CH637645A5 - Verfahren zur herstellung von cyanursaeure. - Google Patents
Verfahren zur herstellung von cyanursaeure. Download PDFInfo
- Publication number
- CH637645A5 CH637645A5 CH994778A CH994778A CH637645A5 CH 637645 A5 CH637645 A5 CH 637645A5 CH 994778 A CH994778 A CH 994778A CH 994778 A CH994778 A CH 994778A CH 637645 A5 CH637645 A5 CH 637645A5
- Authority
- CH
- Switzerland
- Prior art keywords
- urea
- biuret
- sulfolane
- temperature
- reaction
- Prior art date
Links
- ZFSLODLOARCGLH-UHFFFAOYSA-N isocyanuric acid Chemical compound OC1=NC(O)=NC(O)=N1 ZFSLODLOARCGLH-UHFFFAOYSA-N 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 201
- 239000004202 carbamide Substances 0.000 claims description 104
- OHJMTUPIZMNBFR-UHFFFAOYSA-N biuret Chemical compound NC(=O)NC(N)=O OHJMTUPIZMNBFR-UHFFFAOYSA-N 0.000 claims description 98
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 61
- 239000000203 mixture Substances 0.000 claims description 26
- 238000000034 method Methods 0.000 claims description 19
- 239000012442 inert solvent Substances 0.000 claims description 16
- 239000002904 solvent Substances 0.000 claims description 12
- -1 alkyl sulfone Chemical class 0.000 claims description 8
- 239000012535 impurity Substances 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 4
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 2
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000004434 sulfur atom Chemical group 0.000 claims description 2
- 239000011541 reaction mixture Substances 0.000 claims 3
- 125000002947 alkylene group Chemical group 0.000 claims 1
- 125000004429 atom Chemical group 0.000 claims 1
- 239000000284 extract Substances 0.000 claims 1
- 238000010438 heat treatment Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 50
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 32
- 238000004821 distillation Methods 0.000 description 26
- OWIKHYCFFJSOEH-UHFFFAOYSA-N Isocyanic acid Chemical compound N=C=O OWIKHYCFFJSOEH-UHFFFAOYSA-N 0.000 description 20
- 238000001321 HNCO Methods 0.000 description 19
- 230000000694 effects Effects 0.000 description 19
- 239000012066 reaction slurry Substances 0.000 description 16
- 239000002002 slurry Substances 0.000 description 14
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 13
- 238000004458 analytical method Methods 0.000 description 12
- 230000005611 electricity Effects 0.000 description 10
- 238000011065 in-situ storage Methods 0.000 description 9
- 239000007788 liquid Substances 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 239000007795 chemical reaction product Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- 230000003247 decreasing effect Effects 0.000 description 4
- 238000010926 purge Methods 0.000 description 4
- 238000003860 storage Methods 0.000 description 4
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- XLJMAIOERFSOGZ-UHFFFAOYSA-N anhydrous cyanic acid Natural products OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 3
- QYTOONVFPBUIJG-UHFFFAOYSA-N azane;cyanic acid Chemical compound [NH4+].[O-]C#N QYTOONVFPBUIJG-UHFFFAOYSA-N 0.000 description 3
- 238000010924 continuous production Methods 0.000 description 3
- 238000011068 loading method Methods 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- FAXWFCTVSHEODL-UHFFFAOYSA-N 2,4-dibromophenol Chemical compound OC1=CC=C(Br)C=C1Br FAXWFCTVSHEODL-UHFFFAOYSA-N 0.000 description 2
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000005070 sampling Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 150000003457 sulfones Chemical class 0.000 description 2
- 230000002485 urinary effect Effects 0.000 description 2
- HBRXQSHUXIJOKV-UHFFFAOYSA-N 5-methyl-1,3-oxazolidin-2-one Chemical compound CC1CNC(=O)O1 HBRXQSHUXIJOKV-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000000538 analytical sample Substances 0.000 description 1
- 238000010923 batch production Methods 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000001896 cresols Chemical class 0.000 description 1
- XLJMAIOERFSOGZ-UHFFFAOYSA-M cyanate Chemical compound [O-]C#N XLJMAIOERFSOGZ-UHFFFAOYSA-M 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 238000011010 flushing procedure Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/30—Only oxygen atoms
- C07D251/32—Cyanuric acid; Isocyanuric acid
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/835,653 US4187376A (en) | 1977-09-22 | 1977-09-22 | Removal of contaminants from cyanuric acid reaction product |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH637645A5 true CH637645A5 (de) | 1983-08-15 |
Family
ID=25270098
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH994778A CH637645A5 (de) | 1977-09-22 | 1978-09-22 | Verfahren zur herstellung von cyanursaeure. |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US4187376A (OSRAM) |
| JP (1) | JPS5914462B2 (OSRAM) |
| AU (1) | AU521884B2 (OSRAM) |
| BE (1) | BE870703A (OSRAM) |
| BR (1) | BR7806224A (OSRAM) |
| CA (1) | CA1090342A (OSRAM) |
| CH (1) | CH637645A5 (OSRAM) |
| DE (1) | DE2841430A1 (OSRAM) |
| ES (1) | ES473497A1 (OSRAM) |
| FR (1) | FR2404000A1 (OSRAM) |
| GB (1) | GB2005675B (OSRAM) |
| IT (1) | IT1099140B (OSRAM) |
| MX (1) | MX150295A (OSRAM) |
| NL (1) | NL189761C (OSRAM) |
| NO (1) | NO153531C (OSRAM) |
| SE (1) | SE443363B (OSRAM) |
| ZA (1) | ZA785232B (OSRAM) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4282359A (en) * | 1980-03-31 | 1981-08-04 | Fmc Corporation | Purification of cyanuric acid |
| JPS62135263U (OSRAM) * | 1986-02-19 | 1987-08-26 | ||
| AT403475B (de) * | 1994-07-22 | 1998-02-25 | Chemie Linz Gmbh | Verfahren zur herstellung von cyanursäure |
| DE4431811A1 (de) * | 1994-09-07 | 1996-03-14 | Chemie Linz Deutschland | Verfahren zur Herstellung von Cyanursäure durch Abscheidung aus einem Isocyansäure-Ammoniak Gasgemisch |
| KR100798109B1 (ko) * | 2006-08-11 | 2008-01-28 | 주식회사 제이앤드제이 캐미칼 | 뷰렛 및 시아누르산의 제조 방법 및 그 제조 장치 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3164591A (en) * | 1965-01-05 | Preparation of cyanuric acid | ||
| US3065233A (en) * | 1962-11-20 | |||
| US3117963A (en) * | 1964-01-14 | A-phenylbenzyl | ||
| US2368597A (en) * | 1943-02-08 | 1945-01-30 | Shell Dev | Solvent extraction process |
| US2357028A (en) * | 1943-08-04 | 1944-08-29 | Shell Dev | Solvent extraction process |
| GB950826A (en) * | 1959-06-24 | 1964-02-26 | Whiffen & Sons Ltd | Cyanuric acid production |
| DE1770827C3 (de) * | 1968-07-09 | 1975-02-06 | Basf Ag, 6700 Ludwigshafen | Verfahren zur Herstellung von Cyanursäure |
| US3563987A (en) * | 1969-04-01 | 1971-02-16 | Fmc Corp | Preparation of cyanuric acid |
| DE2300037A1 (de) * | 1973-01-02 | 1974-07-04 | Basf Ag | Verfahren zur kontinuierlichen herstellung von cyanursaeure |
| NL180419C (nl) * | 1974-11-12 | 1987-02-16 | Stamicarbon | Werkwijze voor het zuiveren van cyanuurzuur. |
-
1977
- 1977-09-22 US US05/835,653 patent/US4187376A/en not_active Expired - Lifetime
-
1978
- 1978-08-25 CA CA310,070A patent/CA1090342A/en not_active Expired
- 1978-09-06 MX MX174790A patent/MX150295A/es unknown
- 1978-09-14 ZA ZA00785232A patent/ZA785232B/xx unknown
- 1978-09-15 AU AU39913/78A patent/AU521884B2/en not_active Expired
- 1978-09-18 NL NLAANVRAGE7809473,A patent/NL189761C/xx not_active IP Right Cessation
- 1978-09-20 ES ES473497A patent/ES473497A1/es not_active Expired
- 1978-09-21 SE SE7809944A patent/SE443363B/sv not_active IP Right Cessation
- 1978-09-21 JP JP53115231A patent/JPS5914462B2/ja not_active Expired
- 1978-09-21 NO NO783210A patent/NO153531C/no unknown
- 1978-09-21 BR BR7806224A patent/BR7806224A/pt unknown
- 1978-09-21 IT IT27946/78A patent/IT1099140B/it active
- 1978-09-22 DE DE19782841430 patent/DE2841430A1/de active Granted
- 1978-09-22 FR FR7827155A patent/FR2404000A1/fr active Granted
- 1978-09-22 CH CH994778A patent/CH637645A5/de not_active IP Right Cessation
- 1978-09-22 GB GB7837732A patent/GB2005675B/en not_active Expired
- 1978-09-22 BE BE190666A patent/BE870703A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| ES473497A1 (es) | 1979-04-16 |
| BE870703A (fr) | 1979-03-22 |
| NO153531C (no) | 1986-05-14 |
| DE2841430A1 (de) | 1986-10-02 |
| NL189761C (nl) | 1993-07-16 |
| GB2005675B (en) | 1982-04-07 |
| GB2005675A (en) | 1979-04-25 |
| CA1090342A (en) | 1980-11-25 |
| DE2841430C2 (OSRAM) | 1988-09-15 |
| IT7827946A0 (it) | 1978-09-21 |
| SE443363B (sv) | 1986-02-24 |
| FR2404000A1 (fr) | 1979-04-20 |
| JPS5914462B2 (ja) | 1984-04-04 |
| JPS5455589A (en) | 1979-05-02 |
| IT1099140B (it) | 1985-09-18 |
| BR7806224A (pt) | 1979-04-17 |
| US4187376A (en) | 1980-02-05 |
| NO153531B (no) | 1985-12-30 |
| NO783210L (no) | 1979-03-23 |
| NL189761B (nl) | 1993-02-16 |
| MX150295A (es) | 1984-04-11 |
| FR2404000B1 (OSRAM) | 1983-01-21 |
| SE7809944L (sv) | 1979-03-23 |
| ZA785232B (en) | 1979-08-29 |
| AU521884B2 (en) | 1982-05-06 |
| AU3991378A (en) | 1980-03-20 |
| NL7809473A (nl) | 1979-03-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102008007154A1 (de) | Verfahren zur Herstellung eines grobkörnigen Ammoniumsulfat-Produkts durch Kristllisation und Anlage zur Durchführung des Verfahrens | |
| DE69218556T2 (de) | Trocknungsverfahren und Lösungsmittelextraktion von Feststoffen und Schlämmen | |
| DE10008161A1 (de) | Verfahren zur Herstellung eines wasserfreien Alkalimetallsulfids und einer Alkalimetallsulfidlösung | |
| DE1592324A1 (de) | Verfahren zur Reinigung eines hauptsaechlich aus Ammoniak bestehenden Gases | |
| CH637645A5 (de) | Verfahren zur herstellung von cyanursaeure. | |
| DE2300037A1 (de) | Verfahren zur kontinuierlichen herstellung von cyanursaeure | |
| DE2831329A1 (de) | Verfahren zum extrahieren von metall aus einer organischen extraktionsloesung, in der das metall als metallchloridkomplex vorhanden ist | |
| DE102017107932A1 (de) | Verfahren zur kontinuierlichen Herstellung von Alkalisalzen der Dialkyldithiocarbaminsäure | |
| DE2644250C3 (de) | Dipilocarpinium-Ketonsolvat und seine Verwendung | |
| DE2246920A1 (de) | Verfahren zur reinigung von hochschmelzenden isocyanaten | |
| DE2455785C3 (de) | Verfahren zur Entparaffinierung von feuchten Mineralölen durch Behandlung mit Lösungsmitteln, gegebenenfalls unter Zusatz von Harnstoff | |
| DE2428719C2 (de) | Verfahren zur Abtrennung von Trioxan aus wäßrigen Lösungen | |
| DE1495654A1 (de) | Verfahren und Vorrichtung zur kontinuierlichen Rueckgewinnung einer aus Lactamen und Amidoligomeren bestehenden Gasmischung aus mit dieser Mischung verunreinigten Polyamiden | |
| DE1618073A1 (de) | Verfahren zur Herstellung von omega-Cyanopolymethylenzinnkomplexen | |
| DE1645895C3 (de) | Verfahren zur Herstellung von Pyraziny Ithiophosphaten | |
| DE1024935B (de) | Verfahren zur Herstellung von Schwefeldioxyd | |
| DE3029265A1 (de) | Verfahren zu kontinuierlichen herstellung von diphenylbasen | |
| DE2532380C3 (de) | Verfahren zur Herstellung von Hydrazodicarbonamid | |
| DE2549677C3 (de) | Verfahren zur Gewinnung von reinen trimeren und tetrameren cyclischen Phosphornitrilchloridpolymeren | |
| DE2037388C3 (de) | Verfahren zur Herstellung von beta-Aminocrotonamid | |
| DE672874C (de) | Verfahren zur Herstellung tiefstockender OEle | |
| AT163422B (de) | Verfahren zur Herstellung von Melamin | |
| DE3214429A1 (de) | Abstreifen von waessriger ammoniumcarbonat-loesung | |
| AT200569B (de) | Verfahren zur kontinuierlichen Raffination der Isomeren des Benzolhexachlorids | |
| DE1768109C (de) | Verfahren zur Gewinnung von Tetraalkyl blei |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUE | Assignment |
Owner name: OLIN CORPORATION |
|
| PL | Patent ceased |