DE2525778C2 - - Google Patents
Info
- Publication number
- DE2525778C2 DE2525778C2 DE2525778A DE2525778A DE2525778C2 DE 2525778 C2 DE2525778 C2 DE 2525778C2 DE 2525778 A DE2525778 A DE 2525778A DE 2525778 A DE2525778 A DE 2525778A DE 2525778 C2 DE2525778 C2 DE 2525778C2
- Authority
- DE
- Germany
- Prior art keywords
- sodium
- ion exchange
- water
- weight percent
- preparation according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 229910000323 aluminium silicate Inorganic materials 0.000 claims description 86
- 239000003599 detergent Substances 0.000 claims description 71
- 239000000203 mixture Substances 0.000 claims description 66
- 238000002360 preparation method Methods 0.000 claims description 63
- 239000000463 material Substances 0.000 claims description 59
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 58
- 238000005342 ion exchange Methods 0.000 claims description 58
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 claims description 57
- 125000004432 carbon atom Chemical group C* 0.000 claims description 36
- 239000011734 sodium Substances 0.000 claims description 35
- 229910052708 sodium Inorganic materials 0.000 claims description 33
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 29
- 239000000377 silicon dioxide Substances 0.000 claims description 29
- 229910052681 coesite Inorganic materials 0.000 claims description 28
- 229910052906 cristobalite Inorganic materials 0.000 claims description 28
- 235000012239 silicon dioxide Nutrition 0.000 claims description 28
- 229910052682 stishovite Inorganic materials 0.000 claims description 28
- 229910052905 tridymite Inorganic materials 0.000 claims description 28
- 239000007787 solid Substances 0.000 claims description 27
- 239000012459 cleaning agent Substances 0.000 claims description 19
- -1 alkyl ether sulfate Chemical class 0.000 claims description 18
- 239000002245 particle Substances 0.000 claims description 18
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 17
- 125000000217 alkyl group Chemical group 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 16
- 229910001424 calcium ion Inorganic materials 0.000 claims description 13
- BHPQYMZQTOCNFJ-UHFFFAOYSA-N Calcium cation Chemical group [Ca+2] BHPQYMZQTOCNFJ-UHFFFAOYSA-N 0.000 claims description 12
- 239000004094 surface-active agent Substances 0.000 claims description 12
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 claims description 10
- 238000007046 ethoxylation reaction Methods 0.000 claims description 8
- 239000000344 soap Substances 0.000 claims description 7
- 235000011180 diphosphates Nutrition 0.000 claims description 6
- 229910021645 metal ion Inorganic materials 0.000 claims description 6
- 235000019832 sodium triphosphate Nutrition 0.000 claims description 6
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 5
- 229910000272 alkali metal oxide Inorganic materials 0.000 claims description 5
- 125000000129 anionic group Chemical group 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 5
- 235000010216 calcium carbonate Nutrition 0.000 claims description 5
- 229910000019 calcium carbonate Inorganic materials 0.000 claims description 5
- DZCAZXAJPZCSCU-UHFFFAOYSA-K sodium nitrilotriacetate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CC([O-])=O DZCAZXAJPZCSCU-UHFFFAOYSA-K 0.000 claims description 4
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 3
- 239000001509 sodium citrate Substances 0.000 claims description 3
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 claims description 3
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 claims description 3
- 229940048086 sodium pyrophosphate Drugs 0.000 claims description 3
- 235000019818 tetrasodium diphosphate Nutrition 0.000 claims description 3
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 claims description 3
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims description 2
- IFTMCARQCOKBFG-UHFFFAOYSA-H [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)c1c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c1C([O-])=O Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)c1c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c(C([O-])=O)c1C([O-])=O IFTMCARQCOKBFG-UHFFFAOYSA-H 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-J diphosphate(4-) Chemical compound [O-]P([O-])(=O)OP([O-])([O-])=O XPPKVPWEQAFLFU-UHFFFAOYSA-J 0.000 claims description 2
- 229940048084 pyrophosphate Drugs 0.000 claims description 2
- 235000017550 sodium carbonate Nutrition 0.000 claims description 2
- KKCBUQHMOMHUOY-UHFFFAOYSA-N sodium oxide Chemical compound [O-2].[Na+].[Na+] KKCBUQHMOMHUOY-UHFFFAOYSA-N 0.000 claims description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 2
- 238000005987 sulfurization reaction Methods 0.000 claims description 2
- XGMYMWYPSYIPQB-UHFFFAOYSA-J tetrasodium;2-(1,2-dicarboxylatoethoxy)butanedioate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CC(C([O-])=O)OC(C([O-])=O)CC([O-])=O XGMYMWYPSYIPQB-UHFFFAOYSA-J 0.000 claims description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 claims 1
- BNVZBQVIMPLFNA-UHFFFAOYSA-L disodium;2-(carboxymethoxy)butanedioate Chemical compound [Na+].[Na+].OC(=O)COC(C([O-])=O)CC([O-])=O BNVZBQVIMPLFNA-UHFFFAOYSA-L 0.000 claims 1
- NPCCEUVRYRJOLM-UHFFFAOYSA-L disodium;2-(carboxymethoxy)propanedioate Chemical compound [Na+].[Na+].OC(=O)COC(C([O-])=O)C([O-])=O NPCCEUVRYRJOLM-UHFFFAOYSA-L 0.000 claims 1
- 229960001553 phloroglucinol Drugs 0.000 claims 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 claims 1
- CHWRSCGUEQEHOH-UHFFFAOYSA-N potassium oxide Chemical compound [O-2].[K+].[K+] CHWRSCGUEQEHOH-UHFFFAOYSA-N 0.000 claims 1
- 229910001950 potassium oxide Inorganic materials 0.000 claims 1
- 235000011083 sodium citrates Nutrition 0.000 claims 1
- 229910001948 sodium oxide Inorganic materials 0.000 claims 1
- UEUXEKPTXMALOB-UHFFFAOYSA-J tetrasodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O UEUXEKPTXMALOB-UHFFFAOYSA-J 0.000 claims 1
- 229910009112 xH2O Inorganic materials 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 39
- 229910001868 water Inorganic materials 0.000 description 37
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 30
- 238000000034 method Methods 0.000 description 30
- 238000005406 washing Methods 0.000 description 25
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 19
- 238000009472 formulation Methods 0.000 description 16
- 239000000047 product Substances 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 150000002500 ions Chemical class 0.000 description 11
- 229910001388 sodium aluminate Inorganic materials 0.000 description 11
- 239000003760 tallow Substances 0.000 description 11
- 239000007859 condensation product Substances 0.000 description 9
- 238000005260 corrosion Methods 0.000 description 9
- 230000007797 corrosion Effects 0.000 description 9
- 229910052700 potassium Inorganic materials 0.000 description 9
- 239000011591 potassium Substances 0.000 description 9
- 238000001556 precipitation Methods 0.000 description 9
- 230000008569 process Effects 0.000 description 9
- 239000004753 textile Substances 0.000 description 9
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 8
- 239000011575 calcium Substances 0.000 description 8
- 150000001768 cations Chemical class 0.000 description 8
- 238000004140 cleaning Methods 0.000 description 8
- 159000000001 potassium salts Chemical class 0.000 description 8
- 150000004760 silicates Chemical class 0.000 description 8
- 229910052911 sodium silicate Inorganic materials 0.000 description 8
- 239000010457 zeolite Substances 0.000 description 8
- 239000004115 Sodium Silicate Substances 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 235000014113 dietary fatty acids Nutrition 0.000 description 7
- 239000000194 fatty acid Substances 0.000 description 7
- 229930195729 fatty acid Natural products 0.000 description 7
- 150000004665 fatty acids Chemical class 0.000 description 7
- 150000002191 fatty alcohols Chemical class 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 239000003513 alkali Substances 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- 239000008187 granular material Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 5
- 229910019142 PO4 Inorganic materials 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 125000001931 aliphatic group Chemical group 0.000 description 5
- 239000003795 chemical substances by application Substances 0.000 description 5
- 239000004744 fabric Substances 0.000 description 5
- 239000004615 ingredient Substances 0.000 description 5
- 239000003112 inhibitor Substances 0.000 description 5
- 235000021317 phosphate Nutrition 0.000 description 5
- 229920005646 polycarboxylate Polymers 0.000 description 5
- 239000000271 synthetic detergent Substances 0.000 description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 4
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 4
- 230000008901 benefit Effects 0.000 description 4
- 229910052791 calcium Inorganic materials 0.000 description 4
- 230000008021 deposition Effects 0.000 description 4
- 239000012065 filter cake Substances 0.000 description 4
- 230000002209 hydrophobic effect Effects 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- JLVVSXFLKOJNIY-UHFFFAOYSA-N Magnesium ion Chemical compound [Mg+2] JLVVSXFLKOJNIY-UHFFFAOYSA-N 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 238000002441 X-ray diffraction Methods 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 3
- 238000010936 aqueous wash Methods 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 150000007942 carboxylates Chemical class 0.000 description 3
- 238000005341 cation exchange Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 229940096386 coconut alcohol Drugs 0.000 description 3
- 235000019864 coconut oil Nutrition 0.000 description 3
- 239000003240 coconut oil Substances 0.000 description 3
- 238000002425 crystallisation Methods 0.000 description 3
- 230000008025 crystallization Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000005755 formation reaction Methods 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 229910001425 magnesium ion Inorganic materials 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 235000019795 sodium metasilicate Nutrition 0.000 description 3
- 235000019351 sodium silicates Nutrition 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 2
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 2
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical class OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 2
- 102000004190 Enzymes Human genes 0.000 description 2
- 108090000790 Enzymes Proteins 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- 229910021536 Zeolite Inorganic materials 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001335 aliphatic alkanes Chemical group 0.000 description 2
- 150000008051 alkyl sulfates Chemical class 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- YDSWCNNOKPMOTP-UHFFFAOYSA-N mellitic acid Chemical compound OC(=O)C1=C(C(O)=O)C(C(O)=O)=C(C(O)=O)C(C(O)=O)=C1C(O)=O YDSWCNNOKPMOTP-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002808 molecular sieve Substances 0.000 description 2
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical class OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 231100000572 poisoning Toxicity 0.000 description 2
- 230000000607 poisoning effect Effects 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 235000019353 potassium silicate Nutrition 0.000 description 2
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000001694 spray drying Methods 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000001124 (E)-prop-1-ene-1,2,3-tricarboxylic acid Substances 0.000 description 1
- CIOXZGOUEYHNBF-UHFFFAOYSA-N (carboxymethoxy)succinic acid Chemical class OC(=O)COC(C(O)=O)CC(O)=O CIOXZGOUEYHNBF-UHFFFAOYSA-N 0.000 description 1
- SFRLSTJPMFGBDP-UHFFFAOYSA-N 1,2-diphosphonoethylphosphonic acid Chemical class OP(O)(=O)CC(P(O)(O)=O)P(O)(O)=O SFRLSTJPMFGBDP-UHFFFAOYSA-N 0.000 description 1
- XHWHHMNORMIBBB-UHFFFAOYSA-N 2,2,3,3-tetrahydroxybutanedioic acid Chemical compound OC(=O)C(O)(O)C(O)(O)C(O)=O XHWHHMNORMIBBB-UHFFFAOYSA-N 0.000 description 1
- JAHNSTQSQJOJLO-UHFFFAOYSA-N 2-(3-fluorophenyl)-1h-imidazole Chemical compound FC1=CC=CC(C=2NC=CN=2)=C1 JAHNSTQSQJOJLO-UHFFFAOYSA-N 0.000 description 1
- LVVZBNKWTVZSIU-UHFFFAOYSA-N 2-(carboxymethoxy)propanedioic acid Chemical class OC(=O)COC(C(O)=O)C(O)=O LVVZBNKWTVZSIU-UHFFFAOYSA-N 0.000 description 1
- WKVMOQXBMPYPGK-UHFFFAOYSA-N 2-[bis(carboxymethyl)amino]acetic acid;sodium Chemical compound [Na].OC(=O)CN(CC(O)=O)CC(O)=O WKVMOQXBMPYPGK-UHFFFAOYSA-N 0.000 description 1
- PSZAEHPBBUYICS-UHFFFAOYSA-N 2-methylidenepropanedioic acid Chemical compound OC(=O)C(=C)C(O)=O PSZAEHPBBUYICS-UHFFFAOYSA-N 0.000 description 1
- XYJLPCAKKYOLGU-UHFFFAOYSA-N 2-phosphonoethylphosphonic acid Chemical class OP(O)(=O)CCP(O)(O)=O XYJLPCAKKYOLGU-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical class OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229940091181 aconitic acid Drugs 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910001413 alkali metal ion Inorganic materials 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000004645 aluminates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 230000003185 calcium uptake Effects 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- GTZCVFVGUGFEME-IWQZZHSRSA-N cis-aconitic acid Chemical compound OC(=O)C\C(C(O)=O)=C\C(O)=O GTZCVFVGUGFEME-IWQZZHSRSA-N 0.000 description 1
- HNEGQIOMVPPMNR-IHWYPQMZSA-N citraconic acid Chemical compound OC(=O)C(/C)=C\C(O)=O HNEGQIOMVPPMNR-IHWYPQMZSA-N 0.000 description 1
- 229940018557 citraconic acid Drugs 0.000 description 1
- 239000002734 clay mineral Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 230000001276 controlling effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001236 detergent effect Effects 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 230000003467 diminishing effect Effects 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- XWENCHGJOCJZQO-UHFFFAOYSA-N ethane-1,1,2,2-tetracarboxylic acid Chemical compound OC(=O)C(C(O)=O)C(C(O)=O)C(O)=O XWENCHGJOCJZQO-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 235000019197 fats Nutrition 0.000 description 1
- 125000005313 fatty acid group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000021588 free fatty acids Nutrition 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 229960002598 fumaric acid Drugs 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000008233 hard water Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052806 inorganic carbonate Inorganic materials 0.000 description 1
- 229910010272 inorganic material Inorganic materials 0.000 description 1
- 239000011147 inorganic material Substances 0.000 description 1
- 229910052816 inorganic phosphate Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000002366 lipolytic effect Effects 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 238000011177 media preparation Methods 0.000 description 1
- HNEGQIOMVPPMNR-NSCUHMNNSA-N mesaconic acid Chemical compound OC(=O)C(/C)=C/C(O)=O HNEGQIOMVPPMNR-NSCUHMNNSA-N 0.000 description 1
- LVHBHZANLOWSRM-UHFFFAOYSA-N methylenebutanedioic acid Natural products OC(=O)CC(=C)C(O)=O LVHBHZANLOWSRM-UHFFFAOYSA-N 0.000 description 1
- HNEGQIOMVPPMNR-UHFFFAOYSA-N methylfumaric acid Natural products OC(=O)C(C)=CC(O)=O HNEGQIOMVPPMNR-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 230000009972 noncorrosive effect Effects 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- AUONHKJOIZSQGR-UHFFFAOYSA-N oxophosphane Chemical compound P=O AUONHKJOIZSQGR-UHFFFAOYSA-N 0.000 description 1
- MIVZUXGHPJSKRI-UHFFFAOYSA-N pentane-1,1,1,2-tetracarboxylic acid Chemical compound CCCC(C(O)=O)C(C(O)=O)(C(O)=O)C(O)=O MIVZUXGHPJSKRI-UHFFFAOYSA-N 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 125000005342 perphosphate group Chemical group 0.000 description 1
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000634 powder X-ray diffraction Methods 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000002797 proteolythic effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 238000009666 routine test Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000004626 scanning electron microscopy Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 239000010865 sewage Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 239000008234 soft water Substances 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 239000002195 soluble material Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003890 succinate salts Chemical class 0.000 description 1
- 230000001180 sulfating effect Effects 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- GTZCVFVGUGFEME-UHFFFAOYSA-N trans-aconitic acid Natural products OC(=O)CC(C(O)=O)=CC(O)=O GTZCVFVGUGFEME-UHFFFAOYSA-N 0.000 description 1
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical class [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/04—Water-soluble compounds
- C11D3/08—Silicates
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/02—Inorganic compounds ; Elemental compounds
- C11D3/12—Water-insoluble compounds
- C11D3/124—Silicon containing, e.g. silica, silex, quartz or glass beads
- C11D3/1246—Silicates, e.g. diatomaceous earth
- C11D3/128—Aluminium silicates, e.g. zeolites
Landscapes
- Chemical & Material Sciences (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/479,951 US3985669A (en) | 1974-06-17 | 1974-06-17 | Detergent compositions |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2525778A1 DE2525778A1 (de) | 1976-01-02 |
| DE2525778C2 true DE2525778C2 (show.php) | 1991-05-29 |
Family
ID=23906083
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752525778 Granted DE2525778A1 (de) | 1974-06-17 | 1975-06-10 | Reinigungsmittelzubereitungen |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3985669A (show.php) |
| JP (1) | JPS6052194B2 (show.php) |
| AT (1) | AT356787B (show.php) |
| BE (1) | BE830268A (show.php) |
| BR (1) | BR7503776A (show.php) |
| CA (1) | CA1036889A (show.php) |
| CH (1) | CH615458A5 (show.php) |
| DE (1) | DE2525778A1 (show.php) |
| FI (1) | FI59612C (show.php) |
| FR (1) | FR2274683A1 (show.php) |
| GB (1) | GB1501498A (show.php) |
| IE (1) | IE41560B1 (show.php) |
| IT (1) | IT1039019B (show.php) |
| NL (1) | NL172080C (show.php) |
| PH (1) | PH11286A (show.php) |
| SE (1) | SE418406B (show.php) |
Families Citing this family (144)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4083793A (en) * | 1973-05-23 | 1978-04-11 | Henkel Kommanditgesellschaft Auf Aktien | Washing compositions containing aluminosilicates and nonionics and method of washing textiles |
| US4136051A (en) * | 1974-02-25 | 1979-01-23 | Henkel Kommanditgesellschaft Auf Aktien (Henkel Kgaa) | Pourable washing compositions containing a luminosilicates and non-ionics and method for their preparation |
| US4610796A (en) * | 1974-09-06 | 1986-09-09 | The Colgate-Palmolive Co. | Fabric softener composition containing molecular sieve zeolite |
| US4427410A (en) | 1974-09-06 | 1984-01-24 | Colgate-Palmolive Company | Fabric softening composition containing molecular sieve zeolite |
| AT335035B (de) | 1974-10-10 | 1977-02-25 | Henkel & Cie Gmbh | Stabile suspensionen wasserunloslicher, zum binden von calciumionen befahigter silikate und deren verwendung zur herstellung von wasch- und reinigungsmitteln |
| US4169075A (en) * | 1974-10-10 | 1979-09-25 | Henkel Kommanditgesellschaft Auf Aktien | Process for the production of powdery washing agents by spray-drying |
| GB1516848A (en) * | 1974-11-13 | 1978-07-05 | Procter & Gamble Ltd | Detergent composition |
| US4066394A (en) * | 1974-12-30 | 1978-01-03 | Colgate-Palmolive | Reusable zeolite water softener for clothes washing |
| DE2514399C2 (de) * | 1975-04-02 | 1987-01-29 | Degussa Ag, 6000 Frankfurt | Verfahren zur Herstellung von Aluminiumsilikaten |
| DE2517218B2 (de) * | 1975-04-18 | 1977-05-05 | Henkel & Cie GmbH, 4000 Düsseldorf; Deutsche Gold- und Silber-Scheideanstalt vormals Roessler, 6000 Frankfurt | Kristallines zeolithpulver des typs a |
| US4019999A (en) * | 1975-07-23 | 1977-04-26 | The Procter & Gamble Co. | Spray-dried granular detergent containing aluminosilicate, silicate, and pyrophosphate |
| US4041135A (en) * | 1975-07-25 | 1977-08-09 | J. M. Huber Corporation | Production of high capacity inorganic crystalline base exchange materials |
| US4102977A (en) * | 1975-11-18 | 1978-07-25 | Mizusawa Kagaku Kogyo Kabushiki Kaisha | Process for the preparation of alkali aluminosilicate detergent builder |
| JPS5262315A (en) * | 1975-11-18 | 1977-05-23 | Mizusawa Industrial Chem | Detergent composition |
| ZA767170B (en) * | 1975-12-15 | 1978-07-26 | Colgate Palmolive Co | Detergent composition and method for use |
| ZA767282B (en) * | 1975-12-15 | 1978-07-26 | Colgate Palmolive Co | Laundry detergent composition and use |
| JPS52112610A (en) * | 1976-03-19 | 1977-09-21 | Mizusawa Industrial Chem | Detergent builder composition |
| US4414130A (en) * | 1976-08-17 | 1983-11-08 | Colgate Palmolive Company | Readily disintegrable agglomerates of insoluble detergent builders and detergent compositions containing them |
| US4075280A (en) * | 1976-09-28 | 1978-02-21 | J. M. Huber Corporation | Preparation of improved zeolites |
| DE2650278A1 (de) * | 1976-11-02 | 1978-05-03 | Henkel Kgaa | Verfahren zum maschinellen waschen und reinigen von festen werkstoffen unter verwendung phosphatarmer oder phosphatfreier wasch- und reinigungsmittel |
| DE2651419A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iv |
| DE2651437A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a vi |
| DE2651485A1 (de) * | 1976-11-11 | 1978-05-24 | Degussa | Kristallines zeolithpulver des typs a i |
| DE2651436A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a iii |
| DE2651420A1 (de) * | 1976-11-11 | 1978-05-18 | Degussa | Kristallines zeolithpulver des typs a v |
| JPS5371111A (en) * | 1976-12-06 | 1978-06-24 | Kao Corp | Detergent composition |
| US4409136A (en) * | 1977-01-31 | 1983-10-11 | Colgate Palmolive Company | Molecular sieve zeolite-built detergent paste |
| DE2705088C2 (de) * | 1977-02-08 | 1986-05-22 | Kali-Chemie Ag, 3000 Hannover | Verfahren zur Herstellung von überwiegend kristallinen Natriumaluminiumsilikaten |
| US4269725A (en) * | 1977-04-21 | 1981-05-26 | Laporte Industries Limited | Washing compositions |
| FR2392932A1 (fr) * | 1977-06-03 | 1978-12-29 | Rhone Poulenc Ind | Procede de fabrication d'un silico-aluminate alcalin cristallin, produit obtenu et application |
| US4094778A (en) * | 1977-06-27 | 1978-06-13 | Union Carbide Corporation | Sequestering of CA++ and MG++ in aqueous media using zeolite mixtures |
| DE2734296A1 (de) * | 1977-07-29 | 1979-02-08 | Degussa | Verfahren zur herstellung von feinteiligen, zum kationenaustausch befaehigten wasserunloeslichen silikaten |
| US4399048A (en) * | 1977-10-06 | 1983-08-16 | Colgate-Palmolive Company | High bulk density particulate heavy duty laundry detergent |
| US4264464A (en) * | 1977-10-06 | 1981-04-28 | Colgate-Palmolive Company | High bulk density particulate heavy duty laundry detergent |
| US4406808A (en) * | 1977-10-06 | 1983-09-27 | Colgate-Palmolive Company | High bulk density carbonate-zeolite built heavy duty nonionic laundry detergent |
| NZ188469A (en) * | 1977-10-06 | 1980-12-19 | Colgate Palmolive Co | Detergent composition comprising a univalent cation-exchanging zeolite a nonionic detergent and builder salts |
| US4180485A (en) * | 1977-11-02 | 1979-12-25 | The Procter & Gamble Company | Spray-dried detergent compositions |
| US4303556A (en) * | 1977-11-02 | 1981-12-01 | The Procter & Gamble Company | Spray-dried detergent compositions |
| DE2751354A1 (de) * | 1977-11-17 | 1979-05-23 | Hoechst Ag | Verfahren zur herstellung von gemischen aus kristallinem zeolith und natriumtriphosphat |
| DE2902236A1 (de) * | 1978-01-25 | 1979-07-26 | Kao Corp | Bleichmittelmischung |
| US4576986A (en) * | 1978-01-31 | 1986-03-18 | J. M. Huber Corporation | Rubber compositions containing small particle size zeolites and mixtures |
| DE2903058A1 (de) * | 1978-02-01 | 1979-08-09 | Unilever Nv | Verfahren zur herstellung von waschmittelpulver |
| US4288342A (en) * | 1978-03-03 | 1981-09-08 | J. M. Huber Corporation | Inorganic water-softening bead |
| DE2844455A1 (de) * | 1978-10-12 | 1980-04-24 | Henkel Kgaa | Phosphatfreies waschmittel und verfahren zu dessen herstellung |
| US4240919A (en) * | 1978-11-29 | 1980-12-23 | S. C. Johnson & Son, Inc. | Thixotropic abrasive liquid scouring composition |
| US4216125A (en) * | 1978-12-07 | 1980-08-05 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| US4888378A (en) * | 1978-12-20 | 1989-12-19 | J. M. Huber Corporation | Plastic compositions containing small particle size zeolites and mixtures |
| US4612342A (en) * | 1978-12-20 | 1986-09-16 | J. M. Huber Corporation | Rubber compositions containing small particle size zeolites |
| IT1165442B (it) * | 1979-01-26 | 1987-04-22 | Montedison Spa | Zeoliti di tipo a,ad elevato grado di cristallinita' e a granulometria fine e processo per la loro produzione |
| DE2907108A1 (de) * | 1979-02-23 | 1980-09-04 | Basf Ag | Verfahren zur herstellung lagerstabiler, pumpbarer und fliessfaehiger alumosilikat-suspensionen durch nassvermahlung |
| US4415489A (en) * | 1979-04-06 | 1983-11-15 | Colgate Palmolive Company | Process for making high solids content zeolite A-alkylbenzene sulfonate compositions suitable for use in making spray dried detergent compositions |
| US4243545A (en) * | 1979-12-10 | 1981-01-06 | Pq Corporation | Detergent compositions with silane-zeolite silicate builder |
| JPS5919597B2 (ja) * | 1980-04-23 | 1984-05-07 | ライオン株式会社 | ゼオライト含有無燐粒状洗剤組成物 |
| US4308151A (en) * | 1980-05-12 | 1981-12-29 | The Procter & Gamble Company | Detergent-compatible fabric softening and antistatic compositions |
| DE3169193D1 (en) * | 1980-10-29 | 1985-04-11 | Procter & Gamble | Aluminosilicate-agglomerates and detergent compositions containing them |
| US4343713A (en) * | 1980-10-29 | 1982-08-10 | The Procter & Gamble Company | Particulate composition |
| US4462804A (en) * | 1980-11-26 | 1984-07-31 | Colgate Palmolive Company | High bulk density particulate heavy duty laundry detergent |
| US5080820A (en) * | 1981-02-26 | 1992-01-14 | Colgate-Palmolive Co. | Spray dried base beads for detergent compositions containing zeolite, bentonite and polyphosphate |
| US5024778A (en) * | 1981-02-26 | 1991-06-18 | Colgate-Palmolive Company | Spray dried base beads for detergent compositions containing zeolite, bentonite and polyphosphate |
| PH20653A (en) * | 1981-03-23 | 1987-03-16 | Unilever Nv | Process for preparing low silicate detergent compositions |
| US4344871A (en) * | 1981-03-23 | 1982-08-17 | The Procter & Gamble Company | Spray-dried aluminosilicate detergents containing silicate and metaborate |
| US4379080A (en) * | 1981-04-22 | 1983-04-05 | The Procter & Gamble Company | Granular detergent compositions containing film-forming polymers |
| US4404128A (en) * | 1981-05-29 | 1983-09-13 | The Procter & Gamble Company | Enzyme detergent composition |
| NZ201212A (en) * | 1981-07-15 | 1985-08-16 | Unilever Plc | Detergent additives and compositions |
| NZ201211A (en) * | 1981-07-15 | 1985-08-16 | Unilever Plc | Detergent additives and compositions |
| DE3144298A1 (de) * | 1981-11-07 | 1983-05-19 | Degussa Ag, 6000 Frankfurt | Scheuerpulver |
| DE3151536A1 (de) * | 1981-12-28 | 1983-07-07 | Henkel KGaA, 4000 Düsseldorf | Starkschaeumendes, koerniges waschmittel mit erhoehter kornstabilitaet und verfahren zu dessen herstellung |
| EP0087035B1 (en) * | 1982-02-08 | 1985-09-11 | Union Carbide Corporation | Zeolite-containing detergent compositions and process for preparing same |
| US4457854A (en) * | 1982-06-04 | 1984-07-03 | Colgate Palmolive Company | High bulk density carbonate-zeolite built heavy duty nonionic laundry detergent |
| DE3472571D1 (en) * | 1983-08-27 | 1988-08-11 | Procter & Gamble | Detergent compositions |
| GB2152041B (en) | 1983-12-22 | 1987-11-11 | Procter & Gamble | X-substituted derivatives of carboxylic acids used as peroxygen bleach activators |
| US4743394A (en) * | 1984-03-23 | 1988-05-10 | Kaufmann Edward J | Concentrated non-phosphate detergent paste compositions |
| DE3504451A1 (de) * | 1985-02-09 | 1986-08-14 | Degussa Ag, 6000 Frankfurt | Waschmittelbuilder |
| CA1286563C (en) * | 1986-04-04 | 1991-07-23 | Jan Hendrik Eertink | Detergent powders and processes for preparing them |
| DE3620009A1 (de) * | 1986-06-13 | 1987-12-17 | Henkel Kgaa | Koernig agglomerierte natriummetasilikat enthaltende reinigungsmittel, verfahren zu ihrer herstellung und ihrer verwendung |
| CA1314186C (en) * | 1988-04-29 | 1993-03-09 | Frederik Jan Schepers | Liquid cleaning products |
| US5104568A (en) * | 1990-06-18 | 1992-04-14 | The Procter & Gamble Company | Granular detergent compositions built with 2,2'-oxodisuccinate and zeolite a, process to make same, and agglomerated detergency builder |
| US5194639A (en) * | 1990-09-28 | 1993-03-16 | The Procter & Gamble Company | Preparation of polyhydroxy fatty acid amides in the presence of solvents |
| BR9106895A (pt) * | 1990-09-28 | 1993-07-20 | Procter & Gamble | Processo com alto catalisador para detergentes de glucamida |
| BR9106910A (pt) * | 1990-09-28 | 1993-08-24 | Procter & Gamble | Processo catalisado aperfeicoado para detergentes de glucamida |
| DE69105520T2 (de) * | 1990-09-28 | 1995-06-08 | Procter & Gamble | Phase-transfer-verfahren für glucamiddetergentien. |
| BR9106912A (pt) * | 1990-09-28 | 1993-07-20 | Procter & Gamble | Amidas de acidos graxos polihidroxi em composicoes detergentes contendo agentes de liberacao de sujeiras |
| DE69115707T2 (de) * | 1990-09-28 | 1996-11-14 | Procter & Gamble | Polyhydroxyfettsäureamid und alkylestersulfonattenside enthaltende waschmittelzusammensetzungen |
| CA2092188C (en) * | 1990-09-28 | 1999-09-28 | Bruce Prentiss Murch | Polyhydroxy fatty acid amide surfactants in bleach-containing detergent compositions |
| US5174927A (en) * | 1990-09-28 | 1992-12-29 | The Procter & Gamble Company | Process for preparing brightener-containing liquid detergent compositions with polyhydroxy fatty acid amines |
| US5254281A (en) * | 1991-01-29 | 1993-10-19 | The Procter & Gamble Company | Soap bars with polyhydroxy fatty acid amides |
| CA2107356C (en) | 1991-05-14 | 2002-09-17 | Elizabeth J. Gladfelter | Two part solid detergent chemical concentrate |
| WO1993003004A1 (en) * | 1991-07-26 | 1993-02-18 | The Procter & Gamble Company | Process for preparing n-alkyl polyhydroxyalkyl amines in aqueous/hydroxy solvents |
| US5449770A (en) * | 1992-01-14 | 1995-09-12 | The Procter & Gamble Company | Process for making N-alkylamino polyols |
| US5427711A (en) * | 1991-12-29 | 1995-06-27 | Kao Corporation | Synthesized inorganic ion exchange material and detergent composition containing the same |
| US5391326A (en) * | 1992-03-16 | 1995-02-21 | Albemarle Corporation | Granular laundry detergent |
| WO1993025647A1 (en) * | 1992-06-15 | 1993-12-23 | The Procter & Gamble Company | Liquid laundry detergent compositions with silicone antifoam agent |
| US5378388A (en) * | 1993-06-25 | 1995-01-03 | The Procter & Gamble Company | Granular detergent compositions containing selected builders in optimum ratios |
| US5354425A (en) * | 1993-12-13 | 1994-10-11 | The Procter & Gamble Company | Tissue paper treated with polyhydroxy fatty acid amide softener systems that are biodegradable |
| US5618783A (en) * | 1994-03-03 | 1997-04-08 | Kao Corporation | Synthesized inorganic ion exchange material and detergent composition containing the same |
| USH1468H (en) | 1994-04-28 | 1995-08-01 | Costa Jill B | Detergent compositions containing cellulase enzyme and selected perfumes for improved odor and stability |
| US5643358A (en) * | 1994-06-10 | 1997-07-01 | Pq Corporation | Crystalline hydrated layered sodium and potassium silicates and method of producing same |
| US5739098A (en) * | 1994-07-05 | 1998-04-14 | Pq Corporation | Crystalline sodium potassium silicates |
| EP0693549A1 (en) | 1994-07-19 | 1996-01-24 | The Procter & Gamble Company | Solid bleach activator compositions |
| GB2297978A (en) | 1995-02-15 | 1996-08-21 | Procter & Gamble | Detergent compositions containing amylase |
| US5777165A (en) * | 1995-06-07 | 1998-07-07 | The Procter & Gamble Company | Process for preparing amides of N-alkyl polyhydroxyalkyl amines |
| US5723673A (en) * | 1995-06-07 | 1998-03-03 | The Procter & Gamble Company | Process for preparing amides of N-alkyl polyhydroxyalkyls |
| US5562866A (en) * | 1995-06-20 | 1996-10-08 | Albemarle Corporation | Formulated branched chain alcohol ether sulfate compounds |
| EP0753571A1 (en) | 1995-07-10 | 1997-01-15 | The Procter & Gamble Company | Process for making granular detergent composition |
| ES2202343T3 (es) | 1995-09-18 | 2004-04-01 | THE PROCTER & GAMBLE COMPANY | Procedimiento para preparar detergentes en granulos. |
| PT771785E (pt) | 1995-11-02 | 2002-06-28 | Procter & Gamble | Compostos aminoester de alcoois perfumados e seu uso em composicoes de limpeza ou lavandaria |
| EP0778342A1 (en) | 1995-12-06 | 1997-06-11 | The Procter & Gamble Company | Detergent compositions |
| EP0927240A1 (en) | 1996-05-03 | 1999-07-07 | The Procter & Gamble Company | Detergent compositions comprising polyamine polymers with improved soil dispersancy |
| US6150324A (en) | 1997-01-13 | 2000-11-21 | Ecolab, Inc. | Alkaline detergent containing mixed organic and inorganic sequestrants resulting in improved soil removal |
| US6177392B1 (en) * | 1997-01-13 | 2001-01-23 | Ecolab Inc. | Stable solid block detergent composition |
| US6258765B1 (en) | 1997-01-13 | 2001-07-10 | Ecolab Inc. | Binding agent for solid block functional material |
| US6156715A (en) * | 1997-01-13 | 2000-12-05 | Ecolab Inc. | Stable solid block metal protecting warewashing detergent composition |
| DE69910926T2 (de) * | 1998-01-22 | 2004-07-22 | Miz Co., Ltd., Fujisawa | Waschverfahren |
| US6241994B1 (en) | 1998-02-27 | 2001-06-05 | Buckman Laboratories International, Inc. | Solid TCMTB formulations |
| TW523547B (en) * | 1998-10-05 | 2003-03-11 | Miz Co Ltd | Method of producing detergent and the apparatus thereof |
| ATE348869T1 (de) | 1999-07-16 | 2007-01-15 | Procter & Gamble | Mittelseitenkettige tenside und zwitterionische polyamine enthaltende wäschewaschmittelzusammensetzungen |
| US6790814B1 (en) | 1999-12-03 | 2004-09-14 | Procter & Gamble Company | Delivery system having encapsulated porous carrier loaded with additives, particularly detergent additives such as perfumes |
| US6638902B2 (en) | 2001-02-01 | 2003-10-28 | Ecolab Inc. | Stable solid enzyme compositions and methods employing them |
| US20020183226A1 (en) * | 2001-02-28 | 2002-12-05 | Chandrika Kasturi | Liquid detergent composition exhibiting enhanced alpha-amylase enzyme stability |
| EP1239025A3 (de) | 2001-03-03 | 2003-09-03 | Clariant GmbH | Waschmittel und Wäschebehandlungsmittel enthaltend farbübertragungsinhibierend Farbfixiermittel |
| DE10150724A1 (de) | 2001-03-03 | 2003-04-17 | Clariant Gmbh | Waschmittel und Wäschebehandlungsmittel enthaltend ein oder mehrere farbübertragungsinhibierende Farbfixiermittel |
| US6632291B2 (en) | 2001-03-23 | 2003-10-14 | Ecolab Inc. | Methods and compositions for cleaning, rinsing, and antimicrobial treatment of medical equipment |
| US7125833B2 (en) * | 2003-03-24 | 2006-10-24 | Wacker Chemie Ag | Cyclodextrin laundry detergent additive complexes and compositions containing same |
| DE102004029310A1 (de) * | 2004-06-17 | 2005-12-29 | Clariant Gmbh | Hochkonzentrierte, wässrige Formulierungen von Oligo-und Polyestern |
| DE102005061058A1 (de) * | 2005-12-21 | 2007-07-05 | Clariant Produkte (Deutschland) Gmbh | Anionische Soil Release Polymere |
| DE102007013217A1 (de) | 2007-03-15 | 2008-09-18 | Clariant International Ltd. | Anionische Soil Release Polymere |
| US20090253612A1 (en) * | 2008-04-02 | 2009-10-08 | Symrise Gmbh & Co Kg | Particles having a high load of fragrance or flavor oil |
| DE102008023803A1 (de) | 2008-05-15 | 2009-11-26 | Clariant International Ltd. | Additive für Wasch- und Reinigungsmittel |
| US7790664B2 (en) * | 2008-10-27 | 2010-09-07 | The Procter & Gamble Company | Methods for making a nil-phosphate liquid automatic dishwashing composition |
| US8871703B2 (en) | 2009-11-27 | 2014-10-28 | Clariant Finance (Bvi) Limited | Polyester concentrates having high stability in solution and having a greying-inhibiting effect |
| EP2504380B1 (de) | 2009-11-27 | 2014-08-13 | Clariant Finance (BVI) Limited | Soil release polymere mit vergrauungsinhibierender wirkung und hoher lösungsstabilität |
| CN102939367A (zh) | 2010-05-14 | 2013-02-20 | 太阳产品公司 | 含聚合物的清洁组合物及其生产方法和用途 |
| DE102010023790A1 (de) | 2010-06-15 | 2011-12-15 | Heinrich-Heine-Universität Düsseldorf | Waschaktive Zusammensetzung |
| WO2012117024A1 (de) | 2011-03-01 | 2012-09-07 | Basf Se | Farbübertragungsinhibierend wirkende polymere mit verbesserter lagerstabilität und verarbeitbarkeit für wasch- und reinigungsmittel |
| WO2012117030A1 (de) | 2011-03-01 | 2012-09-07 | Basf Se | Carboxylgruppenhaltige polymere mit verbesserter lagerstabilität und verarbeitbarkeit |
| CN103649017B (zh) | 2011-06-29 | 2016-08-24 | 巴斯夫欧洲公司 | 具有提高的储存稳定性和加工性的改性氨基羧酸化物 |
| US9403731B2 (en) | 2011-06-29 | 2016-08-02 | Basf Se | Modified aminocarboxylates with improved storage stability and processability |
| GB201406268D0 (en) * | 2014-04-08 | 2014-05-21 | Pq Silicas Uk Ltd | Particulate zeolite composition |
| EP3282003B1 (en) | 2016-08-09 | 2020-09-02 | Takasago International Corporation | Solid composition comprising free and encapsulated fragrances |
| DE102016223588A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in reinigungsmittel-zusammensetzungen |
| DE102016223590A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymer enthaltende reinigungsmittelzusammensetzungen |
| DE102016223584A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymer enthaltende waschmittelzusammensetzungen |
| DE102016223586A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in reinigungsmittel-zusammensetzungen |
| DE102016223585A1 (de) | 2016-11-28 | 2018-05-30 | Clariant International Ltd | Copolymere und deren verwendung in waschmittel-zusammensetzungen |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2882243A (en) * | 1953-12-24 | 1959-04-14 | Union Carbide Corp | Molecular sieve adsorbents |
| DK359362A (show.php) * | 1961-08-07 | |||
| US3112176A (en) * | 1961-10-04 | 1963-11-26 | Minerals & Chem Philipp Corp | Base-exchange zeolite and method for making the same |
| ZA670030B (show.php) * | 1966-03-09 | |||
| US3574838A (en) * | 1966-12-28 | 1971-04-13 | Merck & Co Inc | 6-sulfamoyl - 2,3 - dichloroquinoxaline compositions and method of treating gastric hyperacidity |
| FR2105475A5 (show.php) * | 1970-09-02 | 1972-04-28 | Sifrance | |
| DE2055423A1 (en) * | 1970-11-11 | 1972-05-18 | Chemische Fabrik Budenheim, Rudolf A. Oetker, 6501 Budenheim | Washing compositions - containing water-insoluble crosslinked cation -exchange polymers especially crosslinked polystyrene,polyacrylic acid |
| US3812044A (en) * | 1970-12-28 | 1974-05-21 | Procter & Gamble | Detergent composition containing a polyfunctionally-substituted aromatic acid sequestering agent |
| US3783008A (en) * | 1971-05-04 | 1974-01-01 | Philadelphia Quartz Co | Process for preparing coated detergent particles |
| US3755180A (en) * | 1972-02-25 | 1973-08-28 | Colgate Palmolive Co | Means to inhibit overglaze damage by automatic dishwashing detergents |
| US3852211A (en) * | 1972-08-09 | 1974-12-03 | Procter & Gamble | Detergent compositions |
| US3862058A (en) * | 1972-11-10 | 1975-01-21 | Procter & Gamble | Detergent compositions containing a smectite-type clay softening agent |
| AT330930B (de) * | 1973-04-13 | 1976-07-26 | Henkel & Cie Gmbh | Verfahren zur herstellung von festen, schuttfahigen wasch- oder reinigungsmitteln mit einem gehalt an calcium bindenden substanzen |
| DK151231C (da) * | 1973-04-13 | 1988-07-04 | Henkel Kgaa | Fremgangsmaade til rensning, herunder vask, forvask og blegende vask, affaste materialer, isaer tekstiler, samt middel til udoevelse af fremgangsmaaden og fremgamgsmaade til fremstiling af midlet |
| AT375390B (de) * | 1973-05-23 | 1984-07-25 | Henkel Kgaa | Verfahren zum waschen bzw. bleichen von textilien sowie mittel dazu |
| US4605509A (en) | 1973-05-11 | 1986-08-12 | The Procter & Gamble Company | Detergent compositions containing sodium aluminosilicate builders |
-
1974
- 1974-06-17 US US05/479,951 patent/US3985669A/en not_active Expired - Lifetime
-
1975
- 1975-05-26 CA CA227,739A patent/CA1036889A/en not_active Expired
- 1975-06-10 DE DE19752525778 patent/DE2525778A1/de active Granted
- 1975-06-16 IE IE1349/75A patent/IE41560B1/en unknown
- 1975-06-16 BE BE157350A patent/BE830268A/xx not_active IP Right Cessation
- 1975-06-16 IT IT24411/75A patent/IT1039019B/it active
- 1975-06-16 FR FR7518798A patent/FR2274683A1/fr active Granted
- 1975-06-16 CH CH779075A patent/CH615458A5/de not_active IP Right Cessation
- 1975-06-16 NL NLAANVRAGE7507132,A patent/NL172080C/xx not_active IP Right Cessation
- 1975-06-16 GB GB25546/75A patent/GB1501498A/en not_active Expired
- 1975-06-16 PH PH17265A patent/PH11286A/en unknown
- 1975-06-16 AT AT458075A patent/AT356787B/de not_active IP Right Cessation
- 1975-06-16 SE SE7506880A patent/SE418406B/xx not_active IP Right Cessation
- 1975-06-16 FI FI751785A patent/FI59612C/fi not_active IP Right Cessation
- 1975-06-17 JP JP50072754A patent/JPS6052194B2/ja not_active Expired
- 1975-06-17 BR BR4858/75D patent/BR7503776A/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7503776A (pt) | 1976-07-06 |
| ATA458075A (de) | 1979-10-15 |
| DE2525778A1 (de) | 1976-01-02 |
| IE41560L (en) | 1975-12-17 |
| NL172080B (nl) | 1983-02-01 |
| FI751785A7 (show.php) | 1975-12-18 |
| JPS6052194B2 (ja) | 1985-11-18 |
| SE418406B (sv) | 1981-05-25 |
| FR2274683B1 (show.php) | 1977-07-08 |
| GB1501498A (en) | 1978-02-15 |
| JPS5112805A (show.php) | 1976-01-31 |
| US3985669A (en) | 1976-10-12 |
| IT1039019B (it) | 1979-12-10 |
| SE7506880L (sv) | 1975-12-18 |
| AT356787B (de) | 1980-05-27 |
| PH11286A (en) | 1977-11-02 |
| CA1036889A (en) | 1978-08-22 |
| FR2274683A1 (fr) | 1976-01-09 |
| FI59612C (fi) | 1981-09-10 |
| AU8145375A (en) | 1976-11-25 |
| BE830268A (fr) | 1975-12-16 |
| CH615458A5 (show.php) | 1980-01-31 |
| NL172080C (nl) | 1983-07-01 |
| NL7507132A (nl) | 1975-12-19 |
| IE41560B1 (en) | 1980-01-30 |
| FI59612B (fi) | 1981-05-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2525778C2 (show.php) | ||
| AT390447B (de) | Waschmittelzusammensetzung | |
| DE2857300C2 (show.php) | ||
| DE2412837C3 (de) | Mittel zum Waschen bzw. Bleichen von Textilien unter Einsatz kristalliner wasserunlöslicher Silikate, ihre Herstellung und ihre Verwendung | |
| DE2857161C2 (show.php) | ||
| DE2549766C2 (de) | Sprühgetrocknetes Waschmittel | |
| DE69330446T2 (de) | Teilchenförmige Wäscheweichmacher und Reinigungsmittel | |
| DE2632352C2 (de) | Sprühgetrocknete Reinigungsmittelzubereitung | |
| DE2433485A1 (de) | Zur verwendung in waschmitteln geeignete aluminosilikat-ionenaustauscher | |
| DE2857163C2 (show.php) | ||
| AT394203B (de) | Teilchenfoermiges, bleichendes und weichmachendes textilwaschmittel sowie verfahren zur herstellung agglomerierter bentonitteilchen | |
| DE2342461B2 (de) | Reinigungsmittelzusammensetzungen | |
| DE2514676C2 (de) | Waschmittel | |
| DE3717227A1 (de) | Phosphatfreies waschmittel mit reduzierter inkrustierungstendenz | |
| DE2637890C2 (de) | Reinigungsmittel-Zusammensetzung | |
| DE2337266C2 (de) | Weichspülendes teilchenförmiges Grobwaschmittel | |
| DE2701664C2 (show.php) | ||
| DE2857154C2 (show.php) | ||
| DE69032814T2 (de) | Reinigungsverstärkeradditiv und dies enthaltendes Detergentsystem | |
| DE2701663C3 (de) | Waschmittel und Verfahren zu ihrer Herstellung | |
| DE69225449T2 (de) | Waschmittelzusammensetzungen | |
| DE2816770C2 (de) | Gerüststoffhaltiges Textilwaschmittel | |
| DE2544019C3 (show.php) | ||
| EP0460035B1 (de) | Körniges bis pulverförmiges wasserenthärtungsmittel | |
| DE2511677C2 (de) | Fett und Öl entfernendes Mittel sowie Waschmittel, die dieses Fett und Öl entfernende Mittel enthalten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8178 | Suspension cancelled | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |