NO125672B - - Google Patents
Download PDFInfo
- Publication number
- NO125672B NO125672B NO0304/68A NO30468A NO125672B NO 125672 B NO125672 B NO 125672B NO 0304/68 A NO0304/68 A NO 0304/68A NO 30468 A NO30468 A NO 30468A NO 125672 B NO125672 B NO 125672B
- Authority
- NO
- Norway
- Prior art keywords
- general formula
- benzoyl
- phenyl
- water
- acid
- Prior art date
Links
- 150000001875 compounds Chemical class 0.000 claims description 33
- 150000003839 salts Chemical class 0.000 claims description 16
- 238000000034 method Methods 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- ALDSXDRDRWDASQ-UHFFFAOYSA-N 2-(3-benzoylphenyl)acetic acid Chemical class OC(=O)CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 ALDSXDRDRWDASQ-UHFFFAOYSA-N 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 33
- 239000000243 solution Substances 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 28
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000010992 reflux Methods 0.000 description 18
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 17
- 239000000203 mixture Substances 0.000 description 16
- -1 alkali metal cyanide Chemical class 0.000 description 15
- 239000000047 product Substances 0.000 description 14
- 239000000155 melt Substances 0.000 description 13
- 241001465754 Metazoa Species 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000003610 charcoal Substances 0.000 description 9
- 239000012141 concentrate Substances 0.000 description 9
- 235000011121 sodium hydroxide Nutrition 0.000 description 8
- 229910052938 sodium sulfate Inorganic materials 0.000 description 8
- 235000011152 sodium sulphate Nutrition 0.000 description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 238000001914 filtration Methods 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 241000700198 Cavia Species 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 6
- MHKMCTCMEDUINO-UHFFFAOYSA-N 2-(3-benzoylphenyl)acetonitrile Chemical class C=1C=CC(CC#N)=CC=1C(=O)C1=CC=CC=C1 MHKMCTCMEDUINO-UHFFFAOYSA-N 0.000 description 5
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 206010000269 abscess Diseases 0.000 description 5
- 239000000679 carrageenan Substances 0.000 description 5
- 229940113118 carrageenan Drugs 0.000 description 5
- 235000010418 carrageenan Nutrition 0.000 description 5
- 229920001525 carrageenan Polymers 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 5
- PAAZPARNPHGIKF-UHFFFAOYSA-N 1,2-dibromoethane Chemical compound BrCCBr PAAZPARNPHGIKF-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- 238000002425 crystallisation Methods 0.000 description 4
- 230000008025 crystallization Effects 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- URBLVRAVOIVZFJ-UHFFFAOYSA-N (3-methylphenyl)-phenylmethanone Chemical class CC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 URBLVRAVOIVZFJ-UHFFFAOYSA-N 0.000 description 3
- MIJYFLXOJQTGHU-UHFFFAOYSA-N 2-(3-benzoyl-2-methoxyphenyl)acetonitrile Chemical compound COC1=C(CC#N)C=CC=C1C(=O)C1=CC=CC=C1 MIJYFLXOJQTGHU-UHFFFAOYSA-N 0.000 description 3
- HLWUKJUOPQJDOL-UHFFFAOYSA-N 2-(4-sulfanylphenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(S)C=C1 HLWUKJUOPQJDOL-UHFFFAOYSA-N 0.000 description 3
- 101800004538 Bradykinin Proteins 0.000 description 3
- 241000700199 Cavia porcellus Species 0.000 description 3
- QXZGBUJJYSLZLT-UHFFFAOYSA-N H-Arg-Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg-OH Natural products NC(N)=NCCCC(N)C(=O)N1CCCC1C(=O)N1C(C(=O)NCC(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CO)C(=O)N2C(CCC2)C(=O)NC(CC=2C=CC=CC=2)C(=O)NC(CCCN=C(N)N)C(O)=O)CCC1 QXZGBUJJYSLZLT-UHFFFAOYSA-N 0.000 description 3
- 102100035792 Kininogen-1 Human genes 0.000 description 3
- 239000007868 Raney catalyst Substances 0.000 description 3
- 229910000564 Raney nickel Inorganic materials 0.000 description 3
- YOHODAGDNCQDNY-UHFFFAOYSA-N [2-(3-benzoylphenyl)-2-cyanopropyl] acetate Chemical compound CC(=O)OCC(C)(C#N)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 YOHODAGDNCQDNY-UHFFFAOYSA-N 0.000 description 3
- WAXNWQKNFZDHOM-UHFFFAOYSA-N [3-(bromomethyl)-2-methoxyphenyl]-phenylmethanone Chemical compound COC1=C(CBr)C=CC=C1C(=O)C1=CC=CC=C1 WAXNWQKNFZDHOM-UHFFFAOYSA-N 0.000 description 3
- SZJQXQICJDHRJE-UHFFFAOYSA-N [3-(bromomethyl)phenyl]-phenylmethanone Chemical compound BrCC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 SZJQXQICJDHRJE-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 239000002585 base Substances 0.000 description 3
- QXZGBUJJYSLZLT-FDISYFBBSA-N bradykinin Chemical compound NC(=N)NCCC[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1[C@H](C(=O)NCC(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CO)C(=O)N2[C@@H](CCC2)C(=O)N[C@@H](CC=2C=CC=CC=2)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O)CCC1 QXZGBUJJYSLZLT-FDISYFBBSA-N 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000012954 diazonium Substances 0.000 description 3
- 150000001989 diazonium salts Chemical class 0.000 description 3
- 238000004090 dissolution Methods 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000012286 potassium permanganate Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- JKTVLDLMMZCXFE-UHFFFAOYSA-N (2-methoxy-3-methylphenyl)-phenylmethanone Chemical compound COC1=C(C)C=CC=C1C(=O)C1=CC=CC=C1 JKTVLDLMMZCXFE-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- RQEUFEKYXDPUSK-UHFFFAOYSA-N 1-phenylethylamine Chemical compound CC(N)C1=CC=CC=C1 RQEUFEKYXDPUSK-UHFFFAOYSA-N 0.000 description 2
- PNYKSCBMMRTDJD-UHFFFAOYSA-N 2-(3-benzoyl-2-hydroxyphenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1O PNYKSCBMMRTDJD-UHFFFAOYSA-N 0.000 description 2
- AULBUIGZOUKLJI-UHFFFAOYSA-N 2-(3-benzoyl-2-methoxyphenyl)propanoic acid Chemical compound COC1=C(C(C)C(O)=O)C=CC=C1C(=O)C1=CC=CC=C1 AULBUIGZOUKLJI-UHFFFAOYSA-N 0.000 description 2
- WOMVICAMAQURRN-UHFFFAOYSA-N 2-(4-aminophenyl)propanoic acid Chemical compound OC(=O)C(C)C1=CC=C(N)C=C1 WOMVICAMAQURRN-UHFFFAOYSA-N 0.000 description 2
- CJNZAXGUTKBIHP-UHFFFAOYSA-N 2-iodobenzoic acid Chemical compound OC(=O)C1=CC=CC=C1I CJNZAXGUTKBIHP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- 238000006217 Nerdel homologation reaction Methods 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 239000012965 benzophenone Substances 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 210000000621 bronchi Anatomy 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 230000002517 constrictor effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical compound OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 2
- 238000006477 desulfuration reaction Methods 0.000 description 2
- 230000023556 desulfurization Effects 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical compound CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 239000012299 nitrogen atmosphere Substances 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 208000009079 Bronchial Spasm Diseases 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 241000212749 Zesius chrysomallus Species 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005910 alkyl carbonate group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 229940121363 anti-inflammatory agent Drugs 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000003110 anti-inflammatory effect Effects 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000010908 decantation Methods 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 230000026030 halogenation Effects 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 230000007794 irritation Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- DKYWVDODHFEZIM-UHFFFAOYSA-N ketoprofen Chemical compound OC(=O)C(C)C1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 DKYWVDODHFEZIM-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 230000003285 pharmacodynamic effect Effects 0.000 description 1
- PEEXCRJDFUVJRT-UHFFFAOYSA-M potassium;methoxymethanedithioate Chemical compound [K+].COC([S-])=S PEEXCRJDFUVJRT-UHFFFAOYSA-M 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000029058 respiratory gaseous exchange Effects 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000004289 sodium hydrogen sulphite Substances 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/77—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D307/78—Benzo [b] furans; Hydrogenated benzo [b] furans
- C07D307/82—Benzo [b] furans; Hydrogenated benzo [b] furans with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/63—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by introduction of halogen; by substitution of halogen atoms by other halogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C57/00—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms
- C07C57/30—Unsaturated compounds having carboxyl groups bound to acyclic carbon atoms containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/84—Unsaturated compounds containing keto groups containing six membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/90—Unsaturated compounds containing keto groups containing singly bound oxygen-containing groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR92828A FR1546478A (fr) | 1967-01-27 | 1967-01-27 | Nouveaux dérivés de l'acide benzoyl-3 phénylacétique et leur préparation |
| FR132526A FR94930E (fr) | 1967-01-27 | 1967-12-15 | Nouveaux dérivés de l'acide benzoyl-3 phénylacétique et leur préparation. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| NO125672B true NO125672B (enExample) | 1972-10-16 |
Family
ID=26174596
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO0304/68A NO125672B (enExample) | 1967-01-27 | 1968-01-24 | |
| NO03695/71*[A NO126177B (enExample) | 1967-01-27 | 1971-10-07 |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NO03695/71*[A NO126177B (enExample) | 1967-01-27 | 1971-10-07 |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US3641127A (enExample) |
| AT (3) | AT281798B (enExample) |
| BE (1) | BE709964A (enExample) |
| CH (1) | CH484863A (enExample) |
| CY (1) | CY668A (enExample) |
| DE (1) | DE1668648C3 (enExample) |
| DK (2) | DK119153B (enExample) |
| ES (3) | ES349842A1 (enExample) |
| FI (1) | FI45953C (enExample) |
| FR (2) | FR1546478A (enExample) |
| GB (1) | GB1164585A (enExample) |
| IE (1) | IE31886B1 (enExample) |
| IL (1) | IL29377A (enExample) |
| LU (1) | LU55356A1 (enExample) |
| MY (1) | MY7300143A (enExample) |
| NL (1) | NL146485B (enExample) |
| NO (2) | NO125672B (enExample) |
| OA (1) | OA03403A (enExample) |
| SE (1) | SE346989B (enExample) |
| SU (1) | SU544364A3 (enExample) |
| YU (3) | YU32373B (enExample) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2460984A (en) * | 1944-06-06 | 1949-02-08 | Wright Aeronautical Corp | Pipe connection |
| FR2043472A1 (enExample) * | 1969-05-19 | 1971-02-19 | Rhone Poulenc Sa | |
| FR2163875A5 (en) * | 1971-12-03 | 1973-07-27 | Rhone Poulenc Sa | 3-benzoylphenyl acetic and 2-(3-benzoyl phenyl) - propionic acids prepn - for use as anti-inflammatories |
| FR2202873A2 (en) * | 1972-10-16 | 1974-05-10 | Rhone Poulenc Sa | 3-benzoylphenyl acetic and 2-(3-benzoyl phenyl) - propionic acids prepn - for use as anti-inflammatories |
| OA04219A (fr) * | 1971-12-03 | 1979-12-31 | Rhone Poulenc Sa | Nouveau procédé de préparation de l'acide (benzol-3-phényl)-2 propionique et analogues. |
| US3928415A (en) * | 1973-05-08 | 1975-12-23 | Cassella Farbwerke Mainkur Ag | Benzophenone derivatives and process for their production II |
| FR2278331A1 (fr) * | 1974-01-24 | 1976-02-13 | Roussel Uclaf | Nouveaux acides carboxyliques et leurs derives, leur application comme medicaments et leur procede de preparation |
| US4216326A (en) | 1975-01-20 | 1980-08-05 | Sterling Drug Inc. | Intermediates for preparing anti-inflammatory phenyl-lower-alkylamines |
| DE2646792C2 (de) * | 1975-10-23 | 1985-05-09 | Mitsubishi Petrochemical Co., Ltd., Tokio/Tokyo | Verfahren zur Herstellung einer α-(arylsubstituierten)-Propionsäure und/oder eines Esters derselben |
| YU39415B (en) * | 1978-04-10 | 1984-12-31 | Lek Tovarna Farmacevtskih | Process for preparing 2-(3-benzoyl-phenyl)-propionic acid |
| US4340740A (en) | 1979-07-16 | 1982-07-20 | Sagami Chemical Research Center | Alpha-thio-alpha-aryl-substituted alkanonitrile and process for preparing alpha-aryl-substituted alkanonitrile therefrom |
| US4417052A (en) | 1980-02-15 | 1983-11-22 | Sterling Drug Inc. | Phenyl-lower-alkyl piperidines and pyrrolidines |
| DE3026402A1 (de) * | 1980-07-11 | 1982-02-04 | Syntex Corp., Palo Alto, Calif. | Die verwendung analgetischer und nicht-hormonaler, entzuendungshemmender mittel bei der behandlung von mikrovaskulaeren erkrankungen |
| AT370721B (de) * | 1981-02-24 | 1983-04-25 | Ciba Geigy Ag | Verfahren zur herstellung von neuen salzen der 2- (2,6-dichloranilino)-phenylessigsaeure, der |
| US5166141A (en) * | 1983-11-01 | 1992-11-24 | Scripps Clinic And Research Foundation | Immunostimulating 7-deaza-7-oxa- and 7-deaza-7-oxo-analogs of 8-substituted-guanine-9-(1'-beta-D-aldoglycosidyl) derivatives and methods of treating test animals |
| EP0306538B1 (en) * | 1987-03-20 | 1992-11-25 | Nippon Petrochemicals Company, Limited | Process for preparing alpha-(3-benzylphenyl)propionic acid derivative |
| US4868214A (en) * | 1987-11-17 | 1989-09-19 | Analgesic Associates | Onset-hastened/enhanced analgesia |
| JP2518014B2 (ja) * | 1988-05-31 | 1996-07-24 | 日産化学工業株式会社 | α−置換酢酸の精製方法 |
| CA2023954C (en) * | 1989-10-17 | 1999-05-04 | Hiroyuki Nohira | Process for the optical resolution of 2-(3-benzoyl) phenylpropionic acid |
| US5218124A (en) * | 1989-10-27 | 1993-06-08 | American Home Products Corporation | Substituted benzoylbenzene-, biphenyl- and 2-oxazole-alkanoic acid derivatives as inhibitors of pla2 and lipoxygenase |
| US5071988A (en) * | 1989-10-27 | 1991-12-10 | American Home Products Corporation | Substituted benzoylbenzene-, biphenyl- and 2-oxazole-alkanoic acid derivatives |
| EP0525506B2 (en) * | 1991-07-31 | 1999-03-17 | Tessenderlo Chemie N.V. | A process for the alpha-monoalkylation of arylacetonitriles, arylacetoesters and arylacetic acids |
| DE4128787A1 (de) * | 1991-08-30 | 1993-03-04 | Bayer Ag | Neue zwischenprodukte und ihre verwendung bei der herstellung von s-ketoprofen |
| FR2687915B1 (fr) * | 1992-02-28 | 1995-05-05 | Rhone Poulenc Rorer Sa | Composition pharmaceutique utilisable comme analgesique contenant l'acide (benzoyl-3 phenyl)-2 propionique-(r). |
| US5331000A (en) * | 1992-03-09 | 1994-07-19 | Sepracor Inc. | Antipyretic and analgesic methods and compositions containing optically pure R(-) ketoprofen |
| ES2049647B1 (es) * | 1992-07-28 | 1994-12-16 | Menarini Lab | "procedimiento para la preparacion de nuevos derivados del acido 2-(3-benzoilfenil) propionico" |
| ES2058024B1 (es) * | 1992-11-10 | 1995-05-01 | Menarini Lab | Nuevo derivado arilpropionico, procedimiento de fabricacion del mismo y su utilizacion como analgesico. |
| IT1256450B (it) * | 1992-11-26 | 1995-12-05 | Soldato Piero Del | Esteri nitrici con attivita' farmacologica e procedimento per la loro preparazione |
| DE4319438C1 (de) * | 1993-06-11 | 1994-06-01 | Gerd Dr Dr Geislinger | Arzneimittel auf der Grundlage von Ketoprofen zur Bekämpfung von Schmerzen und/oder Entzündungen und/oder Fieber an Menschen und Tieren |
| WO1995025511A1 (en) * | 1994-03-18 | 1995-09-28 | Bayer Corporation | Low dosage ketoprofen |
| JPH08151344A (ja) * | 1994-09-26 | 1996-06-11 | Nagase & Co Ltd | 2−(3−ベンゾイルフェニル)プロピオン酸の光学分割方法 |
| ES2109859B1 (es) * | 1994-11-23 | 1998-08-16 | Menarini Lab | Nuevos derivados arilpropionicos con accion analgesica y procedimiento para su obtencion. |
| US6080888A (en) * | 1997-01-08 | 2000-06-27 | Albemarle Corporation | Preparation of olefinic compounds and carboxylic derivatives thereof |
| US5792886A (en) * | 1997-01-08 | 1998-08-11 | Albemarle Corporation | Production of racemic 2-(6-methoxy-2-naphthyl) propionic acid of precursors thereof |
| US6096920A (en) * | 1997-01-08 | 2000-08-01 | Albemarle Corporation | Preparation of carboxylic compounds and their derivatives |
| US6268526B1 (en) | 1998-12-16 | 2001-07-31 | Albemarle Corporation | Palladium catalyzed carbonylation process utilizing aromatic substituted alcohols and/or aromatic substituted alkyl halides |
| IT1308633B1 (it) | 1999-03-02 | 2002-01-09 | Nicox Sa | Nitrossiderivati. |
| US20080021085A1 (en) * | 2000-04-13 | 2008-01-24 | Mayo Foundation For Medical Education And Research | Method of reducing abeta42 and treating diseases |
| EP1284729A4 (en) * | 2000-04-13 | 2007-12-19 | Mayo Foundation | A- (BETA) -42 DECREASING MEDICINAL PRODUCTS |
| IT1318673B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Farmaci per le disfunzioni sessuali. |
| IT1318674B1 (it) * | 2000-08-08 | 2003-08-27 | Nicox Sa | Faramaci per l'incontinenza. |
| US20030027867A1 (en) * | 2001-06-29 | 2003-02-06 | Myriad Genetics, Incorporated | Use of R-NSAID compounds for anti-HIV treatment |
| PL375321A1 (en) * | 2002-09-20 | 2005-11-28 | Nicox S.A. | Manufacturing process for no-donating compounds such as no-donating diclofenac |
| US7090859B2 (en) * | 2002-12-13 | 2006-08-15 | Ronald Thomas Haas | Ketoprofen compositions and methods of making them |
| EP1603548A4 (en) * | 2003-02-05 | 2007-10-10 | Myriad Genetics Inc | METHOD AND COMPOSITION FOR THE TREATMENT OF NEURODEEGENERATIVE DISEASES |
| EP1651195A4 (en) * | 2003-07-11 | 2007-10-03 | Myriad Genetics Inc | PHARMACEUTICAL PROCESSES, DOSIERSCHEMATA AND DOSAGE FORMS FOR THE TREATMENT OF ALZHEIMER DISEASE |
| US20050171207A1 (en) * | 2003-09-26 | 2005-08-04 | Myriad Genetics, Incorporated | Method and composition for combination treatment of neurodegenerative disorders |
| US20060047171A1 (en) * | 2003-12-22 | 2006-03-02 | Harold Meckler | Catalytic hydrogenation of nitriles to produce capsaicinoid derivatives and amine compounds, and methods for purifying and obtaining the polymorphs thereof |
| WO2006001877A2 (en) * | 2004-04-13 | 2006-01-05 | Myriad Genetics, Inc. | Combination treatment for neurodegenerative disorders comprising r-flurbiprofen |
| MXPA06012165A (es) * | 2004-04-29 | 2007-01-17 | Keystone Retaining Wall System | Chapas para muros, muros de contencion y similares. |
| WO2006020852A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| CA2618985A1 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| WO2006020850A2 (en) * | 2004-08-11 | 2006-02-23 | Myriad Genetics, Inc. | Pharmaceutical composition and method for treating neurodegenerative disorders |
| US20070015832A1 (en) * | 2005-07-14 | 2007-01-18 | Myriad Genetics, Incorporated | Methods of treating overactive bladder and urinary incontinence |
| CA2615063A1 (en) * | 2005-07-22 | 2007-02-01 | Myriad Genetics, Inc. | High drug load formulations and dosage forms |
| US20080033045A1 (en) * | 2006-07-07 | 2008-02-07 | Myriad Genetics, Incorporated | Treatment of psychiatric disorders |
| LT5696B (lt) | 2009-01-22 | 2010-11-25 | Sanofi-Synthelabo (India) Ltd, Gidc | Aktyvių ingredientų, turinčių nesteroidinį priešuždegiminį vaistą ir kolchikozido darinį, naujas derinys |
| ES2432222B1 (es) | 2012-04-30 | 2014-06-10 | Farmalider S.A. | Composición farmacéutica inyectable de dexketoprofeno y tramadol |
| WO2014007779A1 (en) | 2012-07-06 | 2014-01-09 | Sanovel Ilac Sanayi Ve Ticaret Anonim Sirketi | Orally-disintegrating formulations of dexketoprofen |
| WO2014007780A1 (en) | 2012-07-06 | 2014-01-09 | Sanovel Ilac Sanayi Ve Ticaret Anonim Sirketi | Orally-disintegrating formulations of dexketoprofen |
| EP2730271B1 (en) | 2012-11-11 | 2018-01-24 | Symrise AG | Aqeuous compositions |
| ES2701758T3 (es) | 2013-02-27 | 2019-02-25 | Symrise Ag | Extracto de jengibre para la protección de citoblastos |
| EP2862852B1 (en) | 2013-10-18 | 2018-07-04 | Symrise AG | Urea derivatives for the protection of stem cells |
| NZ719783A (en) | 2013-12-16 | 2017-01-27 | Zoetis Services Llc | Long-acting ketoprofen compositions |
| EP2921157B1 (en) | 2014-03-18 | 2017-08-16 | Symrise AG | Coated titanium dioxide to reduce whitening effect on skin |
| EP2939710B1 (en) | 2014-04-29 | 2020-06-17 | Symrise AG | Active Mixtures |
| EP3045161A1 (en) | 2015-01-18 | 2016-07-20 | Symrise AG | Active compositions comprising 1,2-hexanediol and 1,2-octanediol |
-
1967
- 1967-01-27 FR FR92828A patent/FR1546478A/fr not_active Expired
- 1967-12-15 FR FR132526A patent/FR94930E/fr not_active Expired
-
1968
- 1968-01-18 OA OA53169A patent/OA03403A/xx unknown
- 1968-01-19 NL NL686800880A patent/NL146485B/xx not_active IP Right Cessation
- 1968-01-24 NO NO0304/68A patent/NO125672B/no unknown
- 1968-01-25 IE IE107/68A patent/IE31886B1/xx unknown
- 1968-01-25 FI FI680194A patent/FI45953C/fi active
- 1968-01-25 US US700375A patent/US3641127A/en not_active Expired - Lifetime
- 1968-01-26 AT AT432569A patent/AT281798B/de not_active IP Right Cessation
- 1968-01-26 IL IL29377A patent/IL29377A/xx unknown
- 1968-01-26 CH CH121968A patent/CH484863A/fr not_active IP Right Cessation
- 1968-01-26 AT AT79468A patent/AT280245B/de not_active IP Right Cessation
- 1968-01-26 LU LU55356D patent/LU55356A1/xx unknown
- 1968-01-26 BE BE709964D patent/BE709964A/xx not_active IP Right Cessation
- 1968-01-26 YU YU0188/68A patent/YU32373B/xx unknown
- 1968-01-26 DK DK31668AA patent/DK119153B/da not_active IP Right Cessation
- 1968-01-26 SE SE01090/68A patent/SE346989B/xx unknown
- 1968-01-26 AT AT04324/69A patent/AT280248B/de active
- 1968-01-26 DE DE1668648A patent/DE1668648C3/de not_active Expired
- 1968-01-26 GB GB4326/68A patent/GB1164585A/en not_active Expired
- 1968-01-27 ES ES349842A patent/ES349842A1/es not_active Expired
- 1968-05-03 ES ES353484A patent/ES353484A1/es not_active Expired
- 1968-05-03 ES ES353485A patent/ES353485A1/es not_active Expired
-
1969
- 1969-01-06 SU SU1295338A patent/SU544364A3/ru active
-
1970
- 1970-03-24 DK DK151970AA patent/DK125550B/da not_active IP Right Cessation
-
1971
- 1971-10-07 NO NO03695/71*[A patent/NO126177B/no unknown
-
1973
- 1973-01-05 CY CY66873A patent/CY668A/xx unknown
- 1973-03-27 YU YU820/73A patent/YU34657B/xx unknown
- 1973-07-27 YU YU819/73A patent/YU34656B/xx unknown
- 1973-12-30 MY MY1343/73A patent/MY7300143A/xx unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NO125672B (enExample) | ||
| US4499299A (en) | Pharmaceutically active phenylcarboxylic acid derivatives | |
| KR20040017812A (ko) | 심장병 환자 및 대사 장애를 위한 갑상선 호르몬 수용체길항근ⅱ | |
| DK141063B (da) | Analogifremgangsmåde til fremstilling af 1-oxo-5-indanyloxyeddikesyrer eller salte deraf med baser. | |
| NO151137B (no) | Rengjoeringsredskap for stoevsuging | |
| NO162556B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive pyridylfenyl- og difenylforbindelser. | |
| NO173058B (no) | Analogifremgangsmaate for fremstilling av terapeutisk aktive kinolinderivater | |
| JPH0662500B2 (ja) | 抗アレルギ−剤 | |
| EP0008226B1 (en) | Phenyl-alkanoic acid derivatives, the preparation thereof and pharmaceutical compositions containing them | |
| NO773300L (no) | Fremgangsmaate for fremstilling av nye eddiksyrederivater | |
| JPS5973579A (ja) | ベンゾフラン又はベンゾチオフェン誘導体,この化合物を有効成分とする尿酸排泄剤及びその製造方法 | |
| Cragoe Jr et al. | The synthesis of 3-hydroxycinchoninic acid and certain of its derivatives | |
| NO131930B (enExample) | ||
| CS207785B2 (en) | Method of making the derivatives of the n-phenylalanine or n-phenylglycine | |
| Jacob III et al. | Sulfur analogues of psychotomimetic agents. Monothio analogs of mescaline and isomescaline | |
| JP6279773B2 (ja) | ロイコトリエン受容体拮抗薬として用いるシクロプロピル不飽和キノリン化合物及びその使用 | |
| US5250541A (en) | Kynurenic acid derivatives, their preparation and pharmaceutical compositions containing them | |
| JPS6040420B2 (ja) | 3−アミノ−2−(5−フルオル−及び5−メトキシ−1h−インド−ル−3−イル)プロパン酸誘導体類、その製法及び利用 | |
| Scartoni et al. | 2‐Phenylphthalimidine derivatives. A probable formation mechanism of adducts from 3‐benzylidenephthalide and aniline | |
| Newman et al. | The Synthesis and Ionization Constants of the Six Aminobenzo [c] phenanthrenes | |
| Bailey et al. | 282. Synthetical experiments in the chelidonine–sanguinarine group of the alkaloids. Part II | |
| MELTZER et al. | 4-(4'-Hydroxyphenoxy)-3-iodophenylacetic Acid and Iodinated Derivatives | |
| NO131507B (enExample) | ||
| US3920828A (en) | Substituted benzofurans | |
| JPS6270351A (ja) | 置換ジ−t−ブチルフエノ−ル類 |