharmaceutical Composition Comprising (1r,4r)-6'-fluoro-N, N-dimethyl-4-phenyl-4,9' -dihydro-3'H-spiro[cyclohexane-1,1' -pyrano[3,4,b]indol]-4-amine and Paracetamol or Propacetamol |
| US8912226B2 (en) | 2012-05-18 | 2014-12-16 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1r,4r) -6′-fluoro-N,N-dimethyl-4-phenyl-4′,9′-dihydro-3′H-spiro[cyclohexane-1,1′-pyrano[3,4,b]indol]-4-amine and a NSAR |
| US9855286B2 (en) | 2012-05-18 | 2018-01-02 | Gruenenthal Gmbh | Pharmaceutical composition comprising (1r,4r)-6′-fluoro-N,N-di methyl-4-phenyl-4′,9′-dihydro-3′H-spiro[cyclohexane-1,1′-pyrano-[3,4,b]indol]-4-amine and a salicylic acid component |
| BR112015000150A2 (pt) | 2012-07-06 | 2017-06-27 | Egalet Ltd | composições farmacêuticas dissuasoras de abuso de liberação controlada |
| WO2014059522A1 (en) | 2012-10-17 | 2014-04-24 | Methylation Sciences International Srl | Compositions comprising s-adenosylmethionine and a gallic acid ester |
| ES2691982T3 (es) | 2012-11-30 | 2018-11-29 | Acura Pharmaceuticals, Inc. | Liberación autorregulada de un principio activo farmacéutico |
| CN108658876A (zh) | 2012-12-17 | 2018-10-16 | 帕里昂科学公司 | 3,5-二氨基-6-氯-n-(n-(4-苯基丁基)甲脒基)吡嗪-2-甲酰胺化合物 |
| CN105073717B (zh) | 2012-12-17 | 2018-05-22 | 帕里昂科学公司 | 可用于治疗由黏膜水化不足造成的疾病的氯-吡嗪甲酰胺衍生物 |
| AP2015008579A0 (en) | 2013-02-05 | 2015-07-31 | Purdue Pharma Lp | Tamper resistant pharmaceutical formulations |
| US10751287B2 (en) | 2013-03-15 | 2020-08-25 | Purdue Pharma L.P. | Tamper resistant pharmaceutical formulations |
| ITMI20132065A1 (it) * | 2013-12-11 | 2015-06-12 | Farmatron Ltd | Sistemi terapeutici a rilascio modificato per la somministrazione orale di curcumina nel trattamento delle malattie intestinali |
| US9102633B2 (en) | 2013-12-13 | 2015-08-11 | Parion Sciences, Inc. | Arylalkyl- and aryloxyalkyl-substituted epithelial sodium channel blocking compounds |
| US9616029B2 (en) | 2014-03-26 | 2017-04-11 | Sun Pharma Advanced Research Company Ltd. | Abuse deterrent immediate release coated reservoir solid dosage form |
| GB201506755D0 (en) | 2015-04-21 | 2015-06-03 | Reckitt Benckiser Llc | Novel pharmaceutical formulation |
| CA2936746C (en) | 2014-10-31 | 2017-06-27 | Purdue Pharma | Methods and compositions particularly for treatment of attention deficit disorder |
| WO2017040607A1 (en) | 2015-08-31 | 2017-03-09 | Acura Pharmaceuticals, Inc. | Methods and compositions for self-regulated release of active pharmaceutical ingredient |
| WO2017062997A1 (en) | 2015-10-09 | 2017-04-13 | Reckitt Benckiser Llc | Pharmaceutical formulation |
| US9737530B1 (en) | 2016-06-23 | 2017-08-22 | Collegium Pharmaceutical, Inc. | Process of making stable abuse-deterrent oral formulations |
| US9980946B1 (en) | 2017-01-25 | 2018-05-29 | Effcon Laboratories, Inc. | Extended release methazolamide formulation |
| US10722473B2 (en) | 2018-11-19 | 2020-07-28 | Purdue Pharma L.P. | Methods and compositions particularly for treatment of attention deficit disorder |
| EP3897728A1 (en) * | 2018-12-18 | 2021-10-27 | DDP Specialty Electronic Materials US, Inc. | A sustained release composition comprising a hydroxyalkyl methylcellulose |
| CN114126601B (zh) * | 2019-06-10 | 2025-07-15 | 庞塞迪利昂健康特定活动公司 | α-酮戊二酸类化合物的持续释放组合物 |
| JP7311448B2 (ja) * | 2020-03-13 | 2023-07-19 | 信越化学工業株式会社 | フィルム成形用組成物及びフィルム |
| KR20260020944A (ko) | 2023-05-15 | 2026-02-12 | 보나파이드 헬스, 엘엘씨 | 수면 개선 조성물 및 이용 방법 |
| FR3152120A1 (fr) * | 2023-08-18 | 2025-02-21 | Urgo Recherche Innovation Et Developpement | Produit de combinaison à libération prolongée pour aider à la relaxation et diminuer l’irritabilité |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3065143A (en) * | 1960-04-19 | 1962-11-20 | Richardson Merrell Inc | Sustained release tablet |
| US3870790A (en) * | 1970-01-22 | 1975-03-11 | Forest Laboratories | Solid pharmaceutical formulations containing hydroxypropyl methyl cellulose |
| US4226849A (en) * | 1979-06-14 | 1980-10-07 | Forest Laboratories Inc. | Sustained release therapeutic compositions |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2887440A (en) * | 1957-08-12 | 1959-05-19 | Dow Chemical Co | Enteric coating |
| US3852421A (en) * | 1970-03-23 | 1974-12-03 | Shinetsu Chemical Co | Excipient and shaped medicaments prepared therewith |
| US3839319A (en) * | 1973-01-26 | 1974-10-01 | Dow Chemical Co | Hydroxypropyl methylcellulose ethers and method of preparation |
| JPS5163927A (en) * | 1974-11-28 | 1976-06-02 | Shinetsu Chemical Co | Ketsugoseiryokonajozaihokaizaino seizohoho |
| AU514195B2 (en) * | 1975-12-15 | 1981-01-29 | F. Hoffmann-La Roche & Co. | Dosage form |
| US4167558A (en) * | 1976-02-13 | 1979-09-11 | Hoffmann-La Roche Inc. | Novel sustained release tablet formulations |
| GB1593261A (en) * | 1976-07-23 | 1981-07-15 | Inveresk Res Int | Controlled release suppository |
| JPS5562012A (en) * | 1978-11-06 | 1980-05-10 | Teijin Ltd | Slow-releasing preparation |
| US4259314A (en) * | 1979-12-10 | 1981-03-31 | Hans Lowey | Method and composition for the preparation of controlled long-acting pharmaceuticals |
| US4369172A (en) * | 1981-12-18 | 1983-01-18 | Forest Laboratories Inc. | Prolonged release therapeutic compositions based on hydroxypropylmethylcellulose |
-
1982
- 1982-03-26 US US06/362,104 patent/US4389393A/en not_active Expired - Lifetime
-
1983
- 1983-01-19 BR BR8300260A patent/BR8300260A/pt unknown
- 1983-03-10 BE BE0/210301A patent/BE896136A/fr not_active IP Right Cessation
- 1983-03-10 CA CA000423322A patent/CA1188614A/en not_active Expired
- 1983-03-16 ZA ZA831817A patent/ZA831817B/xx unknown
- 1983-03-17 DE DE3309516A patent/DE3309516A1/de active Granted
- 1983-03-21 AR AR292456A patent/AR230569A1/es active
- 1983-03-23 FR FR8304751A patent/FR2523845B1/fr not_active Expired
- 1983-03-23 GB GB08307960A patent/GB2117239B/en not_active Expired
- 1983-03-23 SE SE8301579A patent/SE453797B/sv not_active IP Right Cessation
- 1983-03-23 NL NL8301042A patent/NL8301042A/nl not_active Application Discontinuation
- 1983-03-23 CH CH1599/83A patent/CH655241A5/de not_active IP Right Cessation
- 1983-03-24 JP JP58049671A patent/JPS58174311A/ja active Granted
- 1983-03-24 IL IL68233A patent/IL68233A/xx unknown
- 1983-03-25 IT IT12471/83A patent/IT1171119B/it active
- 1983-03-25 MX MX196733A patent/MX155695A/es unknown
- 1983-03-25 ES ES520994A patent/ES520994A0/es active Granted
- 1983-03-25 DK DK137983A patent/DK161014C/da not_active IP Right Cessation
-
1985
- 1985-11-08 JP JP60250570A patent/JPS61178916A/ja active Pending
-
1986
- 1986-04-28 AU AU56761/86A patent/AU583616B2/en not_active Ceased
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3065143A (en) * | 1960-04-19 | 1962-11-20 | Richardson Merrell Inc | Sustained release tablet |
| US3870790A (en) * | 1970-01-22 | 1975-03-11 | Forest Laboratories | Solid pharmaceutical formulations containing hydroxypropyl methyl cellulose |
| US4226849A (en) * | 1979-06-14 | 1980-10-07 | Forest Laboratories Inc. | Sustained release therapeutic compositions |
Non-Patent Citations (12)
| Title |
|---|
| Firmenschrift Formulating Sustained Release * |
| HUBER, H.E., DALE, L.B. und CHRISTENSON, G.L.: Utilization of Hydrophilic Gums for the Control of Drug Release from Tablet Formulations I. Disintegration and Dissolution Behavior, J. Pharm. Sci., 55, 1966, Nr. 9, S. 974-976 |
| LAPIDUS, H. et al.: J. Pharm. Sci. 57, 1292, 1968 * |
| Methocel Handbuch, Dow Chemical Europe S.A., S. 1, 3, 5, 6-8, 16 * |
| Pharmaceutical Products With METHOCEL, The DOW Chemikal Company, 1982, S. 1-20 * |
| SALOMON, J.-L. et al.: Pharm. Acta Helv. 54, 82, 1979 * |
| SALOMON, J.-L., DOELKER, E. und BURI, P.: Im- portance de la technologie et de la formulation pour le mEcanisme de libEration du chlorure de potassium contenu dans des matrices hydrophiles, Pharm. Acta Helv., 54, 1979, Nr. 3, S. 82-85 * |
| SALOMON, J.-L., DOELKER, E. und BURI, P.: Importance de la technologie et de la formulation pour le mécanisme de libération du chlorure de potassium contenu dans des matrices hydrophiles, Pharm. Acta Helv., 54, 1979, Nr. 3, S. 82-85 |
| SALOMON, J.-L., VUAGNAT, P., DOELKER, E. und BURI, P.: Importance de la technologie et de la * |
| SALOMON, J.-L., VUAGNAT, P., DOELKER, E. und BURI, P.: Importance de la technologie et de la formulation pour le mécanisme de libération du chlorure de potassium contenu dans des matrices hydrophiles, Pharm. Acta Helv ., 54, 1979, Nr. 3, S. 86-89 |
| SUCKER, H., FUCHS, P. und SPEISER, P.: Pharma- zeutische Technologie, Georg Thieme Verlag Stuttgart 1978, S. 349-356 * |
| US 41 67 668, als Derwent-Referat * |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3603564A1 (de) * | 1985-02-08 | 1986-08-14 | Ciba-Geigy GmbH, 7867 Wehr | Pharmazeutische praeparate mit analgetrischer wirksamkeit, sowie deren herstellung und verwendung |
| DE4329794A1 (de) * | 1993-09-03 | 1995-03-09 | Gruenenthal Gmbh | Tramadolsalz enthaltende Arzneimittel mit verzögerter Wirkstofffreisetzung |
| US11007156B2 (en) | 2001-10-24 | 2021-05-18 | Gruenenthal Gmbh | Prolonged release pharmaceutical composition containing 3-(3-dimethylamino-1-ethyl-2-methyl-propyl)phenol |
| DE10224108A1 (de) * | 2002-05-29 | 2004-01-29 | Grünenthal GmbH | 1-Dimethylamino-3-(3-methoxy-phenyl)-2-methyl-pentan-3-ol enthaltendes Arzneimiitel mit verzögerter Wirkstofffreisetzung |
| US7410965B2 (en) | 2002-05-29 | 2008-08-12 | Gruenenthal Gmbh | Delayed release pharmaceutical composition containing 1-dimethyl-amino-3-(3-methoxyphenyl)-2-methyl-pentan-3-ol |
| US8404749B2 (en) | 2002-11-22 | 2013-03-26 | Gruenenthal Gmbh | Method of inhibiting inflammatory pain |
| US8003701B2 (en) | 2002-11-22 | 2011-08-23 | Gruenenthal Gmbh | Method of inhibiting inflammatory pain |
| US8420691B2 (en) | 2002-11-22 | 2013-04-16 | Gruenenthal Gmbh | Combination of selected analgesics and COX-II inhibitors |
| US8618177B2 (en) | 2002-11-22 | 2013-12-31 | Gruenenthal Gmbh | Method of treating pain caused by inflammation |
| EP3241550A1 (de) | 2002-11-22 | 2017-11-08 | Grünenthal GmbH | (1r,2r)-3-(3-dimethylamino-1-ethyl-2-methyl-propyl)-phenol zur behandlung von entzündungsschmerz |
| US10471079B2 (en) | 2002-11-22 | 2019-11-12 | Gruenenthal Gmbh | Combination of selected analgesics and COX-II inhibitors |
| EP3662904A1 (de) | 2002-11-22 | 2020-06-10 | Grünenthal GmbH | (1r,2r)-3-(3-dimethylamino-1-ethyl-2-methyl-propyl)-phenol zur behandlung von entzündungsschmerz |
| US7786160B2 (en) | 2002-11-22 | 2010-08-31 | Gruenenthal Gmbh | Combination of selected analgesics and COX-II inhibitors |
Also Published As
| Publication number | Publication date |
|---|---|
| BE896136A (fr) | 1983-07-01 |
| DE3309516C2 (enExample) | 1988-03-24 |
| US4389393A (en) | 1983-06-21 |
| ES8500740A1 (es) | 1984-11-01 |
| SE8301579L (sv) | 1983-09-27 |
| IT8312471A0 (it) | 1983-03-25 |
| JPH0415208B2 (enExample) | 1992-03-17 |
| DK161014C (da) | 1991-10-28 |
| JPS61178916A (ja) | 1986-08-11 |
| GB2117239A (en) | 1983-10-12 |
| SE8301579D0 (sv) | 1983-03-23 |
| IL68233A (en) | 1986-10-31 |
| SE453797B (sv) | 1988-03-07 |
| MX155695A (es) | 1988-04-13 |
| IL68233A0 (en) | 1983-06-15 |
| US4389393B1 (enExample) | 1985-10-22 |
| IT1171119B (it) | 1987-06-10 |
| AU5676186A (en) | 1987-10-29 |
| NL8301042A (nl) | 1983-10-17 |
| FR2523845B1 (fr) | 1986-02-21 |
| ES520994A0 (es) | 1984-11-01 |
| BR8300260A (pt) | 1984-08-28 |
| AU583616B2 (en) | 1989-05-04 |
| GB2117239B (en) | 1987-03-11 |
| DK137983D0 (da) | 1983-03-25 |
| CA1188614A (en) | 1985-06-11 |
| DK161014B (da) | 1991-05-21 |
| DK137983A (da) | 1983-09-27 |
| GB8307960D0 (en) | 1983-04-27 |
| ZA831817B (en) | 1983-12-28 |
| FR2523845A1 (fr) | 1983-09-30 |
| CH655241A5 (de) | 1986-04-15 |
| AR230569A1 (es) | 1984-05-31 |
| JPS58174311A (ja) | 1983-10-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3309516A1 (de) | Verfahren zur herstellung therapeutischer praeparate mit anhaltender freisetzung auf der basis von hydroxypropylmethylzellulose mit hohem molekulargewicht | |
| DE3246492C2 (de) | Verfahren zur Herstellung therapeutischer Präparate auf der Basis von Hydroxypropylmethylzellulose mit verlängertem Freisetzungsverlauf | |
| DE69431247T2 (de) | Oxybutyninformulierungen mit gesteuerter freisetzung | |
| DE69315257T2 (de) | Simethicon enthaltende Arzneimittel zur Behandlung gastrointestinaler Störungen | |
| DE3689983T2 (de) | Arzneimittel mit langsamer Wirkstofffreisetzung. | |
| DE69533492T2 (de) | Orale Metoprolol-Dosisform des Typs "einmal täglich" | |
| DE3880762T2 (de) | Orale, acetaminophen enthaltende zusammensetzung mit gesteuerter arzneistoff-freisetzung und verfahren zu ihrer herstellung. | |
| DE69829591T2 (de) | Fenofibrathaltige Suspension in einer hydrophilen Polymerlösung | |
| DE69723303T2 (de) | Arzneimittel mit verzögerter wirkstoffabgabe | |
| DE3879080T2 (de) | Pharmazeutische matrix mit verzoegerter freisetzung und verfahren. | |
| DE69826290T2 (de) | Pharmazeutische zusammensetzungen zur kontrollierten freigabe von wirkstoffen | |
| DE69230112T2 (de) | Fortschrittliches arzneistoffabgabesystem und verfahren zur behandlung von psychiatrischen, neurologischen und anderen erkrankungen mit carbamazepin | |
| DE69521799T2 (de) | Polymer umhüllte tablette enthaltend amoxicillin und clavulanat | |
| DE69924381T2 (de) | Leicht zerfallende feste zubereitung | |
| DE60133538T2 (de) | Formulierung und tabletten mit guaifenesin mit verzögerter freisetzung | |
| AT398165B (de) | Verfahren zur herstellung einer pharmazeutischen kapsel zur oralen verabreichung mit verzögerter wirkstofffreisetzung bzw. kombinierter verzögerter/rascher wirkstofffreisetzung | |
| DE69722247T2 (de) | Pharmazeutische tablette mit verzögerter freisetzung, enthaltend eine matrix aus quervernetzter amylose und hydroxypropyl methylzellulose | |
| DE69530759T2 (de) | Filmbeschichtete tablette, die paracetamol und domperidone enthält | |
| DE69623634T2 (de) | Pharmazeutische zusammensetzung von l-dopa ethyl ester | |
| DE2414868A1 (de) | Arzneimittel und verfahren zu seiner herstellung | |
| DE1667888C3 (de) | Langwirkende geformte pharmazeutische Zubereitungen | |
| DE3045634A1 (de) | Pharmazeutisches praeparat mit langsamer wirkstofffreisetzung und verfahren zu dessen herstellung | |
| EP0642788A2 (de) | Tramadolsalz enthaltende Arzneimittel mit verzögerter Wirkstofffreitsetzung | |
| DE2323686A1 (de) | Arzneimittelzubereitungsform mit langzeitwirkung und verfahren zu ihrer herstellung | |
| CH664970A5 (de) | Pharmazeutischer traegerstoff sowie diesen traegerstoff enthaltende pharmazeutische zusammensetzung. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8331 | Complete revocation |