DE2708751C3 - Verfahren zur Erhöhung der Reaktionsfähigkeit von Perfluorhalogenalkanen - Google Patents
Verfahren zur Erhöhung der Reaktionsfähigkeit von PerfluorhalogenalkanenInfo
- Publication number
- DE2708751C3 DE2708751C3 DE2708751A DE2708751A DE2708751C3 DE 2708751 C3 DE2708751 C3 DE 2708751C3 DE 2708751 A DE2708751 A DE 2708751A DE 2708751 A DE2708751 A DE 2708751A DE 2708751 C3 DE2708751 C3 DE 2708751C3
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- dmso
- production
- acid
- mixture
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 230000009257 reactivity Effects 0.000 title claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 238000004519 manufacturing process Methods 0.000 claims description 22
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 claims description 18
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 8
- 238000005660 chlorination reaction Methods 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- ABDBNWQRPYOPDF-UHFFFAOYSA-N carbonofluoridic acid Chemical class OC(F)=O ABDBNWQRPYOPDF-UHFFFAOYSA-N 0.000 claims description 6
- 150000002825 nitriles Chemical class 0.000 claims description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 4
- 239000001569 carbon dioxide Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- 150000001298 alcohols Chemical class 0.000 claims description 2
- 150000001299 aldehydes Chemical class 0.000 claims description 2
- HIZCIEIDIFGZSS-UHFFFAOYSA-N carbonotrithioic acid Chemical compound SC(S)=S HIZCIEIDIFGZSS-UHFFFAOYSA-N 0.000 claims description 2
- 150000003841 chloride salts Chemical class 0.000 claims 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 56
- 239000011701 zinc Substances 0.000 description 26
- 229910052751 metal Inorganic materials 0.000 description 22
- 239000002184 metal Substances 0.000 description 22
- 239000010949 copper Substances 0.000 description 17
- 239000000203 mixture Substances 0.000 description 11
- 239000000047 product Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 229910052725 zinc Inorganic materials 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 229910052802 copper Inorganic materials 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 239000007788 liquid Substances 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 5
- 239000000376 reactant Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000012429 reaction media Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001805 chlorine compounds Chemical class 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- LQSJUQMCZHVKES-UHFFFAOYSA-N 6-iodopyrimidin-4-amine Chemical compound NC1=CC(I)=NC=N1 LQSJUQMCZHVKES-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 238000004566 IR spectroscopy Methods 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- -1 Trithiocarbonic acid diesters Chemical class 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052740 iodine Chemical group 0.000 description 2
- 150000002681 magnesium compounds Chemical class 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- BULLJMKUVKYZDJ-UHFFFAOYSA-N 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane Chemical compound FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I BULLJMKUVKYZDJ-UHFFFAOYSA-N 0.000 description 1
- XCWMATKNFUWXCN-UHFFFAOYSA-N 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptan-1-ol Chemical compound OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F XCWMATKNFUWXCN-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- OTLBJZIWBMKOQN-UHFFFAOYSA-N C(S)(S)=S.C(CCC)[Na] Chemical compound C(S)(S)=S.C(CCC)[Na] OTLBJZIWBMKOQN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- LHQLJMJLROMYRN-UHFFFAOYSA-L cadmium acetate Chemical compound [Cd+2].CC([O-])=O.CC([O-])=O LHQLJMJLROMYRN-UHFFFAOYSA-L 0.000 description 1
- CEKJAYFBQARQNG-UHFFFAOYSA-N cadmium zinc Chemical compound [Zn].[Cd] CEKJAYFBQARQNG-UHFFFAOYSA-N 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- RCTYPNKXASFOBE-UHFFFAOYSA-M chloromercury Chemical compound [Hg]Cl RCTYPNKXASFOBE-UHFFFAOYSA-M 0.000 description 1
- TVZPLCNGKSPOJA-UHFFFAOYSA-N copper zinc Chemical compound [Cu].[Zn] TVZPLCNGKSPOJA-UHFFFAOYSA-N 0.000 description 1
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical class OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 229940046892 lead acetate Drugs 0.000 description 1
- JQJCSZOEVBFDKO-UHFFFAOYSA-N lead zinc Chemical compound [Zn].[Pb] JQJCSZOEVBFDKO-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- YVUZUKYBUMROPQ-UHFFFAOYSA-N mercury zinc Chemical compound [Zn].[Hg] YVUZUKYBUMROPQ-UHFFFAOYSA-N 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- ZWBAMYVPMDSJGQ-UHFFFAOYSA-N perfluoroheptanoic acid Chemical compound OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F ZWBAMYVPMDSJGQ-UHFFFAOYSA-N 0.000 description 1
- UZUFPBIDKMEQEQ-UHFFFAOYSA-N perfluorononanoic acid Chemical compound OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F UZUFPBIDKMEQEQ-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- IXPAAHZTOUOJJM-UHFFFAOYSA-N sulfuryl chloride fluoride Chemical class FS(Cl)(=O)=O IXPAAHZTOUOJJM-UHFFFAOYSA-N 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000004448 titration Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C31/00—Saturated compounds having hydroxy or O-metal groups bound to acyclic carbon atoms
- C07C31/34—Halogenated alcohols
- C07C31/40—Halogenated alcohols perhalogenated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C329/00—Thiocarbonic acids; Halides, esters or anhydrides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/15—Preparation of carboxylic acids or their salts, halides or anhydrides by reaction of organic compounds with carbon dioxide, e.g. Kolbe-Schmitt synthesis
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7606303A FR2342950A1 (fr) | 1976-03-05 | 1976-03-05 | Procede de fonctionnalisation de radicaux perfluores |
| FR7637240A FR2373503A2 (fr) | 1976-12-10 | 1976-12-10 | Procede de fonctionnalisation de radicaux perfluores |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2708751A1 DE2708751A1 (de) | 1977-09-08 |
| DE2708751B2 DE2708751B2 (de) | 1980-11-13 |
| DE2708751C3 true DE2708751C3 (de) | 1982-01-07 |
Family
ID=26219332
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2708751A Expired DE2708751C3 (de) | 1976-03-05 | 1977-03-01 | Verfahren zur Erhöhung der Reaktionsfähigkeit von Perfluorhalogenalkanen |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US4098806A (enExample) |
| JP (1) | JPS606332B2 (enExample) |
| CA (1) | CA1084524A (enExample) |
| CH (2) | CH620673A5 (enExample) |
| DE (1) | DE2708751C3 (enExample) |
| GB (1) | GB1539300A (enExample) |
| IT (1) | IT1117060B (enExample) |
| NL (1) | NL186082C (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2374287A1 (fr) * | 1976-12-17 | 1978-07-13 | Ugine Kuhlmann | Procede de preparation de derives des acides perfluoroalcane-carboxyliques et perfluoroalcane-sulfiniques |
| US4222968A (en) * | 1979-06-08 | 1980-09-16 | Schack Carl J | Method for synthesizing fluorocarbon halides |
| FR2521987A1 (fr) * | 1982-02-23 | 1983-08-26 | Ugine Kuhlmann | Procede de preparation d'alcools polyfluores du type rfch2ch2oh |
| JPS59128349A (ja) * | 1982-12-31 | 1984-07-24 | Toyo Soda Mfg Co Ltd | ペルフルオロ又はポリフルオロ脂肪族カルボン酸の製造方法 |
| DE3673245D1 (de) * | 1985-05-27 | 1990-09-13 | Tosoh Corp | Verfahren zur herstellung von fluor enthaltenden aliphatischen carbonsaeuren. |
| FR2597511B1 (fr) * | 1986-04-17 | 1990-09-07 | Atochem | Fonctionnalisation de iodo-polyfluoroalcanes par reduction electrochimique et nouveaux composes fluores ainsi obtenus |
| JPH0772156B2 (ja) * | 1986-07-11 | 1995-08-02 | 東ソー株式会社 | 含フツ素α,β−不飽和カルボン酸の製法 |
| JP2521695B2 (ja) * | 1987-02-27 | 1996-08-07 | 関東電化工業株式会社 | カルビノ−ル誘導体の製造法 |
| US5455373A (en) * | 1994-02-28 | 1995-10-03 | Exfluor Research Corporation | Method of producing perfluorocarbon halides |
| WO2008000682A1 (en) * | 2006-06-27 | 2008-01-03 | Clariant International Ltd | Fluorous telomeric compounds and polymers containing same |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB904263A (en) * | 1958-08-11 | 1962-08-29 | Minnesota Mining & Mfg | Perfluoroalkyl alkanols |
| US3232970A (en) * | 1961-06-02 | 1966-02-01 | Pennsalt Chemicals Corp | Terminally branched and terminally monochlorinated perfluorocarboxylic acids |
| US3600415A (en) * | 1968-08-01 | 1971-08-17 | Allied Chem | Fluorinated amides |
| DE1916669B1 (de) * | 1969-04-01 | 1970-03-05 | Hoechst Ag | Verfahren zur Herstellung von geradkettigen Fluorcarbonsaeuren |
| US3790607A (en) * | 1971-05-20 | 1974-02-05 | Allied Chem | Carbonylation of fluorocarbon iodides |
| CA1023768A (en) * | 1972-12-21 | 1978-01-03 | Horst Jager | Polyfluoroalkyl iodides, process for their manufacture, and their use |
| GB1429279A (en) * | 1973-03-05 | 1976-03-24 | Ciba Geigy Ag | Perfluoroalkylalkyl nitriles, process for their manufacutre and their use |
| DE2318677A1 (de) * | 1973-04-13 | 1974-11-07 | Hoechst Ag | Verfahren zur herstellung von perfluoralkylalkoholen |
| US4001309A (en) | 1973-04-16 | 1977-01-04 | Asahi Glass Co., Ltd. | Method of preparing polyfluoroalkyl group containing compounds |
-
1977
- 1977-02-24 IT IT67412/77A patent/IT1117060B/it active
- 1977-02-25 US US05/772,107 patent/US4098806A/en not_active Expired - Lifetime
- 1977-03-01 DE DE2708751A patent/DE2708751C3/de not_active Expired
- 1977-03-01 GB GB8640/77A patent/GB1539300A/en not_active Expired
- 1977-03-04 NL NLAANVRAGE7702368,A patent/NL186082C/xx not_active IP Right Cessation
- 1977-03-04 JP JP52022901A patent/JPS606332B2/ja not_active Expired
- 1977-03-04 CA CA273,245A patent/CA1084524A/fr not_active Expired
- 1977-03-04 CH CH273277A patent/CH620673A5/fr not_active IP Right Cessation
-
1980
- 1980-01-21 CH CH45880A patent/CH620413A5/fr not_active IP Right Cessation
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2708751B2 (de) | 1980-11-13 |
| DE2708751A1 (de) | 1977-09-08 |
| GB1539300A (en) | 1979-01-31 |
| CH620673A5 (enExample) | 1980-12-15 |
| JPS52106808A (en) | 1977-09-07 |
| NL7702368A (nl) | 1977-09-07 |
| IT1117060B (it) | 1986-02-10 |
| NL186082B (nl) | 1990-04-17 |
| CH620413A5 (enExample) | 1980-11-28 |
| US4098806A (en) | 1978-07-04 |
| CA1084524A (fr) | 1980-08-26 |
| JPS606332B2 (ja) | 1985-02-18 |
| NL186082C (nl) | 1990-09-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH653989A5 (de) | Cyclobutendion-verbindungen. | |
| DE2708751C3 (de) | Verfahren zur Erhöhung der Reaktionsfähigkeit von Perfluorhalogenalkanen | |
| DE1568042A1 (de) | Verfahren zur Herstellung von fluorierten AEthern | |
| DE69010257T2 (de) | Verfahren zur Herstellung N-substituierter Maleimide. | |
| DE2756169C2 (de) | Verfahren zur Herstellung von Perfluorcarbonsäuren oder Perfluoralkansulfonylchloriden | |
| DE60206136T2 (de) | Verfahren zur herstellung von hydroxy-peroxyestern | |
| DE4016071A1 (de) | Stickstoffhaltige polyfluoralkylverbindungen, ihre herstellungsverfahren und ihre verwendung | |
| DE1947264C3 (de) | Phosphorsäurepolycarboxytriphenylester und Verfahren zu deren Herstellung | |
| CH424759A (de) | Verfahren zur Herstellung von Sulfoniumverbindungen | |
| DE69326050T2 (de) | Verfahren zur Herstellung von 0,0'-Diacylweinsäureanhydrid und Verfahren zur Herstellung von 0,0'-Diacylweinsäure | |
| DE2259239A1 (de) | Verfahren zur herstellung von 2alkoxy-5-alkylsulfonyl-benzoesaeure | |
| DE2627985B2 (de) | 4-Homoisotwistan-3-carbonsäureester und Verfahren zu ihrer Herstellung | |
| DE3781774T2 (de) | Verfahren zur herstellung von fluorhaltigen carbonsaeureestern. | |
| DE1618986C3 (de) | Verfahren zur Herstellung von chlorierten aromatischen Nitrilen | |
| DE69127687T2 (de) | Verfahren zur Herstellung von Nepinolon | |
| DE2115944B2 (de) | Verfahren zur herstellung von o-sulfobenzimiden | |
| DE2616612C2 (de) | Verfahren zur Herstellung von Chlorsulfonylbenzoylchlorid | |
| CH624668A5 (enExample) | ||
| AT212305B (de) | Verfahren zur Herstellung von neuen Carbonsäureestern des 4, 6-Dinitro-2-sek. butylphenols | |
| DE1178085B (de) | Verfahren zur Herstellung von 2,3,5,6-Tetra-cyan-1,4-dithiin | |
| DE2308941C3 (de) | Verfahren zur Herstellung von Oxamid | |
| AT253488B (de) | Verfahren zur Herstellung von 2-Methyl-4-chlorphenoxyalkansäuren | |
| AT228802B (de) | Verfahren zur Herstellung des neuen O, O-Dimethyl-O-(3-methyl-4-nitro-phenyl)-thionophosphorsäureesters | |
| DE2530901A1 (de) | Verfahren zur herstellung von beta-isopropylnaphthalinhydroperoxid | |
| DE1618913C (de) | Verfahren zur Herstellung von Alkylthioaldoximen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |