RU2200756C2 - Формованное изделие с моющим или чистящим действием для бытового употребления и способ его получения - Google Patents
Формованное изделие с моющим или чистящим действием для бытового употребления и способ его получения Download PDFInfo
- Publication number
- RU2200756C2 RU2200756C2 RU99122021/04A RU99122021A RU2200756C2 RU 2200756 C2 RU2200756 C2 RU 2200756C2 RU 99122021/04 A RU99122021/04 A RU 99122021/04A RU 99122021 A RU99122021 A RU 99122021A RU 2200756 C2 RU2200756 C2 RU 2200756C2
- Authority
- RU
- Russia
- Prior art keywords
- granulate
- weight
- baking powder
- less
- paragraphs
- Prior art date
Links
- 238000004140 cleaning Methods 0.000 title claims description 13
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 10
- 230000000694 effects Effects 0.000 title abstract description 10
- 239000003599 detergent Substances 0.000 title description 27
- 239000008187 granular material Substances 0.000 claims abstract description 92
- 239000002245 particle Substances 0.000 claims abstract description 43
- 238000009826 distribution Methods 0.000 claims abstract description 14
- 239000003795 chemical substances by application Substances 0.000 claims abstract description 13
- 239000000428 dust Substances 0.000 claims abstract description 12
- 239000000843 powder Substances 0.000 claims description 52
- 239000007884 disintegrant Substances 0.000 claims description 49
- 238000005406 washing Methods 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- 238000004090 dissolution Methods 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 7
- 102000004190 Enzymes Human genes 0.000 claims description 6
- 108090000790 Enzymes Proteins 0.000 claims description 6
- 230000009471 action Effects 0.000 claims description 5
- 239000011521 glass Substances 0.000 claims description 4
- 238000007906 compression Methods 0.000 claims description 3
- 230000006835 compression Effects 0.000 claims description 3
- 238000005029 sieve analysis Methods 0.000 claims description 2
- 239000000126 substance Substances 0.000 abstract description 7
- 230000015556 catabolic process Effects 0.000 abstract 1
- 238000006731 degradation reaction Methods 0.000 abstract 1
- 239000003845 household chemical Substances 0.000 abstract 1
- 238000001179 sorption measurement Methods 0.000 abstract 1
- 239000003826 tablet Substances 0.000 description 61
- 239000000047 product Substances 0.000 description 55
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 14
- -1 bentonites Chemical class 0.000 description 13
- 239000000654 additive Substances 0.000 description 11
- 239000001913 cellulose Substances 0.000 description 11
- 229920002678 cellulose Polymers 0.000 description 10
- 235000010980 cellulose Nutrition 0.000 description 10
- 238000005469 granulation Methods 0.000 description 10
- 238000003825 pressing Methods 0.000 description 10
- 239000012190 activator Substances 0.000 description 9
- 230000003179 granulation Effects 0.000 description 9
- 239000007844 bleaching agent Substances 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 8
- 239000010457 zeolite Substances 0.000 description 8
- 239000004094 surface-active agent Substances 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000013543 active substance Substances 0.000 description 6
- 238000004061 bleaching Methods 0.000 description 6
- 238000004851 dishwashing Methods 0.000 description 6
- 239000002736 nonionic surfactant Substances 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 150000004760 silicates Chemical class 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- 229910021536 Zeolite Inorganic materials 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 150000008051 alkyl sulfates Chemical class 0.000 description 5
- 239000003945 anionic surfactant Substances 0.000 description 5
- 230000008901 benefit Effects 0.000 description 5
- 235000014113 dietary fatty acids Nutrition 0.000 description 5
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 5
- 239000003814 drug Substances 0.000 description 5
- 229940088598 enzyme Drugs 0.000 description 5
- 239000000194 fatty acid Substances 0.000 description 5
- 229930195729 fatty acid Natural products 0.000 description 5
- 239000000835 fiber Substances 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 5
- 239000004753 textile Substances 0.000 description 5
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 4
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 4
- 229920002472 Starch Polymers 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- BGRWYDHXPHLNKA-UHFFFAOYSA-N Tetraacetylethylenediamine Chemical compound CC(=O)N(C(C)=O)CCN(C(C)=O)C(C)=O BGRWYDHXPHLNKA-UHFFFAOYSA-N 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- 125000000217 alkyl group Chemical group 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 229940079593 drug Drugs 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 4
- 239000008108 microcrystalline cellulose Substances 0.000 description 4
- 229940016286 microcrystalline cellulose Drugs 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000000344 soap Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 235000019698 starch Nutrition 0.000 description 4
- 239000011975 tartaric acid Substances 0.000 description 4
- 235000002906 tartaric acid Nutrition 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 235000010443 alginic acid Nutrition 0.000 description 3
- 229920000615 alginic acid Polymers 0.000 description 3
- 125000000129 anionic group Chemical group 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 229920001577 copolymer Polymers 0.000 description 3
- 238000000354 decomposition reaction Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000001125 extrusion Methods 0.000 description 3
- 239000003112 inhibitor Substances 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 238000005453 pelletization Methods 0.000 description 3
- 238000001694 spray drying Methods 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 3
- 238000004381 surface treatment Methods 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 240000000731 Fagus sylvatica Species 0.000 description 2
- 235000010099 Fagus sylvatica Nutrition 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 229920001131 Pulp (paper) Polymers 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 238000005054 agglomeration Methods 0.000 description 2
- 230000002776 aggregation Effects 0.000 description 2
- 235000012216 bentonite Nutrition 0.000 description 2
- 239000011230 binding agent Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- 239000012459 cleaning agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229920000609 methyl cellulose Polymers 0.000 description 2
- 239000001923 methylcellulose Substances 0.000 description 2
- 235000010981 methylcellulose Nutrition 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- 230000002087 whitening effect Effects 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical compound OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- PXRKCOCTEMYUEG-UHFFFAOYSA-N 5-aminoisoindole-1,3-dione Chemical compound NC1=CC=C2C(=O)NC(=O)C2=C1 PXRKCOCTEMYUEG-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-FOQJRBATSA-N 59096-14-9 Chemical compound CC(=O)OC1=CC=CC=C1[14C](O)=O BSYNRYMUTXBXSQ-FOQJRBATSA-N 0.000 description 1
- 102000013142 Amylases Human genes 0.000 description 1
- 108010065511 Amylases Proteins 0.000 description 1
- 229920000945 Amylopectin Polymers 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229920003084 Avicel® PH-102 Polymers 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 102000005575 Cellulases Human genes 0.000 description 1
- 108010084185 Cellulases Proteins 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- PTHCMJGKKRQCBF-UHFFFAOYSA-N Cellulose, microcrystalline Chemical class OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC)C(CO)O1 PTHCMJGKKRQCBF-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 description 1
- 102000004882 Lipase Human genes 0.000 description 1
- 108090001060 Lipase Proteins 0.000 description 1
- 239000004367 Lipase Substances 0.000 description 1
- 102000035195 Peptidases Human genes 0.000 description 1
- 108091005804 Peptidases Proteins 0.000 description 1
- 108700020962 Peroxidase Proteins 0.000 description 1
- 102000003992 Peroxidases Human genes 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical class OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 241000218657 Picea Species 0.000 description 1
- 229920000805 Polyaspartic acid Polymers 0.000 description 1
- 239000004365 Protease Substances 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- ULUAUXLGCMPNKK-UHFFFAOYSA-N Sulfobutanedioic acid Chemical class OC(=O)CC(C(O)=O)S(O)(=O)=O ULUAUXLGCMPNKK-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229960001138 acetylsalicylic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000002535 acidifier Substances 0.000 description 1
- 150000001253 acrylic acids Chemical class 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000783 alginic acid Substances 0.000 description 1
- 229960001126 alginic acid Drugs 0.000 description 1
- 150000004781 alginic acids Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000019418 amylase Nutrition 0.000 description 1
- 229940025131 amylases Drugs 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- FQFKDCGKJRWARK-UHFFFAOYSA-N butanedioic acid;pentanedioic acid Chemical compound OC(=O)CCC(O)=O.OC(=O)CCCC(O)=O FQFKDCGKJRWARK-UHFFFAOYSA-N 0.000 description 1
- 235000011092 calcium acetate Nutrition 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical class [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 229940105329 carboxymethylcellulose Drugs 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- UHZZMRAGKVHANO-UHFFFAOYSA-M chlormequat chloride Chemical compound [Cl-].C[N+](C)(C)CCCl UHZZMRAGKVHANO-UHFFFAOYSA-M 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000007938 effervescent tablet Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical group CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000005187 foaming Methods 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 210000004051 gastric juice Anatomy 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000003979 granulating agent Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001863 hydroxypropyl cellulose Substances 0.000 description 1
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000003475 lamination Methods 0.000 description 1
- DNHVXYDGZKWYNU-UHFFFAOYSA-N lead;hydrate Chemical compound O.[Pb] DNHVXYDGZKWYNU-UHFFFAOYSA-N 0.000 description 1
- 235000019421 lipase Nutrition 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 229960002900 methylcellulose Drugs 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 239000005445 natural material Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 125000000864 peroxy group Chemical group O(O*)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 108010064470 polyaspartate Proteins 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 229920003124 powdered cellulose Polymers 0.000 description 1
- 235000019814 powdered cellulose Nutrition 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000005624 silicic acid group Chemical class 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 238000002791 soaking Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 235000019832 sodium triphosphate Nutrition 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000007885 tablet disintegrant Substances 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Images
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D17/00—Detergent materials or soaps characterised by their shape or physical properties
- C11D17/0047—Detergents in the form of bars or tablets
- C11D17/0065—Solid detergents containing builders
- C11D17/0073—Tablets
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cleaning Implements For Floors, Carpets, Furniture, Walls, And The Like (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19710254A DE19710254A1 (de) | 1997-03-13 | 1997-03-13 | Wasch- oder reinigungsaktive Formkörper für den Gebrauch im Haushalt |
| DE19710254.9 | 1997-03-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU99122021A RU99122021A (ru) | 2001-08-20 |
| RU2200756C2 true RU2200756C2 (ru) | 2003-03-20 |
Family
ID=7823143
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU99122021/04A RU2200756C2 (ru) | 1997-03-13 | 1998-03-04 | Формованное изделие с моющим или чистящим действием для бытового употребления и способ его получения |
Country Status (15)
| Country | Link |
|---|---|
| US (2) | US6506720B1 (enExample) |
| EP (1) | EP0966518B1 (enExample) |
| JP (1) | JP2001514690A (enExample) |
| CN (1) | CN1216976C (enExample) |
| AT (1) | ATE207529T1 (enExample) |
| CZ (1) | CZ295795B6 (enExample) |
| DE (2) | DE19710254A1 (enExample) |
| DK (1) | DK0966518T3 (enExample) |
| ES (1) | ES2166155T3 (enExample) |
| HU (1) | HUP0004864A3 (enExample) |
| PL (1) | PL188853B1 (enExample) |
| PT (1) | PT966518E (enExample) |
| RU (1) | RU2200756C2 (enExample) |
| SK (1) | SK285108B6 (enExample) |
| WO (1) | WO1998040463A1 (enExample) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6410500B1 (en) | 1997-12-30 | 2002-06-25 | Henkel Kommanditgesellschaft Auf Aktien | Moulded body dishwasher detergents with soil release polymers |
| DE19758178A1 (de) * | 1997-12-30 | 1999-07-01 | Henkel Kgaa | Geschirrspülmittelformkörper mit Chlorbleichmitteln |
| US6992056B1 (en) | 1997-12-30 | 2006-01-31 | Henkel Kgaa | Process for preparing detergent tablets having two or more regions |
| DE19803410A1 (de) * | 1998-01-28 | 1999-07-29 | Henkel Kgaa | Mehrphasige Waschmitteltabletten |
| WO2000004122A1 (de) | 1998-07-15 | 2000-01-27 | Henkel Kommanditgesellschaft Auf Aktien | Verfahren zur herstellung mehrphasiger wasch- und reinigungsmittelformkörper |
| DE19847277A1 (de) * | 1998-10-14 | 2000-04-20 | Henkel Kgaa | Bleichaktivator-haltige Wasch- und Reinigungsmittelformkörper |
| DE59800410D1 (de) | 1998-11-11 | 2001-02-01 | Dalli Werke Waesche & Koerperp | Verdichtetes Granulat, Herstellungsverfahren und Verwendung als Sprengmittel für gepresste Formkörper |
| EP1004661A1 (de) * | 1998-11-11 | 2000-05-31 | DALLI-WERKE WÄSCHE- und KÖRPERPFLEGE GmbH & Co. KG | Verdichtetes Granulat, Herstellungsverfahren und Verwendung als Sprengmittel für gepresste Formkörper (2) |
| DE19902425A1 (de) * | 1999-01-22 | 2000-07-27 | Henkel Kgaa | Abriebstabile Wasch- und Reinigungsmittelformkörper |
| DE19903288A1 (de) * | 1999-01-28 | 2000-08-03 | Henkel Kgaa | Mehrphasige Waschmitteltabletten |
| US6770616B1 (en) | 1999-03-04 | 2004-08-03 | The Procter & Gamble Company | Detergent tablet |
| GB2347431A (en) * | 1999-03-04 | 2000-09-06 | Procter & Gamble | Detergent tablet |
| DE19912031A1 (de) | 1999-03-17 | 2000-09-21 | Basf Ag | Verwendung von quervernetztem Polyvinylpyrrolidon zur Erhöhung der Zerfallgeschwindigkeit von kompakten teilchenförmigen Wasch- und Reinigungsmitteln |
| ATE201714T1 (de) * | 1999-03-29 | 2001-06-15 | Dalli Werke Waesche & Koerperp | Sprengmittelgranulat enthaltende waschmitteltabletten |
| ATE334187T1 (de) * | 1999-03-29 | 2006-08-15 | Dalli Werke Gmbh & Co Kg | Verdichtetes sprengmittelgranulat für gepresste formkörper; dessen herstellung und verwendung |
| EP1048720A1 (en) * | 1999-04-30 | 2000-11-02 | The Procter & Gamble Company | Detergent compositions |
| EP1048721A1 (en) * | 1999-04-30 | 2000-11-02 | The Procter & Gamble Company | Detergent compositions |
| GB9913551D0 (en) | 1999-06-10 | 1999-08-11 | Unilever Plc | Cleaning compositions |
| GB9913549D0 (en) | 1999-06-10 | 1999-08-11 | Unilever Plc | Detergent compositions |
| GB2351501A (en) * | 1999-07-01 | 2001-01-03 | Procter & Gamble | Detergent compositions or components |
| DE19940547A1 (de) | 1999-08-26 | 2001-03-01 | Henkel Kgaa | Wasch- oder Reinigungsmittelformkörper mit Partialcoating |
| DE19943237A1 (de) * | 1999-09-11 | 2001-05-17 | Clariant Gmbh | Cogranulate aus Alkalischichtsilikaten und Sprengmitteln |
| DE19944218A1 (de) | 1999-09-15 | 2001-03-29 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| US6686327B1 (en) | 1999-10-09 | 2004-02-03 | Cognis Deutschland Gmbh & Co. Kg | Shaped bodies with improved solubility in water |
| US6610752B1 (en) | 1999-10-09 | 2003-08-26 | Cognis Deutschland Gmbh | Defoamer granules and processes for producing the same |
| DE19953792A1 (de) | 1999-11-09 | 2001-05-17 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19955619B4 (de) * | 1999-11-19 | 2004-01-29 | Daimlerchrysler Ag | Vorrichtung zur Überwachung der Verbrennung in Verbrennungsmotoren |
| DE19956802A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE19956803A1 (de) | 1999-11-25 | 2001-06-13 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE19961367A1 (de) * | 1999-12-17 | 2001-07-05 | Henkel Kgaa | Preßverfahren für mehrphasige Formkörper |
| DE19964225C2 (de) * | 1999-12-17 | 2002-01-24 | Henkel Kgaa | Preßverfahren für mehrphasige Formkörper |
| WO2001045647A2 (de) | 1999-12-20 | 2001-06-28 | Henkel Kommanditgesellschaft Auf Aktien | Tablettierung verdickender systeme |
| DE19962885A1 (de) * | 1999-12-24 | 2001-07-05 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittelformkörper mit verbesserten Zerfallseigenschaften |
| DE19962886A1 (de) | 1999-12-24 | 2001-07-05 | Cognis Deutschland Gmbh | Tensidgranulate mit verbesserter Auflösegeschwindigkeit |
| DE19962883A1 (de) | 1999-12-24 | 2001-07-12 | Cognis Deutschland Gmbh | Waschmitteltabletten |
| DE10003124A1 (de) | 2000-01-26 | 2001-08-09 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Tensidgranulaten |
| DE10010760A1 (de) * | 2000-03-04 | 2001-09-20 | Henkel Kgaa | Mehrphasige Wasch- und Reinigungsmittelformkörper mit nicht-gepreßten Anteilen |
| ATE268344T1 (de) | 2000-03-10 | 2004-06-15 | Basf Ag | Verwendung von quervernetztem polyvinylpyrrolidon als sprengmittel in kompakten, teilchenförmigen wasch- und reinigungsmitteln |
| DE10012949A1 (de) | 2000-03-16 | 2001-09-27 | Henkel Kgaa | Kieselsäureester-Mischungen |
| DE10019344A1 (de) | 2000-04-18 | 2001-11-08 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel |
| DE10019405A1 (de) | 2000-04-19 | 2001-10-25 | Cognis Deutschland Gmbh | Verfahren zur Herstellung von Waschmittelgranulaten |
| AU9521601A (en) | 2000-05-17 | 2001-11-26 | Henkel Kommanditgesellschaft Auf Aktien | Washing or cleaning agent shaped bodies |
| GB0020379D0 (en) * | 2000-08-21 | 2000-10-04 | Clariant Int Ltd | Enzyme composition in tablet form |
| DE10046251A1 (de) | 2000-09-19 | 2002-03-28 | Cognis Deutschland Gmbh | Wasch- und Reinigungsmittel auf Basis von Alkyl- und/oder Alkenyloligoglycosiden und Fettalkoholen |
| WO2002042404A1 (en) * | 2000-11-24 | 2002-05-30 | Unilever N.V. | Cleaning tablets |
| ATE438705T1 (de) * | 2000-11-24 | 2009-08-15 | Unilever Nv | Reinigungsmittelzusammensetzungen |
| DE10064985A1 (de) | 2000-12-23 | 2002-07-11 | Henkel Kgaa | Wasch- und Reinigungsmittelformkörper mit Beschichtung |
| DE10113334A1 (de) * | 2001-03-20 | 2002-09-26 | Cognis Deutschland Gmbh | Quartäre Tenside |
| DE10163856A1 (de) | 2001-12-22 | 2003-07-10 | Cognis Deutschland Gmbh | Hydroxymischether und Polymere in Form von festen Mitteln als Vorcompound für Wasch-, Spül- und Reinigungsmittel |
| DE10202390A1 (de) * | 2002-01-23 | 2003-09-25 | Henkel Kgaa | Kombination von Cellulasen und spezieller Cellulose in Waschmitteln |
| FR2838131B1 (fr) * | 2002-04-08 | 2004-07-23 | Eurotab | Tablette detergente comprenant deux couches reactives en dissolution separees par une couche barriere |
| DE10258870B4 (de) * | 2002-12-17 | 2005-04-07 | Henkel Kgaa | Grossvolumige Reinigungsmittelformkörper |
| US6669929B1 (en) | 2002-12-30 | 2003-12-30 | Colgate Palmolive Company | Dentifrice containing functional film flakes |
| DE10313172B4 (de) * | 2003-03-25 | 2007-08-09 | Henkel Kgaa | Gestaltsoptimierte Reinigungsmitteltabletten |
| DE10327682A1 (de) * | 2003-06-20 | 2005-01-05 | Bayer Chemicals Ag | Wasch- oder reinigungsaktive Formkörper für den Gebrauch im Haushalt |
| DK1917339T3 (da) * | 2005-08-18 | 2010-09-06 | Colgate Palmolive Co | Film med rengøringsmidler |
| US20070148213A1 (en) * | 2005-12-22 | 2007-06-28 | Sayed Ibrahim | Film containing compositions |
| DE102005062268A1 (de) | 2005-12-24 | 2007-08-02 | Henkel Kgaa | Pulverförmige Stylingmittel und deren Spendersysteme |
| DE102006011087A1 (de) * | 2006-03-08 | 2007-09-13 | Henkel Kgaa | Aminoalkyl-Gruppen enthaltende Wirkstoffträger auf Silizium-Basis |
| CN110785481B (zh) * | 2017-06-20 | 2021-04-13 | 荷兰联合利华有限公司 | 包含香料的颗粒洗涤剂组合物 |
| US20230242846A1 (en) * | 2020-05-28 | 2023-08-03 | Conopco, Inc., D/B/A Unilever | Tablet |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3487021A (en) * | 1966-08-11 | 1969-12-30 | Katz Jacob M | One-use hand-cleaning tablets |
| EP0522766A2 (en) * | 1991-07-01 | 1993-01-13 | Unilever Plc | Detergent compositions in tablet form |
Family Cites Families (81)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2560097A (en) | 1949-01-25 | 1951-07-10 | Lawrie L Witter | Hand cleaning tablet |
| DE938566C (de) | 1953-02-22 | 1956-02-02 | Hans Koehler | Verfahren zur Herstellung von lager- und zerfallfaehigen Arzneimitteltabletten |
| GB911204A (en) | 1960-07-28 | 1962-11-21 | Unilever Ltd | Bleaching compositions |
| CH471891A (de) | 1963-12-31 | 1969-04-30 | Unilever Nv | Verfahren zur Herstellung einer Reinigungsmitteltablette |
| US3370015A (en) | 1964-01-30 | 1968-02-20 | Lever Brothers Ltd | Process for preparing detergent compositions |
| DE1228029C2 (de) | 1964-05-09 | 1973-05-17 | Merck Ag E | Verfahren zur Herstellung von Tabletten durch Pressen von Pulvergemischen ohne vorhergehende Granulation |
| US3338836A (en) * | 1964-06-29 | 1967-08-29 | Fmc Corp | Cleansing tablets |
| US3360469A (en) * | 1965-06-07 | 1967-12-26 | Fmc Corp | Dry-mixed detergent compositions |
| US3490742A (en) | 1966-01-14 | 1970-01-20 | Staley Mfg Co A E | Compressed tablets |
| US3622677A (en) * | 1969-07-07 | 1971-11-23 | Staley Mfg Co A E | Compressed tablets containing compacted starch as binder-disintegrant ingredient |
| US4072535A (en) * | 1970-12-28 | 1978-02-07 | A. E. Staley Manufacturing Company | Precompacted-starch binder-disintegrant-filler material for direct compression tablets and dry dosage capsules |
| DE2263939C2 (de) | 1972-07-03 | 1983-01-13 | Henkel KGaA, 4000 Düsseldorf | Zur Verwendung in perhydrathaltigen Textilwaschmitteln geeignete Bleichaktivator-Tablette |
| US3951821A (en) | 1972-07-14 | 1976-04-20 | The Dow Chemical Company | Disintegrating agent for tablets |
| DE2321693C2 (de) | 1972-12-29 | 1982-07-01 | Henkel KGaA, 4000 Düsseldorf | Zur Anwendung mit Textilwaschmitteln geeignete Aufheller-Tablette |
| DE2263940C2 (de) | 1972-12-29 | 1982-04-08 | Henkel KGaA, 4000 Düsseldorf | Zur Anwendung mit Textilwaschmitteln geeignete Aufheller-Tablette |
| JPS5070286A (enExample) | 1973-10-25 | 1975-06-11 | ||
| DE2354096C2 (de) | 1973-10-29 | 1983-01-13 | Henkel KGaA, 4000 Düsseldorf | Zur Anwendung mit Textilwaschmitteln geeignete Aufheller-Tablette |
| DE2362595C2 (de) | 1973-12-17 | 1983-01-20 | Henkel KGaA, 4000 Düsseldorf | Zur Anwendung mit Textilwaschmitteln geeignete, Aufheller-Tablette |
| US4013581A (en) | 1975-07-10 | 1977-03-22 | The Procter & Gamble Company | Bleach tablet composition |
| GB2041966A (en) | 1977-11-29 | 1980-09-17 | Procter & Gamble | Detergent tablet having a hydrated salt coating and process for preparing the tablet |
| US4230590A (en) | 1978-12-11 | 1980-10-28 | Colgate Palmolive Company | Detergent softener compositions containing a soap-cellulose ether mixture |
| US4269859A (en) | 1979-04-19 | 1981-05-26 | Brown Company | Cellulose floc granules and process |
| US4361545A (en) * | 1979-05-21 | 1982-11-30 | Rowell Laboratories, Inc. | Solid pharmaceutical formulations for slow, zero order release via controlled surface erosion |
| US4369308A (en) * | 1981-07-24 | 1983-01-18 | National Starch And Chemical Corporation | Low swelling starches as tablet disintegrants |
| EP0075818B2 (de) | 1981-09-28 | 1990-03-14 | BASF Aktiengesellschaft | Körniger Bleichaktivator |
| LU84192A1 (fr) | 1982-06-09 | 1984-03-07 | Schindfessel Hubert N | Preparation detergente |
| JPS6015500A (ja) | 1983-07-08 | 1985-01-26 | ライオン株式会社 | 高嵩密度洗剤組成物 |
| EP0143476B1 (en) | 1983-10-03 | 1987-09-09 | Akzo N.V. | Dosing unit comprising a detergent and/or bleaching agent |
| US4551177A (en) * | 1984-04-23 | 1985-11-05 | National Starch And Chemical Corporation | Compressible starches as binders for tablets or capsules |
| DE3417649A1 (de) | 1984-05-12 | 1985-11-14 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung von kristallinen natriumsilikaten |
| DE3417820A1 (de) | 1984-05-14 | 1985-11-14 | Henkel KGaA, 4000 Düsseldorf | Verfahren zur herstellung eines waschzusatzes in tablettenform |
| DE3422055A1 (de) * | 1984-06-14 | 1985-12-19 | Henkel KGaA, 4000 Düsseldorf | Waschzusatz |
| DE3505433A1 (de) * | 1985-02-16 | 1986-08-21 | Basf Ag, 6700 Ludwigshafen | Direkttablettierhilfsmittel |
| JPS6230198A (ja) * | 1985-07-31 | 1987-02-09 | ライオン株式会社 | タブレツト洗剤 |
| JPS62197497A (ja) | 1986-02-24 | 1987-09-01 | ライオン株式会社 | タブレツト洗剤 |
| GB8619634D0 (en) | 1986-08-12 | 1986-09-24 | Unilever Plc | Antifoam ingredient |
| US4751015A (en) | 1987-03-17 | 1988-06-14 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| US4818426A (en) | 1987-03-17 | 1989-04-04 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| DE3742043A1 (de) | 1987-12-11 | 1989-06-22 | Hoechst Ag | Verfahren zur herstellung von kristallinen natriumschichtsilikaten |
| GB8810193D0 (en) | 1988-04-29 | 1988-06-02 | Unilever Plc | Detergent compositions & process for preparing them |
| IN170991B (enExample) | 1988-07-21 | 1992-06-27 | Lever Hindustan Ltd | |
| ES2085273T3 (es) | 1988-11-02 | 1996-06-01 | Unilever Nv | Procedimiento para preparar una composicion detergente granular de alta densidad aparente. |
| GB8907187D0 (en) | 1989-03-30 | 1989-05-10 | Unilever Plc | Detergent compositions and process for preparing them |
| JPH02311600A (ja) * | 1989-05-25 | 1990-12-27 | Lion Corp | タブレット洗剤組成物 |
| US5000947A (en) | 1989-05-30 | 1991-03-19 | Moleculon, Inc. | Shaped articles containing liquefiable powders for delivery of cosmetic and other personal care agents |
| US5043091A (en) | 1989-06-21 | 1991-08-27 | Colgate-Palmolive Co. | Process for manufacturing alkyl polysaccharide detergent laundry bar |
| DE4010533A1 (de) | 1990-04-02 | 1991-10-10 | Henkel Kgaa | Tablettierte wasch- und/oder reinigungsmittel fuer haushalt und gewerbe und verfahren zu ihrer herstellung |
| US5468286A (en) * | 1989-10-25 | 1995-11-21 | National Starch And Chemical Investment Holding Corporation | Enzymatically debranched starches as tablet excipients |
| GB8924294D0 (en) | 1989-10-27 | 1989-12-13 | Unilever Plc | Detergent compositions |
| GB2242130A (en) | 1990-03-20 | 1991-09-25 | Infowise Ltd | Cleaning and sanitising tablets manufactured by direct compression |
| DE69125310T2 (de) | 1990-05-21 | 1997-07-03 | Unilever Nv | Bleichmittelaktivierung |
| GB9015504D0 (en) | 1990-07-13 | 1990-08-29 | Unilever Plc | Detergents composition |
| GB9015503D0 (en) | 1990-07-13 | 1990-08-29 | Unilever Plc | Detergent composition |
| JP2756033B2 (ja) * | 1990-10-29 | 1998-05-25 | 花王株式会社 | 錠剤型洗剤 |
| JP2950434B2 (ja) | 1990-12-28 | 1999-09-20 | 新田ゼラチン株式会社 | 毛髪用固体洗浄剤 |
| US5411673A (en) * | 1991-02-06 | 1995-05-02 | The Procter & Gamble Company | Peroxyacid bleach precursor compositions |
| DE4121127A1 (de) | 1991-06-26 | 1993-01-14 | Rettenmaier & Soehne Gmbh & Co | Hilfsstoff zur trockenen direkttablettierung und verfahren zur herstellung desselben |
| DE4133862C2 (de) | 1991-10-12 | 2003-07-17 | Freytag Von Loringhoven Andrea | Duftstoffe enthaltende Tablette |
| GB9127060D0 (en) | 1991-12-20 | 1992-02-19 | Unilever Plc | Bleach activation |
| US5486303A (en) | 1993-08-27 | 1996-01-23 | The Procter & Gamble Company | Process for making high density detergent agglomerates using an anhydrous powder additive |
| DE4344215A1 (de) * | 1993-12-23 | 1995-06-29 | Cognis Bio Umwelt | Silberkorrosionsschutzmittelhaltige Enzymzubereitung |
| DE4404279A1 (de) * | 1994-02-10 | 1995-08-17 | Henkel Kgaa | Tablette mit Buildersubstanzen |
| JPH07286199A (ja) | 1994-04-15 | 1995-10-31 | Lion Corp | タブレット洗剤組成物の製造方法 |
| DE4429550A1 (de) | 1994-08-19 | 1996-02-22 | Henkel Kgaa | Verfahren zur Herstellung von Wasch- oder Reinigungsmitteltabletten |
| GB9422895D0 (en) | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB9422925D0 (en) * | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| GB9422924D0 (en) | 1994-11-14 | 1995-01-04 | Unilever Plc | Detergent compositions |
| DE19500936A1 (de) | 1995-01-14 | 1996-07-18 | Weber Rudolf Dipl Ing | Wasserlösliche Waschmittel und Waschhilfsmittel |
| GB2298867A (en) | 1995-03-11 | 1996-09-18 | Procter & Gamble | Detergent compositions in tablet form |
| DK0737738T3 (da) | 1995-04-12 | 2003-10-20 | Cleantabs As | Blegemiddeltablet |
| US5681475A (en) * | 1995-04-13 | 1997-10-28 | Truetech, Inc. | Water purification composition, kit and method employing the same |
| US5656584A (en) | 1996-02-06 | 1997-08-12 | The Procter & Gamble Company | Process for producing a particulate laundry additive composition for perfume delivery |
| DE19758811B4 (de) | 1997-03-11 | 2008-12-18 | Henkel Ag & Co. Kgaa | Waschmittelpressling |
| GB9711831D0 (en) * | 1997-06-06 | 1997-08-06 | Unilever Plc | Cleaning compositions |
| ZA984570B (en) | 1997-06-06 | 1999-11-29 | Unilever Plc | Cleaning compositions. |
| GB9711829D0 (en) | 1997-06-06 | 1997-08-06 | Unilever Plc | Detergent compositions |
| TW520990B (en) * | 1997-09-29 | 2003-02-21 | Kao Corp | Disintegrating particles and cleanser or detergent composition |
| WO1999036493A1 (en) | 1998-01-13 | 1999-07-22 | The Procter & Gamble Company | A detergent granule with improved dissolution |
| EP1004661A1 (de) * | 1998-11-11 | 2000-05-31 | DALLI-WERKE WÄSCHE- und KÖRPERPFLEGE GmbH & Co. KG | Verdichtetes Granulat, Herstellungsverfahren und Verwendung als Sprengmittel für gepresste Formkörper (2) |
| DE59800410D1 (de) * | 1998-11-11 | 2001-02-01 | Dalli Werke Waesche & Koerperp | Verdichtetes Granulat, Herstellungsverfahren und Verwendung als Sprengmittel für gepresste Formkörper |
| ATE334187T1 (de) * | 1999-03-29 | 2006-08-15 | Dalli Werke Gmbh & Co Kg | Verdichtetes sprengmittelgranulat für gepresste formkörper; dessen herstellung und verwendung |
-
1997
- 1997-03-13 DE DE19710254A patent/DE19710254A1/de not_active Ceased
-
1998
- 1998-03-04 DE DE59801863T patent/DE59801863D1/de not_active Revoked
- 1998-03-04 EP EP98912437A patent/EP0966518B1/de not_active Revoked
- 1998-03-04 ES ES98912437T patent/ES2166155T3/es not_active Expired - Lifetime
- 1998-03-04 JP JP53916498A patent/JP2001514690A/ja active Pending
- 1998-03-04 SK SK1226-99A patent/SK285108B6/sk not_active IP Right Cessation
- 1998-03-04 PT PT98912437T patent/PT966518E/pt unknown
- 1998-03-04 AT AT98912437T patent/ATE207529T1/de not_active IP Right Cessation
- 1998-03-04 PL PL98335445A patent/PL188853B1/pl unknown
- 1998-03-04 RU RU99122021/04A patent/RU2200756C2/ru not_active IP Right Cessation
- 1998-03-04 HU HU0004864A patent/HUP0004864A3/hu not_active Application Discontinuation
- 1998-03-04 DK DK98912437T patent/DK0966518T3/da active
- 1998-03-04 CZ CZ19993238A patent/CZ295795B6/cs not_active IP Right Cessation
- 1998-03-04 WO PCT/EP1998/001203 patent/WO1998040463A1/de not_active Ceased
- 1998-03-04 CN CN988032295A patent/CN1216976C/zh not_active Expired - Fee Related
-
1999
- 1999-09-03 US US09/396,549 patent/US6506720B1/en not_active Ceased
-
2003
- 2003-04-16 US US10/414,962 patent/USRE39139E1/en not_active Expired - Lifetime
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3487021A (en) * | 1966-08-11 | 1969-12-30 | Katz Jacob M | One-use hand-cleaning tablets |
| EP0522766A2 (en) * | 1991-07-01 | 1993-01-13 | Unilever Plc | Detergent compositions in tablet form |
Also Published As
| Publication number | Publication date |
|---|---|
| PL335445A1 (en) | 2000-04-25 |
| SK285108B6 (sk) | 2006-06-01 |
| PT966518E (pt) | 2002-04-29 |
| DE59801863D1 (de) | 2001-11-29 |
| EP0966518B1 (de) | 2001-10-24 |
| PL188853B1 (pl) | 2005-05-31 |
| CN1250474A (zh) | 2000-04-12 |
| WO1998040463A1 (de) | 1998-09-17 |
| HUP0004864A2 (hu) | 2001-08-28 |
| CZ9903238A3 (cs) | 2000-12-13 |
| US6506720B1 (en) | 2003-01-14 |
| ES2166155T3 (es) | 2002-04-01 |
| DE19710254A1 (de) | 1998-09-17 |
| DK0966518T3 (da) | 2002-02-18 |
| EP0966518A1 (de) | 1999-12-29 |
| ATE207529T1 (de) | 2001-11-15 |
| HUP0004864A3 (en) | 2003-03-28 |
| CN1216976C (zh) | 2005-08-31 |
| CZ295795B6 (cs) | 2005-11-16 |
| USRE39139E1 (en) | 2006-06-20 |
| JP2001514690A (ja) | 2001-09-11 |
| SK122699A3 (en) | 2000-05-16 |
| HK1025991A1 (en) | 2000-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2200756C2 (ru) | Формованное изделие с моющим или чистящим действием для бытового употребления и способ его получения | |
| KR950004826B1 (ko) | 세제조성물 | |
| KR950013227B1 (ko) | 세제 조성물 | |
| US6329334B1 (en) | Use of crosslinked polyvinylpyrrolidone to increase the rate of disintegration of compact particular detergents and cleaners | |
| US6232285B1 (en) | Compacted granulate, process for making same and use as disintegrating agent for pressed detergent tablets, cleaning agent tablets for dishwashers, water softening tablets and scouring salt tablets | |
| JPH04339899A (ja) | 洗剤組成物 | |
| EP1007616B1 (de) | Hilfsmittelgranulat für wasch- und reinigungsaktive formkörper | |
| HUP0101052A2 (hu) | Eljárás illatgyöngyöket tartalmazó mosó- és tisztítószer formatestek előállítására | |
| JP2002500690A (ja) | 向上した溶解特性を示す洗剤成形体 | |
| JP2001515953A (ja) | 改善された溶解性を示す洗浄剤および洗剤成形体 | |
| JP2007531803A (ja) | 粒状物の製造方法、ならびに洗剤および/または洗浄剤における該粒状物の使用 | |
| CA2294976A1 (en) | Additive granules for detersive shaped bodies | |
| ES2368134T3 (es) | Composiciones de limpieza. | |
| HK1025991B (en) | Household detergent or cleaning action shaped bodies | |
| CA2293969A1 (en) | Additive granules for detersive shaped bodies | |
| US20070191245A1 (en) | Shaped bodies for the sanitary sector | |
| EP1335967B1 (en) | Cleaning compositions | |
| MXPA04005922A (es) | Cuerpos moldeados con actividad de lavado o de limpieza para uso en el hogar. | |
| JP2002519478A (ja) | 洗剤タブレットの製法 | |
| CZ9904362A3 (cs) | Granulovaný pomocný prostředek | |
| HK1028414A (en) | Detergent shaped body with enhanced dissolving properties | |
| EP1746152A1 (en) | Detergent compositions | |
| CA2297458A1 (en) | Abrasion-resistant detergent tablets with a high nonionic surfactant content | |
| CZ9904276A3 (cs) | Prací a čistící prostředek | |
| CA2300630A1 (en) | Washing and cleaning agent shaped bodies with improved solubility |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20160305 |