NL192205C - Werkwijze voor het bereiden van 7-amino-3-(Z-1-propenyl)-3-cefem-4 -carbonzuur en esters daarvan. - Google Patents
Werkwijze voor het bereiden van 7-amino-3-(Z-1-propenyl)-3-cefem-4 -carbonzuur en esters daarvan. Download PDFInfo
- Publication number
- NL192205C NL192205C NL8601011A NL8601011A NL192205C NL 192205 C NL192205 C NL 192205C NL 8601011 A NL8601011 A NL 8601011A NL 8601011 A NL8601011 A NL 8601011A NL 192205 C NL192205 C NL 192205C
- Authority
- NL
- Netherlands
- Prior art keywords
- formula
- liters
- solution
- stirred
- mixture
- Prior art date
Links
- 238000004519 manufacturing process Methods 0.000 title claims description 3
- ZYLDQHILNOZKIF-AATZEOSQSA-N (6r)-7-amino-8-oxo-3-[(z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(\C=C/C)=C(C(O)=O)N2C(=O)C(N)[C@@H]12 ZYLDQHILNOZKIF-AATZEOSQSA-N 0.000 title description 3
- 150000002148 esters Chemical class 0.000 title description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 claims description 29
- 150000001875 compounds Chemical class 0.000 claims description 20
- 239000000203 mixture Substances 0.000 claims description 19
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 18
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 18
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 14
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 claims description 12
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 150000003839 salts Chemical class 0.000 claims description 10
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 125000006239 protecting group Chemical group 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 239000001257 hydrogen Substances 0.000 claims description 7
- 229910052739 hydrogen Inorganic materials 0.000 claims description 7
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 7
- 239000000126 substance Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- 239000000725 suspension Substances 0.000 claims description 6
- 239000013078 crystal Substances 0.000 claims description 5
- 229910052751 metal Chemical class 0.000 claims description 5
- 239000002184 metal Chemical class 0.000 claims description 5
- 239000012044 organic layer Substances 0.000 claims description 5
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- 125000005982 diphenylmethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 4
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 3
- 239000000706 filtrate Substances 0.000 claims description 3
- 238000004128 high performance liquid chromatography Methods 0.000 claims description 3
- 239000010410 layer Substances 0.000 claims description 3
- 238000002844 melting Methods 0.000 claims description 3
- 230000008018 melting Effects 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 3
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 2
- 239000000284 extract Substances 0.000 claims description 2
- 239000012430 organic reaction media Substances 0.000 claims description 2
- 238000003756 stirring Methods 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 claims 2
- 238000001816 cooling Methods 0.000 claims 2
- 239000012299 nitrogen atmosphere Substances 0.000 claims 2
- IFQUPKAISSPFTE-UHFFFAOYSA-N 4-benzoylbenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(=O)C1=CC=CC=C1 IFQUPKAISSPFTE-UHFFFAOYSA-N 0.000 claims 1
- XVMSFILGAMDHEY-UHFFFAOYSA-N 6-(4-aminophenyl)sulfonylpyridin-3-amine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=N1 XVMSFILGAMDHEY-UHFFFAOYSA-N 0.000 claims 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims 1
- 238000007605 air drying Methods 0.000 claims 1
- 239000006286 aqueous extract Substances 0.000 claims 1
- -1 vinyl cephalosporins Chemical class 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 239000000243 solution Substances 0.000 description 7
- 238000007239 Wittig reaction Methods 0.000 description 6
- 229940124587 cephalosporin Drugs 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 238000001914 filtration Methods 0.000 description 5
- 229930186147 Cephalosporin Natural products 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- UUFQTNFCRMXOAE-UHFFFAOYSA-N 1-methylmethylene Chemical compound C[CH] UUFQTNFCRMXOAE-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 101100167062 Caenorhabditis elegans chch-3 gene Proteins 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000012046 mixed solvent Substances 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- 239000003610 charcoal Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 239000008363 phosphate buffer Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000000453 2,2,2-trichloroethyl group Chemical group [H]C([H])(*)C(Cl)(Cl)Cl 0.000 description 1
- YSULOORXQBDPCU-UHFFFAOYSA-N 2-(trimethylazaniumyl)ethanehydrazonate;hydrochloride Chemical compound [Cl-].C[N+](C)(C)CC(=O)NN YSULOORXQBDPCU-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- GRMFXNQIRFLDLC-RQRXLDSQSA-M [(6R)-2-benzhydryloxycarbonyl-7-(benzylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl-triphenylphosphanium chloride Chemical compound [Cl-].C(C1=CC=CC=C1)=NC1[C@@H]2N(C(=C(CS2)C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O GRMFXNQIRFLDLC-RQRXLDSQSA-M 0.000 description 1
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000004849 alkoxymethyl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- AEECHDKJQFHHEH-YFVGKJKASA-N benzhydryl (6R)-7-(benzylideneamino)-8-oxo-3-[(triphenyl-lambda5-phosphanylidene)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound C(C1=CC=CC=C1)=NC1[C@@H]2N(C(=C(CS2)C=P(C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C(=O)OC(C2=CC=CC=C2)C2=CC=CC=C2)C1=O AEECHDKJQFHHEH-YFVGKJKASA-N 0.000 description 1
- HDYOATPRFNMLSX-ALAWQYECSA-N benzhydryl (6r)-7-amino-3-(chloromethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@@H]1C(C(N11)=O)N)CC(CCl)=C1C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 HDYOATPRFNMLSX-ALAWQYECSA-N 0.000 description 1
- KGHADALWBFAJHM-SOSCOHMFSA-N benzhydryl (6r)-7-amino-8-oxo-3-[(z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound S([C@H]1N2C(C1N)=O)CC(\C=C/C)=C2C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 KGHADALWBFAJHM-SOSCOHMFSA-N 0.000 description 1
- BZFZFEUVSJDIEZ-ICSMSXPMSA-N benzhydryl (6r)-7-amino-8-oxo-3-[(z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride Chemical compound Cl.S([C@H]1N2C(C1N)=O)CC(\C=C/C)=C2C(=O)OC(C=1C=CC=CC=1)C1=CC=CC=C1 BZFZFEUVSJDIEZ-ICSMSXPMSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- WDCDAAMJNUHOIY-UHFFFAOYSA-N ethyl acetate;2-propan-2-yloxypropane Chemical compound CCOC(C)=O.CC(C)OC(C)C WDCDAAMJNUHOIY-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 description 1
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 1
- VBQCHPIMZGQLAZ-UHFFFAOYSA-N phosphorane Chemical class [PH5] VBQCHPIMZGQLAZ-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- OODSAKPEXJRFOF-FQSXHJSUSA-M potassium;(6r,7r)-7-amino-8-oxo-3-[(z)-prop-1-enyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate Chemical compound [K+].S1CC(\C=C/C)=C(C([O-])=O)N2C(=O)[C@@H](N)[C@@H]12 OODSAKPEXJRFOF-FQSXHJSUSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000001981 tert-butyldimethylsilyl group Chemical group [H]C([H])([H])[Si]([H])(C([H])([H])[H])[*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000037 tert-butyldiphenylsilyl group Chemical group [H]C1=C([H])C([H])=C([H])C([H])=C1[Si]([H])([*]C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 150000003751 zinc Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/55—Design of synthesis routes, e.g. reducing the use of auxiliary or protecting groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US72587185A | 1985-04-22 | 1985-04-22 | |
| US72587185 | 1985-04-22 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| NL8601011A NL8601011A (nl) | 1986-11-17 |
| NL192205B NL192205B (nl) | 1996-11-01 |
| NL192205C true NL192205C (nl) | 1997-03-04 |
Family
ID=24916301
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| NL8601011A NL192205C (nl) | 1985-04-22 | 1986-04-21 | Werkwijze voor het bereiden van 7-amino-3-(Z-1-propenyl)-3-cefem-4 -carbonzuur en esters daarvan. |
Country Status (38)
| Country | Link |
|---|---|
| JP (1) | JPS61249989A (de) |
| KR (1) | KR860008189A (de) |
| CN (1) | CN1015714B (de) |
| AR (1) | AR242581A1 (de) |
| AT (1) | AT392072B (de) |
| AU (1) | AU589170B2 (de) |
| BE (1) | BE904646A (de) |
| CA (1) | CA1273629A (de) |
| CH (1) | CH671399A5 (de) |
| CS (1) | CS270435B2 (de) |
| CY (1) | CY1571A (de) |
| DD (1) | DD244557A5 (de) |
| DE (1) | DE3613365A1 (de) |
| DK (1) | DK163584C (de) |
| EG (1) | EG18001A (de) |
| ES (1) | ES8800236A1 (de) |
| FI (1) | FI84268C (de) |
| FR (1) | FR2580652B1 (de) |
| GB (1) | GB2173798B (de) |
| GR (1) | GR861065B (de) |
| HK (1) | HK106290A (de) |
| HU (1) | HU195223B (de) |
| IE (1) | IE59014B1 (de) |
| IT (1) | IT1228241B (de) |
| LU (1) | LU86402A1 (de) |
| MY (1) | MY100694A (de) |
| NL (1) | NL192205C (de) |
| NO (1) | NO164659C (de) |
| NZ (1) | NZ215717A (de) |
| OA (1) | OA08245A (de) |
| PT (1) | PT82436B (de) |
| SE (1) | SE500217C2 (de) |
| SG (1) | SG90890G (de) |
| SU (1) | SU1435155A3 (de) |
| YU (1) | YU43697B (de) |
| ZA (1) | ZA862985B (de) |
| ZM (1) | ZM4286A1 (de) |
| ZW (1) | ZW9086A1 (de) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4708955A (en) * | 1985-06-24 | 1987-11-24 | Bristol-Myers Company | 3-(substituted)propenyl-7-aminothiazol-ylcephalosporanic acids and esters thereof |
| US4870168A (en) * | 1987-02-26 | 1989-09-26 | Bristol-Myers Company | 3-Unsaturated alkyl cephems from 3-triflyl cephems |
| DE3933934A1 (de) * | 1989-10-03 | 1991-04-11 | Bayer Ag | Verfahren zur herstellung von 7-amino-3-((z)-1-propen-1-yl)-3-cephem-4-carbonsaeure |
| DE69231815T2 (de) * | 1991-03-08 | 2001-09-27 | Biochemie Ges.M.B.H., Kundl | Verfahren zur Herstellung von Cephalosporinen und Zwischenprodukte in diesem Verfahren |
| AT399876B (de) * | 1992-02-05 | 1995-08-25 | Biochemie Gmbh | Verfahren zur abreicherung von 7-amino-3-((e)-1- propen-1-yl)-3-cephem-4-carbonsäure |
| KR950700311A (ko) * | 1992-02-05 | 1995-01-16 | 게오르게스 그렐리니, 한스 루돌프하우스 | 3-세펨-4-카복실산 유도체의 정제방법(Process for the purification of a 3-cephem-4-carboxylic acid derivatives) |
| JPH07173168A (ja) * | 1993-07-14 | 1995-07-11 | Sumitomo Chem Co Ltd | セフェム系化合物、その製法、およびそれのセフェム系抗生物質製造への利用 |
| CN1711271A (zh) * | 2002-10-08 | 2005-12-21 | 兰贝克赛实验室有限公司 | 制备富含(z)-异构体的7-氨基-3-丙烯-1-基-3-头孢烯-4-羧酸的方法 |
| US7544797B2 (en) | 2003-10-30 | 2009-06-09 | Cj Cheiljedang Corporation | Processes for the preparation of cephem derivatives |
| JP4046708B2 (ja) * | 2004-06-04 | 2008-02-13 | 明治製菓株式会社 | 3−アルケニルセフェム化合物の製造方法 |
| EP1809638B1 (de) | 2004-11-01 | 2010-02-17 | Hetero Drugs Limited | Neues verfahren zur herstellung eines cefprozil-zwischenprodukts |
| CN103183686B (zh) * | 2011-12-30 | 2016-06-29 | 浙江新和成股份有限公司 | 7β-氨基-7α-甲氧基-3-头孢烯化合物的制备方法 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1342241A (en) * | 1970-01-23 | 1974-01-03 | Glaxo Lab Ltd | Cephalosporin compounds |
| US4110534A (en) * | 1970-01-23 | 1978-08-29 | Glaxo Laboratories Limited | Process for the preparation of 3-vinyl and substituted vinyl cephalosporins |
| US3769277A (en) * | 1970-01-23 | 1973-10-30 | Glaxo Lab Ltd | Preparation of delta3-4 carboxy cephalosporins having a 3-vinyl or substituted 3-vinyl group |
| US4065620A (en) * | 1971-06-14 | 1977-12-27 | Eli Lilly And Company | 3-(Substituted) vinyl cephalosporins |
| US4409214A (en) * | 1979-11-19 | 1983-10-11 | Fujisawa Pharmaceutical, Co., Ltd. | 7-Acylamino-3-vinylcephalosporanic acid derivatives and processes for the preparation thereof |
| US4520022A (en) * | 1983-01-28 | 1985-05-28 | Bristol-Myers Company | Substituted vinyl cephalosporins |
| AU566944B2 (en) * | 1983-10-07 | 1987-11-05 | Gist-Brocades N.V. | Preparation of 3-cephem derivatives |
-
1986
- 1986-03-21 FR FR8604051A patent/FR2580652B1/fr not_active Expired
- 1986-04-07 NZ NZ215717A patent/NZ215717A/xx unknown
- 1986-04-11 NO NO861430A patent/NO164659C/no unknown
- 1986-04-16 AU AU56168/86A patent/AU589170B2/en not_active Expired
- 1986-04-16 SU SU864027263A patent/SU1435155A3/ru active
- 1986-04-17 EG EG219/86A patent/EG18001A/xx active
- 1986-04-17 FI FI861634A patent/FI84268C/fi not_active IP Right Cessation
- 1986-04-18 AR AR86303699A patent/AR242581A1/es active
- 1986-04-18 CA CA000507037A patent/CA1273629A/en not_active Expired - Lifetime
- 1986-04-21 GB GB08609661A patent/GB2173798B/en not_active Expired
- 1986-04-21 SE SE8601825A patent/SE500217C2/sv not_active IP Right Cessation
- 1986-04-21 CN CN86102630A patent/CN1015714B/zh not_active Expired
- 1986-04-21 IE IE104886A patent/IE59014B1/en not_active IP Right Cessation
- 1986-04-21 DE DE19863613365 patent/DE3613365A1/de active Granted
- 1986-04-21 DD DD86289446A patent/DD244557A5/de unknown
- 1986-04-21 IT IT8620162A patent/IT1228241B/it active
- 1986-04-21 CH CH1601/86A patent/CH671399A5/de not_active IP Right Cessation
- 1986-04-21 OA OA58840D patent/OA08245A/xx unknown
- 1986-04-21 ZA ZA862985A patent/ZA862985B/xx unknown
- 1986-04-21 ES ES554215A patent/ES8800236A1/es not_active Expired
- 1986-04-21 LU LU86402A patent/LU86402A1/fr unknown
- 1986-04-21 BE BE0/216572A patent/BE904646A/fr not_active IP Right Cessation
- 1986-04-21 PT PT82436A patent/PT82436B/pt unknown
- 1986-04-21 ZM ZM42/86A patent/ZM4286A1/xx unknown
- 1986-04-21 NL NL8601011A patent/NL192205C/nl not_active IP Right Cessation
- 1986-04-21 CS CS862872A patent/CS270435B2/cs not_active IP Right Cessation
- 1986-04-21 HU HU861664A patent/HU195223B/hu unknown
- 1986-04-21 ZW ZW90/86A patent/ZW9086A1/xx unknown
- 1986-04-21 DK DK182486A patent/DK163584C/da not_active IP Right Cessation
- 1986-04-22 AT AT0106786A patent/AT392072B/de not_active IP Right Cessation
- 1986-04-22 JP JP61091419A patent/JPS61249989A/ja active Granted
- 1986-04-22 KR KR1019860003085A patent/KR860008189A/ko not_active Ceased
- 1986-04-22 GR GR861065A patent/GR861065B/el unknown
- 1986-04-22 YU YU659/86A patent/YU43697B/xx unknown
-
1987
- 1987-09-29 MY MYPI87002270A patent/MY100694A/en unknown
-
1990
- 1990-11-09 SG SG908/90A patent/SG90890G/en unknown
- 1990-12-18 HK HK1062/90A patent/HK106290A/xx not_active IP Right Cessation
-
1991
- 1991-12-20 CY CY1571A patent/CY1571A/en unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NL192205C (nl) | Werkwijze voor het bereiden van 7-amino-3-(Z-1-propenyl)-3-cefem-4 -carbonzuur en esters daarvan. | |
| CA1110231A (en) | 7.beta.-AMINO-CEPHAM-3-ONE-4-CARBOXYLIC ACIDS | |
| US4296236A (en) | 7-(or 6-) Substituted-7-(or 6-)acylimino cephalosporin (or penicillin) compounds | |
| IE43845B1 (en) | 4-thia-1-azabicyclo/4.2.0/oct-2-ene derivatives | |
| US4699979A (en) | 7-amino-3-propenylcephalosporanic acid and esters thereof | |
| US4122086A (en) | Isopenicillins | |
| US5925632A (en) | Derivatives of 3-pyrrolidylidene-2-one-cephalsporines | |
| US4139618A (en) | Cephalosporin type antibacterials | |
| US4888429A (en) | Process for producing allyl aminothiazole acetate intermediates | |
| FI75165B (fi) | Foerbaettrat foerfarande foer framstaellning av penicillansyraklormetylestrar. | |
| US4145540A (en) | 7β-Phosphoramido-7α-methoxycephalosporanic acid derivatives | |
| AU619201B2 (en) | Process for the preparation of 3-exomethylene cepham derivatives | |
| US4051129A (en) | Process for preparing 7-methoxycephalosporin compounds | |
| US4048155A (en) | Process for preparing 7 α-alkoxycephalosporin derivatives | |
| US4959495A (en) | Process for the preparation of intermediates used to produce aminothiazoloximino cephalosporins | |
| US4334063A (en) | Cephalosporin vinyl halides | |
| US4079179A (en) | 6-Loweralkoxy or loweralkylthio-3-cephem-4-carboxylic acids | |
| CA1052373A (en) | Cephalosporin and penicillin derivatives | |
| DE2455358A1 (de) | In 2-stellung thiosubstituierte cephalosporinsulfoxide | |
| US4558124A (en) | Preparation of cephalosporin intermediate compounds | |
| US4560750A (en) | Cephem compounds and process for preparing the same | |
| US4166904A (en) | ⊕-lactam containing compounds | |
| US3993758A (en) | Cephalosporin compounds | |
| US4299954A (en) | Cephalosporin vinyl halides | |
| US3991051A (en) | [(Oxyalkyl)thioacetyl]cephalosporin derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BA | A request for search or an international-type search has been filed | ||
| BB | A search report has been drawn up | ||
| BC | A request for examination has been filed | ||
| DNT | Communications of changes of names of applicants whose applications have been laid open to public inspection |
Free format text: BRISTOL-MYERS SQUIBB COMPANY |
|
| V4 | Discontinued because of reaching the maximum lifetime of a patent |
Effective date: 20060421 |