HU202177B - Process for hydroformylation by using slightly volatile phosphine ligands - Google Patents
Process for hydroformylation by using slightly volatile phosphine ligands Download PDFInfo
- Publication number
- HU202177B HU202177B HU875125A HU512587A HU202177B HU 202177 B HU202177 B HU 202177B HU 875125 A HU875125 A HU 875125A HU 512587 A HU512587 A HU 512587A HU 202177 B HU202177 B HU 202177B
- Authority
- HU
- Hungary
- Prior art keywords
- compound
- ligand
- organic
- hydroformylation
- formula
- Prior art date
Links
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 title claims abstract description 238
- 239000003446 ligand Substances 0.000 title claims abstract description 230
- 238000000034 method Methods 0.000 title claims abstract description 151
- 238000007037 hydroformylation reaction Methods 0.000 title claims abstract description 149
- 230000008569 process Effects 0.000 title claims abstract description 132
- 229910000073 phosphorus hydride Inorganic materials 0.000 title claims abstract description 119
- 229910052751 metal Inorganic materials 0.000 claims abstract description 116
- 239000002184 metal Substances 0.000 claims abstract description 116
- 150000003839 salts Chemical class 0.000 claims abstract description 115
- 239000003054 catalyst Substances 0.000 claims abstract description 109
- 239000012429 reaction media Substances 0.000 claims abstract description 59
- 229910002091 carbon monoxide Inorganic materials 0.000 claims abstract description 43
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 claims abstract description 42
- 239000001257 hydrogen Substances 0.000 claims abstract description 41
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 41
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 41
- 239000011574 phosphorus Substances 0.000 claims abstract description 41
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 38
- -1 alkaline earth metal cation Chemical class 0.000 claims abstract description 29
- 150000002894 organic compounds Chemical class 0.000 claims abstract description 27
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 8
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 7
- 150000001299 aldehydes Chemical class 0.000 claims description 159
- 239000002253 acid Substances 0.000 claims description 113
- 239000000047 product Substances 0.000 claims description 104
- 239000002904 solvent Substances 0.000 claims description 96
- 239000010948 rhodium Substances 0.000 claims description 76
- 229910052703 rhodium Inorganic materials 0.000 claims description 69
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 68
- 150000001875 compounds Chemical class 0.000 claims description 65
- 239000000203 mixture Substances 0.000 claims description 65
- 238000006243 chemical reaction Methods 0.000 claims description 61
- 150000003624 transition metals Chemical class 0.000 claims description 47
- 239000007788 liquid Substances 0.000 claims description 42
- 229910052723 transition metal Inorganic materials 0.000 claims description 39
- 125000002947 alkylene group Chemical group 0.000 claims description 36
- 239000007789 gas Substances 0.000 claims description 33
- 150000001336 alkenes Chemical class 0.000 claims description 32
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 27
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 27
- DAFHKNAQFPVRKR-UHFFFAOYSA-N (3-hydroxy-2,2,4-trimethylpentyl) 2-methylpropanoate Chemical compound CC(C)C(O)C(C)(C)COC(=O)C(C)C DAFHKNAQFPVRKR-UHFFFAOYSA-N 0.000 claims description 24
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 22
- 230000036961 partial effect Effects 0.000 claims description 21
- 239000007858 starting material Substances 0.000 claims description 21
- 239000002736 nonionic surfactant Substances 0.000 claims description 20
- 239000006227 byproduct Substances 0.000 claims description 19
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 claims description 18
- 238000009833 condensation Methods 0.000 claims description 18
- 230000005494 condensation Effects 0.000 claims description 18
- 239000004711 α-olefin Substances 0.000 claims description 18
- 238000009835 boiling Methods 0.000 claims description 16
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 14
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 claims description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 11
- 239000011734 sodium Chemical group 0.000 claims description 11
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical group C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 10
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 10
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 10
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 9
- 239000003085 diluting agent Substances 0.000 claims description 9
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 8
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical group [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 7
- 229910052744 lithium Inorganic materials 0.000 claims description 7
- 239000003960 organic solvent Substances 0.000 claims description 7
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 claims description 6
- 239000011575 calcium Substances 0.000 claims description 6
- 229920001451 polypropylene glycol Polymers 0.000 claims description 6
- 229910052701 rubidium Chemical group 0.000 claims description 6
- IGLNJRXAVVLDKE-UHFFFAOYSA-N rubidium atom Chemical group [Rb] IGLNJRXAVVLDKE-UHFFFAOYSA-N 0.000 claims description 6
- 229910001413 alkali metal ion Inorganic materials 0.000 claims description 5
- 229910001420 alkaline earth metal ion Inorganic materials 0.000 claims description 5
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 claims description 5
- 239000004094 surface-active agent Substances 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical group [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical group [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 4
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical group [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052792 caesium Inorganic materials 0.000 claims description 4
- TVFDJXOCXUVLDH-UHFFFAOYSA-N caesium atom Chemical group [Cs] TVFDJXOCXUVLDH-UHFFFAOYSA-N 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 239000011591 potassium Chemical group 0.000 claims description 4
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 claims description 4
- 239000013638 trimer Substances 0.000 claims description 4
- 229910052788 barium Inorganic materials 0.000 claims description 3
- 229910052791 calcium Inorganic materials 0.000 claims description 3
- 150000002314 glycerols Chemical class 0.000 claims description 3
- 229910021645 metal ion Inorganic materials 0.000 claims description 3
- 230000000737 periodic effect Effects 0.000 claims description 3
- 229910052712 strontium Chemical group 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical group [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical group [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Chemical group 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims 3
- 150000001344 alkene derivatives Chemical class 0.000 claims 1
- ZEDPQIJYJCPIRM-UHFFFAOYSA-N dimethyl benzonitrile Natural products CC1=CC=CC(C#N)=C1C ZEDPQIJYJCPIRM-UHFFFAOYSA-N 0.000 claims 1
- 230000003134 recirculating effect Effects 0.000 claims 1
- 125000004436 sodium atom Chemical group 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 abstract description 11
- 230000006872 improvement Effects 0.000 abstract description 4
- 229910052783 alkali metal Inorganic materials 0.000 abstract description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 abstract description 3
- 230000007704 transition Effects 0.000 abstract description 3
- 125000002485 formyl group Chemical class [H]C(*)=O 0.000 abstract 2
- 125000002877 alkyl aryl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 150000001768 cations Chemical class 0.000 abstract 1
- 239000000243 solution Substances 0.000 description 43
- 229920001223 polyethylene glycol Polymers 0.000 description 38
- 239000012018 catalyst precursor Substances 0.000 description 26
- GYHFUZHODSMOHU-UHFFFAOYSA-N nonanal Chemical compound CCCCCCCCC=O GYHFUZHODSMOHU-UHFFFAOYSA-N 0.000 description 26
- FVEFRICMTUKAML-UHFFFAOYSA-M sodium tetradecyl sulfate Chemical compound [Na+].CCCCC(CC)CCC(CC(C)C)OS([O-])(=O)=O FVEFRICMTUKAML-UHFFFAOYSA-M 0.000 description 25
- 229910052705 radium Inorganic materials 0.000 description 23
- HCWPIIXVSYCSAN-UHFFFAOYSA-N radium atom Chemical compound [Ra] HCWPIIXVSYCSAN-UHFFFAOYSA-N 0.000 description 23
- 239000011541 reaction mixture Substances 0.000 description 21
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 20
- 159000000000 sodium salts Chemical class 0.000 description 19
- KWKAKUADMBZCLK-UHFFFAOYSA-N 1-octene Chemical compound CCCCCCC=C KWKAKUADMBZCLK-UHFFFAOYSA-N 0.000 description 17
- 229920002582 Polyethylene Glycol 600 Polymers 0.000 description 16
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 15
- GGRQQHADVSXBQN-FGSKAQBVSA-N carbon monoxide;(z)-4-hydroxypent-3-en-2-one;rhodium Chemical group [Rh].[O+]#[C-].[O+]#[C-].C\C(O)=C\C(C)=O GGRQQHADVSXBQN-FGSKAQBVSA-N 0.000 description 15
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 14
- CRSBERNSMYQZNG-UHFFFAOYSA-N 1-dodecene Chemical compound CCCCCCCCCCC=C CRSBERNSMYQZNG-UHFFFAOYSA-N 0.000 description 12
- BYGQBDHUGHBGMD-UHFFFAOYSA-N 2-methylbutanal Chemical compound CCC(C)C=O BYGQBDHUGHBGMD-UHFFFAOYSA-N 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 9
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 8
- 150000003983 crown ethers Chemical class 0.000 description 8
- 238000004821 distillation Methods 0.000 description 8
- 239000010410 layer Substances 0.000 description 8
- 238000004519 manufacturing process Methods 0.000 description 8
- TVMXDCGIABBOFY-UHFFFAOYSA-N n-Octanol Natural products CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 238000010924 continuous production Methods 0.000 description 7
- 239000001893 (2R)-2-methylbutanal Substances 0.000 description 6
- 150000001298 alcohols Chemical class 0.000 description 6
- 125000004429 atom Chemical group 0.000 description 6
- 229940069096 dodecene Drugs 0.000 description 6
- 239000012263 liquid product Substances 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 229920000233 poly(alkylene oxides) Polymers 0.000 description 6
- 229920005862 polyol Polymers 0.000 description 6
- 150000003077 polyols Chemical class 0.000 description 6
- 230000007928 solubilization Effects 0.000 description 6
- 238000005063 solubilization Methods 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 6
- 230000008901 benefit Effects 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 230000002411 adverse Effects 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 230000008859 change Effects 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 238000001704 evaporation Methods 0.000 description 4
- 230000008020 evaporation Effects 0.000 description 4
- 150000002334 glycols Chemical class 0.000 description 4
- 238000011065 in-situ storage Methods 0.000 description 4
- 230000004048 modification Effects 0.000 description 4
- 238000012986 modification Methods 0.000 description 4
- 125000004430 oxygen atom Chemical group O* 0.000 description 4
- 238000000926 separation method Methods 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- BGEHHAVMRVXCGR-UHFFFAOYSA-N tridecanal Chemical compound CCCCCCCCCCCCC=O BGEHHAVMRVXCGR-UHFFFAOYSA-N 0.000 description 4
- ILPBINAXDRFYPL-UHFFFAOYSA-N 2-octene Chemical compound CCCCCC=CC ILPBINAXDRFYPL-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000001450 anions Chemical class 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012530 fluid Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000002243 precursor Substances 0.000 description 3
- 238000004064 recycling Methods 0.000 description 3
- 229910001220 stainless steel Inorganic materials 0.000 description 3
- 239000010935 stainless steel Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 2
- HFDVRLIODXPAHB-UHFFFAOYSA-N 1-tetradecene Chemical compound CCCCCCCCCCCCC=C HFDVRLIODXPAHB-UHFFFAOYSA-N 0.000 description 2
- ISZREKMLQKLUDD-UHFFFAOYSA-N 2-methyldodecanal Chemical compound CCCCCCCCCCC(C)C=O ISZREKMLQKLUDD-UHFFFAOYSA-N 0.000 description 2
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- NBBJYMSMWIIQGU-UHFFFAOYSA-N Propionic aldehyde Chemical compound CCC=O NBBJYMSMWIIQGU-UHFFFAOYSA-N 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 230000002860 competitive effect Effects 0.000 description 2
- 125000004122 cyclic group Chemical group 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- ZUBZATZOEPUUQF-UHFFFAOYSA-N isononane Chemical compound CCCCCCC(C)C ZUBZATZOEPUUQF-UHFFFAOYSA-N 0.000 description 2
- 229910003002 lithium salt Inorganic materials 0.000 description 2
- 159000000002 lithium salts Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 239000013110 organic ligand Substances 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 150000003003 phosphines Chemical group 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 230000036632 reaction speed Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 230000003381 solubilizing effect Effects 0.000 description 2
- HHVIBTZHLRERCL-UHFFFAOYSA-N sulfonyldimethane Chemical compound CS(C)(=O)=O HHVIBTZHLRERCL-UHFFFAOYSA-N 0.000 description 2
- HIFJUMGIHIZEPX-UHFFFAOYSA-N sulfuric acid;sulfur trioxide Chemical compound O=S(=O)=O.OS(O)(=O)=O HIFJUMGIHIZEPX-UHFFFAOYSA-N 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 1
- VFTFKUDGYRBSAL-UHFFFAOYSA-N 15-crown-5 Chemical compound C1COCCOCCOCCOCCO1 VFTFKUDGYRBSAL-UHFFFAOYSA-N 0.000 description 1
- 150000003990 18-crown-6 derivatives Chemical class 0.000 description 1
- JCTXKRPTIMZBJT-UHFFFAOYSA-N 2,2,4-trimethylpentane-1,3-diol Chemical compound CC(C)C(O)C(C)(C)CO JCTXKRPTIMZBJT-UHFFFAOYSA-N 0.000 description 1
- CYIFVRUOHKNECG-UHFFFAOYSA-N 2-Tridecanone Natural products CCCCCCCCCCCC(C)=O CYIFVRUOHKNECG-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- XIKBVZQSTQVYMV-UHFFFAOYSA-N CCCCCCCCC=O.CCCCCCCCCCCC(C)=O Chemical compound CCCCCCCCC=O.CCCCCCCCCCCC(C)=O XIKBVZQSTQVYMV-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 229920002176 Pluracol® Polymers 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 229910000272 alkali metal oxide Inorganic materials 0.000 description 1
- 229910001860 alkaline earth metal hydroxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 159000000009 barium salts Chemical class 0.000 description 1
- 229910002056 binary alloy Inorganic materials 0.000 description 1
- 239000007853 buffer solution Substances 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 238000005810 carbonylation reaction Methods 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 150000004696 coordination complex Chemical class 0.000 description 1
- ZXKWUYWWVSKKQZ-UHFFFAOYSA-N cyclohexyl(diphenyl)phosphane Chemical compound C1CCCCC1P(C=1C=CC=CC=1)C1=CC=CC=C1 ZXKWUYWWVSKKQZ-UHFFFAOYSA-N 0.000 description 1
- 230000009089 cytolysis Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- VPLLTGLLUHLIHA-UHFFFAOYSA-N dicyclohexyl(phenyl)phosphane Chemical compound C1CCCCC1P(C=1C=CC=CC=1)C1CCCCC1 VPLLTGLLUHLIHA-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000009977 dual effect Effects 0.000 description 1
- 239000003792 electrolyte Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 230000000670 limiting effect Effects 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012685 metal catalyst precursor Substances 0.000 description 1
- 238000003808 methanol extraction Methods 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100000989 no adverse effect Toxicity 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007523 nucleic acids Chemical class 0.000 description 1
- 102000039446 nucleic acids Human genes 0.000 description 1
- 108020004707 nucleic acids Proteins 0.000 description 1
- 238000005457 optimization Methods 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- OFPXSFXSNFPTHF-UHFFFAOYSA-N oxaprozin Chemical compound O1C(CCC(=O)O)=NC(C=2C=CC=CC=2)=C1C1=CC=CC=C1 OFPXSFXSNFPTHF-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000005086 pumping Methods 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000009877 rendering Methods 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- VXNYVYJABGOSBX-UHFFFAOYSA-N rhodium(3+);trinitrate Chemical compound [Rh+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O VXNYVYJABGOSBX-UHFFFAOYSA-N 0.000 description 1
- 150000003297 rubidium Chemical class 0.000 description 1
- 159000000005 rubidium salts Chemical class 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- VYFPSYVVFFFYBF-UHFFFAOYSA-N sodium;triphenylphosphane Chemical class [Na].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 VYFPSYVVFFFYBF-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- UUCCCPNEFXQJEL-UHFFFAOYSA-L strontium dihydroxide Chemical compound [OH-].[OH-].[Sr+2] UUCCCPNEFXQJEL-UHFFFAOYSA-L 0.000 description 1
- 229910001866 strontium hydroxide Inorganic materials 0.000 description 1
- 238000006277 sulfonation reaction Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 229910000045 transition metal hydride Inorganic materials 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- GPRLSGONYQIRFK-MNYXATJNSA-N triton Chemical compound [3H+] GPRLSGONYQIRFK-MNYXATJNSA-N 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/52—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings
- C07C47/55—Compounds having —CHO groups bound to carbon atoms of six—membered aromatic rings containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/49—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide
- C07C45/50—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with carbon monoxide by oxo-reactions
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P20/00—Technologies relating to chemical industry
- Y02P20/50—Improvements relating to the production of bulk chemicals
- Y02P20/582—Recycling of unreacted starting or intermediate materials
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US06/932,002 US4731486A (en) | 1986-11-18 | 1986-11-18 | Hydroformylation using low volatile phosphine ligands |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| HUT45729A HUT45729A (en) | 1988-08-29 |
| HU202177B true HU202177B (en) | 1991-02-28 |
Family
ID=25461633
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU875125A HU202177B (en) | 1986-11-18 | 1987-11-18 | Process for hydroformylation by using slightly volatile phosphine ligands |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US4731486A (forum.php) |
| EP (1) | EP0268268B1 (forum.php) |
| JP (1) | JPH0667868B2 (forum.php) |
| KR (1) | KR920003556B1 (forum.php) |
| CN (1) | CN1017145B (forum.php) |
| AR (1) | AR248390A1 (forum.php) |
| AT (1) | ATE77075T1 (forum.php) |
| AU (1) | AU611867B2 (forum.php) |
| BE (1) | BE1000619A5 (forum.php) |
| BR (1) | BR8706223A (forum.php) |
| CA (1) | CA1307296C (forum.php) |
| DE (2) | DE3739064A1 (forum.php) |
| DK (1) | DK605887A (forum.php) |
| ES (3) | ES2009221A6 (forum.php) |
| FI (1) | FI90858C (forum.php) |
| FR (1) | FR2606771B1 (forum.php) |
| GB (1) | GB2197867B (forum.php) |
| HU (1) | HU202177B (forum.php) |
| IN (1) | IN170369B (forum.php) |
| IT (1) | IT1223147B (forum.php) |
| MX (1) | MX166784B (forum.php) |
| NL (1) | NL8702752A (forum.php) |
| NO (1) | NO166440C (forum.php) |
| PL (1) | PL153062B1 (forum.php) |
| RU (1) | RU2002728C1 (forum.php) |
| SE (1) | SE8704533L (forum.php) |
| YU (1) | YU45074B (forum.php) |
| ZA (1) | ZA878638B (forum.php) |
Families Citing this family (85)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| PT91162B (pt) * | 1988-07-14 | 1995-03-01 | Union Carbide Chem Plastic | Processo para a separacao do aldeido produzido, do catalisador usado na reaccao de hidroformilacao |
| KR950000633B1 (ko) * | 1988-07-14 | 1995-01-26 | 유니온 카바이드 케미칼즈 앤드 플라스틱스 캄파니 인코포레이티드 | 알콜 및 알데하이드의 제조방법 |
| US5180854A (en) * | 1988-07-14 | 1993-01-19 | Union Carbide Chemicals & Plastics Technology Corporation | Process for catalyst aldehyde product separation |
| US5059710A (en) * | 1988-08-05 | 1991-10-22 | Union Carbide Chemicals And Plastics Technology Corporation | Ionic phosphites and their use in homogeneous transition metal catalyzed processes |
| US5113022A (en) * | 1988-08-05 | 1992-05-12 | Union Carbide Chemicals & Plastics Technology Corporation | Ionic phosphites used in homogeneous transition metal catalyzed processes |
| US4965404A (en) * | 1989-03-09 | 1990-10-23 | Kuraray Company, Ltd. | Process for the preparation of lithium diphenylphosphinobenzene-m-monosulfonate |
| DE3942954A1 (de) * | 1989-12-23 | 1991-06-27 | Hoechst Ag | Verfahren zur herstellung von aldehyden |
| CA2090402A1 (en) * | 1990-08-31 | 1992-03-01 | Ronald George Cavell | Carbonylation of methanol using a novel transition metal catalyst precursor |
| US5087763A (en) * | 1990-11-09 | 1992-02-11 | Union Carbide Chemicals & Plastics Technology Corporation | Hydroformylation process |
| US5215667A (en) * | 1991-08-20 | 1993-06-01 | Exxon Chemical Patents Inc. | Method for separating water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5288818A (en) * | 1991-08-20 | 1994-02-22 | Exxon Chemical Patents Inc. | Method for separating a water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction |
| US5196596A (en) * | 1991-12-26 | 1993-03-23 | Union Carbide Chemicals & Plastics Technology Corporation | Higher aldehyde separation process |
| US5300617A (en) * | 1993-01-21 | 1994-04-05 | Exxon Chemical Patents Inc. | Potassium para-diphenyl phosphino benzene sulfonate ligand |
| DE4400837A1 (de) * | 1994-01-14 | 1995-07-20 | Basf Ag | Verfahren zur Herstellung von n-Butyraldehyd und/oder n-Butanol |
| US6143211A (en) * | 1995-07-21 | 2000-11-07 | Brown University Foundation | Process for preparing microparticles through phase inversion phenomena |
| DE19532393A1 (de) * | 1995-09-02 | 1997-03-06 | Hoechst Ag | Verfahren zur Hydroformylierung olefinisch ungesättigter Verbindungen |
| EP0805139B1 (en) * | 1995-09-26 | 2000-04-26 | Kuraray Co., Ltd. | Hydroformylation method |
| DE19700805C1 (de) * | 1997-01-13 | 1998-08-06 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung olefinischer Verbindungen mit 3 bis 5 Kohlenstoffatomen in Anwesenheit einer Rhodium und sulfonierte Triarylphosphine als Katalysator enthhaltenden wäßrigen Phase |
| DE19700804C1 (de) * | 1997-01-13 | 1998-08-06 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung olefinischer Verbindungen mit 6 bis 16 Kohlenstoffatomen in Anwesenheit einer Rhodium und sulfonierte Triarylphosphine als Katalysator enthaltenden wäßrigen Phase |
| DE19742305A1 (de) * | 1997-09-25 | 1999-04-01 | Hoechst Ag | Verfahren zur Herstellung von Aldehyden durch Hydroformylierung in Gegenwart von Kronenether |
| DE10034360A1 (de) * | 2000-07-14 | 2002-01-24 | Oxeno Olefinchemie Gmbh | Mehrstufiges Verfahren zur Herstellung von Oxo-Aldehyden und/oder Alkoholen |
| FI20002807A0 (fi) * | 2000-09-05 | 2000-12-20 | Neste Chemicals Oy | Menetelmä alkeenien hydroformyloimiseksi |
| WO2002100872A1 (fr) * | 2001-06-07 | 2002-12-19 | Kuraray Co., Ltd. | P-diarylphosphinobenzenesulfonates de lithium, procede de preparation et utilisation de ces composes |
| US6746635B2 (en) * | 2001-08-08 | 2004-06-08 | Brown University Research Foundation | Methods for micronization of hydrophobic drugs |
| AU2002360549A1 (en) * | 2001-12-10 | 2003-06-23 | Spherics, Inc. | Methods and products useful in the formation and isolation of microparticles |
| ATE468318T1 (de) * | 2003-04-25 | 2010-06-15 | Dow Global Technologies Inc | Von samenölen abgeleitete aldehyd- und alkoholzusammensetzungen |
| KR100547587B1 (ko) * | 2004-06-12 | 2006-01-31 | 주식회사 엘지화학 | 인을 포함하는 촉매 조성물 및 이를 이용한히드로포르밀화 방법 |
| KR101225353B1 (ko) * | 2004-10-25 | 2013-01-22 | 다우 글로벌 테크놀로지스 엘엘씨 | 식물성 오일-기재 히드록시-함유 물질로부터 제조된 중합체폴리올 및 중합체 분산액 |
| CA2579511C (en) * | 2004-10-25 | 2013-12-17 | Hanno R. Van Der Wal | Polyurethanes made from hydroxy-methyl containing fatty acids or alkyl esters of such fatty acids |
| WO2006047434A1 (en) * | 2004-10-25 | 2006-05-04 | Dow Global Technologies, Inc. | Prepolymers made from hydroxmethyl-containing polyester polyols derived from fatty acids |
| US7053253B1 (en) * | 2005-05-02 | 2006-05-30 | 3M Innovative Properties Company | Process for purifying hexafluoropropene dimers |
| EP1926740B1 (en) * | 2005-09-15 | 2010-08-11 | Dow Global Technologies Inc. | Process for the monosulfonation of aromatic phosphines, and zwitterionic product derived therefrom |
| CN100526279C (zh) * | 2006-04-11 | 2009-08-12 | 中国科学院兰州化学物理研究所 | 连续制备正戊醛的工艺过程 |
| BRPI0710853A2 (pt) * | 2006-05-15 | 2011-05-17 | Dow Global Technologies Inc | processo de hidroformilação não aquoso |
| AU2007297828B2 (en) * | 2006-09-21 | 2013-06-27 | Dow Brasil Sudeste Industrial Ltda. | Viscoelastic foams having high air flow |
| EP1918247A1 (en) * | 2006-10-18 | 2008-05-07 | Ecole Polytechnique Fédérale de Lausanne (EPFL) | Hydrogen production from formic acid |
| US20100087350A1 (en) * | 2007-04-09 | 2010-04-08 | Sonnenschein Mark F | Capped polyester polyol lubricant composition |
| BRPI0809845A2 (pt) * | 2007-04-27 | 2014-09-23 | Dow Global Technologies Inc | "composição polimérica, processo para produzir revestimento adesivo ou ligante, revestimento adesivo, ligante ou suas combinações, artigo e substrato revestido" |
| WO2008144224A1 (en) * | 2007-05-15 | 2008-11-27 | Dow Global Technologies Inc. | High resilience foams |
| WO2008156993A2 (en) * | 2007-06-13 | 2008-12-24 | Dow Global Technologies Inc. | Extraction process for aldehyde product separation and catalyst recovery |
| CN101802039A (zh) * | 2007-07-12 | 2010-08-11 | 陶氏环球技术公司 | 弹性体的预聚物和聚合物 |
| WO2009009654A1 (en) * | 2007-07-12 | 2009-01-15 | Dow Global Technologies Inc. | Room temperature curable polymers and precursors thereof |
| US8535476B2 (en) * | 2007-08-01 | 2013-09-17 | Dow Global Technologies Llc | Heat bonding polyurethane foams |
| US8466306B2 (en) * | 2008-01-15 | 2013-06-18 | Dow Global Technologies Llc | Sulfonated organophosphine compounds and use in hydroformylation processes |
| EP2231683B1 (en) * | 2008-01-15 | 2016-03-23 | Dow Global Technologies LLC | Sulfonated organophosphine compounds and use thereof in hydroformylation processes |
| US8394978B2 (en) * | 2008-01-15 | 2013-03-12 | Dow Global Technologies Llc | Sulfonated organophosphine compounds and use thereof in hydroformylation processes |
| BRPI0908697A2 (pt) * | 2008-05-09 | 2019-02-26 | Dow Global Technologies Inc | mistura de poliol à base de óleo natural, espuma de poliuretano flexível e método para produzir uma espuma de poliuretano |
| WO2011011587A2 (en) | 2009-07-22 | 2011-01-27 | Dow Global Technologies Inc. | Natural oil based polyurethane foams |
| ES2437749T3 (es) | 2009-12-03 | 2014-01-14 | Dow Global Technologies Llc | Decoloración de polioles |
| US9080003B2 (en) | 2009-12-08 | 2015-07-14 | Dow Global Technologies Llc | Process to prepare open cell foams made with natural oil based polyols and poly(propylene oxide) polyols |
| CN102770502A (zh) | 2009-12-21 | 2012-11-07 | 陶氏环球技术有限责任公司 | 用于绝缘玻璃单元的基于聚氨酯的密封剂 |
| PL2516372T5 (pl) * | 2009-12-22 | 2020-08-10 | Dow Technology Investments Llc | Regulowanie stosunku aldehyd normalny : izoaldehyd w procesie hydroformowania z mieszanymi ligandami przez regulowanie ciśnienia cząsteczkowego gazu syntezowego |
| US20130005900A1 (en) | 2010-03-12 | 2013-01-03 | Dow Global Technologies Llc | Gels and soft elastomers made with natural oil based polyols |
| EP2545094A1 (en) | 2010-03-12 | 2013-01-16 | Dow Global Technologies LLC | Elastomer binding materials made with natural oil based polyols |
| EP2552990B1 (en) | 2010-03-31 | 2017-04-19 | Dow Global Technologies LLC | Polyurethane/polyurea spray elastomers |
| BR112012026146A2 (pt) | 2010-04-14 | 2016-06-28 | Dow Global Technologies Llc | policarbonato poliol e produto de poliuretano |
| EP2585507A1 (en) | 2010-06-22 | 2013-05-01 | Dow Global Technologies LLC | Curable silyl polymers |
| US8822626B2 (en) | 2010-06-30 | 2014-09-02 | Dow Global Technologies Llc | Silyl-terminated polymers |
| ITMI20101380A1 (it) | 2010-07-27 | 2012-01-28 | Dow Global Technologies Inc | Pannello composito poliuretanico a basso impatto ambientale |
| PL2638090T3 (pl) | 2010-11-11 | 2015-07-31 | Dow Global Technologies Llc | Szczeliwo do szyb zespolonych na bazie poliuretanu |
| CN103562251A (zh) | 2011-03-31 | 2014-02-05 | 陶氏环球技术有限责任公司 | 用于聚氨酯应用的疏水性聚酯聚碳酸酯多元醇 |
| CN102826974B (zh) * | 2011-06-17 | 2015-11-25 | 中国石油化工股份有限公司 | 一种丙烯氢甲酰化反应制备丁醛的方法 |
| WO2013003051A2 (en) | 2011-06-30 | 2013-01-03 | Dow Global Technologies Llc | Silane terminated polycarbonate-polyester copolymers for coating, adhesives, sealant and elastomer applications |
| WO2014047531A1 (en) | 2012-09-24 | 2014-03-27 | Exxonmobil Chemical Patents Inc. | Hydroamination of aldehyde-containing macromonomers |
| WO2014047256A1 (en) * | 2012-09-24 | 2014-03-27 | Exxonmobil Chemical Patents Inc. | Catalytic hydroformylation of vinyl terminated polyolefins |
| US9546307B2 (en) | 2012-09-26 | 2017-01-17 | Dow Global Technologies Llc | Polyurethane based insulated glass sealant |
| CN104045532B (zh) | 2013-03-15 | 2018-05-25 | 陶氏技术投资有限责任公司 | 加氢甲酰化方法 |
| CA2928807C (en) | 2013-10-28 | 2023-03-21 | Rohm And Haas Company | Process for separating methacrolein |
| RU2561171C1 (ru) * | 2014-09-12 | 2015-08-27 | Открытое акционерное общество "Нефтяная компания "Роснефть" | Способ непрерывного двухступенчатого гидроформилирования олефинов с3, с4 и технологическая установка для его осуществления |
| WO2017160956A1 (en) | 2016-03-18 | 2017-09-21 | Dow Technology Investments Llc | Hydroformylation process |
| KR102602120B1 (ko) | 2017-05-25 | 2023-11-14 | 롬 앤드 하아스 컴패니 | 메타크롤레인의 제조 방법 |
| EP3630711B1 (en) | 2017-05-25 | 2021-03-17 | Rohm and Haas Company | Process for preparing methacrolein |
| US20250250222A1 (en) | 2021-10-08 | 2025-08-07 | Rohm And Haas Company | Process for an oxidative esterification reactor |
| JP2024535412A (ja) | 2021-10-08 | 2024-09-30 | ダウ グローバル テクノロジーズ エルエルシー | メタクリル酸の製造のための方法 |
| EP4412981A1 (en) | 2021-10-08 | 2024-08-14 | Dow Global Technologies LLC | Process for low byproduct formation from an oxidative esterification reactor with base addition |
| MX2024004169A (es) | 2021-10-08 | 2024-04-23 | Rohm & Haas | Proceso para la produccion de metacrilato de alquilo. |
| US20240409491A1 (en) | 2021-10-08 | 2024-12-12 | Rohm And Haas Company | Process for methyl methacrylate production |
| WO2023059679A1 (en) | 2021-10-08 | 2023-04-13 | Rohm And Haas Company | Process for methyl methacrylate production from ethanol |
| US20250002443A1 (en) | 2021-10-08 | 2025-01-02 | Rohm And Haas Company | Process for low byproduct formation of methyl methacrylate from an oxidative esterification reactor |
| CA3233794A1 (en) | 2021-10-08 | 2023-04-13 | Rohm And Haas Company | Process for methyl methacrylate production |
| KR20250116032A (ko) | 2022-12-08 | 2025-07-31 | 다우 글로벌 테크놀로지스 엘엘씨 | 알킬 메타크릴레이트를 제조하는 방법 |
| EP4605365A1 (en) | 2022-12-08 | 2025-08-27 | Rohm and Haas Company | Process for concurrent methyl methacrylate and methacrylic acid production |
| GB202307175D0 (en) | 2023-05-15 | 2023-06-28 | Johnson Matthey Davy Technologies Ltd | Process for hydrogenating a substrate |
| CN116606197B (zh) * | 2023-05-29 | 2025-05-06 | 国家能源集团宁夏煤业有限责任公司 | 费托油氢甲酰化反应制备醛的方法和产品 |
| GB202404300D0 (en) | 2024-03-26 | 2024-05-08 | Johnson Matthey Davy Technologies Ltd | Process for the production of 2-alkylalkanol |
Family Cites Families (45)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US31812A (en) * | 1861-03-26 | Stump-extractor | ||
| US3527809A (en) * | 1967-08-03 | 1970-09-08 | Union Carbide Corp | Hydroformylation process |
| BE758502A (fr) * | 1969-11-06 | 1971-05-05 | Basf Ag | Preparation d'alcools et d'aldehydes |
| NL7106084A (forum.php) * | 1970-05-06 | 1971-11-09 | ||
| US3968136A (en) * | 1974-07-12 | 1976-07-06 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US4159999A (en) * | 1974-11-22 | 1979-07-03 | Celanese Corporation | Hydroformylation of olefins |
| US4148830A (en) * | 1975-03-07 | 1979-04-10 | Union Carbide Corporation | Hydroformylation of olefins |
| US3984478A (en) * | 1975-05-27 | 1976-10-05 | Universal Oil Products Company | Hydroformylation process |
| US4248802A (en) | 1975-06-20 | 1981-02-03 | Rhone-Poulenc Industries | Catalytic hydroformylation of olefins |
| US4247486A (en) * | 1977-03-11 | 1981-01-27 | Union Carbide Corporation | Cyclic hydroformylation process |
| FR2351077A1 (fr) * | 1976-05-13 | 1977-12-09 | Celanese Corp | Procede perfectionne d'hydroformylation des olefines avec un catalyseur complexe au rhodium |
| US4162261A (en) * | 1976-09-29 | 1979-07-24 | Union Carbide Corporation | Novel solvents for the catalytic process for making polyhydric alcohols |
| ZA78146B (en) * | 1977-01-25 | 1978-12-27 | Union Carbide Corp | Improved hydroformylation process |
| US4211719A (en) * | 1978-02-13 | 1980-07-08 | Union Carbide Corporation | Catalytic process for polyhydric alcohols and derivatives |
| US4306084A (en) * | 1978-12-06 | 1981-12-15 | The University Of Texas | Alcohol and aldehyde production using ruthenium carbonyl catalysts |
| CA1123859A (en) * | 1979-06-18 | 1982-05-18 | Edward B. Hackman | Hydroformylation process improved by choice of reaction solvent and control of product stripping parameters |
| US4329511A (en) * | 1979-06-18 | 1982-05-11 | Celanese Corporation | Hydroformylation process improved by choice of reaction solvent and control of product stripping parameters |
| US4283562A (en) * | 1979-10-26 | 1981-08-11 | Union Carbide Corporation | Hydroformylation process using stable rhodium catalyst |
| FR2478078A2 (fr) * | 1980-03-12 | 1981-09-18 | Rhone Poulenc Ind | Procede d'hydroformylation des olefines |
| US4302547A (en) * | 1980-06-30 | 1981-11-24 | Union Carbide Corporation | Novel solvents for the catalytic process for producing polyhydric alcohols |
| GB2085874B (en) * | 1980-09-04 | 1984-08-08 | Johnson Matthey Plc | Hydroformylation of olefins |
| DE3046355A1 (de) * | 1980-12-09 | 1982-07-15 | Basf Ag, 6700 Ludwigshafen | Verfahren zur hydroformylierung von olefinisch ungesaettigten verbindungen |
| US4400548A (en) * | 1981-08-17 | 1983-08-23 | Union Carbide Corporation | Hydroformylation process using bisphosphine monooxide ligands |
| JPS58157739A (ja) * | 1982-03-12 | 1983-09-19 | Kuraray Co Ltd | 1,9−ノナンジア−ルの製造方法 |
| US4453022A (en) * | 1982-04-21 | 1984-06-05 | Union Carbide Corporation | Process for preparing nonionic surfactants-oxyalkylation with calcium and/or strontium catalysts |
| FR2532318B1 (fr) * | 1982-08-31 | 1985-06-14 | Rhone Poulenc Chim Base | Procede de preparation de triarylphosphines sulfonees |
| DE3234701A1 (de) * | 1982-09-18 | 1984-04-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3235030A1 (de) * | 1982-09-22 | 1984-03-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von sulfonierten arylphosphinen |
| DE3235029A1 (de) * | 1982-09-22 | 1984-03-22 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur rueckgewinnung von wasserloeslichen, rhodium enthaltenden hydroformylierungskatalysatoren |
| US4480138A (en) * | 1982-10-12 | 1984-10-30 | Celanese Corporation | Hydroformylation process |
| DE3245883A1 (de) * | 1982-12-11 | 1984-06-14 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur hydroformylierung von olefinen |
| FR2550202B1 (fr) * | 1983-08-03 | 1986-03-21 | Rhone Poulenc Rech | Procede de preparation de tri(m-sulfophenyl) phosphine |
| DE3341035A1 (de) * | 1983-11-12 | 1985-05-23 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3347406A1 (de) * | 1983-12-29 | 1985-07-11 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur abtrennung und wiedergewinnung von rhodium aus den produkten der oxosynthese |
| DE3412335A1 (de) * | 1984-04-03 | 1985-10-10 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| FR2561650B1 (fr) * | 1984-03-26 | 1987-10-23 | Rhone Poulenc Rech | Perfectionnement au procede de preparation de tri(m-sulfophenyl)phosphine par hydrolyse et dilution controlees du sulfonat |
| DE3411034A1 (de) * | 1984-03-26 | 1985-09-26 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur rueckgewinnung von rhodium aus reaktionsprodukten der oxosynthese |
| DE3413427A1 (de) * | 1984-04-10 | 1985-10-17 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3415968A1 (de) * | 1984-04-28 | 1985-10-31 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3420491A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Verfahren zur herstellung von aldehyden |
| DE3420493A1 (de) * | 1984-06-01 | 1985-12-05 | Ruhrchemie Ag, 4200 Oberhausen | Quartaere ammoniumsalze sulfonierter triarylphosphine |
| US4578523A (en) * | 1985-05-29 | 1986-03-25 | Ruhrchemie Aktiengesellschaft | Process for the preparation of aldehydes |
| DE3534314A1 (de) * | 1985-09-26 | 1987-04-02 | Ruhrchemie Ag | Verfahren zur herstellung von aldehyden |
| US4633021A (en) * | 1985-11-29 | 1986-12-30 | National Distillers And Chemical Corporation | Olefin hydroformylation |
| US4716250A (en) * | 1986-07-10 | 1987-12-29 | Union Carbide Corporation | Hydroformylation using low volatile/organic soluble phosphine ligands |
-
1986
- 1986-11-18 US US06/932,002 patent/US4731486A/en not_active Expired - Lifetime
-
1987
- 1987-11-17 AT AT87116971T patent/ATE77075T1/de active
- 1987-11-17 MX MX009383A patent/MX166784B/es unknown
- 1987-11-17 DE DE19873739064 patent/DE3739064A1/de active Granted
- 1987-11-17 EP EP87116971A patent/EP0268268B1/en not_active Expired - Lifetime
- 1987-11-17 BE BE8701298A patent/BE1000619A5/fr not_active IP Right Cessation
- 1987-11-17 AU AU81280/87A patent/AU611867B2/en not_active Ceased
- 1987-11-17 RU SU874203758A patent/RU2002728C1/ru active
- 1987-11-17 DE DE8787116971T patent/DE3779725D1/de not_active Expired - Lifetime
- 1987-11-18 PL PL1987268876A patent/PL153062B1/pl unknown
- 1987-11-18 IT IT22675/87A patent/IT1223147B/it active
- 1987-11-18 CN CN87101178A patent/CN1017145B/zh not_active Expired
- 1987-11-18 DK DK605887A patent/DK605887A/da not_active Application Discontinuation
- 1987-11-18 YU YU2091/87A patent/YU45074B/xx unknown
- 1987-11-18 JP JP62289666A patent/JPH0667868B2/ja not_active Expired - Fee Related
- 1987-11-18 IN IN834/MAS/87A patent/IN170369B/en unknown
- 1987-11-18 HU HU875125A patent/HU202177B/hu not_active IP Right Cessation
- 1987-11-18 SE SE8704533A patent/SE8704533L/ not_active Application Discontinuation
- 1987-11-18 AR AR87309326A patent/AR248390A1/es active
- 1987-11-18 FI FI875087A patent/FI90858C/fi not_active IP Right Cessation
- 1987-11-18 KR KR1019870012952A patent/KR920003556B1/ko not_active Expired
- 1987-11-18 BR BR8706223A patent/BR8706223A/pt not_active Application Discontinuation
- 1987-11-18 CA CA000552143A patent/CA1307296C/en not_active Expired - Lifetime
- 1987-11-18 NO NO874810A patent/NO166440C/no unknown
- 1987-11-18 NL NL8702752A patent/NL8702752A/nl not_active Application Discontinuation
- 1987-11-18 GB GB8727013A patent/GB2197867B/en not_active Expired - Lifetime
- 1987-11-18 ES ES8703288A patent/ES2009221A6/es not_active Expired
- 1987-11-18 ZA ZA878638A patent/ZA878638B/xx unknown
- 1987-11-18 FR FR878715930A patent/FR2606771B1/fr not_active Expired
-
1989
- 1989-04-24 ES ES8901417A patent/ES2012718A6/es not_active Expired - Lifetime
- 1989-04-24 ES ES8901418A patent/ES2012719A6/es not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| HU202177B (en) | Process for hydroformylation by using slightly volatile phosphine ligands | |
| EP0254937B1 (en) | Hydroformylation using low volatile/organic soluble phosphine ligands | |
| EP0016286B1 (en) | Hydroformylation process | |
| US7935850B2 (en) | Process for hydroformylation of propylene | |
| KR920010519B1 (ko) | 디유기아인산염 리간드의 제조방법 | |
| KR870000201B1 (ko) | 하이드로포르밀화에 의한 알데히드의 제조방법 | |
| KR0131293B1 (ko) | 하이드로포르밀화 촉매의 재활성화 방법 | |
| HU204489B (en) | Hydroformilating process with utilizing transition metal catalyst and hydroformilating catalyst precurzor composition | |
| JPH0745423B2 (ja) | 均一遷移金属触媒方法におけるイオン性ホスフィットの使用 | |
| US5304686A (en) | Process for making 3-hydroxypropanal and 1,3-propanediol | |
| EP0599885B1 (en) | A method for separating a water soluble noble metal catalyst from a noble metal catalyzed hydroformylation reaction | |
| JPS6338009B2 (forum.php) | ||
| KR20210015839A (ko) | 하이드로포밀화 공정의 제어 방법 | |
| EP0682650B1 (en) | Process for making 1,3-diols and 3-hydroxyaldehydes | |
| US6339174B1 (en) | Method for preparing aldehydes by hydroformylation | |
| KR100548975B1 (ko) | 하이드로포르밀화에 의한 알데히드의 제조방법 | |
| KR20000070133A (ko) | 촉매로서의 로듐과 설폰화 트리아릴포스핀을 함유하는 수성 상의 존재하에 알데히드를 제조하는 방법 | |
| US6388142B1 (en) | Method for producing aldehydes by hydroformylation in the presence of crown ether | |
| CA1129439A (en) | Process |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HMM4 | Cancellation of final prot. due to non-payment of fee |