DE1943265C3 - Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide - Google Patents
Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxideInfo
- Publication number
- DE1943265C3 DE1943265C3 DE1943265A DE1943265A DE1943265C3 DE 1943265 C3 DE1943265 C3 DE 1943265C3 DE 1943265 A DE1943265 A DE 1943265A DE 1943265 A DE1943265 A DE 1943265A DE 1943265 C3 DE1943265 C3 DE 1943265C3
- Authority
- DE
- Germany
- Prior art keywords
- benzothiazine
- dihydro
- methyl
- oxo
- dioxide
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- VSCYCJOVRGSJBT-UHFFFAOYSA-N 3,4-dihydro-2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NCCC2=C1 VSCYCJOVRGSJBT-UHFFFAOYSA-N 0.000 title description 3
- QRAOZQGIUIDZQZ-UHFFFAOYSA-N 4-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1,4-benzoxazine Chemical compound C=1C=C2N(C)CCOC2=CC=1B1OC(C)(C)C(C)(C)O1 QRAOZQGIUIDZQZ-UHFFFAOYSA-N 0.000 claims 1
- -1 2-thiazolyl Chemical group 0.000 description 50
- 238000002844 melting Methods 0.000 description 43
- 230000008018 melting Effects 0.000 description 43
- 238000006243 chemical reaction Methods 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 24
- 150000001875 compounds Chemical class 0.000 description 24
- 239000000243 solution Substances 0.000 description 21
- 238000000034 method Methods 0.000 description 18
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 15
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 15
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 11
- 239000000203 mixture Substances 0.000 description 11
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 10
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 238000002360 preparation method Methods 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 239000011541 reaction mixture Substances 0.000 description 9
- 150000003839 salts Chemical class 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 8
- CGIGDMFJXJATDK-UHFFFAOYSA-N indomethacin Chemical compound CC1=C(CC(O)=O)C2=CC(OC)=CC=C2N1C(=O)C1=CC=C(Cl)C=C1 CGIGDMFJXJATDK-UHFFFAOYSA-N 0.000 description 8
- 239000000463 material Substances 0.000 description 8
- 238000001953 recrystallisation Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Substances OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 7
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- 239000007787 solid Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 229940121363 anti-inflammatory agent Drugs 0.000 description 6
- 239000002260 anti-inflammatory agent Substances 0.000 description 6
- 239000012948 isocyanate Substances 0.000 description 6
- 150000002513 isocyanates Chemical class 0.000 description 6
- 238000010992 reflux Methods 0.000 description 6
- 238000005915 ammonolysis reaction Methods 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 241001465754 Metazoa Species 0.000 description 4
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229960000905 indomethacin Drugs 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- 231100000252 nontoxic Toxicity 0.000 description 4
- 230000003000 nontoxic effect Effects 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 229960002895 phenylbutazone Drugs 0.000 description 4
- VYMDGNCVAMGZFE-UHFFFAOYSA-N phenylbutazonum Chemical compound O=C1C(CCCC)C(=O)N(C=2C=CC=CC=2)N1C1=CC=CC=C1 VYMDGNCVAMGZFE-UHFFFAOYSA-N 0.000 description 4
- 230000035484 reaction time Effects 0.000 description 4
- 239000002002 slurry Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- CZQIJQFTRGDODI-UHFFFAOYSA-N 1-bromo-4-isocyanatobenzene Chemical compound BrC1=CC=C(N=C=O)C=C1 CZQIJQFTRGDODI-UHFFFAOYSA-N 0.000 description 3
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 3
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 3
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 230000003110 anti-inflammatory effect Effects 0.000 description 3
- 150000003857 carboxamides Chemical group 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000011282 treatment Methods 0.000 description 3
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- GHNLJDPNIAIWOQ-UHFFFAOYSA-N 2h-1$l^{6},2-benzothiazine 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)NC=CC2=C1 GHNLJDPNIAIWOQ-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 2
- XQIRIYJOVQEBDL-UHFFFAOYSA-N 4h-1,2-benzothiazin-3-one Chemical compound C1=CC=C2SNC(=O)CC2=C1 XQIRIYJOVQEBDL-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- 206010030113 Oedema Diseases 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000538 analytical sample Substances 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000000378 dietary effect Effects 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 2
- 239000000945 filler Substances 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 230000004968 inflammatory condition Effects 0.000 description 2
- 230000002757 inflammatory effect Effects 0.000 description 2
- 230000002401 inhibitory effect Effects 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 235000015110 jellies Nutrition 0.000 description 2
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- UGJYHTWLUYDADV-UHFFFAOYSA-N n,2,5-trimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(C)=CC=C1C UGJYHTWLUYDADV-UHFFFAOYSA-N 0.000 description 2
- BAJXNEYFJDMIFP-UHFFFAOYSA-N n,2-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=CC=C1C BAJXNEYFJDMIFP-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 125000004307 pyrazin-2-yl group Chemical group [H]C1=C([H])N=C(*)C([H])=N1 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- ZTLFUNAIEFGYCS-UHFFFAOYSA-N 1,1-dioxo-N-phenyl-2H-1lambda6,2-benzothiazine-4-carboxamide Chemical compound S1(NC=C(C2=C1C=CC=C2)C(=O)NC2=CC=CC=C2)(=O)=O ZTLFUNAIEFGYCS-UHFFFAOYSA-N 0.000 description 1
- JGLLUEYZVVULEH-UHFFFAOYSA-N 1,1-dioxo-N-phenyl-2H-thiazine-3-carboxamide Chemical compound S1(NC(=CC=C1)C(=O)NC1=CC=CC=C1)(=O)=O JGLLUEYZVVULEH-UHFFFAOYSA-N 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical compound C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- OLBJNSPBWLCTOT-UHFFFAOYSA-N 2,4-dichloro-1-isocyanatobenzene Chemical compound ClC1=CC=C(N=C=O)C(Cl)=C1 OLBJNSPBWLCTOT-UHFFFAOYSA-N 0.000 description 1
- VXGHWBHTDJQBCP-UHFFFAOYSA-N 2-[2-(methylsulfamoyl)phenyl]acetic acid Chemical compound CNS(=O)(=O)C1=CC=CC=C1CC(O)=O VXGHWBHTDJQBCP-UHFFFAOYSA-N 0.000 description 1
- MWYDQCHUGSUGQO-UHFFFAOYSA-N 2-[4-methyl-2-(methylsulfamoyl)phenyl]acetic acid Chemical compound CNS(=O)(=O)C1=CC(C)=CC=C1CC(O)=O MWYDQCHUGSUGQO-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- QUNRGGUMLSPQRW-UHFFFAOYSA-N 2-methyl-1,1,3-trioxo-N-[3-(trifluoromethyl)phenyl]-4H-1lambda6,2-benzothiazine-4-carboxamide Chemical compound FC(C=1C=C(NC(=O)C2C(N(S(C3=C2C=CC=C3)(=O)=O)C)=O)C=CC1)(F)F QUNRGGUMLSPQRW-UHFFFAOYSA-N 0.000 description 1
- CPIFFCMMBZLKDK-UHFFFAOYSA-N 2-methyl-1,1-dioxo-3h-1$l^{6},2-benzothiazin-4-one Chemical compound C1=CC=C2S(=O)(=O)N(C)CC(=O)C2=C1 CPIFFCMMBZLKDK-UHFFFAOYSA-N 0.000 description 1
- GGPCERYTJXDGOH-UHFFFAOYSA-N 2-methyl-1,1-dioxo-4h-1$l^{6},2-benzothiazin-3-one Chemical compound C1=CC=C2S(=O)(=O)N(C)C(=O)CC2=C1 GGPCERYTJXDGOH-UHFFFAOYSA-N 0.000 description 1
- LKLPGDADQQKOMU-UHFFFAOYSA-N 2-methyl-n-(6-methylpyridin-2-yl)-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxamide Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N(C)C1C(=O)NC1=CC=CC(C)=N1 LKLPGDADQQKOMU-UHFFFAOYSA-N 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- WNVACTGALQEPAI-UHFFFAOYSA-N C[N+]1(S(C2=C(CC1=O)C=CC=C2)=O)[O-] Chemical compound C[N+]1(S(C2=C(CC1=O)C=CC=C2)=O)[O-] WNVACTGALQEPAI-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 206010061218 Inflammation Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 240000003183 Manihot esculenta Species 0.000 description 1
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 1
- BXDZOYLPNAIDOC-UHFFFAOYSA-N N-[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]-1-[2-[2-[2-[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethoxy]ethoxy]ethoxy]ethylamino]-2-oxoethyl]piperidine-4-carboxamide Chemical compound CC(C)(C)c1cnc(CSc2cnc(NC(=O)C3CCN(CC(=O)NCCOCCOCCOCCNc4cccc5C(=O)N(C6CCC(=O)NC6=O)C(=O)c45)CC3)s2)o1 BXDZOYLPNAIDOC-UHFFFAOYSA-N 0.000 description 1
- WYJRFFQIYCIPBJ-UHFFFAOYSA-N ON(C=C(C(NC1=CC=CC=C1)=O)C1=C2C=CC=C1)S2=O Chemical compound ON(C=C(C(NC1=CC=CC=C1)=O)C1=C2C=CC=C1)S2=O WYJRFFQIYCIPBJ-UHFFFAOYSA-N 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 244000000231 Sesamum indicum Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000002595 Solanum tuberosum Nutrition 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 210000004100 adrenal gland Anatomy 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229940095564 anhydrous calcium sulfate Drugs 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 230000002917 arthritic effect Effects 0.000 description 1
- 206010003246 arthritis Diseases 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- REHHBTUVMSHZNT-UHFFFAOYSA-N bromocyclohexatriene Chemical compound BrC1=CC=C=C[CH]1 REHHBTUVMSHZNT-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010418 carrageenan Nutrition 0.000 description 1
- 229920001525 carrageenan Polymers 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 235000008504 concentrate Nutrition 0.000 description 1
- 235000009508 confectionery Nutrition 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000012937 correction Methods 0.000 description 1
- 239000003246 corticosteroid Substances 0.000 description 1
- 229960001334 corticosteroids Drugs 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000002651 drug therapy Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- RYXLGZSHBXBSCX-UHFFFAOYSA-N ethyl 2-methyl-1,1,3-trioxo-4h-1$l^{6},2-benzothiazine-4-carboxylate Chemical compound C1=CC=C2C(C(=O)OCC)C(=O)N(C)S(=O)(=O)C2=C1 RYXLGZSHBXBSCX-UHFFFAOYSA-N 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 230000004054 inflammatory process Effects 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000006210 lotion Substances 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- GIQCXAYKJYPPFK-UHFFFAOYSA-N methyl 2-methyl-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxylate Chemical compound C1=CC=C2C(=O)C(C(=O)OC)N(C)S(=O)(=O)C2=C1 GIQCXAYKJYPPFK-UHFFFAOYSA-N 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- MGRYVMQUVRQTST-UHFFFAOYSA-N n-(5-chloropyridin-2-yl)-2-methyl-1,1,4-trioxo-3h-1$l^{6},2-benzothiazine-3-carboxamide Chemical compound O=C1C2=CC=CC=C2S(=O)(=O)N(C)C1C(=O)NC1=CC=C(Cl)C=N1 MGRYVMQUVRQTST-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 239000008203 oral pharmaceutical composition Substances 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 238000006462 rearrangement reaction Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 239000008159 sesame oil Substances 0.000 description 1
- 235000011803 sesame oil Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003270 steroid hormone Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/54—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame
- A61K31/5415—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with at least one nitrogen and one sulfur as the ring hetero atoms, e.g. sulthiame ortho- or peri-condensed with carbocyclic ring systems, e.g. phenothiazine, chlorpromazine, piroxicam
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D279/00—Heterocyclic compounds containing six-membered rings having one nitrogen atom and one sulfur atom as the only ring hetero atoms
- C07D279/02—1,2-Thiazines; Hydrogenated 1,2-thiazines
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- Animal Behavior & Ethology (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen- Or Sulfur-Containing Heterocyclic Ring Compounds With Rings Of Six Or More Members (AREA)
- Production Of Liquid Hydrocarbon Mixture For Refining Petroleum (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US76759468A | 1968-08-27 | 1968-08-27 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE1943265A1 DE1943265A1 (de) | 1970-08-13 |
| DE1943265B2 DE1943265B2 (de) | 1981-05-14 |
| DE1943265C3 true DE1943265C3 (de) | 1982-02-04 |
Family
ID=25079964
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1943265A Expired DE1943265C3 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
| DE1967325A Expired DE1967325C2 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE1967325A Expired DE1967325C2 (de) | 1968-08-27 | 1969-08-26 | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3591584A (enExample) |
| JP (2) | JPS50677B1 (enExample) |
| AT (2) | AT294113B (enExample) |
| BE (1) | BE737962A (enExample) |
| BR (1) | BR6911817D0 (enExample) |
| CH (1) | CH520705A (enExample) |
| DE (2) | DE1943265C3 (enExample) |
| DK (1) | DK145297C (enExample) |
| ES (1) | ES370861A1 (enExample) |
| FI (1) | FI51189C (enExample) |
| FR (1) | FR2016455B1 (enExample) |
| GB (1) | GB1257180A (enExample) |
| IL (1) | IL32836A (enExample) |
| MY (1) | MY7300310A (enExample) |
| NL (1) | NL157013B (enExample) |
| NO (1) | NO129746B (enExample) |
| PH (1) | PH10029A (enExample) |
| SE (2) | SE373854B (enExample) |
Families Citing this family (75)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3692780A (en) * | 1970-10-14 | 1972-09-19 | Warner Lambert Pharmaceutical | 4-substituted-2-alkyl-3-phenyl-2h-1,2-benzothiazine-1,1-dioxides and processes for their production |
| US3862319A (en) * | 1971-02-09 | 1975-01-21 | Pfizer | Benzothiazine dioxides as anti-thromobotic agents |
| US3787324A (en) * | 1971-03-01 | 1974-01-22 | Warner Lambert Co | 4-hydroxy-3-(3-isoxazolocarbamyl)-2h-1,2-benzothiazine 1,dioxides and process for their production |
| DK153148C (da) * | 1971-03-01 | 1988-10-31 | Warner Lambert Co | Analogifremgangsmaade til fremstilling af 4-hydroxy-3-(3-isoxazolcarbamyl)-2h-1,2-benzothiazin-1,1-d ioxider eller alkalimetal-, jordalkalimetal- eller aminsalte deraf |
| US3769292A (en) * | 1972-04-28 | 1973-10-30 | Warner Lambert Co | N-(pyridyl)2h 1-benzothiopyran-3-carboxamide-4-hydroxy 1,1-dioxides |
| US3927002A (en) * | 1973-04-23 | 1975-12-16 | Pfizer | N-(pyridyl)-N{40 -alkyl-N{40 -(2-alkoxycarbonylbenzenesulfonyl)-glycineamides and derivatives |
| US3853862A (en) * | 1973-04-23 | 1974-12-10 | Pfizer | Production of 4-hydroxy-1,2-benzothiazine-3-carboxamides |
| SE411208B (sv) * | 1973-06-15 | 1979-12-10 | Merck & Co Inc | Forfarande for framstellning av merkaptoalkylpyridiner med en etenylsubstituent |
| US3891637A (en) * | 1974-10-01 | 1975-06-24 | Pfizer | Process for the production of carboxamides of oxo-1,2-benzothiazine-1,1-dioxides |
| DE2539112C2 (de) * | 1975-09-03 | 1983-12-15 | Dr. Karl Thomae Gmbh, 7950 Biberach | 4-Hydroxy-2H-naphtho[2,1-e]-1,2-thiazin-3-carboxamid-1,1-dioxide, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| SE421792B (sv) * | 1976-01-12 | 1982-02-01 | Pfizer | Forfarande for framstellning av n-(2-pyridyl)-4-hydroxi-2-metyl-2h-1,2-benso-tiazin-3-karboxamid-1,1-dioxid |
| MC1135A1 (fr) * | 1976-02-23 | 1977-11-18 | Hoffmann La Roche | Derives de thiazine |
| US4100347A (en) | 1976-06-10 | 1978-07-11 | Pfizer Inc. | 3,4-Dihydro-2-methyl-4-oxo-2H-1,2-benzothiazine-3-carboxylic acid-1,1-dioxide |
| JPS5342370U (enExample) * | 1976-09-16 | 1978-04-12 | ||
| LU78009A1 (de) * | 1977-08-22 | 1979-05-23 | Hoffmann La Roche | Verfahren zur herstellung von thiazinderivaten |
| DE2756113A1 (de) * | 1977-12-16 | 1979-06-21 | Thomae Gmbh Dr K | Neue 4-hydroxy-2h-1,2-benzothiazin- 3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel |
| US4213980A (en) * | 1978-01-30 | 1980-07-22 | Ciba-Geigy Corporation | Azathianaphthalenes |
| US4246263A (en) | 1979-10-15 | 1981-01-20 | Pfizer Inc. | Antiinflammatory and immunoregulatory pyrimidines, their method of use and pharmaceutical compositions |
| GB2078738B (en) * | 1980-06-27 | 1983-11-30 | Mitsui Toatsu Chemicals | Benzothiazine derivatives |
| JPS5714589A (en) * | 1980-06-27 | 1982-01-25 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation and drug composition |
| JPS57140785A (en) * | 1981-02-24 | 1982-08-31 | Mitsui Toatsu Chem Inc | Benzothiazine derivative, its preparation, and pharmaceutical composition containing the same |
| US4289879A (en) * | 1980-09-29 | 1981-09-15 | Pfizer Inc. | Synthetic method and intermediate for piroxicam |
| US4309427A (en) * | 1981-01-15 | 1982-01-05 | Pfizer Inc. | Benzothiazine dioxide derivatives |
| US4434164A (en) | 1981-06-01 | 1984-02-28 | Pfizer Inc. | Crystalline benzothiazine dioxide salts |
| US4434163A (en) | 1981-06-01 | 1984-02-28 | Pfizer Inc. | Water-soluble benzothiazine dioxide salts |
| US4474955A (en) * | 1981-06-17 | 1984-10-02 | Vincenzo Iannella | Process for preparing 4-hydroxy-2-methyl-2H-1,2-benzothiazine-3-[N-(2-pyridinyl)carboxamide]-1,1-dioxide, and its phosphoric ester |
| GT198276334A (es) * | 1981-08-03 | 1984-01-10 | Procedimiento e inter-medios para la produccion de carboxamidas de benzotiazina. | |
| IN159273B (enExample) * | 1981-10-05 | 1987-04-25 | Pfizer | |
| CA1197244A (en) * | 1982-04-16 | 1985-11-26 | Medichem, S.A. | Process for the preparation of 4-hydroxy-2-methyl-2h- 1,2-benzothiazine-3-carboxamide-1,1-dioxides |
| SU1306476A3 (ru) * | 1982-06-17 | 1987-04-23 | Пфайзер,Инк (Фирма) | Способ получени 2-метил-3- @ -(2-пиридил)-карбамоил-3,4-дигидро-2 @ -1,2-бензтиазин-1,1-диоксида |
| ATE31309T1 (de) * | 1982-07-07 | 1987-12-15 | Siegfried Ag | Verfahren zur herstellung von 4-hydroxy-2-methyln-2-pyridyl-2h-1,2-benzothiazin-3-carboxamid 1,1- dioxid. |
| JPS5913714A (ja) * | 1982-07-13 | 1984-01-24 | Taito Pfizer Kk | 外用消炎鎮痛剤 |
| US4483982A (en) * | 1982-09-02 | 1984-11-20 | Pfizer Inc. | Processes for preparing piroxicam and intermediates leading thereto |
| DE3237473A1 (de) * | 1982-10-09 | 1984-04-12 | Dr. Karl Thomae Gmbh, 7950 Biberach | Neue 4-hydroxy-2h-1,2-benzothiazin-3-carboxamid-1,1-dioxide, verfahren zu ihrer herstellung, ihre verwendung und diese verbindungen enthaltende arzneimittel |
| IT1153293B (it) * | 1982-10-22 | 1987-01-14 | Francia Famaceutici S R L | Derivati del 4-idrossi-2-metil-2h-1, 2-benzotiazina-3-carbossamide 1, 1-biossido e procedimento per la loro preparazione |
| JPS59193879A (ja) * | 1983-03-31 | 1984-11-02 | Fujisawa Pharmaceut Co Ltd | トロポン誘導体 |
| JPS59179683U (ja) * | 1983-05-19 | 1984-11-30 | 寺田毛織株式会社 | 貼り合わせふとん |
| GR80576B (en) * | 1983-10-17 | 1984-11-29 | Fujisawa Pharmaceutical Co | Thiazine derivatives, process for preparation thereof and pharmaceutical composition comprising the same |
| US4551452A (en) * | 1983-12-21 | 1985-11-05 | Pfizer Inc. | Anti-inflammatory 2-methyl-2H-1,2-benzo-(or -thieno-)thiazine-3-carboxamide 1,1-dioxide derivatives, compositions, and method of use therefor |
| US4656265A (en) * | 1984-06-21 | 1987-04-07 | Pfizer Inc. | Cyclic prodrugs of antiinflammatory oxicams |
| DE3437232A1 (de) * | 1984-10-10 | 1986-04-17 | Mack Chem Pharm | Stabilisierte injektionsloesungen von piroxicam |
| US4582831A (en) | 1984-11-16 | 1986-04-15 | Pfizer Inc. | Anti-inflammatory polymorphic monoethanolamine salt of N-(2-pyridyl)-2-methyl-4-hydroxy-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxide compound, composition, and method of use therefor |
| CH663899A5 (fr) * | 1985-03-20 | 1988-01-29 | Nestle Sa | Procede pour la preparation d'une composition a base d'un principe actif de faible hydrosolubilite finement divise. |
| US4623486A (en) * | 1985-05-29 | 1986-11-18 | Pfizer Inc. | [4-substituted benzoyloxy]-N-substituted-2H-1,2-benzothiazine-3-carboxamide 1,1-dioxides having anti-arthritic activity |
| US4610982A (en) * | 1985-06-03 | 1986-09-09 | Pfizer Inc. | Anti-inflammatory benzo- and thieno-1,2-thiazine-3-carboxamide 1,1-dioxide derivatives, compositions, and method of use therefor |
| US4761424A (en) * | 1985-10-01 | 1988-08-02 | Warner-Lambert Company | Enolamides, pharmaceutical compositions and methods for treating inflammation |
| HU199833B (en) * | 1986-05-16 | 1990-03-28 | Pfizer | Process for producing benzothiazine dioxide derivatives |
| ES2031514T3 (es) * | 1986-08-29 | 1992-12-16 | Pfizer Inc. | 2-guanidino-4-ariltiazoles para el tratamiento de ulceras pepticas. |
| US5196410A (en) * | 1986-10-31 | 1993-03-23 | Pfizer Inc. | Transdermal flux enhancing compositions |
| MX174093B (es) * | 1987-06-10 | 1994-04-21 | Pfizer | 1,1-DIOXIDOS DE 3,4-DIHIDRO-2-ALQUIL-3-OXO-N-ARIL-2H[1] BENZOTIENO[3,2-e]-1,2-TIAZINO-4-CARBOXIAMIDA |
| FI893111A7 (fi) * | 1987-10-26 | 1989-06-26 | Pfizer | Bensotiatsiinidioksidi-johdannaisia |
| JPH0629271B2 (ja) * | 1988-03-09 | 1994-04-20 | 株式会社日本ハイポックス | ベンゾチアジン―1,1―ジオキシド誘導体及びそれを含有する医薬組成物 |
| HU200926B (en) * | 1988-10-28 | 1990-09-28 | Egyt Gyogyszervegyeszeti Gyar | Pharmaceutical composition comprising piroxicam and lactose for use in making tablets or capsules |
| JPH0717589B2 (ja) * | 1990-01-22 | 1995-03-01 | ファイザー製薬株式会社 | 新規1,3―ジカルボニル化合物およびその組成物 |
| JP2988739B2 (ja) * | 1990-04-16 | 1999-12-13 | 協和醗酵工業株式会社 | 1,8−ナフチリジン−2−オン誘導体 |
| DE4141218A1 (de) * | 1991-12-13 | 1993-06-17 | Luitpold Werk Chem Pharm | Thiadiazincarbonsaeureamidderivate, verfahren zu ihrer herstellung und arzneimittel |
| JP2964195B2 (ja) * | 1992-04-28 | 1999-10-18 | エスエス製薬株式会社 | ピロキシカム錠及びその製造法 |
| US5362758A (en) * | 1992-09-18 | 1994-11-08 | Pfizer Inc. | Ophthalmic piroxicam solution |
| US5420124A (en) * | 1994-01-12 | 1995-05-30 | Kim; Young S. | Stable, painless piroxicam potassium injectable composition |
| US5436241A (en) * | 1994-01-14 | 1995-07-25 | Bristol-Myers Squibb Company | Topical anti-inflammatory compositions containing piroxicam |
| WO1997046532A1 (en) * | 1996-06-03 | 1997-12-11 | Boehringer Ingelheim Pharmaceuticals, Inc. | 2-benzyl-4-sulfonyl-4h-isoquinolin-1,3-diones and their use as anti-inflammatory agents |
| US5952328A (en) * | 1997-11-12 | 1999-09-14 | Cephalon, Inc. | Benzothiazo and related heterocyclic group-containing cysteine and serine protease inhibitors |
| WO2000025776A1 (en) | 1998-10-30 | 2000-05-11 | Nitromed, Inc. | Nitrosated and nitrosylated nonsteroidal antiinflammatory compounds, compositions and methods of use |
| IT1308633B1 (it) | 1999-03-02 | 2002-01-09 | Nicox Sa | Nitrossiderivati. |
| IT1318674B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Faramaci per l'incontinenza. |
| IT1318673B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Farmaci per le disfunzioni sessuali. |
| US6544556B1 (en) | 2000-09-11 | 2003-04-08 | Andrx Corporation | Pharmaceutical formulations containing a non-steroidal antiinflammatory drug and a proton pump inhibitor |
| ITMI20020773A1 (it) * | 2002-04-11 | 2003-10-13 | Nicox Sa | Farmaci per il trattamento dell'artrite |
| JP2007501244A (ja) * | 2003-08-06 | 2007-01-25 | ファイザー・プロダクツ・インク | 神経変性障害治療用オキサゾール化合物 |
| US20060047171A1 (en) * | 2003-12-22 | 2006-03-02 | Harold Meckler | Catalytic hydrogenation of nitriles to produce capsaicinoid derivatives and amine compounds, and methods for purifying and obtaining the polymorphs thereof |
| US20050222227A1 (en) * | 2004-04-01 | 2005-10-06 | Pfizer Inc | Oxazole-amine compounds for the treatment of neurodegenerative disorders |
| EP2026651B1 (en) | 2006-03-08 | 2013-04-17 | Cortria Corporation | Combination therapy with non-selective cox inhibitors to prevent cox-related gastric injuries |
| FR2942797B1 (fr) * | 2009-03-03 | 2011-04-29 | Pf Medicament | Derives de benzothiazines, leur preparation et leur application a titre de medicaments |
| CN101665472B (zh) * | 2009-06-15 | 2011-08-24 | 威海迪素制药有限公司 | 2-甲基-3,4-二氢-4-氧代-2h-1,2-苯并噻嗪-3-羧酸乙酯-1,1-二氧化物的制备方法 |
| ITUB20152229A1 (it) * | 2015-07-16 | 2017-01-16 | Edmond Pharma Srl | Processo per la preparazione di farmaci antiinfiammatori non steroidei della classe oxicam |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1302858B (enExample) * | 1962-09-21 | 1972-05-04 |
-
1968
- 1968-08-27 US US767594*A patent/US3591584A/en not_active Expired - Lifetime
- 1968-12-31 GB GB1257180D patent/GB1257180A/en not_active Expired
-
1969
- 1969-08-12 NO NO03274/69A patent/NO129746B/no unknown
- 1969-08-15 IL IL32836A patent/IL32836A/en unknown
- 1969-08-25 FI FI692460A patent/FI51189C/fi active
- 1969-08-25 BR BR211817/69A patent/BR6911817D0/pt unknown
- 1969-08-25 PH PH10669A patent/PH10029A/en unknown
- 1969-08-26 AT AT814669A patent/AT294113B/de not_active IP Right Cessation
- 1969-08-26 BE BE737962D patent/BE737962A/xx not_active IP Right Cessation
- 1969-08-26 NL NL6912981.A patent/NL157013B/xx not_active IP Right Cessation
- 1969-08-26 AT AT936670A patent/AT298503B/de not_active IP Right Cessation
- 1969-08-26 DE DE1943265A patent/DE1943265C3/de not_active Expired
- 1969-08-26 ES ES370861A patent/ES370861A1/es not_active Expired
- 1969-08-26 DK DK457069A patent/DK145297C/da not_active IP Right Cessation
- 1969-08-26 CH CH1291469A patent/CH520705A/fr not_active IP Right Cessation
- 1969-08-26 DE DE1967325A patent/DE1967325C2/de not_active Expired
- 1969-08-27 FR FR6929284A patent/FR2016455B1/fr not_active Expired
- 1969-08-27 SE SE6911871A patent/SE373854B/xx unknown
- 1969-08-27 JP JP44067265A patent/JPS50677B1/ja active Pending
-
1973
- 1973-01-15 SE SE7300511A patent/SE402459B/xx unknown
- 1973-07-24 JP JP48082782A patent/JPS5142114B1/ja active Pending
- 1973-12-30 MY MY310/73A patent/MY7300310A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| DE1943265A1 (de) | 1970-08-13 |
| NO129746B (enExample) | 1974-05-20 |
| MY7300310A (en) | 1973-12-31 |
| ES370861A1 (es) | 1971-07-01 |
| DK145297B (da) | 1982-10-25 |
| FI51189C (fi) | 1976-11-10 |
| US3591584A (en) | 1971-07-06 |
| DE1943265B2 (de) | 1981-05-14 |
| IL32836A (en) | 1972-08-30 |
| PH10029A (en) | 1976-07-13 |
| JPS50677B1 (enExample) | 1975-01-10 |
| DE1967325C2 (de) | 1982-03-18 |
| NL157013B (nl) | 1978-06-15 |
| SE373854B (enExample) | 1975-02-17 |
| GB1257180A (enExample) | 1971-12-15 |
| FI51189B (enExample) | 1976-08-02 |
| BE737962A (enExample) | 1970-02-26 |
| BR6911817D0 (pt) | 1973-02-13 |
| AT298503B (de) | 1972-05-10 |
| AT294113B (de) | 1971-11-10 |
| IL32836A0 (en) | 1969-11-12 |
| FR2016455B1 (enExample) | 1974-02-01 |
| CH520705A (fr) | 1972-03-31 |
| FR2016455A1 (enExample) | 1970-05-08 |
| SE402459B (sv) | 1978-07-03 |
| NL6912981A (enExample) | 1970-03-03 |
| DE1967325B2 (de) | 1981-08-13 |
| DK145297C (da) | 1983-03-14 |
| JPS5142114B1 (enExample) | 1976-11-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1943265C3 (de) | Isomere 3,4-Dihydro-2H-1,2-benzothiazin-1,1-dioxide | |
| DE2928485A1 (de) | Verwendung von harnstoffderivaten als arzneimittel bei der behandlung von fettstoffwechselstoerungen | |
| DD216929A5 (de) | Verfahren zur herstellung von thiazolidinderivaten | |
| DE3231255A1 (de) | Tetrazin-derivate, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| DE2724989A1 (de) | Guanidinderivate, verfahren zu ihrer herstellung und arzneimittel | |
| DE2918523A1 (de) | Lactam-n-essigsaeuren und deren amide, verfahren zu ihrer herstellung und diese enthaltende arzneimittel | |
| DE2163601A1 (de) | Arzneimittel mit einem Gehalt an (3,5,3,5-Tetraoxo)-1,2-dipiperazinoalkanverbindungen und Verfahren zur Herstellung der Verbindungen | |
| DE3880077T2 (de) | Mittel gegen angst. | |
| EP0185909B1 (de) | 5-Alkyl-1-phenyl-2-piperazinoalkylpyrazolin-3-on-Verbindungen sowie Verfahren und Zwischenprodukte zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| CH631172A5 (de) | Verfahren zur herstellung von neuen 1,2-benzisothiazolinonen-3. | |
| DE3532279A1 (de) | 1,4-benzoxathiin-derivate | |
| DE2535599C2 (de) | Substituierte Zimtsäureamide, Verfahren zu ihrer Herstellung und pharmazeutische Zubereitungen, welche diese Verbindungen enthalten | |
| EP0006217B1 (de) | Substituierte Aminoalkansäuren, ihre Verwendung und Herstellung und sie enthaltende Arzneimittel | |
| DE2427272C3 (de) | 1-(2-(β-Naphthyloxy)-äthyl)-3-methyl -pyrazolon-(5), Verfahren sowie Verwendung als Antithrombotikum | |
| DE3246148A1 (de) | Pyrazolo(4.3-b)(1.4)oxazine, verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE2457309A1 (de) | 2-phenylhydrazinothiazolin- beziehungsweise 2-phenylhydrazinothiazininderivate sowie ihre verwendung und verfahren zur herstellung derselben | |
| EP0088323B1 (de) | Imidazothiadiazolalkencarbonsäureamide, neue Zwischenprodukte zu ihrer Herstellung, ihre Herstellung und ihre Verwendung in Arzneimitteln | |
| EP0017705A1 (de) | Phenylalanyltryptophan-Derivate, sie enthaltende Arzneimittel, ihre Herstellung und Verwendung | |
| DE2319281A1 (de) | Diuretisches und antihypertensives mittel | |
| EP0006218B1 (de) | Substituierte Aminosäuren, ihre Verwendung und Herstellung und sie enthaltende Arzneimittel | |
| DE2856722A1 (de) | Acylhydrocarbylaminoalkansaeuren, ihre herstellung und verwendung sowie sie enthaltende arzneimittel | |
| DE69025819T2 (de) | Stickstoff- und schwefelenthaltende heterocyclische Verbindungen, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Zusammensetzungen | |
| EP0158083A2 (de) | Arzneimittel | |
| DE3710254A1 (de) | Antiulcusmittel | |
| AT367740B (de) | Verfahren zur herstellung von neuen omega-(2(n-niederalkyl-benzamido)-phenyl)-alkansaeuren und ihren salzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| OI | Miscellaneous see part 1 | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| AH | Division in |
Ref country code: DE Ref document number: 1967325 Format of ref document f/p: P |