DE2357079C2 - Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern - Google Patents
Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen CelluloseethernInfo
- Publication number
- DE2357079C2 DE2357079C2 DE2357079A DE2357079A DE2357079C2 DE 2357079 C2 DE2357079 C2 DE 2357079C2 DE 2357079 A DE2357079 A DE 2357079A DE 2357079 A DE2357079 A DE 2357079A DE 2357079 C2 DE2357079 C2 DE 2357079C2
- Authority
- DE
- Germany
- Prior art keywords
- cellulose
- weight
- isopropanol
- hour
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 29
- 238000000034 method Methods 0.000 title claims description 19
- 229920003086 cellulose ether Polymers 0.000 title claims description 14
- 238000004519 manufacturing process Methods 0.000 title description 9
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 104
- 229920002678 cellulose Polymers 0.000 claims description 45
- 239000001913 cellulose Substances 0.000 claims description 45
- 238000004132 cross linking Methods 0.000 claims description 23
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 claims description 20
- 238000006266 etherification reaction Methods 0.000 claims description 20
- 239000003431 cross linking reagent Substances 0.000 claims description 13
- 229960005215 dichloroacetic acid Drugs 0.000 claims description 10
- 239000003513 alkali Substances 0.000 claims description 9
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 claims description 8
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 7
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 7
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 7
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 7
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 7
- 229920003090 carboxymethyl hydroxyethyl cellulose Polymers 0.000 claims description 6
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 claims description 6
- ZIUHHBKFKCYYJD-UHFFFAOYSA-N n,n'-methylenebisacrylamide Chemical compound C=CC(=O)NCNC(=O)C=C ZIUHHBKFKCYYJD-UHFFFAOYSA-N 0.000 claims description 5
- 239000012429 reaction media Substances 0.000 claims description 5
- DPVIABCMTHHTGB-UHFFFAOYSA-N 2,4,6-trichloropyrimidine Chemical compound ClC1=CC(Cl)=NC(Cl)=N1 DPVIABCMTHHTGB-UHFFFAOYSA-N 0.000 claims description 4
- GVBHCMNXRKOJRH-UHFFFAOYSA-N 2,4,5,6-tetrachloropyrimidine Chemical compound ClC1=NC(Cl)=C(Cl)C(Cl)=N1 GVBHCMNXRKOJRH-UHFFFAOYSA-N 0.000 claims description 3
- BJELTSYBAHKXRW-UHFFFAOYSA-N 2,4,6-triallyloxy-1,3,5-triazine Chemical compound C=CCOC1=NC(OCC=C)=NC(OCC=C)=N1 BJELTSYBAHKXRW-UHFFFAOYSA-N 0.000 claims description 3
- 229920001479 Hydroxyethyl methyl cellulose Polymers 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- XAUOLNXWBDOYAI-UHFFFAOYSA-N 2-chloro-n'-prop-2-enoylprop-2-enehydrazide Chemical compound ClC(=C)C(=O)NNC(=O)C=C XAUOLNXWBDOYAI-UHFFFAOYSA-N 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 74
- 239000000243 solution Substances 0.000 description 27
- 239000011734 sodium Substances 0.000 description 12
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 11
- 238000004898 kneading Methods 0.000 description 11
- 239000000047 product Substances 0.000 description 11
- 238000003756 stirring Methods 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 8
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 8
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 8
- 150000003839 salts Chemical class 0.000 description 8
- 238000006243 chemical reaction Methods 0.000 description 7
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- DOSWKTVGTNVYQM-UHFFFAOYSA-N n,n'-bis(hydroxymethyl)hepta-2,5-dienediamide Chemical compound OCNC(=O)C=CCC=CC(=O)NCO DOSWKTVGTNVYQM-UHFFFAOYSA-N 0.000 description 5
- 230000001588 bifunctional effect Effects 0.000 description 4
- 229940050176 methyl chloride Drugs 0.000 description 4
- 230000006855 networking Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000004971 Cross linker Substances 0.000 description 3
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 238000006386 neutralization reaction Methods 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- -1 Acrylamido methylene chloroacetamide Chemical compound 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 230000003113 alkalizing effect Effects 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000008186 active pharmaceutical agent Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- AFOSIXZFDONLBT-UHFFFAOYSA-N divinyl sulfone Chemical compound C=CS(=O)(=O)C=C AFOSIXZFDONLBT-UHFFFAOYSA-N 0.000 description 1
- 239000013051 drainage agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- NIQQIJXGUZVEBB-UHFFFAOYSA-N methanol;propan-2-one Chemical compound OC.CC(C)=O NIQQIJXGUZVEBB-UHFFFAOYSA-N 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- FDRCDNZGSXJAFP-UHFFFAOYSA-M sodium chloroacetate Chemical compound [Na+].[O-]C(=O)CCl FDRCDNZGSXJAFP-UHFFFAOYSA-M 0.000 description 1
- 229940080263 sodium dichloroacetate Drugs 0.000 description 1
- LUPNKHXLFSSUGS-UHFFFAOYSA-M sodium;2,2-dichloroacetate Chemical compound [Na+].[O-]C(=O)C(Cl)Cl LUPNKHXLFSSUGS-UHFFFAOYSA-M 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08B—POLYSACCHARIDES; DERIVATIVES THEREOF
- C08B15/00—Preparation of other cellulose derivatives or modified cellulose, e.g. complexes
- C08B15/10—Crosslinking of cellulose
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61L—METHODS OR APPARATUS FOR STERILISING MATERIALS OR OBJECTS IN GENERAL; DISINFECTION, STERILISATION OR DEODORISATION OF AIR; CHEMICAL ASPECTS OF BANDAGES, DRESSINGS, ABSORBENT PADS OR SURGICAL ARTICLES; MATERIALS FOR BANDAGES, DRESSINGS, ABSORBENT PADS OR SURGICAL ARTICLES
- A61L15/00—Chemical aspects of, or use of materials for, bandages, dressings or absorbent pads
- A61L15/16—Bandages, dressings or absorbent pads for physiological fluids such as urine or blood, e.g. sanitary towels, tampons
- A61L15/22—Bandages, dressings or absorbent pads for physiological fluids such as urine or blood, e.g. sanitary towels, tampons containing macromolecular materials
- A61L15/28—Polysaccharides or their derivatives
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08B—POLYSACCHARIDES; DERIVATIVES THEREOF
- C08B11/00—Preparation of cellulose ethers
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Materials Engineering (AREA)
- Polymers & Plastics (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Biochemistry (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Hematology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Polysaccharides And Polysaccharide Derivatives (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
- Solid-Sorbent Or Filter-Aiding Compositions (AREA)
Priority Applications (18)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2357079A DE2357079C2 (de) | 1973-11-15 | 1973-11-15 | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern |
| NL7414412A NL7414412A (nl) | 1973-11-15 | 1974-11-05 | Werkwijze voor het bereiden van wateropnemende, maar in water onoplosbare celluloseethers. |
| SE7414057A SE433613B (sv) | 1973-11-15 | 1974-11-08 | Forfarande for framstellning av vatten upptagande, men deri till mer en 50 viktprocent olosliga cellulosaetrar |
| US05/522,741 US3936441A (en) | 1973-11-15 | 1974-11-11 | Process for the production of water adsorbing but water-insoluble cellulose ethers |
| CH1510674A CH610336A5 (Direct) | 1973-11-15 | 1974-11-12 | |
| AU75261/74A AU483876B2 (en) | 1974-11-12 | Process forthe production of water adsorbing but water-insoluble cellulose ethers | |
| FI3292/74A FI58334C (fi) | 1973-11-15 | 1974-11-13 | Foerfarande foer framstaellning av vatten upptagande men daeri oloesliga cellulosaetrar |
| AT907474A AT332887B (de) | 1973-11-15 | 1974-11-13 | Verfahren zur herstellung von wasser aufnehmenden, aber darin weitgehend unloslichen celluloseathern |
| ZA00747282A ZA747282B (en) | 1973-11-15 | 1974-11-13 | Process for the manufacture of water adsorbing cellulose ethers |
| CA213,589A CA1029370A (en) | 1973-11-15 | 1974-11-13 | Process for the production of water-adsorbing but water-insoluble cellulose ethers |
| GB49154/74A GB1487938A (en) | 1973-11-15 | 1974-11-13 | Process for the manufacture of water adsorbing cellulose ethers |
| IT54028/74A IT1023243B (it) | 1973-11-15 | 1974-11-13 | Procedimento per produrre eteri di cellulosa assorbenti aoqua ma insolubili in essa |
| ES431916A ES431916A1 (es) | 1973-11-15 | 1974-11-13 | Un procedimiento para la produccion de eteres celulosicos adsorbentes de agua. |
| BR9528/74A BR7409528A (pt) | 1973-11-15 | 1974-11-13 | Processo para a producao de eteres celulosicos que podem absorver agua embora nao sejam hidrosoluveis |
| JP49131546A JPS5843403B2 (ja) | 1973-11-15 | 1974-11-14 | キユウスイセイデアルガミズニフヨウセイノ セルロ−スエ−テルノ セイゾウホウホウ |
| AR256521A AR203219A1 (es) | 1973-11-15 | 1974-11-14 | Procedimiento para la produccion de eteres celulosicos adsorbentes del agua pero en gran parte insolubles en agua |
| BE150543A BE822233A (fr) | 1973-11-15 | 1974-11-14 | Procede pour preparer des ehters cellulosiques hydrophiles insolubles dans l'eau |
| FR7437577A FR2251572B1 (Direct) | 1973-11-15 | 1974-11-14 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2357079A DE2357079C2 (de) | 1973-11-15 | 1973-11-15 | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2357079A1 DE2357079A1 (de) | 1975-05-28 |
| DE2357079C2 true DE2357079C2 (de) | 1982-07-29 |
Family
ID=5898211
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2357079A Expired DE2357079C2 (de) | 1973-11-15 | 1973-11-15 | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3936441A (Direct) |
| JP (1) | JPS5843403B2 (Direct) |
| AR (1) | AR203219A1 (Direct) |
| AT (1) | AT332887B (Direct) |
| BE (1) | BE822233A (Direct) |
| BR (1) | BR7409528A (Direct) |
| CA (1) | CA1029370A (Direct) |
| CH (1) | CH610336A5 (Direct) |
| DE (1) | DE2357079C2 (Direct) |
| ES (1) | ES431916A1 (Direct) |
| FI (1) | FI58334C (Direct) |
| FR (1) | FR2251572B1 (Direct) |
| GB (1) | GB1487938A (Direct) |
| IT (1) | IT1023243B (Direct) |
| NL (1) | NL7414412A (Direct) |
| SE (1) | SE433613B (Direct) |
| ZA (1) | ZA747282B (Direct) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4186238A (en) * | 1973-12-24 | 1980-01-29 | Hoechst Aktiengesellschaft | Hydrophilic articles of water-insoluble polymers |
| US4194024A (en) * | 1973-12-24 | 1980-03-18 | Hoechst Aktiengesellschaft | Method of making hydrophilic articles of water-insoluble polymers |
| DE2447690C2 (de) * | 1974-10-07 | 1982-02-25 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung eines Kunststoffs auf Basis von chemisch modifiziertem Casein und seine Verwendung |
| DE2519927C2 (de) * | 1975-05-05 | 1986-10-23 | Hoechst Ag, 6230 Frankfurt | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50 Gew.-% unlöslichen Celluloseethern |
| DE2520337A1 (de) * | 1975-05-07 | 1976-11-18 | Hoechst Ag | Verfahren zum herstellen von wasser aufnehmenden, aber darin unloeslichen celluloseaethern |
| DE2520336A1 (de) * | 1975-05-07 | 1976-11-18 | Hoechst Ag | Verfahren zum herstellen von wasser aufnehmenden, aber darin unloeslichen celluloseaethern |
| DE2543187C2 (de) * | 1975-09-27 | 1982-05-06 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von Wasser aufnehmenden, aber darin weitgehend unlöslichen Celluloseethern |
| US4063017A (en) * | 1976-04-22 | 1977-12-13 | Purdue Research Foundation | Porous cellulose beads and the immobilization of enzymes therewith |
| DE2634539C2 (de) * | 1976-07-31 | 1983-08-25 | Hoechst Ag, 6230 Frankfurt | Verfahren zur Herstellung von saugfähigen, modifizierten Stärkeethern und deren Verwendung |
| DE2644678A1 (de) * | 1976-10-02 | 1978-04-06 | Dynamit Nobel Ag | Verfahren zur herstellung funktionalisierter cellulosen |
| FR2378808A1 (fr) * | 1977-01-28 | 1978-08-25 | Mar Pha Etu Expl Marques | Nouveaux copolymeres hydrophiles a base de n-(tris(hydroxy-methyl)methyl)acrylamide ou de n-(tris (hydroxymethyl)methyl)methacrylamide, leur preparation et leur emploi dans les techniques de separation |
| DE2707308C2 (de) * | 1977-02-19 | 1982-07-01 | Hoechst Ag, 6000 Frankfurt | Formkörper schwammartiger Struktur auf Basis von regenerierter Cellulose für medizinische Zwecke |
| DE2823757C2 (de) * | 1978-05-31 | 1982-10-21 | Hoechst Ag, 6000 Frankfurt | Verfahren zur Herstellung von quellfähigen Fasern oder quellfähigen textilen Flächengebilden |
| DE3112945A1 (de) * | 1981-03-31 | 1982-10-07 | Hoechst Ag, 6000 Frankfurt | Celluloseether und cellulosemischether mit mindestens einem phosphorhaltigen substituenten und ein verfahren zu ihrer herstellung |
| US4368323A (en) * | 1981-09-21 | 1983-01-11 | Personal Products Company | Substantive wetting agents for absorbent materials |
| US4573578A (en) * | 1983-12-19 | 1986-03-04 | The Dow Chemical Company | Method and material for the restraint of polar organic liquids |
| JPS6190657A (ja) * | 1984-10-11 | 1986-05-08 | 三井東圧化学株式会社 | 尿の吸収・保持剤 |
| US4813945A (en) * | 1986-02-26 | 1989-03-21 | Arco Chemical Technology, Inc. | Ultrahigh water-absorbing fiber forming composition |
| US4892533A (en) * | 1986-02-26 | 1990-01-09 | Arco Chemical Technology, Inc. | Ultrahigh water-absorbing fiber-forming composition |
| JPS63210102A (ja) * | 1987-02-27 | 1988-08-31 | Mitsubishi Petrochem Co Ltd | 高吸水性ポリマ−の製造法 |
| JPH01204654A (ja) * | 1988-02-10 | 1989-08-17 | Olympus Optical Co Ltd | 超音波内視鏡 |
| IT1218202B (it) * | 1988-03-30 | 1990-04-12 | Mini Ricerca Scient Tecnolog | Emulsioni acquose di poliisocianati e procedimento per la loro preparazione |
| ATA255988A (de) * | 1988-10-14 | 1993-05-15 | Chemie Linz Gmbh | Absorbierendes polymerisat |
| US5783691A (en) * | 1989-02-08 | 1998-07-21 | Biomatrix, Inc. | Crosslinked hyaluronate gels, their use and method for producing them |
| US5124197A (en) * | 1989-07-28 | 1992-06-23 | Kimberly-Clark Corporation | Inflated cellulose fiber web possessing improved vertical wicking properties |
| JPH0394207U (Direct) * | 1990-01-10 | 1991-09-26 | ||
| US5247072A (en) * | 1991-10-25 | 1993-09-21 | Kimberly-Clark Corporation | Carboxyalkyl polysaccharides having improved absorbent properties and process for the preparation thereof |
| US5550189A (en) * | 1992-04-17 | 1996-08-27 | Kimberly-Clark Corporation | Modified polysaccharides having improved absorbent properties and process for the preparation thereof |
| US5801116A (en) * | 1995-04-07 | 1998-09-01 | Rhodia Inc. | Process for producing polysaccharides and their use as absorbent materials |
| DE10233788A1 (de) † | 2002-07-25 | 2004-02-05 | Wolff Cellulosics Gmbh & Co. Kg | Cellulosederivate mit gel-artigen rheologischen Eigenschaften und Verfahren zur Herstellung derselben |
| US7741424B2 (en) * | 2004-09-29 | 2010-06-22 | Kowa Co., Ltd. | Phosphoric ester of cellulose derivative and metal adsorbent comprising the same |
| US20060142480A1 (en) * | 2004-12-29 | 2006-06-29 | Mengkui Luo | Method of making carboxyalkyl cellulose polymer network |
| US20060142561A1 (en) * | 2004-12-29 | 2006-06-29 | Mengkui Luo | Carboxyalkyl cellulose |
| US20060142478A1 (en) * | 2004-12-29 | 2006-06-29 | Mengkui Luo | Carboxyalkyl cellulose polymer network |
| US20060142481A1 (en) * | 2004-12-29 | 2006-06-29 | Herriott Carole W | Method for making a mixed polymer network |
| US7541396B2 (en) * | 2004-12-29 | 2009-06-02 | Weyerhaeuser Nr Company | Method for making carboxyalkyl cellulose |
| US7300965B2 (en) * | 2004-12-29 | 2007-11-27 | Weyerhaeuser Company | Mixed polymer network |
| JP2009120716A (ja) * | 2007-11-14 | 2009-06-04 | Kao Corp | ヒドロキシエチルセルロースの製造方法 |
| CN102939146B (zh) * | 2010-06-02 | 2015-11-25 | 加尔各答大学 | 用于在温和条件下交联纤维素醚的方法 |
| CN114452948A (zh) * | 2022-01-10 | 2022-05-10 | 安徽农业大学 | 一种改性纤维素气凝胶及其制备方法与应用 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB513917A (en) * | 1937-04-15 | 1939-10-25 | Du Pont | Improvements in and relating to the production of cellulose derivatives |
| US2338681A (en) * | 1942-01-17 | 1944-01-04 | Rohm & Haas | Reaction of acrylamide with cellulose |
| US2517577A (en) * | 1946-12-10 | 1950-08-08 | Hercules Powder Co Ltd | Preparation of carboxyalkyl ethers of cellulose |
| US2618633A (en) * | 1949-12-23 | 1952-11-18 | Hercules Powder Co Ltd | Preparation of carboxyethyl cellulose |
| US2618635A (en) * | 1949-12-23 | 1952-11-18 | Hercules Powder Co Ltd | Mixed cellulose ether |
| US2886474A (en) * | 1954-04-14 | 1959-05-12 | Rohm & Haas | Compositions for binding pigments |
| US2837512A (en) * | 1954-11-03 | 1958-06-03 | Du Pont | Activated cellulose ethers and process of preparing same |
| US2971815A (en) * | 1957-10-31 | 1961-02-14 | Austin L Bullock | Chemically modified textiles |
| US3029232A (en) * | 1958-12-26 | 1962-04-10 | American Cyanamid Co | Production of amide containing cellulose |
| NL251910A (Direct) * | 1959-05-23 | |||
| US3102773A (en) * | 1959-06-25 | 1963-09-03 | Nalco Chemical Co | Process for treating textiles |
| US3017237A (en) * | 1960-09-13 | 1962-01-16 | Austin L Bullock | Cellulose derivative and method of preparing same |
| BE614497A (Direct) * | 1961-02-28 | |||
| US3298979A (en) * | 1963-08-09 | 1967-01-17 | Eastman Kodak Co | Graft copolymers comprising acrylonitrile and cellulose derivatives |
| US3696092A (en) * | 1963-08-13 | 1972-10-03 | Giuliana C Tesoro | Process for the chemical modification of polymers containing active hydrogen atoms by reacting such with a sulfonamide compound |
| US3423163A (en) * | 1966-07-19 | 1969-01-21 | Du Pont | Cellulosic textile fibers bearing grafted n-methylol amide |
| GB1099239A (en) * | 1966-11-09 | 1968-01-17 | Japan Atomic Energy Res Inst | Graft polymerization of vinyl compound onto cellulose |
| US3589364A (en) * | 1968-03-14 | 1971-06-29 | Buckeye Cellulose Corp | Bibulous cellulosic fibers |
| DE1920493A1 (de) * | 1969-04-23 | 1970-11-05 | Henkel & Cie Gmbh | Verfahren zur Herstellung von Carbamyl-aethylgruppen enthaltenden Cellulosederivaten |
-
1973
- 1973-11-15 DE DE2357079A patent/DE2357079C2/de not_active Expired
-
1974
- 1974-11-05 NL NL7414412A patent/NL7414412A/xx not_active Application Discontinuation
- 1974-11-08 SE SE7414057A patent/SE433613B/xx not_active IP Right Cessation
- 1974-11-11 US US05/522,741 patent/US3936441A/en not_active Expired - Lifetime
- 1974-11-12 CH CH1510674A patent/CH610336A5/xx not_active IP Right Cessation
- 1974-11-13 ES ES431916A patent/ES431916A1/es not_active Expired
- 1974-11-13 BR BR9528/74A patent/BR7409528A/pt unknown
- 1974-11-13 AT AT907474A patent/AT332887B/de active
- 1974-11-13 IT IT54028/74A patent/IT1023243B/it active
- 1974-11-13 ZA ZA00747282A patent/ZA747282B/xx unknown
- 1974-11-13 GB GB49154/74A patent/GB1487938A/en not_active Expired
- 1974-11-13 FI FI3292/74A patent/FI58334C/fi active
- 1974-11-13 CA CA213,589A patent/CA1029370A/en not_active Expired
- 1974-11-14 AR AR256521A patent/AR203219A1/es active
- 1974-11-14 JP JP49131546A patent/JPS5843403B2/ja not_active Expired
- 1974-11-14 FR FR7437577A patent/FR2251572B1/fr not_active Expired
- 1974-11-14 BE BE150543A patent/BE822233A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BR7409528A (pt) | 1976-05-25 |
| AR203219A1 (es) | 1975-08-22 |
| FR2251572B1 (Direct) | 1977-08-05 |
| SE433613B (sv) | 1984-06-04 |
| SE7414057L (Direct) | 1975-05-16 |
| FI329274A7 (Direct) | 1975-05-16 |
| CA1029370A (en) | 1978-04-11 |
| FI58334C (fi) | 1981-01-12 |
| IT1023243B (it) | 1978-05-10 |
| ZA747282B (en) | 1975-11-26 |
| AU7526174A (en) | 1976-05-13 |
| ATA907474A (de) | 1976-02-15 |
| FR2251572A1 (Direct) | 1975-06-13 |
| GB1487938A (en) | 1977-10-05 |
| AT332887B (de) | 1976-10-25 |
| JPS5080376A (Direct) | 1975-06-30 |
| NL7414412A (nl) | 1975-05-20 |
| DE2357079A1 (de) | 1975-05-28 |
| BE822233A (fr) | 1975-05-14 |
| FI58334B (fi) | 1980-09-30 |
| ES431916A1 (es) | 1976-11-01 |
| CH610336A5 (Direct) | 1979-04-12 |
| JPS5843403B2 (ja) | 1983-09-27 |
| US3936441A (en) | 1976-02-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2357079C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern | |
| DE2358150C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50% unlöslichen Celluloseethern | |
| CH618448A5 (Direct) | ||
| DE69408454T2 (de) | Verfahren zur herstellung von amid-modifiziertem carboxyl enthaltenden polysaccharid und so erzeugtes fettsäureamid modifiziertes polysaccharid | |
| EP1384727B2 (de) | Cellulosederivate mit gel-artigen rheologischen Eigenschaften und Verfahren zur Herstellung derselben | |
| EP0077949B1 (de) | Verfahren zur Herstellung von Hydroxypropylstärke | |
| DE2634539A1 (de) | Verfahren zur herstellung von saugfaehigen, modifizierten staerkeaethern und deren verwendung | |
| DE2314689A1 (de) | Fluessigkeiten aufsaugende und zurueckhaltende cellulosematerialien und verfahren zu ihrer herstellung | |
| DE2823757C2 (de) | Verfahren zur Herstellung von quellfähigen Fasern oder quellfähigen textilen Flächengebilden | |
| DD144062A5 (de) | Verfahren und vorrichtung zur herstellung von quellfaehiger,vernetzter carboxyalkylcellulose | |
| DE60113392T2 (de) | Superabsorbierende folie auf der basis von polysacchariden | |
| DE2543187C2 (de) | Verfahren zur Herstellung von Wasser aufnehmenden, aber darin weitgehend unlöslichen Celluloseethern | |
| DE3025094A1 (de) | Vernetzte cellulosesulfatester, deren herstellung und verwendung | |
| DE2520336A1 (de) | Verfahren zum herstellen von wasser aufnehmenden, aber darin unloeslichen celluloseaethern | |
| DE2519927C2 (de) | Verfahren zum Herstellen von Wasser aufnehmenden, aber darin zu mehr als 50 Gew.-% unlöslichen Celluloseethern | |
| DE69807885T2 (de) | Absorbierendes polymermaterial auf basis von erneuerbaren ausgangsprodukten | |
| EP0117490B1 (de) | Verfahren zur Herstellung von Celluloseethern mit einem Dimethoxyethan enthaltenden Dispergierhilfsmittel | |
| DD212969A1 (de) | Verfahren zur modifizierung von carboxymethylcellulose | |
| EP1537149A1 (de) | Verfahren zum herstellen von temporär vernetzten celluloseethern | |
| DE2823710A1 (de) | Verfahren zur herstellung von quellfaehiger, vernetzter carboxyalkylcellulose in faserform aus natuerlich vorkommender cellulose und deren verwendung | |
| EP1574522B1 (de) | Verfahren zur Herstellung von quellfähigen modifizierten Cellulose-oder Stärkeethern | |
| AT360555B (de) | Verfahren zur herstellung von modifizierten saugfaehigen staerkeaethern | |
| EP0719793B1 (de) | Verfahren zur Herstellung von wasserlöslichen Aminoalkylderivaten von Polysacchariden | |
| EP0021131A1 (de) | Verfahren zur Herstellung von quellfähigen, vernetzten Ethern des Polyvinylalkohols und deren Verwendung | |
| DE2550033A1 (de) | Verfahren zum herstellen von wasser aufnehmenden celluloseaethern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| AG | Has addition no. |
Ref country code: DE Ref document number: 2520337 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8365 | Fully valid after opposition proceedings | ||
| 8339 | Ceased/non-payment of the annual fee |