DE3138292C2 - - Google Patents
Info
- Publication number
- DE3138292C2 DE3138292C2 DE3138292A DE3138292A DE3138292C2 DE 3138292 C2 DE3138292 C2 DE 3138292C2 DE 3138292 A DE3138292 A DE 3138292A DE 3138292 A DE3138292 A DE 3138292A DE 3138292 C2 DE3138292 C2 DE 3138292C2
- Authority
- DE
- Germany
- Prior art keywords
- recording material
- material according
- substituted
- hydrogen atom
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000000463 material Substances 0.000 claims description 174
- 239000000049 pigment Substances 0.000 claims description 131
- 239000010410 layer Substances 0.000 claims description 130
- 239000002800 charge carrier Substances 0.000 claims description 57
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 50
- -1 pyrazoline compound Chemical class 0.000 claims description 49
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 34
- 239000012790 adhesive layer Substances 0.000 claims description 27
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 claims description 22
- 125000003118 aryl group Chemical group 0.000 claims description 20
- 125000005843 halogen group Chemical group 0.000 claims description 20
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 239000011230 binding agent Substances 0.000 claims description 16
- 125000003545 alkoxy group Chemical group 0.000 claims description 15
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Chemical compound C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 claims description 15
- 150000002430 hydrocarbons Chemical group 0.000 claims description 15
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 13
- 239000005018 casein Substances 0.000 claims description 11
- BECPQYXYKAMYBN-UHFFFAOYSA-N casein, tech. Chemical compound NCCCCC(C(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(CC(C)C)N=C(O)C(CCC(O)=O)N=C(O)C(CC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(C(C)O)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=N)N=C(O)C(CCC(O)=O)N=C(O)C(CCC(O)=O)N=C(O)C(COP(O)(O)=O)N=C(O)C(CCC(O)=N)N=C(O)C(N)CC1=CC=CC=C1 BECPQYXYKAMYBN-UHFFFAOYSA-N 0.000 claims description 11
- 235000021240 caseins Nutrition 0.000 claims description 11
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- DNDAOZDDKCRAPX-UHFFFAOYSA-N 3-N,4-N-diethyl-2-phenyl-1,3,4-oxadiazolidine-3,4-diamine Chemical compound C(C)NN1N(C(OC1)C1=CC=CC=C1)NCC DNDAOZDDKCRAPX-UHFFFAOYSA-N 0.000 claims description 10
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 10
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 229920000515 polycarbonate Polymers 0.000 claims description 9
- 239000004417 polycarbonate Substances 0.000 claims description 9
- 125000004442 acylamino group Chemical group 0.000 claims description 7
- 230000008878 coupling Effects 0.000 claims description 7
- 238000010168 coupling process Methods 0.000 claims description 7
- 238000005859 coupling reaction Methods 0.000 claims description 7
- 125000005842 heteroatom Chemical group 0.000 claims description 7
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 7
- 239000004372 Polyvinyl alcohol Substances 0.000 claims description 6
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 6
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 5
- 125000002560 nitrile group Chemical group 0.000 claims description 5
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 5
- VHQGURIJMFPBKS-UHFFFAOYSA-N 2,4,7-trinitrofluoren-9-one Chemical compound [O-][N+](=O)C1=CC([N+]([O-])=O)=C2C3=CC=C([N+](=O)[O-])C=C3C(=O)C2=C1 VHQGURIJMFPBKS-UHFFFAOYSA-N 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229920000728 polyester Polymers 0.000 claims description 4
- 229920000178 Acrylic resin Polymers 0.000 claims description 3
- 239000004925 Acrylic resin Substances 0.000 claims description 3
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 3
- 150000001454 anthracenes Chemical class 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- 125000005678 ethenylene group Chemical group [H]C([*:1])=C([H])[*:2] 0.000 claims description 3
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 3
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 3
- 150000004866 oxadiazoles Chemical class 0.000 claims description 3
- 150000002916 oxazoles Chemical class 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 3
- 125000004434 sulfur atom Chemical group 0.000 claims description 3
- HCSGQHDONHRJCM-CCEZHUSRSA-N 9-[(e)-2-phenylethenyl]anthracene Chemical compound C=12C=CC=CC2=CC2=CC=CC=C2C=1\C=C\C1=CC=CC=C1 HCSGQHDONHRJCM-CCEZHUSRSA-N 0.000 claims description 2
- 239000004716 Ethylene/acrylic acid copolymer Substances 0.000 claims description 2
- 239000000020 Nitrocellulose Substances 0.000 claims description 2
- 239000004952 Polyamide Substances 0.000 claims description 2
- QHIWVLPBUQWDMQ-UHFFFAOYSA-N butyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.COC(=O)C(C)=C.CCCCOC(=O)C=C QHIWVLPBUQWDMQ-UHFFFAOYSA-N 0.000 claims description 2
- 239000012461 cellulose resin Substances 0.000 claims description 2
- 239000003822 epoxy resin Substances 0.000 claims description 2
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 2
- 229920001220 nitrocellulos Polymers 0.000 claims description 2
- 229920006287 phenoxy resin Polymers 0.000 claims description 2
- 239000013034 phenoxy resin Substances 0.000 claims description 2
- 229920002401 polyacrylamide Polymers 0.000 claims description 2
- 229920002647 polyamide Polymers 0.000 claims description 2
- 229920000647 polyepoxide Polymers 0.000 claims description 2
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 2
- 229920002717 polyvinylpyridine Polymers 0.000 claims description 2
- 229920002803 thermoplastic polyurethane Polymers 0.000 claims description 2
- 150000007857 hydrazones Chemical class 0.000 claims 2
- 125000004957 naphthylene group Chemical group 0.000 claims 2
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 claims 1
- 150000008376 fluorenones Chemical class 0.000 claims 1
- 239000011118 polyvinyl acetate Substances 0.000 claims 1
- 239000000243 solution Substances 0.000 description 64
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 52
- 238000000034 method Methods 0.000 description 34
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 26
- 239000006185 dispersion Substances 0.000 description 23
- 229910052782 aluminium Inorganic materials 0.000 description 20
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 20
- 230000015572 biosynthetic process Effects 0.000 description 19
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 17
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 16
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- 229920005989 resin Polymers 0.000 description 14
- 239000011347 resin Substances 0.000 description 14
- 230000032258 transport Effects 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 11
- 239000011888 foil Substances 0.000 description 11
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 11
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 10
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 10
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 10
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 10
- 229910052794 bromium Inorganic materials 0.000 description 9
- 239000000460 chlorine Substances 0.000 description 9
- 229910052801 chlorine Inorganic materials 0.000 description 9
- 229910052740 iodine Chemical group 0.000 description 9
- 238000003786 synthesis reaction Methods 0.000 description 9
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 8
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 8
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 8
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 8
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 229920003227 poly(N-vinyl carbazole) Polymers 0.000 description 7
- 229920000139 polyethylene terephthalate Polymers 0.000 description 7
- 239000005020 polyethylene terephthalate Substances 0.000 description 7
- 230000035945 sensitivity Effects 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 238000007738 vacuum evaporation Methods 0.000 description 7
- MNKUJJOWHVPZDZ-UHFFFAOYSA-N 2-phenyl-3-N,4-N-dipropyl-1,3,4-oxadiazolidine-3,4-diamine Chemical compound C(CC)NN1N(C(OC1)C1=CC=CC=C1)NCCC MNKUJJOWHVPZDZ-UHFFFAOYSA-N 0.000 description 6
- VQCPXKGDRIYRKX-UHFFFAOYSA-N 3-N,4-N-dimethyl-2-phenyl-1,3,4-oxadiazolidine-3,4-diamine Chemical compound CNN1N(C(OC1)C1=CC=CC=C1)NC VQCPXKGDRIYRKX-UHFFFAOYSA-N 0.000 description 6
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 6
- 239000004793 Polystyrene Substances 0.000 description 6
- ZZCUCJQBLYYUTA-UHFFFAOYSA-N 3-N,4-N-dibenzyl-2-phenyl-1,3,4-oxadiazolidine-3,4-diamine Chemical compound C(C1=CC=CC=C1)NN1N(C(OC1)C1=CC=CC=C1)NCC1=CC=CC=C1 ZZCUCJQBLYYUTA-UHFFFAOYSA-N 0.000 description 5
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- 150000004985 diamines Chemical class 0.000 description 5
- 229920001225 polyester resin Polymers 0.000 description 5
- 239000004645 polyester resin Substances 0.000 description 5
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 5
- CBIKTIWXUUIWDO-UHFFFAOYSA-N 2-(9h-carbazol-3-yl)-5-methyl-1,3,4-oxadiazole Chemical compound O1C(C)=NN=C1C1=CC=C(NC=2C3=CC=CC=2)C3=C1 CBIKTIWXUUIWDO-UHFFFAOYSA-N 0.000 description 4
- 238000010521 absorption reaction Methods 0.000 description 4
- 238000000862 absorption spectrum Methods 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000012860 organic pigment Substances 0.000 description 4
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 239000004926 polymethyl methacrylate Substances 0.000 description 4
- 239000001294 propane Substances 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 235000011121 sodium hydroxide Nutrition 0.000 description 4
- 235000010288 sodium nitrite Nutrition 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- YCRPQBIANOLHRC-UHFFFAOYSA-N 2-(9h-carbazol-3-yl)-5-ethyl-1,3,4-oxadiazole Chemical compound O1C(CC)=NN=C1C1=CC=C(NC=2C3=CC=CC=2)C3=C1 YCRPQBIANOLHRC-UHFFFAOYSA-N 0.000 description 3
- YJCQUUAHEMJSTE-UHFFFAOYSA-N 2-ethyl-5-(9-ethylcarbazol-3-yl)-1,3,4-oxadiazole Chemical compound O1C(CC)=NN=C1C1=CC=C(N(CC)C=2C3=CC=CC=2)C3=C1 YJCQUUAHEMJSTE-UHFFFAOYSA-N 0.000 description 3
- MJZXFMSIHMJQBW-UHFFFAOYSA-N 4-[5-(4-aminophenyl)-1,3,4-oxadiazol-2-yl]aniline Chemical compound C1=CC(N)=CC=C1C1=NN=C(C=2C=CC(N)=CC=2)O1 MJZXFMSIHMJQBW-UHFFFAOYSA-N 0.000 description 3
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 3
- 229920001634 Copolyester Polymers 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 238000000921 elemental analysis Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- HLSTTYRAKOWMOY-UHFFFAOYSA-N n,n-diethyl-5-(9-ethylcarbazol-3-yl)-2h-1,3,4-oxadiazol-3-amine Chemical compound CCN(CC)N1COC(C=2C=C3C4=CC=CC=C4N(CC)C3=CC=2)=N1 HLSTTYRAKOWMOY-UHFFFAOYSA-N 0.000 description 3
- 239000002985 plastic film Substances 0.000 description 3
- 229920006255 plastic film Polymers 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- LWHDQPLUIFIFFT-UHFFFAOYSA-N 2,3,5,6-tetrabromocyclohexa-2,5-diene-1,4-dione Chemical compound BrC1=C(Br)C(=O)C(Br)=C(Br)C1=O LWHDQPLUIFIFFT-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229950011260 betanaphthol Drugs 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000012876 carrier material Substances 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 125000004986 diarylamino group Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 2
- BBEAQIROQSPTKN-UHFFFAOYSA-N pyrene Chemical compound C1=CC=C2C=CC3=CC=CC4=CC=C1C2=C43 BBEAQIROQSPTKN-UHFFFAOYSA-N 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- JOERSAVCLPYNIZ-UHFFFAOYSA-N 2,4,5,7-tetranitrofluoren-9-one Chemical compound O=C1C2=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C2C2=C1C=C([N+](=O)[O-])C=C2[N+]([O-])=O JOERSAVCLPYNIZ-UHFFFAOYSA-N 0.000 description 1
- FVNMKGQIOLSWHJ-UHFFFAOYSA-N 2,4,5,7-tetranitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC([N+](=O)[O-])=CC([N+]([O-])=O)=C3OC2=C1[N+]([O-])=O FVNMKGQIOLSWHJ-UHFFFAOYSA-N 0.000 description 1
- WCQLACGUXBFKGM-UHFFFAOYSA-N 2-(2,4,7-trinitro-1-oxo-2h-fluoren-9-ylidene)propanedinitrile Chemical compound [O-][N+](=O)C1=CC=C2C(C(=CC(C3=O)[N+](=O)[O-])[N+]([O-])=O)=C3C(=C(C#N)C#N)C2=C1 WCQLACGUXBFKGM-UHFFFAOYSA-N 0.000 description 1
- CIMLJLMMRYUTDY-UHFFFAOYSA-N 2-(4-aminophenyl)-5-methyl-1,3-benzoxazol-6-amine Chemical compound O1C=2C=C(N)C(C)=CC=2N=C1C1=CC=C(N)C=C1 CIMLJLMMRYUTDY-UHFFFAOYSA-N 0.000 description 1
- PFIFABSZHBUGBK-UHFFFAOYSA-N 2-(9h-carbazol-3-yl)-5-(2-phenylethenyl)-1,3,4-oxadiazole Chemical compound N=1N=C(C=2C=C3C4=CC=CC=C4NC3=CC=2)OC=1C=CC1=CC=CC=C1 PFIFABSZHBUGBK-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- WGRSVHBSCVGKDP-UHFFFAOYSA-N 2-ethyl-9h-carbazole-1-carbaldehyde Chemical compound C1=CC=C2C3=CC=C(CC)C(C=O)=C3NC2=C1 WGRSVHBSCVGKDP-UHFFFAOYSA-N 0.000 description 1
- CXYMDAXGGAITQP-UHFFFAOYSA-N 2-hydroxy-n-phenylnaphthalene-1-carboxamide Chemical group OC1=CC=C2C=CC=CC2=C1C(=O)NC1=CC=CC=C1 CXYMDAXGGAITQP-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- IICCLYANAQEHCI-UHFFFAOYSA-N 4,5,6,7-tetrachloro-3',6'-dihydroxy-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanthene]-1-one Chemical compound O1C(=O)C(C(=C(Cl)C(Cl)=C2Cl)Cl)=C2C21C1=CC(I)=C(O)C(I)=C1OC1=C(I)C(O)=C(I)C=C21 IICCLYANAQEHCI-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- NRCMAYZCPIVABH-UHFFFAOYSA-N Quinacridone Chemical compound N1C2=CC=CC=C2C(=O)C2=C1C=C1C(=O)C3=CC=CC=C3NC1=C2 NRCMAYZCPIVABH-UHFFFAOYSA-N 0.000 description 1
- 241000519995 Stachys sylvatica Species 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- UOCJDOLVGGIYIQ-PBFPGSCMSA-N cefatrizine Chemical group S([C@@H]1[C@@H](C(N1C=1C(O)=O)=O)NC(=O)[C@H](N)C=2C=CC(O)=CC=2)CC=1CSC=1C=NNN=1 UOCJDOLVGGIYIQ-PBFPGSCMSA-N 0.000 description 1
- 125000004803 chlorobenzyl group Chemical group 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 230000002542 deteriorative effect Effects 0.000 description 1
- 125000006286 dichlorobenzyl group Chemical group 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 125000005805 dimethoxy phenyl group Chemical group 0.000 description 1
- 238000003618 dip coating Methods 0.000 description 1
- 125000004914 dipropylamino group Chemical group C(CC)N(CCC)* 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- GVEPBJHOBDJJJI-UHFFFAOYSA-N fluoranthrene Natural products C1=CC(C2=CC=CC=C22)=C3C2=CC=CC3=C1 GVEPBJHOBDJJJI-UHFFFAOYSA-N 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 238000007648 laser printing Methods 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 125000006178 methyl benzyl group Chemical group 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 125000006501 nitrophenyl group Chemical group 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000379 polypropylene carbonate Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003219 pyrazolines Chemical class 0.000 description 1
- RCYFOPUXRMOLQM-UHFFFAOYSA-N pyrene-1-carbaldehyde Chemical compound C1=C2C(C=O)=CC=C(C=C3)C2=C2C3=CC=CC2=C1 RCYFOPUXRMOLQM-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229930187593 rose bengal Natural products 0.000 description 1
- 229940081623 rose bengal Drugs 0.000 description 1
- STRXNPAVPKGJQR-UHFFFAOYSA-N rose bengal A Natural products O1C(=O)C(C(=CC=C2Cl)Cl)=C2C21C1=CC(I)=C(O)C(I)=C1OC1=C(I)C(O)=C(I)C=C21 STRXNPAVPKGJQR-UHFFFAOYSA-N 0.000 description 1
- WKEDVNSFRWHDNR-UHFFFAOYSA-N salicylanilide Chemical group OC1=CC=CC=C1C(=O)NC1=CC=CC=C1 WKEDVNSFRWHDNR-UHFFFAOYSA-N 0.000 description 1
- 230000001235 sensitizing effect Effects 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- NLDYACGHTUPAQU-UHFFFAOYSA-N tetracyanoethylene Chemical group N#CC(C#N)=C(C#N)C#N NLDYACGHTUPAQU-UHFFFAOYSA-N 0.000 description 1
- PCCVSPMFGIFTHU-UHFFFAOYSA-N tetracyanoquinodimethane Chemical compound N#CC(C#N)=C1C=CC(=C(C#N)C#N)C=C1 PCCVSPMFGIFTHU-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- ODHXBMXNKOYIBV-UHFFFAOYSA-N triphenylamine Chemical compound C1=CC=CC=C1N(C=1C=CC=CC=1)C1=CC=CC=C1 ODHXBMXNKOYIBV-UHFFFAOYSA-N 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- 125000005023 xylyl group Chemical group 0.000 description 1
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0683—Disazo dyes containing polymethine or anthraquinone groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0681—Disazo dyes containing hetero rings in the part of the molecule between the azo-groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0679—Disazo dyes
- G03G5/0683—Disazo dyes containing polymethine or anthraquinone groups
- G03G5/0685—Disazo dyes containing polymethine or anthraquinone groups containing hetero rings in the part of the molecule between the azo-groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0687—Trisazo dyes
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0687—Trisazo dyes
- G03G5/0688—Trisazo dyes containing hetero rings
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0687—Trisazo dyes
- G03G5/069—Trisazo dyes containing polymethine or anthraquinone groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0664—Dyes
- G03G5/0675—Azo dyes
- G03G5/0687—Trisazo dyes
- G03G5/069—Trisazo dyes containing polymethine or anthraquinone groups
- G03G5/0692—Trisazo dyes containing polymethine or anthraquinone groups containing hetero rings
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP13296580A JPS5758154A (en) | 1980-09-26 | 1980-09-26 | Electrophotographic receptor |
| JP13826480A JPS5763549A (en) | 1980-10-04 | 1980-10-04 | Electrophotographic receptor |
| JP13826680A JPS5763538A (en) | 1980-10-04 | 1980-10-04 | Electrophotographic receptor |
| JP13826380A JPS5763542A (en) | 1980-10-04 | 1980-10-04 | Electrophotographic receptor |
| JP13826580A JPS5763537A (en) | 1980-10-04 | 1980-10-04 | Electrophotographic receptor |
| JP15381480A JPS5778542A (en) | 1980-11-04 | 1980-11-04 | Electrophotographic receptor |
| JP16655780A JPS5790632A (en) | 1980-11-28 | 1980-11-28 | Electrophotographic receptor |
| JP10485681A JPS587146A (ja) | 1981-07-03 | 1981-07-03 | 電子写真感光体 |
| JP10485881A JPS587148A (ja) | 1981-07-03 | 1981-07-03 | 電子写真感光体 |
| JP10485781A JPS587147A (ja) | 1981-07-03 | 1981-07-03 | 電子写真感光体 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE3138292A1 DE3138292A1 (de) | 1982-05-27 |
| DE3138292C2 true DE3138292C2 (enExample) | 1990-02-01 |
Family
ID=27580222
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19813138292 Granted DE3138292A1 (de) | 1980-09-26 | 1981-09-25 | Lichtempfindliches element fuer elektrofotografische zwecke |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4390611A (enExample) |
| DE (1) | DE3138292A1 (enExample) |
| GB (1) | GB2088575B (enExample) |
Families Citing this family (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5660443A (en) * | 1979-10-23 | 1981-05-25 | Copyer Co Ltd | Lamination type electrophotographic receptor |
| JPS57195255A (en) * | 1981-05-26 | 1982-11-30 | Canon Inc | Electrophotographic receptor |
| US4540643A (en) * | 1983-04-26 | 1985-09-10 | Ricoh Co., Ltd. | Tetrazonium salt compounds, novel disazo compounds, method for the production thereof and disazo compound-containing electrophotographic elements |
| GB2153378B (en) * | 1983-12-28 | 1987-11-04 | Ricoh Kk | Disazo compounds and electrophotographic elements containing them |
| US4666805A (en) * | 1984-06-19 | 1987-05-19 | Ricoh Co., Ltd. | Photosensitive material containing disazo compound for use in electrophotography |
| US4600674A (en) * | 1984-06-21 | 1986-07-15 | Mitsubishi Paper Mills, Ltd. | Trisazo electrophotographic photoconductive material |
| JPS6148859A (ja) * | 1984-08-17 | 1986-03-10 | Konishiroku Photo Ind Co Ltd | 正帯電用感光体 |
| JPS6156351A (ja) * | 1984-08-28 | 1986-03-22 | Konishiroku Photo Ind Co Ltd | 感光体 |
| US4735882A (en) * | 1985-04-02 | 1988-04-05 | Canon Kabushiki Kaisha | Trisazo photsensitive member for electrophotography |
| US4713307A (en) * | 1986-04-11 | 1987-12-15 | Xerox Corporation | Organic azo photoconductor imaging members |
| JPS63284555A (ja) * | 1987-05-15 | 1988-11-21 | Alps Electric Co Ltd | 光導電性被膜およびそれを用いた電子写真感光体 |
| US4797337A (en) * | 1987-07-27 | 1989-01-10 | Xerox Corporation | Disazo photoconductive imaging members |
| US4999272A (en) * | 1988-08-31 | 1991-03-12 | Canon Kabushiki Kaisha | Electrophotographic analog and digital imaging and developing using magnetic toner |
| JPH02178670A (ja) * | 1988-12-29 | 1990-07-11 | Canon Inc | 電子写真感光体 |
| DE4018010C2 (de) * | 1989-06-06 | 1995-04-27 | Fuji Electric Co Ltd | Elektrophotographisches Aufzeichnungsmaterial |
| DE4042454C2 (de) * | 1989-06-06 | 1996-08-14 | Fuji Electric Co Ltd | Elektrophotographisches Aufzeichnungsmaterial |
| US5275898A (en) * | 1989-06-06 | 1994-01-04 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5132189A (en) * | 1989-09-07 | 1992-07-21 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| JP2770539B2 (ja) * | 1990-03-08 | 1998-07-02 | 富士電機株式会社 | 電子写真用感光体 |
| US5229237A (en) * | 1990-04-12 | 1993-07-20 | Canon Kabushiki Kaisha | Electrophotographic photosensitive member and process for production thereof comprising a disazo and trisazo pigment |
| US5139910A (en) * | 1990-12-21 | 1992-08-18 | Xerox Corporation | Photoconductive imaging members with bisazo compositions |
| US5316881A (en) * | 1991-12-27 | 1994-05-31 | Fuji Electric Co., Ltd. | Photoconductor for electrophotgraphy containing benzidine derivative |
| JPH05224439A (ja) * | 1992-02-12 | 1993-09-03 | Fuji Electric Co Ltd | 電子写真用感光体 |
| JP2817822B2 (ja) * | 1992-05-14 | 1998-10-30 | 富士電機株式会社 | 電子写真用感光体 |
| US5422211A (en) * | 1993-04-30 | 1995-06-06 | Xerox Corporation | Imaging members with trisazo photogenerating materials |
| US5524342A (en) * | 1994-05-27 | 1996-06-11 | Xerox Corporation | Methods for shrinking nickel articles |
| US5573445A (en) * | 1994-08-31 | 1996-11-12 | Xerox Corporation | Liquid honing process and composition for interference fringe suppression in photosensitive imaging members |
| US5635324A (en) * | 1995-03-20 | 1997-06-03 | Xerox Corporation | Multilayered photoreceptor using a roughened substrate and method for fabricating same |
| US5725667A (en) | 1996-03-01 | 1998-03-10 | Xerox Corporation | Dip coating apparatus having a single coating vessel |
| US5925486A (en) * | 1997-12-11 | 1999-07-20 | Lexmark International, Inc. | Imaging members with improved wear characteristics |
| US6214513B1 (en) | 1999-11-24 | 2001-04-10 | Xerox Corporation | Slot coating under an electric field |
| US6214419B1 (en) * | 1999-12-17 | 2001-04-10 | Xerox Corporation | Immersion coating process |
| US6312522B1 (en) | 1999-12-17 | 2001-11-06 | Xerox Corporation | Immersion coating system |
| US6174637B1 (en) | 2000-01-19 | 2001-01-16 | Xerox Corporation | Electrophotographic imaging member and process of making |
| US7132125B2 (en) * | 2001-09-17 | 2006-11-07 | Xerox Corporation | Processes for coating photoconductors |
| US6576299B1 (en) | 2001-12-19 | 2003-06-10 | Xerox Corporation | Coating method |
| US6962626B1 (en) | 2004-05-28 | 2005-11-08 | Xerox Corporation | Venting assembly for dip coating apparatus and related processes |
| US7582165B2 (en) * | 2005-03-31 | 2009-09-01 | Xerox Corporation | Photoreceptor plug to enable universal chuck capability |
| US20060254921A1 (en) * | 2005-05-10 | 2006-11-16 | Xerox Corporation | Anodization process and layers produced therefrom |
| US7523946B2 (en) * | 2005-06-20 | 2009-04-28 | Xerox Corporation | Expandable chuck |
| JP5569831B1 (ja) | 2013-05-15 | 2014-08-13 | 国立大学法人東北大学 | マイクロ空室の内壁面処理方法 |
| JP7621773B2 (ja) * | 2019-11-22 | 2025-01-27 | キヤノン株式会社 | 電子写真用部材、プロセスカートリッジおよび電子写真画像形成装置 |
Family Cites Families (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB768681A (en) | 1953-11-25 | 1957-02-20 | Ici Ltd | New disazo metallisable dyestuffs |
| US3553189A (en) * | 1967-04-13 | 1971-01-05 | Sumitomo Chemical Co | Amino-naphthol-azo-phenyl dyes |
| US3898084A (en) * | 1971-03-30 | 1975-08-05 | Ibm | Electrophotographic processes using disazo pigments |
| IT946574B (it) * | 1971-03-30 | 1973-05-21 | Ibm | Procedimento elettrofotografico impiegante disazopigmenti |
| US4118232A (en) * | 1971-04-07 | 1978-10-03 | Ciba-Geigy Ag | Photographic material containing sulphonic acid group containing disazo dyestuffs |
| DE2246254C2 (de) * | 1972-09-21 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | Elektrophotographisches Aufzeichnungsmaterial |
| US4024125A (en) * | 1973-01-19 | 1977-05-17 | Hoechst Aktiengesellschaft | Dis-azo pigments deriving from bis-diazotized diamino-2-phenyl-benzazolones |
| US3932381A (en) * | 1973-02-12 | 1976-01-13 | Eastman Kodak Company | Magenta image-providing phenylazo-naphthyl dyes |
| FR2272082B1 (enExample) * | 1974-05-24 | 1978-08-11 | Issec | |
| NL184708C (nl) * | 1975-07-04 | 1989-10-02 | Oce Van Der Grinten Nv | Elektrofotografisch kopieerprocede en produkt daarmee verkregen. |
| US4293628A (en) * | 1977-01-27 | 1981-10-06 | Ricoh Co., Ltd. | Electrophotographic elements containing disazo compounds |
| US4272598A (en) * | 1977-04-27 | 1981-06-09 | Ricoh Co., Ltd. | Electrophotographic material containing disazo compounds |
| US4251613A (en) * | 1977-06-08 | 1981-02-17 | Ricoh Company, Ltd. | Disazo compounds, process for preparation of same and application of said disazo compounds and analogues thereof to electrophotographic sensitive materials |
| US4251614A (en) * | 1977-07-05 | 1981-02-17 | Ricoh Company, Ltd. | Novel disazo compounds, process for the preparation of same and application of said disazo compounds and analogues thereof to electrophotographic sensitive materials |
| JPS6027017B2 (ja) * | 1977-07-08 | 1985-06-26 | 株式会社リコー | 電子写真用感光体 |
| US4299896A (en) * | 1977-07-18 | 1981-11-10 | Ricoh Co., Ltd. | Electrophotographic sensitive materials containing a disazo pigment |
| US4150987A (en) * | 1977-10-17 | 1979-04-24 | International Business Machines Corporation | Hydrazone containing charge transport element and photoconductive process of using same |
| JPS54112637A (en) * | 1978-02-06 | 1979-09-03 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS54150128A (en) * | 1978-05-17 | 1979-11-26 | Mitsubishi Chem Ind | Electrophotographic photosensitive member |
| JPS5573057A (en) * | 1978-11-27 | 1980-06-02 | Ricoh Co Ltd | Electrophotographic photoreceptor |
| JPS5584943A (en) * | 1978-12-21 | 1980-06-26 | Ricoh Co Ltd | Laminated type electrophotographic photoreceptor |
| JPS55108667A (en) * | 1979-02-13 | 1980-08-21 | Ricoh Co Ltd | Electrophotographic receptor |
| JPS55151645A (en) * | 1979-05-15 | 1980-11-26 | Ricoh Co Ltd | Laminate type electrophotographic receptor |
| US4297426A (en) * | 1979-05-28 | 1981-10-27 | Ricoh Co., Ltd. | Electrophotographic element with carbazole hydrazone or anile charge transport compounds |
-
1981
- 1981-09-22 US US06/304,564 patent/US4390611A/en not_active Expired - Lifetime
- 1981-09-25 DE DE19813138292 patent/DE3138292A1/de active Granted
- 1981-09-25 GB GB8129123A patent/GB2088575B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB2088575A (en) | 1982-06-09 |
| US4390611A (en) | 1983-06-28 |
| DE3138292A1 (de) | 1982-05-27 |
| GB2088575B (en) | 1984-03-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3138292C2 (enExample) | ||
| DE2829543C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3626497C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3139524C2 (enExample) | ||
| DE3750498T2 (de) | Photoempfindliches material für elektrophotographie. | |
| DE3216738C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3135942C2 (enExample) | ||
| DE3617948C2 (enExample) | ||
| DE69908451T2 (de) | Elektrophotographisches lichtempfindliches Element, Arbeitseinheit und elektrophotographischer Apparat | |
| DE69410942T2 (de) | Elektrophotographisches lichtempfindliches Element, Arbeitseinheit und ein elektrophotographisches Gerät, worin eine solche Einheit eingesetzt wird | |
| DE3841207C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3625766C2 (de) | Elektrophotographisches aufzeichnungsmaterial | |
| DE3921421A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE3448011C2 (enExample) | ||
| DE3521652C2 (enExample) | ||
| DE68912884T2 (de) | Elektrophotographischer Photorezeptor. | |
| DE3336595C2 (enExample) | ||
| DE3220208C2 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE3211299C2 (enExample) | ||
| DE69119689T2 (de) | Elektrophotographisches, lichtempfindliches Element und elektrophotographischer Apparat und Faksimile-Apparat, in welchen das elektrophotographische, lichtempfindliche Element verwendet wird | |
| DE4028184A1 (de) | Photoleiter fuer die elektrophotographie | |
| DE69424265T2 (de) | Elektrophotographisches photosensitives Element, Prozesskassette mit diesem Element und elektrophotographisches Gerät | |
| DE4009969C2 (enExample) | ||
| DE3522896C2 (enExample) | ||
| DE69322319T2 (de) | Photoerzeugende Azopigmente |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |