DE2842005A1 - Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendung - Google Patents
Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendungInfo
- Publication number
- DE2842005A1 DE2842005A1 DE19782842005 DE2842005A DE2842005A1 DE 2842005 A1 DE2842005 A1 DE 2842005A1 DE 19782842005 DE19782842005 DE 19782842005 DE 2842005 A DE2842005 A DE 2842005A DE 2842005 A1 DE2842005 A1 DE 2842005A1
- Authority
- DE
- Germany
- Prior art keywords
- polycarbonates
- hydroxyphenyl
- diphenols
- bis
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 30
- 239000004417 polycarbonate Substances 0.000 title claims description 30
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 239000006085 branching agent Substances 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 4
- 229920001169 thermoplastic Polymers 0.000 claims description 3
- 239000004416 thermosoftening plastic Substances 0.000 claims description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 18
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000012071 phase Substances 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- -1 cycloalkanes Bis (hydroxyphenyl) sulfides Bis (hydroxyphenyl) ether bis (hydroxyphenyl) ketones Bis (hydroxyphenyl) sulfoxides Chemical class 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 230000007062 hydrolysis Effects 0.000 description 3
- 238000006460 hydrolysis reaction Methods 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- IGFHQQFPSIBGKE-UHFFFAOYSA-N 4-nonylphenol Chemical compound CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 2
- QHPQWRBYOIRBIT-UHFFFAOYSA-N 4-tert-butylphenol Chemical compound CC(C)(C)C1=CC=C(O)C=C1 QHPQWRBYOIRBIT-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- QMKYBPDZANOJGF-UHFFFAOYSA-N benzene-1,3,5-tricarboxylic acid Chemical compound OC(=O)C1=CC(C(O)=O)=CC(C(O)=O)=C1 QMKYBPDZANOJGF-UHFFFAOYSA-N 0.000 description 2
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical class OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- DCXXMTOCNZCJGO-UHFFFAOYSA-N tristearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 2
- VPVTXVHUJHGOCM-UHFFFAOYSA-N 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol Chemical compound C=1C=C(O)C(C(C)(C)C=2C=CC(O)=CC=2)=CC=1C(C)(C)C1=CC=C(O)C=C1 VPVTXVHUJHGOCM-UHFFFAOYSA-N 0.000 description 1
- MAQOZOILPAMFSW-UHFFFAOYSA-N 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=C(CC=3C(=CC=C(C)C=3)O)C=C(C)C=2)O)=C1 MAQOZOILPAMFSW-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical class OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- KAIRTVANLJFYQS-UHFFFAOYSA-N 2-(3,5-dimethylheptyl)phenol Chemical compound CCC(C)CC(C)CCC1=CC=CC=C1O KAIRTVANLJFYQS-UHFFFAOYSA-N 0.000 description 1
- ZEKCYPANSOJWDH-UHFFFAOYSA-N 3,3-bis(4-hydroxy-3-methylphenyl)-1H-indol-2-one Chemical compound C1=C(O)C(C)=CC(C2(C3=CC=CC=C3NC2=O)C=2C=C(C)C(O)=CC=2)=C1 ZEKCYPANSOJWDH-UHFFFAOYSA-N 0.000 description 1
- IGDJYCYTMKFRMP-UHFFFAOYSA-N 4-(10-methylundecyl)phenol Chemical compound CC(C)CCCCCCCCCC1=CC=C(O)C=C1 IGDJYCYTMKFRMP-UHFFFAOYSA-N 0.000 description 1
- CUAUDSWILJWDOD-UHFFFAOYSA-N 4-(3,5-dimethylheptyl)phenol Chemical compound CCC(C)CC(C)CCC1=CC=C(O)C=C1 CUAUDSWILJWDOD-UHFFFAOYSA-N 0.000 description 1
- BRPSWMCDEYMRPE-UHFFFAOYSA-N 4-[1,1-bis(4-hydroxyphenyl)ethyl]phenol Chemical compound C=1C=C(O)C=CC=1C(C=1C=CC(O)=CC=1)(C)C1=CC=C(O)C=C1 BRPSWMCDEYMRPE-UHFFFAOYSA-N 0.000 description 1
- VFGBGCDMQOVGIU-UHFFFAOYSA-N 4-[1-(4-hydroxyphenyl)propan-2-yl]benzene-1,3-diol Chemical compound C=1C=C(O)C=C(O)C=1C(C)CC1=CC=C(O)C=C1 VFGBGCDMQOVGIU-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- JHSDIILQGDBNPD-UHFFFAOYSA-N 4-[2-[4-[tris[4-[2-(4-hydroxyphenyl)propan-2-yl]phenoxy]methoxy]phenyl]propan-2-yl]phenol Chemical compound C=1C=C(OC(OC=2C=CC(=CC=2)C(C)(C)C=2C=CC(O)=CC=2)(OC=2C=CC(=CC=2)C(C)(C)C=2C=CC(O)=CC=2)OC=2C=CC(=CC=2)C(C)(C)C=2C=CC(O)=CC=2)C=CC=1C(C)(C)C1=CC=C(O)C=C1 JHSDIILQGDBNPD-UHFFFAOYSA-N 0.000 description 1
- RQTDWDATSAVLOR-UHFFFAOYSA-N 4-[3,5-bis(4-hydroxyphenyl)phenyl]phenol Chemical compound C1=CC(O)=CC=C1C1=CC(C=2C=CC(O)=CC=2)=CC(C=2C=CC(O)=CC=2)=C1 RQTDWDATSAVLOR-UHFFFAOYSA-N 0.000 description 1
- CIEGINNQDIULCT-UHFFFAOYSA-N 4-[4,6-bis(4-hydroxyphenyl)-4,6-dimethylheptan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)CC(C)(C=1C=CC(O)=CC=1)CC(C)(C)C1=CC=C(O)C=C1 CIEGINNQDIULCT-UHFFFAOYSA-N 0.000 description 1
- LIDWAYDGZUAJEG-UHFFFAOYSA-N 4-[bis(4-hydroxyphenyl)-phenylmethyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=CC=C1 LIDWAYDGZUAJEG-UHFFFAOYSA-N 0.000 description 1
- BOCLKUCIZOXUEY-UHFFFAOYSA-N 4-[tris(4-hydroxyphenyl)methyl]phenol Chemical compound C1=CC(O)=CC=C1C(C=1C=CC(O)=CC=1)(C=1C=CC(O)=CC=1)C1=CC=C(O)C=C1 BOCLKUCIZOXUEY-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N Alumina Chemical class [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229910004261 CaF 2 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- 238000012696 Interfacial polycondensation Methods 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- KYPYTERUKNKOLP-UHFFFAOYSA-N Tetrachlorobisphenol A Chemical compound C=1C(Cl)=C(O)C(Cl)=CC=1C(C)(C)C1=CC(Cl)=C(O)C(Cl)=C1 KYPYTERUKNKOLP-UHFFFAOYSA-N 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000003712 anti-aging effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- IEPIYXWWJPPIEM-UHFFFAOYSA-N benzene-1,3-diol;benzene-1,4-diol Chemical compound OC1=CC=C(O)C=C1.OC1=CC=CC(O)=C1 IEPIYXWWJPPIEM-UHFFFAOYSA-N 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 239000002667 nucleating agent Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G64/00—Macromolecular compounds obtained by reactions forming a carbonic ester link in the main chain of the macromolecule
- C08G64/04—Aromatic polycarbonates
- C08G64/06—Aromatic polycarbonates not containing aliphatic unsaturation
- C08G64/14—Aromatic polycarbonates not containing aliphatic unsaturation containing a chain-terminating or -crosslinking agent
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842005 DE2842005A1 (de) | 1978-09-27 | 1978-09-27 | Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendung |
| US06/075,439 US4269964A (en) | 1978-09-27 | 1979-09-14 | Polycarbonates with alkylphenyl end groups, their preparation and their use |
| EP79103471A EP0010602B1 (de) | 1978-09-27 | 1979-09-17 | Polycarbonate mit Alkylphenyl-Endgruppen und ihre Herstellung |
| DE7979103471T DE2962828D1 (en) | 1978-09-27 | 1979-09-17 | Polycarbonates with alkylphenyl end groups and their preparation |
| JP54122159A JPS6045651B2 (ja) | 1978-09-27 | 1979-09-25 | アルキルフェニル未端を有するポリカ−ボネ−トの製造法 |
| JP60043828A JPS60215021A (ja) | 1978-09-27 | 1985-03-07 | アルキルフエニル末端基を有するポリカ−ボネ−ト |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782842005 DE2842005A1 (de) | 1978-09-27 | 1978-09-27 | Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2842005A1 true DE2842005A1 (de) | 1980-04-10 |
Family
ID=6050577
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782842005 Withdrawn DE2842005A1 (de) | 1978-09-27 | 1978-09-27 | Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendung |
| DE7979103471T Expired DE2962828D1 (en) | 1978-09-27 | 1979-09-17 | Polycarbonates with alkylphenyl end groups and their preparation |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979103471T Expired DE2962828D1 (en) | 1978-09-27 | 1979-09-17 | Polycarbonates with alkylphenyl end groups and their preparation |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4269964A (enExample) |
| EP (1) | EP0010602B1 (enExample) |
| JP (2) | JPS6045651B2 (enExample) |
| DE (2) | DE2842005A1 (enExample) |
Cited By (190)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0026868A1 (de) * | 1979-10-03 | 1981-04-15 | Bayer Ag | Aromatische Polyester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Spritzgussartikeln, Folien und Überzügen |
| EP0039452A3 (en) * | 1980-05-07 | 1982-10-06 | Bayer Ag | Process for preparing aromatic polycarbonates |
| DE3125485A1 (de) * | 1981-05-04 | 1983-02-03 | Galina Alekseevna Škarpejkina | Niedermolekulare polykarbonate mit endstaendigen arylgruppen, verfahren zu ihrer herstelung und mit hilfederselben weichgemachte polykarbonatmischung |
| EP0249882A3 (en) * | 1986-06-18 | 1989-03-15 | Mitsubishi Kasei Corporation | Process for producing polycarbonate resin |
| DE3829890A1 (de) * | 1988-09-02 | 1990-03-15 | Bayer Ag | Polystyrol-polycarbonat-mischungen |
| EP0264792B1 (de) * | 1986-10-22 | 1991-04-10 | Bayer Ag | Thermoplastische Mischungen aus aromatischen Polycarbonaten und Polystyrolen und ihre Verwendung als Substrate für optische Datenspeicher |
| EP0693495A1 (de) | 1994-07-22 | 1996-01-24 | Bayer Ag | Mehrkernige Phosphorsäureester |
| EP0695785A2 (de) | 1994-08-01 | 1996-02-07 | Bayer Ag | Mischungen aus Polycarbonat, phenolisch hydroxyfunktionellen verzweigten Dimerfettsäurepolyestern und gegebenenfalls Pfropfpolymerisat |
| EP0697441A2 (de) | 1994-08-18 | 1996-02-21 | Bayer Ag | Flammgeschützte thermoplastische Polycarbonat-Formmassen |
| EP0716125A2 (de) | 1994-12-05 | 1996-06-12 | Bayer Ag | Flammgeschützte, thermoplastische Polycarbonatformmassen |
| EP0717077A2 (de) | 1994-11-24 | 1996-06-19 | Bayer Ag | ABS-Formmassen mit neuartiger Morphologie |
| US5548011A (en) * | 1994-09-12 | 1996-08-20 | Bayer Ag | Blends of polycarbonates, dimeric fatty acid polyesters and PIB rubbers, silicones or mineral oils |
| EP0783019A1 (de) | 1995-12-05 | 1997-07-09 | Bayer Ag | Thermoplastische Massen mit verbessertem Röntgenkontrast |
| US5994463A (en) * | 1997-04-01 | 1999-11-30 | Bayer Aktiengesellschaft | Polycarbonate/graft polymer moulding compositions with reduced deposit formation |
| DE102007003662A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupfer(I)enthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007002925A1 (de) | 2007-01-19 | 2008-07-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007003648A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupferenthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007003649A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupfer(II)enthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007016786A1 (de) | 2007-04-05 | 2008-10-09 | Bayer Materialscience Ag | Polycarbonat-Formmassen |
| DE102008015124A1 (de) | 2007-05-16 | 2008-11-20 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007035462A1 (de) | 2007-07-28 | 2009-01-29 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von Pfropfkautschuken |
| WO2009021648A1 (de) | 2007-08-16 | 2009-02-19 | Bayer Materialscience Ag | Glasfaserverstärkte polycarbonat-formmassen |
| DE102007040927A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Verfahren zur Herstellung schlagzähmodifizierter gefüllter Polycarbonat-Zusammensetzungen |
| DE102008038410A1 (de) | 2007-09-11 | 2009-03-12 | Basf Se | Flammgeschützte Polyester |
| DE102007045959A1 (de) | 2007-09-26 | 2009-04-09 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von Kautschuklatices mit definiertem stabilem Gelgehalt für die ABS-Herstellung |
| DE102007061761A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061762A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061759A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061758A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102008024672A1 (de) | 2008-05-21 | 2009-11-26 | Bayer Materialscience Ag | Tieftemperaturzähe Polycarbonat-Blends |
| DE102008028571A1 (de) | 2008-06-16 | 2009-12-17 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE202008012066U1 (de) | 2008-08-26 | 2010-01-28 | Lanxess Deutschland Gmbh | Querträgermodul für ein Kraftfahrzeug |
| DE102008048202A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend plättchen- oder schuppförmigen anorganischen Füllstoff ausgenommen Talk |
| DE102008048201A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend isotropen Füllstoff |
| DE102008042325A1 (de) | 2008-09-24 | 2010-04-01 | Isringhausen Gmbh & Co. Kg | Gurtholm für Integralsitze |
| DE102008048204A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend Talk |
| DE102008060536A1 (de) | 2008-12-04 | 2010-06-10 | Bayer Materialscience Ag | Saure Phosphorverbindungen enthaltende schlagzähmodifizierte Polycarbonat-Zusammensetzungen mit basisch gefälltem Emulsionspfropfpolymersiat |
| DE102008062945A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102008062903A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102009005762A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| EP2210916A1 (en) | 2009-01-23 | 2010-07-28 | Bayer MaterialScience AG | Polycarbonate molding composition |
| WO2010089241A1 (de) | 2009-02-04 | 2010-08-12 | Basf Se | Schwarze, uv-stabile thermoplastische formmassen |
| WO2010094416A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur herstellung von polymer-zusammensetzungen mit reduziertem gehalt an flüchtigen organischen verbindungen |
| WO2010108618A1 (de) | 2009-03-25 | 2010-09-30 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte polycarbonat-zusammensetzungen |
| DE102009015039A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen zur Herstellung metallisierter Formkörper mit homogenem Oberflächenglanz |
| DE102009034767A1 (de) | 2009-07-25 | 2011-01-27 | Lanxess Deutschland Gmbh & Co. Kg | Organoblechstrukturbauteil |
| DE102009035807A1 (de) | 2009-08-01 | 2011-02-03 | Bayer Materialscience Ag | Verbesserte Haftung zwischen Thermoplasten und Polyurethan |
| EP2308679A1 (de) | 2009-10-06 | 2011-04-13 | Bayer MaterialScience AG | Solarmodule mit Polycarbonatblend-Folie als Rückseitenfolie |
| WO2011054754A1 (de) | 2009-11-05 | 2011-05-12 | Faurecia Kunststoff Automobilsysteme Gmbh | Kraftfahrzeug-frontend |
| WO2011070043A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur herstellung von polyurethan-verbundbauteilen sowie diese verbundbauteile |
| WO2011070044A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verbundbauteile mit verbesserter haftung aus polycarbonat- / polyesterzusammensetzungen und polyurethan |
| DE102009058180A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyurethan-Verbundbauteilen |
| DE102009059075A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Flammgeschützte, schlagzähmodifizierte, kratzfeste Polycarbonat-Formmassen mit guten mechanischen Eigenschaften |
| DE102009059074A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Kratzfeste, schlagzähe Polycarbonat-Formmassen mit guten mechanischen Eigenschaften II |
| DE102009059076A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Kratzfeste, schlagzähe Polycarbonat-Formmassen mit guten mechanischen Eigenschaften I |
| DE102009058182A1 (de) | 2009-12-15 | 2011-06-30 | Bayer MaterialScience AG, 51373 | Verbundbauteile mit verbesserter Haftung aus Polycarbonat- / Polyesterzusammensetzungen und Polyurethan |
| EP2377746A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Querträgermodul für ein Kraftfahrzeug |
| EP2377704A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Türstrukturmodul |
| WO2011131727A1 (de) | 2010-04-23 | 2011-10-27 | Bayer Materialscience Ag | LEICHTFLIEßENDE POLYCARBONAT/ABS-FORMMASSEN MIT GUTEN MECHANISCHEN EIGENSCHAFTEN UND GUTER OBERFLÄCHE |
| WO2011138384A1 (de) | 2010-05-05 | 2011-11-10 | Basf Se | Bauteil umfassend ein einlegeteil und eine kunststoffummantelung sowie verfahren zu seiner herstellung |
| WO2011144502A1 (de) | 2010-05-18 | 2011-11-24 | Basf Se | Lasertransparente polyester |
| WO2011154518A1 (de) | 2010-06-11 | 2011-12-15 | Basf Se | Lasertransparentes pbt mit organischen additiven |
| WO2012013564A1 (de) | 2010-07-30 | 2012-02-02 | Basf Se | Flammgeschützte formmassen |
| WO2012020112A1 (de) | 2010-08-13 | 2012-02-16 | Basf Se | Expandierbare granulate auf polyesterbasis |
| WO2012022710A1 (en) | 2010-08-16 | 2012-02-23 | Ineos Abs (Jersey) Limited | Process for the preparation of agglomerated rubber latices and the use thereof for the manufacture of polymer compositions |
| WO2012022669A2 (de) | 2010-08-19 | 2012-02-23 | Basf Se | Nanocompositblends mit polyestern |
| WO2012025481A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Ag | SCHLAGZÄHMODIFIZIERTE POLYESTER/POLYCARBONAT-ZUSAMMENSETZUNGEN MIT VERBESSERTER REIßDEHNUNG |
| WO2012038421A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte batteriegehäuse auf polycarbonatbasis i |
| WO2012038419A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte batteriegehäuse auf polycarbonatbasis ii |
| WO2012084865A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Verfahren zur verbesserung der russdispergierung |
| WO2012084848A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Antistatische polycarbonat-formmassen |
| DE102011087869A1 (de) | 2010-12-08 | 2012-09-06 | Basf Se | Lasermarkierbare flammgeschützte Formkörper |
| WO2012119966A1 (de) | 2011-03-07 | 2012-09-13 | Basf Se | Lasertransparente polyester |
| WO2012119996A1 (de) | 2011-03-08 | 2012-09-13 | Basf Se | Lasertransparente polyester mit carbonsäuresalzen |
| WO2012119967A1 (de) | 2011-03-08 | 2012-09-13 | Basf Se | Lasertransparente polyester mit anorganischen salzen |
| WO2012143314A1 (de) | 2011-04-20 | 2012-10-26 | Basf Se | Lasertransparente polyester mit alkalinitriten |
| US8318843B2 (en) | 2010-05-18 | 2012-11-27 | Basf Se | Laser-transparent polyesters |
| WO2012163822A1 (de) | 2011-06-01 | 2012-12-06 | Basf Se | Polyester mit styrolcopolymeren |
| EP2537895A1 (en) | 2011-06-20 | 2012-12-26 | Styrolution (Jersey) Limited | Impact modified polycarbonate compositions |
| EP2574642A1 (de) | 2011-09-28 | 2013-04-03 | Bayer Material Science AG | Flammgeschützte PC/ABS-Zusammensetzungen mit guter Schlagzähigkeit, Fließfähigkeit und Chemikalienbeständigkeit |
| WO2013045206A1 (de) | 2011-09-29 | 2013-04-04 | Styrolution GmbH | Stabilisierte polycarbonat acrylnitril/styrol/acrylester formmassen |
| US8425829B2 (en) | 2007-11-20 | 2013-04-23 | Basf Se | Use of thermoplastic molding materials for GID/WIT |
| EP2584001A1 (de) | 2002-05-28 | 2013-04-24 | Styrolution (Jersey) Limited | Zusammensetzung mit verbesserten Zähigkeitseigenschaften |
| WO2013060685A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Verfahren zur herstellung und stabilisierung von schlagzähmodifizierten polycarbonat- zusammensetzungen unter verwendung von verdünnten lösungen saurer verbindungen |
| WO2013060687A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Stabilisierte polycarbonatzusammensetzungen mit abmischungen aus kieselsäure und einer anorganischen säure |
| WO2013079555A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Formkörper mit hoher oberflächengüte |
| WO2013087584A1 (de) | 2011-12-13 | 2013-06-20 | Bayer Intellectual Property Gmbh | Flammgeschützte polyalkylenterephthalat/polycarbonat-zusammensetzungen |
| WO2013098176A1 (de) | 2011-12-29 | 2013-07-04 | Bayer Intellectual Property Gmbh | Polymerzusammensetzungen mit verbesserter haftung |
| US8530568B2 (en) | 2004-10-20 | 2013-09-10 | Basf Se | Flowable polyamides with hyperbranched polyesters/polycarbonates |
| EP2647669A1 (de) | 2012-04-05 | 2013-10-09 | Bayer MaterialScience AG | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen zur vereinfachten Herstellung von tieftemperaturzähen Bauteilen mit hochglänzenden und matten Bauteilabschnitten |
| EP2657294A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | Verarbeitungsstabile PC/ABS-Zusammensetzungen |
| EP2657258A1 (de) | 2012-04-23 | 2013-10-30 | Bayer MaterialScience AG | Verfahren zur Herstellung von ABS-Zusammensetzungen mit verbesserter Oberfläche nach Wärme-Feucht-Lagerung |
| EP2657259A1 (de) | 2012-04-23 | 2013-10-30 | Bayer MaterialScience AG | ABS-Zusammensetzungen mit verbesserter Oberfläche nach Wärme-Feucht-Lagerung |
| EP2657298A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | PC/ABS-Zusammensetzungen mit guter thermischer und chemischer Beständigkeit |
| WO2013189779A1 (de) | 2012-06-18 | 2013-12-27 | Basf Se | Flammgeschützte polyester mit polyacrylnitrilhomopolymerisaten |
| US8618201B2 (en) | 2011-03-08 | 2013-12-31 | Basf Se | Laser-transparent polyesters with inorganic salts |
| WO2014029641A1 (de) | 2012-08-20 | 2014-02-27 | Basf Se | Langfaserverstärkte flammgeschützte polyester |
| WO2014086800A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen vi |
| WO2014086743A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen i |
| WO2014086944A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen ii |
| US8791179B2 (en) | 2011-03-07 | 2014-07-29 | Basf Se | Laser-transparent polyesters |
| US8796365B2 (en) | 2007-06-28 | 2014-08-05 | Basf Se | Thermoplastic molding materials comprising organic black pigments |
| WO2014122178A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche nach wärme-feucht-lagerung |
| WO2014122177A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche |
| WO2014122179A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche |
| WO2014146912A1 (de) | 2013-03-18 | 2014-09-25 | Basf Se | Polyester für profilextrusion und/oder rohrextrusion |
| US8859664B2 (en) | 2011-04-20 | 2014-10-14 | Basf Se | Laser-transparent polyesters with alkali metal nitrites |
| US8889768B2 (en) | 2010-06-11 | 2014-11-18 | Basf Se | Laser-transparent PBT with organic additives |
| EP2816081A1 (de) | 2013-06-17 | 2014-12-24 | Basf Se | Polyesterformmassen mit geringer TOC Emission |
| US8962717B2 (en) | 2012-08-20 | 2015-02-24 | Basf Se | Long-fiber-reinforced flame-retardant polyesters |
| WO2015049185A1 (de) | 2013-10-02 | 2015-04-09 | Bayer Materialscience Ag | Verfahren zur herstellung eines formteils im schaumspritzguss, formteil aus einem aufgeschäumten thermoplastischen kunststoff und verwendungen dafür |
| WO2015052114A1 (de) | 2013-10-08 | 2015-04-16 | Bayer Materialscience Ag | Faserverbundwerkstoff, verwendung dafür und verfahren zu dessen herstellung |
| WO2015055719A1 (de) | 2013-10-18 | 2015-04-23 | Bayer Materialscience Ag | Polycarbonatzusammensetzungen mit verbesserter haftung zu polyurethanschichten |
| EP2899008A1 (de) | 2014-01-27 | 2015-07-29 | Bayer MaterialScience AG | Spritzgiessverfahren zur Herstellung eines Verbundbauteiles mit Oberflächenstrukturierung im Kontaktbereich der Schichten zur Verbesserung der Haftung |
| US9249270B2 (en) | 2010-08-13 | 2016-02-02 | Basf Se | Expandable pelletized materials based on polyester |
| WO2016198403A1 (de) | 2015-06-09 | 2016-12-15 | Covestro Deutschland Ag | Glasfaserverstärkte polycarbonat-formmassen mit verbesserter zähigkeit |
| WO2016202399A1 (de) | 2015-06-18 | 2016-12-22 | Covestro Deutschland Ag | Flammgeschütze polycarbonat-polyester-zusammensetzungen |
| WO2017055416A1 (de) | 2015-10-02 | 2017-04-06 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit verbesserter stabilisierung |
| WO2017066596A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| WO2017063841A1 (de) | 2015-10-14 | 2017-04-20 | Basf Se | Polyesterblend mit halogenfreiem flammschutz |
| WO2017068045A1 (de) | 2015-10-23 | 2017-04-27 | Covestro Deutschland Ag | Verfahren zur herstellung von polycarbonat-formmassen mit verbesserter thermischer verarbeitungsstabilität |
| WO2017089547A1 (en) | 2015-11-26 | 2017-06-01 | Ineos Styrolution Group Gmbh | Polycarbonate-asa blends with antistatic properties using sulfonated alkanes |
| WO2017099754A1 (en) | 2015-12-09 | 2017-06-15 | Covestro Llc | Thermoplastic compositions having low gloss and high impact strength |
| WO2017162769A1 (de) | 2016-03-23 | 2017-09-28 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit verbesserter hydrolysebeständigkeit |
| WO2017186690A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische und lichtstabile thermoplastische polycarbonat-formmassen |
| WO2017186663A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische thermoplastische formmassen |
| WO2018015557A1 (de) | 2016-07-22 | 2018-01-25 | Covestro Deutschland Ag | Kratzfeste polycarbonat-zusammensetzungen mit guter thermischer stabilität |
| WO2018050426A1 (de) | 2016-09-14 | 2018-03-22 | Basf Se | Polyester für profilextrusion und/oder rohrextrusion |
| WO2018060111A1 (de) | 2016-09-27 | 2018-04-05 | Ineos Styrolution Group Gmbh | Verbessertes verfahren zur herstellung von asa-kunststoffen |
| WO2019007961A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC STYRENE COPOLYMER RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| WO2019007957A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| WO2019007967A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| WO2019020677A1 (en) | 2017-07-26 | 2019-01-31 | Ineos Styrolution Group Gmbh | STYRENE COPOLYMER COMPOSITION WITH IMPROVED SHOCK RESISTANCE COMPRISING POLYSILOXANE ADDITIVE HAVING IMPROVED ABRASION FEATURES |
| WO2019020680A1 (en) | 2017-07-26 | 2019-01-31 | Ineos Styrolution Group Gmbh | ANTICHOCK COPPER STYRENE COPOLYMER COMPOSITION COMPRISING A POLYSILOXANE ADDITIVE HAVING IMPROVED ABRASION CHARACTERISTICS |
| WO2019092237A1 (en) | 2017-11-13 | 2019-05-16 | Ineos Styrolution Group Gmbh | Thermoplastic molding composition and articles made thereof having improved surface quality |
| WO2019121463A1 (de) | 2017-12-19 | 2019-06-27 | Covestro Deutschland Ag | Thermoplastische zusammensetzungen mit guter stabilität |
| EP3556527A1 (en) | 2018-04-19 | 2019-10-23 | Covestro Deutschland AG | Thermoplastic composite article and manufacturing method and use thereof |
| EP3560675A1 (en) | 2018-04-24 | 2019-10-30 | Covestro Deutschland AG | Thermoplastic composite article and manufacturing method and use thereof |
| WO2019233929A1 (en) | 2018-06-07 | 2019-12-12 | Covestro Deutschland Ag | Thermoplastic composite article and preparation method thereof |
| WO2019243107A1 (en) | 2018-06-20 | 2019-12-26 | Ineos Styrolution Group Gmbh | High heat resistant impact modified polycarbonate blend |
| WO2019243105A1 (en) | 2018-06-18 | 2019-12-26 | Ineos Styrolution Group Gmbh | Thermoplastic compositions with improved uv resistance |
| WO2020020814A1 (de) | 2018-07-25 | 2020-01-30 | Covestro Deutschland Ag | Polymer-blends enthaltend thermoplast und vernetztes reaktionsprodukt aus polyaddition oder polykondensation |
| EP3608358A1 (de) | 2018-08-09 | 2020-02-12 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-polyalkylenterephthalat-zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit |
| WO2020051190A1 (en) | 2018-09-07 | 2020-03-12 | Covestro Llc | A device for cooling battery cells |
| EP3633785A1 (en) | 2018-10-05 | 2020-04-08 | Covestro LLC | A device for cooling battery cells |
| EP3650487A1 (en) | 2018-11-06 | 2020-05-13 | Covestro Deutschland AG | Thermoplastic composite article and preparation method thereof |
| WO2020100350A1 (ja) | 2018-11-12 | 2020-05-22 | 積水化学工業株式会社 | 樹脂シート |
| WO2020194996A1 (ja) | 2019-03-27 | 2020-10-01 | 積水化学工業株式会社 | 樹脂組成物及び成形体 |
| EP3725819A1 (de) | 2019-04-18 | 2020-10-21 | Covestro Deutschland AG | Verfahren zur herstellung einer polycarbonat-formmasse |
| WO2021037705A1 (en) | 2019-08-28 | 2021-03-04 | Covestro Intellectual Property Gmbh & Co. Kg | Flame-retardant polycarbonate composition and molded parts as well as articles made therefrom |
| WO2021043653A1 (en) | 2019-09-05 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polymer composition and article made from the same |
| WO2021043654A1 (de) | 2019-09-04 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| EP3828236A1 (de) | 2019-11-27 | 2021-06-02 | Covestro Intellectual Property GmbH & Co. KG | Flammgeschützter polycarbonat-polyester blend |
| WO2021110550A1 (en) | 2019-12-04 | 2021-06-10 | Covestro Intellectual Property Gmbh & Co. Kg | Flame retardant impact-modified polycarbonate composition |
| WO2021191178A1 (en) | 2020-03-23 | 2021-09-30 | Basf Se | Container for ingredients for making beverages |
| WO2021224136A1 (en) | 2020-05-06 | 2021-11-11 | Basf Se | Flame retarded polyester blend |
| WO2021228636A1 (en) | 2020-05-13 | 2021-11-18 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2021233727A1 (de) | 2020-05-18 | 2021-11-25 | Covestro Deutschland Ag | Polycarbonat blend mit verringerten störgeräuschen |
| WO2021233773A1 (en) | 2020-05-22 | 2021-11-25 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2021233774A1 (en) | 2020-05-22 | 2021-11-25 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2022029260A1 (de) | 2020-08-07 | 2022-02-10 | Basf Se | Thermoplastische mischungen |
| WO2022058222A1 (de) | 2020-09-18 | 2022-03-24 | Covestro Deutschland Ag | Mehrschichtkörper für diffuse durchleuchtung |
| WO2022081375A1 (en) | 2020-10-12 | 2022-04-21 | Covestro Llc | A modular battery pack |
| EP4015580A1 (de) | 2020-12-18 | 2022-06-22 | Covestro Deutschland AG | Zusammensetzung und verfahren zur herstellung einer transluzenten thermoplastischen polycarbonat/polymethylmethacrylat-formmasse |
| EP4039746A1 (de) | 2021-02-08 | 2022-08-10 | Covestro Deutschland AG | Polycarbonat-polyester zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit und hoher thermischer belastbarkeit |
| EP4047073A1 (de) | 2021-02-17 | 2022-08-24 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022178755A1 (en) | 2021-02-25 | 2022-09-01 | Covestro Deutschland Ag | Heat-resistant semi-conductive thermoplastic resin composition |
| WO2023280608A1 (de) | 2021-07-05 | 2023-01-12 | Covestro Deutschland Ag | Zusammensetzung und verfahren zur herstellung einer transparenten thermoplastischen polycarbonat/polymethylmethacrylat-formmasse |
| WO2023009417A1 (en) | 2021-07-28 | 2023-02-02 | Covestro Llc | A drug injection device and recycling system |
| EP4177301A1 (de) | 2021-11-03 | 2023-05-10 | Covestro Deutschland AG | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2023088806A1 (de) | 2021-11-22 | 2023-05-25 | Basf Se | Thermoplastische mischungen |
| EP4198076A1 (en) | 2021-12-16 | 2023-06-21 | Covestro Deutschland AG | Process for recovery of rubber-modified vinyl(co)polymer |
| EP4201987A1 (de) | 2021-12-22 | 2023-06-28 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| EP4245521A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| EP4245529A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| EP4249560A1 (de) | 2022-03-25 | 2023-09-27 | Covestro Deutschland AG | Polycarbonat/polyester-zusammensetzung und bauteil mit hoher kriechstromfestigkeit |
| EP4257619A1 (de) | 2022-04-04 | 2023-10-11 | Covestro Deutschland AG | Pfropfcopolymere zur reduktion der grenzflächenspannung in polymerblends |
| EP4311839A1 (de) | 2022-07-28 | 2024-01-31 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024028311A1 (de) | 2022-08-04 | 2024-02-08 | Ineos Styrolution Group Gmbh | Thermoplastische abs-formmasse mit guter eigenschaftskombination von verarbeitbarkeit und oberflächenqualität |
| WO2024028309A1 (de) | 2022-08-04 | 2024-02-08 | Ineos Styrolution Group Gmbh | Thermoplastische abs-formmassen mit einer guten eigenschaftskombination von verarbeitbarkeit und oberflächenqualität |
| EP4345136A1 (de) | 2022-09-29 | 2024-04-03 | Covestro Deutschland AG | E/e-bauteil enthaltend polycarbonat-material mit hoher kriechstromfestigkeit |
| WO2024146774A1 (de) | 2023-01-05 | 2024-07-11 | Covestro Deutschland Ag | Mineralgefüllte polycarbonat- und/oder polyestercarbonat-formmasse mit guter thermischer stabilität |
| WO2024156587A1 (en) | 2023-01-26 | 2024-08-02 | Basf Se | Compositions comprising polyarylene(ether)sulfones |
| WO2025073535A1 (de) | 2023-10-02 | 2025-04-10 | Covestro Deutschland Ag | Gefüllte zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit guter oberflächenkosmetik und reduziertem gehalt an freiem bisphenol a |
| WO2025098864A1 (de) | 2023-11-07 | 2025-05-15 | Covestro Deutschland Ag | Verfahren zur nachträglichen reduzierung des gehalts an freiem bisphenol-a von polycarbonat und/oder polyestercarbonat formmassen |
| EP4606841A1 (de) | 2024-02-22 | 2025-08-27 | Covestro Deutschland AG | Blockcopolymer und verfahren zu dessen herstellung unter verwendung eines speziellen katalysators |
| WO2025252781A1 (en) | 2024-06-05 | 2025-12-11 | Basf Se | Flame retardant polyamides for improved lsr compression set |
| WO2026037707A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie olefin-(meth)acrylsäure-copolymer und phosphoniumsalz |
| WO2026037708A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie olefin-(meth)acrylat-copolymer und ein spezielles salz |
| WO2026037709A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie ein olefin-(meth)acrylat-copolymer mit besonderer molmassenverteilung |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3007934A1 (de) * | 1980-03-01 | 1981-09-17 | Bayer Ag, 5090 Leverkusen | Aromatische polyestercarbonate, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von spritzgussartikeln, folien und ueberzuegen |
| US4330663A (en) * | 1980-12-31 | 1982-05-18 | General Electric Company | Benzoate ester terminated polyester-carbonate |
| JPS57133149A (en) * | 1981-02-12 | 1982-08-17 | Idemitsu Kosan Co Ltd | Polycarbonate resin composition |
| US4393156A (en) * | 1981-07-20 | 1983-07-12 | General Electric Company | Hydrolytically stable polyester-carbonate compositions |
| US4515921A (en) * | 1982-07-21 | 1985-05-07 | Mobay Chemical Corporation | Polycarbonate compositions having a high impact strength and melt flow rate |
| DE3442125A1 (de) * | 1984-11-17 | 1986-05-22 | Bayer Ag, 5090 Leverkusen | Voll-aromatische polyester, verfahren zu ihrer herstellung und ihre verwendung zur herstellung von formkoerpern |
| DE3506472A1 (de) * | 1985-02-23 | 1986-08-28 | Bayer Ag, 5090 Leverkusen | Neue polydiorganosiloxan-polycarbonat-blockcopolymere |
| DE3506680A1 (de) * | 1985-02-26 | 1986-08-28 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen auf basis von polysiloxan-polycarbonat-blockcopolymeren |
| DE3519690A1 (de) * | 1985-02-26 | 1986-08-28 | Bayer Ag, 5090 Leverkusen | Thermoplastische formmassen auf basis von polysiloxan-polycarbonat-blockcopolymeren |
| DE3537622A1 (de) * | 1985-10-23 | 1987-04-23 | Bayer Ag | Mischungen aromatischer polycarbonate und aromatischer polyestercarbonate und ihre verwendung zur herstellung von formkoerpern, folien, fasern, filamenten und beschichtungen |
| JPS62285937A (ja) * | 1986-06-04 | 1987-12-11 | Japan Synthetic Rubber Co Ltd | 難燃性スチレン系樹脂組成物 |
| NL8602363A (nl) * | 1986-09-18 | 1988-04-18 | Gen Electric | Werkwijze voor het bereiden van een aromatisch polycarbonaat. |
| DE3886659T2 (de) * | 1987-10-13 | 1994-04-28 | Miles Inc | Coextrudierte Strukturen. |
| US4970041A (en) * | 1987-10-13 | 1990-11-13 | Mobay Corporation | Coextruded structures |
| US5080961A (en) * | 1987-10-13 | 1992-01-14 | Macy Richard J | Coextruded structures |
| NL8702632A (nl) * | 1987-11-04 | 1989-06-01 | Gen Electric | Polycarbonaat met lage relatieve viscositeit en polymeermengsels. |
| US4814421A (en) * | 1987-12-04 | 1989-03-21 | General Electric Company | Hydroxy terminated polycarbonates |
| DE3803939A1 (de) * | 1988-02-10 | 1989-08-24 | Bayer Ag | Polycarbonate mit aralkylphenylendgruppen, ihre herstellung und verwendung |
| US4994594A (en) * | 1988-02-29 | 1991-02-19 | General Electric Company | Oligomeric carbonate chainstoppers |
| EP0335214B1 (en) * | 1988-03-28 | 1993-12-08 | Idemitsu Petrochemical Co. Ltd. | Polycarbonate |
| DE3821340A1 (de) * | 1988-06-24 | 1989-12-28 | Bayer Ag | Polycarbonate mit mesogenen verbindungen als endgruppen, ihre herstellung und verwendung |
| EP0360578B1 (en) * | 1988-09-22 | 1998-08-05 | Ge Plastics Japan Ltd. | Process for the production of polycarbonates |
| CA2009491A1 (en) * | 1989-03-08 | 1990-09-08 | Richard J. Macy | Coextruded structures |
| IT1231155B (it) * | 1989-07-19 | 1991-11-19 | Enichem Tecnoresine | Policarbonati aventi caratteristiche di elevata fluidita' e procedimento per la loro preparazione |
| IT1231154B (it) * | 1989-07-19 | 1991-11-19 | Enichem Tecnoresine | Policarbonati ad elevata fluidita' e procedimento per la loro preparazione. |
| US5412060A (en) * | 1991-08-20 | 1995-05-02 | Bayer Aktiengesellschaft | Process for the production of polycarbonate of constant viscosity |
| DE4342045A1 (de) * | 1993-12-09 | 1995-06-14 | Basf Ag | Dreistufige Pfropfcopolymerisate und solche enthaltende witterungsbeständige, matte thermoplastische Formmassen mit hoher Kältezähigkeit |
| JP3436466B2 (ja) * | 1996-03-07 | 2003-08-11 | 出光石油化学株式会社 | デジタルビデオディスク基板 |
| DE19635078A1 (de) | 1996-08-30 | 1998-03-05 | Basf Ag | Formmassen aus einer Polycarbonatmischung und einem Siloxannetzwerkkautschuk |
| DE69919082T2 (de) | 1998-01-19 | 2005-07-21 | Mitsubishi Chemical Corp. | Polycarbonatharz, daraus hergestelltes optisches datenaufzeichnungdmedium und optisches datenaufzeichnungsmedium |
| US6379795B1 (en) | 1999-01-19 | 2002-04-30 | E. I. Du Pont De Nemours And Company | Injection moldable conductive aromatic thermoplastic liquid crystalline polymeric compositions |
| DE10008420A1 (de) * | 2000-02-23 | 2001-08-30 | Bayer Ag | Polymerzusammensetzungen mit verbesserter Eigenschaftskonstanz |
| JP2005518076A (ja) * | 2002-02-13 | 2005-06-16 | デュポン カナダ インコーポレイテッド | 低剪断歪み下の燃料電池セパレータープレートの製造方法 |
| DE10248952A1 (de) * | 2002-10-21 | 2004-04-29 | Bayer Ag | Polycarbonate, Polyestercarbonate und Polyester mit lateral-ständigen Cycloalkyl-substituierten Phenolen |
| US6916899B2 (en) * | 2002-10-21 | 2005-07-12 | Bayer Aktiengesellschaft | Polycarbonates, polyester carbonates and polyesters having lateral, cycloalkyl-substituted phenols |
| DE102004054632A1 (de) * | 2004-11-11 | 2006-05-18 | Basf Ag | Polymerblends aus Polyestern und linearen oligomeren Polycarbonaten |
| KR100713099B1 (ko) * | 2005-03-07 | 2007-05-02 | 주식회사 엘지화학 | 폴리카보네이트 수지의 제조 방법 |
| DE102006006167A1 (de) * | 2005-04-06 | 2006-10-12 | Lanxess Deutschland Gmbh | Formmassen auf Basis eines thermoplastischen Polycarbonats |
| KR101492278B1 (ko) * | 2006-10-12 | 2015-02-11 | 바스프 에스이 | 열전도성 폴리에스테르 성형 재료 |
| DE102007015948A1 (de) * | 2007-04-03 | 2008-10-09 | Bayer Materialscience Ag | Modifizierte Polycarbonate, Polyestercarbonate und Polyester mit verbessertem Dehnverhalten und Flammwidrigkeit |
| WO2024206154A1 (en) | 2023-03-24 | 2024-10-03 | Covestro Llc | Thermal stabilization package for polycarbonate/acrylonitrile-butadiene-styrene blends |
| WO2025024161A1 (en) | 2023-07-21 | 2025-01-30 | Covestro Llc | Polycarbonate/acrylonitrile-styrene-acrylate blends with exceptional weatherability and gloss retention |
| EP4553116A1 (en) | 2023-11-09 | 2025-05-14 | Covestro LLC | Polycarbonate/acrylonitrile-styrene-acrylate blends with exceptional weatherability and gloss retention |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3080342A (en) * | 1960-05-31 | 1963-03-05 | Dow Chemical Co | Ether terminated polycarbonates |
| US3177179A (en) * | 1960-05-31 | 1965-04-06 | Dow Chemical Co | Chain terminated polycarbonates |
| US3214405A (en) * | 1961-07-31 | 1965-10-26 | Air Reduction | Preparation of polycarbonate resins |
| US3544514A (en) * | 1965-01-15 | 1970-12-01 | Bayer Ag | Process for the production of thermoplastic polycarbonates |
| DE2063050C3 (de) * | 1970-12-22 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | Verseifungsbeständige Polycarbonate, Verfahren zu deren Herstellung und deren Verwendung |
| US4001183A (en) * | 1971-03-19 | 1977-01-04 | Bayer Aktiengesellschaft | Tetraphenol containing polycarbonates |
| DE2254918A1 (de) * | 1972-11-09 | 1974-05-16 | Bayer Ag | Verzweigte aromatische polycarbonate |
| CA1019886A (en) * | 1972-11-09 | 1977-10-25 | Eckart Reese | Process for preparing polycarbonates |
| US4185009A (en) * | 1975-01-03 | 1980-01-22 | Bayer Aktiengesellschaft | Branched, high-molecular weight thermoplastic polycarbonates |
| DE2702626A1 (de) * | 1977-01-22 | 1978-07-27 | Bayer Ag | Verfahren zur herstellung von neuen hochmolekularen, segmentierten polycarbonat-elastomeren und neue verfahrensgemaess erhaltene polycarbonat- elastomere |
| DE2718466A1 (de) * | 1977-04-26 | 1978-11-02 | Bayer Ag | Verfahren zur herstellung von verzweigten polycarbonaten |
-
1978
- 1978-09-27 DE DE19782842005 patent/DE2842005A1/de not_active Withdrawn
-
1979
- 1979-09-14 US US06/075,439 patent/US4269964A/en not_active Expired - Lifetime
- 1979-09-17 DE DE7979103471T patent/DE2962828D1/de not_active Expired
- 1979-09-17 EP EP79103471A patent/EP0010602B1/de not_active Expired
- 1979-09-25 JP JP54122159A patent/JPS6045651B2/ja not_active Expired
-
1985
- 1985-03-07 JP JP60043828A patent/JPS60215021A/ja active Granted
Cited By (253)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0026868A1 (de) * | 1979-10-03 | 1981-04-15 | Bayer Ag | Aromatische Polyester, Verfahren zu ihrer Herstellung und ihre Verwendung zur Herstellung von Spritzgussartikeln, Folien und Überzügen |
| EP0039452A3 (en) * | 1980-05-07 | 1982-10-06 | Bayer Ag | Process for preparing aromatic polycarbonates |
| DE3125485A1 (de) * | 1981-05-04 | 1983-02-03 | Galina Alekseevna Škarpejkina | Niedermolekulare polykarbonate mit endstaendigen arylgruppen, verfahren zu ihrer herstelung und mit hilfederselben weichgemachte polykarbonatmischung |
| EP0249882A3 (en) * | 1986-06-18 | 1989-03-15 | Mitsubishi Kasei Corporation | Process for producing polycarbonate resin |
| EP0264792B1 (de) * | 1986-10-22 | 1991-04-10 | Bayer Ag | Thermoplastische Mischungen aus aromatischen Polycarbonaten und Polystyrolen und ihre Verwendung als Substrate für optische Datenspeicher |
| DE3829890A1 (de) * | 1988-09-02 | 1990-03-15 | Bayer Ag | Polystyrol-polycarbonat-mischungen |
| EP0693495A1 (de) | 1994-07-22 | 1996-01-24 | Bayer Ag | Mehrkernige Phosphorsäureester |
| EP0695785A2 (de) | 1994-08-01 | 1996-02-07 | Bayer Ag | Mischungen aus Polycarbonat, phenolisch hydroxyfunktionellen verzweigten Dimerfettsäurepolyestern und gegebenenfalls Pfropfpolymerisat |
| EP0697441A2 (de) | 1994-08-18 | 1996-02-21 | Bayer Ag | Flammgeschützte thermoplastische Polycarbonat-Formmassen |
| US5548011A (en) * | 1994-09-12 | 1996-08-20 | Bayer Ag | Blends of polycarbonates, dimeric fatty acid polyesters and PIB rubbers, silicones or mineral oils |
| EP0717077A2 (de) | 1994-11-24 | 1996-06-19 | Bayer Ag | ABS-Formmassen mit neuartiger Morphologie |
| EP0716125A2 (de) | 1994-12-05 | 1996-06-12 | Bayer Ag | Flammgeschützte, thermoplastische Polycarbonatformmassen |
| EP0783019A1 (de) | 1995-12-05 | 1997-07-09 | Bayer Ag | Thermoplastische Massen mit verbessertem Röntgenkontrast |
| US5994463A (en) * | 1997-04-01 | 1999-11-30 | Bayer Aktiengesellschaft | Polycarbonate/graft polymer moulding compositions with reduced deposit formation |
| EP2584001A1 (de) | 2002-05-28 | 2013-04-24 | Styrolution (Jersey) Limited | Zusammensetzung mit verbesserten Zähigkeitseigenschaften |
| US8530568B2 (en) | 2004-10-20 | 2013-09-10 | Basf Se | Flowable polyamides with hyperbranched polyesters/polycarbonates |
| DE102007003662A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupfer(I)enthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007003648A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupferenthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007003649A1 (de) | 2007-01-18 | 2008-07-24 | Rebac Gmbh | Kupfer(II)enthaltende Formmasse aus Polyester, ihre Herstellung und Verwendung |
| DE102007002925A1 (de) | 2007-01-19 | 2008-07-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007016786A1 (de) | 2007-04-05 | 2008-10-09 | Bayer Materialscience Ag | Polycarbonat-Formmassen |
| DE102008015124A1 (de) | 2007-05-16 | 2008-11-20 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| US8796365B2 (en) | 2007-06-28 | 2014-08-05 | Basf Se | Thermoplastic molding materials comprising organic black pigments |
| DE102007035462A1 (de) | 2007-07-28 | 2009-01-29 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von Pfropfkautschuken |
| DE102007038438A1 (de) | 2007-08-16 | 2009-02-19 | Bayer Materialscience Ag | Glasfaserverstärkte Polycarbonat-Formmassen |
| WO2009021648A1 (de) | 2007-08-16 | 2009-02-19 | Bayer Materialscience Ag | Glasfaserverstärkte polycarbonat-formmassen |
| DE102007040927A1 (de) | 2007-08-30 | 2009-03-05 | Bayer Materialscience Ag | Verfahren zur Herstellung schlagzähmodifizierter gefüllter Polycarbonat-Zusammensetzungen |
| DE102008038410A1 (de) | 2007-09-11 | 2009-03-12 | Basf Se | Flammgeschützte Polyester |
| DE102007045959A1 (de) | 2007-09-26 | 2009-04-09 | Lanxess Deutschland Gmbh | Verfahren zur Herstellung von Kautschuklatices mit definiertem stabilem Gelgehalt für die ABS-Herstellung |
| US8425829B2 (en) | 2007-11-20 | 2013-04-23 | Basf Se | Use of thermoplastic molding materials for GID/WIT |
| DE102007061758A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061759A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061762A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102007061761A1 (de) | 2007-12-20 | 2009-06-25 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102008024672A1 (de) | 2008-05-21 | 2009-11-26 | Bayer Materialscience Ag | Tieftemperaturzähe Polycarbonat-Blends |
| DE102008028571A1 (de) | 2008-06-16 | 2009-12-17 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE202008012066U1 (de) | 2008-08-26 | 2010-01-28 | Lanxess Deutschland Gmbh | Querträgermodul für ein Kraftfahrzeug |
| DE102008039652A1 (de) | 2008-08-26 | 2010-03-11 | Lanxess Deutschland Gmbh | Querträgermodul für ein Kraftfahrzeug |
| DE102008048202A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend plättchen- oder schuppförmigen anorganischen Füllstoff ausgenommen Talk |
| DE102008048201A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend isotropen Füllstoff |
| DE102008048204A1 (de) | 2008-09-20 | 2010-04-01 | Bayer Materialscience Ag | Spannungsrissbeständige und verzugsarme Zweikomponenten-Formteile enthaltend Talk |
| DE202008017621U1 (de) | 2008-09-24 | 2010-08-19 | Isringhausen Gmbh & Co. Kg | Gurtholm für Integralsitze |
| DE102008042325A1 (de) | 2008-09-24 | 2010-04-01 | Isringhausen Gmbh & Co. Kg | Gurtholm für Integralsitze |
| DE102008060536A1 (de) | 2008-12-04 | 2010-06-10 | Bayer Materialscience Ag | Saure Phosphorverbindungen enthaltende schlagzähmodifizierte Polycarbonat-Zusammensetzungen mit basisch gefälltem Emulsionspfropfpolymersiat |
| DE102008062903A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102009005762A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| DE102008062945A1 (de) | 2008-12-23 | 2010-06-24 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| EP2210916A1 (en) | 2009-01-23 | 2010-07-28 | Bayer MaterialScience AG | Polycarbonate molding composition |
| WO2010083974A1 (en) | 2009-01-23 | 2010-07-29 | Bayer Materialscience Ag | Polycarbonate molding compositions |
| WO2010089241A1 (de) | 2009-02-04 | 2010-08-12 | Basf Se | Schwarze, uv-stabile thermoplastische formmassen |
| DE102009009680A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur Herstellung von Polymer-Zusammensetzungen mit reduziertem Gehalt an flüchtigen organischen Verbindungen |
| US8680201B2 (en) | 2009-02-19 | 2014-03-25 | Bayer Materialscience Ag | Compounding method for producing polymer compositions with a reduced content of volatile organic compounds |
| WO2010094416A1 (de) | 2009-02-19 | 2010-08-26 | Bayer Materialscience Ag | Compoundierungsverfahren zur herstellung von polymer-zusammensetzungen mit reduziertem gehalt an flüchtigen organischen verbindungen |
| DE102009014878A1 (de) | 2009-03-25 | 2010-09-30 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte Polycarbonat-Zusammensetzungen |
| WO2010108618A1 (de) | 2009-03-25 | 2010-09-30 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte polycarbonat-zusammensetzungen |
| WO2010108617A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte polycarbonat-zusammensetzungen zur herstellung metallisierter formkörper mit homogenem oberflächenglanz |
| US8703869B2 (en) | 2009-03-26 | 2014-04-22 | Bayer Materialscience Ag | Impact-modified polycarbonate compositions for the production of metallised mouldings with homogeneous surface gloss |
| DE102009015039A1 (de) | 2009-03-26 | 2010-09-30 | Bayer Materialscience Ag | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen zur Herstellung metallisierter Formkörper mit homogenem Oberflächenglanz |
| DE202010001918U1 (de) | 2009-07-25 | 2011-06-27 | LANXESS Deutschland GmbH, 51373 | Organoblechstrukturbauteil |
| DE102009034767A1 (de) | 2009-07-25 | 2011-01-27 | Lanxess Deutschland Gmbh & Co. Kg | Organoblechstrukturbauteil |
| WO2011015286A1 (de) | 2009-08-01 | 2011-02-10 | Bayer Materialscience Ag | Verbesserte haftung zwischen thermoplasten und polyurethan |
| DE102009035807A1 (de) | 2009-08-01 | 2011-02-03 | Bayer Materialscience Ag | Verbesserte Haftung zwischen Thermoplasten und Polyurethan |
| WO2011042361A1 (de) | 2009-10-06 | 2011-04-14 | Bayer Materialscience Ag | Solarmodule mit polycarbonatblend-folie als rückseitenfolie |
| EP2308679A1 (de) | 2009-10-06 | 2011-04-13 | Bayer MaterialScience AG | Solarmodule mit Polycarbonatblend-Folie als Rückseitenfolie |
| DE102009052110A1 (de) | 2009-11-05 | 2011-05-12 | Faurecia Innenraum Systeme Gmbh | Kraftfahrzeug-Frontend |
| WO2011054754A1 (de) | 2009-11-05 | 2011-05-12 | Faurecia Kunststoff Automobilsysteme Gmbh | Kraftfahrzeug-frontend |
| US8852744B2 (en) | 2009-12-08 | 2014-10-07 | Bayer Materialscience Ag | Composite components with improved adhesion of polycarbonate/polyester compositions and polyurethane |
| WO2011070044A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verbundbauteile mit verbesserter haftung aus polycarbonat- / polyesterzusammensetzungen und polyurethan |
| WO2011070043A1 (de) | 2009-12-08 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur herstellung von polyurethan-verbundbauteilen sowie diese verbundbauteile |
| DE102009058180A1 (de) | 2009-12-15 | 2011-06-16 | Bayer Materialscience Ag | Verfahren zur Herstellung von Polyurethan-Verbundbauteilen |
| DE102009058182A1 (de) | 2009-12-15 | 2011-06-30 | Bayer MaterialScience AG, 51373 | Verbundbauteile mit verbesserter Haftung aus Polycarbonat- / Polyesterzusammensetzungen und Polyurethan |
| WO2011073290A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions having good mechanical properties ii |
| WO2011073291A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Flameproofed, impact-modified, scratch-resistant polycarbonate moulding compositions with good mechanical properties |
| DE102009059075A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Flammgeschützte, schlagzähmodifizierte, kratzfeste Polycarbonat-Formmassen mit guten mechanischen Eigenschaften |
| DE102009059074A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Kratzfeste, schlagzähe Polycarbonat-Formmassen mit guten mechanischen Eigenschaften II |
| DE102009059076A1 (de) | 2009-12-18 | 2011-06-22 | Bayer MaterialScience AG, 51373 | Kratzfeste, schlagzähe Polycarbonat-Formmassen mit guten mechanischen Eigenschaften I |
| WO2011073289A1 (en) | 2009-12-18 | 2011-06-23 | Bayer Materialscience Ag | Scratch-resistant, impact-resistant polycarbonate moulding compositions with good mechanical properties i |
| EP2377747A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Querträgermodul für ein Kraftfahrzeug |
| EP2377704A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Türstrukturmodul |
| EP2377746A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Querträgermodul für ein Kraftfahrzeug |
| EP2377703A1 (de) | 2010-04-15 | 2011-10-19 | LANXESS Deutschland GmbH | Türstrukturmodul |
| WO2011131727A1 (de) | 2010-04-23 | 2011-10-27 | Bayer Materialscience Ag | LEICHTFLIEßENDE POLYCARBONAT/ABS-FORMMASSEN MIT GUTEN MECHANISCHEN EIGENSCHAFTEN UND GUTER OBERFLÄCHE |
| DE102010018234A1 (de) | 2010-04-23 | 2012-03-29 | Bayer Materialscience Aktiengesellschaft | Leichtfließende Polycarbonat/ABS-Formmassen mit guten mechanischen Eigenschaften und guter Oberfläche |
| WO2011138384A1 (de) | 2010-05-05 | 2011-11-10 | Basf Se | Bauteil umfassend ein einlegeteil und eine kunststoffummantelung sowie verfahren zu seiner herstellung |
| US8318843B2 (en) | 2010-05-18 | 2012-11-27 | Basf Se | Laser-transparent polyesters |
| WO2011144502A1 (de) | 2010-05-18 | 2011-11-24 | Basf Se | Lasertransparente polyester |
| WO2011154518A1 (de) | 2010-06-11 | 2011-12-15 | Basf Se | Lasertransparentes pbt mit organischen additiven |
| US8889768B2 (en) | 2010-06-11 | 2014-11-18 | Basf Se | Laser-transparent PBT with organic additives |
| WO2012013564A1 (de) | 2010-07-30 | 2012-02-02 | Basf Se | Flammgeschützte formmassen |
| US9249270B2 (en) | 2010-08-13 | 2016-02-02 | Basf Se | Expandable pelletized materials based on polyester |
| WO2012020112A1 (de) | 2010-08-13 | 2012-02-16 | Basf Se | Expandierbare granulate auf polyesterbasis |
| WO2012022710A1 (en) | 2010-08-16 | 2012-02-23 | Ineos Abs (Jersey) Limited | Process for the preparation of agglomerated rubber latices and the use thereof for the manufacture of polymer compositions |
| WO2012022669A2 (de) | 2010-08-19 | 2012-02-23 | Basf Se | Nanocompositblends mit polyestern |
| DE102010039712A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Aktiengesellschaft | Schlagzähmodifizierte Polyester/Polycarbonat-Zusammensetzungen mit verbesserter Reißdehnung |
| WO2012025481A1 (de) | 2010-08-24 | 2012-03-01 | Bayer Materialscience Ag | SCHLAGZÄHMODIFIZIERTE POLYESTER/POLYCARBONAT-ZUSAMMENSETZUNGEN MIT VERBESSERTER REIßDEHNUNG |
| DE102010041387A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Aktiengesellschaft | Flammgeschützte schlagzähmodifizierte Batteriegehäuse auf Polycarbonatbasis I |
| DE102010041388A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Aktiengesellschaft | Flammgeschützte schlagzähmodifizierte Batteriegehäuse auf Polycarbonatbasis II |
| WO2012038419A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte batteriegehäuse auf polycarbonatbasis ii |
| WO2012038421A1 (de) | 2010-09-24 | 2012-03-29 | Bayer Materialscience Ag | Flammgeschützte schlagzähmodifizierte batteriegehäuse auf polycarbonatbasis i |
| DE102011087869A1 (de) | 2010-12-08 | 2012-09-06 | Basf Se | Lasermarkierbare flammgeschützte Formkörper |
| WO2012084848A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Antistatische polycarbonat-formmassen |
| WO2012084865A1 (de) | 2010-12-23 | 2012-06-28 | Bayer Materialscience Ag | Verfahren zur verbesserung der russdispergierung |
| WO2012119966A1 (de) | 2011-03-07 | 2012-09-13 | Basf Se | Lasertransparente polyester |
| US8791179B2 (en) | 2011-03-07 | 2014-07-29 | Basf Se | Laser-transparent polyesters |
| WO2012119967A1 (de) | 2011-03-08 | 2012-09-13 | Basf Se | Lasertransparente polyester mit anorganischen salzen |
| WO2012119996A1 (de) | 2011-03-08 | 2012-09-13 | Basf Se | Lasertransparente polyester mit carbonsäuresalzen |
| US8618201B2 (en) | 2011-03-08 | 2013-12-31 | Basf Se | Laser-transparent polyesters with inorganic salts |
| WO2012143314A1 (de) | 2011-04-20 | 2012-10-26 | Basf Se | Lasertransparente polyester mit alkalinitriten |
| US8859664B2 (en) | 2011-04-20 | 2014-10-14 | Basf Se | Laser-transparent polyesters with alkali metal nitrites |
| WO2012163822A1 (de) | 2011-06-01 | 2012-12-06 | Basf Se | Polyester mit styrolcopolymeren |
| EP2537895A1 (en) | 2011-06-20 | 2012-12-26 | Styrolution (Jersey) Limited | Impact modified polycarbonate compositions |
| US9080045B2 (en) | 2011-06-20 | 2015-07-14 | Styrolution (Jersey) Limited | Impact modified polycarbonate compositions |
| EP2574642A1 (de) | 2011-09-28 | 2013-04-03 | Bayer Material Science AG | Flammgeschützte PC/ABS-Zusammensetzungen mit guter Schlagzähigkeit, Fließfähigkeit und Chemikalienbeständigkeit |
| WO2013045544A1 (de) | 2011-09-28 | 2013-04-04 | Bayer Intellectual Property Gmbh | Flammgeschützte pc/abs-zusammensetzungen mit guter schlagzähigkeit, fliessfähigkeit und chemikalienbeständigkeit |
| WO2013045206A1 (de) | 2011-09-29 | 2013-04-04 | Styrolution GmbH | Stabilisierte polycarbonat acrylnitril/styrol/acrylester formmassen |
| WO2013060687A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Stabilisierte polycarbonatzusammensetzungen mit abmischungen aus kieselsäure und einer anorganischen säure |
| WO2013060685A1 (de) | 2011-10-26 | 2013-05-02 | Bayer Intellectual Property Gmbh | Verfahren zur herstellung und stabilisierung von schlagzähmodifizierten polycarbonat- zusammensetzungen unter verwendung von verdünnten lösungen saurer verbindungen |
| WO2013079555A1 (de) | 2011-11-30 | 2013-06-06 | Bayer Intellectual Property Gmbh | Formkörper mit hoher oberflächengüte |
| WO2013087584A1 (de) | 2011-12-13 | 2013-06-20 | Bayer Intellectual Property Gmbh | Flammgeschützte polyalkylenterephthalat/polycarbonat-zusammensetzungen |
| WO2013098176A1 (de) | 2011-12-29 | 2013-07-04 | Bayer Intellectual Property Gmbh | Polymerzusammensetzungen mit verbesserter haftung |
| WO2013150011A1 (de) | 2012-04-05 | 2013-10-10 | Bayer Materialscience Ag | Schlagzähmodifizierte polycarbonat-zusammensetzungen zur vereinfachten herstellung von tieftemperaturzähen bauteilen mit hochglänzenden und matten bauteilabschnitten |
| EP2647669A1 (de) | 2012-04-05 | 2013-10-09 | Bayer MaterialScience AG | Schlagzähmodifizierte Polycarbonat-Zusammensetzungen zur vereinfachten Herstellung von tieftemperaturzähen Bauteilen mit hochglänzenden und matten Bauteilabschnitten |
| EP2657259A1 (de) | 2012-04-23 | 2013-10-30 | Bayer MaterialScience AG | ABS-Zusammensetzungen mit verbesserter Oberfläche nach Wärme-Feucht-Lagerung |
| WO2013160245A1 (de) | 2012-04-23 | 2013-10-31 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche nach wärme-feucht-lagerung |
| WO2013160029A1 (de) | 2012-04-23 | 2013-10-31 | Bayer Materialscience Ag | Emulsionspolymerisat enthaltende zusammensetzungen mit verbesserter oberfläche nach wärme-feucht-lagerung |
| WO2013160249A1 (de) | 2012-04-23 | 2013-10-31 | Bayer Materialscience Ag | Abs-zusammensetzungen mit verbesserter oberfläche nach wärme-feucht-lagerung |
| EP2657258A1 (de) | 2012-04-23 | 2013-10-30 | Bayer MaterialScience AG | Verfahren zur Herstellung von ABS-Zusammensetzungen mit verbesserter Oberfläche nach Wärme-Feucht-Lagerung |
| WO2013160373A1 (de) | 2012-04-27 | 2013-10-31 | Bayer Materialscience Ag | Verarbeitungsstabile pc/abs-zusammensetzungen |
| WO2013160371A1 (de) | 2012-04-27 | 2013-10-31 | Bayer Materialscience Ag | Pc/abs-zusammensetzungen mit guter thermischer und chemischer beständigkeit |
| EP2657298A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | PC/ABS-Zusammensetzungen mit guter thermischer und chemischer Beständigkeit |
| EP2657294A1 (de) | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | Verarbeitungsstabile PC/ABS-Zusammensetzungen |
| WO2013189779A1 (de) | 2012-06-18 | 2013-12-27 | Basf Se | Flammgeschützte polyester mit polyacrylnitrilhomopolymerisaten |
| WO2014029641A1 (de) | 2012-08-20 | 2014-02-27 | Basf Se | Langfaserverstärkte flammgeschützte polyester |
| US8962717B2 (en) | 2012-08-20 | 2015-02-24 | Basf Se | Long-fiber-reinforced flame-retardant polyesters |
| WO2014086800A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen vi |
| WO2014086944A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen ii |
| WO2014086743A1 (de) | 2012-12-07 | 2014-06-12 | Bayer Materialscience Ag | Flammgeschützte polycarbonatformmassen i |
| WO2014122179A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche |
| WO2014122177A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche |
| WO2014122178A1 (de) | 2013-02-07 | 2014-08-14 | Bayer Materialscience Ag | Verfahren zur herstellung von abs-zusammensetzungen mit verbesserter oberfläche nach wärme-feucht-lagerung |
| WO2014146912A1 (de) | 2013-03-18 | 2014-09-25 | Basf Se | Polyester für profilextrusion und/oder rohrextrusion |
| EP2816081A1 (de) | 2013-06-17 | 2014-12-24 | Basf Se | Polyesterformmassen mit geringer TOC Emission |
| WO2015049185A1 (de) | 2013-10-02 | 2015-04-09 | Bayer Materialscience Ag | Verfahren zur herstellung eines formteils im schaumspritzguss, formteil aus einem aufgeschäumten thermoplastischen kunststoff und verwendungen dafür |
| WO2015052114A1 (de) | 2013-10-08 | 2015-04-16 | Bayer Materialscience Ag | Faserverbundwerkstoff, verwendung dafür und verfahren zu dessen herstellung |
| US10808086B2 (en) | 2013-10-08 | 2020-10-20 | Covestro Deutschland Ag | Fiber composite material, use therefor, and method for the production thereof |
| WO2015055719A1 (de) | 2013-10-18 | 2015-04-23 | Bayer Materialscience Ag | Polycarbonatzusammensetzungen mit verbesserter haftung zu polyurethanschichten |
| EP2899008A1 (de) | 2014-01-27 | 2015-07-29 | Bayer MaterialScience AG | Spritzgiessverfahren zur Herstellung eines Verbundbauteiles mit Oberflächenstrukturierung im Kontaktbereich der Schichten zur Verbesserung der Haftung |
| WO2016198403A1 (de) | 2015-06-09 | 2016-12-15 | Covestro Deutschland Ag | Glasfaserverstärkte polycarbonat-formmassen mit verbesserter zähigkeit |
| US10597529B2 (en) | 2015-06-09 | 2020-03-24 | Covestro Deutschland Ag | Glass-fibre-reinforced polycarbonate moulding compositions with improved toughness |
| WO2016202399A1 (de) | 2015-06-18 | 2016-12-22 | Covestro Deutschland Ag | Flammgeschütze polycarbonat-polyester-zusammensetzungen |
| US10501624B2 (en) | 2015-06-18 | 2019-12-10 | Covestro Deutschland Ag | Flame-retardant polycarbonate-polyester compositions |
| WO2017055416A1 (de) | 2015-10-02 | 2017-04-06 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit verbesserter stabilisierung |
| US10899909B2 (en) | 2015-10-02 | 2021-01-26 | Covestro Deutschland Ag | Polycarbonate compositions with improved stabilisation |
| WO2017063841A1 (de) | 2015-10-14 | 2017-04-20 | Basf Se | Polyesterblend mit halogenfreiem flammschutz |
| WO2017065762A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| WO2017066596A1 (en) | 2015-10-14 | 2017-04-20 | Covestro Llc | Phosphazene modified polycarbonate molded battery cooling device |
| WO2017068045A1 (de) | 2015-10-23 | 2017-04-27 | Covestro Deutschland Ag | Verfahren zur herstellung von polycarbonat-formmassen mit verbesserter thermischer verarbeitungsstabilität |
| US10844182B2 (en) | 2015-10-23 | 2020-11-24 | Covestro Deutschland Ag | Method for producing polycarbonate molding compositions with improved thermal processing stability |
| WO2017089547A1 (en) | 2015-11-26 | 2017-06-01 | Ineos Styrolution Group Gmbh | Polycarbonate-asa blends with antistatic properties using sulfonated alkanes |
| WO2017099754A1 (en) | 2015-12-09 | 2017-06-15 | Covestro Llc | Thermoplastic compositions having low gloss and high impact strength |
| WO2017162769A1 (de) | 2016-03-23 | 2017-09-28 | Covestro Deutschland Ag | Polycarbonat-zusammensetzungen mit verbesserter hydrolysebeständigkeit |
| WO2017186663A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische thermoplastische formmassen |
| WO2017186690A1 (de) | 2016-04-27 | 2017-11-02 | Covestro Deutschland Ag | Antistatische und lichtstabile thermoplastische polycarbonat-formmassen |
| US10655011B2 (en) | 2016-04-27 | 2020-05-19 | Covestro Deutschland Ag | Antistatic and light-stable thermoplastic polycarbonate moulding compounds |
| US11352494B2 (en) | 2016-04-27 | 2022-06-07 | Covestro Deutschland Ag | Anti-static thermoplastic molding materials |
| WO2018015557A1 (de) | 2016-07-22 | 2018-01-25 | Covestro Deutschland Ag | Kratzfeste polycarbonat-zusammensetzungen mit guter thermischer stabilität |
| US10899925B2 (en) | 2016-07-22 | 2021-01-26 | Covestro Deutschland Ag | Scratch-resistant polycarbonate compositions having good thermal stability |
| WO2018050426A1 (de) | 2016-09-14 | 2018-03-22 | Basf Se | Polyester für profilextrusion und/oder rohrextrusion |
| US11401412B2 (en) | 2016-09-14 | 2022-08-02 | Basf Se | Polyester for profile extrusion and/or pipe extrusion |
| US11059965B2 (en) | 2016-09-27 | 2021-07-13 | Ineos Styrolution Group Gmbh | Process for producing ASA plastics |
| WO2018060111A1 (de) | 2016-09-27 | 2018-04-05 | Ineos Styrolution Group Gmbh | Verbessertes verfahren zur herstellung von asa-kunststoffen |
| WO2019007961A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC STYRENE COPOLYMER RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| US11549008B2 (en) | 2017-07-05 | 2023-01-10 | Ineos Styrolution Group Gmbh | Thermoplastic resin composition with improved UV resistance |
| US11525052B2 (en) | 2017-07-05 | 2022-12-13 | Ineos Styrolution Group Gmbh | Thermoplastic styrene copolymer resin composition with improved UV resistance |
| WO2019007957A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| US11225570B2 (en) | 2017-07-05 | 2022-01-18 | Ineos Styrolution Group Gmbh | Thermoplastic resin composition with improved UV resistance |
| WO2019007967A1 (en) | 2017-07-05 | 2019-01-10 | Ineos Styrolution Group Gmbh | THERMOPLASTIC RESIN COMPOSITION HAVING ENHANCED UV RESISTANCE |
| WO2019020680A1 (en) | 2017-07-26 | 2019-01-31 | Ineos Styrolution Group Gmbh | ANTICHOCK COPPER STYRENE COPOLYMER COMPOSITION COMPRISING A POLYSILOXANE ADDITIVE HAVING IMPROVED ABRASION CHARACTERISTICS |
| WO2019020677A1 (en) | 2017-07-26 | 2019-01-31 | Ineos Styrolution Group Gmbh | STYRENE COPOLYMER COMPOSITION WITH IMPROVED SHOCK RESISTANCE COMPRISING POLYSILOXANE ADDITIVE HAVING IMPROVED ABRASION FEATURES |
| US11680161B2 (en) | 2017-11-13 | 2023-06-20 | Ineos Styrolution Group Gmbh | Thermoplastic molding composition and articles made thereof having improved surface quality |
| WO2019092237A1 (en) | 2017-11-13 | 2019-05-16 | Ineos Styrolution Group Gmbh | Thermoplastic molding composition and articles made thereof having improved surface quality |
| WO2019121463A1 (de) | 2017-12-19 | 2019-06-27 | Covestro Deutschland Ag | Thermoplastische zusammensetzungen mit guter stabilität |
| EP4431562A2 (de) | 2017-12-19 | 2024-09-18 | Covestro Deutschland AG | Thermoplastische zusammensetzungen mit guter stabilität |
| EP3556527A1 (en) | 2018-04-19 | 2019-10-23 | Covestro Deutschland AG | Thermoplastic composite article and manufacturing method and use thereof |
| EP3560675A1 (en) | 2018-04-24 | 2019-10-30 | Covestro Deutschland AG | Thermoplastic composite article and manufacturing method and use thereof |
| WO2019233929A1 (en) | 2018-06-07 | 2019-12-12 | Covestro Deutschland Ag | Thermoplastic composite article and preparation method thereof |
| WO2019243105A1 (en) | 2018-06-18 | 2019-12-26 | Ineos Styrolution Group Gmbh | Thermoplastic compositions with improved uv resistance |
| US11965066B2 (en) | 2018-06-18 | 2024-04-23 | Ineos Styrolution Group Gmbh | Thermoplastic compositions with improved UV resistance |
| WO2019243107A1 (en) | 2018-06-20 | 2019-12-26 | Ineos Styrolution Group Gmbh | High heat resistant impact modified polycarbonate blend |
| WO2020020814A1 (de) | 2018-07-25 | 2020-01-30 | Covestro Deutschland Ag | Polymer-blends enthaltend thermoplast und vernetztes reaktionsprodukt aus polyaddition oder polykondensation |
| EP3608358A1 (de) | 2018-08-09 | 2020-02-12 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-polyalkylenterephthalat-zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit |
| WO2020030640A1 (de) | 2018-08-09 | 2020-02-13 | Covestro Deutschland Ag | Mineralgefüllte polycarbonat-polyalkylenterephthalat-zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit |
| WO2020051190A1 (en) | 2018-09-07 | 2020-03-12 | Covestro Llc | A device for cooling battery cells |
| EP3633785A1 (en) | 2018-10-05 | 2020-04-08 | Covestro LLC | A device for cooling battery cells |
| EP3650487A1 (en) | 2018-11-06 | 2020-05-13 | Covestro Deutschland AG | Thermoplastic composite article and preparation method thereof |
| WO2020100350A1 (ja) | 2018-11-12 | 2020-05-22 | 積水化学工業株式会社 | 樹脂シート |
| WO2020194996A1 (ja) | 2019-03-27 | 2020-10-01 | 積水化学工業株式会社 | 樹脂組成物及び成形体 |
| WO2020212229A1 (de) | 2019-04-18 | 2020-10-22 | Covestro Intellectual Property Gmbh & Co. Kg | Verfahren zur herstellung einer polycarbonat-formmasse |
| EP3725819A1 (de) | 2019-04-18 | 2020-10-21 | Covestro Deutschland AG | Verfahren zur herstellung einer polycarbonat-formmasse |
| WO2021037705A1 (en) | 2019-08-28 | 2021-03-04 | Covestro Intellectual Property Gmbh & Co. Kg | Flame-retardant polycarbonate composition and molded parts as well as articles made therefrom |
| WO2021043654A1 (de) | 2019-09-04 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2021043653A1 (en) | 2019-09-05 | 2021-03-11 | Covestro Intellectual Property Gmbh & Co. Kg | Polymer composition and article made from the same |
| EP3828236A1 (de) | 2019-11-27 | 2021-06-02 | Covestro Intellectual Property GmbH & Co. KG | Flammgeschützter polycarbonat-polyester blend |
| WO2021105008A1 (de) | 2019-11-27 | 2021-06-03 | Covestro Intellectual Property Gmbh & Co. Kg | Flammgeschützter polycarbonat-polyester blend |
| WO2021110550A1 (en) | 2019-12-04 | 2021-06-10 | Covestro Intellectual Property Gmbh & Co. Kg | Flame retardant impact-modified polycarbonate composition |
| WO2021191178A1 (en) | 2020-03-23 | 2021-09-30 | Basf Se | Container for ingredients for making beverages |
| WO2021224136A1 (en) | 2020-05-06 | 2021-11-11 | Basf Se | Flame retarded polyester blend |
| WO2021228636A1 (en) | 2020-05-13 | 2021-11-18 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2021233727A1 (de) | 2020-05-18 | 2021-11-25 | Covestro Deutschland Ag | Polycarbonat blend mit verringerten störgeräuschen |
| WO2021233773A1 (en) | 2020-05-22 | 2021-11-25 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2021233774A1 (en) | 2020-05-22 | 2021-11-25 | Covestro Deutschland Ag | Flame-retardant polycarbonate composition |
| WO2022029260A1 (de) | 2020-08-07 | 2022-02-10 | Basf Se | Thermoplastische mischungen |
| WO2022058222A1 (de) | 2020-09-18 | 2022-03-24 | Covestro Deutschland Ag | Mehrschichtkörper für diffuse durchleuchtung |
| WO2022081375A1 (en) | 2020-10-12 | 2022-04-21 | Covestro Llc | A modular battery pack |
| WO2022128837A1 (de) | 2020-12-18 | 2022-06-23 | Covestro Deutschland Ag | Zusammensetzung und verfahren zur herstellung einer transluzenten thermoplastischen polycarbonat/polymethylmethacrylat-formmasse |
| EP4015580A1 (de) | 2020-12-18 | 2022-06-22 | Covestro Deutschland AG | Zusammensetzung und verfahren zur herstellung einer transluzenten thermoplastischen polycarbonat/polymethylmethacrylat-formmasse |
| EP4039746A1 (de) | 2021-02-08 | 2022-08-10 | Covestro Deutschland AG | Polycarbonat-polyester zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit und hoher thermischer belastbarkeit |
| WO2022167395A1 (de) | 2021-02-08 | 2022-08-11 | Covestro Deutschland Ag | Polycarbonat-polyester zusammensetzung, formmasse und formkörper mit guter schlagzähigkeit und hoher thermischer belastbarkeit |
| EP4047073A1 (de) | 2021-02-17 | 2022-08-24 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022174963A1 (de) | 2021-02-17 | 2022-08-25 | Covestro Deutschland Ag | Pyrolyse von polycarbonat-haltigem material zur wiedergewinnung von rohstoffen |
| WO2022178755A1 (en) | 2021-02-25 | 2022-09-01 | Covestro Deutschland Ag | Heat-resistant semi-conductive thermoplastic resin composition |
| WO2023280608A1 (de) | 2021-07-05 | 2023-01-12 | Covestro Deutschland Ag | Zusammensetzung und verfahren zur herstellung einer transparenten thermoplastischen polycarbonat/polymethylmethacrylat-formmasse |
| WO2023009417A1 (en) | 2021-07-28 | 2023-02-02 | Covestro Llc | A drug injection device and recycling system |
| EP4177301A1 (de) | 2021-11-03 | 2023-05-10 | Covestro Deutschland AG | Polyphosphazen und formmasse enthaltend das polyphosphazen |
| WO2023088806A1 (de) | 2021-11-22 | 2023-05-25 | Basf Se | Thermoplastische mischungen |
| EP4198076A1 (en) | 2021-12-16 | 2023-06-21 | Covestro Deutschland AG | Process for recovery of rubber-modified vinyl(co)polymer |
| WO2023110654A1 (en) | 2021-12-16 | 2023-06-22 | Covestro Deutschland Ag | Process for recovery of rubber-modified vinyl(co)polymer |
| EP4201987A1 (de) | 2021-12-22 | 2023-06-28 | Covestro Deutschland AG | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| WO2023118104A1 (de) | 2021-12-22 | 2023-06-29 | Covestro Deutschland Ag | Pyrolyse von polycarbonat-haltigem material in kombination mit phosphorhaltiger organischer verbindung zur wiedergewinnung von rohstoffen |
| EP4245521A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| WO2023174781A1 (de) | 2022-03-16 | 2023-09-21 | Covestro Deutschland Ag | Metallschicht enthaltender mehrschichtkörper für diffuse durchleuchtung |
| EP4245529A1 (de) | 2022-03-16 | 2023-09-20 | Covestro Deutschland AG | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| WO2023174782A1 (de) | 2022-03-16 | 2023-09-21 | Covestro Deutschland Ag | Durchleuchtbarer mehrschichtkörper mit thermo- oder druckempfindlicher dekorationsschicht |
| EP4249560A1 (de) | 2022-03-25 | 2023-09-27 | Covestro Deutschland AG | Polycarbonat/polyester-zusammensetzung und bauteil mit hoher kriechstromfestigkeit |
| WO2023180158A1 (de) | 2022-03-25 | 2023-09-28 | Covestro Deutschland Ag | Polycarbonat/polyester-zusammensetzung und bauteil mit hoher kriechstromfestigkeit |
| EP4257619A1 (de) | 2022-04-04 | 2023-10-11 | Covestro Deutschland AG | Pfropfcopolymere zur reduktion der grenzflächenspannung in polymerblends |
| WO2023194166A1 (de) | 2022-04-04 | 2023-10-12 | Covestro Deutschland Ag | Pfropfcopolymere zur reduktion der grenzflächenspannung in polymerblends |
| EP4311839A1 (de) | 2022-07-28 | 2024-01-31 | Covestro Deutschland AG | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024022964A1 (de) | 2022-07-28 | 2024-02-01 | Covestro Deutschland Ag | Mineralgefüllte polycarbonat-blend-formmasse mit niedrigem bpa-gehalt und verfahren zu ihrer herstellung |
| WO2024028311A1 (de) | 2022-08-04 | 2024-02-08 | Ineos Styrolution Group Gmbh | Thermoplastische abs-formmasse mit guter eigenschaftskombination von verarbeitbarkeit und oberflächenqualität |
| WO2024028309A1 (de) | 2022-08-04 | 2024-02-08 | Ineos Styrolution Group Gmbh | Thermoplastische abs-formmassen mit einer guten eigenschaftskombination von verarbeitbarkeit und oberflächenqualität |
| WO2024068403A1 (de) | 2022-09-29 | 2024-04-04 | Covestro Deutschland Ag | E/e-bauteil enthaltend polycarbonat-material mit hoher kriechstromfestigkeit |
| EP4345136A1 (de) | 2022-09-29 | 2024-04-03 | Covestro Deutschland AG | E/e-bauteil enthaltend polycarbonat-material mit hoher kriechstromfestigkeit |
| WO2024146774A1 (de) | 2023-01-05 | 2024-07-11 | Covestro Deutschland Ag | Mineralgefüllte polycarbonat- und/oder polyestercarbonat-formmasse mit guter thermischer stabilität |
| WO2024156587A1 (en) | 2023-01-26 | 2024-08-02 | Basf Se | Compositions comprising polyarylene(ether)sulfones |
| WO2025073535A1 (de) | 2023-10-02 | 2025-04-10 | Covestro Deutschland Ag | Gefüllte zusammensetzung und thermoplastische formmasse zur herstellung von formkörpern mit guter oberflächenkosmetik und reduziertem gehalt an freiem bisphenol a |
| WO2025098864A1 (de) | 2023-11-07 | 2025-05-15 | Covestro Deutschland Ag | Verfahren zur nachträglichen reduzierung des gehalts an freiem bisphenol-a von polycarbonat und/oder polyestercarbonat formmassen |
| EP4606841A1 (de) | 2024-02-22 | 2025-08-27 | Covestro Deutschland AG | Blockcopolymer und verfahren zu dessen herstellung unter verwendung eines speziellen katalysators |
| WO2025176592A1 (de) | 2024-02-22 | 2025-08-28 | Covestro Deutschland Ag | Blockcopolymer und verfahren zu dessen herstellung unter verwendung eines speziellen katalysators |
| WO2025252781A1 (en) | 2024-06-05 | 2025-12-11 | Basf Se | Flame retardant polyamides for improved lsr compression set |
| WO2026037707A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie olefin-(meth)acrylsäure-copolymer und phosphoniumsalz |
| WO2026037708A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie olefin-(meth)acrylat-copolymer und ein spezielles salz |
| WO2026037709A1 (de) | 2024-08-12 | 2026-02-19 | Covestro Deutschland Ag | Zusammensetzung enthaltend polycarbonat, polyestercarbonat und/oder polyester sowie ein olefin-(meth)acrylat-copolymer mit besonderer molmassenverteilung |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6045651B2 (ja) | 1985-10-11 |
| US4269964A (en) | 1981-05-26 |
| EP0010602A1 (de) | 1980-05-14 |
| JPS60215021A (ja) | 1985-10-28 |
| EP0010602B1 (de) | 1982-05-12 |
| JPS5545792A (en) | 1980-03-31 |
| DE2962828D1 (en) | 1982-07-01 |
| JPH0210175B2 (enExample) | 1990-03-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2842005A1 (de) | Polycarbonate mit alkylphenyl-endgruppen, ihre herstellung und ihre verwendung | |
| EP0193757B1 (de) | Neue Polydiorganosioxan-Polycarbonat-Blockcopolymere | |
| EP0691364B1 (de) | Epoxigruppen enthaltende Siloxane und ihre Mischungen mit Polycarbonaten | |
| DE4240313A1 (de) | Polycarbonate für optische Datenträger | |
| EP0374635A2 (de) | Polydiorganosiloxan-Polycarbonat-Blockcokondensate auf Basis spezieller Dihydroxydiphenylcycloalkane | |
| EP0374656A2 (de) | Polycarbonate aus Alkylcyclohexylidenbisphenolen | |
| EP0013904B1 (de) | Verfahren zur Herstellung von Polycarbonaten | |
| EP0001096B1 (de) | Polycarbonatgemische mit verbesserter Flammwidrigkeit | |
| EP0078943A1 (de) | Verfahren zur Herstellung von Polycarbonaten mit verbessertem Alterungsverhalten | |
| DE2620255A1 (de) | Thermoplastische formmassen und formkoerper aus polycarbonaten mit verbesserter entformbarkeit beim spritzgiessen | |
| DE2615038A1 (de) | 1,1,3,4,6-pentamethyl-3-(3,5- dimethyl-4-hydroxyphenyl)-indan-5-ol- polycarbonate | |
| EP0413205A2 (de) | Polysiloxan-Polycarbonat-Blockcopolymere auf Basis spezieller Dihydroxydiphenylcycloalkane | |
| EP0414083B1 (de) | Stabilisierte Polycarbonate | |
| EP0065728B1 (de) | Neue Copolyestercarbonate und deren Abmischung mit bekannten Polycarbonaten zu thermoplastischen Formmassen | |
| EP0347682A2 (de) | Polycarbonate mit mesogenen Verbindungen als Endgruppen, ihre Herstellung und Verwendung | |
| EP0423562B1 (de) | Polycarbonate mit verbesserter Wärmeformbeständigkeit | |
| EP1203044A1 (de) | Polycarbonate mit asparaginsäureesterfunktionellen silikonen | |
| EP0374623B1 (de) | Polycarbonate aus mehrfach substituierten Cyclohexylidenbisphenolen | |
| EP0099990A1 (de) | Verfahren zur Herstellung von Polycarbonaten mit N-Alkyl-perfluoralkylsulfonamid-Endgruppen | |
| EP0327951B1 (de) | Polycarbonate mit Aralkylphenylendgruppen, ihre Herstellung und Verwendung | |
| EP0480237B1 (de) | Spezielle Dihydroxydiphenylbicycloalkane, ihre Herstellung und ihre Verwendung zur Herstellung von hochmolekularen Polycarbonaten | |
| EP0374630A2 (de) | Polycarbonate aus Cycloalkylidenbisphenolen | |
| DE2716304A1 (de) | Verfahren zur herstellung von polycarbonatgemischen | |
| EP0457102A2 (de) | tert.-Alkylester-Bisphenole, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0678538B1 (de) | Verwendung von hydrierter Abietinsäure als Kettenabbrecher für die Herstellung von Polycarbonaten und von Polyestercarbonaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |