DE1943265C3 - Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide - Google Patents
Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxideInfo
- Publication number
- DE1943265C3 DE1943265C3 DE1943265A DE1943265A DE1943265C3 DE 1943265 C3 DE1943265 C3 DE 1943265C3 DE 1943265 A DE1943265 A DE 1943265A DE 1943265 A DE1943265 A DE 1943265A DE 1943265 C3 DE1943265 C3 DE 1943265C3
- Authority
- DE
- Germany
- Prior art keywords
- benzothiazine
- dihydro
- methyl
- oxo
- dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VSCYCJOVRGSJBT-UHFFFAOYSA-N 3,4-dihydro-2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NCCC2=C1 VSCYCJOVRGSJBT-UHFFFAOYSA-N 0.000 title description 3
- QRAOZQGIUIDZQZ-UHFFFAOYSA-N 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound C=1C=C2N(C)CCOC2=CC=1B1OC(C)(C)C(C)(C)O1 QRAOZQGIUIDZQZ-UHFFFAOYSA-N 0.000 claims 1
- -1 2-thiazolyl Chemical group 0.000 description 50
- 238000002844 melting Methods 0.000 description 43
- 230000008018 melting Effects 0.000 description 43
- 238000006243 chemical reaction Methods 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 150000001875 compounds Chemical class 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- 238000000034 method Methods 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 8
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 229940121363 anti-inflammatory agent Drugs 0.000 description 6
- 239000002260 anti-inflammatory agent Substances 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- 150000002513 isocyanates Chemical class 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000005915 ammonolysis reaction Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229960000905 indomethacin Drugs 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 229960002895 phenylbutazone Drugs 0.000 description 4
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 150000003857 carboxamides Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- GHNLJDPNIAIWOQ-UHFFFAOYSA-N 2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NC=CC2=C1 GHNLJDPNIAIWOQ-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 2
- XQIRIYJOVQEBDL-UHFFFAOYSA-N 4h-1,2-benzothiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=C1 XQIRIYJOVQEBDL-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000000378 dietary effect Effects 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000004968 inflammatory condition Effects 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 235000015110 jellies Nutrition 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- UGJYHTWLUYDADV-UHFFFAOYSA-N n,2,5-trimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(C)=CC=C1C UGJYHTWLUYDADV-UHFFFAOYSA-N 0.000 description 2
- BAJXNEYFJDMIFP-UHFFFAOYSA-N n,2-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1C BAJXNEYFJDMIFP-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZTLFUNAIEFGYCS-UHFFFAOYSA-N 1,1-dioxo-N-phenyl-2H-1lambda6,2-benzothiazine-4-carboxamide Chemical compound S1(NC=C(C2=C1C=CC=C2)C(=O)NC2=CC=CC=C2)(=O)=O ZTLFUNAIEFGYCS-UHFFFAOYSA-N 0.000 description 1
- JGLLUEYZVVULEH-UHFFFAOYSA-N 1,1-dioxo-N-phenyl-2H-thiazine-3-carboxamide Chemical compound S1(NC(=CC=C1)C(=O)NC1=CC=CC=C1)(=O)=O JGLLUEYZVVULEH-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical compound C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- OLBJNSPBWLCTOT-UHFFFAOYSA-N 2,4-dichloro-1-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C(Cl)=C1 OLBJNSPBWLCTOT-UHFFFAOYSA-N 0.000 description 1
- VXGHWBHTDJQBCP-UHFFFAOYSA-N 2-[2-(methylsulfamoyl)phenyl]acetic acid Chemical compound CNS(=O)(=O)C1=CC=CC=C1CC(O)=O VXGHWBHTDJQBCP-UHFFFAOYSA-N 0.000 description 1
- MWYDQCHUGSUGQO-UHFFFAOYSA-N 2-[4-methyl-2-(methylsulfamoyl)phenyl]acetic acid Chemical compound CNS(=O)(=O)C1=CC(C)=CC=C1CC(O)=O MWYDQCHUGSUGQO-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- QUNRGGUMLSPQRW-UHFFFAOYSA-N 2-methyl-1,1,3-trioxo-N-[3-(trifluoromethyl)phenyl]-4H-1lambda6,2-benzothiazine-4-carboxamide Chemical compound FC(C=1C=C(NC(=O)C2C(N(S(C3=C2C=CC=C3)(=O)=O)C)=O)C=CC1)(F)F QUNRGGUMLSPQRW-UHFFFAOYSA-N 0.000 description 1
- CPIFFCMMBZLKDK-UHFFFAOYSA-N 2-methyl-1,1-dioxo-3h-1$l^{6},2-benzothiazin-4-one Chemical compound C1=CC=C2S(=O)(=O)N(C)CC(=O)C2=C1 CPIFFCMMBZLKDK-UHFFFAOYSA-N 0.000 description 1
- GGPCERYTJXDGOH-UHFFFAOYSA-N 2-methyl-1,1-dioxo-4h-1$l^{6},2-benzothiazin-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C)C(=O)CC2=C1 GGPCERYTJXDGOH-UHFFFAOYSA-N 0.000 description 1
- LKLPGDADQQKOMU-UHFFFAOYSA-N 2-methyl-n-(6-methylpyridin-2-yl)-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxamide Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N(C)C1C(=O)NC1=CC=CC(C)=N1 LKLPGDADQQKOMU-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WNVACTGALQEPAI-UHFFFAOYSA-N C[N+]1(S(C2=C(CC1=O)C=CC=C2)=O)[O-] Chemical compound C[N+]1(S(C2=C(CC1=O)C=CC=C2)=O)[O-] WNVACTGALQEPAI-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- BXDZOYLPNAIDOC-UHFFFAOYSA-N N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]piperidine-4-carboxamide Chemical compound CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCN(CC(=O)NCCOCCOCCOCCNc4cccc5C(=O)N(C6CCC(=O)NC6=O)C(=O)c45)CC3)s2)o1 BXDZOYLPNAIDOC-UHFFFAOYSA-N 0.000 description 1
- WYJRFFQIYCIPBJ-UHFFFAOYSA-N ON(C=C(C(NC1=CC=CC=C1)=O)C1=C2C=CC=C1)S2=O Chemical compound ON(C=C(C(NC1=CC=CC=C1)=O)C1=C2C=CC=C1)S2=O WYJRFFQIYCIPBJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- REHHBTUVMSHZNT-UHFFFAOYSA-N bromocyclohexatriene Chemical compound BrC1=CC=C=C[CH]1 REHHBTUVMSHZNT-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000002651 drug therapy Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- RYXLGZSHBXBSCX-UHFFFAOYSA-N ethyl 2-methyl-1,1,3-trioxo-4h-1$l^{6},2-benzothiazine-4-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC)C(=O)N(C)S(=O)(=O)C2=C1 RYXLGZSHBXBSCX-UHFFFAOYSA-N 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- GIQCXAYKJYPPFK-UHFFFAOYSA-N methyl 2-methyl-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OC)N(C)S(=O)(=O)C2=C1 GIQCXAYKJYPPFK-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- MGRYVMQUVRQTST-UHFFFAOYSA-N n-(5-chloropyridin-2-yl)-2-methyl-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxamide Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N(C)C1C(=O)NC1=CC=C(Cl)C=N1 MGRYVMQUVRQTST-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000008203 oral pharmaceutical composition Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003270 steroid hormone Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/5415—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with carbocyclic ring systems, e.g. phenothiazine, chlorpromazine, piroxicam
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D279/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D279/02—1,2-Thiazines; Hydrogenated 1,2-thiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Production Of Liquid Hydrocarbon Mixture For Refining Petroleum (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US76759468A | 1968-08-27 | 1968-08-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1943265A1 DE1943265A1 (de) | 1970-08-13 |
| DE1943265B2 DE1943265B2 (de) | 1981-05-14 |
| DE1943265C3 true DE1943265C3 (de) | 1982-02-04 |
Family
ID=25079964
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1943265A Expired DE1943265C3 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
| DE1967325A Expired DE1967325C2 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967325A Expired DE1967325C2 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3591584A (enExample) |
| JP (2) | JPS50677B1 (enExample) |
| AT (2) | AT294113B (enExample) |
| BE (1) | BE737962A (enExample) |
| BR (1) | BR6911817D0 (enExample) |
| CH (1) | CH520705A (enExample) |
| DE (2) | DE1943265C3 (enExample) |
| DK (1) | DK145297C (enExample) |
| ES (1) | ES370861A1 (enExample) |
| FI (1) | FI51189C (enExample) |
| FR (1) | FR2016455B1 (enExample) |
| GB (1) | GB1257180A (enExample) |
| IL (1) | IL32836A (enExample) |
| MY (1) | MY7300310A (enExample) |
| NL (1) | NL157013B (enExample) |
| NO (1) | NO129746B (enExample) |
| PH (1) | PH10029A (enExample) |
| SE (2) | SE373854B (enExample) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3692780A (en) * | 1970-10-14 | 1972-09-19 | Warner Lambert Pharmaceutical | 4-substituted-2-alkyl-3-phenyl-2h-1,2-benzothiazine-1,1-dioxides and processes for their production |
| US3862319A (en) * | 1971-02-09 | 1975-01-21 | Pfizer | Benzothiazine dioxides as anti-thromobotic agents |
| DK153148C (da) * | 1971-03-01 | 1988-10-31 | Warner Lambert Co | Analogifremgangsmaade til fremstilling af 4-hydroxy-3-(3-isoxazolcarbamyl)-2h-1,2-benzothiazin-1,1-d ioxider eller alkalimetal-, jordalkalimetal- eller aminsalte deraf |
| US3787324A (en) * | 1971-03-01 | 1974-01-22 | Warner Lambert Co | 4-hydroxy-3-(3-isoxazolocarbamyl)-2h-1,2-benzothiazine 1,dioxides and process for their production |
| US3769292A (en) * | 1972-04-28 | 1973-10-30 | Warner Lambert Co | N-(pyridyl)2h 1-benzothiopyran-3-carboxamide-4-hydroxy 1,1-dioxides |
| US3853862A (en) * | 1973-04-23 | 1974-12-10 | Pfizer | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
| US3927002A (en) * | 1973-04-23 | 1975-12-16 | Pfizer | N-(pyridyl)-N{40 -alkyl-N{40 -(2-alkoxycarbonylbenzenesulfonyl)-glycineamides and derivatives |
| SE411208B (sv) * | 1973-06-15 | 1979-12-10 | Merck & Co Inc | Forfarande for framstellning av merkaptoalkylpyridiner med en etenylsubstituent |
| US3891637A (en) * | 1974-10-01 | 1975-06-24 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| DE2539112C2 (de) * | 1975-09-03 | 1983-12-15 | Dr. Karl Thomae Gmbh, 7950 Biberach | 4-Hydroxy-2H-naphtho[2,1-e]-1,2-thiazin-3-carboxamid-1,1-dioxide, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| SE421792B (sv) * | 1976-01-12 | 1982-02-01 | Pfizer | Forfarande for framstellning av n-(2-pyridyl)-4-hydroxi-2-metyl-2h-1,2-benso-tiazin-3-karboxamid-1,1-dioxid |
| MC1135A1 (fr) * | 1976-02-23 | 1977-11-18 | Hoffmann La Roche | Derives de thiazine |
| US4100347A (en) | 1976-06-10 | 1978-07-11 | Pfizer Inc. | 3,4-Dihydro-2-methyl-4-oxo-2H-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide |
| JPS5342370U (enExample) * | 1976-09-16 | 1978-04-12 | ||
| LU78009A1 (de) * | 1977-08-22 | 1979-05-23 | Hoffmann La Roche | Verfahren zur herstellung von thiazinderivaten |
| DE2756113A1 (de) * | 1977-12-16 | 1979-06-21 | Thomae Gmbh Dr K | Neue 4-hydroxy-2h-1,2-benzothiazin- 3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| US4213980A (en) * | 1978-01-30 | 1980-07-22 | Ciba-Geigy Corporation | Azathianaphthalenes |
| US4246263A (en) | 1979-10-15 | 1981-01-20 | Pfizer Inc. | Antiinflammatory and immunoregulatory pyrimidines, their method of use and pharmaceutical compositions |
| JPS57140785A (en) * | 1981-02-24 | 1982-08-31 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation, and pharmaceutical composition containing the same |
| GB2078738B (en) * | 1980-06-27 | 1983-11-30 | Mitsui Toatsu Chemicals | Benzothiazine derivatives |
| JPS5714589A (en) * | 1980-06-27 | 1982-01-25 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation and drug composition |
| US4289879A (en) * | 1980-09-29 | 1981-09-15 | Pfizer Inc. | Synthetic method and intermediate for piroxicam |
| US4309427A (en) * | 1981-01-15 | 1982-01-05 | Pfizer Inc. | Benzothiazine dioxide derivatives |
| US4434164A (en) | 1981-06-01 | 1984-02-28 | Pfizer Inc. | Crystalline benzothiazine dioxide salts |
| US4434163A (en) | 1981-06-01 | 1984-02-28 | Pfizer Inc. | Water-soluble benzothiazine dioxide salts |
| US4474955A (en) * | 1981-06-17 | 1984-10-02 | Vincenzo Iannella | Process for preparing 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-[N-(2-pyridinyl)carboxamide]-1,1-dioxide, and its phosphoric ester |
| GT198276334A (es) * | 1981-08-03 | 1984-01-10 | Procedimiento e inter-medios para la produccion de carboxamidas de benzotiazina. | |
| IN159273B (enExample) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| CA1197244A (en) * | 1982-04-16 | 1985-11-26 | Medichem, S.A. | Process for the preparation of 4-hydroxy-2-methyl-2h- 1,2-benzothiazine-3-carboxamide-1,1-dioxides |
| SU1306476A3 (ru) * | 1982-06-17 | 1987-04-23 | Пфайзер,Инк (Фирма) | Способ получени 2-метил-3- @ -(2-пиридил)-карбамоил-3,4-дигидро-2 @ -1,2-бензтиазин-1,1-диоксида |
| DE3374865D1 (en) * | 1982-07-07 | 1988-01-21 | Siegfried Ag | Process for preparing 4-hydroxy-2-methyl-n-2-pyridyl-2h-1,2-benzothiazine-3-carboxamide 1,1-dioxide |
| JPS5913714A (ja) * | 1982-07-13 | 1984-01-24 | Taito Pfizer Kk | 外用消炎鎮痛剤 |
| US4483982A (en) * | 1982-09-02 | 1984-11-20 | Pfizer Inc. | Processes for preparing piroxicam and intermediates leading thereto |
| DE3237473A1 (de) * | 1982-10-09 | 1984-04-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue 4-hydroxy-2h-1,2-benzothiazin-3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung, ihre verwendung und diese verbindungen enthaltende arzneimittel |
| IT1153293B (it) * | 1982-10-22 | 1987-01-14 | Francia Famaceutici S R L | Derivati del 4-idrossi-2-metil-2h-1, 2-benzotiazina-3-carbossamide 1, 1-biossido e procedimento per la loro preparazione |
| JPS59193879A (ja) * | 1983-03-31 | 1984-11-02 | Fujisawa Pharmaceut Co Ltd | トロポン誘導体 |
| JPS59179683U (ja) * | 1983-05-19 | 1984-11-30 | 寺田毛織株式会社 | 貼り合わせふとん |
| GR80576B (en) * | 1983-10-17 | 1984-11-29 | Fujisawa Pharmaceutical Co | Thiazine derivatives, process for preparation thereof and pharmaceutical composition comprising the same |
| US4551452A (en) * | 1983-12-21 | 1985-11-05 | Pfizer Inc. | Anti-inflammatory 2-methyl-2H-1,2-benzo-(or -thieno-)thiazine-3-carboxamide 1,1-dioxide derivatives, compositions, and method of use therefor |
| US4656265A (en) * | 1984-06-21 | 1987-04-07 | Pfizer Inc. | Cyclic prodrugs of antiinflammatory oxicams |
| DE3437232A1 (de) * | 1984-10-10 | 1986-04-17 | Mack Chem Pharm | Stabilisierte injektionsloesungen von piroxicam |
| US4582831A (en) | 1984-11-16 | 1986-04-15 | Pfizer Inc. | Anti-inflammatory polymorphic monoethanolamine salt of N-(2-pyridyl)-2-methyl-4-hydroxy-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide compound, composition, and method of use therefor |
| CH663899A5 (fr) * | 1985-03-20 | 1988-01-29 | Nestle Sa | Procede pour la preparation d'une composition a base d'un principe actif de faible hydrosolubilite finement divise. |
| US4623486A (en) | 1985-05-29 | 1986-11-18 | Pfizer Inc. | [4-substituted benzoyloxy]-N-substituted-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxides having anti-arthritic activity |
| US4610982A (en) * | 1985-06-03 | 1986-09-09 | Pfizer Inc. | Anti-inflammatory benzo- and thieno-1,2-thiazine-3-carboxamide 1,1-dioxide derivatives, compositions, and method of use therefor |
| US4761424A (en) * | 1985-10-01 | 1988-08-02 | Warner-Lambert Company | Enolamides, pharmaceutical compositions and methods for treating inflammation |
| US4829062A (en) * | 1986-05-16 | 1989-05-09 | Pfizer Inc. | Benzothiazine dioxide derivatives |
| ES2031514T3 (es) * | 1986-08-29 | 1992-12-16 | Pfizer Inc. | 2-guanidino-4-ariltiazoles para el tratamiento de ulceras pepticas. |
| US5196410A (en) * | 1986-10-31 | 1993-03-23 | Pfizer Inc. | Transdermal flux enhancing compositions |
| WO1988009793A1 (en) * | 1987-06-10 | 1988-12-15 | Pfizer Inc. | 3,4-DIHYDRO-2-ALKYL-3-OXO-N-ARYL-2H-[1]BENZOTHIENO[3,2-e]-1,2-THIAZINE-4-CARBOXAMIDE-1,1-DIOXIDES |
| US5081118A (en) * | 1987-10-26 | 1992-01-14 | Pfizer Inc. | Benzothiazine dioxide derivatives |
| JPH0629271B2 (ja) * | 1988-03-09 | 1994-04-20 | 株式会社日本ハイポックス | ベンゾチアジン―1,1―ジオキシド誘導体及びそれを含有する医薬組成物 |
| HU200926B (en) * | 1988-10-28 | 1990-09-28 | Egyt Gyogyszervegyeszeti Gyar | Pharmaceutical composition comprising piroxicam and lactose for use in making tablets or capsules |
| JPH0717589B2 (ja) * | 1990-01-22 | 1995-03-01 | ファイザー製薬株式会社 | 新規1,3―ジカルボニル化合物およびその組成物 |
| JP2988739B2 (ja) * | 1990-04-16 | 1999-12-13 | 協和醗酵工業株式会社 | 1,8−ナフチリジン−2−オン誘導体 |
| DE4141218A1 (de) * | 1991-12-13 | 1993-06-17 | Luitpold Werk Chem Pharm | Thiadiazincarbonsaeureamidderivate, verfahren zu ihrer herstellung und arzneimittel |
| JP2964195B2 (ja) * | 1992-04-28 | 1999-10-18 | エスエス製薬株式会社 | ピロキシカム錠及びその製造法 |
| US5362758A (en) * | 1992-09-18 | 1994-11-08 | Pfizer Inc. | Ophthalmic piroxicam solution |
| US5420124A (en) * | 1994-01-12 | 1995-05-30 | Kim; Young S. | Stable, painless piroxicam potassium injectable composition |
| US5436241A (en) * | 1994-01-14 | 1995-07-25 | Bristol-Myers Squibb Company | Topical anti-inflammatory compositions containing piroxicam |
| WO1997046532A1 (en) * | 1996-06-03 | 1997-12-11 | Boehringer Ingelheim Pharmaceuticals, Inc. | 2-benzyl-4-sulfonyl-4h-isoquinolin-1,3-diones and their use as anti-inflammatory agents |
| US5952328A (en) * | 1997-11-12 | 1999-09-14 | Cephalon, Inc. | Benzothiazo and related heterocyclic group-containing cysteine and serine protease inhibitors |
| JP2002528495A (ja) | 1998-10-30 | 2002-09-03 | ニトロメド インコーポレーテッド | ニトロソ化およびニトロシル化された非ステロイド抗炎症性化合物、組成物および使用方法 |
| IT1308633B1 (it) | 1999-03-02 | 2002-01-09 | Nicox Sa | Nitrossiderivati. |
| IT1318673B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Farmaci per le disfunzioni sessuali. |
| IT1318674B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Faramaci per l'incontinenza. |
| US6544556B1 (en) | 2000-09-11 | 2003-04-08 | Andrx Corporation | Pharmaceutical formulations containing a non-steroidal antiinflammatory drug and a proton pump inhibitor |
| ITMI20020773A1 (it) * | 2002-04-11 | 2003-10-13 | Nicox Sa | Farmaci per il trattamento dell'artrite |
| EP1653952A4 (en) * | 2003-08-06 | 2007-04-04 | Pfizer Prod Inc | OXAZOLE COMPOUNDS FOR THE TREATMENT OF NEURODEEGENERATIVE DISORDER |
| US20060047171A1 (en) * | 2003-12-22 | 2006-03-02 | Harold Meckler | Catalytic hydrogenation of nitriles to produce capsaicinoid derivatives and amine compounds, and methods for purifying and obtaining the polymorphs thereof |
| US20050222227A1 (en) * | 2004-04-01 | 2005-10-06 | Pfizer Inc | Oxazole-amine compounds for the treatment of neurodegenerative disorders |
| CA2657606A1 (en) | 2006-03-08 | 2007-09-13 | Cortria Corporation | Combination therapy with non-selective cox inhibitors to prevent cox-related gastric injuries |
| FR2942797B1 (fr) * | 2009-03-03 | 2011-04-29 | Pf Medicament | Derives de benzothiazines, leur preparation et leur application a titre de medicaments |
| CN101665472B (zh) * | 2009-06-15 | 2011-08-24 | 威海迪素制药有限公司 | 2-甲基-3,4-二氢-4-氧代-2h-1,2-苯并噻嗪-3-羧酸乙酯-1,1-二氧化物的制备方法 |
| ITUB20152229A1 (it) * | 2015-07-16 | 2017-01-16 | Edmond Pharma Srl | Processo per la preparazione di farmaci antiinfiammatori non steroidei della classe oxicam |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1302858B (enExample) * | 1962-09-21 | 1972-05-04 |
-
1968
- 1968-08-27 US US767594*A patent/US3591584A/en not_active Expired - Lifetime
- 1968-12-31 GB GB1257180D patent/GB1257180A/en not_active Expired
-
1969
- 1969-08-12 NO NO03274/69A patent/NO129746B/no unknown
- 1969-08-15 IL IL32836A patent/IL32836A/en unknown
- 1969-08-25 FI FI692460A patent/FI51189C/fi active
- 1969-08-25 PH PH10669A patent/PH10029A/en unknown
- 1969-08-25 BR BR211817/69A patent/BR6911817D0/pt unknown
- 1969-08-26 NL NL6912981.A patent/NL157013B/xx not_active IP Right Cessation
- 1969-08-26 DE DE1943265A patent/DE1943265C3/de not_active Expired
- 1969-08-26 ES ES370861A patent/ES370861A1/es not_active Expired
- 1969-08-26 AT AT814669A patent/AT294113B/de not_active IP Right Cessation
- 1969-08-26 AT AT936670A patent/AT298503B/de not_active IP Right Cessation
- 1969-08-26 BE BE737962D patent/BE737962A/xx not_active IP Right Cessation
- 1969-08-26 DK DK457069A patent/DK145297C/da not_active IP Right Cessation
- 1969-08-26 DE DE1967325A patent/DE1967325C2/de not_active Expired
- 1969-08-26 CH CH1291469A patent/CH520705A/fr not_active IP Right Cessation
- 1969-08-27 FR FR6929284A patent/FR2016455B1/fr not_active Expired
- 1969-08-27 SE SE6911871A patent/SE373854B/xx unknown
- 1969-08-27 JP JP44067265A patent/JPS50677B1/ja active Pending
-
1973
- 1973-01-15 SE SE7300511A patent/SE402459B/xx unknown
- 1973-07-24 JP JP48082782A patent/JPS5142114B1/ja active Pending
- 1973-12-30 MY MY310/73A patent/MY7300310A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| FI51189B (enExample) | 1976-08-02 |
| IL32836A0 (en) | 1969-11-12 |
| IL32836A (en) | 1972-08-30 |
| DK145297C (da) | 1983-03-14 |
| JPS5142114B1 (enExample) | 1976-11-13 |
| PH10029A (en) | 1976-07-13 |
| SE373854B (enExample) | 1975-02-17 |
| DE1943265B2 (de) | 1981-05-14 |
| DE1967325C2 (de) | 1982-03-18 |
| DE1943265A1 (de) | 1970-08-13 |
| FR2016455A1 (enExample) | 1970-05-08 |
| US3591584A (en) | 1971-07-06 |
| JPS50677B1 (enExample) | 1975-01-10 |
| FR2016455B1 (enExample) | 1974-02-01 |
| MY7300310A (en) | 1973-12-31 |
| AT298503B (de) | 1972-05-10 |
| NL6912981A (enExample) | 1970-03-03 |
| SE402459B (sv) | 1978-07-03 |
| FI51189C (fi) | 1976-11-10 |
| AT294113B (de) | 1971-11-10 |
| GB1257180A (enExample) | 1971-12-15 |
| BR6911817D0 (pt) | 1973-02-13 |
| NO129746B (enExample) | 1974-05-20 |
| DK145297B (da) | 1982-10-25 |
| DE1967325B2 (de) | 1981-08-13 |
| CH520705A (fr) | 1972-03-31 |
| BE737962A (enExample) | 1970-02-26 |
| NL157013B (nl) | 1978-06-15 |
| ES370861A1 (es) | 1971-07-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1943265C3 (de) | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide | |
| DE2928485A1 (de) | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen | |
| DD216929A5 (de) | Verfahren zur herstellung von thiazolidinderivaten | |
| DE3231255A1 (de) | Tetrazin-derivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DE2724989A1 (de) | Guanidinderivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE2918523A1 (de) | Lactam-n-essigsaeuren und deren amide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| DE2163601A1 (de) | Arzneimittel mit einem Gehalt an (3,5,3,5-Tetraoxo)-1,2-dipiperazinoalkanverbindungen und Verfahren zur Herstellung der Verbindungen | |
| DE3880077T2 (de) | Mittel gegen angst. | |
| EP0185909B1 (de) | 5-Alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH631172A5 (de) | Verfahren zur herstellung von neuen 1,2-benzisothiazolinonen-3. | |
| DE3532279A1 (de) | 1,4-benzoxathiin-derivate | |
| DE2535599C2 (de) | Substituierte Zimtsäureamide, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthalten | |
| EP0006217B1 (de) | Substituierte Aminoalkansäuren, ihre Verwendung und Herstellung und sie enthaltende Arzneimittel | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE3246148A1 (de) | Pyrazolo(4.3-b)(1.4)oxazine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2457309A1 (de) | 2-phenylhydrazinothiazolin- beziehungsweise 2-phenylhydrazinothiazininderivate sowie ihre verwendung und verfahren zur herstellung derselben | |
| EP0088323B1 (de) | Imidazothiadiazolalkencarbonsäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| EP0017705A1 (de) | Phenylalanyltryptophan-Derivate, sie enthaltende Arzneimittel, ihre Herstellung und Verwendung | |
| DE69012451T2 (de) | Cyanoguanidin-Derivate. | |
| DE2319281A1 (de) | Diuretisches und antihypertensives mittel | |
| EP0006218B1 (de) | Substituierte Aminosäuren, ihre Verwendung und Herstellung und sie enthaltende Arzneimittel | |
| DE2856722A1 (de) | Acylhydrocarbylaminoalkansaeuren, ihre herstellung und verwendung sowie sie enthaltende arzneimittel | |
| DE69025819T2 (de) | Stickstoff- und schwefelenthaltende heterocyclische Verbindungen, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| EP0158083A2 (de) | Arzneimittel | |
| DE1159458B (de) | Verfahren zur Herstellung spinalblockierend wirksamer s-Triazine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| AH | Division in |
Ref country code: DE Ref document number: 1967325 Format of ref document f/p: P |