DE2252250A1 - Verfahren zur herstellung von brenzkatechinderivaten - Google Patents
Verfahren zur herstellung von brenzkatechinderivatenInfo
- Publication number
- DE2252250A1 DE2252250A1 DE2252250A DE2252250A DE2252250A1 DE 2252250 A1 DE2252250 A1 DE 2252250A1 DE 2252250 A DE2252250 A DE 2252250A DE 2252250 A DE2252250 A DE 2252250A DE 2252250 A1 DE2252250 A1 DE 2252250A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- parts
- weight
- pyrocatechol
- halogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 6
- YCIMNLLNPGFGHC-UHFFFAOYSA-N o-dihydroxy-benzene Natural products OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 claims description 62
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 33
- -1 catechol ethers Chemical class 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 125000003342 alkenyl group Chemical group 0.000 claims description 11
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 229910052801 chlorine Inorganic materials 0.000 claims description 8
- 150000005206 1,2-dihydroxybenzenes Chemical class 0.000 claims description 7
- QYKIQEUNHZKYBP-UHFFFAOYSA-N Vinyl ether Chemical compound C=COC=C QYKIQEUNHZKYBP-UHFFFAOYSA-N 0.000 claims description 6
- 125000002252 acyl group Chemical group 0.000 claims description 6
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 5
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 claims description 5
- 230000002378 acidificating effect Effects 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 229940100198 alkylating agent Drugs 0.000 claims description 3
- 239000002168 alkylating agent Substances 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 239000000047 product Substances 0.000 claims description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 239000007795 chemical reaction product Substances 0.000 claims description 2
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims 4
- 230000029936 alkylation Effects 0.000 claims 1
- 238000005804 alkylation reaction Methods 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 18
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- 238000006243 chemical reaction Methods 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 13
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 239000011734 sodium Substances 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- FJKIXWOMBXYWOQ-UHFFFAOYSA-N ethenoxyethane Chemical compound CCOC=C FJKIXWOMBXYWOQ-UHFFFAOYSA-N 0.000 description 6
- 150000002367 halogens Chemical group 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- PZFBULOUMNPBFA-UHFFFAOYSA-N 3-chlorobut-1-yne Chemical compound CC(Cl)C#C PZFBULOUMNPBFA-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical compound COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 description 3
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- NFKRBIJFEJTLBQ-UHFFFAOYSA-N 2-(1-methoxyethoxy)phenol Chemical compound COC(C)OC1=CC=CC=C1O NFKRBIJFEJTLBQ-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- KDKYADYSIPSCCQ-UHFFFAOYSA-N but-1-yne Chemical compound CCC#C KDKYADYSIPSCCQ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 230000007812 deficiency Effects 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 238000006266 etherification reaction Methods 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 2
- 125000001412 tetrahydropyranyl group Chemical group 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- RJXXCLQZUVADGY-UHFFFAOYSA-N 2-(1-ethoxyethoxy)phenol Chemical compound CCOC(C)OC1=CC=CC=C1O RJXXCLQZUVADGY-UHFFFAOYSA-N 0.000 description 1
- KKRJBAXPLIDXML-UHFFFAOYSA-N 2-but-2-ynoxyphenol Chemical compound CC#CCOC1=CC=CC=C1O KKRJBAXPLIDXML-UHFFFAOYSA-N 0.000 description 1
- JQPFYXFVUKHERX-UHFFFAOYSA-N 2-hydroxy-2-cyclohexen-1-one Natural products OC1=CCCCC1=O JQPFYXFVUKHERX-UHFFFAOYSA-N 0.000 description 1
- ZNCUUYCDKVNVJH-UHFFFAOYSA-N 2-isopropoxyphenol Chemical compound CC(C)OC1=CC=CC=C1O ZNCUUYCDKVNVJH-UHFFFAOYSA-N 0.000 description 1
- VZGLVCFVUREVDP-UHFFFAOYSA-N 3-chlorobut-1-ene Chemical compound CC(Cl)C=C VZGLVCFVUREVDP-UHFFFAOYSA-N 0.000 description 1
- PZASAAIJIFDWSB-CKPDSHCKSA-N 8-[(1S)-1-[8-(trifluoromethyl)-7-[4-(trifluoromethyl)cyclohexyl]oxynaphthalen-2-yl]ethyl]-8-azabicyclo[3.2.1]octane-3-carboxylic acid Chemical compound FC(F)(F)C=1C2=CC([C@@H](N3C4CCC3CC(C4)C(O)=O)C)=CC=C2C=CC=1OC1CCC(C(F)(F)F)CC1 PZASAAIJIFDWSB-CKPDSHCKSA-N 0.000 description 1
- LIRNTOVCFYXOTG-UHFFFAOYSA-N C#CCOC1=C(C=CC=C1)OC(C)OC Chemical compound C#CCOC1=C(C=CC=C1)OC(C)OC LIRNTOVCFYXOTG-UHFFFAOYSA-N 0.000 description 1
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000002841 Lewis acid Substances 0.000 description 1
- ISRUGXGCCGIOQO-UHFFFAOYSA-N Rhoden Chemical compound CNC(=O)OC1=CC=CC=C1OC(C)C ISRUGXGCCGIOQO-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 238000007171 acid catalysis Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- OILAIQUEIWYQPH-UHFFFAOYSA-N cyclohexane-1,2-dione Chemical compound O=C1CCCCC1=O OILAIQUEIWYQPH-UHFFFAOYSA-N 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 150000007517 lewis acids Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 239000011814 protection agent Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 238000005730 ring rearrangement reaction Methods 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 239000002351 wastewater Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C43/00—Ethers; Compounds having groups, groups or groups
- C07C43/02—Ethers
- C07C43/20—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring
- C07C43/23—Ethers having an ether-oxygen atom bound to a carbon atom of a six-membered aromatic ring containing hydroxy or O-metal groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252250A DE2252250A1 (de) | 1972-10-25 | 1972-10-25 | Verfahren zur herstellung von brenzkatechinderivaten |
| DD173806A DD107250A5 (enExample) | 1972-10-25 | 1973-10-01 | |
| BE136334A BE805653A (fr) | 1972-10-25 | 1973-10-04 | Procede de preparation de derives de la pyrocatechine |
| TR17990A TR17990A (tr) | 1972-10-25 | 1973-10-09 | Pirokatehin tuerevlerinin imaline mahsus usul |
| IL43407A IL43407A (en) | 1972-10-25 | 1973-10-09 | Preparation of pyrocatechol monoethers |
| CA182,869A CA1025888A (en) | 1972-10-25 | 1973-10-09 | Preparation of pyrocatechol derivatives |
| AU61229/73A AU480242B2 (en) | 1972-10-25 | 1973-10-10 | Preparation of pyrocatechol derivatives |
| JP48117014A JPS4972223A (enExample) | 1972-10-25 | 1973-10-19 | |
| ZA738186A ZA738186B (en) | 1972-10-25 | 1973-10-23 | Preparation of pyrocatechol derivatives |
| BR8252/73A BR7308252D0 (pt) | 1972-10-25 | 1973-10-23 | Processo de fabricacao de derivados do pirocatecol |
| CS737336A CS198129B2 (en) | 1972-10-25 | 1973-10-24 | Method of preparing pyrocatechol ethers |
| GB4940473A GB1457108A (en) | 1972-10-25 | 1973-10-24 | Preparation of pyrocatechol derivatives and intermediates used |
| IT53329/73A IT997658B (it) | 1972-10-25 | 1973-10-24 | Procedimento per la produzione di derivati della pirocatechina |
| SU1965923A SU501665A3 (ru) | 1972-10-25 | 1973-10-24 | Способ получени эфиров пирокатехина |
| CH1498873A CH602533A5 (enExample) | 1972-10-25 | 1973-10-24 | |
| NL7314702A NL7314702A (enExample) | 1972-10-25 | 1973-10-25 | |
| FR7338132A FR2204602B1 (enExample) | 1972-10-25 | 1973-10-25 | |
| AR250686A AR208656A1 (es) | 1972-10-25 | 1973-10-25 | Procedimiento para la obtencion de monoeteres de alquil pirocatequina utiles para preparar derivados de accion insecticida y de aplicacion fitosanitaria |
| US05/710,415 US4129601A (en) | 1972-10-25 | 1976-08-02 | Pyrocatechol derivatives |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2252250A DE2252250A1 (de) | 1972-10-25 | 1972-10-25 | Verfahren zur herstellung von brenzkatechinderivaten |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2252250A1 true DE2252250A1 (de) | 1974-05-02 |
Family
ID=5859991
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2252250A Withdrawn DE2252250A1 (de) | 1972-10-25 | 1972-10-25 | Verfahren zur herstellung von brenzkatechinderivaten |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS4972223A (enExample) |
| AR (1) | AR208656A1 (enExample) |
| BE (1) | BE805653A (enExample) |
| BR (1) | BR7308252D0 (enExample) |
| CA (1) | CA1025888A (enExample) |
| CH (1) | CH602533A5 (enExample) |
| CS (1) | CS198129B2 (enExample) |
| DD (1) | DD107250A5 (enExample) |
| DE (1) | DE2252250A1 (enExample) |
| FR (1) | FR2204602B1 (enExample) |
| GB (1) | GB1457108A (enExample) |
| IL (1) | IL43407A (enExample) |
| IT (1) | IT997658B (enExample) |
| NL (1) | NL7314702A (enExample) |
| SU (1) | SU501665A3 (enExample) |
| TR (1) | TR17990A (enExample) |
| ZA (1) | ZA738186B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102018101457A1 (de) * | 2018-01-23 | 2019-07-25 | Eppendorf Ag | Verfahren und Vorrichtung zur Überwachung der Drehzahl eines Elements |
-
1972
- 1972-10-25 DE DE2252250A patent/DE2252250A1/de not_active Withdrawn
-
1973
- 1973-10-01 DD DD173806A patent/DD107250A5/xx unknown
- 1973-10-04 BE BE136334A patent/BE805653A/xx unknown
- 1973-10-09 TR TR17990A patent/TR17990A/xx unknown
- 1973-10-09 CA CA182,869A patent/CA1025888A/en not_active Expired
- 1973-10-09 IL IL43407A patent/IL43407A/en unknown
- 1973-10-19 JP JP48117014A patent/JPS4972223A/ja active Pending
- 1973-10-23 ZA ZA738186A patent/ZA738186B/xx unknown
- 1973-10-23 BR BR8252/73A patent/BR7308252D0/pt unknown
- 1973-10-24 CH CH1498873A patent/CH602533A5/xx not_active IP Right Cessation
- 1973-10-24 SU SU1965923A patent/SU501665A3/ru active
- 1973-10-24 CS CS737336A patent/CS198129B2/cs unknown
- 1973-10-24 IT IT53329/73A patent/IT997658B/it active
- 1973-10-24 GB GB4940473A patent/GB1457108A/en not_active Expired
- 1973-10-25 AR AR250686A patent/AR208656A1/es active
- 1973-10-25 NL NL7314702A patent/NL7314702A/xx not_active Application Discontinuation
- 1973-10-25 FR FR7338132A patent/FR2204602B1/fr not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE102018101457A1 (de) * | 2018-01-23 | 2019-07-25 | Eppendorf Ag | Verfahren und Vorrichtung zur Überwachung der Drehzahl eines Elements |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1025888A (en) | 1978-02-07 |
| DD107250A5 (enExample) | 1974-07-20 |
| FR2204602B1 (enExample) | 1977-03-11 |
| AR208656A1 (es) | 1977-02-28 |
| AU6122973A (en) | 1975-04-10 |
| BR7308252D0 (pt) | 1974-07-18 |
| TR17990A (tr) | 1976-08-20 |
| CH602533A5 (enExample) | 1978-07-31 |
| JPS4972223A (enExample) | 1974-07-12 |
| IT997658B (it) | 1975-12-30 |
| BE805653A (fr) | 1974-04-04 |
| GB1457108A (en) | 1976-12-01 |
| SU501665A3 (ru) | 1976-01-30 |
| CS198129B2 (en) | 1980-05-30 |
| ZA738186B (en) | 1974-10-30 |
| NL7314702A (enExample) | 1974-04-29 |
| FR2204602A1 (enExample) | 1974-05-24 |
| IL43407A0 (en) | 1974-01-14 |
| IL43407A (en) | 1977-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE949231C (de) | Verfahren zur Herstellung von chlkorierten Benzylestern der Thiol- bzw. Thionothiolphosphorsaeuren | |
| DE1965472A1 (de) | Verfahren zur Herstellung von Phosphonsaeure-Diestern | |
| DE2008626A1 (de) | Synthese von alpha-Dehydrobiotin | |
| DE2252250A1 (de) | Verfahren zur herstellung von brenzkatechinderivaten | |
| EP0299277B1 (de) | Verfahren zur Herstellung von substituierten Pyridylalkylketonen | |
| DE847900C (de) | Verfahren zur Herstellung von mindestens eine AEthergruppe enthaltenden tertiaeren und quaternaeren Diaminen | |
| DE2252198A1 (de) | Brenzkatechinaether | |
| DE1141634B (de) | Verfahren zur Herstellung von Dithiolphosphorsaeureestern | |
| DE965813C (de) | Verfahren zur Herstellung von AEthern von Morpholinoalkanolen | |
| DE1097995B (de) | Verfahren zur Herstellung von Phenthiazinderivaten | |
| EP2340239A2 (de) | Synthese von myrtucommulon a und myrtucommulon-analoga | |
| DE3223949A1 (de) | Thiolphosphorsaeureester, ihre herstellung und verwendung | |
| AT358059B (de) | Verfahren zur herstellung von neuen oxiranen | |
| AT394556B (de) | Neue cumarinderivate und verfahren zu ihrer herstellung | |
| DE1570034A1 (de) | Verfahren zur Herstellung von Nikotinsaeureamiden | |
| DE2311637C3 (de) | Verfahren zur Herstellung von 2-Aminobenzylaminen | |
| US4129601A (en) | Pyrocatechol derivatives | |
| DE1670431A1 (de) | Verfahren zur Herstellung neuer Piperazin-Derivate | |
| AT376677B (de) | Verfahren zur herstellung von neuen indolizinderivaten und deren pharmazeutisch zulaessigen saeureadditionssalzen | |
| DE2222578C3 (de) | Verfahren zur Herstellung von O1O-Dialkyl-O-phenylthionophosphorsäureestern | |
| AT258264B (de) | Verfahren zur Herstellung von 5-(3'-Methylaminopropyl)-5H-dibenzo[a,d] cyclohepten | |
| AT233592B (de) | Verfahren zur Herstellung von neuen, beispielsweise zur Schädlingsbekämpfung verwendbaren Organophosphorverbindungen | |
| AT210438B (de) | Verfahren zur Herstellung von neuen Phosphon- bzw. Thiophosphonsäureestern | |
| DE2601782A1 (de) | Verfahren zur herstellung von o-dialkylaminomethylphenolen | |
| CH551393A (de) | Verfahren zur herstellung von formaldoximderivaten. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8130 | Withdrawal |