AU2008242720A1 - Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases - Google Patents
Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases Download PDFInfo
- Publication number
- AU2008242720A1 AU2008242720A1 AU2008242720A AU2008242720A AU2008242720A1 AU 2008242720 A1 AU2008242720 A1 AU 2008242720A1 AU 2008242720 A AU2008242720 A AU 2008242720A AU 2008242720 A AU2008242720 A AU 2008242720A AU 2008242720 A1 AU2008242720 A1 AU 2008242720A1
- Authority
- AU
- Australia
- Prior art keywords
- c6alkyl
- pyrazol
- group
- phenyl
- yloxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Abandoned
Links
- 201000010099 disease Diseases 0.000 title claims description 25
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 title claims description 25
- 229940043355 kinase inhibitor Drugs 0.000 title description 4
- 239000003757 phosphotransferase inhibitor Substances 0.000 title description 4
- 230000002062 proliferating effect Effects 0.000 title description 4
- -1 isoxazolyl-4-yl Chemical group 0.000 claims description 149
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 125
- 150000001875 compounds Chemical class 0.000 claims description 93
- 108091000080 Phosphotransferase Proteins 0.000 claims description 64
- 102000020233 phosphotransferase Human genes 0.000 claims description 64
- 238000000034 method Methods 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 39
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 23
- 125000000623 heterocyclic group Chemical group 0.000 claims description 22
- 206010028980 Neoplasm Diseases 0.000 claims description 21
- 102000037865 fusion proteins Human genes 0.000 claims description 21
- 108020001507 fusion proteins Proteins 0.000 claims description 21
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 20
- 229910052801 chlorine Inorganic materials 0.000 claims description 20
- 229910052757 nitrogen Inorganic materials 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 16
- 229910052799 carbon Inorganic materials 0.000 claims description 14
- 102000016971 Proto-Oncogene Proteins c-kit Human genes 0.000 claims description 13
- 108010014608 Proto-Oncogene Proteins c-kit Proteins 0.000 claims description 13
- 229910052736 halogen Inorganic materials 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 13
- 230000001594 aberrant effect Effects 0.000 claims description 12
- 230000000694 effects Effects 0.000 claims description 12
- WEVYNIUIFUYDGI-UHFFFAOYSA-N 3-[6-[4-(trifluoromethoxy)anilino]-4-pyrimidinyl]benzamide Chemical compound NC(=O)C1=CC=CC(C=2N=CN=C(NC=3C=CC(OC(F)(F)F)=CC=3)C=2)=C1 WEVYNIUIFUYDGI-UHFFFAOYSA-N 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 11
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 claims description 10
- 201000011510 cancer Diseases 0.000 claims description 10
- 125000004432 carbon atom Chemical group C* 0.000 claims description 10
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- 125000001072 heteroaryl group Chemical group 0.000 claims description 10
- 230000035772 mutation Effects 0.000 claims description 10
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 10
- 231100000590 oncogenic Toxicity 0.000 claims description 10
- 230000002246 oncogenic effect Effects 0.000 claims description 10
- 102000001253 Protein Kinase Human genes 0.000 claims description 9
- 230000001404 mediated effect Effects 0.000 claims description 9
- 108060006633 protein kinase Proteins 0.000 claims description 9
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 8
- 125000002947 alkylene group Chemical group 0.000 claims description 8
- 201000011243 gastrointestinal stromal tumor Diseases 0.000 claims description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 claims description 8
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 7
- 125000001424 substituent group Chemical group 0.000 claims description 7
- MZAGXDHQGXUDDX-JSRXJHBZSA-N (e,2z)-4-ethyl-2-hydroxyimino-5-nitrohex-3-enamide Chemical compound [O-][N+](=O)C(C)C(/CC)=C/C(=N/O)/C(N)=O MZAGXDHQGXUDDX-JSRXJHBZSA-N 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 102000009929 raf Kinases Human genes 0.000 claims description 6
- 108010077182 raf Kinases Proteins 0.000 claims description 6
- 125000004568 thiomorpholinyl group Chemical group 0.000 claims description 6
- KKVYYGGCHJGEFJ-UHFFFAOYSA-N 1-n-(4-chlorophenyl)-6-methyl-5-n-[3-(7h-purin-6-yl)pyridin-2-yl]isoquinoline-1,5-diamine Chemical compound N=1C=CC2=C(NC=3C(=CC=CN=3)C=3C=4N=CNC=4N=CN=3)C(C)=CC=C2C=1NC1=CC=C(Cl)C=C1 KKVYYGGCHJGEFJ-UHFFFAOYSA-N 0.000 claims description 5
- 206010006187 Breast cancer Diseases 0.000 claims description 5
- 208000026310 Breast neoplasm Diseases 0.000 claims description 5
- 206010051066 Gastrointestinal stromal tumour Diseases 0.000 claims description 5
- 101100381978 Mus musculus Braf gene Proteins 0.000 claims description 5
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 5
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 5
- 208000032839 leukemia Diseases 0.000 claims description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 5
- 125000002971 oxazolyl group Chemical group 0.000 claims description 5
- 125000004076 pyridyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 5
- 125000001425 triazolyl group Chemical group 0.000 claims description 5
- 108091008794 FGF receptors Proteins 0.000 claims description 4
- 206010048643 Hypereosinophilic syndrome Diseases 0.000 claims description 4
- 206010027476 Metastases Diseases 0.000 claims description 4
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 4
- 206010038923 Retinopathy Diseases 0.000 claims description 4
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 4
- 230000001684 chronic effect Effects 0.000 claims description 4
- 230000009401 metastasis Effects 0.000 claims description 4
- 206010039073 rheumatoid arthritis Diseases 0.000 claims description 4
- 201000004569 Blindness Diseases 0.000 claims description 3
- 208000008839 Kidney Neoplasms Diseases 0.000 claims description 3
- 206010027406 Mesothelioma Diseases 0.000 claims description 3
- 208000014767 Myeloproliferative disease Diseases 0.000 claims description 3
- 208000022873 Ocular disease Diseases 0.000 claims description 3
- 206010033128 Ovarian cancer Diseases 0.000 claims description 3
- 206010061535 Ovarian neoplasm Diseases 0.000 claims description 3
- 206010061902 Pancreatic neoplasm Diseases 0.000 claims description 3
- 206010033701 Papillary thyroid cancer Diseases 0.000 claims description 3
- 206010060862 Prostate cancer Diseases 0.000 claims description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 claims description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 claims description 3
- 208000006673 asthma Diseases 0.000 claims description 3
- 125000002785 azepinyl group Chemical group 0.000 claims description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004604 benzisothiazolyl group Chemical group S1N=C(C2=C1C=CC=C2)* 0.000 claims description 3
- 125000004603 benzisoxazolyl group Chemical group O1N=C(C2=C1C=CC=C2)* 0.000 claims description 3
- 125000003310 benzodiazepinyl group Chemical group N1N=C(C=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 3
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 claims description 3
- 208000019065 cervical carcinoma Diseases 0.000 claims description 3
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 claims description 3
- 208000029742 colonic neoplasm Diseases 0.000 claims description 3
- 125000002576 diazepinyl group Chemical group N1N=C(C=CC=C1)* 0.000 claims description 3
- 125000005044 dihydroquinolinyl group Chemical group N1(CC=CC2=CC=CC=C12)* 0.000 claims description 3
- 102000052178 fibroblast growth factor receptor activity proteins Human genes 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 208000005017 glioblastoma Diseases 0.000 claims description 3
- 125000004857 imidazopyridinyl group Chemical group N1C(=NC2=C1C=CC=N2)* 0.000 claims description 3
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 claims description 3
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 3
- 125000001041 indolyl group Chemical group 0.000 claims description 3
- 125000004594 isoindolinyl group Chemical group C1(NCC2=CC=CC=C12)* 0.000 claims description 3
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 claims description 3
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 3
- 208000020816 lung neoplasm Diseases 0.000 claims description 3
- 208000015486 malignant pancreatic neoplasm Diseases 0.000 claims description 3
- 208000000516 mast-cell leukemia Diseases 0.000 claims description 3
- 208000008585 mastocytosis Diseases 0.000 claims description 3
- 201000001441 melanoma Diseases 0.000 claims description 3
- 125000002757 morpholinyl group Chemical group 0.000 claims description 3
- 125000001624 naphthyl group Chemical group 0.000 claims description 3
- 208000002154 non-small cell lung carcinoma Diseases 0.000 claims description 3
- 230000000414 obstructive effect Effects 0.000 claims description 3
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 3
- 125000000160 oxazolidinyl group Chemical group 0.000 claims description 3
- 125000005968 oxazolinyl group Chemical group 0.000 claims description 3
- 125000003585 oxepinyl group Chemical group 0.000 claims description 3
- 125000003566 oxetanyl group Chemical group 0.000 claims description 3
- 201000002528 pancreatic cancer Diseases 0.000 claims description 3
- 208000008443 pancreatic carcinoma Diseases 0.000 claims description 3
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000005545 phthalimidyl group Chemical group 0.000 claims description 3
- 125000004193 piperazinyl group Chemical group 0.000 claims description 3
- 125000003386 piperidinyl group Chemical group 0.000 claims description 3
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 claims description 3
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 3
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 3
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 claims description 3
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 claims description 3
- 125000003039 tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 claims description 3
- 125000001412 tetrahydropyranyl group Chemical group 0.000 claims description 3
- 125000000147 tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 claims description 3
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 208000030045 thyroid gland papillary carcinoma Diseases 0.000 claims description 3
- 125000004306 triazinyl group Chemical group 0.000 claims description 3
- 208000029729 tumor suppressor gene on chromosome 11 Diseases 0.000 claims description 3
- 125000004454 (C1-C6) alkoxycarbonyl group Chemical group 0.000 claims description 2
- 208000032791 BCR-ABL1 positive chronic myelogenous leukemia Diseases 0.000 claims description 2
- 208000010833 Chronic myeloid leukaemia Diseases 0.000 claims description 2
- 206010012689 Diabetic retinopathy Diseases 0.000 claims description 2
- 208000033761 Myelogenous Chronic BCR-ABL Positive Leukemia Diseases 0.000 claims description 2
- 101150038994 PDGFRA gene Proteins 0.000 claims description 2
- 108010053099 Vascular Endothelial Growth Factor Receptor-2 Proteins 0.000 claims description 2
- 239000000654 additive Substances 0.000 claims description 2
- 230000000996 additive effect Effects 0.000 claims description 2
- 239000002671 adjuvant Substances 0.000 claims description 2
- 206010064930 age-related macular degeneration Diseases 0.000 claims description 2
- 230000033115 angiogenesis Effects 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 2
- 230000003463 hyperproliferative effect Effects 0.000 claims description 2
- 208000014018 liver neoplasm Diseases 0.000 claims description 2
- 208000002780 macular degeneration Diseases 0.000 claims description 2
- 208000030159 metabolic disease Diseases 0.000 claims description 2
- 230000004770 neurodegeneration Effects 0.000 claims description 2
- 208000015122 neurodegenerative disease Diseases 0.000 claims description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 2
- 239000008194 pharmaceutical composition Substances 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 238000007920 subcutaneous administration Methods 0.000 claims description 2
- 102000004441 bcr-abl Fusion Proteins Human genes 0.000 claims 2
- 108010056708 bcr-abl Fusion Proteins Proteins 0.000 claims 2
- 101100123850 Caenorhabditis elegans her-1 gene Proteins 0.000 claims 1
- 101001012157 Homo sapiens Receptor tyrosine-protein kinase erbB-2 Proteins 0.000 claims 1
- 241000124008 Mammalia Species 0.000 claims 1
- 208000035268 Mast Cell Activation disease Diseases 0.000 claims 1
- 102100030485 Platelet-derived growth factor receptor alpha Human genes 0.000 claims 1
- 101710148465 Platelet-derived growth factor receptor alpha Proteins 0.000 claims 1
- 102000008022 Proto-Oncogene Proteins c-met Human genes 0.000 claims 1
- 108010089836 Proto-Oncogene Proteins c-met Proteins 0.000 claims 1
- 102100030086 Receptor tyrosine-protein kinase erbB-2 Human genes 0.000 claims 1
- 239000003937 drug carrier Substances 0.000 claims 1
- 230000002685 pulmonary effect Effects 0.000 claims 1
- 239000003381 stabilizer Substances 0.000 claims 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 366
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 212
- 235000013877 carbamide Nutrition 0.000 description 184
- 239000004202 carbamide Substances 0.000 description 183
- 238000006243 chemical reaction Methods 0.000 description 93
- 235000019439 ethyl acetate Nutrition 0.000 description 86
- 238000005481 NMR spectroscopy Methods 0.000 description 81
- 239000000203 mixture Substances 0.000 description 71
- 239000000243 solution Substances 0.000 description 69
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 59
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 58
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 52
- 239000012267 brine Substances 0.000 description 51
- 235000013350 formula milk Nutrition 0.000 description 51
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 51
- 239000007787 solid Substances 0.000 description 49
- 150000001412 amines Chemical class 0.000 description 48
- 239000011734 sodium Substances 0.000 description 46
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 44
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 39
- 239000011541 reaction mixture Substances 0.000 description 36
- 229910052740 iodine Inorganic materials 0.000 description 34
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 33
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 32
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 31
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 26
- 238000007429 general method Methods 0.000 description 25
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- 238000004440 column chromatography Methods 0.000 description 21
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 20
- 239000012044 organic layer Substances 0.000 description 20
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 19
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- 210000004027 cell Anatomy 0.000 description 18
- 239000000543 intermediate Substances 0.000 description 18
- 239000002253 acid Substances 0.000 description 17
- 239000006260 foam Substances 0.000 description 16
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000000460 chlorine Substances 0.000 description 15
- 150000002148 esters Chemical class 0.000 description 15
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 14
- 238000004587 chromatography analysis Methods 0.000 description 14
- 239000000706 filtrate Substances 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- 238000003556 assay Methods 0.000 description 13
- 238000002360 preparation method Methods 0.000 description 13
- 230000002829 reductive effect Effects 0.000 description 13
- 150000003839 salts Chemical class 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 12
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 12
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 12
- 238000010898 silica gel chromatography Methods 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- SORGEQQSQGNZFI-UHFFFAOYSA-N [azido(phenoxy)phosphoryl]oxybenzene Chemical compound C=1C=CC=CC=1OP(=O)(N=[N+]=[N-])OC1=CC=CC=C1 SORGEQQSQGNZFI-UHFFFAOYSA-N 0.000 description 11
- 230000008878 coupling Effects 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 125000002950 monocyclic group Chemical group 0.000 description 11
- 239000012074 organic phase Substances 0.000 description 11
- 238000010992 reflux Methods 0.000 description 11
- 238000012360 testing method Methods 0.000 description 11
- 238000005160 1H NMR spectroscopy Methods 0.000 description 10
- 102000003855 L-lactate dehydrogenase Human genes 0.000 description 10
- 108700023483 L-lactate dehydrogenases Proteins 0.000 description 10
- 102000013009 Pyruvate Kinase Human genes 0.000 description 10
- 108020005115 Pyruvate Kinase Proteins 0.000 description 10
- 239000012043 crude product Substances 0.000 description 10
- 238000010438 heat treatment Methods 0.000 description 10
- 239000003112 inhibitor Substances 0.000 description 10
- 230000005764 inhibitory process Effects 0.000 description 10
- 229930027945 nicotinamide-adenine dinucleotide Natural products 0.000 description 10
- BOPGDPNILDQYTO-NNYOXOHSSA-N nicotinamide-adenine dinucleotide Chemical compound C1=CCC(C(=O)N)=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@@H](O2)N2C3=NC=NC(N)=C3N=C2)O)O1 BOPGDPNILDQYTO-NNYOXOHSSA-N 0.000 description 10
- 239000003921 oil Substances 0.000 description 10
- 108090000623 proteins and genes Proteins 0.000 description 10
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 9
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- 238000001914 filtration Methods 0.000 description 9
- 239000010410 layer Substances 0.000 description 9
- 230000003647 oxidation Effects 0.000 description 9
- 238000007254 oxidation reaction Methods 0.000 description 9
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 8
- 101100030361 Neurospora crassa (strain ATCC 24698 / 74-OR23-1A / CBS 708.71 / DSM 1257 / FGSC 987) pph-3 gene Proteins 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 8
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical group OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 8
- 230000000670 limiting effect Effects 0.000 description 8
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 8
- 239000011369 resultant mixture Substances 0.000 description 8
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 7
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 7
- 230000004913 activation Effects 0.000 description 7
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 7
- 239000003153 chemical reaction reagent Substances 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000012948 isocyanate Substances 0.000 description 7
- 150000002513 isocyanates Chemical class 0.000 description 7
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 7
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 7
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- LJCZNYWLQZZIOS-UHFFFAOYSA-N 2,2,2-trichlorethoxycarbonyl chloride Chemical compound ClC(=O)OCC(Cl)(Cl)Cl LJCZNYWLQZZIOS-UHFFFAOYSA-N 0.000 description 6
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 6
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 6
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 6
- 125000004802 cyanophenyl group Chemical group 0.000 description 6
- 125000005842 heteroatom Chemical group 0.000 description 6
- 235000019341 magnesium sulphate Nutrition 0.000 description 6
- 229910052763 palladium Inorganic materials 0.000 description 6
- AMMGCGVWJMRTQI-UHFFFAOYSA-N prop-1-en-2-yl carbonochloridate Chemical compound CC(=C)OC(Cl)=O AMMGCGVWJMRTQI-UHFFFAOYSA-N 0.000 description 6
- 235000018102 proteins Nutrition 0.000 description 6
- 102000004169 proteins and genes Human genes 0.000 description 6
- 230000009466 transformation Effects 0.000 description 6
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 6
- TYPVHTOETJVYIV-UHFFFAOYSA-N 2,4-dichloropyridine Chemical compound ClC1=CC=NC(Cl)=C1 TYPVHTOETJVYIV-UHFFFAOYSA-N 0.000 description 5
- FNRMMDCDHWCQTH-UHFFFAOYSA-N 2-chloropyridine;3-chloropyridine;4-chloropyridine Chemical compound ClC1=CC=NC=C1.ClC1=CC=CN=C1.ClC1=CC=CC=N1 FNRMMDCDHWCQTH-UHFFFAOYSA-N 0.000 description 5
- WEMOCHMQDCMPNK-UHFFFAOYSA-N 4-(2-chloropyridin-4-yl)oxy-2-fluoroaniline Chemical compound C1=C(F)C(N)=CC=C1OC1=CC=NC(Cl)=C1 WEMOCHMQDCMPNK-UHFFFAOYSA-N 0.000 description 5
- 238000006969 Curtius rearrangement reaction Methods 0.000 description 5
- 102000004190 Enzymes Human genes 0.000 description 5
- 108090000790 Enzymes Proteins 0.000 description 5
- 239000007983 Tris buffer Substances 0.000 description 5
- 238000010521 absorption reaction Methods 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- 239000010949 copper Substances 0.000 description 5
- 230000007423 decrease Effects 0.000 description 5
- GLXDVVHUTZTUQK-UHFFFAOYSA-M lithium;hydroxide;hydrate Chemical compound [Li+].O.[OH-] GLXDVVHUTZTUQK-UHFFFAOYSA-M 0.000 description 5
- HEGSGKPQLMEBJL-RKQHYHRCSA-N octyl beta-D-glucopyranoside Chemical compound CCCCCCCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O HEGSGKPQLMEBJL-RKQHYHRCSA-N 0.000 description 5
- 229930029653 phosphoenolpyruvate Natural products 0.000 description 5
- DTBNBXWJWCWCIK-UHFFFAOYSA-N phosphoenolpyruvic acid Chemical compound OC(=O)C(=C)OP(O)(O)=O DTBNBXWJWCWCIK-UHFFFAOYSA-N 0.000 description 5
- KWTBUMWSEOCASE-UHFFFAOYSA-N prop-1-en-2-yl carbamate Chemical class CC(=C)OC(N)=O KWTBUMWSEOCASE-UHFFFAOYSA-N 0.000 description 5
- 125000004497 pyrazol-5-yl group Chemical group N1N=CC=C1* 0.000 description 5
- 108091008598 receptor tyrosine kinases Proteins 0.000 description 5
- 102000027426 receptor tyrosine kinases Human genes 0.000 description 5
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 5
- 241000894007 species Species 0.000 description 5
- 238000010189 synthetic method Methods 0.000 description 5
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 150000003852 triazoles Chemical group 0.000 description 5
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 4
- FGJVUIXKMLBXSZ-UHFFFAOYSA-N 2,2,2-trichloroethyl n-[2-(3-cyanophenyl)-5-ethylpyrazol-3-yl]carbamate Chemical compound N1=C(CC)C=C(NC(=O)OCC(Cl)(Cl)Cl)N1C1=CC=CC(C#N)=C1 FGJVUIXKMLBXSZ-UHFFFAOYSA-N 0.000 description 4
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 4
- 102100020880 Kit ligand Human genes 0.000 description 4
- 102000038030 PI3Ks Human genes 0.000 description 4
- 108091007960 PI3Ks Proteins 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 4
- 108090000430 Phosphatidylinositol 3-kinases Proteins 0.000 description 4
- 102000004022 Protein-Tyrosine Kinases Human genes 0.000 description 4
- 108090000412 Protein-Tyrosine Kinases Proteins 0.000 description 4
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- QUKGYYKBILRGFE-UHFFFAOYSA-N benzyl acetate Chemical compound CC(=O)OCC1=CC=CC=C1 QUKGYYKBILRGFE-UHFFFAOYSA-N 0.000 description 4
- 125000002619 bicyclic group Chemical group 0.000 description 4
- 125000002837 carbocyclic group Chemical group 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 210000000349 chromosome Anatomy 0.000 description 4
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 4
- 238000010828 elution Methods 0.000 description 4
- 125000004494 ethyl ester group Chemical group 0.000 description 4
- 238000003818 flash chromatography Methods 0.000 description 4
- 150000004820 halides Chemical group 0.000 description 4
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- 239000003446 ligand Substances 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 4
- 229910000027 potassium carbonate Inorganic materials 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 238000001953 recrystallisation Methods 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 229920006395 saturated elastomer Polymers 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 229910052717 sulfur Inorganic materials 0.000 description 4
- 239000011593 sulfur Substances 0.000 description 4
- 229910052723 transition metal Inorganic materials 0.000 description 4
- 150000003624 transition metals Chemical class 0.000 description 4
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical group [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 3
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical compound OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 3
- KPWDGTGXUYRARH-UHFFFAOYSA-N 2,2,2-trichloroethanol Chemical compound OCC(Cl)(Cl)Cl KPWDGTGXUYRARH-UHFFFAOYSA-N 0.000 description 3
- IUVCFHHAEHNCFT-INIZCTEOSA-N 2-[(1s)-1-[4-amino-3-(3-fluoro-4-propan-2-yloxyphenyl)pyrazolo[3,4-d]pyrimidin-1-yl]ethyl]-6-fluoro-3-(3-fluorophenyl)chromen-4-one Chemical compound C1=C(F)C(OC(C)C)=CC=C1C(C1=C(N)N=CN=C11)=NN1[C@@H](C)C1=C(C=2C=C(F)C=CC=2)C(=O)C2=CC(F)=CC=C2O1 IUVCFHHAEHNCFT-INIZCTEOSA-N 0.000 description 3
- ANECANOKKKXBNH-UHFFFAOYSA-N 3-(2-benzhydrylidenehydrazinyl)benzonitrile Chemical compound N#CC1=CC=CC(NN=C(C=2C=CC=CC=2)C=2C=CC=CC=2)=C1 ANECANOKKKXBNH-UHFFFAOYSA-N 0.000 description 3
- KOYWUYIBEXFRFH-UHFFFAOYSA-N 3-oxopentanenitrile Chemical compound CCC(=O)CC#N KOYWUYIBEXFRFH-UHFFFAOYSA-N 0.000 description 3
- MXZMACXOMZKYHJ-UHFFFAOYSA-N 4,4-dimethyl-3-oxopentanenitrile Chemical compound CC(C)(C)C(=O)CC#N MXZMACXOMZKYHJ-UHFFFAOYSA-N 0.000 description 3
- URMCOUKSGRWIOF-UHFFFAOYSA-N 4-(1-methylpyrazol-4-yl)-2-methylsulfonylpyrimidine Chemical compound C1=NN(C)C=C1C1=CC=NC(S(C)(=O)=O)=N1 URMCOUKSGRWIOF-UHFFFAOYSA-N 0.000 description 3
- MNPLTKHJEAFOCA-UHFFFAOYSA-N 4-amino-3-fluorophenol Chemical compound NC1=CC=C(O)C=C1F MNPLTKHJEAFOCA-UHFFFAOYSA-N 0.000 description 3
- VKZGTORDNRVMIN-UHFFFAOYSA-N 4-methyl-3-oxopentanenitrile Chemical compound CC(C)C(=O)CC#N VKZGTORDNRVMIN-UHFFFAOYSA-N 0.000 description 3
- 208000034951 Genetic Translocation Diseases 0.000 description 3
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 3
- 101100335081 Mus musculus Flt3 gene Proteins 0.000 description 3
- 108700020796 Oncogene Proteins 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 108010039445 Stem Cell Factor Proteins 0.000 description 3
- 238000006619 Stille reaction Methods 0.000 description 3
- 238000006069 Suzuki reaction reaction Methods 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 238000010719 annulation reaction Methods 0.000 description 3
- QYCSNMDOZNUZIT-UHFFFAOYSA-N benzhydrylidenehydrazine Chemical compound C=1C=CC=CC=1C(=NN)C1=CC=CC=C1 QYCSNMDOZNUZIT-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid group Chemical group C(C1=CC=CC=C1)(=O)O WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 238000001516 cell proliferation assay Methods 0.000 description 3
- 230000000295 complement effect Effects 0.000 description 3
- MKRTXPORKIRPDG-UHFFFAOYSA-N diphenylphosphoryl azide Chemical compound C=1C=CC=CC=1P(=O)(N=[N+]=[N-])C1=CC=CC=C1 MKRTXPORKIRPDG-UHFFFAOYSA-N 0.000 description 3
- ILTUMWMASHHTOQ-UHFFFAOYSA-N ethyl 5-propan-2-yl-1h-pyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(C(C)C)NN=1 ILTUMWMASHHTOQ-UHFFFAOYSA-N 0.000 description 3
- RCXMILPYEKVQLB-UHFFFAOYSA-N ethyl 5-tert-butyl-1h-pyrazole-3-carboxylate Chemical compound CCOC(=O)C=1C=C(C(C)(C)C)NN=1 RCXMILPYEKVQLB-UHFFFAOYSA-N 0.000 description 3
- 239000012065 filter cake Substances 0.000 description 3
- 238000004108 freeze drying Methods 0.000 description 3
- 230000004927 fusion Effects 0.000 description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- YLMAHDNUQAMNNX-UHFFFAOYSA-N imatinib methanesulfonate Chemical compound CS(O)(=O)=O.C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 YLMAHDNUQAMNNX-UHFFFAOYSA-N 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 238000004895 liquid chromatography mass spectrometry Methods 0.000 description 3
- 229910052744 lithium Inorganic materials 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000009635 nitrosylation Effects 0.000 description 3
- 230000000269 nucleophilic effect Effects 0.000 description 3
- 102000027450 oncoproteins Human genes 0.000 description 3
- 108091008819 oncoproteins Proteins 0.000 description 3
- 125000002524 organometallic group Chemical group 0.000 description 3
- 230000037361 pathway Effects 0.000 description 3
- 230000026731 phosphorylation Effects 0.000 description 3
- 238000006366 phosphorylation reaction Methods 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 230000008569 process Effects 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 102000005962 receptors Human genes 0.000 description 3
- 108020003175 receptors Proteins 0.000 description 3
- 229910000080 stannane Inorganic materials 0.000 description 3
- 238000003786 synthesis reaction Methods 0.000 description 3
- 238000000844 transformation Methods 0.000 description 3
- 230000007704 transition Effects 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- BTQIJXHWQVDZJL-UHFFFAOYSA-N (2-chloro-4-fluoro-5-nitrophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC([N+]([O-])=O)=C(F)C=C1Cl BTQIJXHWQVDZJL-UHFFFAOYSA-N 0.000 description 2
- OYZZFKIAYSRYMD-UHFFFAOYSA-N (2-chloro-4-fluorophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(F)C=C1Cl OYZZFKIAYSRYMD-UHFFFAOYSA-N 0.000 description 2
- XDBHWPLGGBLUHH-UHFFFAOYSA-N (3-cyanophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(C#N)=C1 XDBHWPLGGBLUHH-UHFFFAOYSA-N 0.000 description 2
- KIQNTUVEIYAMDA-UHFFFAOYSA-N (4-fluoro-2-methylphenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(F)C=C1C KIQNTUVEIYAMDA-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- AVWNNVJXXMKAPB-UHFFFAOYSA-N 1,3-difluoro-2-methyl-4-nitrobenzene Chemical compound CC1=C(F)C=CC([N+]([O-])=O)=C1F AVWNNVJXXMKAPB-UHFFFAOYSA-N 0.000 description 2
- WORJRXHJTUTINR-UHFFFAOYSA-N 1,4-dioxane;hydron;chloride Chemical compound Cl.C1COCCO1 WORJRXHJTUTINR-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- ZIQAVMIKEIMTPT-UHFFFAOYSA-N 1h-pyrazol-4-ylcarbamic acid Chemical compound OC(=O)NC=1C=NNC=1 ZIQAVMIKEIMTPT-UHFFFAOYSA-N 0.000 description 2
- WCKCRGJWZOEAQQ-UHFFFAOYSA-N 2,2,2-trichloroethyl 5-tert-butyl-2-(3-ethoxycarbonylphenyl)pyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC=CC(N2C(=CC(=N2)C(C)(C)C)C(=O)OCC(Cl)(Cl)Cl)=C1 WCKCRGJWZOEAQQ-UHFFFAOYSA-N 0.000 description 2
- QPLJYAKLSCXZSF-UHFFFAOYSA-N 2,2,2-trichloroethyl carbamate Chemical class NC(=O)OCC(Cl)(Cl)Cl QPLJYAKLSCXZSF-UHFFFAOYSA-N 0.000 description 2
- CEPXFJNTZQMVSD-UHFFFAOYSA-N 2,3-difluoro-1-nitro-4-phenylmethoxybenzene Chemical compound FC1=C(F)C([N+](=O)[O-])=CC=C1OCC1=CC=CC=C1 CEPXFJNTZQMVSD-UHFFFAOYSA-N 0.000 description 2
- NAWVMCKMQMJQMF-UHFFFAOYSA-N 2-chloro-4-fluoro-5-nitrophenol Chemical compound OC1=CC([N+]([O-])=O)=C(F)C=C1Cl NAWVMCKMQMJQMF-UHFFFAOYSA-N 0.000 description 2
- FKYGTZCBTMOXLJ-UHFFFAOYSA-N 2-fluoro-3-methyl-1-nitro-4-phenylmethoxybenzene Chemical compound CC1=C(F)C([N+]([O-])=O)=CC=C1OCC1=CC=CC=C1 FKYGTZCBTMOXLJ-UHFFFAOYSA-N 0.000 description 2
- WNDLOBWBYQHDQY-UHFFFAOYSA-N 3-(2-fluorophenyl)-3-oxopropanenitrile Chemical compound FC1=CC=CC=C1C(=O)CC#N WNDLOBWBYQHDQY-UHFFFAOYSA-N 0.000 description 2
- SYBYTAAJFKOIEJ-UHFFFAOYSA-N 3-Methylbutan-2-one Chemical compound CC(C)C(C)=O SYBYTAAJFKOIEJ-UHFFFAOYSA-N 0.000 description 2
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 2
- YONFQPJFIKYVLO-UHFFFAOYSA-N 3-hydrazinylbenzoic acid;hydrochloride Chemical compound Cl.NNC1=CC=CC(C(O)=O)=C1 YONFQPJFIKYVLO-UHFFFAOYSA-N 0.000 description 2
- XYBDWAJRLOENQM-UHFFFAOYSA-N 3-phenyl-1-propan-2-ylpyrazole-4-carboxylic acid Chemical compound CC(C)N1C=C(C(O)=O)C(C=2C=CC=CC=2)=N1 XYBDWAJRLOENQM-UHFFFAOYSA-N 0.000 description 2
- UJLKEKMILUDAKA-UHFFFAOYSA-N 4-(1-methylpyrazol-4-yl)-2-methylsulfinylpyrimidine Chemical compound C1=NN(C)C=C1C1=CC=NC(S(C)=O)=N1 UJLKEKMILUDAKA-UHFFFAOYSA-N 0.000 description 2
- YPCCTUAFFCMZHT-UHFFFAOYSA-N 4-(2-chloropyridin-4-yl)oxy-2-fluoro-3-methylaniline Chemical compound CC1=C(F)C(N)=CC=C1OC1=CC=NC(Cl)=C1 YPCCTUAFFCMZHT-UHFFFAOYSA-N 0.000 description 2
- TVOJIBGZFYMWDT-UHFFFAOYSA-N 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1h-pyrazole Chemical compound O1C(C)(C)C(C)(C)OB1C1=CNN=C1 TVOJIBGZFYMWDT-UHFFFAOYSA-N 0.000 description 2
- QSNBIPPOAHDRFM-UHFFFAOYSA-N 4-amino-3-fluoro-2-methylphenol Chemical compound CC1=C(O)C=CC(N)=C1F QSNBIPPOAHDRFM-UHFFFAOYSA-N 0.000 description 2
- RSHVJZUBABFJRL-UHFFFAOYSA-N 4-fluoro-2-methyl-5-nitrophenol Chemical compound CC1=CC(F)=C([N+]([O-])=O)C=C1O RSHVJZUBABFJRL-UHFFFAOYSA-N 0.000 description 2
- MACOQKREHMMMLL-UHFFFAOYSA-N 5-(2-benzhydrylidenehydrazinyl)-2-fluorobenzonitrile Chemical compound C1=C(C#N)C(F)=CC=C1NN=C(C=1C=CC=CC=1)C1=CC=CC=C1 MACOQKREHMMMLL-UHFFFAOYSA-N 0.000 description 2
- HEAQOCBITATQEW-UHFFFAOYSA-N 5-amino-4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=C(N)C=C1O HEAQOCBITATQEW-UHFFFAOYSA-N 0.000 description 2
- HCFXEPUTNPFTSQ-UHFFFAOYSA-N 5-hydrazinyl-2-methylbenzonitrile;hydrochloride Chemical compound Cl.CC1=CC=C(NN)C=C1C#N HCFXEPUTNPFTSQ-UHFFFAOYSA-N 0.000 description 2
- WZOJXPDBRDXLHM-UHFFFAOYSA-N 5-phenyl-1-propan-2-ylpyrazole-4-carboxylic acid Chemical compound CC(C)N1N=CC(C(O)=O)=C1C1=CC=CC=C1 WZOJXPDBRDXLHM-UHFFFAOYSA-N 0.000 description 2
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- JGLMVXWAHNTPRF-CMDGGOBGSA-N CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O Chemical compound CCN1N=C(C)C=C1C(=O)NC1=NC2=CC(=CC(OC)=C2N1C\C=C\CN1C(NC(=O)C2=CC(C)=NN2CC)=NC2=CC(=CC(OCCCN3CCOCC3)=C12)C(N)=O)C(N)=O JGLMVXWAHNTPRF-CMDGGOBGSA-N 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- 208000032320 Germ cell tumor of testis Diseases 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000005517 L01XE01 - Imatinib Substances 0.000 description 2
- 208000019693 Lung disease Diseases 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- 102100027754 Mast/stem cell growth factor receptor Kit Human genes 0.000 description 2
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical class CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- 208000034176 Neoplasms, Germ Cell and Embryonal Diseases 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- 108010024221 Proto-Oncogene Proteins c-bcr Proteins 0.000 description 2
- 102000015690 Proto-Oncogene Proteins c-bcr Human genes 0.000 description 2
- WHBMMWSBFZVSSR-UHFFFAOYSA-N R3HBA Natural products CC(O)CC(O)=O WHBMMWSBFZVSSR-UHFFFAOYSA-N 0.000 description 2
- 206010041067 Small cell lung cancer Diseases 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 108091008605 VEGF receptors Proteins 0.000 description 2
- 102100033177 Vascular endothelial growth factor receptor 2 Human genes 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001345 alkine derivatives Chemical class 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 125000000539 amino acid group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000012298 atmosphere Substances 0.000 description 2
- 125000004429 atom Chemical group 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 229940007550 benzyl acetate Drugs 0.000 description 2
- 235000019445 benzyl alcohol Nutrition 0.000 description 2
- 230000002051 biphasic effect Effects 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000006880 cross-coupling reaction Methods 0.000 description 2
- 230000001086 cytosolic effect Effects 0.000 description 2
- 230000007547 defect Effects 0.000 description 2
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 2
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 238000001952 enzyme assay Methods 0.000 description 2
- YAHUDNWHZFLCBN-ZRDIBKRKSA-N ethyl (e)-2-benzoyl-3-ethoxyprop-2-enoate Chemical compound CCO\C=C(\C(=O)OCC)C(=O)C1=CC=CC=C1 YAHUDNWHZFLCBN-ZRDIBKRKSA-N 0.000 description 2
- YAHUDNWHZFLCBN-BENRWUELSA-N ethyl (z)-2-benzoyl-3-ethoxyprop-2-enoate Chemical compound CCO\C=C(/C(=O)OCC)C(=O)C1=CC=CC=C1 YAHUDNWHZFLCBN-BENRWUELSA-N 0.000 description 2
- VIXWCQLEEMDSRY-UHFFFAOYSA-N ethyl 2-(3-cyanophenyl)-5-propan-2-ylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C(C)C)=NN1C1=CC=CC(C#N)=C1 VIXWCQLEEMDSRY-UHFFFAOYSA-N 0.000 description 2
- DNDJARWVBDEYEW-UHFFFAOYSA-N ethyl 2-methyl-4-phenylpyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=C(C)N=C1C1=CC=CC=C1 DNDJARWVBDEYEW-UHFFFAOYSA-N 0.000 description 2
- QMOYBOQAQDIKMU-UHFFFAOYSA-N ethyl 4-[3-ethyl-5-[[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]carbamoylamino]pyrazol-1-yl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(NC(=O)NC=2C(=CC(OC=3C=C(N=CC=3)C3=CN(C)N=C3)=CC=2)F)=CC(CC)=N1 QMOYBOQAQDIKMU-UHFFFAOYSA-N 0.000 description 2
- FKRCODPIKNYEAC-UHFFFAOYSA-N ethyl propionate Chemical compound CCOC(=O)CC FKRCODPIKNYEAC-UHFFFAOYSA-N 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229940080856 gleevec Drugs 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002429 hydrazines Chemical class 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 238000001727 in vivo Methods 0.000 description 2
- 238000011534 incubation Methods 0.000 description 2
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 2
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical compound C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- 229910052749 magnesium Inorganic materials 0.000 description 2
- GJMNUIAUZFBEAT-UHFFFAOYSA-N methyl 2-tert-butyl-4-phenylpyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(C(C)(C)C)N=C1C1=CC=CC=C1 GJMNUIAUZFBEAT-UHFFFAOYSA-N 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000007339 nucleophilic aromatic substitution reaction Methods 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000003880 polar aprotic solvent Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 239000000651 prodrug Substances 0.000 description 2
- 229940002612 prodrug Drugs 0.000 description 2
- LTIYUAPHCSXAFF-UHFFFAOYSA-N prop-1-en-2-yl 2-(4-ethoxycarbonylphenyl)-5-ethylpyrazole-3-carboxylate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(C(=O)OC(C)=C)=CC(CC)=N1 LTIYUAPHCSXAFF-UHFFFAOYSA-N 0.000 description 2
- BJJPGSMLBCFUBD-UHFFFAOYSA-N prop-1-en-2-yl n-[2-(3-cyano-4-fluorophenyl)-5-propan-2-ylpyrazol-3-yl]carbamate Chemical compound N1=C(C(C)C)C=C(NC(=O)OC(C)=C)N1C1=CC=C(F)C(C#N)=C1 BJJPGSMLBCFUBD-UHFFFAOYSA-N 0.000 description 2
- 150000003217 pyrazoles Chemical class 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 230000011664 signaling Effects 0.000 description 2
- 150000003384 small molecules Chemical class 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003419 tautomerization reaction Methods 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 208000002918 testicular germ cell tumor Diseases 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- 230000001131 transforming effect Effects 0.000 description 2
- DBGVGMSCBYYSLD-UHFFFAOYSA-N tributylstannane Chemical class CCCC[SnH](CCCC)CCCC DBGVGMSCBYYSLD-UHFFFAOYSA-N 0.000 description 2
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 2
- UCPYLLCMEDAXFR-UHFFFAOYSA-N triphosgene Chemical compound ClC(Cl)(Cl)OC(=O)OC(Cl)(Cl)Cl UCPYLLCMEDAXFR-UHFFFAOYSA-N 0.000 description 2
- 229940121358 tyrosine kinase inhibitor Drugs 0.000 description 2
- 238000011144 upstream manufacturing Methods 0.000 description 2
- UAOUIVVJBYDFKD-XKCDOFEDSA-N (1R,9R,10S,11R,12R,15S,18S,21R)-10,11,21-trihydroxy-8,8-dimethyl-14-methylidene-4-(prop-2-enylamino)-20-oxa-5-thia-3-azahexacyclo[9.7.2.112,15.01,9.02,6.012,18]henicosa-2(6),3-dien-13-one Chemical compound C([C@@H]1[C@@H](O)[C@@]23C(C1=C)=O)C[C@H]2[C@]12C(N=C(NCC=C)S4)=C4CC(C)(C)[C@H]1[C@H](O)[C@]3(O)OC2 UAOUIVVJBYDFKD-XKCDOFEDSA-N 0.000 description 1
- KNXQDJCZSVHEIW-UHFFFAOYSA-N (3-fluorophenyl)boronic acid Chemical compound OB(O)C1=CC=CC(F)=C1 KNXQDJCZSVHEIW-UHFFFAOYSA-N 0.000 description 1
- CEBAHYWORUOILU-UHFFFAOYSA-N (4-cyanophenyl)boronic acid Chemical compound OB(O)C1=CC=C(C#N)C=C1 CEBAHYWORUOILU-UHFFFAOYSA-N 0.000 description 1
- PTXLLIWPYYEKGR-UHFFFAOYSA-N (4-fluoro-2-methyl-5-nitrophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC([N+]([O-])=O)=C(F)C=C1C PTXLLIWPYYEKGR-UHFFFAOYSA-N 0.000 description 1
- ARCACZWMYGILNI-UHFFFAOYSA-N 1,2,3-trifluoro-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(F)C(F)=C1F ARCACZWMYGILNI-UHFFFAOYSA-N 0.000 description 1
- HANPIZQMFCWPKY-UHFFFAOYSA-N 1,2-oxazol-4-ylboronic acid Chemical compound OB(O)C=1C=NOC=1 HANPIZQMFCWPKY-UHFFFAOYSA-N 0.000 description 1
- GKIDQFNROYTUAL-UHFFFAOYSA-N 1-(1-ethyl-3-phenylpyrazol-4-yl)-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1=NN(CC)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 GKIDQFNROYTUAL-UHFFFAOYSA-N 0.000 description 1
- XPTCUTMHMRXBHU-UHFFFAOYSA-N 1-(1-ethyl-5-phenylpyrazol-4-yl)-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea;hydrochloride Chemical compound Cl.C=1C=CC=CC=1C=1N(CC)N=CC=1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 XPTCUTMHMRXBHU-UHFFFAOYSA-N 0.000 description 1
- VXODIBRCNBLDIH-UHFFFAOYSA-N 1-(5-chloro-2-phenylphenyl)-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3C(=CC=C(Cl)C=3)C=3C=CC=CC=3)=CC=2)=CC=N1 VXODIBRCNBLDIH-UHFFFAOYSA-N 0.000 description 1
- ZXZSNOJHTHZYNF-UHFFFAOYSA-N 1-[1-tert-butyl-3-[3-(hydroxymethyl)phenyl]pyrazol-4-yl]-3-[2-fluoro-4-[2-(1,2-oxazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(CO)=CC=1C1=NN(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NOC=1 ZXZSNOJHTHZYNF-UHFFFAOYSA-N 0.000 description 1
- FMERGBRRDDXJOI-UHFFFAOYSA-N 1-[1-tert-butyl-3-[3-(hydroxymethyl)phenyl]pyrazol-4-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3C(=NN(C=3)C(C)(C)C)C=3C=C(CO)C=CC=3)=CC=2)=CC=N1 FMERGBRRDDXJOI-UHFFFAOYSA-N 0.000 description 1
- OSFNODLLLVLZQR-UHFFFAOYSA-N 1-[1-tert-butyl-3-[3-(hydroxymethyl)phenyl]pyrazol-4-yl]-3-[2-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(CO)=CC=1C1=NN(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NNC=1 OSFNODLLLVLZQR-UHFFFAOYSA-N 0.000 description 1
- GFLSINAFUKNBTC-UHFFFAOYSA-N 1-[1-tert-butyl-3-[3-(hydroxymethyl)phenyl]pyrazol-4-yl]-3-[2-fluoro-4-[2-(2-methylpyrazol-3-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound CN1N=CC=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3C(=NN(C=3)C(C)(C)C)C=3C=C(CO)C=CC=3)=CC=2)=CC=N1 GFLSINAFUKNBTC-UHFFFAOYSA-N 0.000 description 1
- WCEAREQIDQARIH-UHFFFAOYSA-N 1-[2,3-difluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-(2,5-diphenylpyrazol-3-yl)urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=C(F)C(NC(=O)NC=3N(N=C(C=3)C=3C=CC=CC=3)C=3C=CC=CC=3)=CC=2)F)=CC=N1 WCEAREQIDQARIH-UHFFFAOYSA-N 0.000 description 1
- PWIVMJWLAINUKF-UHFFFAOYSA-N 1-[2,3-difluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-[5-(2-fluorophenyl)-2-methylpyrazol-3-yl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=C(F)C(NC(=O)NC=3N(N=C(C=3)C=3C(=CC=CC=3)F)C)=CC=2)F)=CC=N1 PWIVMJWLAINUKF-UHFFFAOYSA-N 0.000 description 1
- GDKNSJQSNHZYNZ-UHFFFAOYSA-N 1-[2-(3-cyano-4-fluorophenyl)-5-propan-2-ylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(F)C(C#N)=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 GDKNSJQSNHZYNZ-UHFFFAOYSA-N 0.000 description 1
- HTCXPQJVAMJBGA-UHFFFAOYSA-N 1-[2-(3-cyano-4-methylphenyl)-5-propan-2-ylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(C)C(C#N)=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 HTCXPQJVAMJBGA-UHFFFAOYSA-N 0.000 description 1
- SCJOVWUUOWTHCN-UHFFFAOYSA-N 1-[2-(3-cyanophenyl)-5-ethylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-propylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(CCC)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(CC)C=3)C=3C=C(C=CC=3)C#N)=CC=2)=CC=N1 SCJOVWUUOWTHCN-UHFFFAOYSA-N 0.000 description 1
- DORIGQQZEKDVBT-UHFFFAOYSA-N 1-[2-(3-cyanophenyl)-5-methylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 DORIGQQZEKDVBT-UHFFFAOYSA-N 0.000 description 1
- GSWJSTUXIMEXDR-UHFFFAOYSA-N 1-[2-(3-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 GSWJSTUXIMEXDR-UHFFFAOYSA-N 0.000 description 1
- ZYTOUCZCUKNGHE-UHFFFAOYSA-N 1-[2-(3-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]-3-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C=C1F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 ZYTOUCZCUKNGHE-UHFFFAOYSA-N 0.000 description 1
- MROUKGSJYWFAFQ-UHFFFAOYSA-N 1-[2-(4-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-3-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(C#N)C=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=CN(C)N=1 MROUKGSJYWFAFQ-UHFFFAOYSA-N 0.000 description 1
- FZABQTJYCOJHKT-UHFFFAOYSA-N 1-[2-(4-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(C#N)C=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 FZABQTJYCOJHKT-UHFFFAOYSA-N 0.000 description 1
- MDDVBVIUOHBTCR-UHFFFAOYSA-N 1-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-(2-methyl-4-phenylpyrimidin-5-yl)urea Chemical compound C=1C=CC=CC=1C1=NC(C)=NC=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 MDDVBVIUOHBTCR-UHFFFAOYSA-N 0.000 description 1
- HOQPQQKQXDAQJG-UHFFFAOYSA-N 1-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-(5-phenyl-1-propan-2-ylpyrazol-4-yl)urea Chemical compound C=1C=CC=CC=1C=1N(C(C)C)N=CC=1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 HOQPQQKQXDAQJG-UHFFFAOYSA-N 0.000 description 1
- KBHRBAYJHAEYEL-UHFFFAOYSA-N 1-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-[2-(3-fluorophenyl)-5-propan-2-ylpyrazol-3-yl]urea Chemical compound C=1C=CC(F)=CC=1N1N=C(C(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 KBHRBAYJHAEYEL-UHFFFAOYSA-N 0.000 description 1
- ASELVHQOJUSFIR-UHFFFAOYSA-N 1-[3-(4-fluorophenoxy)-5-(trifluoromethyl)phenyl]-3-[3-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=CC(F)=CC=C1OC1=CC(NC(=O)NC=2C=C(F)C(OC=3C=C(N=CC=3)C3=CNN=C3)=CC=2)=CC(C(F)(F)F)=C1 ASELVHQOJUSFIR-UHFFFAOYSA-N 0.000 description 1
- CSUXRVCDKAATHX-UHFFFAOYSA-N 1-[3-(4-fluorophenoxy)-5-methylphenyl]-3-[3-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C(OC=2C=CC(F)=CC=2)=CC(C)=CC=1NC(=O)NC(C=C1F)=CC=C1OC(C=1)=CC=NC=1C=1C=NNC=1 CSUXRVCDKAATHX-UHFFFAOYSA-N 0.000 description 1
- HQXRWWMRIPLYMW-UHFFFAOYSA-N 1-[3-(4-fluorophenoxy)phenyl]-3-[3-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=CC(F)=CC=C1OC1=CC=CC(NC(=O)NC=2C=C(F)C(OC=3C=C(N=CC=3)C3=CNN=C3)=CC=2)=C1 HQXRWWMRIPLYMW-UHFFFAOYSA-N 0.000 description 1
- DPFHMHIISQWZNL-UHFFFAOYSA-N 1-[3-chloro-5-(4-fluorophenoxy)phenyl]-3-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC=3C=C(OC=4C=CC(F)=CC=4)C=C(Cl)C=3)=CC=2)F)=CC=N1 DPFHMHIISQWZNL-UHFFFAOYSA-N 0.000 description 1
- SILDETHPSJDJIM-UHFFFAOYSA-N 1-[3-chloro-5-(4-fluorophenoxy)phenyl]-3-[3-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=CC(F)=CC=C1OC1=CC(Cl)=CC(NC(=O)NC=2C=C(F)C(OC=3C=C(N=CC=3)C3=CNN=C3)=CC=2)=C1 SILDETHPSJDJIM-UHFFFAOYSA-N 0.000 description 1
- SILHIALPOIEVNS-UHFFFAOYSA-N 1-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-(2-oxo-5-phenoxy-1,3-dihydroindol-3-yl)urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC3C4=CC(OC=5C=CC=CC=5)=CC=C4NC3=O)=CC=2)F)=CC=N1 SILHIALPOIEVNS-UHFFFAOYSA-N 0.000 description 1
- OWWFRQPTQLAOCS-UHFFFAOYSA-N 1-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-(5-phenoxy-1h-indazol-3-yl)urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC=3C4=CC(OC=5C=CC=CC=5)=CC=C4NN=3)=CC=2)F)=CC=N1 OWWFRQPTQLAOCS-UHFFFAOYSA-N 0.000 description 1
- YUMMMEDPJXTKDV-UHFFFAOYSA-N 1-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-[3-(4-fluorophenoxy)phenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC=3C=C(OC=4C=CC(F)=CC=4)C=CC=3)=CC=2)F)=CC=N1 YUMMMEDPJXTKDV-UHFFFAOYSA-N 0.000 description 1
- QSXBKIVBUIKDFV-UHFFFAOYSA-N 1-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-[5-(4-fluorophenoxy)-1h-indazol-3-yl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC=3C4=CC(OC=5C=CC(F)=CC=5)=CC=C4NN=3)=CC=2)F)=CC=N1 QSXBKIVBUIKDFV-UHFFFAOYSA-N 0.000 description 1
- OCAWDADMYSVUNP-UHFFFAOYSA-N 1-[3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]-3-[6-(4-fluorophenoxy)-1,3-benzoxazol-2-yl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(NC(=O)NC=3OC4=CC(OC=5C=CC(F)=CC=5)=CC=C4N=3)=CC=2)F)=CC=N1 OCAWDADMYSVUNP-UHFFFAOYSA-N 0.000 description 1
- MKINOOBYTFRYSX-UHFFFAOYSA-N 1-[5-ethyl-2-[3-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(CO)=CC=1N1N=C(CC)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 MKINOOBYTFRYSX-UHFFFAOYSA-N 0.000 description 1
- DMMDGQZWHMPHDJ-UHFFFAOYSA-N 1-[5-ethyl-2-[4-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(CO)C=CC=1N1N=C(CC)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NN(C)C=1 DMMDGQZWHMPHDJ-UHFFFAOYSA-N 0.000 description 1
- SQUAQOZKVBLBGI-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1,2-oxazol-3-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=CON=1 SQUAQOZKVBLBGI-UHFFFAOYSA-N 0.000 description 1
- PSQFZTWODIVNIQ-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1,2-oxazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NOC=1 PSQFZTWODIVNIQ-UHFFFAOYSA-N 0.000 description 1
- DVANBILRBGXIGI-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea;hydrochloride Chemical compound Cl.C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=C(C=CC=3)C#N)=CC=2)=CC=N1 DVANBILRBGXIGI-UHFFFAOYSA-N 0.000 description 1
- WXEBLUABRDGWBA-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea;hydrochloride Chemical compound Cl.C=1C=CC(C#N)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NNC=1 WXEBLUABRDGWBA-UHFFFAOYSA-N 0.000 description 1
- LOECNKYCWHEMDP-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(3-methyltriazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound CN1N=NC=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=C(C=CC=3)C#N)=CC=2)=CC=N1 LOECNKYCWHEMDP-UHFFFAOYSA-N 0.000 description 1
- BZLVIXCGKGIGKN-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-methyl-5-[4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]urea Chemical compound C1=C(OC=2N=C(C=CN=2)C2=CN(C)N=C2)C(C)=CC(F)=C1NC(=O)NC1=CC(C(C)(C)C)=NN1C1=CC=CC(C#N)=C1 BZLVIXCGKGIGKN-UHFFFAOYSA-N 0.000 description 1
- AAIPCVGZBFINTE-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-5-[2-(1h-pyrazol-4-yl)pyrimidin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(C#N)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=CC=1)F)=CC=1OC(N=1)=CC=NC=1C=1C=NNC=1 AAIPCVGZBFINTE-UHFFFAOYSA-N 0.000 description 1
- XUOZBBMEXHPTGL-UHFFFAOYSA-N 1-[5-tert-butyl-2-(3-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-5-[4-(1-methylpyrazol-4-yl)pyrimidin-2-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC=NC(OC=2C=C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=C(C=CC=3)C#N)C(F)=CC=2)=N1 XUOZBBMEXHPTGL-UHFFFAOYSA-N 0.000 description 1
- OTTRRMHAOOBVOQ-UHFFFAOYSA-N 1-[5-tert-butyl-2-(4-cyano-3-fluorophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=C(C#N)C(F)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NNC=1 OTTRRMHAOOBVOQ-UHFFFAOYSA-N 0.000 description 1
- RYPLJPGNAZOTTL-UHFFFAOYSA-N 1-[5-tert-butyl-2-(4-cyanophenyl)pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=CC(=CC=3)C#N)=CC=2)=CC=N1 RYPLJPGNAZOTTL-UHFFFAOYSA-N 0.000 description 1
- XUZMSNXFRHBMPM-UHFFFAOYSA-N 1-[5-tert-butyl-2-[3-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=C(CO)C=CC=3)=CC=2)=CC=N1 XUZMSNXFRHBMPM-UHFFFAOYSA-N 0.000 description 1
- PVWFHNCTUUEFOV-UHFFFAOYSA-N 1-[5-tert-butyl-2-[3-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(CO)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=NNC=1 PVWFHNCTUUEFOV-UHFFFAOYSA-N 0.000 description 1
- PCXWKTKYNKWYOH-UHFFFAOYSA-N 1-[5-tert-butyl-2-[3-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1h-pyrazol-5-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C=1C=CC(CO)=CC=1N1N=C(C(C)(C)C)C=C1NC(=O)NC(C(=C1)F)=CC=C1OC(C=1)=CC=NC=1C=1C=CNN=1 PCXWKTKYNKWYOH-UHFFFAOYSA-N 0.000 description 1
- IECILGJFDXGUEF-UHFFFAOYSA-N 1-[5-tert-butyl-2-[4-(hydroxymethyl)phenyl]pyrazol-3-yl]-3-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]urea Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=CC(CO)=CC=3)=CC=2)=CC=N1 IECILGJFDXGUEF-UHFFFAOYSA-N 0.000 description 1
- BJMSXWLXFYZHIU-UHFFFAOYSA-N 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound CN1C=CC(B2OC(C)(C)C(C)(C)O2)=N1 BJMSXWLXFYZHIU-UHFFFAOYSA-N 0.000 description 1
- ZROILLPDIUNLSE-UHFFFAOYSA-N 1-phenyl-1h-pyrazole-4-carboxylic acid Chemical compound C1=C(C(=O)O)C=NN1C1=CC=CC=C1 ZROILLPDIUNLSE-UHFFFAOYSA-N 0.000 description 1
- OGYYMVGDKVJYSU-UHFFFAOYSA-N 1-propan-2-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(C(C)C)C=C1B1OC(C)(C)C(C)(C)O1 OGYYMVGDKVJYSU-UHFFFAOYSA-N 0.000 description 1
- BKLGYJWLZWMIDO-UHFFFAOYSA-N 1-propyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole Chemical compound C1=NN(CCC)C=C1B1OC(C)(C)C(C)(C)O1 BKLGYJWLZWMIDO-UHFFFAOYSA-N 0.000 description 1
- QWENRTYMTSOGBR-UHFFFAOYSA-N 1H-1,2,3-Triazole Chemical compound C=1C=NNN=1 QWENRTYMTSOGBR-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- KOPFEFZSAMLEHK-UHFFFAOYSA-M 1h-pyrazole-5-carboxylate Chemical compound [O-]C(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-M 0.000 description 1
- YPNKSHMVFZYSOJ-UHFFFAOYSA-N 2-(3-fluorophenyl)-5-propan-2-ylpyrazole-3-carboxylic acid Chemical compound N1=C(C(C)C)C=C(C(O)=O)N1C1=CC=CC(F)=C1 YPNKSHMVFZYSOJ-UHFFFAOYSA-N 0.000 description 1
- TVTJUIAKQFIXCE-HUKYDQBMSA-N 2-amino-9-[(2R,3S,4S,5R)-4-fluoro-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-prop-2-ynyl-1H-purine-6,8-dione Chemical compound NC=1NC(C=2N(C(N(C=2N=1)[C@@H]1O[C@@H]([C@H]([C@H]1O)F)CO)=O)CC#C)=O TVTJUIAKQFIXCE-HUKYDQBMSA-N 0.000 description 1
- IGYXYGDEYHNFFT-UHFFFAOYSA-N 2-chloro-4-fluorophenol Chemical compound OC1=CC=C(F)C=C1Cl IGYXYGDEYHNFFT-UHFFFAOYSA-N 0.000 description 1
- QQTSNAYKLCTERN-UHFFFAOYSA-N 2-fluoro-3-methyl-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyaniline Chemical compound C1=CC(N)=C(F)C(C)=C1OC1=CC=NC(C2=CN(C)N=C2)=C1 QQTSNAYKLCTERN-UHFFFAOYSA-N 0.000 description 1
- WMGWVMIJCJGFMT-UHFFFAOYSA-N 2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyaniline Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(N)=CC=2)=CC=N1 WMGWVMIJCJGFMT-UHFFFAOYSA-N 0.000 description 1
- SNNXJTVWMPKCJE-UHFFFAOYSA-N 2-fluoro-4-[2-(1-propan-2-ylpyrazol-4-yl)pyridin-4-yl]oxyaniline Chemical compound C1=NN(C(C)C)C=C1C1=CC(OC=2C=C(F)C(N)=CC=2)=CC=N1 SNNXJTVWMPKCJE-UHFFFAOYSA-N 0.000 description 1
- HQUOIRHAAZBOKP-UHFFFAOYSA-N 2-fluoro-4-[2-(1h-pyrazol-4-yl)pyridin-4-yl]oxyaniline Chemical compound C1=C(F)C(N)=CC=C1OC1=CC=NC(C2=CNN=C2)=C1 HQUOIRHAAZBOKP-UHFFFAOYSA-N 0.000 description 1
- GDHXJNRAJRCGMX-UHFFFAOYSA-N 2-fluorobenzonitrile Chemical compound FC1=CC=CC=C1C#N GDHXJNRAJRCGMX-UHFFFAOYSA-N 0.000 description 1
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 1
- XKJAQESOTNACHT-UHFFFAOYSA-N 2-methyl-4-phenylpyrimidine-5-carboxylic acid Chemical compound CC1=NC=C(C(O)=O)C(C=2C=CC=CC=2)=N1 XKJAQESOTNACHT-UHFFFAOYSA-N 0.000 description 1
- NFAMUEUGJSLZMQ-UHFFFAOYSA-N 2-tert-butyl-4-phenylpyrimidine-5-carboxylic acid Chemical compound CC(C)(C)C1=NC=C(C(O)=O)C(C=2C=CC=CC=2)=N1 NFAMUEUGJSLZMQ-UHFFFAOYSA-N 0.000 description 1
- DMSCRVSGZGQYMN-UHFFFAOYSA-N 3-(5-amino-3-ethylpyrazol-1-yl)benzonitrile Chemical compound N1=C(CC)C=C(N)N1C1=CC=CC(C#N)=C1 DMSCRVSGZGQYMN-UHFFFAOYSA-N 0.000 description 1
- PGNOIIIMPYPVHH-UHFFFAOYSA-N 3-(5-amino-3-propan-2-ylpyrazol-1-yl)benzonitrile Chemical compound N1=C(C(C)C)C=C(N)N1C1=CC=CC(C#N)=C1 PGNOIIIMPYPVHH-UHFFFAOYSA-N 0.000 description 1
- LIUJJVCUIDFKSW-UHFFFAOYSA-N 3-(5-amino-3-tert-butylpyrazol-1-yl)benzoic acid Chemical compound N1=C(C(C)(C)C)C=C(N)N1C1=CC=CC(C(O)=O)=C1 LIUJJVCUIDFKSW-UHFFFAOYSA-N 0.000 description 1
- FKZOBLFLZDLLMW-UHFFFAOYSA-N 3-[3-tert-butyl-5-[[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]carbamoylamino]pyrazol-1-yl]benzoic acid Chemical compound C1=NN(C)C=C1C1=CC(OC=2C=C(F)C(NC(=O)NC=3N(N=C(C=3)C(C)(C)C)C=3C=C(C=CC=3)C(O)=O)=CC=2)=CC=N1 FKZOBLFLZDLLMW-UHFFFAOYSA-N 0.000 description 1
- VJCSFNNTQGRAKH-UHFFFAOYSA-N 3-amino-4-fluorophenol Chemical compound NC1=CC(O)=CC=C1F VJCSFNNTQGRAKH-UHFFFAOYSA-N 0.000 description 1
- XFDUHJPVQKIXHO-UHFFFAOYSA-N 3-aminobenzoic acid Chemical compound NC1=CC=CC(C(O)=O)=C1 XFDUHJPVQKIXHO-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- STXAVEHFKAXGOX-UHFFFAOYSA-N 3-bromobenzonitrile Chemical compound BrC1=CC=CC(C#N)=C1 STXAVEHFKAXGOX-UHFFFAOYSA-N 0.000 description 1
- KLLMSGLHWUJAAQ-UHFFFAOYSA-N 3-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyaniline Chemical compound C1=NN(C)C=C1C1=CC(OC=2C(=CC(N)=CC=2)F)=CC=N1 KLLMSGLHWUJAAQ-UHFFFAOYSA-N 0.000 description 1
- HXUIDZOMTRMIOE-UHFFFAOYSA-M 3-oxo-3-phenylpropionate Chemical compound [O-]C(=O)CC(=O)C1=CC=CC=C1 HXUIDZOMTRMIOE-UHFFFAOYSA-M 0.000 description 1
- ITDQAGVPLHRULM-UHFFFAOYSA-N 4-(1-methylpyrazol-4-yl)-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=CC(C2=CN(C)N=C2)=N1 ITDQAGVPLHRULM-UHFFFAOYSA-N 0.000 description 1
- NATYUMBJQCWZKF-UHFFFAOYSA-N 4-(2-chloropyridin-4-yl)oxy-2,3-difluoroaniline Chemical compound FC1=C(F)C(N)=CC=C1OC1=CC=NC(Cl)=C1 NATYUMBJQCWZKF-UHFFFAOYSA-N 0.000 description 1
- XWXXTHOWEMYGQC-UHFFFAOYSA-N 4-(2-chloropyridin-4-yl)oxy-3-fluoroaniline Chemical compound FC1=CC(N)=CC=C1OC1=CC=NC(Cl)=C1 XWXXTHOWEMYGQC-UHFFFAOYSA-N 0.000 description 1
- NEVRIJCQFAFPOK-UHFFFAOYSA-N 4-[2-(1-ethylpyrazol-4-yl)pyridin-4-yl]oxy-2-fluoroaniline Chemical compound C1=NN(CC)C=C1C1=CC(OC=2C=C(F)C(N)=CC=2)=CC=N1 NEVRIJCQFAFPOK-UHFFFAOYSA-N 0.000 description 1
- LYFMJLYBTMEYDV-UHFFFAOYSA-N 4-amino-2,3-difluorophenol Chemical compound NC1=CC=C(O)C(F)=C1F LYFMJLYBTMEYDV-UHFFFAOYSA-N 0.000 description 1
- MXJQJURZHQZLNN-UHFFFAOYSA-N 4-amino-2-fluorophenol Chemical compound NC1=CC=C(O)C(F)=C1 MXJQJURZHQZLNN-UHFFFAOYSA-N 0.000 description 1
- DFOHHQRGDOQMKG-UHFFFAOYSA-N 4-chloro-2-methylsulfanylpyrimidine Chemical compound CSC1=NC=CC(Cl)=N1 DFOHHQRGDOQMKG-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- GKQDDKKGDIVDAG-UHFFFAOYSA-N 4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=CC=C1O GKQDDKKGDIVDAG-UHFFFAOYSA-N 0.000 description 1
- PCNFLKVWBDNNOW-UHFFFAOYSA-N 4-hydrazinylbenzoic acid Chemical compound NNC1=CC=C(C(O)=O)C=C1 PCNFLKVWBDNNOW-UHFFFAOYSA-N 0.000 description 1
- LCPUQZNJLLPNCJ-UHFFFAOYSA-N 5-(2-fluorophenyl)-2-methylpyrazol-3-amine Chemical compound C1=C(N)N(C)N=C1C1=CC=CC=C1F LCPUQZNJLLPNCJ-UHFFFAOYSA-N 0.000 description 1
- SNBUESVDYDPIDN-UHFFFAOYSA-N 5-(5-amino-3-propan-2-ylpyrazol-1-yl)-2-methylbenzonitrile Chemical compound N1=C(C(C)C)C=C(N)N1C1=CC=C(C)C(C#N)=C1 SNBUESVDYDPIDN-UHFFFAOYSA-N 0.000 description 1
- YDZVQWCVKXYGIU-UHFFFAOYSA-N 5-amino-2-methylbenzonitrile Chemical compound CC1=CC=C(N)C=C1C#N YDZVQWCVKXYGIU-UHFFFAOYSA-N 0.000 description 1
- GYCNHFWRPJXTSB-UHFFFAOYSA-N 5-bromo-2-fluorobenzonitrile Chemical compound FC1=CC=C(Br)C=C1C#N GYCNHFWRPJXTSB-UHFFFAOYSA-N 0.000 description 1
- QKEOQGBNDQBEOU-UHFFFAOYSA-N 5-tert-butyl-2-(3-cyanophenyl)pyrazole-3-carboxylic acid Chemical compound N1=C(C(C)(C)C)C=C(C(O)=O)N1C1=CC=CC(C#N)=C1 QKEOQGBNDQBEOU-UHFFFAOYSA-N 0.000 description 1
- CRAKJFIYOPRJAB-UHFFFAOYSA-N 5-tert-butyl-2-(4-cyanophenyl)pyrazole-3-carboxylic acid Chemical compound N1=C(C(C)(C)C)C=C(C(O)=O)N1C1=CC=C(C#N)C=C1 CRAKJFIYOPRJAB-UHFFFAOYSA-N 0.000 description 1
- GFWSTBBSSBVVQP-UHFFFAOYSA-N 5-tert-butyl-2-phenylpyrazol-3-amine Chemical compound N1=C(C(C)(C)C)C=C(N)N1C1=CC=CC=C1 GFWSTBBSSBVVQP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 102100034213 ATPase family protein 2 homolog Human genes 0.000 description 1
- 102000007469 Actins Human genes 0.000 description 1
- 108010085238 Actins Proteins 0.000 description 1
- 206010000830 Acute leukaemia Diseases 0.000 description 1
- 208000024893 Acute lymphoblastic leukemia Diseases 0.000 description 1
- 208000014697 Acute lymphocytic leukaemia Diseases 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 206010071973 C-kit gene mutation Diseases 0.000 description 1
- 101100348008 Caenorhabditis elegans nas-2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 206010010356 Congenital anomaly Diseases 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 208000007033 Dysgerminoma Diseases 0.000 description 1
- 102100035813 E3 ubiquitin-protein ligase CBL Human genes 0.000 description 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DSLZVSRJTYRBFB-UHFFFAOYSA-N Galactaric acid Natural products OC(=O)C(O)C(O)C(O)C(O)C(O)=O DSLZVSRJTYRBFB-UHFFFAOYSA-N 0.000 description 1
- IAJILQKETJEXLJ-UHFFFAOYSA-N Galacturonsaeure Natural products O=CC(O)C(O)C(O)C(O)C(O)=O IAJILQKETJEXLJ-UHFFFAOYSA-N 0.000 description 1
- 108090000100 Hepatocyte Growth Factor Proteins 0.000 description 1
- 102100021866 Hepatocyte growth factor Human genes 0.000 description 1
- 208000027927 Hereditary papillary renal cell carcinoma Diseases 0.000 description 1
- 101000692455 Homo sapiens Platelet-derived growth factor receptor beta Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 108010002386 Interleukin-3 Proteins 0.000 description 1
- 101710177504 Kit ligand Proteins 0.000 description 1
- ROHFNLRQFUQHCH-YFKPBYRVSA-N L-leucine Chemical compound CC(C)C[C@H](N)C(O)=O ROHFNLRQFUQHCH-YFKPBYRVSA-N 0.000 description 1
- OUYCCCASQSFEME-QMMMGPOBSA-N L-tyrosine Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-QMMMGPOBSA-N 0.000 description 1
- ROHFNLRQFUQHCH-UHFFFAOYSA-N Leucine Natural products CC(C)CC(N)C(O)=O ROHFNLRQFUQHCH-UHFFFAOYSA-N 0.000 description 1
- 229910010082 LiAlH Inorganic materials 0.000 description 1
- 229910010084 LiAlH4 Inorganic materials 0.000 description 1
- 101100166793 Mus musculus Cela2a gene Proteins 0.000 description 1
- 101100042271 Mus musculus Sema3b gene Proteins 0.000 description 1
- VZUNGTLZRAYYDE-UHFFFAOYSA-N N-methyl-N'-nitro-N-nitrosoguanidine Chemical compound O=NN(C)C(=N)N[N+]([O-])=O VZUNGTLZRAYYDE-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- JQGPBDSMTHZOMO-UHFFFAOYSA-N OBO.C=1C=NNC=1 Chemical compound OBO.C=1C=NNC=1 JQGPBDSMTHZOMO-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical compound C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 108091008606 PDGF receptors Proteins 0.000 description 1
- 208000012641 Pigmentation disease Diseases 0.000 description 1
- 102000011653 Platelet-Derived Growth Factor Receptors Human genes 0.000 description 1
- 102100026547 Platelet-derived growth factor receptor beta Human genes 0.000 description 1
- 208000006664 Precursor Cell Lymphoblastic Leukemia-Lymphoma Diseases 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000052575 Proto-Oncogene Human genes 0.000 description 1
- 108700020978 Proto-Oncogene Proteins 0.000 description 1
- 102100033810 RAC-alpha serine/threonine-protein kinase Human genes 0.000 description 1
- 239000012980 RPMI-1640 medium Substances 0.000 description 1
- 102000004278 Receptor Protein-Tyrosine Kinases Human genes 0.000 description 1
- 108090000873 Receptor Protein-Tyrosine Kinases Proteins 0.000 description 1
- 102000014400 SH2 domains Human genes 0.000 description 1
- 108050003452 SH2 domains Proteins 0.000 description 1
- 102000000395 SH3 domains Human genes 0.000 description 1
- 108050008861 SH3 domains Proteins 0.000 description 1
- 201000010208 Seminoma Diseases 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 238000003477 Sonogashira cross-coupling reaction Methods 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 229940100514 Syk tyrosine kinase inhibitor Drugs 0.000 description 1
- 101150037066 TPR3 gene Proteins 0.000 description 1
- 208000024313 Testicular Neoplasms Diseases 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 102000009484 Vascular Endothelial Growth Factor Receptors Human genes 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- PSLUFJFHTBIXMW-WYEYVKMPSA-N [(3r,4ar,5s,6s,6as,10s,10ar,10bs)-3-ethenyl-10,10b-dihydroxy-3,4a,7,7,10a-pentamethyl-1-oxo-6-(2-pyridin-2-ylethylcarbamoyloxy)-5,6,6a,8,9,10-hexahydro-2h-benzo[f]chromen-5-yl] acetate Chemical compound O([C@@H]1[C@@H]([C@]2(O[C@](C)(CC(=O)[C@]2(O)[C@@]2(C)[C@@H](O)CCC(C)(C)[C@@H]21)C=C)C)OC(=O)C)C(=O)NCCC1=CC=CC=N1 PSLUFJFHTBIXMW-WYEYVKMPSA-N 0.000 description 1
- AXHWDJKFMJVHMJ-UHFFFAOYSA-N [2-(3-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]urea Chemical compound N1=C(C(C)C)C=C(NC(N)=O)N1C1=CC=CC(C#N)=C1 AXHWDJKFMJVHMJ-UHFFFAOYSA-N 0.000 description 1
- QQIRAVWVGBTHMJ-UHFFFAOYSA-N [dimethyl-(trimethylsilylamino)silyl]methane;lithium Chemical compound [Li].C[Si](C)(C)N[Si](C)(C)C QQIRAVWVGBTHMJ-UHFFFAOYSA-N 0.000 description 1
- CSCPPACGZOOCGX-WFGJKAKNSA-N acetone d6 Chemical compound [2H]C([2H])([2H])C(=O)C([2H])([2H])[2H] CSCPPACGZOOCGX-WFGJKAKNSA-N 0.000 description 1
- GPEHQHXBPDGGDP-UHFFFAOYSA-N acetonitrile;propan-2-one Chemical compound CC#N.CC(C)=O GPEHQHXBPDGGDP-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- IAJILQKETJEXLJ-RSJOWCBRSA-N aldehydo-D-galacturonic acid Chemical compound O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O IAJILQKETJEXLJ-RSJOWCBRSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001028 anti-proliverative effect Effects 0.000 description 1
- 230000000259 anti-tumor effect Effects 0.000 description 1
- 230000006907 apoptotic process Effects 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 230000035578 autophosphorylation Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- PUJDIJCNWFYVJX-UHFFFAOYSA-N benzyl carbamate Chemical compound NC(=O)OCC1=CC=CC=C1 PUJDIJCNWFYVJX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000012455 biphasic mixture Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 125000005620 boronic acid group Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 229910052792 caesium Inorganic materials 0.000 description 1
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical compound [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 description 1
- FJDQFPXHSGXQBY-UHFFFAOYSA-L caesium carbonate Chemical compound [Cs+].[Cs+].[O-]C([O-])=O FJDQFPXHSGXQBY-UHFFFAOYSA-L 0.000 description 1
- 229910000024 caesium carbonate Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 239000003183 carcinogenic agent Substances 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000010261 cell growth Effects 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 210000003855 cell nucleus Anatomy 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000030570 cellular localization Effects 0.000 description 1
- 230000033077 cellular process Effects 0.000 description 1
- 230000005754 cellular signaling Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000013626 chemical specie Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000012069 chiral reagent Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- VDANGULDQQJODZ-UHFFFAOYSA-N chloroprocaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1Cl VDANGULDQQJODZ-UHFFFAOYSA-N 0.000 description 1
- 229960002023 chloroprocaine Drugs 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 229940125851 compound 27 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000006552 constitutive activation Effects 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011254 conventional chemotherapy Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- WZHCOOQXZCIUNC-UHFFFAOYSA-N cyclandelate Chemical compound C1C(C)(C)CC(C)CC1OC(=O)C(O)C1=CC=CC=C1 WZHCOOQXZCIUNC-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000000151 cysteine group Chemical group N[C@@H](CS)C(=O)* 0.000 description 1
- 210000004292 cytoskeleton Anatomy 0.000 description 1
- 230000009849 deactivation Effects 0.000 description 1
- 230000030609 dephosphorylation Effects 0.000 description 1
- 238000006209 dephosphorylation reaction Methods 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000009547 development abnormality Effects 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 229940043237 diethanolamine Drugs 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 230000003828 downregulation Effects 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 238000007876 drug discovery Methods 0.000 description 1
- WCQOBLXWLRDEQA-UHFFFAOYSA-N ethanimidamide;hydrochloride Chemical compound Cl.CC(N)=N WCQOBLXWLRDEQA-UHFFFAOYSA-N 0.000 description 1
- QZYYZFWVIAHCTN-UHFFFAOYSA-N ethyl 2-(3-fluorophenyl)-5-propan-2-ylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C(C)C)=NN1C1=CC=CC(F)=C1 QZYYZFWVIAHCTN-UHFFFAOYSA-N 0.000 description 1
- KQBTZSUKLIBZJW-UHFFFAOYSA-N ethyl 3-(5-amino-3-tert-butylpyrazol-1-yl)benzoate Chemical compound CCOC(=O)C1=CC=CC(N2C(=CC(=N2)C(C)(C)C)N)=C1 KQBTZSUKLIBZJW-UHFFFAOYSA-N 0.000 description 1
- RTLJGLSLQQJIME-UHFFFAOYSA-N ethyl 3-[3-tert-butyl-5-[[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]carbamoylamino]pyrazol-1-yl]benzoate Chemical compound CCOC(=O)C1=CC=CC(N2C(=CC(=N2)C(C)(C)C)NC(=O)NC=2C(=CC(OC=3C=C(N=CC=3)C3=CN(C)N=C3)=CC=2)F)=C1 RTLJGLSLQQJIME-UHFFFAOYSA-N 0.000 description 1
- ZRNRWBLFYWURLU-UHFFFAOYSA-N ethyl 3-phenyl-1-propan-2-ylpyrazole-4-carboxylate Chemical compound CCOC(=O)C1=CN(C(C)C)N=C1C1=CC=CC=C1 ZRNRWBLFYWURLU-UHFFFAOYSA-N 0.000 description 1
- YJLUVPHICRYDFL-UHFFFAOYSA-N ethyl 4-(5-amino-3-ethylpyrazol-1-yl)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(N)=CC(CC)=N1 YJLUVPHICRYDFL-UHFFFAOYSA-N 0.000 description 1
- JDAVIYWEIKKXJI-UHFFFAOYSA-N ethyl 4-(5-amino-3-tert-butylpyrazol-1-yl)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(N)=CC(C(C)(C)C)=N1 JDAVIYWEIKKXJI-UHFFFAOYSA-N 0.000 description 1
- SXIORCNLTMZHAU-UHFFFAOYSA-N ethyl 4-[3-tert-butyl-5-[[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]carbamoylamino]pyrazol-1-yl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1N1C(NC(=O)NC=2C(=CC(OC=3C=C(N=CC=3)C3=CN(C)N=C3)=CC=2)F)=CC(C(C)(C)C)=N1 SXIORCNLTMZHAU-UHFFFAOYSA-N 0.000 description 1
- JYYDHGMTXHCSKZ-UHFFFAOYSA-N ethyl 4-hydrazinylbenzoate Chemical compound CCOC(=O)C1=CC=C(NN)C=C1 JYYDHGMTXHCSKZ-UHFFFAOYSA-N 0.000 description 1
- LQIYWOVORITWEA-UHFFFAOYSA-N ethyl 5-phenyl-1h-pyrazole-4-carboxylate Chemical compound C1=NNC(C=2C=CC=CC=2)=C1C(=O)OCC LQIYWOVORITWEA-UHFFFAOYSA-N 0.000 description 1
- CRKFZZCKYLCKCT-UHFFFAOYSA-N ethyl 5-tert-butyl-2-(3-cyanophenyl)-4-ethylpyrazole-3-carboxylate Chemical compound CCOC(=O)C1=C(CC)C(C(C)(C)C)=NN1C1=CC=CC(C#N)=C1 CRKFZZCKYLCKCT-UHFFFAOYSA-N 0.000 description 1
- ZJAWMVMWJVSZTE-UHFFFAOYSA-N ethyl 5-tert-butyl-2-(4-cyanophenyl)pyrazole-3-carboxylate Chemical compound CCOC(=O)C1=CC(C(C)(C)C)=NN1C1=CC=C(C#N)C=C1 ZJAWMVMWJVSZTE-UHFFFAOYSA-N 0.000 description 1
- WHQLQYRFIHPMNA-UHFFFAOYSA-N ethyl acetate;oxolane Chemical compound C1CCOC1.CCOC(C)=O WHQLQYRFIHPMNA-UHFFFAOYSA-N 0.000 description 1
- PQVSTLUFSYVLTO-UHFFFAOYSA-N ethyl n-ethoxycarbonylcarbamate Chemical compound CCOC(=O)NC(=O)OCC PQVSTLUFSYVLTO-UHFFFAOYSA-N 0.000 description 1
- 229940012017 ethylenediamine Drugs 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000012091 fetal bovine serum Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000006870 function Effects 0.000 description 1
- DSLZVSRJTYRBFB-DUHBMQHGSA-N galactaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(O)=O DSLZVSRJTYRBFB-DUHBMQHGSA-N 0.000 description 1
- 238000005227 gel permeation chromatography Methods 0.000 description 1
- 230000002068 genetic effect Effects 0.000 description 1
- 230000013595 glycosylation Effects 0.000 description 1
- 238000006206 glycosylation reaction Methods 0.000 description 1
- 230000002710 gonadal effect Effects 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003102 growth factor Substances 0.000 description 1
- 239000001963 growth medium Substances 0.000 description 1
- 230000002489 hematologic effect Effects 0.000 description 1
- 210000003958 hematopoietic stem cell Anatomy 0.000 description 1
- KDCIHNCMPUBDKT-UHFFFAOYSA-N hexane;propan-2-one Chemical class CC(C)=O.CCCCCC KDCIHNCMPUBDKT-UHFFFAOYSA-N 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- KTUFNOKKBVMGRW-UHFFFAOYSA-N imatinib Chemical compound C1CN(C)CCN1CC1=CC=C(C(=O)NC=2C=C(NC=3N=C(C=CN=3)C=3C=NC=CC=3)C(C)=CC=2)C=C1 KTUFNOKKBVMGRW-UHFFFAOYSA-N 0.000 description 1
- 229960003685 imatinib mesylate Drugs 0.000 description 1
- JCYWCSGERIELPG-UHFFFAOYSA-N imes Chemical compound CC1=CC(C)=CC(C)=C1N1C=CN(C=2C(=CC(C)=CC=2C)C)[C]1 JCYWCSGERIELPG-UHFFFAOYSA-N 0.000 description 1
- 230000002055 immunohistochemical effect Effects 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 102000006495 integrins Human genes 0.000 description 1
- 108010044426 integrins Proteins 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- 125000004501 isothiazol-5-yl group Chemical group S1N=CC=C1* 0.000 description 1
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 238000000021 kinase assay Methods 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 1
- 229940040692 lithium hydroxide monohydrate Drugs 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- 230000036210 malignancy Effects 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 229960003194 meglumine Drugs 0.000 description 1
- 210000002752 melanocyte Anatomy 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- APURDRCSFCEZAJ-UHFFFAOYSA-N methyl 2-tert-butyl-4-chloropyrimidine-5-carboxylate Chemical compound COC(=O)C1=CN=C(C(C)(C)C)N=C1Cl APURDRCSFCEZAJ-UHFFFAOYSA-N 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000003032 molecular docking Methods 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- ACTNHJDHMQSOGL-UHFFFAOYSA-N n',n'-dibenzylethane-1,2-diamine Chemical compound C=1C=CC=CC=1CN(CCN)CC1=CC=CC=C1 ACTNHJDHMQSOGL-UHFFFAOYSA-N 0.000 description 1
- MGNPLIACIXIYJE-UHFFFAOYSA-N n-fluoroaniline Chemical compound FNC1=CC=CC=C1 MGNPLIACIXIYJE-UHFFFAOYSA-N 0.000 description 1
- 210000004897 n-terminal region Anatomy 0.000 description 1
- 230000027405 negative regulation of phosphorylation Effects 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 102000037979 non-receptor tyrosine kinases Human genes 0.000 description 1
- 108091008046 non-receptor tyrosine kinases Proteins 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- 150000002916 oxazoles Chemical class 0.000 description 1
- 230000036542 oxidative stress Effects 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- DDBREPKUVSBGFI-UHFFFAOYSA-N phenobarbital Chemical compound C=1C=CC=CC=1C1(CC)C(=O)NC(=O)NC1=O DDBREPKUVSBGFI-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 210000004214 philadelphia chromosome Anatomy 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 201000009442 piebaldism Diseases 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- PJGSXYOJTGTZAV-UHFFFAOYSA-N pinacolone Chemical compound CC(=O)C(C)(C)C PJGSXYOJTGTZAV-UHFFFAOYSA-N 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000035755 proliferation Effects 0.000 description 1
- JCAHGYSEGZEPKB-UHFFFAOYSA-N prop-1-en-2-yl n-[2-(3-cyanophenyl)-5-ethylpyrazol-3-yl]carbamate Chemical compound N1=C(CC)C=C(NC(=O)OC(C)=C)N1C1=CC=CC(C#N)=C1 JCAHGYSEGZEPKB-UHFFFAOYSA-N 0.000 description 1
- BHJPUKDCYNTWAS-UHFFFAOYSA-N prop-1-en-2-yl n-[2-(3-cyanophenyl)-5-propan-2-ylpyrazol-3-yl]carbamate Chemical compound N1=C(C(C)C)C=C(NC(=O)OC(C)=C)N1C1=CC=CC(C#N)=C1 BHJPUKDCYNTWAS-UHFFFAOYSA-N 0.000 description 1
- IOHQNZOBHURLKQ-UHFFFAOYSA-N prop-1-en-2-yl n-[2-fluoro-4-[2-(1-methylpyrazol-4-yl)pyridin-4-yl]oxyphenyl]carbamate Chemical compound C1=C(F)C(NC(=O)OC(=C)C)=CC=C1OC1=CC=NC(C2=CN(C)N=C2)=C1 IOHQNZOBHURLKQ-UHFFFAOYSA-N 0.000 description 1
- KJQKMIVZLOMZLL-UHFFFAOYSA-N prop-1-en-2-ylcarbamic acid Chemical compound CC(=C)NC(O)=O KJQKMIVZLOMZLL-UHFFFAOYSA-N 0.000 description 1
- 125000004353 pyrazol-1-yl group Chemical group [H]C1=NN(*)C([H])=C1[H] 0.000 description 1
- NGVDGCNFYWLIFO-UHFFFAOYSA-N pyridoxal 5'-phosphate Chemical compound CC1=NC=C(COP(O)(O)=O)C(C=O)=C1O NGVDGCNFYWLIFO-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 102000016914 ras Proteins Human genes 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000007115 recruitment Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 208000021070 secondary pulmonary alveolar proteinosis Diseases 0.000 description 1
- 238000013207 serial dilution Methods 0.000 description 1
- 230000019491 signal transduction Effects 0.000 description 1
- 150000004756 silanes Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 208000000587 small cell lung carcinoma Diseases 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000000527 sonication Methods 0.000 description 1
- 108010091193 spermatogenesis associated factor Proteins 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- KXCAEQNNTZANTK-UHFFFAOYSA-N stannane Chemical compound [SnH4] KXCAEQNNTZANTK-UHFFFAOYSA-N 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 210000000130 stem cell Anatomy 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- 230000019635 sulfation Effects 0.000 description 1
- 238000005670 sulfation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 208000011580 syndromic disease Diseases 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 125000001712 tetrahydronaphthyl group Chemical group C1(CCCC2=CC=CC=C12)* 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 125000000437 thiazol-2-yl group Chemical group [H]C1=C([H])N=C(*)S1 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000002769 thiazolinyl group Chemical group 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- CFOAUYCPAUGDFF-UHFFFAOYSA-N tosmic Chemical compound CC1=CC=C(S(=O)(=O)C[N+]#[C-])C=C1 CFOAUYCPAUGDFF-UHFFFAOYSA-N 0.000 description 1
- 238000006276 transfer reaction Methods 0.000 description 1
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 description 1
- 150000008648 triflates Chemical class 0.000 description 1
- SEDZOYHHAIAQIW-UHFFFAOYSA-N trimethylsilyl azide Chemical compound C[Si](C)(C)N=[N+]=[N-] SEDZOYHHAIAQIW-UHFFFAOYSA-N 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- UKHQRARQNZOXRL-UHFFFAOYSA-N trimethyltin Chemical compound C[SnH](C)C UKHQRARQNZOXRL-UHFFFAOYSA-N 0.000 description 1
- 229960000281 trometamol Drugs 0.000 description 1
- OUYCCCASQSFEME-UHFFFAOYSA-N tyrosine Natural products OC(=O)C(N)CC1=CC=C(O)C=C1 OUYCCCASQSFEME-UHFFFAOYSA-N 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
- A61K31/33—Heterocyclic compounds
- A61K31/395—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins
- A61K31/495—Heterocyclic compounds having nitrogen as a ring hetero atom, e.g. guanethidine or rifamycins having six-membered rings with two or more nitrogen atoms as the only ring heteroatoms, e.g. piperazine or tetrazines
- A61K31/505—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim
- A61K31/506—Pyrimidines; Hydrogenated pyrimidines, e.g. trimethoprim not condensed and containing further heterocyclic rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P11/00—Drugs for disorders of the respiratory system
- A61P11/06—Antiasthmatics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/02—Drugs for skeletal disorders for joint disorders, e.g. arthritis, arthrosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P27/00—Drugs for disorders of the senses
- A61P27/02—Ophthalmic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/02—Antineoplastic agents specific for leukemia
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
- A61P35/04—Antineoplastic agents specific for metastasis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/14—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing three or more hetero rings
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Pulmonology (AREA)
- Oncology (AREA)
- Hematology (AREA)
- Immunology (AREA)
- Rheumatology (AREA)
- Ophthalmology & Optometry (AREA)
- Urology & Nephrology (AREA)
- Heart & Thoracic Surgery (AREA)
- Diabetes (AREA)
- Obesity (AREA)
- Vascular Medicine (AREA)
- Pain & Pain Management (AREA)
- Cardiology (AREA)
- Orthopedic Medicine & Surgery (AREA)
- Physical Education & Sports Medicine (AREA)
- Epidemiology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US91321607P | 2007-04-20 | 2007-04-20 | |
| US60/913,216 | 2007-04-20 | ||
| PCT/US2008/060896 WO2008131276A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| AU2008242720A1 true AU2008242720A1 (en) | 2008-10-30 |
Family
ID=39872877
Family Applications (4)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2008242720A Abandoned AU2008242720A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| AU2008242767A Abandoned AU2008242767A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| AU2008242697A Abandoned AU2008242697A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| AU2008251723A Abandoned AU2008251723A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU2008242767A Abandoned AU2008242767A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| AU2008242697A Abandoned AU2008242697A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| AU2008251723A Abandoned AU2008251723A1 (en) | 2007-04-20 | 2008-04-18 | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
Country Status (14)
| Country | Link |
|---|---|
| US (4) | US20080269267A1 (enExample) |
| EP (5) | EP2481736A1 (enExample) |
| JP (2) | JP2010524974A (enExample) |
| KR (2) | KR20100014811A (enExample) |
| CN (2) | CN101878031A (enExample) |
| AU (4) | AU2008242720A1 (enExample) |
| BR (2) | BRPI0807717A2 (enExample) |
| CA (4) | CA2684950A1 (enExample) |
| EA (1) | EA200970700A1 (enExample) |
| IL (1) | IL201650A0 (enExample) |
| MX (2) | MX2009011343A (enExample) |
| RU (1) | RU2009142851A (enExample) |
| SG (1) | SG183054A1 (enExample) |
| WO (4) | WO2008131276A1 (enExample) |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US20110189167A1 (en) * | 2007-04-20 | 2011-08-04 | Flynn Daniel L | Methods and Compositions for the Treatment of Myeloproliferative Diseases and other Proliferative Diseases |
| BRPI0807717A2 (pt) | 2007-04-20 | 2014-05-20 | Deciphera Pharmaceuticals Llc | Inibidores de quinase úteis para o tratamento de doenças mieloproliferativas e outras doenças proliferativas. |
| KR20110099687A (ko) * | 2008-10-29 | 2011-09-08 | 데시페라 파마슈티칼스, 엘엘씨. | 항-암과 항-증식성 활성을 나타내는 시클로프로판 아미드와 유사체 |
| AU2010289353B2 (en) * | 2009-09-03 | 2016-12-08 | Allergan, Inc. | Compounds as tyrosine kinase modulators |
| WO2011062955A2 (en) * | 2009-11-18 | 2011-05-26 | University Of Massachusetts | Compounds for modulating tlr2 |
| PL2509961T3 (pl) | 2009-12-11 | 2016-09-30 | Pochodne imidazolidynodionu | |
| US8912184B1 (en) | 2010-03-01 | 2014-12-16 | Alzheimer's Institute Of America, Inc. | Therapeutic and diagnostic methods |
| EP2594566A4 (en) * | 2010-07-16 | 2014-10-01 | Kyowa Hakko Kirin Co Ltd | AROMATIC HETEROCYCLIC NITROGEN CYCLE DERIVATIVE |
| CN103080109A (zh) * | 2010-09-01 | 2013-05-01 | 苏州爱斯鹏药物研发有限责任公司 | 氘代杂环化合物激酶抑制剂 |
| CN102408408A (zh) * | 2010-09-20 | 2012-04-11 | 北大方正集团有限公司 | 具有抗肿瘤作用的芳基脲衍生物 |
| CN102432592A (zh) * | 2010-09-29 | 2012-05-02 | 北大方正集团有限公司 | 具有抗肿瘤作用的芳基脲衍生物及其制备方法 |
| US9346790B2 (en) | 2010-12-06 | 2016-05-24 | Autifony Therapeutics Limited | Hydantoin derivatives useful as Kv3 inhibitors |
| US8563558B2 (en) * | 2010-12-06 | 2013-10-22 | Confluence Life Sciences, Inc. | Substituted pyridine urea compounds |
| CN102558144A (zh) * | 2010-12-22 | 2012-07-11 | 北大方正集团有限公司 | 一种芳基脲衍生物 |
| CN102532113B (zh) * | 2010-12-22 | 2014-09-10 | 北大方正集团有限公司 | 芳基脲衍生物 |
| KR20120100027A (ko) * | 2011-03-02 | 2012-09-12 | 한국생명공학연구원 | 엔도사이토시스 모티프 및 단백질 도입 도메인을 포함하는 암 예방 또는 치료용 약학적 조성물 |
| UA114711C2 (uk) | 2011-05-13 | 2017-07-25 | Еррей Біофарма Інк. | Сполуки піролідинілсечовини й піролідинілтіосечовини як інгібітори кінази trka |
| JP6008953B2 (ja) | 2011-06-07 | 2016-10-19 | アウトイフオンイ トヘラペウトイクス リミテッド | Kv3阻害剤としてのヒダントイン誘導体 |
| WO2013036232A2 (en) * | 2011-09-08 | 2013-03-14 | Deciphera Pharmaceuticals, Llc | Methods and compositions for the treatment of myeloproliferative diseases and other proliferative diseases |
| WO2013161919A1 (ja) | 2012-04-26 | 2013-10-31 | 小野薬品工業株式会社 | Trk阻害化合物 |
| BR112014028718A2 (pt) | 2012-05-22 | 2017-06-27 | Autifony Therapeutics Ltd | derivados de hidantoína como inibidores de kv3 |
| US9422252B2 (en) | 2012-05-22 | 2016-08-23 | Autifony Therapeutics Limited | Triazoles as Kv3 inhibitors |
| US8461179B1 (en) | 2012-06-07 | 2013-06-11 | Deciphera Pharmaceuticals, Llc | Dihydronaphthyridines and related compounds useful as kinase inhibitors for the treatment of proliferative diseases |
| EP2875014B1 (en) * | 2012-07-17 | 2017-11-29 | Washington University | Anti-mucus drugs and uses therefor |
| WO2014078328A1 (en) | 2012-11-13 | 2014-05-22 | Array Biopharma Inc. | N-bicyclic aryl,n'-pyrazolyl urea, thiourea, guanidine and cyanoguanidine compounds as trka kinase inhibitors |
| US9790178B2 (en) | 2012-11-13 | 2017-10-17 | Array Biopharma Inc. | Pyrrolidinyl urea, thiourea, guanidine and cyanoguanidine compounds as TrkA kinase inhibitors |
| US9981959B2 (en) | 2012-11-13 | 2018-05-29 | Array Biopharma Inc. | Thiazolyl and oxazolyl urea, thiourea, guanidine and cyanoguanidine compounds as TrkA kinase inhibitors |
| WO2014078378A1 (en) | 2012-11-13 | 2014-05-22 | Array Biopharma Inc. | Pyrrolidinyl urea, thiourea, guanidine and cyanoguanidine compounds as trka kinase inhibitors |
| US9809578B2 (en) | 2012-11-13 | 2017-11-07 | Array Biopharma Inc. | Pyrazolyl urea, thiourea, guanidine and cyanoguanidine compounds as trkA kinase inhibitors |
| EP2922844B1 (en) | 2012-11-13 | 2018-01-10 | Array Biopharma, Inc. | N-pyrrolidinyl, n'-pyrazolyl- urea, thiourea, guanidine and cyanoguanidine compounds as trka kinase inhibitors |
| US9822118B2 (en) | 2012-11-13 | 2017-11-21 | Array Biopharma Inc. | Bicyclic heteroaryl urea, thiourea, guanidine and cyanoguanidine compounds as TrkA kinase inhibitors |
| WO2014078331A1 (en) | 2012-11-13 | 2014-05-22 | Array Biopharma Inc. | N-(arylalkyl)-n'-pyrazolyl-urea, thiourea, guanidine and cyanoguanidine compounds as trka kinase inhibitors |
| US9790210B2 (en) | 2012-11-13 | 2017-10-17 | Array Biopharma Inc. | N-(monocyclic aryl),N'-pyrazolyl-urea, thiourea, guanidine and cyanoguanidine compounds as TrkA kinase inhibitors |
| HRP20161613T1 (hr) | 2012-11-13 | 2017-01-13 | Array Biopharma, Inc. | Tvari bicikličke ureje, tioureje, gvanidina i cijanogvanidina korisne za liječenje boli |
| EP2960234B1 (en) | 2013-02-19 | 2018-12-19 | ONO Pharmaceutical Co., Ltd. | Trk-inhibiting compound |
| CA2903081A1 (en) | 2013-03-14 | 2014-09-25 | Quanticel Pharmaceuticals, Inc. | Histone demethylase inhibitors |
| WO2014172639A1 (en) * | 2013-04-19 | 2014-10-23 | Ruga Corporation | Raf kinase inhibitors |
| ITMI20132201A1 (it) * | 2013-12-23 | 2015-06-24 | Isagro Spa | Processo per la sintesi regioselettiva di pirazoli |
| CN104974132B (zh) * | 2014-04-08 | 2017-05-17 | 北大方正集团有限公司 | 多取代的吡啶化合物、制备方法、用途及药物组合物 |
| RU2719489C2 (ru) | 2014-05-15 | 2020-04-17 | Эррэй Биофарма Инк. | 1-((3S,4R)-4-(3-ФТОРФЕНИЛ)-1-(2-МЕТОКСИЭТИЛ)ПИРРОЛИДИН-3-ИЛ)-3-(4-МЕТИЛ-3-(2-МЕТИЛПИРИМИДИН-5-ИЛ)-1-ФЕНИЛ-1Н-ПИРАЗОЛ-5-ИЛ)МОЧЕВИНА В КАЧЕСТВЕ ИНГИБИТОРА TrkA КИНАЗЫ |
| PE20181539A1 (es) * | 2016-02-02 | 2018-09-26 | Basf Se | Proceso de hidrogenacion catalitico para preparar pirazoles |
| CN105646448B (zh) * | 2016-02-03 | 2019-03-01 | 沈阳药科大学 | 吡啶类化合物及其用途 |
| CN108341813B (zh) * | 2017-01-24 | 2020-11-17 | 四川大学 | 取代的1-(异恶唑-3-基)-3-(3-氟-4-苯基)脲衍生物及其制备方法和用途 |
| AU2018392816B2 (en) | 2017-12-22 | 2023-04-20 | HiberCell Inc. | Chromenopyridine derivatives as phosphatidylinositol phosphate kinase inhibitors |
| BR112020015581A2 (pt) | 2018-01-31 | 2021-02-02 | Deciphera Pharmaceuticals, Llc | terapia de combinação para o tratamento de tumores estromais gastrointestinais |
| EP3746060A1 (en) | 2018-01-31 | 2020-12-09 | Deciphera Pharmaceuticals, LLC | Combination therapy for the treatment of mastocytosis |
| CA3121202A1 (en) | 2018-11-30 | 2020-06-04 | Nuvation Bio Inc. | Pyrrole and pyrazole compounds and methods of use thereof |
| BR112021012812A2 (pt) | 2018-12-28 | 2021-12-07 | Deciphera Pharmaceuticals Llc | Csf1r inhibitors para uso e tratamento de câncer |
| EP3934763A4 (en) * | 2019-03-06 | 2023-03-15 | University Of Maryland, Baltimore | SCAFFOLDS OF TETRAMERIC PROTEINS USED AS NANO-CARRIERS OF THERAPEUTIC PEPTIDES FOR THE TREATMENT OF CANCER AND OTHER DISEASES |
| CN118878519A (zh) | 2019-05-10 | 2024-11-01 | 德西费拉制药有限责任公司 | 苯基氨基嘧啶酰胺自噬抑制剂及其使用方法 |
| IL287795B2 (en) | 2019-05-10 | 2025-05-01 | Deciphera Pharmaceuticals Llc | Heteroarylaminopyrimidine amides as autophagy inhibitors and methods of using them |
| WO2020257180A1 (en) | 2019-06-17 | 2020-12-24 | Deciphera Pharmaceuticals, Llc | Aminopyrimidine amide autophagy inhibitors and methods of use thereof |
| WO2021013712A1 (en) | 2019-07-19 | 2021-01-28 | Anagenesis Biotechnologies S.A.S. | Polyaromatic urea derivatives and their use in the treatment of muscle diseases |
| WO2021030405A1 (en) | 2019-08-12 | 2021-02-18 | Deciphera Pharmaceuticals, Llc | Ripretinib for treating gastrointestinal stromal tumors |
| KR20220045189A (ko) | 2019-08-12 | 2022-04-12 | 데시페라 파마슈티칼스, 엘엘씨. | 위장관 기질 종양을 치료하는 방법 |
| CN118948773A (zh) | 2019-12-30 | 2024-11-15 | 德西费拉制药有限责任公司 | 1-(4溴-5-(1乙基-7-(甲氨基)-2侧氧基-1,2-二氢-1,6-萘啶-3基)-2氟苯基)-3-苯基脲的组合物 |
| SMT202300467T1 (it) | 2019-12-30 | 2024-01-10 | Deciphera Pharmaceuticals Llc | Formulazioni di inibitori di chinasi amorfi e loro procedimenti d’uso |
| MX2022014021A (es) * | 2020-05-08 | 2023-02-16 | Georgiamune Llc | Moduladores de akt3. |
| EP4247795A1 (en) | 2020-11-18 | 2023-09-27 | Deciphera Pharmaceuticals, LLC | Gcn2 and perk kinase inhibitors and methods of use thereof |
| CN112830936B (zh) * | 2021-01-08 | 2022-01-28 | 广西师范大学 | 核黄素化合物、其制备方法及应用 |
| EP4029501A1 (en) | 2021-01-19 | 2022-07-20 | Anagenesis Biotechnologies | Combination of polyaromatic urea derivatives and glucocorticoid or hdac inhibitor for the treatment of diseases or conditions associated with muscle cells and/or satellite cells |
| CN115772167B (zh) * | 2021-09-08 | 2025-07-29 | 暨南大学 | 含脲结构的化合物及其应用 |
| MX2024007042A (es) | 2021-12-09 | 2024-09-04 | Deciphera Pharmaceuticals Llc | Inhibidores de raf quinasa y metodos de uso de los mismos. |
| US11779572B1 (en) | 2022-09-02 | 2023-10-10 | Deciphera Pharmaceuticals, Llc | Methods of treating gastrointestinal stromal tumors |
| WO2025122952A1 (en) | 2023-12-08 | 2025-06-12 | Deciphera Pharmaceuticals, Llc | Formulations of vimseltinib |
Family Cites Families (99)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1115350B (de) | 1959-04-17 | 1961-10-19 | Siemens Ag | Selbstschalter, insbesondere Leitungsschutz-schalter, mit einem aus einem Kniegelenk bestehenden Antriebsmechanismus fuer das Schaltorgan |
| GB971307A (en) | 1961-03-02 | 1964-09-30 | Wellcome Found | 5-anilinopyrimidines |
| GB1127875A (en) * | 1967-03-23 | 1968-09-18 | Parke Davis & Co | 4-(5-nitro-2-furyl) thiazolyl hydantoins and hydrouracils |
| US3949002A (en) * | 1970-11-13 | 1976-04-06 | Imperial Chemical Industries Limited | Process for producing sulfone containing thiophenols |
| US3818024A (en) * | 1972-02-16 | 1974-06-18 | Velsicol Chemical Corp | Benzothiazol substituted thiadiazolidines |
| CH565887A5 (enExample) | 1972-08-22 | 1975-08-29 | Ciba Geigy Ag | |
| US3939122A (en) * | 1973-04-11 | 1976-02-17 | Bayer Aktiengesellschaft | Process for the preparation of compounds which contain hydantoin rings |
| FR2337554A1 (fr) | 1976-01-08 | 1977-08-05 | Buzas Andre | Nouveaux derives de la pyrazolidinedione |
| US4093624A (en) * | 1977-01-31 | 1978-06-06 | Icn Pharmaceuticals, Inc. | 1,2,4-Thiadiazolidine-3,5-dione |
| FR2396549A2 (fr) | 1977-07-06 | 1979-02-02 | Buzas Andre | Nouveaux derives de la pyrazolidinedione |
| US4256758A (en) | 1979-06-11 | 1981-03-17 | Merck & Co., Inc. | 4-Substituted-3-hydroxy-3-pyrroline-2,5-dione inhibitors of glycolic acid oxidase |
| US4298743A (en) | 1979-09-11 | 1981-11-03 | Merck & Co., Inc. | 4-(Substituted phenyl thiazolyl)-3-hydroxy-3-pyrroline-2,5-diones |
| US4296237A (en) * | 1979-09-11 | 1981-10-20 | Merck & Co., Inc. | 4-(Pyridyl, piperazinyl and thiazolyl substituted thiazolyl)-3-hydroxy-3-pyrroline-2,5-diones |
| US4432992A (en) * | 1979-11-05 | 1984-02-21 | Merck & Co., Inc. | 4-[5(and 4)-Substituted-2-thienyl]-3-hydroxy-3-pyrroline-2,5-dione inhibitors of glycolic acid oxidase |
| US4366189A (en) * | 1979-12-21 | 1982-12-28 | Ciba-Geigy Corporation | 4-Heterocyclyl-4'-vinylstilbenes |
| JPS5915247A (ja) | 1982-07-16 | 1984-01-26 | Mitsubishi Paper Mills Ltd | 画像形成方法 |
| JPS59177557A (ja) * | 1983-03-28 | 1984-10-08 | Fuji Photo Film Co Ltd | ハロゲン化銀カラ−写真感光材料 |
| DE3406329A1 (de) | 1984-02-22 | 1985-08-22 | Merck Patent Gmbh, 6100 Darmstadt | Pyridone |
| US4816454A (en) * | 1984-09-21 | 1989-03-28 | Cassella Aktiengesellschaft | 4,5-dihydro-3(2H)-pyridazinones and their pharmacological use |
| US5103014A (en) * | 1987-09-30 | 1992-04-07 | American Home Products Corporation | Certain 3,3'-[[[(2-phenyl-4-thiazolyl)methoxy]phenyl]methylene]dithiobis-propanoic acid derivatives |
| AU606808B2 (en) | 1988-06-29 | 1991-02-14 | Otsuka Pharmaceutical Factory, Inc. | Arylcarboxamide substituted by alkylphosphonates, process for preparing the same and a pharmaceutical composition containing the same |
| GB9012936D0 (en) | 1990-06-11 | 1990-08-01 | Fujisawa Pharmaceutical Co | Thiophene derivatives,processes for preparation thereof and pharmaceutical composition comprising the same |
| US5254715A (en) | 1990-11-07 | 1993-10-19 | Warner-Lambert Company | Aminosulfonyl carbamates |
| EP0525197B1 (en) * | 1991-01-21 | 1997-08-27 | Shionogi Seiyaku Kabushiki Kaisha | 3-benzylidene-1-carbamoyl-2-pyrrolidone analogs |
| US5162360A (en) * | 1991-06-24 | 1992-11-10 | Warner-Lambert Company | 2-heteroatom containing urea and thiourea ACAT inhibitors |
| DE4302702A1 (de) | 1993-02-01 | 1994-08-04 | Bayer Ag | Arylaminosulfonylharnstoffe |
| WO1994021617A1 (en) | 1993-03-19 | 1994-09-29 | Dowelanco | A process for preparing halogenated isothiazoles |
| EP0692483A1 (en) | 1993-03-30 | 1996-01-17 | Yoshitomi Pharmaceutical Industries, Ltd. | Cell adhesion inhibitor and thienotriazolodiazepine compound |
| WO1994024095A1 (en) | 1993-04-16 | 1994-10-27 | Abbott Laboratories | Immunosuppressive agents |
| CA2123728A1 (en) * | 1993-05-21 | 1994-11-22 | Noriyoshi Sueda | Urea derivatives and their use as acat inhibitors |
| DE4337847A1 (de) | 1993-11-05 | 1995-05-11 | Bayer Ag | Substituierte Phenylaminosulfonylharnstoffe |
| EP0733048A1 (en) | 1993-12-07 | 1996-09-25 | Smithkline Beecham Plc | Heterocyclic biphenylylamides useful as 5ht1d antagonists |
| DE4343831A1 (de) | 1993-12-22 | 1995-06-29 | Magyar Tudomanyos Akademia | Substituierte Sulfonylharnstoffe |
| FR2715155B1 (fr) * | 1994-01-19 | 1996-07-26 | Mayoly Spindler | Inhibiteurs de la monoamine oxydase B et leurs procédés de préparation. |
| DE4414840A1 (de) | 1994-04-28 | 1995-11-02 | Bayer Ag | Substituierte Phenylaminosulfonylharnstoffe |
| CN100384825C (zh) | 1994-06-15 | 2008-04-30 | 大塚制药株式会社 | 苯并杂环衍生物 |
| DK0793656T3 (da) | 1994-11-24 | 2003-07-21 | Basilea Pharmaceutica Ag | Hidtil ukendte benzyl-pyrimidiner |
| US5494925A (en) * | 1994-12-02 | 1996-02-27 | Sterling Winthrop Inc. | 2-heterocyclyloxymethyl and 2-heterocyclylthiomethyl-1,2,5-thiadiazolidin-3-one 1,1-dioxides and compositions and method of use thereof |
| US5972951A (en) | 1994-12-22 | 1999-10-26 | Smithkline Beecham Plc | Tetracyclic spiro compounds, process for their preparation and their use as 5HT1D receptor antagonists |
| EP0739884B1 (en) | 1995-04-24 | 2003-08-13 | Semiconductor Energy Laboratory Co., Ltd. | Liquid crystal compound and liquid crystal composition containing the same |
| JPH09221476A (ja) | 1995-12-15 | 1997-08-26 | Otsuka Pharmaceut Co Ltd | 医薬組成物 |
| GB9605945D0 (en) | 1996-03-21 | 1996-05-22 | Smithkline Beecham Plc | Novel compounds |
| PL192628B1 (pl) * | 1996-04-23 | 2006-11-30 | Vertex Pharma | Pochodne mocznika, kompozycje farmaceutyczne i zastosowanie związku i kompozycji |
| JPH107804A (ja) | 1996-06-25 | 1998-01-13 | Japan Synthetic Rubber Co Ltd | 熱硬化性樹脂組成物 |
| GB9623833D0 (en) | 1996-11-16 | 1997-01-08 | Zeneca Ltd | Chemical compound |
| US6020357A (en) * | 1996-12-23 | 2000-02-01 | Dupont Pharmaceuticals Company | Nitrogen containing heteroaromatics as factor Xa inhibitors |
| ATE230742T1 (de) | 1997-03-27 | 2003-01-15 | Great Lakes Chemical Europ | 2-(2'-hydroxphenyl)-benzotriazole und ihre verwendung als lichtschutzmittel für organische polymere |
| DE69826695T2 (de) | 1997-05-23 | 2006-02-02 | Bayer Pharmaceuticals Corp., West Haven | Arylharnstoffderivate zur behandlung von inflammatorischen oder immunomodulatorischen erkrankungen |
| US6235786B1 (en) * | 1997-08-06 | 2001-05-22 | Abbott Laboratories | Reverse hydroxamate inhibitors of matrix metalloproteinases |
| US6294573B1 (en) * | 1997-08-06 | 2001-09-25 | Abbott Laboratories | Reverse hydroxamate inhibitors of matrix metalloproteinases |
| CN1271279A (zh) | 1997-09-23 | 2000-10-25 | 普尼卡有限公司 | 用于治疗细胞因子介导性疾病的酰胺类衍生物 |
| IT1295933B1 (it) | 1997-10-30 | 1999-05-28 | Great Lakes Chemical Italia | 2-(2'-idrossifenil)benzotriazoli e procedimento per la loro preparazione |
| JP2001521934A (ja) * | 1997-11-03 | 2001-11-13 | ベーリンガー インゲルハイム ファーマシューティカルズ インコーポレイテッド | 抗炎症薬としての芳香族ヘテロ環式化合物 |
| CA2315720A1 (en) | 1997-12-22 | 1999-07-01 | Bayer Corporation | Inhibition of p38 kinase activity using substituted heterocyclic ureas |
| DK1043995T3 (da) | 1997-12-22 | 2007-03-05 | Bayer Pharmaceuticals Corp | Inhibering af p38 kinaseaktivitet ved anvendelse af aryl- og heteroaryl-substituerede, heterocykliske urinstoffer |
| RU2265597C2 (ru) | 1997-12-22 | 2005-12-10 | Байер Копэрейшн | Арил- и гетероарилзамещенные гетероциклические производные мочевины, способ ингибирования киназы raf и фармацевтическая композиция |
| DK1047418T3 (da) | 1997-12-22 | 2005-11-21 | Bayer Pharmaceuticals Corp | Inhibering af raf-kinase ved hjælp af substituerede heterocykliske urinstoffer |
| NZ333399A (en) | 1997-12-24 | 2000-05-26 | Sankyo Co | Cyclooxygenase-2 inhibitors (COX-2) for the prevention and treatment of tumors, cachexia and tumor-metastasis |
| EP0928790B1 (en) * | 1998-01-02 | 2003-03-05 | F. Hoffmann-La Roche Ag | Thiazole derivatives |
| EP0956855B1 (en) | 1998-04-24 | 2003-03-12 | K.U. Leuven Research & Development | Immunosuppressive effects of 8 substituted xanthine derivatives |
| US6197599B1 (en) * | 1998-07-30 | 2001-03-06 | Guorong Chin | Method to detect proteins |
| GB9823873D0 (en) * | 1998-10-30 | 1998-12-30 | Pharmacia & Upjohn Spa | 2-ureido-thiazole derivatives,process for their preparation,and their use as antitumour agents |
| UA73492C2 (en) * | 1999-01-19 | 2005-08-15 | Aromatic heterocyclic compounds as antiinflammatory agents | |
| JP2000275886A (ja) | 1999-03-23 | 2000-10-06 | Konica Corp | 電子写真感光体、それを用いたプロセスカートリッジ及び画像形成装置 |
| US6410254B1 (en) * | 1999-05-18 | 2002-06-25 | Cytokinetics | Compositions and assays utilizing ADP or phosphate for detecting protein modulators |
| US6525046B1 (en) * | 2000-01-18 | 2003-02-25 | Boehringer Ingelheim Pharmaceuticals, Inc. | Aromatic heterocyclic compounds as antiinflammatory agents |
| US6500628B1 (en) * | 2000-05-25 | 2002-12-31 | Millennium Pharmaceuticals, Inc. | Nucleic acid molecules encoding human kinase and phosphatase homologues and uses therefor |
| US6645990B2 (en) * | 2000-08-15 | 2003-11-11 | Amgen Inc. | Thiazolyl urea compounds and methods of uses |
| EP1506962B1 (en) * | 2000-10-20 | 2008-07-02 | Eisai R&D Management Co., Ltd. | Nitrogen-containing aromatic heterocycles |
| WO2002066442A1 (en) * | 2001-02-15 | 2002-08-29 | Boehringer Ingelheim Pharmaceuticals, Inc. | Process for synthesis of heteroaryl-substituted urea compounds useful as antiinflammatory agents |
| WO2002070662A2 (en) * | 2001-03-02 | 2002-09-12 | Gpc Biotech Ag | Three hybrid assay system |
| ATE338758T1 (de) * | 2001-03-23 | 2006-09-15 | Merck Sharp & Dohme | Imidazopyrimidin-derivate als liganden für gaba- rezeptoren |
| EP1281399A3 (en) | 2001-08-01 | 2004-02-11 | Warner-Lambert Company | Dual inhibitors of wax ester and cholesteryl ester synthesis for inhibiting sebum production |
| EP1427412A1 (en) * | 2001-09-13 | 2004-06-16 | Boehringer Ingelheim Pharmaceuticals Inc. | Methods of treating cytokine mediated diseases |
| US20040023961A1 (en) | 2002-02-11 | 2004-02-05 | Bayer Corporation | Aryl ureas with raf kinase and angiogenisis inhibiting activity |
| SI1478358T1 (sl) * | 2002-02-11 | 2013-09-30 | Bayer Healthcare Llc | Sorafenib tozilat za zdravljenje bolezni, značilnih po abnormalni angiogenezi |
| WO2003072569A1 (en) * | 2002-02-25 | 2003-09-04 | Boehringer Ingelheim Pharmaceuticals, Inc. | 1,4-disubstituted benzofused cycloalkyl urea compounds useful in treating cytokine mediated diseases |
| AR037647A1 (es) | 2002-05-29 | 2004-12-01 | Novartis Ag | Derivados de diarilurea utiles para el tratamiento de enfermedades dependientes de la cinasa de proteina |
| AU2003246927A1 (en) | 2002-07-03 | 2004-01-23 | Astex Technology Limited | 3-`(hetero) arylmethoxy ! pyridines and their analogues as p38 map kinase inhibitors |
| US20040138216A1 (en) | 2002-12-23 | 2004-07-15 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Process for the preparation of an essentially pure polymorph of an n-pyrazolyl-n'-naphthyl-urea |
| US20080045706A1 (en) * | 2002-12-31 | 2008-02-21 | Flynn Daniel L | Anti-inflammatory medicaments |
| US7202257B2 (en) * | 2003-12-24 | 2007-04-10 | Deciphera Pharmaceuticals, Llc | Anti-inflammatory medicaments |
| US7144911B2 (en) * | 2002-12-31 | 2006-12-05 | Deciphera Pharmaceuticals Llc | Anti-inflammatory medicaments |
| US20040171075A1 (en) * | 2002-12-31 | 2004-09-02 | Flynn Daniel L | Modulation of protein functionalities |
| EP1603879A2 (en) * | 2003-02-28 | 2005-12-14 | Bayer Pharmaceuticals Corporation | Substituted pyridine derivatives useful in the treatment of cancer and other disorders |
| US7557129B2 (en) * | 2003-02-28 | 2009-07-07 | Bayer Healthcare Llc | Cyanopyridine derivatives useful in the treatment of cancer and other disorders |
| WO2004113352A1 (en) | 2003-06-19 | 2004-12-29 | Amedis Pharmaceuticals Ltd. | Silylated heterocyclylurea derivatives as cytokine-inhibitors |
| WO2005002673A1 (en) | 2003-07-03 | 2005-01-13 | Astex Therapeutics Limited | Raf kinase inhibitors |
| EP1684762A4 (en) * | 2003-11-13 | 2009-06-17 | Ambit Biosciences Corp | UREA DERIVATIVES AS MODULATORS OF KINASE |
| US20070191336A1 (en) * | 2003-12-24 | 2007-08-16 | Flynn Daniel L | Anti-inflammatory medicaments |
| US20080220497A1 (en) * | 2003-12-24 | 2008-09-11 | Flynn Daniel L | Modulation of protein functionalities |
| AU2005321946B2 (en) * | 2004-12-23 | 2012-08-16 | Deciphera Pharmaceuticals, Llc | Enzyme modulators and treatments |
| US20090312349A1 (en) * | 2004-12-23 | 2009-12-17 | Deciphera Pharmaceuticals, Llc | Anti-inflammatory medicaments |
| US7622583B2 (en) * | 2005-01-14 | 2009-11-24 | Chemocentryx, Inc. | Heteroaryl sulfonamides and CCR2 |
| TW200804349A (en) | 2005-12-23 | 2008-01-16 | Kalypsys Inc | Novel substituted pyrimidinyloxy ureas as inhibitors of protein kinases |
| US7790756B2 (en) * | 2006-10-11 | 2010-09-07 | Deciphera Pharmaceuticals, Llc | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
| US20080248487A1 (en) * | 2007-04-09 | 2008-10-09 | Flynn Daniel L | Modulation of protein functionalities |
| US20080248548A1 (en) * | 2007-04-09 | 2008-10-09 | Flynn Daniel L | Modulation of protein functionalities |
| BRPI0807717A2 (pt) | 2007-04-20 | 2014-05-20 | Deciphera Pharmaceuticals Llc | Inibidores de quinase úteis para o tratamento de doenças mieloproliferativas e outras doenças proliferativas. |
-
2008
- 2008-04-18 BR BRPI0807717-7A2A patent/BRPI0807717A2/pt not_active IP Right Cessation
- 2008-04-18 RU RU2009142851/15A patent/RU2009142851A/ru not_active Application Discontinuation
- 2008-04-18 MX MX2009011343A patent/MX2009011343A/es not_active Application Discontinuation
- 2008-04-18 AU AU2008242720A patent/AU2008242720A1/en not_active Abandoned
- 2008-04-18 EP EP12153098A patent/EP2481736A1/en not_active Withdrawn
- 2008-04-18 EP EP08746306A patent/EP2146718A4/en not_active Withdrawn
- 2008-04-18 EP EP08746279A patent/EP2146716A4/en not_active Withdrawn
- 2008-04-18 KR KR1020097017379A patent/KR20100014811A/ko not_active Withdrawn
- 2008-04-18 CA CA002684950A patent/CA2684950A1/en active Pending
- 2008-04-18 CN CN2008800085252A patent/CN101878031A/zh active Pending
- 2008-04-18 EP EP08746294A patent/EP2146717A4/en not_active Withdrawn
- 2008-04-18 CA CA002684666A patent/CA2684666A1/en not_active Abandoned
- 2008-04-18 JP JP2010504293A patent/JP2010524974A/ja active Pending
- 2008-04-18 SG SG2012053559A patent/SG183054A1/en unknown
- 2008-04-18 EP EP08746333A patent/EP2148677A4/en not_active Withdrawn
- 2008-04-18 KR KR1020097024209A patent/KR20100017184A/ko not_active Withdrawn
- 2008-04-18 WO PCT/US2008/060896 patent/WO2008131276A1/en not_active Ceased
- 2008-04-18 WO PCT/US2008/060867 patent/WO2008131253A1/en not_active Ceased
- 2008-04-18 US US12/105,302 patent/US20080269267A1/en not_active Abandoned
- 2008-04-18 US US12/105,408 patent/US8143293B2/en not_active Expired - Fee Related
- 2008-04-18 AU AU2008242767A patent/AU2008242767A1/en not_active Abandoned
- 2008-04-18 WO PCT/US2008/060833 patent/WO2008131227A1/en not_active Ceased
- 2008-04-18 US US12/105,350 patent/US20080269254A1/en not_active Abandoned
- 2008-04-18 AU AU2008242697A patent/AU2008242697A1/en not_active Abandoned
- 2008-04-18 CA CA002684949A patent/CA2684949A1/en not_active Abandoned
- 2008-04-18 WO PCT/US2008/060855 patent/WO2008140895A1/en not_active Ceased
- 2008-04-18 BR BRPI0810094-2A2A patent/BRPI0810094A2/pt not_active IP Right Cessation
- 2008-04-18 MX MX2009009066A patent/MX2009009066A/es not_active Application Discontinuation
- 2008-04-18 AU AU2008251723A patent/AU2008251723A1/en not_active Abandoned
- 2008-04-18 EA EA200970700A patent/EA200970700A1/ru unknown
- 2008-04-18 CN CN200880020714A patent/CN101801383A/zh active Pending
- 2008-04-18 JP JP2010504274A patent/JP2010524970A/ja active Pending
- 2008-04-18 US US12/105,376 patent/US20080261961A1/en not_active Abandoned
- 2008-04-18 CA CA002678639A patent/CA2678639A1/en not_active Abandoned
-
2009
- 2009-10-20 IL IL201650A patent/IL201650A0/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU2008242720A1 (en) | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases | |
| KR101439823B1 (ko) | 골수증식성 질환 및 기타 증식성 질환의 치료에 유용한 키나제 억제제 | |
| US8486951B2 (en) | Cyclopropane amides and analogs exhibiting anti-cancer and anti-proliferative activities | |
| HK1217482A1 (en) | Enzyme modulators and therapies | |
| WO2013036232A2 (en) | Methods and compositions for the treatment of myeloproliferative diseases and other proliferative diseases | |
| WO2012019015A2 (en) | Methods and compositions for the treatment of myeloproliferative diseases and other proliferative diseases | |
| HK1150233A (en) | Kinase inhibitors useful for the treatment of myleoproliferative diseases and other proliferative diseases |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MK4 | Application lapsed section 142(2)(d) - no continuation fee paid for the application |