DE2260194C3 - Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren - Google Patents
Photographisches Aufzeichnungsmaterial für das FarbdiffusionsübertragungsverfahrenInfo
- Publication number
- DE2260194C3 DE2260194C3 DE2260194A DE2260194A DE2260194C3 DE 2260194 C3 DE2260194 C3 DE 2260194C3 DE 2260194 A DE2260194 A DE 2260194A DE 2260194 A DE2260194 A DE 2260194A DE 2260194 C3 DE2260194 C3 DE 2260194C3
- Authority
- DE
- Germany
- Prior art keywords
- layer
- compound
- image
- compounds
- recording material
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims description 181
- 238000000034 method Methods 0.000 title claims description 45
- 230000008569 process Effects 0.000 title claims description 30
- 238000012546 transfer Methods 0.000 title claims description 27
- 238000009792 diffusion process Methods 0.000 title claims description 17
- 150000001875 compounds Chemical class 0.000 claims description 284
- -1 silver halide Chemical class 0.000 claims description 148
- 229910052709 silver Inorganic materials 0.000 claims description 115
- 239000004332 silver Substances 0.000 claims description 115
- 239000000839 emulsion Substances 0.000 claims description 92
- 150000003254 radicals Chemical class 0.000 claims description 49
- 239000003795 chemical substances by application Substances 0.000 claims description 46
- 150000003839 salts Chemical class 0.000 claims description 18
- 238000005859 coupling reaction Methods 0.000 claims description 12
- 230000008878 coupling Effects 0.000 claims description 10
- 238000010168 coupling process Methods 0.000 claims description 10
- 229910052757 nitrogen Inorganic materials 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- ZRHUHDUEXWHZMA-UHFFFAOYSA-N 1,4-dihydropyrazol-5-one Chemical compound O=C1CC=NN1 ZRHUHDUEXWHZMA-UHFFFAOYSA-N 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 5
- MCSKRVKAXABJLX-UHFFFAOYSA-N pyrazolo[3,4-d]triazole Chemical compound N1=NN=C2N=NC=C21 MCSKRVKAXABJLX-UHFFFAOYSA-N 0.000 claims description 5
- 125000000217 alkyl group Polymers 0.000 claims description 4
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 3
- 125000000547 substituted alkyl group Chemical group 0.000 claims description 3
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 3
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 claims description 2
- 125000001118 alkylidene group Chemical group 0.000 claims description 2
- 150000001412 amines Chemical class 0.000 claims description 2
- MDFFNEOEWAXZRQ-UHFFFAOYSA-N aminyl Chemical group [NH2] MDFFNEOEWAXZRQ-UHFFFAOYSA-N 0.000 claims description 2
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 claims description 2
- 125000005337 azoxy group Chemical group [N+]([O-])(=N*)* 0.000 claims description 2
- 125000004119 disulfanediyl group Chemical group *SS* 0.000 claims description 2
- BQPIGGFYSBELGY-UHFFFAOYSA-N mercury(2+) Chemical compound [Hg+2] BQPIGGFYSBELGY-UHFFFAOYSA-N 0.000 claims description 2
- 125000001820 oxy group Chemical group [*:1]O[*:2] 0.000 claims description 2
- 125000000446 sulfanediyl group Chemical group *S* 0.000 claims description 2
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 125000004103 aminoalkyl group Chemical group 0.000 claims 1
- 229910052736 halogen Inorganic materials 0.000 claims 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims 1
- 125000005420 sulfonamido group Chemical group S(=O)(=O)(N*)* 0.000 claims 1
- 239000010410 layer Substances 0.000 description 415
- 239000000975 dye Substances 0.000 description 122
- 108010010803 Gelatin Proteins 0.000 description 73
- 229920000159 gelatin Polymers 0.000 description 73
- 239000008273 gelatin Substances 0.000 description 73
- 235000019322 gelatine Nutrition 0.000 description 73
- 235000011852 gelatine desserts Nutrition 0.000 description 73
- 239000007788 liquid Substances 0.000 description 60
- 238000011161 development Methods 0.000 description 55
- 230000003647 oxidation Effects 0.000 description 48
- 238000007254 oxidation reaction Methods 0.000 description 48
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 27
- CWNSVVHTTQBGQB-UHFFFAOYSA-N N,N-Diethyldodecanamide Chemical compound CCCCCCCCCCCC(=O)N(CC)CC CWNSVVHTTQBGQB-UHFFFAOYSA-N 0.000 description 23
- 238000004519 manufacturing process Methods 0.000 description 23
- 239000007800 oxidant agent Substances 0.000 description 22
- 238000012360 testing method Methods 0.000 description 21
- 239000000243 solution Substances 0.000 description 19
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 17
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 150000004010 onium ions Chemical class 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 12
- 238000002844 melting Methods 0.000 description 12
- 230000008018 melting Effects 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 238000010521 absorption reaction Methods 0.000 description 11
- 239000007864 aqueous solution Substances 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000005554 pickling Methods 0.000 description 11
- 239000000758 substrate Substances 0.000 description 11
- 239000003112 inhibitor Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- DRSHXJFUUPIBHX-UHFFFAOYSA-N COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 Chemical compound COc1ccc(cc1)N1N=CC2C=NC(Nc3cc(OC)c(OC)c(OCCCN4CCN(C)CC4)c3)=NC12 DRSHXJFUUPIBHX-UHFFFAOYSA-N 0.000 description 9
- LZZYPRNAOMGNLH-UHFFFAOYSA-M Cetrimonium bromide Chemical compound [Br-].CCCCCCCCCCCCCCCC[N+](C)(C)C LZZYPRNAOMGNLH-UHFFFAOYSA-M 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 9
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 8
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 8
- RSAZYXZUJROYKR-UHFFFAOYSA-N indophenol Chemical compound C1=CC(O)=CC=C1N=C1C=CC(=O)C=C1 RSAZYXZUJROYKR-UHFFFAOYSA-N 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- OIPQUBBCOVJSNS-UHFFFAOYSA-L bromo(iodo)silver Chemical compound Br[Ag]I OIPQUBBCOVJSNS-UHFFFAOYSA-L 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 7
- 229920000642 polymer Polymers 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- OAHWWXAJFXEIPX-UHFFFAOYSA-M tributyl(octadecyl)azanium;bromide Chemical compound [Br-].CCCCCCCCCCCCCCCCCC[N+](CCCC)(CCCC)CCCC OAHWWXAJFXEIPX-UHFFFAOYSA-M 0.000 description 7
- NWUNKFTVLXWQQC-UHFFFAOYSA-N 2,5-di(dodecan-2-yl)benzene-1,4-diol Chemical compound CCCCCCCCCCC(C)C1=CC(O)=C(C(C)CCCCCCCCCC)C=C1O NWUNKFTVLXWQQC-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 239000002585 base Substances 0.000 description 6
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 6
- 230000007935 neutral effect Effects 0.000 description 6
- 230000001590 oxidative effect Effects 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- YSMRWXYRXBRSND-UHFFFAOYSA-N TOTP Chemical compound CC1=CC=CC=C1OP(=O)(OC=1C(=CC=CC=1)C)OC1=CC=CC=C1C YSMRWXYRXBRSND-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- 239000012670 alkaline solution Substances 0.000 description 5
- 125000004429 atom Chemical group 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000000084 colloidal system Substances 0.000 description 5
- ZPFAVCIQZKRBGF-UHFFFAOYSA-N 1,3,2-dioxathiolane 2,2-dioxide Chemical compound O=S1(=O)OCCO1 ZPFAVCIQZKRBGF-UHFFFAOYSA-N 0.000 description 4
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 4
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 4
- JCTYXESWNZITDY-UHFFFAOYSA-N 4-hexadecylmorpholine Chemical compound CCCCCCCCCCCCCCCCN1CCOCC1 JCTYXESWNZITDY-UHFFFAOYSA-N 0.000 description 4
- MSQYZPLOZLNVND-UHFFFAOYSA-M 4-methylbenzenesulfonate;tridodecyl(methyl)azanium Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[N+](C)(CCCCCCCCCCCC)CCCCCCCCCCCC MSQYZPLOZLNVND-UHFFFAOYSA-M 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- LIMFPAAAIVQRRD-BCGVJQADSA-N N-[2-[(3S,4R)-3-fluoro-4-methoxypiperidin-1-yl]pyrimidin-4-yl]-8-[(2R,3S)-2-methyl-3-(methylsulfonylmethyl)azetidin-1-yl]-5-propan-2-ylisoquinolin-3-amine Chemical compound F[C@H]1CN(CC[C@H]1OC)C1=NC=CC(=N1)NC=1N=CC2=C(C=CC(=C2C=1)C(C)C)N1[C@@H]([C@H](C1)CS(=O)(=O)C)C LIMFPAAAIVQRRD-BCGVJQADSA-N 0.000 description 4
- 229920002125 Sokalan® Polymers 0.000 description 4
- 125000003118 aryl group Chemical group 0.000 description 4
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 230000000873 masking effect Effects 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- CMCWWLVWPDLCRM-UHFFFAOYSA-N phenidone Chemical compound N1C(=O)CCN1C1=CC=CC=C1 CMCWWLVWPDLCRM-UHFFFAOYSA-N 0.000 description 4
- 239000004584 polyacrylic acid Substances 0.000 description 4
- 229920000139 polyethylene terephthalate Polymers 0.000 description 4
- 239000005020 polyethylene terephthalate Substances 0.000 description 4
- 229920002717 polyvinylpyridine Polymers 0.000 description 4
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 4
- 230000002028 premature Effects 0.000 description 4
- 150000003142 primary aromatic amines Chemical class 0.000 description 4
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 238000001228 spectrum Methods 0.000 description 4
- FMCAFXHLMUOIGG-IWFBPKFRSA-N (2s)-2-[[(2s)-2-[[(2s)-2-[[(2r)-2-formamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,5-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoic acid Chemical compound O=CN[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@H](C(=O)N[C@@H](CCSC)C(O)=O)CC1=CC(C)=C(O)C=C1C FMCAFXHLMUOIGG-IWFBPKFRSA-N 0.000 description 3
- SAVMNSHHXUMFRQ-UHFFFAOYSA-N 1-[bis(ethenylsulfonyl)methoxy-ethenylsulfonylmethyl]sulfonylethene Chemical compound C=CS(=O)(=O)C(S(=O)(=O)C=C)OC(S(=O)(=O)C=C)S(=O)(=O)C=C SAVMNSHHXUMFRQ-UHFFFAOYSA-N 0.000 description 3
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 3
- 239000000853 adhesive Substances 0.000 description 3
- 230000001070 adhesive effect Effects 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 239000006229 carbon black Substances 0.000 description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 3
- 229920002301 cellulose acetate Polymers 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001013 indophenol dye Substances 0.000 description 3
- AGJSNMGHAVDLRQ-HUUJSLGLSA-N methyl (2s)-2-[[(2r)-2-[[(2s)-2-[[(2r)-2-amino-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxy-2,3-dimethylphenyl)propanoyl]amino]-4-methylsulfanylbutanoate Chemical compound SC[C@H](N)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(=O)N[C@@H](CCSC)C(=O)OC)CC1=CC=C(O)C(C)=C1C AGJSNMGHAVDLRQ-HUUJSLGLSA-N 0.000 description 3
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 3
- 230000005012 migration Effects 0.000 description 3
- 238000013508 migration Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- MWUXSHHQAYIFBG-UHFFFAOYSA-N nitrogen oxide Inorganic materials O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 3
- NDGRWYRVNANFNB-UHFFFAOYSA-N pyrazolidin-3-one Chemical compound O=C1CCNN1 NDGRWYRVNANFNB-UHFFFAOYSA-N 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- 238000006479 redox reaction Methods 0.000 description 3
- 150000003378 silver Chemical class 0.000 description 3
- 230000003381 solubilizing effect Effects 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- SWGJCIMEBVHMTA-UHFFFAOYSA-K trisodium;6-oxido-4-sulfo-5-[(4-sulfonatonaphthalen-1-yl)diazenyl]naphthalene-2-sulfonate Chemical compound [Na+].[Na+].[Na+].C1=CC=C2C(N=NC3=C4C(=CC(=CC4=CC=C3O)S([O-])(=O)=O)S([O-])(=O)=O)=CC=C(S([O-])(=O)=O)C2=C1 SWGJCIMEBVHMTA-UHFFFAOYSA-K 0.000 description 3
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical class CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- XCZKKZXWDBOGPA-UHFFFAOYSA-N 2-phenylbenzene-1,4-diol Chemical compound OC1=CC=C(O)C(C=2C=CC=CC=2)=C1 XCZKKZXWDBOGPA-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- FOIXSVOLVBLSDH-UHFFFAOYSA-N Silver ion Chemical compound [Ag+] FOIXSVOLVBLSDH-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 150000003868 ammonium compounds Chemical class 0.000 description 2
- XYXNTHIYBIDHGM-UHFFFAOYSA-N ammonium thiosulfate Chemical compound [NH4+].[NH4+].[O-]S([O-])(=O)=S XYXNTHIYBIDHGM-UHFFFAOYSA-N 0.000 description 2
- 125000000732 arylene group Chemical group 0.000 description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- WZJYKHNJTSNBHV-UHFFFAOYSA-N benzo[h]quinoline Chemical compound C1=CN=C2C3=CC=CC=C3C=CC2=C1 WZJYKHNJTSNBHV-UHFFFAOYSA-N 0.000 description 2
- IOJUPLGTWVMSFF-UHFFFAOYSA-N benzothiazole Chemical compound C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 description 2
- 238000004061 bleaching Methods 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 2
- 238000002845 discoloration Methods 0.000 description 2
- XPROKLGQTCGPDN-UHFFFAOYSA-M dodecyl(dimethyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCCCC[S+](C)C XPROKLGQTCGPDN-UHFFFAOYSA-M 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012530 fluid Substances 0.000 description 2
- 210000001654 germ layer Anatomy 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 229920001477 hydrophilic polymer Polymers 0.000 description 2
- CUILPNURFADTPE-UHFFFAOYSA-N hypobromous acid Chemical compound BrO CUILPNURFADTPE-UHFFFAOYSA-N 0.000 description 2
- 150000002466 imines Chemical class 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-M iodide Chemical compound [I-] XMBWDFGMSWQBCA-UHFFFAOYSA-M 0.000 description 2
- 229910052740 iodine Inorganic materials 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- AJDUTMFFZHIJEM-UHFFFAOYSA-N n-(9,10-dioxoanthracen-1-yl)-4-[4-[[4-[4-[(9,10-dioxoanthracen-1-yl)carbamoyl]phenyl]phenyl]diazenyl]phenyl]benzamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2NC(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1N=NC(C=C1)=CC=C1C(C=C1)=CC=C1C(=O)NC1=CC=CC2=C1C(=O)C1=CC=CC=C1C2=O AJDUTMFFZHIJEM-UHFFFAOYSA-N 0.000 description 2
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 2
- 239000003605 opacifier Substances 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 2
- 230000033458 reproduction Effects 0.000 description 2
- 230000002441 reversible effect Effects 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 2
- 239000001043 yellow dye Substances 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 1
- ABFDKXBSQCTIKH-UHFFFAOYSA-M 1-ethylpyridin-1-ium;bromide Chemical compound [Br-].CC[N+]1=CC=CC=C1 ABFDKXBSQCTIKH-UHFFFAOYSA-M 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- ZMIJLUMNHQMCKA-UHFFFAOYSA-N 1H-benzimidazole benzo[e][1,3]benzothiazole Chemical compound N1=CSC2=C1C1=CC=CC=C1C=C2.N2=CNC1=C2C=CC=C1 ZMIJLUMNHQMCKA-UHFFFAOYSA-N 0.000 description 1
- NDZLIAZRGGTCJZ-UHFFFAOYSA-N 1h-indole;phenol Chemical class OC1=CC=CC=C1.C1=CC=C2NC=CC2=C1 NDZLIAZRGGTCJZ-UHFFFAOYSA-N 0.000 description 1
- LEJIWJCKYUOQDZ-UHFFFAOYSA-N 1h-pyrrole;hydrobromide Chemical compound Br.C=1C=CNC=1 LEJIWJCKYUOQDZ-UHFFFAOYSA-N 0.000 description 1
- WBVHQTGGKTXUJS-UHFFFAOYSA-N 2,3-dimethyl-5-(1-phenyltetrazol-5-yl)sulfanylbenzene-1,4-diol Chemical compound CC1=C(O)C(=CC(=C1C)O)SC1=NN=NN1C1=CC=CC=C1 WBVHQTGGKTXUJS-UHFFFAOYSA-N 0.000 description 1
- WBIBUCGCVLAPQG-UHFFFAOYSA-N 2-(2-pyridin-2-ylethyl)pyridine Chemical compound C=1C=CC=NC=1CCC1=CC=CC=N1 WBIBUCGCVLAPQG-UHFFFAOYSA-N 0.000 description 1
- JJIBFFQMTFEYBS-UHFFFAOYSA-M 2-ethyl-3-methylisoquinolin-2-ium;bromide Chemical compound [Br-].C1=CC=C2C=C(C)[N+](CC)=CC2=C1 JJIBFFQMTFEYBS-UHFFFAOYSA-M 0.000 description 1
- YSUUCHVSWMMYLY-UHFFFAOYSA-M 2-methyl-1-(1-phenylpropyl)pyridin-1-ium bromide Chemical compound [Br-].CCC(C1=CC=CC=C1)[N+]1=CC=CC=C1C YSUUCHVSWMMYLY-UHFFFAOYSA-M 0.000 description 1
- JYHNNCBQCSLFQM-UHFFFAOYSA-N 3,6-dihydroxybenzonorbornane Chemical compound OC1=CC=C(O)C2=C1C1CCC2C1 JYHNNCBQCSLFQM-UHFFFAOYSA-N 0.000 description 1
- MRIBCCHYZOSDOM-UHFFFAOYSA-N 3-(1-phenyltetrazol-5-yl)sulfanylpropanenitrile Chemical compound N#CCCSC1=NN=NN1C1=CC=CC=C1 MRIBCCHYZOSDOM-UHFFFAOYSA-N 0.000 description 1
- FVVXWRGARUACNW-UHFFFAOYSA-N 3-methylisoquinoline Chemical compound C1=CC=C2C=NC(C)=CC2=C1 FVVXWRGARUACNW-UHFFFAOYSA-N 0.000 description 1
- YRUPBAWWCPVHFT-UHFFFAOYSA-N 4-(4-hydroxyanilino)phenol Chemical compound C1=CC(O)=CC=C1NC1=CC=C(O)C=C1 YRUPBAWWCPVHFT-UHFFFAOYSA-N 0.000 description 1
- SRYYOKKLTBRLHT-UHFFFAOYSA-N 4-(benzylamino)phenol Chemical compound C1=CC(O)=CC=C1NCC1=CC=CC=C1 SRYYOKKLTBRLHT-UHFFFAOYSA-N 0.000 description 1
- ADQJNEIDNYJPKO-UHFFFAOYSA-N 4-(hydroxymethyl)-1-methylpyrazolidin-3-one Chemical compound CN1CC(CO)C(=O)N1 ADQJNEIDNYJPKO-UHFFFAOYSA-N 0.000 description 1
- XUXUHDYTLNCYQQ-UHFFFAOYSA-N 4-amino-TEMPO Chemical group CC1(C)CC(N)CC(C)(C)N1[O] XUXUHDYTLNCYQQ-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- ZFPLORNMFKACPO-UHFFFAOYSA-N 4-methylbenzenesulfonic acid;2-methylpyridine Chemical compound CC1=CC=CC=N1.CC1=CC=C(S(O)(=O)=O)C=C1 ZFPLORNMFKACPO-UHFFFAOYSA-N 0.000 description 1
- BJVLSHGFPDRBLC-UHFFFAOYSA-N C(CCCCC)[N+]1(CCOCC1)CCCCCCCCCC Chemical compound C(CCCCC)[N+]1(CCOCC1)CCCCCCCCCC BJVLSHGFPDRBLC-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000694440 Colpidium aqueous Species 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- 229940090898 Desensitizer Drugs 0.000 description 1
- QAHFOPIILNICLA-UHFFFAOYSA-N Diphenamid Chemical compound C=1C=CC=CC=1C(C(=O)N(C)C)C1=CC=CC=C1 QAHFOPIILNICLA-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 229930192627 Naphthoquinone Natural products 0.000 description 1
- 230000006179 O-acylation Effects 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000004133 Sodium thiosulphate Substances 0.000 description 1
- 208000004350 Strabismus Diseases 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229910010413 TiO 2 Inorganic materials 0.000 description 1
- XUAJZOHXBBRXOX-UHFFFAOYSA-M [Ag]Br.[I] Chemical compound [Ag]Br.[I] XUAJZOHXBBRXOX-UHFFFAOYSA-M 0.000 description 1
- TZTCYKFMDLPFPV-UHFFFAOYSA-N [Br-].C(C1=CC=CC=C1)C1([NH2+]C=CC=C1)C Chemical compound [Br-].C(C1=CC=CC=C1)C1([NH2+]C=CC=C1)C TZTCYKFMDLPFPV-UHFFFAOYSA-N 0.000 description 1
- 229910052946 acanthite Inorganic materials 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 150000001263 acyl chlorides Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- XIWMTQIUUWJNRP-UHFFFAOYSA-N amidol Chemical compound NC1=CC=C(O)C(N)=C1 XIWMTQIUUWJNRP-UHFFFAOYSA-N 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- SOIFLUNRINLCBN-UHFFFAOYSA-N ammonium thiocyanate Chemical compound [NH4+].[S-]C#N SOIFLUNRINLCBN-UHFFFAOYSA-N 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 150000004054 benzoquinones Chemical class 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 150000001649 bromium compounds Chemical class 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- AFWARTLPQGAFMN-UHFFFAOYSA-M butyl(dimethyl)sulfanium;bromide Chemical compound [Br-].CCCC[S+](C)C AFWARTLPQGAFMN-UHFFFAOYSA-M 0.000 description 1
- 239000000648 calcium alginate Substances 0.000 description 1
- 235000010410 calcium alginate Nutrition 0.000 description 1
- 229960002681 calcium alginate Drugs 0.000 description 1
- OKHHGHGGPDJQHR-YMOPUZKJSA-L calcium;(2s,3s,4s,5s,6r)-6-[(2r,3s,4r,5s,6r)-2-carboxy-6-[(2r,3s,4r,5s,6r)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate Chemical compound [Ca+2].O[C@@H]1[C@H](O)[C@H](O)O[C@@H](C([O-])=O)[C@H]1O[C@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]2[C@H]([C@@H](O)[C@H](O)[C@H](O2)C([O-])=O)O)[C@H](C(O)=O)O1 OKHHGHGGPDJQHR-YMOPUZKJSA-L 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 238000001311 chemical methods and process Methods 0.000 description 1
- 235000019646 color tone Nutrition 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- LKBMPSMLBVPIKO-UHFFFAOYSA-M decyl(dimethyl)sulfanium;4-methylbenzenesulfonate Chemical compound CC1=CC=C(S([O-])(=O)=O)C=C1.CCCCCCCCCC[S+](C)C LKBMPSMLBVPIKO-UHFFFAOYSA-M 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000037213 diet Effects 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- BPPUNZFQQROEGL-UHFFFAOYSA-N dimethylsulfanium;4-methylbenzenesulfonate Chemical compound C[SH+]C.CC1=CC=C(S([O-])(=O)=O)C=C1 BPPUNZFQQROEGL-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 150000002019 disulfides Chemical class 0.000 description 1
- ILRSCQWREDREME-UHFFFAOYSA-N dodecanamide Chemical compound CCCCCCCCCCCC(N)=O ILRSCQWREDREME-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- YAGKRVSRTSUGEY-UHFFFAOYSA-N ferricyanide Chemical compound [Fe+3].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] YAGKRVSRTSUGEY-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 150000002537 isoquinolines Chemical class 0.000 description 1
- 150000002605 large molecules Chemical class 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000010871 livestock manure Substances 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 229910052976 metal sulfide Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 150000002791 naphthoquinones Chemical class 0.000 description 1
- 150000002832 nitroso derivatives Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical class OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical class OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- KHUXNRRPPZOJPT-UHFFFAOYSA-N phenoxy radical Chemical group O=C1C=C[CH]C=C1 KHUXNRRPPZOJPT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 1
- 229940116357 potassium thiocyanate Drugs 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- BBFCIBZLAVOLCF-UHFFFAOYSA-N pyridin-1-ium;bromide Chemical compound Br.C1=CC=NC=C1 BBFCIBZLAVOLCF-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000000979 retarding effect Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 1
- 229940056910 silver sulfide Drugs 0.000 description 1
- RHUVFRWZKMEWNS-UHFFFAOYSA-M silver thiocyanate Chemical compound [Ag+].[S-]C#N RHUVFRWZKMEWNS-UHFFFAOYSA-M 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 description 1
- 235000019345 sodium thiosulphate Nutrition 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 230000003595 spectral effect Effects 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 125000000565 sulfonamide group Chemical group 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 150000004026 tertiary sulfonium compounds Chemical class 0.000 description 1
- 125000005207 tetraalkylammonium group Chemical group 0.000 description 1
- 150000005621 tetraalkylammonium salts Chemical class 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- LIXPXSXEKKHIRR-UHFFFAOYSA-M tetraethylphosphanium;bromide Chemical compound [Br-].CC[P+](CC)(CC)CC LIXPXSXEKKHIRR-UHFFFAOYSA-M 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 description 1
- ANUSMYJRISPAKG-UHFFFAOYSA-M triethylsulfanium;bromide Chemical compound [Br-].CC[S+](CC)CC ANUSMYJRISPAKG-UHFFFAOYSA-M 0.000 description 1
- 238000009827 uniform distribution Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
- DRDVZXDWVBGGMH-UHFFFAOYSA-N zinc;sulfide Chemical class [S-2].[Zn+2] DRDVZXDWVBGGMH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C8/00—Diffusion transfer processes or agents therefor; Photosensitive materials for such processes
- G03C8/02—Photosensitive materials characterised by the image-forming section
- G03C8/08—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds
- G03C8/10—Photosensitive materials characterised by the image-forming section the substances transferred by diffusion consisting of organic compounds of dyes or their precursors
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S430/00—Radiation imagery chemistry: process, composition, or product thereof
- Y10S430/156—Precursor compound
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Heat Sensitive Colour Forming Recording (AREA)
- Color Printing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US20683671A | 1971-12-10 | 1971-12-10 | |
| US308869A US3880658A (en) | 1971-12-10 | 1972-11-22 | Photographic elements containing oxichromic compounds with reduced azomethine linkages |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2260194A1 DE2260194A1 (de) | 1973-06-20 |
| DE2260194B2 DE2260194B2 (de) | 1980-06-12 |
| DE2260194C3 true DE2260194C3 (de) | 1981-06-19 |
Family
ID=26901707
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2260194A Expired DE2260194C3 (de) | 1971-12-10 | 1972-12-08 | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3880658A (enExample) |
| JP (1) | JPS5522780B2 (enExample) |
| BE (1) | BE792598A (enExample) |
| CA (1) | CA995948A (enExample) |
| CH (1) | CH560918A5 (enExample) |
| DE (1) | DE2260194C3 (enExample) |
| FR (1) | FR2162661B1 (enExample) |
| GB (1) | GB1415537A (enExample) |
| IT (1) | IT971700B (enExample) |
| NL (1) | NL7216746A (enExample) |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS557578B2 (enExample) * | 1972-05-25 | 1980-02-26 | ||
| US4199354A (en) * | 1973-01-26 | 1980-04-22 | Eastman Kodak Company | Positive-working immobile photographic compounds and photographic elements containing same |
| FR2232776B1 (enExample) * | 1973-06-05 | 1976-06-25 | Eastman Kodak Co | |
| JPS5529418B2 (enExample) * | 1973-10-24 | 1980-08-04 | ||
| JPS513233A (enExample) * | 1974-06-27 | 1976-01-12 | Fuji Photo Film Co Ltd | |
| US4154610A (en) * | 1974-10-31 | 1979-05-15 | Fuji Photo Film Co., Ltd. | Photographic method and film unit |
| US4278598A (en) * | 1974-12-20 | 1981-07-14 | Eastman Kodak Company | Positive-working immobile intramolecular nucleophilic displacement compounds and photographic elements containing same |
| US4199355A (en) * | 1975-06-24 | 1980-04-22 | Eastman Kodak Company | Positive-working immobile photographic compounds and photographic elements containing same |
| US4099972A (en) * | 1975-08-02 | 1978-07-11 | Mitsubishi Chemical Industries Limited | Dye image forming process using shifted azo dye developer |
| JPS52153739A (en) * | 1976-06-16 | 1977-12-21 | Konishiroku Photo Ind Co Ltd | Photographic material for diffusion transfer |
| JPS5914740B2 (ja) * | 1976-07-02 | 1984-04-05 | コニカ株式会社 | 拡散転写用写真材料 |
| US4124392A (en) * | 1976-09-07 | 1978-11-07 | Eastman Kodak Company | Cobalt complex amplification imaging system with blocked dye precursor |
| DE2640601C2 (de) * | 1976-09-09 | 1985-11-28 | Agfa-Gevaert Ag, 5090 Leverkusen | Farbphotographisches Material mit 2-Äquivalent-Gelbkupplern |
| JPS6029103B2 (ja) * | 1976-12-10 | 1985-07-09 | 富士写真フイルム株式会社 | カラ−拡散転写法用写真要素 |
| US4148648A (en) * | 1977-02-16 | 1979-04-10 | Polaroid Corporation | Diffusion transfer elements comprising U V light absorbers |
| US4248962A (en) * | 1977-12-23 | 1981-02-03 | Eastman Kodak Company | Photographic emulsions, elements and processes utilizing release compounds |
| DE2965489D1 (en) * | 1978-05-02 | 1983-07-07 | Polaroid Corp | Photosensitive elements for use in a diffusion transfer film unit |
| US4298676A (en) * | 1979-10-29 | 1981-11-03 | Polaroid Corporation | Optical filter agents and photographic products and processes containing same |
| US4409315A (en) * | 1982-06-28 | 1983-10-11 | Eastman Kodak Company | Reducing post-process Dmin increase in positive redox dye-releasing image transfer systems using oxidants in cover sheets |
| JPS5953845A (ja) * | 1982-09-22 | 1984-03-28 | Fuji Photo Film Co Ltd | カラ−拡散転写用写真要素 |
| JPS5958428A (ja) * | 1982-09-29 | 1984-04-04 | Fuji Photo Film Co Ltd | カラ−拡散転写用写真要素 |
| JPS59177546A (ja) * | 1983-03-29 | 1984-10-08 | Fuji Photo Film Co Ltd | 熱現像感光材料 |
| JPS59184699U (ja) * | 1983-05-25 | 1984-12-08 | 吉川 昭 | 光フアイバ−による衣服やビ−ズの発光装置 |
| US4485164A (en) * | 1983-07-06 | 1984-11-27 | Eastman Kodak Company | Oxidants for reducing post-process D-min increase in positive redox dye-releasing image transfer systems |
| JPS6037014U (ja) * | 1983-08-18 | 1985-03-14 | 井沢 一彦 | 婚礼用衣裳 |
| JPS6227385U (enExample) * | 1985-07-31 | 1987-02-19 | ||
| US4749641A (en) * | 1986-09-15 | 1988-06-07 | Eastman Kodak Company | Imaging element containing dye masking coupler |
| JPH0823684B2 (ja) * | 1987-12-22 | 1996-03-06 | 富士写真フイルム株式会社 | カラー感光材料 |
| US4865958A (en) * | 1988-08-18 | 1989-09-12 | Eastman Kodak Company | Photographic recording material comprising leuco dye for cold silver image tone |
| US5455141A (en) * | 1992-05-29 | 1995-10-03 | Eastman Kodak Company | Photographic elements containing blocked dye moieties |
| EP0573099B1 (en) * | 1992-05-29 | 1998-04-22 | Eastman Kodak Company | Photographic elements containing release compounds |
| US5432041A (en) * | 1993-03-18 | 1995-07-11 | Minnesota Mining And Manufacturing Company | Yellow and magenta chromogenic leuco dyes for photothermographic elements |
| US5583255A (en) * | 1993-12-03 | 1996-12-10 | Imation Corp. | Yellow and magenta chromogenic leuco dyes for photothermographic elements |
| US5492804A (en) * | 1994-06-30 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Chromogenic leuco redox-dye-releasing compounds for photothermographic elements |
| US5492805A (en) * | 1994-06-30 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Blocked leuco dyes for photothermographic elements |
| US5492803A (en) * | 1995-01-06 | 1996-02-20 | Minnesota Mining And Manufacturing Company | Hydrazide redox-dye-releasing compounds for photothermographic elements |
| US5593809A (en) * | 1995-12-07 | 1997-01-14 | Polaroid Corporation | Peel apart diffusion transfer compound film unit with crosslinkable layer and borate |
| US12200414B2 (en) * | 2017-12-28 | 2025-01-14 | Nitto Denko Corporation | Waterproof member and electronic device |
Family Cites Families (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2909430A (en) * | 1958-10-08 | 1959-10-20 | Polaroid Corp | Photographic processes |
| US3255001A (en) * | 1955-02-03 | 1966-06-07 | Polaroid Corp | Photographic products, processes and compositions utilizing insulated azo dye developers |
| NL218146A (enExample) * | 1956-02-13 | 1900-01-01 | ||
| US3065074A (en) * | 1958-08-20 | 1962-11-20 | Polaroid Corp | 1,4-benzoquinone oxidizing agents for color transfer processes |
| BE619300A (enExample) * | 1959-04-06 | |||
| US3260597A (en) * | 1960-12-02 | 1966-07-12 | Eastman Kodak Co | Photographic multicolor diffusion transfer process using dye developers and development arrestors |
| US3230082A (en) * | 1962-05-14 | 1966-01-18 | Polaroid Corp | Color processes and products |
| US3227550A (en) * | 1962-09-07 | 1966-01-04 | Eastman Kodak Co | Photographic color reproduction process and element |
| US3347671A (en) * | 1963-09-20 | 1967-10-17 | Eastman Kodak Co | Preparation of photographic direct positive color images and photographic elements therefor |
| US3320063A (en) * | 1963-12-04 | 1967-05-16 | Polaroid Corp | Photographic developing agents and uses thereof |
| US3711546A (en) * | 1966-12-02 | 1973-01-16 | M Simon | N-(ortho-substituted benzene or naphthalene carboxamidoethyle)para-phenylene diamines as coupler-developers |
| US3415644A (en) * | 1967-03-10 | 1968-12-10 | Polaroid Corp | Novel photographic products and processes |
| US3443943A (en) * | 1967-07-24 | 1969-05-13 | Polaroid Corp | Photographic products and processes employing ring - closing 2 - equivalent silver halide developing agents |
| DE1668268C3 (de) * | 1967-09-05 | 1974-08-15 | International Polaroid Corp., Jersey City, N.J. (V.St.A.) | p-Dihydroxyphenyl verbindungen |
| US3698897A (en) * | 1971-07-06 | 1972-10-17 | Eastman Kodak Co | Diffusion transfer processes and film units comprising compounds which are cleavable upon oxidation in alkali media to produce diffusible dyes or dye precursors |
| US3725062A (en) * | 1971-07-06 | 1973-04-03 | Eastman Kodak Co | Color diffusion processes utilizing hydroquinones which provide dye image materials upon oxidation in alkaline conditions |
| US3728113A (en) * | 1971-07-06 | 1973-04-17 | Eastman Kodak Co | Selective transfer system and compounds for employment therein |
-
0
- BE BE792598D patent/BE792598A/xx unknown
-
1972
- 1972-11-22 US US308869A patent/US3880658A/en not_active Expired - Lifetime
- 1972-12-01 CA CA158,463A patent/CA995948A/en not_active Expired
- 1972-12-07 IT IT32691/72A patent/IT971700B/it active
- 1972-12-08 GB GB5669272A patent/GB1415537A/en not_active Expired
- 1972-12-08 NL NL7216746A patent/NL7216746A/xx unknown
- 1972-12-08 DE DE2260194A patent/DE2260194C3/de not_active Expired
- 1972-12-11 FR FR7243943A patent/FR2162661B1/fr not_active Expired
- 1972-12-11 CH CH1800172A patent/CH560918A5/xx not_active IP Right Cessation
- 1972-12-11 JP JP12425072A patent/JPS5522780B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH560918A5 (enExample) | 1975-04-15 |
| NL7216746A (enExample) | 1973-06-13 |
| US3880658A (en) | 1975-04-29 |
| IT971700B (it) | 1974-05-10 |
| JPS4866440A (enExample) | 1973-09-12 |
| DE2260194B2 (de) | 1980-06-12 |
| CA995948A (en) | 1976-08-31 |
| FR2162661B1 (enExample) | 1976-08-20 |
| JPS5522780B2 (enExample) | 1980-06-19 |
| BE792598A (fr) | 1973-06-12 |
| GB1415537A (en) | 1975-11-26 |
| DE2260194A1 (de) | 1973-06-20 |
| FR2162661A1 (enExample) | 1973-07-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2260194C3 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE1772929C3 (de) | Diffusionsübertragungsverfahren zur Herstellung fotografischer Farbbilder | |
| DE2809716A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE2740719A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE2628043C3 (de) | Photographisches Aufzeichnungsmaterial | |
| DE2052145A1 (de) | Photographische Filmeinheit | |
| DE2228361A1 (de) | Farbphotographisches diffusionsuebertragungsverfahren und zugehoeriges photographisches material | |
| DE2607440C2 (de) | Photographisches Aufzeichnungsmaterial für das Farbdiffusionsübertragungsverfahren | |
| DE3127781A1 (de) | Fotografisches element | |
| DE2913140C2 (enExample) | ||
| DE2022697C2 (de) | Photographisches Aufzeichnungsmaterial für das Diffusionsübertragungsverfahren | |
| DE3048165A1 (de) | Xanthenverbindungen und photographische produkte und verfahren | |
| DE2756656C2 (enExample) | ||
| DE2136994A1 (de) | Photographische Filmeinheit fur das Farbdifrusionsubertragungsverfahren | |
| DE2853584A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE2645656C2 (de) | Photographisches Farbdiffusionsübertragungsverfahren | |
| DE2823903C2 (enExample) | ||
| EP0037985B1 (de) | Fotografisches Aufzeichnungsmaterial und hierfür geeignete Verbindungen mit fotografisch wirksamem, abspaltbarem Rest | |
| EP0000511A1 (de) | Fotografisches Farbdiffusionsübertragungsverfahren | |
| EP0035685B1 (de) | Photographisches Aufzeichnungsmaterial für Diffusionsverfahren und hierfür geeignete neue nichtdiffundierende Sulfiliminverbindungen | |
| DE2238052C3 (de) | Photographisches Diffusionsübertragungsverfahren zur Herstellung von Farbbildern sowie photographische Aufzeichnungseinheit zur Durchführung des Verfahrens | |
| DE3620824A1 (de) | Farbfotografisches aufzeichnungsmaterial mit einem farbabspalter fuer blaugruene farbstoffe und ein mit diesen farbstoffen erzeugtes farbbild | |
| DE2934742A1 (de) | Photographisches aufzeichnungsmaterial | |
| DE2630999A1 (de) | Lichtempfindliches diffusionsuebertragungselement | |
| DE2650997C2 (de) | Verfahren zur Herstellung eines Farbbildes nach dem Diffusionsübertragungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |