DE3521652C2 - - Google Patents
Info
- Publication number
- DE3521652C2 DE3521652C2 DE3521652A DE3521652A DE3521652C2 DE 3521652 C2 DE3521652 C2 DE 3521652C2 DE 3521652 A DE3521652 A DE 3521652A DE 3521652 A DE3521652 A DE 3521652A DE 3521652 C2 DE3521652 C2 DE 3521652C2
- Authority
- DE
- Germany
- Prior art keywords
- group
- methyl
- ethyl
- propyl
- butyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 claims description 76
- -1 methoxy, ethoxy, propoxy, butoxy, carboxy, methylcarboxy, phenylcarboxy, sulfo, sulfamoyl group Chemical group 0.000 claims description 38
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 30
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 28
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 28
- 125000001997 phenyl group Chemical class [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 27
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 24
- 239000000049 pigment Substances 0.000 claims description 23
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 22
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 22
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000005843 halogen group Chemical group 0.000 claims description 15
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 14
- 125000001624 naphthyl group Chemical group 0.000 claims description 13
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 claims description 6
- 125000000609 carbazolyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 claims description 6
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 239000000460 chlorine Substances 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000001041 indolyl group Chemical group 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 150000003254 radicals Chemical class 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- UJOBWOGCFQCDNV-UHFFFAOYSA-N 9H-carbazole Chemical class C1=CC=C2C3=CC=CC=C3NC2=C1 UJOBWOGCFQCDNV-UHFFFAOYSA-N 0.000 claims description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical class C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 claims description 4
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical class C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 claims description 4
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 4
- 125000004185 ester group Chemical group 0.000 claims description 4
- 125000004494 ethyl ester group Chemical group 0.000 claims description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 4
- 125000001725 pyrenyl group Chemical group 0.000 claims description 4
- 125000005504 styryl group Chemical group 0.000 claims description 4
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 125000004970 halomethyl group Chemical group 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical class C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 claims description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 claims description 2
- 229910052731 fluorine Inorganic materials 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Chemical class CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 claims description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Chemical class C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 description 20
- 150000001875 compounds Chemical class 0.000 description 17
- 239000000243 solution Substances 0.000 description 11
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 10
- 125000003545 alkoxy group Chemical group 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 10
- 238000004519 manufacturing process Methods 0.000 description 8
- 239000011230 binding agent Substances 0.000 description 7
- 230000035945 sensitivity Effects 0.000 description 7
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000004663 dialkyl amino group Chemical group 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 239000000758 substrate Substances 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical group C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229920005989 resin Polymers 0.000 description 4
- 239000011347 resin Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 3
- 238000000862 absorption spectrum Methods 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- GACNTLAEHODJKY-UHFFFAOYSA-N n,n-dibenzyl-4-[1-[4-(dibenzylamino)phenyl]propyl]aniline Chemical compound C=1C=C(N(CC=2C=CC=CC=2)CC=2C=CC=CC=2)C=CC=1C(CC)C(C=C1)=CC=C1N(CC=1C=CC=CC=1)CC1=CC=CC=C1 GACNTLAEHODJKY-UHFFFAOYSA-N 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 3
- 235000021286 stilbenes Nutrition 0.000 description 3
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- NGQSLSMAEVWNPU-YTEMWHBBSA-N 1,2-bis[(e)-2-phenylethenyl]benzene Chemical compound C=1C=CC=CC=1/C=C/C1=CC=CC=C1\C=C\C1=CC=CC=C1 NGQSLSMAEVWNPU-YTEMWHBBSA-N 0.000 description 2
- QNLZIZAQLLYXTC-UHFFFAOYSA-N 1,2-dimethylnaphthalene Chemical compound C1=CC=CC2=C(C)C(C)=CC=C21 QNLZIZAQLLYXTC-UHFFFAOYSA-N 0.000 description 2
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 2
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 description 2
- AHILZYFVSFKAKS-UHFFFAOYSA-N 2,6-bis[(4-aminophenyl)methylidene]-4-methylcyclohexan-1-one Chemical compound O=C1C(=CC=2C=CC(N)=CC=2)CC(C)CC1=CC1=CC=C(N)C=C1 AHILZYFVSFKAKS-UHFFFAOYSA-N 0.000 description 2
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 2
- BZKRKPGZABEOSM-XMHGGMMESA-N 4-[(e)-2-[3-[4-(diethylamino)phenyl]-2-phenyl-3,4-dihydropyrazol-5-yl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1\C=C\C1=NN(C=2C=CC=CC=2)C(C=2C=CC(=CC=2)N(CC)CC)C1 BZKRKPGZABEOSM-XMHGGMMESA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 206010034972 Photosensitivity reaction Diseases 0.000 description 2
- 239000004952 Polyamide Substances 0.000 description 2
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000006193 diazotization reaction Methods 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000010408 film Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical group 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- QYXUHIZLHNDFJT-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-methylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C)C1=CC=CC=C1 QYXUHIZLHNDFJT-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 150000004866 oxadiazoles Chemical class 0.000 description 2
- 125000002080 perylenyl group Chemical group C1(=CC=C2C=CC=C3C4=CC=CC5=CC=CC(C1=C23)=C45)* 0.000 description 2
- 230000036211 photosensitivity Effects 0.000 description 2
- 239000002985 plastic film Substances 0.000 description 2
- 229920006255 plastic film Polymers 0.000 description 2
- 229920002647 polyamide Polymers 0.000 description 2
- 230000027756 respiratory electron transport chain Effects 0.000 description 2
- 229910052711 selenium Inorganic materials 0.000 description 2
- 239000011669 selenium Substances 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000010409 thin film Substances 0.000 description 2
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 2
- 239000011787 zinc oxide Substances 0.000 description 2
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 description 1
- PMBBBTMBKMPOQF-UHFFFAOYSA-N 1,3,7-trinitrodibenzothiophene 5,5-dioxide Chemical compound O=S1(=O)C2=CC([N+](=O)[O-])=CC=C2C2=C1C=C([N+]([O-])=O)C=C2[N+]([O-])=O PMBBBTMBKMPOQF-UHFFFAOYSA-N 0.000 description 1
- WQGWMEKAPOBYFV-UHFFFAOYSA-N 1,5,7-trinitrothioxanthen-9-one Chemical compound C1=CC([N+]([O-])=O)=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3SC2=C1 WQGWMEKAPOBYFV-UHFFFAOYSA-N 0.000 description 1
- AOLUMCPVEUKWBX-UHFFFAOYSA-N 1-[2-[2-[2-(2,4-dimethoxyphenyl)ethenyl]phenyl]ethenyl]-2,4-dimethoxybenzene Chemical compound COC1=CC(OC)=CC=C1C=CC1=CC=CC=C1C=CC1=CC=C(OC)C=C1OC AOLUMCPVEUKWBX-UHFFFAOYSA-N 0.000 description 1
- MNCMBBIFTVWHIP-UHFFFAOYSA-N 1-anthracen-9-yl-2,2,2-trifluoroethanone Chemical group C1=CC=C2C(C(=O)C(F)(F)F)=C(C=CC=C3)C3=CC2=C1 MNCMBBIFTVWHIP-UHFFFAOYSA-N 0.000 description 1
- LFKNYYQRWMMFSM-UHFFFAOYSA-N 1-ethyl-9h-carbazole;formaldehyde Chemical compound O=C.N1C2=CC=CC=C2C2=C1C(CC)=CC=C2 LFKNYYQRWMMFSM-UHFFFAOYSA-N 0.000 description 1
- GTELMICNKVYBCM-UHFFFAOYSA-N 2,3-dibenzylidenecyclohexan-1-one Chemical group C=1C=CC=CC=1C=C1C(=O)CCCC1=CC1=CC=CC=C1 GTELMICNKVYBCM-UHFFFAOYSA-N 0.000 description 1
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- FVNMKGQIOLSWHJ-UHFFFAOYSA-N 2,4,5,7-tetranitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3OC2=C1[N+]([O-])=O FVNMKGQIOLSWHJ-UHFFFAOYSA-N 0.000 description 1
- WDFBSMBVBUXHRP-UHFFFAOYSA-N 2-[2-(4-methylphenyl)-1-phenylethenyl]-n-phenylaniline Chemical compound C1=CC(C)=CC=C1C=C(C=1C(=CC=CC=1)NC=1C=CC=CC=1)C1=CC=CC=C1 WDFBSMBVBUXHRP-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- CUDANNOCLGTWLM-UHFFFAOYSA-N 2-methyl-n-(2-methylphenyl)-n-[4-(2-phenylethenyl)phenyl]aniline Chemical compound CC1=CC=CC=C1N(C=1C(=CC=CC=1)C)C(C=C1)=CC=C1C=CC1=CC=CC=C1 CUDANNOCLGTWLM-UHFFFAOYSA-N 0.000 description 1
- JFGQHAHJWJBOPD-UHFFFAOYSA-N 3-hydroxy-n-phenylnaphthalene-2-carboxamide Chemical compound OC1=CC2=CC=CC=C2C=C1C(=O)NC1=CC=CC=C1 JFGQHAHJWJBOPD-UHFFFAOYSA-N 0.000 description 1
- NIZIGUQDQIALBQ-UHFFFAOYSA-N 4-(2,2-diphenylethenyl)-n,n-diphenylaniline Chemical compound C=1C=C(N(C=2C=CC=CC=2)C=2C=CC=CC=2)C=CC=1C=C(C=1C=CC=CC=1)C1=CC=CC=C1 NIZIGUQDQIALBQ-UHFFFAOYSA-N 0.000 description 1
- PLVXCTLGYWKUAY-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethenyl)-n,n-diphenylaniline Chemical compound C=1C=CC2=CC=CC=C2C=1C=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 PLVXCTLGYWKUAY-UHFFFAOYSA-N 0.000 description 1
- GAYAMEKFIBYRJW-UHFFFAOYSA-N 4-(fluoren-9-ylidenemethyl)-n,n-dimethylaniline Chemical compound C1=CC(N(C)C)=CC=C1C=C1C2=CC=CC=C2C2=CC=CC=C21 GAYAMEKFIBYRJW-UHFFFAOYSA-N 0.000 description 1
- YGBCLRRWZQSURU-UHFFFAOYSA-N 4-[(diphenylhydrazinylidene)methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 YGBCLRRWZQSURU-UHFFFAOYSA-N 0.000 description 1
- VWEQSBRKYZRWPQ-UHFFFAOYSA-N 4-[2-(10-bromoanthracen-9-yl)ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=C(C=CC=C2)C2=C(Br)C2=CC=CC=C12 VWEQSBRKYZRWPQ-UHFFFAOYSA-N 0.000 description 1
- ZTYUDPDLRTYFCU-UHFFFAOYSA-N 4-[2-[2-[2-[4-(diethylamino)phenyl]ethenyl]phenyl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=CC=C1C=CC1=CC=C(N(CC)CC)C=C1 ZTYUDPDLRTYFCU-UHFFFAOYSA-N 0.000 description 1
- HXOZSIAZPFUUHH-UHFFFAOYSA-N 4-[2-[4-[5-[4-[2-[4-(diethylamino)phenyl]ethenyl]phenyl]-1,3,4-oxadiazol-2-yl]phenyl]ethenyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=C(C=2OC(=NN=2)C=2C=CC(C=CC=3C=CC(=CC=3)N(CC)CC)=CC=2)C=C1 HXOZSIAZPFUUHH-UHFFFAOYSA-N 0.000 description 1
- JJQOKUCYWIGCIN-UHFFFAOYSA-N 4-[4-(2-chlorophenyl)-2-ethenyl-1,3-oxazol-5-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=C(C=2C(=CC=CC=2)Cl)N=C(C=C)O1 JJQOKUCYWIGCIN-UHFFFAOYSA-N 0.000 description 1
- UZGVMZRBRRYLIP-UHFFFAOYSA-N 4-[5-[4-(diethylamino)phenyl]-1,3,4-oxadiazol-2-yl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)N(CC)CC)O1 UZGVMZRBRRYLIP-UHFFFAOYSA-N 0.000 description 1
- AEEHOVNCLFTKTO-UHFFFAOYSA-N 4-[[benzyl(phenyl)hydrazinylidene]methyl]-n,n-diphenylaniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC=CC=1)N=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 AEEHOVNCLFTKTO-UHFFFAOYSA-N 0.000 description 1
- SBMCZDLOXDWNIN-UHFFFAOYSA-N 4-[bis[4-(diethylamino)phenyl]methyl]-n,n-diethylaniline Chemical compound C1=CC(N(CC)CC)=CC=C1C(C=1C=CC(=CC=1)N(CC)CC)C1=CC=C(N(CC)CC)C=C1 SBMCZDLOXDWNIN-UHFFFAOYSA-N 0.000 description 1
- CBZMQWPBAUBAPO-UHFFFAOYSA-N 4-ethenyl-n,n-diethylaniline Chemical compound CCN(CC)C1=CC=C(C=C)C=C1 CBZMQWPBAUBAPO-UHFFFAOYSA-N 0.000 description 1
- WATOJXAPBDFTQJ-UHFFFAOYSA-N 4-methyl-2,6-bis[(4-nitrophenyl)methylidene]cyclohexan-1-one Chemical compound O=C1C(=CC=2C=CC(=CC=2)[N+]([O-])=O)CC(C)CC1=CC1=CC=C([N+]([O-])=O)C=C1 WATOJXAPBDFTQJ-UHFFFAOYSA-N 0.000 description 1
- FVGPNZKTTWPLOC-UHFFFAOYSA-N 9-ethyl-3-(2-phenylethenyl)carbazole Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=CC1=CC=CC=C1 FVGPNZKTTWPLOC-UHFFFAOYSA-N 0.000 description 1
- BODPVHGDJHVWAW-UHFFFAOYSA-N 9-ethyl-3-[2-(4-methoxyphenyl)ethenyl]carbazole Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=CC1=CC=C(OC)C=C1 BODPVHGDJHVWAW-UHFFFAOYSA-N 0.000 description 1
- SCHUFJWXJINKKV-UHFFFAOYSA-N 9-ethyl-3-fluoren-9-ylidene-2h-carbazole Chemical compound C12=CC=CC=C2C2=CC=CC=C2C1=C1C=C2C3=CC=CC=C3N(CC)C2=CC1 SCHUFJWXJINKKV-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- 206010034960 Photophobia Diseases 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 1
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical group C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 1
- MKYQPGPNVYRMHI-UHFFFAOYSA-N Triphenylethylene Chemical compound C=1C=CC=CC=1C=C(C=1C=CC=CC=1)C1=CC=CC=C1 MKYQPGPNVYRMHI-UHFFFAOYSA-N 0.000 description 1
- MUBKMWFYVHYZAI-UHFFFAOYSA-N [Al].[Cu].[Zn] Chemical compound [Al].[Cu].[Zn] MUBKMWFYVHYZAI-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000001450 anions Chemical group 0.000 description 1
- 125000005577 anthracene group Chemical group 0.000 description 1
- 125000001691 aryl alkyl amino group Chemical group 0.000 description 1
- 230000004888 barrier function Effects 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 125000004965 chloroalkyl group Chemical group 0.000 description 1
- 239000002131 composite material Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004986 diarylamino group Chemical group 0.000 description 1
- 230000009189 diving Effects 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000003983 fluorenyl group Chemical group C1(=CC=CC=2C3=CC=CC=C3CC12)* 0.000 description 1
- OHUWRYQKKWKGKG-UHFFFAOYSA-N formaldehyde;pyrene Chemical compound O=C.C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 OHUWRYQKKWKGKG-UHFFFAOYSA-N 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 208000013469 light sensitivity Diseases 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- OJVNNLDLHOFPFQ-UHFFFAOYSA-N n,n-dibenzyl-4-(2-phenylethenyl)aniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=CC=2C=CC=CC=2)=CC=1)CC1=CC=CC=C1 OJVNNLDLHOFPFQ-UHFFFAOYSA-N 0.000 description 1
- IRKBOPBCDTWDDY-UHFFFAOYSA-N n,n-dibenzyl-4-[(diphenylhydrazinylidene)methyl]aniline Chemical compound C=1C=CC=CC=1CN(C=1C=CC(C=NN(C=2C=CC=CC=2)C=2C=CC=CC=2)=CC=1)CC1=CC=CC=C1 IRKBOPBCDTWDDY-UHFFFAOYSA-N 0.000 description 1
- BVTXDOPTUCCGGU-UHFFFAOYSA-N n,n-diethyl-4-(2-naphthalen-1-ylethenyl)aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C=CC1=CC=CC2=CC=CC=C12 BVTXDOPTUCCGGU-UHFFFAOYSA-N 0.000 description 1
- GAZKGHIEJKXNCQ-UHFFFAOYSA-N n,n-diethyl-4-(4-phenyl-1,3-oxazol-2-yl)aniline Chemical compound C1=CC(N(CC)CC)=CC=C1C1=NC(C=2C=CC=CC=2)=CO1 GAZKGHIEJKXNCQ-UHFFFAOYSA-N 0.000 description 1
- DXYYLUGHPCHMRQ-UHFFFAOYSA-N n,n-diphenyl-4-(2-phenylethenyl)aniline Chemical compound C=1C=CC=CC=1C=CC(C=C1)=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 DXYYLUGHPCHMRQ-UHFFFAOYSA-N 0.000 description 1
- UAVOVDWXWRXKPS-UHFFFAOYSA-N n-[(4-methoxyphenyl)methylideneamino]-n-methylaniline Chemical compound C1=CC(OC)=CC=C1C=NN(C)C1=CC=CC=C1 UAVOVDWXWRXKPS-UHFFFAOYSA-N 0.000 description 1
- CEAPHJPESODIQL-UHFFFAOYSA-N n-[(9-ethylcarbazol-3-yl)methylideneamino]-n-phenylaniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C=1C=CC=CC=1)C1=CC=CC=C1 CEAPHJPESODIQL-UHFFFAOYSA-N 0.000 description 1
- ZQKFNYHHBMBPHU-UHFFFAOYSA-N n-benzyl-n-[(2,4-dimethoxyphenyl)methylideneamino]aniline Chemical compound COC1=CC(OC)=CC=C1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 ZQKFNYHHBMBPHU-UHFFFAOYSA-N 0.000 description 1
- HIWDRSNALOGCSA-UHFFFAOYSA-N n-benzyl-n-[(4-methoxynaphthalen-1-yl)methylideneamino]aniline Chemical compound C12=CC=CC=C2C(OC)=CC=C1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 HIWDRSNALOGCSA-UHFFFAOYSA-N 0.000 description 1
- RPHJRJPXKZMFFQ-UHFFFAOYSA-N n-benzyl-n-[(9-ethylcarbazol-3-yl)methylideneamino]aniline Chemical compound C=1C=C2N(CC)C3=CC=CC=C3C2=CC=1C=NN(C=1C=CC=CC=1)CC1=CC=CC=C1 RPHJRJPXKZMFFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004957 naphthylene group Chemical group 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 238000005498 polishing Methods 0.000 description 1
- 229920002401 polyacrylamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920001470 polyketone Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 229920006215 polyvinyl ketone Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012925 reference material Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B35/00—Disazo and polyazo dyes of the type A<-D->B prepared by diazotising and coupling
- C09B35/02—Disazo dyes
- C09B35/021—Disazo dyes characterised by two coupling components of the same type
- C09B35/033—Disazo dyes characterised by two coupling components of the same type in which the coupling component is an arylamide of an o-hydroxy-carboxylic acid or of a beta-keto-carboxylic acid
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B56/00—Azo dyes containing other chromophoric systems
- C09B56/16—Methine- or polymethine-azo dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP59124572A JPH0721116B2 (ja) | 1984-06-19 | 1984-06-19 | 新規なジスアゾ化合物およびその製造方法 |
| JP60056676A JPH065389B2 (ja) | 1985-03-20 | 1985-03-20 | 電子写真用感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3521652A1 DE3521652A1 (de) | 1985-12-19 |
| DE3521652C2 true DE3521652C2 (enExample) | 1992-08-13 |
Family
ID=26397638
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853521652 Granted DE3521652A1 (de) | 1984-06-19 | 1985-06-18 | Disazoverbindungen, verfahren zu deren herstellung und diese enthaltende lichtempfindliche materialien |
Country Status (2)
| Country | Link |
|---|---|
| US (1) | US4666805A (enExample) |
| DE (1) | DE3521652A1 (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4916039A (en) * | 1987-07-08 | 1990-04-10 | Ricoh Company, Ltd. | Electrophotographic photoconductor |
| US5077161A (en) * | 1990-05-31 | 1991-12-31 | Xerox Corporation | Imaging members with bichromophoric bisazo perylene photoconductive materials |
| US5066796A (en) * | 1990-05-31 | 1991-11-19 | Xerox Corporation | Electrophotographic imaging members with bichromophoric bisazo phthalocyanine photoconductive materials |
| US5055367A (en) * | 1990-05-31 | 1991-10-08 | Xerox Corporation | Imaging members with bichromophoric bisazo perinone photoconductive materials |
| JP2782108B2 (ja) * | 1990-06-13 | 1998-07-30 | キヤノン株式会社 | 電子写真感光体、該電子写真感光体を備えた電子写真装置並びにファクシミリ |
| US5192632A (en) * | 1990-07-30 | 1993-03-09 | Canon Kabushiki Kaisha | Electrophotographic bisazo photosensitive member, and electrophotographic apparatus and facsimile employing the same |
| US5281503A (en) * | 1992-04-17 | 1994-01-25 | Xerox Corporation | Couplers for photogenerating azo pigments |
| US7410746B2 (en) * | 2002-03-29 | 2008-08-12 | Dai Nippon Printing Co., Ltd. | Photoradical polymerization initiator, radical generator, photosensitive compound and photosensitive resin composition containing these materials and product or its accessory portions using the composition |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE756410A (fr) * | 1969-09-22 | 1971-03-01 | Fuji Photo Film Co Ltd | Materiels photosensibles de photographie en couleurs contenant un colorant bleu-vert pour le procede de blanchiment a l'argent/colorant |
| JPS5746246A (en) * | 1980-09-04 | 1982-03-16 | Ricoh Co Ltd | Electrophotographic receptor |
| JPS5747357A (en) * | 1980-09-04 | 1982-03-18 | Ricoh Co Ltd | Novel disazo compound and its preparation |
| US4390611A (en) * | 1980-09-26 | 1983-06-28 | Shozo Ishikawa | Electrophotographic photosensitive azo pigment containing members |
| JPS57101846A (en) * | 1980-12-17 | 1982-06-24 | Ricoh Co Ltd | Electrophotographic receptor |
| JPS5816243A (ja) * | 1981-07-22 | 1983-01-29 | Copyer Co Ltd | 電子写真感光体 |
| DE3301453A1 (de) * | 1982-01-18 | 1983-07-21 | Fuji Photo Film Co., Ltd., Minami-Ashigara, Kanagawa | Disazoverbindungen, photoleitfaehige zusammensetzungen und elektrophotographische aufzeichnungsmaterialien |
| JPS58129060A (ja) * | 1982-01-29 | 1983-08-01 | Asahi Glass Co Ltd | 新規なジスアゾ化合物及びその製造法 |
| JPS5945444A (ja) * | 1982-09-08 | 1984-03-14 | Fuji Photo Film Co Ltd | 電子写真感光体 |
-
1985
- 1985-06-11 US US06/743,537 patent/US4666805A/en not_active Expired - Lifetime
- 1985-06-18 DE DE19853521652 patent/DE3521652A1/de active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| US4666805A (en) | 1987-05-19 |
| DE3521652A1 (de) | 1985-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2829543C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3750498T2 (de) | Photoempfindliches material für elektrophotographie. | |
| DE3138292C2 (enExample) | ||
| DE3626497C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2935536C2 (enExample) | ||
| US4299896A (en) | Electrophotographic sensitive materials containing a disazo pigment | |
| DE3447685C2 (enExample) | ||
| DE3617948C2 (enExample) | ||
| DE3602987C2 (enExample) | ||
| US4314015A (en) | Electrophotographic sensitive materials containing disazo compounds | |
| DE69118467T2 (de) | Elektrophotographisches Element | |
| DE2947760C2 (enExample) | ||
| DE3521652C2 (enExample) | ||
| DE3049184A1 (de) | Elektrophotographisches element | |
| DE3448011C2 (enExample) | ||
| DE3049303C2 (enExample) | ||
| DE3810522A1 (de) | Aromatische diolefinische verbindungen, aromatische diethylverbindungen und elektrophotographische photoleiter, die eine aromatische diethylverbindung enthalten | |
| DE3321871C2 (enExample) | ||
| DE3220208C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3522896C2 (enExample) | ||
| DE3886446T2 (de) | Elektrophotographisches lichtempfindliches Element. | |
| DE69214715T2 (de) | Elektrophotographischer Photorezeptor | |
| DE10249645A1 (de) | Organisches fotoleitendes Material und elektrofotografischer Fotorezeptor, in dem das Material verwendet wird | |
| DE69018872T2 (de) | Elektrophotographischer Photorezeptor. | |
| DE69023262T2 (de) | Elektrophotographischer Photorezeptor. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OP8 | Request for examination as to paragraph 44 patent law | ||
| 8125 | Change of the main classification |
Ipc: G03G 5/06 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Free format text: BARZ, P., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 80803 MUENCHEN |
|
| 8339 | Ceased/non-payment of the annual fee |