DE2312956C2 - - Google Patents
Info
- Publication number
- DE2312956C2 DE2312956C2 DE2312956A DE2312956A DE2312956C2 DE 2312956 C2 DE2312956 C2 DE 2312956C2 DE 2312956 A DE2312956 A DE 2312956A DE 2312956 A DE2312956 A DE 2312956A DE 2312956 C2 DE2312956 C2 DE 2312956C2
- Authority
- DE
- Germany
- Prior art keywords
- plants
- carbon atoms
- cyan
- hydrogen atom
- cyano
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 claims description 21
- 239000000417 fungicide Substances 0.000 claims description 20
- CAFXGFHPOQBGJP-UHFFFAOYSA-N 2-cyano-2-hydroxyiminoacetamide Chemical class NC(=O)C(=NO)C#N CAFXGFHPOQBGJP-UHFFFAOYSA-N 0.000 claims description 14
- 230000000855 fungicidal effect Effects 0.000 claims description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 5
- FVKUIMIFQJZHTM-UHFFFAOYSA-N 2-amino-n-dodecoxy-2-oxoethanimidoyl cyanide Chemical compound CCCCCCCCCCCCON=C(C#N)C(N)=O FVKUIMIFQJZHTM-UHFFFAOYSA-N 0.000 claims description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 4
- 239000011734 sodium Chemical group 0.000 claims description 4
- 229910052708 sodium Inorganic materials 0.000 claims description 4
- ORQGCZICHIRLTG-UHFFFAOYSA-N 2-amino-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(N)=O ORQGCZICHIRLTG-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical group [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 229910052742 iron Inorganic materials 0.000 claims description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical group [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 2
- AVOBWYIQSABXDK-UHFFFAOYSA-N n-methoxy-2-(methylcarbamoylamino)-2-oxoethanimidoyl cyanide Chemical compound CNC(=O)NC(=O)C(C#N)=NOC AVOBWYIQSABXDK-UHFFFAOYSA-N 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 239000011701 zinc Chemical group 0.000 claims description 2
- 229910052725 zinc Inorganic materials 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims 6
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 claims 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 229910052791 calcium Inorganic materials 0.000 claims 1
- 239000011575 calcium Chemical group 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 239000011591 potassium Chemical group 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 239000011814 protection agent Substances 0.000 claims 1
- 125000004434 sulfur atom Chemical group 0.000 claims 1
- 241000196324 Embryophyta Species 0.000 description 54
- 238000011282 treatment Methods 0.000 description 30
- 150000001875 compounds Chemical class 0.000 description 29
- 239000004480 active ingredient Substances 0.000 description 28
- 201000010099 disease Diseases 0.000 description 26
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 26
- 239000003795 chemical substances by application Substances 0.000 description 14
- -1 n-octyl Chemical class 0.000 description 11
- 240000003768 Solanum lycopersicum Species 0.000 description 10
- 238000009472 formulation Methods 0.000 description 10
- 239000000243 solution Substances 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 241000233866 Fungi Species 0.000 description 8
- 241000233622 Phytophthora infestans Species 0.000 description 8
- 239000006185 dispersion Substances 0.000 description 8
- 230000035876 healing Effects 0.000 description 8
- 238000011534 incubation Methods 0.000 description 8
- 239000004615 ingredient Substances 0.000 description 8
- 239000004094 surface-active agent Substances 0.000 description 8
- 230000006378 damage Effects 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 125000000217 alkyl group Chemical group 0.000 description 6
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- 230000009885 systemic effect Effects 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 5
- 244000061456 Solanum tuberosum Species 0.000 description 5
- 235000002595 Solanum tuberosum Nutrition 0.000 description 5
- CRQQGFGUEAVUIL-UHFFFAOYSA-N chlorothalonil Chemical compound ClC1=C(Cl)C(C#N)=C(Cl)C(C#N)=C1Cl CRQQGFGUEAVUIL-UHFFFAOYSA-N 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229920006395 saturated elastomer Polymers 0.000 description 5
- 239000002689 soil Substances 0.000 description 5
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- 244000141359 Malus pumila Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000003905 agrochemical Substances 0.000 description 4
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 4
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 4
- 235000013399 edible fruits Nutrition 0.000 description 4
- 239000002245 particle Substances 0.000 description 4
- 239000000575 pesticide Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000007921 spray Substances 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 239000005747 Chlorothalonil Substances 0.000 description 3
- 229920003171 Poly (ethylene oxide) Chemical class 0.000 description 3
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 3
- 229920000940 maneb Polymers 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 210000000056 organ Anatomy 0.000 description 3
- 150000002923 oximes Chemical class 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 230000001681 protective effect Effects 0.000 description 3
- 230000001850 reproductive effect Effects 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000002002 slurry Substances 0.000 description 3
- 235000010288 sodium nitrite Nutrition 0.000 description 3
- KUAZQDVKQLNFPE-UHFFFAOYSA-N thiram Chemical class CN(C)C(=S)SSC(=S)N(C)C KUAZQDVKQLNFPE-UHFFFAOYSA-N 0.000 description 3
- 239000004563 wettable powder Substances 0.000 description 3
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 2
- TXHNTGRBGAZDQK-UHFFFAOYSA-N 2-(carbamoylamino)-n-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(=O)NC(N)=O TXHNTGRBGAZDQK-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical class [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 206010061217 Infestation Diseases 0.000 description 2
- 239000005809 Metiram Substances 0.000 description 2
- 206010039509 Scab Diseases 0.000 description 2
- JZFICWYCTCCINF-UHFFFAOYSA-N Thiadiazin Chemical compound S=C1SC(C)NC(C)N1CCN1C(=S)SC(C)NC1C JZFICWYCTCCINF-UHFFFAOYSA-N 0.000 description 2
- 241000219094 Vitaceae Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000011717 all-trans-retinol Substances 0.000 description 2
- 235000019169 all-trans-retinol Nutrition 0.000 description 2
- IMHBYKMAHXWHRP-UHFFFAOYSA-N anilazine Chemical compound ClC1=CC=CC=C1NC1=NC(Cl)=NC(Cl)=N1 IMHBYKMAHXWHRP-UHFFFAOYSA-N 0.000 description 2
- 125000000129 anionic group Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- JHRWWRDRBPCWTF-UHFFFAOYSA-N captafol Chemical compound C1C=CCC2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)C21 JHRWWRDRBPCWTF-UHFFFAOYSA-N 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 2
- 239000004495 emulsifiable concentrate Substances 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- WDQNIWFZKXZFAY-UHFFFAOYSA-M fentin acetate Chemical compound CC([O-])=O.C1=CC=CC=C1[Sn+](C=1C=CC=CC=1)C1=CC=CC=C1 WDQNIWFZKXZFAY-UHFFFAOYSA-M 0.000 description 2
- BFWMWWXRWVJXSE-UHFFFAOYSA-M fentin hydroxide Chemical compound C=1C=CC=CC=1[Sn](C=1C=CC=CC=1)(O)C1=CC=CC=C1 BFWMWWXRWVJXSE-UHFFFAOYSA-M 0.000 description 2
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 2
- 235000021021 grapes Nutrition 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229920000257 metiram Polymers 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- PVACLFWULIFYKF-UHFFFAOYSA-N n-carbamoyl-2-cyano-2-hydroxyiminoacetamide Chemical compound NC(=O)NC(=O)C(=NO)C#N PVACLFWULIFYKF-UHFFFAOYSA-N 0.000 description 2
- PSZYNBSKGUBXEH-UHFFFAOYSA-M naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)[O-])=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-M 0.000 description 2
- 239000002736 nonionic surfactant Substances 0.000 description 2
- 239000006187 pill Substances 0.000 description 2
- 235000012015 potatoes Nutrition 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 230000001629 suppression Effects 0.000 description 2
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical compound COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 2
- 229960002447 thiram Drugs 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 1
- SKIDNYUZJPMKFC-UHFFFAOYSA-N 1-iododecane Chemical compound CCCCCCCCCCI SKIDNYUZJPMKFC-UHFFFAOYSA-N 0.000 description 1
- GCDPERPXPREHJF-UHFFFAOYSA-N 1-iodododecane Chemical compound CCCCCCCCCCCCI GCDPERPXPREHJF-UHFFFAOYSA-N 0.000 description 1
- QSZNEJCXMCJXFT-UHFFFAOYSA-N 2-(carbamoylamino)-2-oxo-N-(3-phenylpropoxy)ethanimidoyl cyanide Chemical compound NC(=O)NC(=O)C(=NOCCCC1=CC=CC=C1)C#N QSZNEJCXMCJXFT-UHFFFAOYSA-N 0.000 description 1
- IZGHUGSNWYJVFF-UHFFFAOYSA-N 2-(carbamoylamino)-N-dodecoxy-2-oxoethanimidoyl cyanide Chemical compound C(N)(=O)NC(C(=NOCCCCCCCCCCCC)C#N)=O IZGHUGSNWYJVFF-UHFFFAOYSA-N 0.000 description 1
- ATEXUZRMCKBSNZ-UHFFFAOYSA-N 2-(carbamoylamino)-N-octoxy-2-oxoethanimidoyl cyanide Chemical compound C(N)(=O)NC(C(=NOCCCCCCCC)C#N)=O ATEXUZRMCKBSNZ-UHFFFAOYSA-N 0.000 description 1
- MEBNSSXUQVJDKA-UHFFFAOYSA-N 2-(dimethylcarbamoylamino)-N-methoxy-2-oxoethanimidoyl cyanide Chemical compound CON=C(C#N)C(=O)NC(=O)N(C)C MEBNSSXUQVJDKA-UHFFFAOYSA-N 0.000 description 1
- XBILTXZTHTVIFW-UHFFFAOYSA-N 2-amino-n-methoxy-2-sulfanylideneethanimidoyl cyanide Chemical compound CON=C(C#N)C(N)=S XBILTXZTHTVIFW-UHFFFAOYSA-N 0.000 description 1
- LGFFZORGCLXIRU-UHFFFAOYSA-N 2-amino-n-octoxy-2-oxoethanimidoyl cyanide Chemical compound CCCCCCCCON=C(C#N)C(N)=O LGFFZORGCLXIRU-UHFFFAOYSA-N 0.000 description 1
- FBVPWNIBLBCCBC-UHFFFAOYSA-N 2-cyano-2-hydroxyiminoethanethioamide Chemical compound NC(=S)C(=NO)C#N FBVPWNIBLBCCBC-UHFFFAOYSA-N 0.000 description 1
- BHPYMZQTCPRLNR-UHFFFAOYSA-N 2-cyanoethanethioamide Chemical compound NC(=S)CC#N BHPYMZQTCPRLNR-UHFFFAOYSA-N 0.000 description 1
- 244000291564 Allium cepa Species 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- 244000099147 Ananas comosus Species 0.000 description 1
- 235000007119 Ananas comosus Nutrition 0.000 description 1
- 241000208173 Apiaceae Species 0.000 description 1
- 241000924691 Aristolochia bracteolata Species 0.000 description 1
- 235000000832 Ayote Nutrition 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- 241000219122 Cucurbita Species 0.000 description 1
- 240000004244 Cucurbita moschata Species 0.000 description 1
- 235000009854 Cucurbita moschata Nutrition 0.000 description 1
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- 241000221787 Erysiphe Species 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241001270527 Phyllosticta citrullina Species 0.000 description 1
- 241000233618 Phytophthora cinnamomi Species 0.000 description 1
- 231100000674 Phytotoxicity Toxicity 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241001281805 Pseudoperonospora cubensis Species 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 241000208292 Solanaceae Species 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005843 Thiram Substances 0.000 description 1
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- RKZXQQPEDGMHBJ-LIGJGSPWSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentakis[[(z)-octadec-9-enoyl]oxy]hexyl] (z)-octadec-9-enoate Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)[C@@H](OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC RKZXQQPEDGMHBJ-LIGJGSPWSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 1
- 125000000676 alkoxyimino group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 235000021016 apples Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- RYAGRZNBULDMBW-UHFFFAOYSA-L calcium;3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Ca+2].COC1=CC=CC(CC(CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O RYAGRZNBULDMBW-UHFFFAOYSA-L 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- LDVVMCZRFWMZSG-UHFFFAOYSA-N captan Chemical compound C1C=CCC2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C21 LDVVMCZRFWMZSG-UHFFFAOYSA-N 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 230000021235 carbamoylation Effects 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N carbendazim Chemical compound C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- DGJMPUGMZIKDRO-UHFFFAOYSA-N cyanoacetamide Chemical compound NC(=O)CC#N DGJMPUGMZIKDRO-UHFFFAOYSA-N 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 1
- 229910000397 disodium phosphate Inorganic materials 0.000 description 1
- 235000019800 disodium phosphate Nutrition 0.000 description 1
- YDEXUEFDPVHGHE-GGMCWBHBSA-L disodium;(2r)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate Chemical compound [Na+].[Na+].COC1=CC=CC(C[C@H](CS([O-])(=O)=O)OC=2C(=CC(CCCS([O-])(=O)=O)=CC=2)OC)=C1O YDEXUEFDPVHGHE-GGMCWBHBSA-L 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical class CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- AWYFNIZYMPNGAI-UHFFFAOYSA-N ethylenebis(dithiocarbamic acid) Chemical compound SC(=S)NCCNC(S)=S AWYFNIZYMPNGAI-UHFFFAOYSA-N 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000007380 fibre production Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 230000003760 hair shine Effects 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 238000003306 harvesting Methods 0.000 description 1
- 239000003701 inert diluent Substances 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000011081 inoculation Methods 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229910052622 kaolinite Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- 230000011987 methylation Effects 0.000 description 1
- 238000007069 methylation reaction Methods 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- QJGRPCPCQQPZLZ-UHFFFAOYSA-N n-carbamoyl-2-cyanoacetamide Chemical compound NC(=O)NC(=O)CC#N QJGRPCPCQQPZLZ-UHFFFAOYSA-N 0.000 description 1
- 125000006610 n-decyloxy group Chemical group 0.000 description 1
- 230000009935 nitrosation Effects 0.000 description 1
- 238000007034 nitrosation reaction Methods 0.000 description 1
- 239000012053 oil suspension Substances 0.000 description 1
- 150000002888 oleic acid derivatives Chemical class 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 230000001717 pathogenic effect Effects 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 230000008654 plant damage Effects 0.000 description 1
- 239000004476 plant protection product Substances 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000056 polyoxyethylene ether Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- IJIHYLHFNAWUGR-UHFFFAOYSA-N propylene 1,2-bis(dithiocarbamic acid) Chemical compound SC(=S)NC(C)CNC(S)=S IJIHYLHFNAWUGR-UHFFFAOYSA-N 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- 235000015136 pumpkin Nutrition 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- ZIWRUEGECALFST-UHFFFAOYSA-M sodium 4-(4-dodecoxysulfonylphenoxy)benzenesulfonate Chemical compound [Na+].CCCCCCCCCCCCOS(=O)(=O)c1ccc(Oc2ccc(cc2)S([O-])(=O)=O)cc1 ZIWRUEGECALFST-UHFFFAOYSA-M 0.000 description 1
- 229940045998 sodium isethionate Drugs 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- IZWPGJFSBABFGL-GMFCBQQYSA-M sodium;2-[methyl-[(z)-octadec-9-enoyl]amino]ethanesulfonate Chemical compound [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)N(C)CCS([O-])(=O)=O IZWPGJFSBABFGL-GMFCBQQYSA-M 0.000 description 1
- LADXKQRVAFSPTR-UHFFFAOYSA-M sodium;2-hydroxyethanesulfonate Chemical compound [Na+].OCCS([O-])(=O)=O LADXKQRVAFSPTR-UHFFFAOYSA-M 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 125000005017 substituted alkenyl group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 125000000446 sulfanediyl group Chemical group *S* 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910002029 synthetic silica gel Inorganic materials 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920003169 water-soluble polymer Polymers 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/48—Y being a hydrogen or a carbon atom
- C07C275/50—Y being a hydrogen or an acyclic carbon atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23499772A | 1972-03-15 | 1972-03-15 | |
| US33045773A | 1973-02-07 | 1973-02-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2312956A1 DE2312956A1 (de) | 1973-09-20 |
| DE2312956C2 true DE2312956C2 (enExample) | 1987-10-01 |
Family
ID=26928470
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2312956A Granted DE2312956A1 (de) | 1972-03-15 | 1973-03-15 | Mittel zum bekaempfen von flunguserkrankungen bei pflanzen |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5828243B2 (enExample) |
| AR (1) | AR208496A1 (enExample) |
| AU (1) | AU474556B2 (enExample) |
| CA (1) | CA1040530A (enExample) |
| CH (1) | CH570106A5 (enExample) |
| CS (1) | CS190387B2 (enExample) |
| DD (1) | DD105112A5 (enExample) |
| DE (1) | DE2312956A1 (enExample) |
| EG (1) | EG10809A (enExample) |
| FR (1) | FR2187224B1 (enExample) |
| GB (2) | GB1425621A (enExample) |
| HU (1) | HU167737B (enExample) |
| IL (1) | IL41581A (enExample) |
| IT (1) | IT979609B (enExample) |
| PH (1) | PH16838A (enExample) |
| SU (1) | SU736856A3 (enExample) |
| ZA (1) | ZA731111B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2552867A1 (de) * | 1975-11-25 | 1977-06-02 | Du Pont | Mittel zum bekaempfen von funguserkrankungen bei pflanzen |
| US8415274B2 (en) | 2003-10-10 | 2013-04-09 | Bayer Cropscience Ag | Synergistic fungicidal active substance combinations |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE38344B1 (en) * | 1972-10-13 | 1978-02-15 | Ciba Geigy Ag | Cyano-hydroxyimino-acetamide derivatives as plant growth regulants and fungicides |
| ZA757990B (en) | 1975-01-30 | 1976-12-29 | Du Pont | Stabilized formulations of 2-alkoxyiminon-carbamoyl-2-cyanoacetamides |
| DK333276A (da) * | 1975-09-11 | 1977-03-12 | Du Pont | Fungicide, substituerede 2-cyanoacet-amidderivater |
| JPS5266631A (en) * | 1975-12-02 | 1977-06-02 | Du Pont | Combined germicide |
| US4178383A (en) | 1976-05-28 | 1979-12-11 | Bayer Aktiengesellschaft | Fungicidally active oxime-ethers of isonitrosocyanoacetamides |
| US4188401A (en) | 1977-06-04 | 1980-02-12 | Bayer Aktiengesellschaft | Combating fungi with 1-(ω-substituted pentyl)-3-(2-cyano-acetyl)-ureas |
| AT365410B (de) * | 1978-08-31 | 1982-01-11 | Ciba Geigy Ag | Mittel zum schutz von kulturpflanzen vor aggressi-ven herbiziden |
| BE870067A (fr) * | 1978-09-04 | 1979-02-28 | Ciba Geigy | Derives d'oximes pour la protection des cultures |
| DE3041998A1 (de) | 1980-11-07 | 1982-06-09 | Bayer Ag, 5090 Leverkusen | Pyrazolsubstituierte oximino-cyan-acetamid-derivate, verfahren zu ihrer herstellung sowie ihre verwendung als fungizide |
| JPS5848782U (ja) * | 1981-09-24 | 1983-04-01 | 津田駒工業株式会社 | 流体噴射式織機用メインノズル |
| CH654979A5 (de) * | 1982-01-26 | 1986-03-27 | Sandoz Ag | Fungizide und ihre verwendung. |
| DE3206235A1 (de) * | 1982-02-20 | 1983-09-01 | Bayer Ag, 5090 Leverkusen | Substituierte oximinoacetanilide, verfahren zu ihrer herstellung sowie ihre verwendung als schaedlingsbekaempfungsmittel |
| DE3222961A1 (de) * | 1982-06-19 | 1983-12-22 | Bayer Ag, 5090 Leverkusen | Azolsubstituierte oximino-cyan-acetamid-derivate |
| JPS6139182U (ja) * | 1984-08-07 | 1986-03-12 | ユニチカ株式会社 | ウオ−タジエツトル−ム用緯糸噴射ノズル |
| JPS61103485U (enExample) * | 1984-12-07 | 1986-07-01 | ||
| DE3602243A1 (de) * | 1985-06-13 | 1986-12-18 | Bayer Ag, 5090 Leverkusen | E-isomere von n(pfeil hoch)(alpha)(pfeil hoch)-(2-cyan-2-alkoximino-acetyl)-aminosaeurederivaten und -peptiden |
| DE3625497A1 (de) * | 1986-07-28 | 1988-02-11 | Bayer Ag | E/z-isomerengemische und reine z-isomere von n(pfeil hoch)(alpha)(pfeil hoch)-(2-cyan-2-alkoximinoacetyl)-aminosaeurederivaten und -peptiden |
| DE3630732A1 (de) * | 1986-09-10 | 1988-03-17 | Bayer Ag | 2-cyano-2-alkoximino-acetamide |
| US5231109A (en) * | 1986-09-10 | 1993-07-27 | Bayer Aktiengesellschaft | 2-cyano-2-alkoximino-acetamides |
| DE3702283A1 (de) * | 1987-01-27 | 1988-08-04 | Bayer Ag | Verfahren zur herstellung von 2-cyano-2-oximino-acetamid-derivaten |
| DE10349501A1 (de) | 2003-10-23 | 2005-05-25 | Bayer Cropscience Ag | Synergistische fungizide Wirkstoffkombinationen |
| EP2255648A3 (de) | 2005-06-09 | 2011-03-02 | Bayer CropScience AG | Wirkstoffkombinationen |
| DE102005026482A1 (de) | 2005-06-09 | 2006-12-14 | Bayer Cropscience Ag | Wirkstoffkombinationen |
| DE102006023263A1 (de) | 2006-05-18 | 2007-11-22 | Bayer Cropscience Ag | Synergistische Wirkstoffkombinationen |
| DE102007045920B4 (de) | 2007-09-26 | 2018-07-05 | Bayer Intellectual Property Gmbh | Synergistische Wirkstoffkombinationen |
| EP2410850A2 (de) | 2009-03-25 | 2012-02-01 | Bayer Cropscience AG | Synergistische wirkstoffkombinationen |
| AU2010272872B2 (en) | 2009-07-16 | 2014-08-28 | Bayer Intellectual Property Gmbh | Synergistic active substance combinations containing phenyl triazoles |
| EP2910126A1 (en) | 2015-05-05 | 2015-08-26 | Bayer CropScience AG | Active compound combinations having insecticidal properties |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH484604A (de) * | 1966-11-10 | 1970-01-31 | Ciba Geigy | Schädlingsbekämpfungsmittel |
| FR1542325A (fr) * | 1966-11-10 | 1968-10-11 | Ciba Geigy | Nouveaux agents pesticides |
| US3694482A (en) * | 1970-04-15 | 1972-09-26 | Exxon Research Engineering Co | Malononitrile oxime derivatives |
-
1973
- 1973-02-16 ZA ZA731111A patent/ZA731111B/xx unknown
- 1973-02-19 IL IL41581A patent/IL41581A/en unknown
- 1973-02-28 CA CA164,860A patent/CA1040530A/en not_active Expired
- 1973-02-28 IT IT21024/73A patent/IT979609B/it active
- 1973-03-05 PH PH14391A patent/PH16838A/en unknown
- 1973-03-13 HU HUDU200A patent/HU167737B/hu unknown
- 1973-03-14 CH CH373873A patent/CH570106A5/xx not_active IP Right Cessation
- 1973-03-14 AU AU53258/73A patent/AU474556B2/en not_active Expired
- 1973-03-14 SU SU731890161A patent/SU736856A3/ru active
- 1973-03-14 AR AR247003A patent/AR208496A1/es active
- 1973-03-14 DD DD169440A patent/DD105112A5/xx unknown
- 1973-03-14 CS CS731846A patent/CS190387B2/cs unknown
- 1973-03-14 EG EG94/73A patent/EG10809A/xx active
- 1973-03-14 JP JP48029098A patent/JPS5828243B2/ja not_active Expired
- 1973-03-14 FR FR737309083A patent/FR2187224B1/fr not_active Expired
- 1973-03-15 DE DE2312956A patent/DE2312956A1/de active Granted
- 1973-03-15 GB GB1245873A patent/GB1425621A/en not_active Expired
- 1973-03-15 GB GB3615575A patent/GB1425622A/en not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2552867A1 (de) * | 1975-11-25 | 1977-06-02 | Du Pont | Mittel zum bekaempfen von funguserkrankungen bei pflanzen |
| US8415274B2 (en) | 2003-10-10 | 2013-04-09 | Bayer Cropscience Ag | Synergistic fungicidal active substance combinations |
| US9006143B2 (en) | 2003-10-10 | 2015-04-14 | Bayer Intellectual Property Gmbh | Synergistic fungicidal active substance combinations |
| US9049867B2 (en) | 2003-10-10 | 2015-06-09 | Bayer Intellectual Property Gmbh | Synergistic fungicidal active substance combinations |
| US9288988B2 (en) | 2003-10-10 | 2016-03-22 | Fmc Corporation | Synergistic fungicidal active substance combinations |
Also Published As
| Publication number | Publication date |
|---|---|
| CH570106A5 (enExample) | 1975-12-15 |
| DD105112A5 (enExample) | 1974-04-12 |
| GB1425622A (en) | 1976-02-18 |
| EG10809A (en) | 1976-06-30 |
| GB1425621A (en) | 1976-02-18 |
| SU736856A3 (ru) | 1980-05-25 |
| ZA731111B (en) | 1974-03-27 |
| IL41581A0 (en) | 1973-04-30 |
| IT979609B (it) | 1974-09-30 |
| FR2187224A1 (enExample) | 1974-01-18 |
| AU474556B2 (en) | 1976-07-29 |
| HU167737B (enExample) | 1975-12-25 |
| DE2312956A1 (de) | 1973-09-20 |
| JPS5828243B2 (ja) | 1983-06-15 |
| PH16838A (en) | 1984-03-15 |
| FR2187224B1 (enExample) | 1979-02-09 |
| CA1040530A (en) | 1978-10-17 |
| CS190387B2 (en) | 1979-05-31 |
| AU5325873A (en) | 1974-09-19 |
| JPS49427A (enExample) | 1974-01-05 |
| AR208496A1 (es) | 1977-02-15 |
| IL41581A (en) | 1976-09-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2312956C2 (enExample) | ||
| DE2808317C2 (enExample) | ||
| DE1695269C3 (de) | 2-Dialkylamino-4-pyrimidinylcarbamate, Verfahren zur Herstellung derselben sowie sie enthaltende Schädlingsbekämpfungsmittel | |
| EP0158600A2 (de) | Verfahren zur selektiven Unkrautbekämpfung in Nutzpflanzenkulturen | |
| EP2238834A1 (de) | Defoliant auf Basis von Thidiazuron und 1,2,4-Triazinonen | |
| DE2703542A1 (de) | Thiazolylzimtsaeurenitrile, schaedlingsbekaempfungsmittel enthaltend diese verbindungen sowie verfahren zu ihrer herstellung | |
| DD292128A5 (de) | Biozide zubereitungen | |
| EP2238835B1 (de) | Defoliant auf Basis von Thidiazuron und Flufenacet | |
| EP2150116B1 (de) | Defoliant | |
| EP0495748A1 (de) | Akarizide Mittel | |
| DE69307882T2 (de) | Neues verfahren zur bekämpfung von insekteneier und ovizide zusammensetzungen | |
| DE69904955T2 (de) | Fungizide zusammensetzungen | |
| DE2144700C3 (de) | Benzyl-N.N-di-sek.-butylthiolcarbamat, seine Herstellung und Verwendung | |
| CH506237A (de) | Gegebenenfalls substituiertes N,N'-Bis-(carbamoyloxy)-dithiooxalimidat enthaltendes Schädlingsbekämpfungsmittel | |
| DE2552867A1 (de) | Mittel zum bekaempfen von funguserkrankungen bei pflanzen | |
| DE2748450C3 (de) | Neue Benzoyl-N'-trichloräthylidenhydrazine und neue fungizide Zubereitungen | |
| DE1017405B (de) | Fungizide Pflanzenschutzmittel mit innertherapeutischer Wirksamkeit | |
| DE2104857C3 (de) | N-Benzylcarboxamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| CH574710A5 (en) | N-carbamoyl-2-cyano-2-oxyiminoacetamines - as plant disease control agents | |
| DE2635967A1 (de) | 2-cyanacetamid-derivate und ihre herstellung und anwendung | |
| WO2007098841A2 (de) | Defoliant | |
| DE4011781A1 (de) | Herbizides mittel | |
| DE2342073C3 (de) | Verwendung von Bis-(trialkylzinn)oxiden zur Bekämpfung von Milben auf Nutzpflanzen | |
| DE2027058C3 (de) | N-acylierte Carbamate, Verfahren zur Herstellung derselben und diese Verbindungen enthaltende Schädlingsbekämpfungsmittel | |
| DE2000347C (de) | N Polychlorvinylsulfenylharnstoffe und deren Verwendung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8172 | Supplementary division/partition in: |
Ref country code: DE Ref document number: 2366620 Format of ref document f/p: P |
|
| Q171 | Divided out to: |
Ref country code: DE Ref document number: 2366620 |
|
| AG | Has addition no. |
Ref country code: DE Ref document number: 2552867 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |