DE1161725B - Fungizides Pflanzenschutzmittel - Google Patents
Fungizides PflanzenschutzmittelInfo
- Publication number
- DE1161725B DE1161725B DEF29581A DEF0029581A DE1161725B DE 1161725 B DE1161725 B DE 1161725B DE F29581 A DEF29581 A DE F29581A DE F0029581 A DEF0029581 A DE F0029581A DE 1161725 B DE1161725 B DE 1161725B
- Authority
- DE
- Germany
- Prior art keywords
- plants
- plant protection
- protection product
- fungicidal
- fungicidal plant
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000000855 fungicidal effect Effects 0.000 title claims description 6
- 239000004476 plant protection product Substances 0.000 title description 2
- 239000002253 acid Substances 0.000 claims description 5
- 150000001450 anions Chemical class 0.000 claims description 2
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 claims description 2
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 claims 1
- 239000011814 protection agent Substances 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 7
- 206010061217 Infestation Diseases 0.000 description 5
- 150000001875 compounds Chemical class 0.000 description 5
- 239000004480 active ingredient Substances 0.000 description 4
- 208000015181 infectious disease Diseases 0.000 description 4
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 241000233622 Phytophthora infestans Species 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 240000008067 Cucumis sativus Species 0.000 description 2
- 241000233866 Fungi Species 0.000 description 2
- 241000896218 Golovinomyces orontii Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- SNWNNVAELIRDJV-UHFFFAOYSA-N 1-dodecyl-3-methyl-2-phenyl-2H-benzimidazole Chemical class CN1C(N(C2=C1C=CC=C2)CCCCCCCCCCCC)C2=CC=CC=C2 SNWNNVAELIRDJV-UHFFFAOYSA-N 0.000 description 1
- JMZRZEXRYJUHEB-UHFFFAOYSA-N 2-carbamothioylsulfanylethyl carbamodithioate;zinc Chemical compound [Zn].NC(=S)SCCSC(N)=S JMZRZEXRYJUHEB-UHFFFAOYSA-N 0.000 description 1
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000227653 Lycopersicon Species 0.000 description 1
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 1
- 241001281803 Plasmopara viticola Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 150000001556 benzimidazoles Chemical class 0.000 description 1
- SXDBWCPKPHAZSM-UHFFFAOYSA-N bromic acid Chemical compound OBr(=O)=O SXDBWCPKPHAZSM-UHFFFAOYSA-N 0.000 description 1
- 235000010633 broth Nutrition 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 244000038559 crop plants Species 0.000 description 1
- 239000000645 desinfectant Substances 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 230000003032 phytopathogenic effect Effects 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- AMHNZOICSMBGDH-UHFFFAOYSA-L zineb Chemical compound [Zn+2].[S-]C(=S)NCCNC([S-])=S AMHNZOICSMBGDH-UHFFFAOYSA-L 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/08—Radicals containing only hydrogen and carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF29581A DE1161725B (de) | 1959-10-10 | 1959-10-10 | Fungizides Pflanzenschutzmittel |
| CH1102160A CH388011A (de) | 1959-10-10 | 1960-09-30 | Fungizide Pflanzenschutzmittel |
| US60289A US3097132A (en) | 1959-10-10 | 1960-10-04 | Fungicidal plant protection |
| GB34358/60A GB925320A (en) | 1959-10-10 | 1960-10-06 | Fungicidal compositions containing benzimidazole derivatives |
| FR840746A FR1270890A (fr) | 1959-10-10 | 1960-10-10 | Agents fongicides pour la protection des plantes |
| NL256690A NL128942C (enExample) | 1959-10-10 | 1960-10-10 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF29581A DE1161725B (de) | 1959-10-10 | 1959-10-10 | Fungizides Pflanzenschutzmittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1161725B true DE1161725B (de) | 1964-01-23 |
Family
ID=7093378
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF29581A Pending DE1161725B (de) | 1959-10-10 | 1959-10-10 | Fungizides Pflanzenschutzmittel |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3097132A (enExample) |
| CH (1) | CH388011A (enExample) |
| DE (1) | DE1161725B (enExample) |
| GB (1) | GB925320A (enExample) |
| NL (1) | NL128942C (enExample) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL256862A (enExample) * | 1959-10-14 | |||
| US3223711A (en) * | 1962-03-20 | 1965-12-14 | Hollichem Corp | Cyclic imide addition products |
| US3182070A (en) * | 1962-05-24 | 1965-05-04 | Dow Chemical Co | Benzimidazole compounds |
| US3325271A (en) * | 1963-07-17 | 1967-06-13 | United States Borax Chem | Herbicidal composition and method employing substituted benzimidazoles |
| US3255202A (en) * | 1963-08-23 | 1966-06-07 | Union Carbide Corp | Process for the preparation of 2-(acylamidoalkyl)benzimidazoles |
| US3284292A (en) * | 1963-09-10 | 1966-11-08 | Hoechst Ag | Quaternary salts of aromatic disulfonic acids and their use for combating phytopathogenic microorganisms |
| US3320273A (en) * | 1963-11-29 | 1967-05-16 | Merck & Co Inc | Trifluoroacetoxy alkenyl or alkyl benzimidazoles |
| US3419562A (en) * | 1964-03-17 | 1968-12-31 | Millmaster Onyx Corp | Quaternary ammonium acinitro compounds |
| US3336314A (en) * | 1964-12-02 | 1967-08-15 | Mobil Oil Corp | O-quinolinyl s-alkyl-alkylphos-phonodithioates |
| US3350211A (en) * | 1964-12-31 | 1967-10-31 | Merck & Co Inc | Compositions useful in controlling marine fouling and methods for their use |
| US3281427A (en) * | 1965-01-12 | 1966-10-25 | Stauffer Chemical Co | N-phthalimidomethoxymethyl-o, o-dialkyl phosphorodithioate derivatives |
| DE1645944A1 (de) * | 1965-12-06 | 1971-05-13 | Dynachim Sarl | Fungicide |
| JP5207715B2 (ja) * | 2006-12-26 | 2013-06-12 | エスケー化研株式会社 | 殺菌性組成物 |
| CN101910137A (zh) * | 2007-12-27 | 2010-12-08 | K·M·阿韦林 | 显示出再生活性、消炎活性和抗微生物活性的1,3-二烷基苯并咪唑卤化物 |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2782204A (en) * | 1955-07-01 | 1957-02-19 | Nepera Chemical Co Inc | Benzimidazole compounds |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA601091A (en) * | 1960-07-05 | C. Torgeson Dewayne | 2-heptadecylimidazoline chelate composition | |
| NL194182A (enExample) * | 1954-01-22 | |||
| US2876233A (en) * | 1956-10-29 | 1959-03-03 | Gruenenthal Chemie | 1-(p-halobenzyl)-2-methyl benzimidazoles and salts |
-
1959
- 1959-10-10 DE DEF29581A patent/DE1161725B/de active Pending
-
1960
- 1960-09-30 CH CH1102160A patent/CH388011A/de unknown
- 1960-10-04 US US60289A patent/US3097132A/en not_active Expired - Lifetime
- 1960-10-06 GB GB34358/60A patent/GB925320A/en not_active Expired
- 1960-10-10 NL NL256690A patent/NL128942C/xx active
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2782204A (en) * | 1955-07-01 | 1957-02-19 | Nepera Chemical Co Inc | Benzimidazole compounds |
Also Published As
| Publication number | Publication date |
|---|---|
| CH388011A (de) | 1965-02-15 |
| NL128942C (enExample) | 1970-05-16 |
| US3097132A (en) | 1963-07-09 |
| GB925320A (en) | 1963-05-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2312956C2 (enExample) | ||
| DE1161725B (de) | Fungizides Pflanzenschutzmittel | |
| DE1144969B (de) | Fungizide Mittel | |
| DE1170190B (de) | Fungizide Mittel | |
| DE4326860C2 (de) | Fungizides Mittel mit synergistischer Wirkung | |
| DE1159594B (de) | Antimicrobische Mittel | |
| DE1017405B (de) | Fungizide Pflanzenschutzmittel mit innertherapeutischer Wirksamkeit | |
| DE947209C (de) | Behandlung von Pflanzen zwecks Bekaempfung von Krankheitserregern, insbesondere von Pilzen | |
| DE1134855B (de) | Fungizide Pflanzenschutzmittel | |
| DE1157027B (de) | Fungizide Mittel | |
| AT227023B (de) | Fungizide Pflanzenschutzmittel | |
| AT227024B (de) | Fungizide Pflanzenschutzmittel | |
| DE1542684C (de) | Fungizide | |
| DE853532C (de) | Fungicides und baktericides Mittel | |
| DE1695270C3 (de) | Mittel zur Bekämpfung von Pilzen bei Pflanzen | |
| AT233320B (de) | Metallfreie Fungicide | |
| DE1167586B (de) | Fungizide Mittel | |
| AT226475B (de) | Fungizide Mittel | |
| DE1617973C3 (de) | Bei niederen Temperaturen beständige antimikrobielle Zusammensetzung | |
| DE956639C (de) | Fungicides Gemisch | |
| DE1017846B (de) | Fungicide und acaricide Mittel | |
| DE921180C (de) | Schaedlingsbekaempfungsmittel | |
| AT259934B (de) | Pflanzenschutzmittel | |
| DE1288745B (de) | Verwendung von substituierten Cumarinen als bakteriostatische und fungistatische Mittel | |
| DE1085374B (de) | Fungizide Mittel und Verfahren zu ihrer Herstellung |