DE3139524A1 - "elektrofotografisches, fotoempfindliches element" - Google Patents
"elektrofotografisches, fotoempfindliches element"Info
- Publication number
- DE3139524A1 DE3139524A1 DE19813139524 DE3139524A DE3139524A1 DE 3139524 A1 DE3139524 A1 DE 3139524A1 DE 19813139524 DE19813139524 DE 19813139524 DE 3139524 A DE3139524 A DE 3139524A DE 3139524 A1 DE3139524 A1 DE 3139524A1
- Authority
- DE
- Germany
- Prior art keywords
- photosensitive element
- electrophotographic photosensitive
- formula
- element according
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000010410 layer Substances 0.000 claims description 129
- 239000000049 pigment Substances 0.000 claims description 73
- -1 hydrazone compounds Chemical class 0.000 claims description 60
- 230000032258 transport Effects 0.000 claims description 46
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 37
- 239000000463 material Substances 0.000 claims description 32
- 239000012790 adhesive layer Substances 0.000 claims description 31
- 125000000217 alkyl group Chemical group 0.000 claims description 20
- 239000011230 binding agent Substances 0.000 claims description 17
- 125000003118 aryl group Chemical group 0.000 claims description 15
- 230000008878 coupling Effects 0.000 claims description 15
- 238000010168 coupling process Methods 0.000 claims description 15
- 238000005859 coupling reaction Methods 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 12
- 239000001257 hydrogen Substances 0.000 claims description 12
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 claims description 10
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- 229910052736 halogen Inorganic materials 0.000 claims description 9
- 150000002367 halogens Chemical class 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 9
- 125000004442 acylamino group Chemical group 0.000 claims description 8
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 8
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 8
- 239000005018 casein Substances 0.000 claims description 7
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 claims description 7
- 235000021240 caseins Nutrition 0.000 claims description 7
- 229920001225 polyester resin Polymers 0.000 claims description 7
- 239000004645 polyester resin Substances 0.000 claims description 7
- 125000004429 atom Chemical group 0.000 claims description 6
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 claims description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 5
- 150000007857 hydrazones Chemical class 0.000 claims description 4
- 125000001624 naphthyl group Chemical group 0.000 claims description 4
- 150000003219 pyrazolines Chemical class 0.000 claims description 4
- 150000004866 oxadiazoles Chemical class 0.000 claims description 3
- 150000002916 oxazoles Chemical class 0.000 claims description 3
- 150000003557 thiazoles Chemical class 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000005577 anthracene group Chemical group 0.000 claims description 2
- 150000001716 carbazoles Chemical class 0.000 claims description 2
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 2
- TXCDCPKCNAJMEE-UHFFFAOYSA-N dibenzofuran Chemical group C1=CC=C2C3=CC=CC=C3OC2=C1 TXCDCPKCNAJMEE-UHFFFAOYSA-N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 5
- 101000749842 Homo sapiens Leukocyte cell-derived chemotaxin 1 Proteins 0.000 claims 1
- 102100040448 Leukocyte cell-derived chemotaxin 1 Human genes 0.000 claims 1
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 64
- 239000000243 solution Substances 0.000 description 48
- 238000001035 drying Methods 0.000 description 47
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 29
- 239000006185 dispersion Substances 0.000 description 23
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 22
- 229910052782 aluminium Inorganic materials 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 18
- 229920005989 resin Polymers 0.000 description 13
- 239000011347 resin Substances 0.000 description 13
- 150000003254 radicals Chemical class 0.000 description 11
- 150000004985 diamines Chemical class 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- 229920002799 BoPET Polymers 0.000 description 8
- 239000005041 Mylar™ Substances 0.000 description 8
- 230000014759 maintenance of location Effects 0.000 description 8
- 229920005668 polycarbonate resin Polymers 0.000 description 8
- 239000004431 polycarbonate resin Substances 0.000 description 8
- 229920000515 polycarbonate Polymers 0.000 description 7
- 239000004417 polycarbonate Substances 0.000 description 7
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 7
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 6
- 235000019441 ethanol Nutrition 0.000 description 6
- 229960004756 ethanol Drugs 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 229920002451 polyvinyl alcohol Polymers 0.000 description 6
- 238000007738 vacuum evaporation Methods 0.000 description 6
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- 241000251730 Chondrichthyes Species 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 230000035945 sensitivity Effects 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 4
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 4
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 4
- 239000011248 coating agent Substances 0.000 description 4
- 238000000576 coating method Methods 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 4
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 4
- 239000004926 polymethyl methacrylate Substances 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 3
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 125000003282 alkyl amino group Chemical group 0.000 description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 3
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000013034 phenoxy resin Substances 0.000 description 3
- 229920006287 phenoxy resin Polymers 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 238000012546 transfer Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 2
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 2
- PGDARWFJWJKPLY-UHFFFAOYSA-N 4-[2-[3-[4-(diethylamino)phenyl]-2-phenyl-1,3-dihydropyrazol-5-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC(C=2C=CC(=CC=2)N(CC)CC)N(C=2C=CC=CC=2)N1 PGDARWFJWJKPLY-UHFFFAOYSA-N 0.000 description 2
- BDQMFBXOQYLWQE-UHFFFAOYSA-N 4-[5-(2-chlorophenyl)-2-[4-(diethylamino)phenyl]-1,3-oxazol-4-yl]-n,n-dimethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NC(C=2C=CC(=CC=2)N(C)C)=C(C=2C(=CC=CC=2)Cl)O1 BDQMFBXOQYLWQE-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 2
- 229920000178 Acrylic resin Polymers 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000004793 Polystyrene Substances 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- 101150052863 THY1 gene Proteins 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000005840 aryl radicals Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004803 chlorobenzyl group Chemical group 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- 125000006286 dichlorobenzyl group Chemical group 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000012860 organic pigment Substances 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 238000007639 printing Methods 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 239000006163 transport media Substances 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- UVHXEHGUEKARKZ-UHFFFAOYSA-N 1-ethenylanthracene Chemical compound C1=CC=C2C=C3C(C=C)=CC=CC3=CC2=C1 UVHXEHGUEKARKZ-UHFFFAOYSA-N 0.000 description 1
- WPMHMYHJGDAHKX-UHFFFAOYSA-N 1-ethenylpyrene Chemical compound C1=C2C(C=C)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 WPMHMYHJGDAHKX-UHFFFAOYSA-N 0.000 description 1
- MWOODERJGVWYJE-UHFFFAOYSA-N 1-methyl-1-phenylhydrazine Chemical compound CN(N)C1=CC=CC=C1 MWOODERJGVWYJE-UHFFFAOYSA-N 0.000 description 1
- FBNAYEYTRHHEOB-UHFFFAOYSA-N 2,3,5-triphenyl-1,3-dihydropyrazole Chemical compound N1N(C=2C=CC=CC=2)C(C=2C=CC=CC=2)C=C1C1=CC=CC=C1 FBNAYEYTRHHEOB-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- WCQLACGUXBFKGM-UHFFFAOYSA-N 2-(2,4,7-trinitro-1-oxo-2h-fluoren-9-ylidene)propanedinitrile Chemical compound [O-][N+](=O)C1=CC=C2C(C(=CC(C3=O)[N+](=O)[O-])[N+]([O-])=O)=C3C(=C(C#N)C#N)C2=C1 WCQLACGUXBFKGM-UHFFFAOYSA-N 0.000 description 1
- KUBDPQJOLOUJRM-UHFFFAOYSA-N 2-(chloromethyl)oxirane;4-[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound ClCC1CO1.C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 KUBDPQJOLOUJRM-UHFFFAOYSA-N 0.000 description 1
- MJUUNUGPLWUXRC-UHFFFAOYSA-N 2-[2-[4-(dimethylamino)phenyl]ethenyl]-n,n-dimethyl-1,3-benzothiazol-6-amine Chemical compound C1=CC(N(C)C)=CC=C1C=CC1=NC2=CC=C(N(C)C)C=C2S1 MJUUNUGPLWUXRC-UHFFFAOYSA-N 0.000 description 1
- 125000005999 2-bromoethyl group Chemical group 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- WUPHOULIZUERAE-UHFFFAOYSA-N 3-(oxolan-2-yl)propanoic acid Chemical compound OC(=O)CCC1CCCO1 WUPHOULIZUERAE-UHFFFAOYSA-N 0.000 description 1
- JFGQHAHJWJBOPD-UHFFFAOYSA-N 3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical compound OC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=CC=C1 JFGQHAHJWJBOPD-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- JJQYAPNPXXKRDF-UHFFFAOYSA-N 4-(2,3-dihydro-1h-pyrazol-3-yl)-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1C=CNN1 JJQYAPNPXXKRDF-UHFFFAOYSA-N 0.000 description 1
- MNFZZNNFORDXSV-UHFFFAOYSA-N 4-(diethylamino)benzaldehyde Chemical compound CCN(CC)C1=CC=C(C=O)C=C1 MNFZZNNFORDXSV-UHFFFAOYSA-N 0.000 description 1
- JDUKORYFKBOOBJ-UHFFFAOYSA-N 4-[2-[3-[4-(diethylamino)phenyl]-1,3-dihydropyrazol-2-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CN1C(C=2C=CC(=CC=2)N(CC)CC)C=CN1 JDUKORYFKBOOBJ-UHFFFAOYSA-N 0.000 description 1
- OVYWSSPXKUPBRQ-UHFFFAOYSA-N 4-[5-(2-chlorophenyl)-2-[4-(dimethylamino)phenyl]-1,3-oxazol-4-yl]-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C1=NC(C=2C=CC(=CC=2)N(C)C)=C(C=2C(=CC=CC=2)Cl)O1 OVYWSSPXKUPBRQ-UHFFFAOYSA-N 0.000 description 1
- XXWVEJFXXLLAIB-UHFFFAOYSA-N 4-[[4-(diethylamino)-2-methylphenyl]-phenylmethyl]-n,n-diethyl-3-methylaniline Chemical compound CC1=CC(N(CC)CC)=CC=C1C(C=1C(=CC(=CC=1)N(CC)CC)C)C1=CC=CC=C1 XXWVEJFXXLLAIB-UHFFFAOYSA-N 0.000 description 1
- AHDTYXOIJHCGKH-UHFFFAOYSA-N 4-[[4-(dimethylamino)-2-methylphenyl]-phenylmethyl]-n,n,3-trimethylaniline Chemical compound CC1=CC(N(C)C)=CC=C1C(C=1C(=CC(=CC=1)N(C)C)C)C1=CC=CC=C1 AHDTYXOIJHCGKH-UHFFFAOYSA-N 0.000 description 1
- SXIFAEWFOJETOA-UHFFFAOYSA-N 4-hydroxy-butyl Chemical group [CH2]CCCO SXIFAEWFOJETOA-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WRYSPKMJQFYQOY-UHFFFAOYSA-N 9-ethenyl-1-phenylanthracene Chemical compound C=12C(C=C)=C3C=CC=CC3=CC2=CC=CC=1C1=CC=CC=C1 WRYSPKMJQFYQOY-UHFFFAOYSA-N 0.000 description 1
- PLAZXGNBGZYJSA-UHFFFAOYSA-N 9-ethylcarbazole Chemical compound C1=CC=C2N(CC)C3=CC=CC=C3C2=C1 PLAZXGNBGZYJSA-UHFFFAOYSA-N 0.000 description 1
- LSZJZNNASZFXKN-UHFFFAOYSA-N 9-propan-2-ylcarbazole Chemical compound C1=CC=C2N(C(C)C)C3=CC=CC=C3C2=C1 LSZJZNNASZFXKN-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 206010070834 Sensitisation Diseases 0.000 description 1
- 241000519995 Stachys sylvatica Species 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical class FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052980 cadmium sulfide Inorganic materials 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 239000013256 coordination polymer Substances 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004966 cyanoalkyl group Chemical group 0.000 description 1
- 125000002946 cyanobenzyl group Chemical group 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 125000004915 dibutylamino group Chemical group C(CCC)N(CCCC)* 0.000 description 1
- 150000004656 dimethylamines Chemical class 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- YLQWCDOCJODRMT-UHFFFAOYSA-N fluoren-9-one Chemical compound C1=CC=C2C(=O)C3=CC=CC=C3C2=C1 YLQWCDOCJODRMT-UHFFFAOYSA-N 0.000 description 1
- 150000008376 fluorenones Chemical class 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000007648 laser printing Methods 0.000 description 1
- 235000021190 leftovers Nutrition 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical class C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- OPRARKQRGJPDDK-UHFFFAOYSA-N n,n-dibenzyl-2-[2-[4-(dibenzylamino)phenyl]ethenyl]-1,3-benzothiazol-6-amine Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=CC=2SC3=CC(=CC=C3N=2)N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=CC=1)CC1=CC=CC=C1 OPRARKQRGJPDDK-UHFFFAOYSA-N 0.000 description 1
- FTYFUACTSPEFHZ-UHFFFAOYSA-N n,n-dibenzyl-4-[5-[4-(dibenzylamino)phenyl]-1,3,4-oxadiazol-2-yl]aniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC(=CC=1)C=1OC(=NN=1)C=1C=CC(=CC=1)N(CC=1C=CC=CC=1)CC=1C=CC=CC=1)CC1=CC=CC=C1 FTYFUACTSPEFHZ-UHFFFAOYSA-N 0.000 description 1
- VUEAFNVYJHPLNK-UHFFFAOYSA-N n,n-dibenzyl-4-[[4-(dibenzylamino)-2-methylphenyl]-phenylmethyl]-3-methylaniline Chemical compound CC1=CC(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)=CC=C1C(C=1C(=CC(=CC=1)N(CC=1C=CC=CC=1)CC=1C=CC=CC=1)C)C1=CC=CC=C1 VUEAFNVYJHPLNK-UHFFFAOYSA-N 0.000 description 1
- MYAYHEHMOLEOQG-UHFFFAOYSA-N n,n-diethyl-1,3-benzothiazol-6-amine Chemical compound CCN(CC)C1=CC=C2N=CSC2=C1 MYAYHEHMOLEOQG-UHFFFAOYSA-N 0.000 description 1
- JQMMCLJHJIQMIK-UHFFFAOYSA-N n,n-diethyl-2-(2-phenylethenyl)-1,3-benzothiazol-6-amine Chemical compound S1C2=CC(N(CC)CC)=CC=C2N=C1C=CC1=CC=CC=C1 JQMMCLJHJIQMIK-UHFFFAOYSA-N 0.000 description 1
- VREONUZGDYDJLN-UHFFFAOYSA-N n-(benzylideneamino)-n-phenylaniline Chemical compound C=1C=CC=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 VREONUZGDYDJLN-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- XRWSIBVXSYPWLH-UHFFFAOYSA-N n-phenyl-n-[(4-pyrrolidin-1-ylphenyl)methylideneamino]aniline Chemical compound C1CCCN1C(C=C1)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 XRWSIBVXSYPWLH-UHFFFAOYSA-N 0.000 description 1
- KKFHAJHLJHVUDM-UHFFFAOYSA-N n-vinylcarbazole Chemical compound C1=CC=C2N(C=C)C3=CC=CC=C3C2=C1 KKFHAJHLJHVUDM-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920002382 photo conductive polymer Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- RCYFOPUXRMOLQM-UHFFFAOYSA-N pyrene-1-carbaldehyde Chemical compound C1=C2C(C=O)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 RCYFOPUXRMOLQM-UHFFFAOYSA-N 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229930187593 rose bengal Natural products 0.000 description 1
- AZJPTIGZZTZIDR-UHFFFAOYSA-L rose bengal Chemical compound [K+].[K+].[O-]C(=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1C1=C2C=C(I)C(=O)C(I)=C2OC2=C(I)C([O-])=C(I)C=C21 AZJPTIGZZTZIDR-UHFFFAOYSA-L 0.000 description 1
- 229940081623 rose bengal Drugs 0.000 description 1
- STRXNPAVPKGJQR-UHFFFAOYSA-N rose bengal A Natural products O1C(=O)C(C(=CC=C2Cl)Cl)=C2C21C1=CC(I)=C(O)C(I)=C1OC1=C(I)C(O)=C(I)C=C21 STRXNPAVPKGJQR-UHFFFAOYSA-N 0.000 description 1
- 229910052711 selenium Inorganic materials 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 230000008313 sensitization Effects 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N tetrahydropyrrole Substances C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 125000005425 toluyl group Chemical group 0.000 description 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000011800 void material Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/02—Disazo dyes
- C09B35/039—Disazo dyes characterised by the tetrazo component
- C09B35/34—Disazo dyes characterised by the tetrazo component the tetrazo component being heterocyclic
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0681—Disazo dyes containing hetero rings in the part of the molecule between the azo-groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0683—Disazo dyes containing polymethine or anthraquinone groups
- G03G5/0685—Disazo dyes containing polymethine or anthraquinone groups containing hetero rings in the part of the molecule between the azo-groups
Landscapes
- Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13871780A JPS5763540A (en) | 1980-10-06 | 1980-10-06 | Electrophotographic receptor |
| JP14041280A JPS5764742A (en) | 1980-10-09 | 1980-10-09 | Electrophotographic receptor |
| JP14250580A JPS5766438A (en) | 1980-10-14 | 1980-10-14 | Electrophotographic receptor |
| JP15022580A JPS5774746A (en) | 1980-10-28 | 1980-10-28 | Electrophotographic receptor |
| JP15022680A JPS5774747A (en) | 1980-10-28 | 1980-10-28 | Electrophotographic receptor |
| JP15381580A JPS5778543A (en) | 1980-11-04 | 1980-11-04 | Electrophotographic receptor |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3139524A1 true DE3139524A1 (de) | 1982-08-19 |
| DE3139524C2 DE3139524C2 (enExample) | 1990-02-01 |
Family
ID=27552903
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813139524 Granted DE3139524A1 (de) | 1980-10-06 | 1981-10-05 | "elektrofotografisches, fotoempfindliches element" |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4399206A (enExample) |
| DE (1) | DE3139524A1 (enExample) |
| GB (1) | GB2088576B (enExample) |
Cited By (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3841207A1 (de) * | 1987-12-08 | 1989-06-29 | Fuji Electric Co Ltd | Photoleiter fuer die elektrophotographie |
| US4910110A (en) * | 1987-12-21 | 1990-03-20 | Fuji Electric Co., Ltd. | Photoconductor including hydrazone compound in a photoconductive layer |
| US4935323A (en) * | 1988-06-08 | 1990-06-19 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US4948689A (en) * | 1988-06-27 | 1990-08-14 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography having an amino charge transport compound |
| US4954405A (en) * | 1988-06-30 | 1990-09-04 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography comprising squarylium containing generator layer and hydrazone containing transport layer |
| US4956277A (en) * | 1987-12-09 | 1990-09-11 | Fuji Electric Co., Ltd. | Photoconductor comprising charge transporting hydrazone compounds |
| US4957837A (en) * | 1987-10-15 | 1990-09-18 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography containing hydrazone in charge transport layer |
| US4971876A (en) * | 1989-01-19 | 1990-11-20 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| DE4018010A1 (de) * | 1989-06-06 | 1990-12-20 | Fuji Electric Co Ltd | Photoleiter fuer die elektrophotographie |
| US5132189A (en) * | 1989-09-07 | 1992-07-21 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US5158848A (en) * | 1990-01-17 | 1992-10-27 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| DE4042455C2 (de) * | 1989-06-06 | 1993-10-07 | Fuji Electric Co Ltd | Elektrophotographisches Aufzeichnungsmaterial |
| US5286590A (en) * | 1989-06-06 | 1994-02-15 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5316881A (en) * | 1991-12-27 | 1994-05-31 | Fuji Electric Co., Ltd. | Photoconductor for electrophotgraphy containing benzidine derivative |
| US5368966A (en) * | 1992-05-14 | 1994-11-29 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography with indole derivative |
| US5393627A (en) * | 1992-02-12 | 1995-02-28 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4551404A (en) * | 1981-06-18 | 1985-11-05 | Canon Kabushiki Kaisha | Disazo electrophotographic photosensitive member |
| JPS58102239A (ja) * | 1981-12-14 | 1983-06-17 | Fuji Photo Film Co Ltd | 光導電性組成物およびそれを用いた電子写真感光材料 |
| JPS58129434A (ja) * | 1982-01-28 | 1983-08-02 | Fuji Photo Film Co Ltd | 光導電性組成物およびそれを用いた電子写真感光材料 |
| JPS58200242A (ja) * | 1982-05-19 | 1983-11-21 | Canon Inc | 電子写真感光体 |
| JPS59218447A (ja) * | 1983-05-26 | 1984-12-08 | Konishiroku Photo Ind Co Ltd | 電子写真感光体及びその製造方法 |
| JPS6360455A (ja) * | 1986-09-01 | 1988-03-16 | Mitsui Toatsu Chem Inc | 電子写真用感光体 |
| JP2605704B2 (ja) * | 1987-02-12 | 1997-04-30 | ミノルタ株式会社 | 感光体 |
| JPS6478259A (en) * | 1987-09-18 | 1989-03-23 | Fuji Photo Film Co Ltd | Photoconductive composition and electrophotographic sensitive body using same |
| JP2556079B2 (ja) * | 1987-12-29 | 1996-11-20 | ミノルタ株式会社 | 感光体 |
| JP2643209B2 (ja) * | 1988-01-09 | 1997-08-20 | ミノルタ株式会社 | 感光体 |
| US4945021A (en) * | 1988-02-16 | 1990-07-31 | Minolta Camera Kabushiki Kaisha | Photosensitive member comprising bisazo pigment |
| JP2002342702A (ja) * | 2001-05-16 | 2002-11-29 | Cycolor System Co Ltd | カラーコード記録方式 |
| US7960080B2 (en) * | 2008-03-31 | 2011-06-14 | Xerox Corporation | Oxadiazole containing photoconductors |
| JP5569831B1 (ja) | 2013-05-15 | 2014-08-13 | 国立大学法人東北大学 | マイクロ空室の内壁面処理方法 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2829543A1 (de) * | 1977-07-08 | 1979-01-11 | Ricoh Kk | Elektrophotographisches aufzeichnungsmaterial |
| DE2947760A1 (de) * | 1978-11-27 | 1980-06-04 | Ricoh Kk | Photosensitives element |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL99369C (enExample) | 1956-06-04 | |||
| GB1068025A (en) | 1963-03-12 | 1967-05-10 | Lichtdrukpapierfabriek De Atla | Material for electrophotographic reproductions |
| US3895004A (en) * | 1967-08-25 | 1975-07-15 | Ciba Geigy Ag | Disazo dyestuffs containing a heterocyclic bridging member |
| CH584739A5 (enExample) * | 1973-12-21 | 1977-02-15 | Ciba Geigy Ag | |
| JPS6027015B2 (ja) * | 1977-06-08 | 1985-06-26 | 株式会社リコー | 電子写真用感光体 |
| JPS591424B2 (ja) * | 1978-12-19 | 1984-01-12 | キヤノン株式会社 | 電子写真感光体 |
-
1981
- 1981-09-30 US US06/307,154 patent/US4399206A/en not_active Expired - Lifetime
- 1981-10-02 GB GB8135084A patent/GB2088576B/en not_active Expired
- 1981-10-05 DE DE19813139524 patent/DE3139524A1/de active Granted
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2829543A1 (de) * | 1977-07-08 | 1979-01-11 | Ricoh Kk | Elektrophotographisches aufzeichnungsmaterial |
| DE2947760A1 (de) * | 1978-11-27 | 1980-06-04 | Ricoh Kk | Photosensitives element |
Cited By (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4957837A (en) * | 1987-10-15 | 1990-09-18 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography containing hydrazone in charge transport layer |
| DE3841207A1 (de) * | 1987-12-08 | 1989-06-29 | Fuji Electric Co Ltd | Photoleiter fuer die elektrophotographie |
| US4929525A (en) * | 1987-12-08 | 1990-05-29 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography containing azo or disazo compound |
| US4956277A (en) * | 1987-12-09 | 1990-09-11 | Fuji Electric Co., Ltd. | Photoconductor comprising charge transporting hydrazone compounds |
| US4910110A (en) * | 1987-12-21 | 1990-03-20 | Fuji Electric Co., Ltd. | Photoconductor including hydrazone compound in a photoconductive layer |
| US4935323A (en) * | 1988-06-08 | 1990-06-19 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US4948689A (en) * | 1988-06-27 | 1990-08-14 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography having an amino charge transport compound |
| US4954405A (en) * | 1988-06-30 | 1990-09-04 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography comprising squarylium containing generator layer and hydrazone containing transport layer |
| US4971876A (en) * | 1989-01-19 | 1990-11-20 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| DE4018010A1 (de) * | 1989-06-06 | 1990-12-20 | Fuji Electric Co Ltd | Photoleiter fuer die elektrophotographie |
| DE4042455C2 (de) * | 1989-06-06 | 1993-10-07 | Fuji Electric Co Ltd | Elektrophotographisches Aufzeichnungsmaterial |
| US5286590A (en) * | 1989-06-06 | 1994-02-15 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5292608A (en) * | 1989-06-06 | 1994-03-08 | Fugi Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5292602A (en) * | 1989-06-06 | 1994-03-08 | Fugi Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5132189A (en) * | 1989-09-07 | 1992-07-21 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US5158848A (en) * | 1990-01-17 | 1992-10-27 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US5316881A (en) * | 1991-12-27 | 1994-05-31 | Fuji Electric Co., Ltd. | Photoconductor for electrophotgraphy containing benzidine derivative |
| US5393627A (en) * | 1992-02-12 | 1995-02-28 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US5368966A (en) * | 1992-05-14 | 1994-11-29 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography with indole derivative |
Also Published As
| Publication number | Publication date |
|---|---|
| US4399206A (en) | 1983-08-16 |
| GB2088576B (en) | 1984-02-08 |
| DE3139524C2 (enExample) | 1990-02-01 |
| GB2088576A (en) | 1982-06-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3139524A1 (de) | "elektrofotografisches, fotoempfindliches element" | |
| DE3138292C2 (enExample) | ||
| DE2935536C2 (enExample) | ||
| DE2829543C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3216738C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2924865A1 (de) | Lichtempfindliches elektrophotographisches aufzeichnungsmaterial | |
| DE3208866A1 (de) | Elektrophotographische lichtempfindliche materialien | |
| DE3447685C2 (enExample) | ||
| DE3617948C2 (enExample) | ||
| DE3135942C2 (enExample) | ||
| DE3740730C2 (enExample) | ||
| DE3150068A1 (de) | Lichtempfindliches element fuer elektrophotografische zwecke | |
| DE3844602C2 (enExample) | ||
| DE3049184A1 (de) | Elektrophotographisches element | |
| DE3613566A1 (de) | Lichtempfindliches aufzeichnungsmaterial fuer die elektrophotographie | |
| DE69008895T2 (de) | Elektrophotographischer Photorezeptor. | |
| DE3448011C2 (enExample) | ||
| DE3521652C2 (enExample) | ||
| DE3049303A1 (de) | Elektrophotographisches element | |
| DE3220208C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2722332C2 (de) | 5-[3-(9-Äthyl)-carbazolyl]-1,3,4-oxadiazolderivate | |
| DE3321871C2 (enExample) | ||
| DE3522896C2 (enExample) | ||
| DE69424265T2 (de) | Elektrophotographisches photosensitives Element, Prozesskassette mit diesem Element und elektrophotographisches Gerät | |
| DE3211299A1 (de) | Organisches, fotoleitendes material und elektrofotografisches, lichtempfindliches element |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |