CA1138010A - Spreader for spreading granular and/or powdery material - Google Patents
Spreader for spreading granular and/or powdery materialInfo
- Publication number
- CA1138010A CA1138010A CA000326847A CA326847A CA1138010A CA 1138010 A CA1138010 A CA 1138010A CA 000326847 A CA000326847 A CA 000326847A CA 326847 A CA326847 A CA 326847A CA 1138010 A CA1138010 A CA 1138010A
- Authority
- CA
- Canada
- Prior art keywords
- spreader
- distribution
- distribution member
- members
- ejection
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000463 material Substances 0.000 title claims abstract description 91
- 230000007480 spreading Effects 0.000 title claims abstract description 9
- 238000009826 distribution Methods 0.000 claims abstract description 202
- 230000007246 mechanism Effects 0.000 claims description 20
- 230000005540 biological transmission Effects 0.000 claims description 16
- 230000008878 coupling Effects 0.000 claims description 5
- 238000010168 coupling process Methods 0.000 claims description 5
- 238000005859 coupling reaction Methods 0.000 claims description 5
- 230000008859 change Effects 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 3
- 150000002500 ions Chemical class 0.000 description 3
- 230000009471 action Effects 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 229920000136 polysorbate Polymers 0.000 description 2
- 238000009827 uniform distribution Methods 0.000 description 2
- 241000208140 Acer Species 0.000 description 1
- 241001282736 Oriens Species 0.000 description 1
- 241000592503 Speea Species 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000001788 irregular Effects 0.000 description 1
- KRTSDMXIXPKRQR-AATRIKPKSA-N monocrotophos Chemical compound CNC(=O)\C=C(/C)OP(=O)(OC)OC KRTSDMXIXPKRQR-AATRIKPKSA-N 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 239000002420 orchard Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01C—PLANTING; SOWING; FERTILISING
- A01C17/00—Fertilisers or seeders with centrifugal wheels
- A01C17/001—Centrifugal throwing devices with a vertical axis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07H—SUGARS; DERIVATIVES THEREOF; NUCLEOSIDES; NUCLEOTIDES; NUCLEIC ACIDS
- C07H5/00—Compounds containing saccharide radicals in which the hetero bonds to oxygen have been replaced by the same number of hetero bonds to halogen, nitrogen, sulfur, selenium, or tellurium
- C07H5/04—Compounds containing saccharide radicals in which the hetero bonds to oxygen have been replaced by the same number of hetero bonds to halogen, nitrogen, sulfur, selenium, or tellurium to nitrogen
- C07H5/06—Aminosugars
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Health & Medical Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Biochemistry (AREA)
- Environmental Sciences (AREA)
- Molecular Biology (AREA)
- Genetics & Genomics (AREA)
- Biotechnology (AREA)
- Soil Sciences (AREA)
- Engineering & Computer Science (AREA)
- Pain & Pain Management (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Rheumatology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Animal Behavior & Ethology (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Fertilizing (AREA)
- Catching Or Destruction (AREA)
- Nozzles (AREA)
- Sowing (AREA)
- Coating Apparatus (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL7804824 | 1978-05-05 | ||
| NL78.04824 | 1978-05-05 | ||
| NL7901632A NL190570C (nl) | 1978-05-05 | 1979-03-01 | Inrichting voor het strooien van korrel- en/of poedervormig materiaal. |
| NL79.01632 | 1979-03-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1138010A true CA1138010A (en) | 1982-12-21 |
Family
ID=26645415
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA000326847A Expired CA1138010A (en) | 1978-05-05 | 1979-05-03 | Spreader for spreading granular and/or powdery material |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US5018669A (enFirst) |
| JP (1) | JPS54146010A (enFirst) |
| AT (2) | AT387130B (enFirst) |
| AU (1) | AU534391B2 (enFirst) |
| CA (1) | CA1138010A (enFirst) |
| CH (1) | CH641318A5 (enFirst) |
| DE (3) | DE2917843A1 (enFirst) |
| DK (2) | DK157421C (enFirst) |
| ES (1) | ES480230A1 (enFirst) |
| FR (2) | FR2424691B1 (enFirst) |
| GB (2) | GB2020154B (enFirst) |
| IT (1) | IT1112506B (enFirst) |
| NL (1) | NL190570C (enFirst) |
| NZ (1) | NZ190371A (enFirst) |
| SE (1) | SE438419B (enFirst) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL190570C (nl) * | 1978-05-05 | 1994-05-02 | Lely Nv C Van Der | Inrichting voor het strooien van korrel- en/of poedervormig materiaal. |
| NL7810805A (nl) * | 1978-10-31 | 1980-05-02 | Lely Nv C Van Der | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
| NL8006454A (nl) * | 1980-11-27 | 1982-06-16 | Lely Nv C Van Der | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
| EP0088105B1 (en) * | 1981-09-14 | 1986-07-30 | C. van der Lely N.V. | Device for spreading granular and/or powdery material |
| NL8200177A (nl) * | 1982-01-19 | 1983-08-16 | Lely Nv C Van Der | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
| NL192240C (nl) * | 1983-02-16 | 1997-04-03 | Lely Nv C Van Der | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
| DE3310694A1 (de) * | 1983-03-24 | 1984-09-27 | Amazonen Werke Dreyer H | Schleuderstreuer, insbesondere zur ausbringung von mineralischen streustoffen |
| IT1179919B (it) * | 1984-04-19 | 1987-09-16 | Andrea Ricca | Perfezionamenti nella macchina spandiconcimi |
| GB2163032B (en) * | 1984-08-17 | 1988-02-17 | Lely Nv C Van Der | A spreader |
| EP0192089B1 (de) * | 1985-02-06 | 1991-08-28 | Amazonen-Werke H. Dreyer GmbH & Co. KG | Schleuderstreuer, insbesondere für gekörnte Düngemittel |
| DE3634096A1 (de) * | 1986-10-07 | 1988-04-14 | Amazonen Werke Dreyer H | Schleuderduengerstreuer |
| DE3931835A1 (de) * | 1989-09-23 | 1991-04-04 | Amazonen Werke Dreyer H | Schleuderduengerstreuer |
| AU9154591A (en) * | 1990-12-28 | 1992-08-17 | O.M. Scott & Sons Company, The | Dual rotary impeller broadcast spreaders |
| US5203510A (en) * | 1990-12-28 | 1993-04-20 | The O. M. Scott & Sons Company | Dual rotary impeller broadcast spreaders |
| US5626260A (en) * | 1994-07-01 | 1997-05-06 | Waldner; David J. | Dry composition dispenser |
| US6871762B1 (en) | 1997-12-03 | 2005-03-29 | Paul E. Cripps | Dispenser for ice-thawing and other granulated materials |
| US6499679B1 (en) * | 1997-12-04 | 2002-12-31 | Basf Aktiengesellschaft | Granular spreader and product container |
| EP2279654B1 (en) * | 2009-07-28 | 2015-05-20 | CNH Industrial Belgium nv | Spreader disk assembly convertible for windrowing |
| US20190099779A1 (en) * | 2017-09-29 | 2019-04-04 | Thomas E. Farmer | Broadcast Spreader Mechanism |
| DE102019135005A1 (de) * | 2018-12-18 | 2020-06-18 | Earthway Products Inc | Doppellaufradstreuer mit doppelabsperrsteuerungen |
| US11553641B2 (en) * | 2018-12-18 | 2023-01-17 | Earthway Products Inc | Dual-impeller spreader with dual shut-off controls |
Family Cites Families (51)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7115099U (de) * | 1971-08-05 | Steib J Spezialfabrik Fuer Landmaschinen | Streugerat | |
| CA896411A (en) * | 1972-03-28 | C. Van Der Lely N.V. | Spreading implements | |
| CA729496A (en) * | 1966-03-08 | L. Larson Lester | Pattern control device for spreaders | |
| CA802764A (en) * | 1968-12-31 | Dreyer Heinz | Centrifugal spreader, especially for spreading mineral fertilizers | |
| CA781829A (en) * | 1968-04-02 | Dreyer Heinz | Centrifugal spreader for mineral fertilizers or other granular materials | |
| CA901037A (en) * | 1972-05-23 | Van Der Lely Cornelis | Spreading implements | |
| FR391691A (fr) * | 1908-06-25 | 1908-11-06 | Charles Louis Auguste Severin | Semoir centrifuge |
| BE394975A (enFirst) * | 1932-03-14 | 1933-04-29 | ||
| GB618205A (en) * | 1946-01-03 | 1949-02-17 | George Otto Hoffstetter | Improvements in machines for distributing fertilisers and other materials |
| US2652261A (en) * | 1948-04-20 | 1953-09-15 | Presler James Lawrence | Machine for planting grass and clover seed |
| US2723860A (en) * | 1952-06-03 | 1955-11-15 | Charles E Weeks | Tractor mounted broadcast seeder |
| GB733935A (en) * | 1952-11-17 | 1955-07-20 | William Edmund Lea | Improvements in or relating to mechanical spreaders and distributors |
| GB872604A (en) * | 1956-11-09 | 1961-07-12 | Lely Nv C Van Der | Improvements in or relating to devices for spreading granular or powdery material over a surface |
| CH386754A (de) * | 1960-10-03 | 1965-01-15 | Amazonen Werke Dreyer H | Schleuderstreuer, insbesondere für mineralische Düngemittel |
| US3109657A (en) * | 1961-09-21 | 1963-11-05 | Amazonen Werke Dreyer H | Centrifugal spreader |
| GB987128A (en) * | 1962-01-29 | 1965-03-24 | Johan Sigurd Kaller | Spreader for artificial fertilisers and other granular material |
| US3133737A (en) * | 1962-01-29 | 1964-05-19 | Kaller Johan Sigurd | Spreader for artificial fertilizers and other granular material |
| AT248772B (de) * | 1963-07-12 | 1966-08-10 | Amazonen Werke Dreyer H | Reihenstreuvorrichtung für Zentrifugalstreuer |
| DE1966951U (de) | 1964-04-23 | 1967-08-24 | Amazonen Werke Dreyer H | Zentrifugalstreuer, insbesondere zum ausstreuen mineralischer duengemittel. |
| DE1258648B (de) * | 1964-04-27 | 1968-01-11 | Amazonen Werke Dreyer H | Zentrifugalstreuer, insbesondere zum Ausstreuen von Mineralduengemitteln |
| AT258628B (de) * | 1964-07-10 | 1967-12-11 | Amazonen Werke Dreyer H | Mit zwei Streuorganen ausgestatteter Zentrifugalstreuer |
| DE1992777U (de) | 1964-07-24 | 1968-08-29 | Amazonen Werke Dreyer H | Maschine zum ausstreuen von mineralduenger. |
| GB1045370A (en) * | 1964-12-31 | 1966-10-12 | Mini Of The Ministerul Ind Con | Centrifugal distributor for fertilizers and other materials in powder or granules |
| DE1457772A1 (de) * | 1965-06-23 | 1970-01-02 | Amazonen Werke Dreyer H | Maschine zum Verteilen von streubarem Material |
| FR1440385A (fr) * | 1965-07-07 | 1966-05-27 | Amazonen Werke H Dreyer Fa | Procédé d'épandage uniforme en surface au moyen d'épandeurs centrifuges équipés d'au moins deux organes d'épandage |
| US3313549A (en) * | 1965-09-03 | 1967-04-11 | Willmar Mfg | Compact spreader for particulate |
| DE1993246U (de) * | 1966-06-02 | 1968-09-05 | Amazonen Werke Dreyer H | Zentrifugalstreuer, insbesondere fuer duengemittel. |
| FR1532897A (fr) * | 1966-07-29 | 1968-07-12 | Ver Kunstmestf Mekog Albatros | Appareil centrifuge d'épandage muni de deux éléments distributeurs |
| NL6610697A (enFirst) * | 1966-07-29 | 1968-01-30 | ||
| DE1557917A1 (de) * | 1967-03-15 | 1970-04-30 | Amazonen Werke Dreyer H | Zentrifugalstreuer,insbesondere fuer Duengemittel |
| FR1523961A (fr) * | 1967-05-25 | 1968-05-03 | Amazonen Werke Dreyer H | épandeur centrifuge, notamment pour engrais |
| DE1966423U (de) | 1967-05-26 | 1967-08-17 | Steib Josef Landmasch Spezfab | Kunstduengerstreugeraet. |
| NL6708370A (enFirst) * | 1967-06-16 | 1968-12-17 | ||
| NL161033C (nl) * | 1967-12-27 | 1980-01-15 | Lely Nv C Van Der | Inrichting voor het verspreiden van materiaal. |
| FR2000315A1 (enFirst) * | 1968-01-17 | 1969-09-05 | Norton Co | |
| US3539113A (en) * | 1968-07-09 | 1970-11-10 | Letco Inc | Distributor means for a fertilizer spreader |
| DE1995258U (de) | 1968-07-18 | 1968-10-24 | Landruf Gmbh Rubertus & Fries | Vorrichtung zum ausstreuen rieselfaehiger stoffe, vorzugswaise kunstduenger. |
| NL6812821A (enFirst) * | 1968-09-09 | 1970-03-11 | ||
| GB1287404A (en) * | 1968-09-12 | 1972-08-31 | Goulding Ltd W & H M | The manufacture of plastics bags, sacks and tubular or sheet film |
| AT284528B (de) * | 1968-12-18 | 1970-09-25 | Vogel & Noot Ag | Schleuderstreuer |
| GB1266531A (enFirst) * | 1969-01-02 | 1972-03-08 | ||
| NL6900783A (enFirst) * | 1969-01-17 | 1970-07-21 | ||
| US3899138A (en) * | 1969-01-17 | 1975-08-12 | Der Lely Ary Van | Spreading implements |
| NL6902712A (enFirst) * | 1969-02-21 | 1970-08-25 | ||
| NL7101612A (enFirst) * | 1971-02-08 | 1972-08-10 | ||
| GB1389835A (en) * | 1971-03-29 | 1975-04-09 | Bomford Evershed Ltd | Devices for broadcasting granular material |
| NL7105004A (enFirst) * | 1971-04-15 | 1972-10-17 | ||
| NL7613260A (nl) * | 1976-11-29 | 1978-05-31 | Texas Industries Inc | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
| DE2818227A1 (de) * | 1978-04-26 | 1979-11-08 | Amazonen Werke Dreyer H | Zentrifugalstreuer, insbesondere fuer duengemittel |
| NL190570C (nl) * | 1978-05-05 | 1994-05-02 | Lely Nv C Van Der | Inrichting voor het strooien van korrel- en/of poedervormig materiaal. |
| NL7810805A (nl) * | 1978-10-31 | 1980-05-02 | Lely Nv C Van Der | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. |
-
1979
- 1979-03-01 NL NL7901632A patent/NL190570C/xx not_active IP Right Cessation
- 1979-05-01 US US06/035,075 patent/US5018669A/en not_active Expired - Lifetime
- 1979-05-01 DK DK178179A patent/DK157421C/da not_active IP Right Cessation
- 1979-05-02 GB GB7915292A patent/GB2020154B/en not_active Expired
- 1979-05-02 GB GB08136863A patent/GB2100565B/en not_active Expired
- 1979-05-02 FR FR7910997A patent/FR2424691B1/fr not_active Expired
- 1979-05-02 AU AU46670/79A patent/AU534391B2/en not_active Expired
- 1979-05-03 DE DE19792917843 patent/DE2917843A1/de not_active Ceased
- 1979-05-03 DE DE19797912803U patent/DE7912803U1/de not_active Expired
- 1979-05-03 CH CH416279A patent/CH641318A5/de not_active IP Right Cessation
- 1979-05-03 AT AT0332579A patent/AT387130B/de not_active IP Right Cessation
- 1979-05-03 CA CA000326847A patent/CA1138010A/en not_active Expired
- 1979-05-03 DE DE2954169A patent/DE2954169C2/de not_active Expired
- 1979-05-04 JP JP5413279A patent/JPS54146010A/ja active Granted
- 1979-05-04 NZ NZ190371A patent/NZ190371A/xx unknown
- 1979-05-04 IT IT22380/79A patent/IT1112506B/it active
- 1979-05-04 SE SE7903874A patent/SE438419B/sv not_active IP Right Cessation
- 1979-05-04 ES ES480230A patent/ES480230A1/es not_active Expired
-
1982
- 1982-04-30 AT AT0169882A patent/AT377523B/de not_active IP Right Cessation
-
1985
- 1985-03-29 FR FR858504766A patent/FR2561059B1/fr not_active Expired - Lifetime
-
1989
- 1989-08-21 DK DK410289A patent/DK410289A/da not_active Application Discontinuation
Also Published As
| Publication number | Publication date |
|---|---|
| AT377523B (de) | 1985-03-25 |
| FR2561059A1 (fr) | 1985-09-20 |
| DK410289D0 (da) | 1989-08-21 |
| US5018669A (en) | 1991-05-28 |
| JPS54146010A (en) | 1979-11-14 |
| NZ190371A (en) | 1982-11-23 |
| DE7912803U1 (de) | 1984-02-02 |
| SE7903874L (sv) | 1979-11-06 |
| AU534391B2 (en) | 1984-01-26 |
| FR2561059B1 (fr) | 1991-05-17 |
| GB2100565A (en) | 1983-01-06 |
| DK157421C (da) | 1990-05-28 |
| NL7901632A (nl) | 1979-11-07 |
| JPS6312663B2 (enFirst) | 1988-03-22 |
| IT7922380A0 (it) | 1979-05-04 |
| AT387130B (de) | 1988-12-12 |
| NL190570C (nl) | 1994-05-02 |
| ATA169882A (de) | 1984-08-15 |
| GB2020154B (en) | 1982-09-08 |
| NL190570B (nl) | 1993-12-01 |
| IT1112506B (it) | 1986-01-20 |
| DE2954169C2 (enFirst) | 1987-07-30 |
| DK178179A (da) | 1979-11-06 |
| DK157421B (da) | 1990-01-08 |
| GB2020154A (en) | 1979-11-14 |
| ATA332579A (de) | 1988-05-15 |
| DE2917843A1 (de) | 1979-11-15 |
| CH641318A5 (de) | 1984-02-29 |
| AU4667079A (en) | 1979-11-08 |
| FR2424691B1 (fr) | 1985-09-13 |
| GB2100565B (en) | 1983-06-02 |
| FR2424691A1 (fr) | 1979-11-30 |
| ES480230A1 (es) | 1980-08-16 |
| DK410289A (da) | 1989-08-21 |
| SE438419B (sv) | 1985-04-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1138010A (en) | Spreader for spreading granular and/or powdery material | |
| US4793742A (en) | Truck mounted fertilizer applicator using fluid conveying | |
| US4609153A (en) | Device for spreading granular and/or powdery material | |
| US4008855A (en) | Spreading implements | |
| CN113348281B (zh) | 用于旋转式撒布机的分流器 | |
| US20090178382A1 (en) | Mower | |
| US4381080A (en) | Spreading device for effecting a uniform distribution of material such as fertilizer | |
| GB2163032A (en) | A spreader | |
| US5125583A (en) | Truck mounted fertilizer applicator using fluid conveying | |
| US5004163A (en) | Devices for spreading granular and/or powdery material | |
| EP0176117B1 (en) | Device for spreading granular and/or powdery material | |
| GB2186473A (en) | Mowing mechanism with transverse conveyor belt | |
| US4141508A (en) | Spreader | |
| US4316581A (en) | Spreader suitable for spreading granular and/or powdery material | |
| GB2150802A (en) | Material spreaders | |
| US4128191A (en) | Collector for a pneumatic dispenser | |
| US3473739A (en) | Device for spreading granular or powdery material | |
| EP0081257A1 (en) | Device for spreading granular and/or powdery material | |
| US2945698A (en) | Distributor machine for the distribution of fertilizer | |
| GB2112614A (en) | A spreader for spreading granular and/or powdery material | |
| EP0088105A1 (en) | SPREADING DEVICE FOR GRANULAR OR POWDERED GOODS. | |
| NL193302C (nl) | Inrichting voor het verspreiden van korrel- en/of poedervormig materiaal. | |
| CA1298247C (en) | Truck mounted fertilizer applicator using fluid conveying | |
| EP0238153B1 (en) | A spreader for spreading granular and/or powdery matrial | |
| GB1600407A (en) | Machines for broadcasting seed fertilizer and other granular or powdered materials |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |