FI69300C - Foerfarande foer framstaellning av terapeutiskt anvaendbara ny karbostyrilderivat - Google Patents
Foerfarande foer framstaellning av terapeutiskt anvaendbara ny karbostyrilderivat Download PDFInfo
- Publication number
- FI69300C FI69300C FI781811A FI781811A FI69300C FI 69300 C FI69300 C FI 69300C FI 781811 A FI781811 A FI 781811A FI 781811 A FI781811 A FI 781811A FI 69300 C FI69300 C FI 69300C
- Authority
- FI
- Finland
- Prior art keywords
- group
- carbostyril
- propoxy
- methyl
- carbon atoms
- Prior art date
Links
- 229910052799 carbon Inorganic materials 0.000 title description 6
- 238000011282 treatment Methods 0.000 title description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 title description 3
- 230000001225 therapeutic effect Effects 0.000 title 2
- -1 C3,4-dimethoxyphenyl phenyl Chemical group 0.000 claims description 164
- 150000001875 compounds Chemical class 0.000 claims description 156
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 claims description 103
- 238000000034 method Methods 0.000 claims description 48
- 125000004432 carbon atom Chemical group C* 0.000 claims description 38
- 150000001412 amines Chemical class 0.000 claims description 27
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 20
- 125000005843 halogen group Chemical group 0.000 claims description 19
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 16
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 11
- 125000002947 alkylene group Chemical group 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 7
- 125000002071 phenylalkoxy group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 5
- 229910052700 potassium Inorganic materials 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 4
- 125000005529 alkyleneoxy group Chemical group 0.000 claims 2
- 230000027455 binding Effects 0.000 claims 2
- 238000009739 binding Methods 0.000 claims 2
- 125000004429 atom Chemical group 0.000 claims 1
- WSDQIHATCCOMLH-UHFFFAOYSA-N phenyl n-(3,5-dichlorophenyl)carbamate Chemical group ClC1=CC(Cl)=CC(NC(=O)OC=2C=CC=CC=2)=C1 WSDQIHATCCOMLH-UHFFFAOYSA-N 0.000 claims 1
- 238000006243 chemical reaction Methods 0.000 description 132
- 239000000243 solution Substances 0.000 description 86
- 239000013078 crystal Substances 0.000 description 80
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 58
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 57
- 239000000203 mixture Substances 0.000 description 54
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 50
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 47
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 47
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 44
- 239000002904 solvent Substances 0.000 description 41
- 238000003756 stirring Methods 0.000 description 40
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 36
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 35
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 33
- 239000003054 catalyst Substances 0.000 description 30
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 30
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 25
- 238000002844 melting Methods 0.000 description 25
- 230000008018 melting Effects 0.000 description 25
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 22
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 21
- 238000012360 testing method Methods 0.000 description 21
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 18
- 239000011734 sodium Substances 0.000 description 18
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 16
- 238000001816 cooling Methods 0.000 description 16
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 15
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 15
- 239000000741 silica gel Substances 0.000 description 15
- 229910002027 silica gel Inorganic materials 0.000 description 15
- 229960001866 silicon dioxide Drugs 0.000 description 15
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 150000007514 bases Chemical class 0.000 description 14
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 13
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- 102000004861 Phosphoric Diester Hydrolases Human genes 0.000 description 11
- 108090001050 Phosphoric Diester Hydrolases Proteins 0.000 description 11
- 239000013256 coordination polymer Substances 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- 229910052757 nitrogen Inorganic materials 0.000 description 11
- 210000004623 platelet-rich plasma Anatomy 0.000 description 11
- 235000011121 sodium hydroxide Nutrition 0.000 description 11
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- IVOMOUWHDPKRLL-KQYNXXCUSA-N Cyclic adenosine monophosphate Chemical compound C([C@H]1O2)OP(O)(=O)O[C@H]1[C@@H](O)[C@@H]2N1C(N=CN=C2N)=C2N=C1 IVOMOUWHDPKRLL-KQYNXXCUSA-N 0.000 description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 10
- IVOMOUWHDPKRLL-UHFFFAOYSA-N UNPD107823 Natural products O1C2COP(O)(=O)OC2C(O)C1N1C(N=CN=C2N)=C2N=C1 IVOMOUWHDPKRLL-UHFFFAOYSA-N 0.000 description 10
- 239000003795 chemical substances by application Substances 0.000 description 10
- 229940095074 cyclic amp Drugs 0.000 description 10
- 230000000694 effects Effects 0.000 description 10
- 229910052740 iodine Inorganic materials 0.000 description 10
- 239000012452 mother liquor Substances 0.000 description 10
- 239000012044 organic layer Substances 0.000 description 10
- 235000009518 sodium iodide Nutrition 0.000 description 10
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- 102000008186 Collagen Human genes 0.000 description 9
- 108010035532 Collagen Proteins 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 229910052783 alkali metal Inorganic materials 0.000 description 9
- 229920001436 collagen Polymers 0.000 description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 description 9
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 9
- 239000007858 starting material Substances 0.000 description 9
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 9
- XTWYTFMLZFPYCI-KQYNXXCUSA-N 5'-adenylphosphoric acid Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O XTWYTFMLZFPYCI-KQYNXXCUSA-N 0.000 description 8
- XTWYTFMLZFPYCI-UHFFFAOYSA-N Adenosine diphosphate Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(=O)OP(O)(O)=O)C(O)C1O XTWYTFMLZFPYCI-UHFFFAOYSA-N 0.000 description 8
- BERPCVULMUPOER-UHFFFAOYSA-N Quinolinediol Chemical class C1=CC=C2NC(=O)C(O)=CC2=C1 BERPCVULMUPOER-UHFFFAOYSA-N 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 229910010272 inorganic material Inorganic materials 0.000 description 8
- 239000011147 inorganic material Substances 0.000 description 8
- 229910052763 palladium Inorganic materials 0.000 description 8
- 239000003208 petroleum Substances 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 8
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 7
- HQWFWBNJUPPCDU-UHFFFAOYSA-N 4-chloro-n-cyclohexyl-n-methylbutanamide Chemical compound ClCCCC(=O)N(C)C1CCCCC1 HQWFWBNJUPPCDU-UHFFFAOYSA-N 0.000 description 7
- 238000006704 dehydrohalogenation reaction Methods 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 6
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- 241000283973 Oryctolagus cuniculus Species 0.000 description 6
- 150000008065 acid anhydrides Chemical class 0.000 description 6
- OIRDTQYFTABQOQ-KQYNXXCUSA-N adenosine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O OIRDTQYFTABQOQ-KQYNXXCUSA-N 0.000 description 6
- 150000001340 alkali metals Chemical class 0.000 description 6
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 6
- 239000003480 eluent Substances 0.000 description 6
- 150000002148 esters Chemical class 0.000 description 6
- 230000002140 halogenating effect Effects 0.000 description 6
- 229910052759 nickel Inorganic materials 0.000 description 6
- 230000000144 pharmacologic effect Effects 0.000 description 6
- 235000011118 potassium hydroxide Nutrition 0.000 description 6
- 239000008096 xylene Substances 0.000 description 6
- HZNVUJQVZSTENZ-UHFFFAOYSA-N 2,3-dichloro-5,6-dicyano-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O HZNVUJQVZSTENZ-UHFFFAOYSA-N 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- XTUVJUMINZSXGF-UHFFFAOYSA-N N-methylcyclohexylamine Chemical compound CNC1CCCCC1 XTUVJUMINZSXGF-UHFFFAOYSA-N 0.000 description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N N-methylcyclohexylamine Natural products CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 5
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Natural products C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 5
- YZCKVEUIGOORGS-NJFSPNSNSA-N Tritium Chemical compound [3H] YZCKVEUIGOORGS-NJFSPNSNSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 238000003556 assay Methods 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 238000009835 boiling Methods 0.000 description 5
- 239000000872 buffer Substances 0.000 description 5
- 238000005119 centrifugation Methods 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 238000004587 chromatography analysis Methods 0.000 description 5
- 229910017052 cobalt Inorganic materials 0.000 description 5
- 239000010941 cobalt Substances 0.000 description 5
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000005457 ice water Substances 0.000 description 5
- 230000035699 permeability Effects 0.000 description 5
- 229910052697 platinum Inorganic materials 0.000 description 5
- 239000002798 polar solvent Substances 0.000 description 5
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 5
- 239000002244 precipitate Substances 0.000 description 5
- 229910052703 rhodium Inorganic materials 0.000 description 5
- 239000010948 rhodium Substances 0.000 description 5
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 5
- 238000010898 silica gel chromatography Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 description 5
- 235000017550 sodium carbonate Nutrition 0.000 description 5
- 229910052722 tritium Inorganic materials 0.000 description 5
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 4
- FHJRNXFGMHYZDW-UHFFFAOYSA-N 4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoic acid Chemical compound N1C(=O)C=CC2=CC(OCCCC(=O)O)=CC=C21 FHJRNXFGMHYZDW-UHFFFAOYSA-N 0.000 description 4
- HOSGXJWQVBHGLT-UHFFFAOYSA-N 6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(O)=CC=C21 HOSGXJWQVBHGLT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 238000009825 accumulation Methods 0.000 description 4
- 239000008351 acetate buffer Substances 0.000 description 4
- 230000002776 aggregation Effects 0.000 description 4
- 238000004220 aggregation Methods 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- 150000001339 alkali metal compounds Chemical class 0.000 description 4
- 238000010976 amide bond formation reaction Methods 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 4
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 4
- 150000002170 ethers Chemical class 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- HMDSHIZGTPRJHT-UHFFFAOYSA-N n,2-dimethylcyclohexan-1-amine Chemical compound CNC1CCCCC1C HMDSHIZGTPRJHT-UHFFFAOYSA-N 0.000 description 4
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- XQYZDYMELSJDRZ-UHFFFAOYSA-N papaverine Chemical compound C1=C(OC)C(OC)=CC=C1CC1=NC=CC2=CC(OC)=C(OC)C=C12 XQYZDYMELSJDRZ-UHFFFAOYSA-N 0.000 description 4
- 239000011736 potassium bicarbonate Substances 0.000 description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 4
- 229940086066 potassium hydrogencarbonate Drugs 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- AQLYZDRHNHZHIS-UHFFFAOYSA-N quinoline-2,6-diol Chemical compound N1C(=O)C=CC2=CC(O)=CC=C21 AQLYZDRHNHZHIS-UHFFFAOYSA-N 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 4
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- UVSKBQACCRVBTH-UHFFFAOYSA-N 3-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]butanoic acid Chemical compound N1C(=O)CCC2=C1C=CC=C2OCC(C)CC(O)=O UVSKBQACCRVBTH-UHFFFAOYSA-N 0.000 description 3
- UTTJAIFHRUAFED-UHFFFAOYSA-N 5-hydroxy-3,4-dihydro-2(1h)-quinolinone Chemical compound N1C(=O)CCC2=C1C=CC=C2O UTTJAIFHRUAFED-UHFFFAOYSA-N 0.000 description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 3
- 239000002126 C01EB10 - Adenosine Substances 0.000 description 3
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 3
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 3
- KXKVLQRXCPHEJC-UHFFFAOYSA-N acetic acid trimethyl ester Natural products COC(C)=O KXKVLQRXCPHEJC-UHFFFAOYSA-N 0.000 description 3
- 229960001138 acetylsalicylic acid Drugs 0.000 description 3
- 229960005305 adenosine Drugs 0.000 description 3
- 230000006502 antiplatelets effects Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 230000002517 constrictor effect Effects 0.000 description 3
- 229910052802 copper Inorganic materials 0.000 description 3
- 150000001924 cycloalkanes Chemical class 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 238000005658 halogenation reaction Methods 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 238000010348 incorporation Methods 0.000 description 3
- 230000002401 inhibitory effect Effects 0.000 description 3
- 150000007529 inorganic bases Chemical class 0.000 description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 3
- QQHNGZNHRRLNKI-UHFFFAOYSA-N methyl carbonobromidate Chemical compound COC(Br)=O QQHNGZNHRRLNKI-UHFFFAOYSA-N 0.000 description 3
- IKZRDLOFEKQEPJ-UHFFFAOYSA-N n,3-dimethyl-n-(2-methylcyclohexyl)-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCC(C)CC(=O)N(C)C1CCCCC1C IKZRDLOFEKQEPJ-UHFFFAOYSA-N 0.000 description 3
- WJPDPBXURRIOFG-UHFFFAOYSA-N n-cyclohexyl-n-methyl-4-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2N(C)C(=O)CCC2=CC=1OCCCC(=O)N(C)C1CCCCC1 WJPDPBXURRIOFG-UHFFFAOYSA-N 0.000 description 3
- XSUBCFUQNASGMT-UHFFFAOYSA-N n-cyclohexyl-n-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCC(=O)N(C)C1CCCCC1 XSUBCFUQNASGMT-UHFFFAOYSA-N 0.000 description 3
- AGVKXDPPPSLISR-UHFFFAOYSA-N n-ethylcyclohexanamine Chemical compound CCNC1CCCCC1 AGVKXDPPPSLISR-UHFFFAOYSA-N 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000007530 organic bases Chemical class 0.000 description 3
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 3
- 210000002381 plasma Anatomy 0.000 description 3
- 229910003446 platinum oxide Inorganic materials 0.000 description 3
- 229960003975 potassium Drugs 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- HGRWHBQLRXWSLV-DEOSSOPVSA-N (4s)-3'-(3,6-dihydro-2h-pyran-5-yl)-1'-fluoro-7'-(3-fluoropyridin-2-yl)spiro[5h-1,3-oxazole-4,5'-chromeno[2,3-c]pyridine]-2-amine Chemical compound C1OC(N)=N[C@]21C1=CC(C=3COCCC=3)=NC(F)=C1OC1=CC=C(C=3C(=CC=CN=3)F)C=C12 HGRWHBQLRXWSLV-DEOSSOPVSA-N 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 2
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 2
- QKNYBSVHEMOAJP-UHFFFAOYSA-N 2-amino-2-(hydroxymethyl)propane-1,3-diol;hydron;chloride Chemical compound Cl.OCC(N)(CO)CO QKNYBSVHEMOAJP-UHFFFAOYSA-N 0.000 description 2
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 2
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 2
- SMXSSIWOLSYXGA-UHFFFAOYSA-N 3-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoic acid Chemical compound N1C(=O)C=CC2=CC(OCC(C)CC(O)=O)=CC=C21 SMXSSIWOLSYXGA-UHFFFAOYSA-N 0.000 description 2
- FVXYRXMYPXVHNY-UHFFFAOYSA-N 3-propoxy-3,4-dihydro-1H-quinolin-2-one Chemical compound C(CC)OC1C(NC2=CC=CC=C2C1)=O FVXYRXMYPXVHNY-UHFFFAOYSA-N 0.000 description 2
- LHSYLPPPCKSEOW-UHFFFAOYSA-N 4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanoic acid Chemical compound N1C(=O)CCC2=CC(OCCCC(=O)O)=CC=C21 LHSYLPPPCKSEOW-UHFFFAOYSA-N 0.000 description 2
- OYUIUMREMKVLBL-UHFFFAOYSA-N 4-chloro-n-ethyl-3-methyl-n-(2-methylcyclohexyl)butanamide Chemical compound ClCC(C)CC(=O)N(CC)C1CCCCC1C OYUIUMREMKVLBL-UHFFFAOYSA-N 0.000 description 2
- CDIIZULDSLKBKV-UHFFFAOYSA-N 4-chlorobutanoyl chloride Chemical compound ClCCCC(Cl)=O CDIIZULDSLKBKV-UHFFFAOYSA-N 0.000 description 2
- XCXDDKNPUFGHKD-UHFFFAOYSA-N 6-hydroxy-1-methyl-3,4-dihydroquinolin-2-one Chemical compound OC1=CC=C2N(C)C(=O)CCC2=C1 XCXDDKNPUFGHKD-UHFFFAOYSA-N 0.000 description 2
- 229930008281 A03AD01 - Papaverine Natural products 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- OJGMBLNIHDZDGS-UHFFFAOYSA-N N-Ethylaniline Chemical compound CCNC1=CC=CC=C1 OJGMBLNIHDZDGS-UHFFFAOYSA-N 0.000 description 2
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 2
- GYZTUNOPQAZWTJ-UHFFFAOYSA-N N-cyclohexyl-N-methyl-4-[(2-oxo-1H-quinolin-3-yl)oxy]butanamide Chemical compound CN(C(=O)CCCOC=1C(NC2=CC=CC=C2C=1)=O)C1CCCCC1 GYZTUNOPQAZWTJ-UHFFFAOYSA-N 0.000 description 2
- UIAYVIIHMORPSJ-UHFFFAOYSA-N N-cyclohexyl-N-methyl-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C)C1CCCCC1 UIAYVIIHMORPSJ-UHFFFAOYSA-N 0.000 description 2
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 2
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 2
- 238000000862 absorption spectrum Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000000702 anti-platelet effect Effects 0.000 description 2
- 239000003146 anticoagulant agent Substances 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 2
- 229910001863 barium hydroxide Inorganic materials 0.000 description 2
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 239000007853 buffer solution Substances 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000004452 carbocyclyl group Chemical group 0.000 description 2
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 239000012230 colorless oil Substances 0.000 description 2
- 238000006482 condensation reaction Methods 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- 238000006297 dehydration reaction Methods 0.000 description 2
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 238000010828 elution Methods 0.000 description 2
- 150000002168 ethanoic acid esters Chemical class 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000007429 general method Methods 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- ZSIAUFGUXNUGDI-UHFFFAOYSA-N hexan-1-ol Chemical compound CCCCCCO ZSIAUFGUXNUGDI-UHFFFAOYSA-N 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 2
- 239000000411 inducer Substances 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- QEOVZKKLVAZJGC-UHFFFAOYSA-N n-cyclohexyl-n-ethyl-3-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]butanamide Chemical compound C=1C=CC=2NC(=O)CCC=2C=1OCC(C)CC(=O)N(CC)C1CCCCC1 QEOVZKKLVAZJGC-UHFFFAOYSA-N 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 229910000480 nickel oxide Inorganic materials 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- GNRSAWUEBMWBQH-UHFFFAOYSA-N oxonickel Chemical compound [Ni]=O GNRSAWUEBMWBQH-UHFFFAOYSA-N 0.000 description 2
- 229960001789 papaverine Drugs 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 230000003389 potentiating effect Effects 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000004742 propyloxycarbonyl group Chemical group 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 229910052707 ruthenium Inorganic materials 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- JPJALAQPGMAKDF-UHFFFAOYSA-N selenium dioxide Chemical compound O=[Se]=O JPJALAQPGMAKDF-UHFFFAOYSA-N 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- PIEPQKCYPFFYMG-UHFFFAOYSA-N tris acetate Chemical compound CC(O)=O.OCC(N)(CO)CO PIEPQKCYPFFYMG-UHFFFAOYSA-N 0.000 description 2
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 1
- WYNJLBDOYKQQTE-UHFFFAOYSA-N (4-nitrophenyl) 3-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoate Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCC(C)CC(=O)OC1=CC=C([N+]([O-])=O)C=C1 WYNJLBDOYKQQTE-UHFFFAOYSA-N 0.000 description 1
- SJQBHNHASPQACB-ONEGZZNKSA-N (e)-1,2-dimethoxyethene Chemical group CO\C=C\OC SJQBHNHASPQACB-ONEGZZNKSA-N 0.000 description 1
- ZGYIXVSQHOKQRZ-COIATFDQSA-N (e)-n-[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]-3-cyano-7-[(3s)-oxolan-3-yl]oxyquinolin-6-yl]-4-(dimethylamino)but-2-enamide Chemical compound N#CC1=CN=C2C=C(O[C@@H]3COCC3)C(NC(=O)/C=C/CN(C)C)=CC2=C1NC(C=C1Cl)=CC=C1OCC1=CC=CC=N1 ZGYIXVSQHOKQRZ-COIATFDQSA-N 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- ZXSQEZNORDWBGZ-UHFFFAOYSA-N 1,3-dihydropyrrolo[2,3-b]pyridin-2-one Chemical compound C1=CN=C2NC(=O)CC2=C1 ZXSQEZNORDWBGZ-UHFFFAOYSA-N 0.000 description 1
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 1
- BLIQUJLAJXRXSG-UHFFFAOYSA-N 1-benzyl-3-(trifluoromethyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1C(C(=O)O)(C(F)(F)F)CCN1CC1=CC=CC=C1 BLIQUJLAJXRXSG-UHFFFAOYSA-N 0.000 description 1
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000005976 1-phenylethyloxy group Chemical group 0.000 description 1
- NXBJSUOOKXVSFX-UHFFFAOYSA-N 2-(propan-2-ylamino)cyclohexan-1-ol Chemical compound CC(C)NC1CCCCC1O NXBJSUOOKXVSFX-UHFFFAOYSA-N 0.000 description 1
- PRPQJXJAZXXHQL-UHFFFAOYSA-N 2-[methyl-[4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoyl]amino]cyclohexane-1-carboxylic acid Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C)C1CCCCC1C(O)=O PRPQJXJAZXXHQL-UHFFFAOYSA-N 0.000 description 1
- PQMCFTMVQORYJC-UHFFFAOYSA-N 2-aminocyclohexan-1-ol Chemical compound NC1CCCCC1O PQMCFTMVQORYJC-UHFFFAOYSA-N 0.000 description 1
- 125000006176 2-ethylbutyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(C([H])([H])*)C([H])([H])C([H])([H])[H] 0.000 description 1
- FWJSWOKMWDIRJA-UHFFFAOYSA-N 2-methyl-2-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]propanoic acid Chemical compound N1C(=O)CCC2=CC(OC(C)(C)C(O)=O)=CC=C21 FWJSWOKMWDIRJA-UHFFFAOYSA-N 0.000 description 1
- 125000004493 2-methylbut-1-yl group Chemical group CC(C*)CC 0.000 description 1
- CGNJLKUFSWTLKW-UHFFFAOYSA-N 2-oxo-7-propoxy-3,4-dihydro-1H-quinoline-3-carboxamide Chemical compound NC(=O)C1C(NC2=CC(=CC=C2C1)OCCC)=O CGNJLKUFSWTLKW-UHFFFAOYSA-N 0.000 description 1
- 125000005975 2-phenylethyloxy group Chemical group 0.000 description 1
- APIXJSLKIYYUKG-UHFFFAOYSA-N 3 Isobutyl 1 methylxanthine Chemical compound O=C1N(C)C(=O)N(CC(C)C)C2=C1N=CN2 APIXJSLKIYYUKG-UHFFFAOYSA-N 0.000 description 1
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 1
- LQIMKAYQADIOHA-UHFFFAOYSA-N 3-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]-n-propan-2-ylpropanamide Chemical compound N1C(=O)CCC2=CC(OCCC(=O)NC(C)C)=CC=C21 LQIMKAYQADIOHA-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- MSSJTTFHXMTEHT-UHFFFAOYSA-N 3-ethoxy-1H-quinolin-2-one Chemical compound C(C)OC=1C(=NC2=CC=CC=C2C1)O MSSJTTFHXMTEHT-UHFFFAOYSA-N 0.000 description 1
- WZWIHIXOELFINB-UHFFFAOYSA-N 3-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]-n-propylbutanamide Chemical compound N1C(=O)CCC2=CC(OCC(C)CC(=O)NCCC)=CC=C21 WZWIHIXOELFINB-UHFFFAOYSA-N 0.000 description 1
- 125000003469 3-methylhexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000005977 3-phenylpropyloxy group Chemical group 0.000 description 1
- UFOSBJPQFRACNM-UHFFFAOYSA-N 4-(1-ethyl-2-oxoquinolin-6-yl)oxy-n-methyl-n-phenylbutanamide Chemical compound C1=C2C=CC(=O)N(CC)C2=CC=C1OCCCC(=O)N(C)C1=CC=CC=C1 UFOSBJPQFRACNM-UHFFFAOYSA-N 0.000 description 1
- OMJKFWFDNIIACS-UHFFFAOYSA-N 4-(methylamino)cyclohexan-1-ol Chemical compound CNC1CCC(O)CC1 OMJKFWFDNIIACS-UHFFFAOYSA-N 0.000 description 1
- CVTSMAOVTVKGJQ-UHFFFAOYSA-N 4-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]butanoic acid Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCC(=O)O CVTSMAOVTVKGJQ-UHFFFAOYSA-N 0.000 description 1
- KHBBTPYACMTAQZ-UHFFFAOYSA-N 4-[(5-chloro-2-oxo-1h-quinolin-6-yl)oxy]butanoic acid Chemical compound N1C(=O)C=CC2=C(Cl)C(OCCCC(=O)O)=CC=C21 KHBBTPYACMTAQZ-UHFFFAOYSA-N 0.000 description 1
- PMVATBCIJJIBQM-UHFFFAOYSA-N 4-[(8-bromo-2-oxo-1H-quinolin-6-yl)oxy]-N-cyclohexyl-N,3-dimethylbutanamide Chemical compound C=1C(Br)=C2NC(=O)C=CC2=CC=1OCC(C)CC(=O)N(C)C1CCCCC1 PMVATBCIJJIBQM-UHFFFAOYSA-N 0.000 description 1
- VAKSOZVCMSBFCW-UHFFFAOYSA-N 4-chloro-n-(1-cyclopentylpropan-2-yl)butanamide Chemical compound ClCCCC(=O)NC(C)CC1CCCC1 VAKSOZVCMSBFCW-UHFFFAOYSA-N 0.000 description 1
- KYKIYEJLXULPLV-UHFFFAOYSA-N 4-chloro-n-cyclohexylbutanamide Chemical compound ClCCCC(=O)NC1CCCCC1 KYKIYEJLXULPLV-UHFFFAOYSA-N 0.000 description 1
- ONFLCMFDSFTMPA-UHFFFAOYSA-N 4-chloro-n-methyl-n-phenylbutanamide Chemical compound ClCCCC(=O)N(C)C1=CC=CC=C1 ONFLCMFDSFTMPA-UHFFFAOYSA-N 0.000 description 1
- ZFIQGRISGKSVAG-UHFFFAOYSA-N 4-methylaminophenol Chemical compound CNC1=CC=C(O)C=C1 ZFIQGRISGKSVAG-UHFFFAOYSA-N 0.000 description 1
- 125000003836 4-phenylbutoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 102100022464 5'-nucleotidase Human genes 0.000 description 1
- NXGYIDNFNINXDO-UHFFFAOYSA-N 5,7,8-trichloro-6-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C(Cl)C(O)=C(Cl)C(Cl)=C21 NXGYIDNFNINXDO-UHFFFAOYSA-N 0.000 description 1
- NJZVTNYJNDWQND-UHFFFAOYSA-N 5-chloro-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2Cl NJZVTNYJNDWQND-UHFFFAOYSA-N 0.000 description 1
- OGHVHWURQPBPBZ-UHFFFAOYSA-N 6,8-dichloro-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Cl)=CC(Cl)=C2O OGHVHWURQPBPBZ-UHFFFAOYSA-N 0.000 description 1
- NOIQPNXLNANOPX-UHFFFAOYSA-N 6-hydroxy-1-methylquinolin-2-one Chemical compound C1=C(O)C=C2C=CC(=O)N(C)C2=C1 NOIQPNXLNANOPX-UHFFFAOYSA-N 0.000 description 1
- CBTAWFFEPGSZNS-UHFFFAOYSA-N 7-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]heptanoic acid Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCCCCC(=O)O CBTAWFFEPGSZNS-UHFFFAOYSA-N 0.000 description 1
- DQJZKRKTOJJCCO-UHFFFAOYSA-N 7-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]heptanoic acid Chemical compound N1C(=O)CCC2=CC(OCCCCCCC(=O)O)=CC=C21 DQJZKRKTOJJCCO-UHFFFAOYSA-N 0.000 description 1
- UNQYAAAWKOOBFQ-UHFFFAOYSA-N 7-[(4-chlorophenyl)methyl]-8-[4-chloro-3-(trifluoromethoxy)phenoxy]-1-(3-hydroxypropyl)-3-methylpurine-2,6-dione Chemical compound C=1C=C(Cl)C=CC=1CN1C=2C(=O)N(CCCO)C(=O)N(C)C=2N=C1OC1=CC=C(Cl)C(OC(F)(F)F)=C1 UNQYAAAWKOOBFQ-UHFFFAOYSA-N 0.000 description 1
- CUIKMKFHNHPLPY-UHFFFAOYSA-N 8-bromo-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2O CUIKMKFHNHPLPY-UHFFFAOYSA-N 0.000 description 1
- UDKMDIKMJWOSJP-UHFFFAOYSA-N 8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2O UDKMDIKMJWOSJP-UHFFFAOYSA-N 0.000 description 1
- AEOBEOJCBAYXBA-UHFFFAOYSA-N A2P5P Natural products C1=NC=2C(N)=NC=NC=2N1C1OC(COP(O)(O)=O)C(O)C1OP(O)(O)=O AEOBEOJCBAYXBA-UHFFFAOYSA-N 0.000 description 1
- LBCCPKFTHIBIKU-UHFFFAOYSA-N Aethyl-propyl-glyoxal Natural products CCCC(=O)C(=O)CC LBCCPKFTHIBIKU-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 101000736752 Arabidopsis thaliana Photosystem I subunit O Proteins 0.000 description 1
- 101100515517 Arabidopsis thaliana XI-I gene Proteins 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- 108091003079 Bovine Serum Albumin Proteins 0.000 description 1
- KPEFUOXDZFLDKX-UHFFFAOYSA-N CC(CC(NC1CCCCC1)=O)CCl Chemical compound CC(CC(NC1CCCCC1)=O)CCl KPEFUOXDZFLDKX-UHFFFAOYSA-N 0.000 description 1
- JVDXDAUFRGVXMX-UHFFFAOYSA-N CC1(CCC(CC1)O)NC(=O)CCCOC2=CC=CC3=C2CCC(=O)N3 Chemical compound CC1(CCC(CC1)O)NC(=O)CCCOC2=CC=CC3=C2CCC(=O)N3 JVDXDAUFRGVXMX-UHFFFAOYSA-N 0.000 description 1
- MPRWYHNMPOSMCO-UHFFFAOYSA-N CC1CCCC(C1C)NC(=O)CC(C)COC2=CC3=C(C=C2)NC(=O)CC3 Chemical compound CC1CCCC(C1C)NC(=O)CC(C)COC2=CC3=C(C=C2)NC(=O)CC3 MPRWYHNMPOSMCO-UHFFFAOYSA-N 0.000 description 1
- VTTLTJWWMPLDDL-UHFFFAOYSA-N CCC(CCOC1=CC2=C(C=C1)NC(=O)C=C2)C(=O)N(CC)C3CCCCC3 Chemical compound CCC(CCOC1=CC2=C(C=C1)NC(=O)C=C2)C(=O)N(CC)C3CCCCC3 VTTLTJWWMPLDDL-UHFFFAOYSA-N 0.000 description 1
- IRWJYJIQNSXKDF-UHFFFAOYSA-N CCCOC1=C(C(N)=O)C2=CC=CC=C2NC1=O Chemical compound CCCOC1=C(C(N)=O)C2=CC=CC=C2NC1=O IRWJYJIQNSXKDF-UHFFFAOYSA-N 0.000 description 1
- BRTPHBSWDYVVOC-UHFFFAOYSA-N CCN(C1=CC=CC=C1)C(=O)C(C)COC2=CC=CC3=C2CCC(=O)N3 Chemical compound CCN(C1=CC=CC=C1)C(=O)C(C)COC2=CC=CC3=C2CCC(=O)N3 BRTPHBSWDYVVOC-UHFFFAOYSA-N 0.000 description 1
- FLXGKMUBZRUKCJ-UHFFFAOYSA-N CCN(C1CCCCC1)C(=O)C(C)CCOC2=CC3=C(C=C2)NC(=O)C=C3 Chemical compound CCN(C1CCCCC1)C(=O)C(C)CCOC2=CC3=C(C=C2)NC(=O)C=C3 FLXGKMUBZRUKCJ-UHFFFAOYSA-N 0.000 description 1
- FOHGYAMUUARFRZ-UHFFFAOYSA-N CN(C(=O)CC(COC=1C(NC2=CC=CC=C2C=1)=O)C)C1C(CCCC1)C Chemical compound CN(C(=O)CC(COC=1C(NC2=CC=CC=C2C=1)=O)C)C1C(CCCC1)C FOHGYAMUUARFRZ-UHFFFAOYSA-N 0.000 description 1
- MNELYNXYGXZEBT-UHFFFAOYSA-N CN(C1CC1)C(=O)CCCOC2=CC3=C(C=C2)NC(=O)C=C3 Chemical compound CN(C1CC1)C(=O)CCCOC2=CC3=C(C=C2)NC(=O)C=C3 MNELYNXYGXZEBT-UHFFFAOYSA-N 0.000 description 1
- FQTAEOCGMHBFBK-UHFFFAOYSA-N CN(C1CCCCC1)C(=O)CCCOC2=CC3=C(C=C2)N(C(=O)C=C3)CC4=CC=CC=C4 Chemical compound CN(C1CCCCC1)C(=O)CCCOC2=CC3=C(C=C2)N(C(=O)C=C3)CC4=CC=CC=C4 FQTAEOCGMHBFBK-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 102100035861 Cytosolic 5'-nucleotidase 1A Human genes 0.000 description 1
- GUBGYTABKSRVRQ-WFVLMXAXSA-N DEAE-cellulose Chemical compound OC1C(O)C(O)C(CO)O[C@H]1O[C@@H]1C(CO)OC(O)C(O)C1O GUBGYTABKSRVRQ-WFVLMXAXSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 101000802744 Homo sapiens Cytosolic 5'-nucleotidase 1A Proteins 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- 241000764238 Isis Species 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 241000699666 Mus <mouse, genus> Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- XSWWLIKQUUZRIJ-UHFFFAOYSA-N N-(2-chlorocyclohexyl)-N-(cyclohexylmethyl)-4-[(2-oxo-1H-quinolin-6-yl)oxy]butanamide Chemical compound ClC1CCCCC1N(C(=O)CCCOC=1C=C2C=CC(=O)NC2=CC=1)CC1CCCCC1 XSWWLIKQUUZRIJ-UHFFFAOYSA-N 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- HAWJJTBWFDGAJQ-UHFFFAOYSA-N N-butyl-4-[(5-chloro-2-oxo-1H-quinolin-6-yl)oxy]-N-cyclohexylbutanamide Chemical compound ClC1=C2C=CC(NC2=CC=C1OCCCC(=O)N(CCCC)C1CCCCC1)=O HAWJJTBWFDGAJQ-UHFFFAOYSA-N 0.000 description 1
- OYADPONHTLKVEH-UHFFFAOYSA-N N-cyclohexyl-4-[(2-oxo-1H-quinolin-6-yl)oxy]-N-propan-2-ylbutanamide Chemical compound C(C)(C)N(C(=O)CCCOC=1C=C2C=CC(NC2=CC=1)=O)C1CCCCC1 OYADPONHTLKVEH-UHFFFAOYSA-N 0.000 description 1
- PHYMTMIXYNEIML-UHFFFAOYSA-N N-cyclohexyl-4-[(2-oxo-1H-quinolin-6-yl)oxy]-N-propylbutanamide Chemical compound C(CC)N(C(=O)CCCOC=1C=C2C=CC(NC2=CC=1)=O)C1CCCCC1 PHYMTMIXYNEIML-UHFFFAOYSA-N 0.000 description 1
- SVGQJRQMGRSAHB-UHFFFAOYSA-N N-cyclohexyl-N-ethyl-2-[(2-oxo-1H-quinolin-6-yl)oxy]acetamide Chemical compound C(C)N(C1CCCCC1)C(=O)COC=1C=C2C=CC(NC2=CC=1)=O SVGQJRQMGRSAHB-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 208000003251 Pruritus Diseases 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- BBQQLBGXIDYZRE-UHFFFAOYSA-N [4-[methyl-[4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoyl]amino]cyclohexyl] acetate Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C)C1CCC(OC(C)=O)CC1 BBQQLBGXIDYZRE-UHFFFAOYSA-N 0.000 description 1
- SKAJFTMILLERCB-UHFFFAOYSA-M [Na+].CC(O)=O.CC(O)=O.CC(O)=O.CC([O-])=O Chemical compound [Na+].CC(O)=O.CC(O)=O.CC(O)=O.CC([O-])=O SKAJFTMILLERCB-UHFFFAOYSA-M 0.000 description 1
- 238000002835 absorbance Methods 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 231100000215 acute (single dose) toxicity testing Toxicity 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 125000004423 acyloxy group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- UDMBCSSLTHHNCD-KQYNXXCUSA-N adenosine 5'-monophosphate Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O UDMBCSSLTHHNCD-KQYNXXCUSA-N 0.000 description 1
- 125000005236 alkanoylamino group Chemical group 0.000 description 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 125000003705 anilinocarbonyl group Chemical group O=C([*])N([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000002260 anti-inflammatory agent Substances 0.000 description 1
- 230000002421 anti-septic effect Effects 0.000 description 1
- 230000000767 anti-ulcer Effects 0.000 description 1
- 229940064004 antiseptic throat preparations Drugs 0.000 description 1
- 239000003699 antiulcer agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000004054 benzoquinones Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 229940098773 bovine serum albumin Drugs 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- OAABHEHWRQAHEJ-UHFFFAOYSA-N butan-1-ol;chloroform Chemical compound ClC(Cl)Cl.CCCCO OAABHEHWRQAHEJ-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000004744 butyloxycarbonyl group Chemical group 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000005345 coagulation Methods 0.000 description 1
- 230000015271 coagulation Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- FQROBSPJQAMMPA-UHFFFAOYSA-N cyclohexyl 4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanoate Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCC(=O)OC1CCCCC1 FQROBSPJQAMMPA-UHFFFAOYSA-N 0.000 description 1
- 150000003946 cyclohexylamines Chemical class 0.000 description 1
- 125000004210 cyclohexylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000004851 cyclopentylmethyl group Chemical group C1(CCCC1)C* 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 235000005911 diet Nutrition 0.000 description 1
- 230000000378 dietary effect Effects 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- SBZXBUIDTXKZTM-UHFFFAOYSA-N diglyme Chemical compound COCCOCCOC SBZXBUIDTXKZTM-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- OKQSSSVVBOUMNZ-UHFFFAOYSA-N diminazene diaceturate Chemical compound CC(=O)NCC(O)=O.CC(=O)NCC(O)=O.C1=CC(C(=N)N)=CC=C1NN=NC1=CC=C(C(N)=N)C=C1 OKQSSSVVBOUMNZ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000004210 ether based solvent Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- WCTMRZGBQOAJNP-UHFFFAOYSA-N ethyl 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-6-yl)oxy]propanoate Chemical compound CN1C(=O)CCC2=CC(OC(C)C(=O)OCC)=CC=C21 WCTMRZGBQOAJNP-UHFFFAOYSA-N 0.000 description 1
- ORTHSJDDYKIPFJ-UHFFFAOYSA-N ethyl 2-[(2-oxo-1h-quinolin-6-yl)oxy]propanoate Chemical compound N1C(=O)C=CC2=CC(OC(C)C(=O)OCC)=CC=C21 ORTHSJDDYKIPFJ-UHFFFAOYSA-N 0.000 description 1
- HFUIGOFKSVEFSI-UHFFFAOYSA-N ethyl 2-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]propanoate Chemical compound N1C(=O)CCC2=CC(OC(C)C(=O)OCC)=CC=C21 HFUIGOFKSVEFSI-UHFFFAOYSA-N 0.000 description 1
- YCLBWBPKRSBGEB-UHFFFAOYSA-N ethyl 2-[(2-oxo-3,4-dihydro-1h-quinolin-7-yl)oxy]propanoate Chemical compound C1CC(=O)NC2=CC(OC(C)C(=O)OCC)=CC=C21 YCLBWBPKRSBGEB-UHFFFAOYSA-N 0.000 description 1
- ZXCQOWHICBYYQD-UHFFFAOYSA-N ethyl 2-[(2-oxo-3,4-dihydro-1h-quinolin-8-yl)oxy]propanoate Chemical compound C1CC(=O)NC2=C1C=CC=C2OC(C)C(=O)OCC ZXCQOWHICBYYQD-UHFFFAOYSA-N 0.000 description 1
- SNBIRWAABSXIMA-UHFFFAOYSA-N ethyl 2-[(8-bromo-2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]acetate Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2OCC(=O)OCC SNBIRWAABSXIMA-UHFFFAOYSA-N 0.000 description 1
- HFNZBYCSGWOSSC-UHFFFAOYSA-N ethyl 4-[(2-oxo-1h-quinolin-6-yl)oxy]butanoate Chemical compound N1C(=O)C=CC2=CC(OCCCC(=O)OCC)=CC=C21 HFNZBYCSGWOSSC-UHFFFAOYSA-N 0.000 description 1
- JAQRBXZYBPDYJA-UHFFFAOYSA-N ethyl 4-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]butanoate Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCC(=O)OCC JAQRBXZYBPDYJA-UHFFFAOYSA-N 0.000 description 1
- QOQVKCLJMBKWCA-UHFFFAOYSA-N ethyl 4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanoate Chemical compound N1C(=O)CCC2=CC(OCCCC(=O)OCC)=CC=C21 QOQVKCLJMBKWCA-UHFFFAOYSA-N 0.000 description 1
- ROMUOLIBKWIVQG-UHFFFAOYSA-N ethyl 7-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]heptanoate Chemical compound N1C(=O)CCC2=CC(OCCCCCCC(=O)OCC)=CC=C21 ROMUOLIBKWIVQG-UHFFFAOYSA-N 0.000 description 1
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 1
- XCPXPFNKTCFWTA-UHFFFAOYSA-N ethyl carbonobromidate Chemical compound CCOC(Br)=O XCPXPFNKTCFWTA-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000011049 filling Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000007903 gelatin capsule Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 150000003949 imides Chemical class 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000000555 isopropenyl group Chemical group [H]\C([H])=C(\*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 125000005928 isopropyloxycarbonyl group Chemical group [H]C([H])([H])C([H])(OC(*)=O)C([H])([H])[H] 0.000 description 1
- 239000007951 isotonicity adjuster Substances 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 238000000691 measurement method Methods 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 150000004692 metal hydroxides Chemical class 0.000 description 1
- 229910001511 metal iodide Inorganic materials 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- FKZRAGAQRONYBG-UHFFFAOYSA-N n,n-dicyclohexyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C1CCCCC1)C1CCCCC1 FKZRAGAQRONYBG-UHFFFAOYSA-N 0.000 description 1
- ZQVOIVLHTTWANF-UHFFFAOYSA-N n,n-dicyclohexyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCC(=O)N(C1CCCCC1)C1CCCCC1 ZQVOIVLHTTWANF-UHFFFAOYSA-N 0.000 description 1
- ULZFIGHUHPVTHP-UHFFFAOYSA-N n,n-dimethyl-2-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]acetamide Chemical compound N1C(=O)CCC2=C1C=CC=C2OCC(=O)N(C)C ULZFIGHUHPVTHP-UHFFFAOYSA-N 0.000 description 1
- PKSXAPXRTBJGAA-UHFFFAOYSA-N n-(1-cyclopentylpropan-2-yl)-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)NC(C)CC1CCCC1 PKSXAPXRTBJGAA-UHFFFAOYSA-N 0.000 description 1
- GJMZEUNVNDHGQD-UHFFFAOYSA-N n-(2-hydroxy-5-methylcyclohexyl)-n-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C1C(C)CCC(O)C1N(C)C(=O)CCCOC1=CC=C(NC(=O)C=C2)C2=C1 GJMZEUNVNDHGQD-UHFFFAOYSA-N 0.000 description 1
- LSTSBZKCLQHYGO-UHFFFAOYSA-N n-(3,4-dimethoxycyclohexyl)-n-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C1C(OC)C(OC)CCC1N(C)C(=O)CCCOC1=CC=C(NC(=O)C=C2)C2=C1 LSTSBZKCLQHYGO-UHFFFAOYSA-N 0.000 description 1
- PYDXJQWWXPSIHY-UHFFFAOYSA-N n-(4-hydroxycyclohexyl)-n-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C)C1CCC(O)CC1 PYDXJQWWXPSIHY-UHFFFAOYSA-N 0.000 description 1
- CELVVBWYVXJNNT-UHFFFAOYSA-N n-(4-methoxycyclohexyl)-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanamide Chemical compound C1CC(OC)CCC1NC(=O)CCCOC1=CC=C(NC(=O)CC2)C2=C1 CELVVBWYVXJNNT-UHFFFAOYSA-N 0.000 description 1
- KVZYKYUSNOBGTM-UHFFFAOYSA-N n-benzyl-4-[(1-ethyl-2-oxo-3,4-dihydroquinolin-5-yl)oxy]butanamide Chemical compound C1=CC=C2N(CC)C(=O)CCC2=C1OCCCC(=O)NCC1=CC=CC=C1 KVZYKYUSNOBGTM-UHFFFAOYSA-N 0.000 description 1
- ZUYNBXWHCMZZIE-UHFFFAOYSA-N n-benzyl-n-cyclohexyl-7-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]heptanamide Chemical compound C=1C=CC=2NC(=O)CCC=2C=1OCCCCCCC(=O)N(C1CCCCC1)CC1=CC=CC=C1 ZUYNBXWHCMZZIE-UHFFFAOYSA-N 0.000 description 1
- IYWYMFZAZUYNLC-UHFFFAOYSA-N n-benzylcyclohexanamine Chemical compound C=1C=CC=CC=1CNC1CCCCC1 IYWYMFZAZUYNLC-UHFFFAOYSA-N 0.000 description 1
- BVUULUGQCNAZKP-UHFFFAOYSA-N n-butyl-n-cyclooctyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(CCCC)C1CCCCCCC1 BVUULUGQCNAZKP-UHFFFAOYSA-N 0.000 description 1
- VXXLEXCQCSPKFI-UHFFFAOYSA-N n-butylcyclohexanamine Chemical compound CCCCNC1CCCCC1 VXXLEXCQCSPKFI-UHFFFAOYSA-N 0.000 description 1
- RQGJDYPBBZGUKL-UHFFFAOYSA-N n-cyclohexyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)NC1CCCCC1 RQGJDYPBBZGUKL-UHFFFAOYSA-N 0.000 description 1
- HMFXIDNJCWANQB-UHFFFAOYSA-N n-cyclohexyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCC(=O)NC1CCCCC1 HMFXIDNJCWANQB-UHFFFAOYSA-N 0.000 description 1
- BRLURRAYRSMTQV-UHFFFAOYSA-N n-cyclohexyl-n-ethyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(CC)C1CCCCC1 BRLURRAYRSMTQV-UHFFFAOYSA-N 0.000 description 1
- MAIPUMHMEHYUGW-UHFFFAOYSA-N n-cyclohexyl-n-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]butanamide Chemical compound C=1C=CC=2NC(=O)CCC=2C=1OCCCC(=O)N(C)C1CCCCC1 MAIPUMHMEHYUGW-UHFFFAOYSA-N 0.000 description 1
- XPRXUARMKOMPCN-UHFFFAOYSA-N n-ethyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]-n-phenylbutanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(CC)C1=CC=CC=C1 XPRXUARMKOMPCN-UHFFFAOYSA-N 0.000 description 1
- CGTUVQGZAHKHNS-UHFFFAOYSA-N n-ethyl-7-[(2-oxo-1h-quinolin-6-yl)oxy]-n-phenylheptanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCCCCC(=O)N(CC)C1=CC=CC=C1 CGTUVQGZAHKHNS-UHFFFAOYSA-N 0.000 description 1
- SDGLZYZMEJGJDJ-UHFFFAOYSA-N n-hexylcyclohexanamine Chemical compound CCCCCCNC1CCCCC1 SDGLZYZMEJGJDJ-UHFFFAOYSA-N 0.000 description 1
- OVIZUAPOIAVILA-UHFFFAOYSA-N n-methyl-4-[(2-oxo-1h-quinolin-6-yl)oxy]-n-phenylbutanamide Chemical compound C=1C=C2NC(=O)C=CC2=CC=1OCCCC(=O)N(C)C1=CC=CC=C1 OVIZUAPOIAVILA-UHFFFAOYSA-N 0.000 description 1
- JREJXTLTNVFDGX-UHFFFAOYSA-N n-methyl-4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]-n-phenylbutanamide Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCCCC(=O)N(C)C1=CC=CC=C1 JREJXTLTNVFDGX-UHFFFAOYSA-N 0.000 description 1
- LCUCBBNKAFTMEG-UHFFFAOYSA-N n-methyl-n-(2-methylcyclohexyl)-4-[(2-oxo-1h-quinolin-6-yl)oxy]butanamide Chemical compound CC1CCCCC1N(C)C(=O)CCCOC1=CC=C(NC(=O)C=C2)C2=C1 LCUCBBNKAFTMEG-UHFFFAOYSA-N 0.000 description 1
- SQGBZKZDUMBTIJ-UHFFFAOYSA-N n-prop-2-enylcyclohexanamine Chemical compound C=CCNC1CCCCC1 SQGBZKZDUMBTIJ-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XIKYYQJBTPYKSG-UHFFFAOYSA-N nickel Chemical compound [Ni].[Ni] XIKYYQJBTPYKSG-UHFFFAOYSA-N 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229910003445 palladium oxide Inorganic materials 0.000 description 1
- JQPTYAILLJKUCY-UHFFFAOYSA-N palladium(ii) oxide Chemical compound [O-2].[Pd+2] JQPTYAILLJKUCY-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- TWVXKHLXVRWAAP-UHFFFAOYSA-N pentyl 2-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]propanoate Chemical compound N1C(=O)CCC2=CC(OC(C)C(=O)OCCCCC)=CC=C21 TWVXKHLXVRWAAP-UHFFFAOYSA-N 0.000 description 1
- CQPOKUTXQWMNDQ-UHFFFAOYSA-N pentyl 4-[(2-oxo-3,4-dihydro-1h-quinolin-6-yl)oxy]butanoate Chemical compound N1C(=O)CCC2=CC(OCCCC(=O)OCCCCC)=CC=C21 CQPOKUTXQWMNDQ-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 125000001148 pentyloxycarbonyl group Chemical group 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 125000000109 phenylethoxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 235000019422 polyvinyl alcohol Nutrition 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- LOSADGOBZWIIFQ-UHFFFAOYSA-N propan-2-yl 2-[(2-oxo-1h-quinolin-6-yl)oxy]propanoate Chemical compound N1C(=O)C=CC2=CC(OC(C)C(=O)OC(C)C)=CC=C21 LOSADGOBZWIIFQ-UHFFFAOYSA-N 0.000 description 1
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 1
- 108010043671 prostatic acid phosphatase Proteins 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- LKZMBDSASOBTPN-UHFFFAOYSA-L silver carbonate Substances [Ag].[O-]C([O-])=O LKZMBDSASOBTPN-UHFFFAOYSA-L 0.000 description 1
- 229910001958 silver carbonate Inorganic materials 0.000 description 1
- 239000003998 snake venom Substances 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007901 soft capsule Substances 0.000 description 1
- 235000013599 spices Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 125000005346 substituted cycloalkyl group Chemical group 0.000 description 1
- 229960004793 sucrose Drugs 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 125000004213 tert-butoxy group Chemical group [H]C([H])([H])C(O*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6931977A JPS545981A (en) | 1977-06-10 | 1977-06-10 | Carbostyryl derivatives |
| JP6931977 | 1977-06-10 | ||
| JP7586377A JPS5412385A (en) | 1977-06-24 | 1977-06-24 | Carbostyril derivative |
| JP7586377 | 1977-06-24 | ||
| JP53023012A JPS6059912B2 (ja) | 1978-02-28 | 1978-02-28 | カルボスチリル誘導体 |
| JP2301278 | 1978-02-28 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI781811A7 FI781811A7 (fi) | 1978-12-11 |
| FI69300B FI69300B (fi) | 1985-09-30 |
| FI69300C true FI69300C (fi) | 1986-01-10 |
Family
ID=27284068
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI781811A FI69300C (fi) | 1977-06-10 | 1978-06-07 | Foerfarande foer framstaellning av terapeutiskt anvaendbara ny karbostyrilderivat |
Country Status (21)
| Country | Link |
|---|---|
| US (1) | US4298739A (OSRAM) |
| AR (2) | AR224345A1 (OSRAM) |
| AT (1) | AT367038B (OSRAM) |
| AU (1) | AU510138B2 (OSRAM) |
| CA (1) | CA1098907A (OSRAM) |
| CH (1) | CH636087A5 (OSRAM) |
| DE (1) | DE2825048A1 (OSRAM) |
| DK (1) | DK149449C (OSRAM) |
| ES (2) | ES470690A1 (OSRAM) |
| FI (1) | FI69300C (OSRAM) |
| FR (1) | FR2393795B1 (OSRAM) |
| GB (1) | GB2002745B (OSRAM) |
| IE (1) | IE46852B1 (OSRAM) |
| IT (1) | IT1108326B (OSRAM) |
| MX (1) | MX5527E (OSRAM) |
| NL (1) | NL178074C (OSRAM) |
| NO (1) | NO148813C (OSRAM) |
| NZ (1) | NZ187452A (OSRAM) |
| PH (1) | PH14670A (OSRAM) |
| PT (1) | PT68157A (OSRAM) |
| SE (1) | SE444562B (OSRAM) |
Families Citing this family (36)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU843739A3 (ru) * | 1978-02-17 | 1981-06-30 | Карл Томэ Гмбх (Фирма) | Способ получени карбостириловыхили ОКСиНдОлОВыХ пРОизВОдНыХ |
| AT383594B (de) * | 1980-02-29 | 1987-07-27 | Otsuka Pharma Co Ltd | Verfahren zum herstellen von neuen carbostyrilderivaten und ihren salzen |
| JPS56122356A (en) * | 1980-02-29 | 1981-09-25 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
| FI77852C (fi) * | 1981-02-17 | 1989-05-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av nya, saosom hjaertmediciner anvaendbara substituerade amid- och (maettad heterocykel)karbonylkarbostyrilderivat. |
| US4442111A (en) * | 1981-07-25 | 1984-04-10 | Dr. Karl Thomae Gesellschaft Mit Beschrankter Haftung | Antithrombotic sulfimino and sulfoximino indolinones-2 |
| FI80022C (fi) * | 1982-07-05 | 1990-04-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av ett nytt, terapeutiskt anvaendbart karbostyrilderivat. |
| CH655110A5 (de) * | 1982-09-03 | 1986-03-27 | Otsuka Pharma Co Ltd | Carbostyrilderivate, verfahren zu deren herstellung und arzneimittel, welche diese enthalten. |
| US4663320A (en) * | 1983-02-16 | 1987-05-05 | Syntex (U.S.A.) Inc. | (2-oxo-1,2,3,5-tetrahydroimidazo[2,1-b]quinoazolinyl)oxyalkylamides, compositions and the use thereof |
| US4490371A (en) * | 1983-02-16 | 1984-12-25 | Syntex (U.S.A.) Inc. | N,N-Disubstituted-(2-oxo-1,2,3,5-tetrahydroimidazo-[2,1-B]quinazolinyl)oxyalkylamides |
| ES8607299A1 (es) * | 1984-02-15 | 1986-06-01 | Syntex Inc | Procedimiento para preparar (2-oxo-1,2,3,5-tetrahidroimida- zo(2,1-b)quinazolinil)-oxialquilamidas |
| US4670434A (en) * | 1985-11-14 | 1987-06-02 | Syntex (U.S.A.) Inc. | (2-oxo-3-methylene-1,2,3,5-tetrahydroimidazo[2,1-b]quinazolinyl)oxyalkylamides useful as cyclic AMP phosphodiesterase inhibitors |
| US5227381A (en) * | 1988-05-02 | 1993-07-13 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivative |
| JP2753622B2 (ja) | 1988-05-02 | 1998-05-20 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| TW201305B (OSRAM) * | 1991-04-03 | 1993-03-01 | Otsuka Pharma Co Ltd | |
| KR930702307A (ko) * | 1991-08-23 | 1993-09-08 | 오오쓰까 아끼히꼬 | 카르보스티릴 유도체 및 혈소판 응집 억제제 |
| US5958926A (en) * | 1996-11-01 | 1999-09-28 | Nitromed, Inc. | Nitrosated and nitrosylated phosphodiesterase inhibitor compounds, compositions and their uses |
| US7772188B2 (en) | 2003-01-28 | 2010-08-10 | Ironwood Pharmaceuticals, Inc. | Methods and compositions for the treatment of gastrointestinal disorders |
| TWI435729B (zh) | 2005-11-09 | 2014-05-01 | Combinatorx Inc | 治療病症之方法,組合物及套組 |
| US8969514B2 (en) | 2007-06-04 | 2015-03-03 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase useful for the treatment of hypercholesterolemia, atherosclerosis, coronary heart disease, gallstone, obesity and other cardiovascular diseases |
| MX354786B (es) | 2007-06-04 | 2018-03-21 | Synergy Pharmaceuticals Inc | Agonistas de guanilato ciclasa utiles para el tratamiento de trastornos gastrointestinales, inflamacion, cancer y otros trastornos. |
| DE102008022221A1 (de) | 2008-05-06 | 2009-11-12 | Universität des Saarlandes | Inhibitoren der humanen Aldosteronsynthase CYP11B2 |
| CA2930674A1 (en) | 2008-06-04 | 2009-12-10 | Synergy Pharmaceuticals Inc. | Agonists of guanylate cyclase useful for the treatment of gastrointestinal disorders, inflammation, cancer and other disorders |
| JP2011528375A (ja) | 2008-07-16 | 2011-11-17 | シナジー ファーマシューティカルズ インコーポレイテッド | 胃腸障害、炎症、癌、およびその他の障害の治療のために有用なグアニル酸シクラーゼのアゴニスト |
| EP2196453A1 (en) * | 2008-12-10 | 2010-06-16 | Cellvir | Novel substituted aryl derivatives, their process of preparation and their therapeutical uses as anti-HIV agents |
| TWI481601B (zh) | 2009-08-21 | 2015-04-21 | Otsuka Pharma Co Ltd | 含氮化合物及藥學組成物 |
| JP5649577B2 (ja) | 2009-08-21 | 2015-01-07 | 大塚製薬株式会社 | ベンゾ[b][1,4]ジアゼピン−2,4−ジオン化合物の製造方法 |
| US8541404B2 (en) | 2009-11-09 | 2013-09-24 | Elexopharm Gmbh | Inhibitors of the human aldosterone synthase CYP11B2 |
| US9616097B2 (en) | 2010-09-15 | 2017-04-11 | Synergy Pharmaceuticals, Inc. | Formulations of guanylate cyclase C agonists and methods of use |
| KR102034748B1 (ko) | 2011-03-01 | 2019-10-21 | 시너지 파마슈티컬즈 인코포레이티드 | 구아닐레이트 사이클라제 c 작용제의 제조 방법 |
| WO2013106547A1 (en) | 2012-01-10 | 2013-07-18 | President And Fellows Of Harvard College | Beta-cell replication promoting compounds and methods of their use |
| EP3718557A3 (en) | 2013-02-25 | 2020-10-21 | Bausch Health Ireland Limited | Guanylate cyclase receptor agonist sp-333 for use in colonic cleansing |
| US9708367B2 (en) | 2013-03-15 | 2017-07-18 | Synergy Pharmaceuticals, Inc. | Agonists of guanylate cyclase and their uses |
| CA2905435A1 (en) | 2013-03-15 | 2014-09-25 | Synergy Pharmaceuticals Inc. | Compositions useful for the treatment of gastrointestinal disorders |
| EP4424697A3 (en) | 2013-06-05 | 2024-12-25 | Bausch Health Ireland Limited | Ultra-pure agonists of guanylate cyclase c, method of making and using same |
| CA2920856A1 (en) | 2013-08-09 | 2015-02-12 | Ardelyx, Inc. | Ph modulating compounds for inhibiting gastrointestinal phosphate uptake |
| CN114340631A (zh) | 2019-05-21 | 2022-04-12 | 阿德利克斯股份有限公司 | 用于降低患者的血清磷酸盐的组合 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207554A1 (es) * | 1972-12-02 | 1976-10-15 | Otsuka Pharma Co Ltd | Procedimiento para producir derivados de 3-alquil-5-((3,4-dihidro-5-carbostiril)oximetil)-oxazolidinona-(2) |
| JPS5239035B2 (OSRAM) * | 1972-12-14 | 1977-10-03 | ||
| JPS5234629B2 (OSRAM) * | 1973-02-03 | 1977-09-05 | ||
| SE431451B (sv) * | 1973-10-24 | 1984-02-06 | Otsuka Pharma Co Ltd | Forfarande for framstellning av 2,3-dihydroxipropoxikinoliner eller -isokinoliner |
| US4022784A (en) * | 1974-01-31 | 1977-05-10 | Otsuka Pharmaceutical Company Limited | 5-[1-Hydroxy-2-(substituted-amino)]alkyl-8-substituted-carbostyril and -3,4-dihydrocarbostyril derivatives |
| FI59246C (fi) * | 1974-06-24 | 1981-07-10 | Otsuka Pharma Co Ltd | Foerfarande foer framstaellning av benscykloamidderivat anvaendbara vid trombos- och emboliterapin |
| JPS54119478A (en) * | 1978-03-06 | 1979-09-17 | Otsuka Pharmaceut Co Ltd | Carbostyril derivative |
-
1978
- 1978-06-01 IE IE1104/78A patent/IE46852B1/en unknown
- 1978-06-01 NZ NZ187452A patent/NZ187452A/xx unknown
- 1978-06-06 AU AU36866/78A patent/AU510138B2/en not_active Expired
- 1978-06-07 FI FI781811A patent/FI69300C/fi not_active IP Right Cessation
- 1978-06-07 DE DE19782825048 patent/DE2825048A1/de active Granted
- 1978-06-08 NL NLAANVRAGE7806245,A patent/NL178074C/xx not_active IP Right Cessation
- 1978-06-08 FR FR7817167A patent/FR2393795B1/fr not_active Expired
- 1978-06-08 DK DK254878A patent/DK149449C/da not_active IP Right Cessation
- 1978-06-09 PT PT68157A patent/PT68157A/pt unknown
- 1978-06-09 IT IT68355/78A patent/IT1108326B/it active
- 1978-06-09 AT AT0421378A patent/AT367038B/de not_active IP Right Cessation
- 1978-06-09 MX MX787136U patent/MX5527E/es unknown
- 1978-06-09 NO NO782022A patent/NO148813C/no unknown
- 1978-06-09 CH CH632578A patent/CH636087A5/de not_active IP Right Cessation
- 1978-06-09 GB GB7826613A patent/GB2002745B/en not_active Expired
- 1978-06-09 ES ES470690A patent/ES470690A1/es not_active Expired
- 1978-06-09 SE SE7806710A patent/SE444562B/sv not_active IP Right Cessation
- 1978-06-09 PH PH21245A patent/PH14670A/en unknown
- 1978-06-09 CA CA305,102A patent/CA1098907A/en not_active Expired
- 1978-06-09 AR AR272511A patent/AR224345A1/es active
-
1979
- 1979-03-30 ES ES479138A patent/ES479138A1/es not_active Expired
-
1980
- 1980-02-05 AR AR279858A patent/AR225755A1/es active
- 1980-04-21 US US06/142,057 patent/US4298739A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI69300C (fi) | Foerfarande foer framstaellning av terapeutiskt anvaendbara ny karbostyrilderivat | |
| US11034662B2 (en) | Substituted phenothiazines as mitochondrial agents | |
| AU2004255854B2 (en) | Specific glucocorticosteroid compound having anti- inflammatory activity | |
| US5281620A (en) | Compounds having antitumor and antibacterial properties | |
| WO2021244323A1 (zh) | 一种乌帕替尼的晶型及其制备方法和用途 | |
| JPS63119469A (ja) | 糖尿病合併症用組成物 | |
| CN108864024B (zh) | 一类灯盏乙素苷元氮芥类衍生物及其制备方法和用途 | |
| BRPI0514351A2 (pt) | hidratos e polimorfos de 4-[[(7r)-8-ciclopentil-7-etil-5,6,7,8-tetrahidro-5-metil-4- 6-oxo -2-pteridinil]amino]-3-metóxi-n-(1-metil-4-piperidinil)-b enzamida, processos para sua preparação e seu uso como medicamento | |
| CA1245663A (en) | 1-nitrogen containing-7-hydroxy-indone derivatives and salts thereof | |
| WO2022170864A1 (zh) | Belumosudil甲磺酸盐的晶型及其制备方法和用途 | |
| CN114621310A (zh) | 基于雷公藤红素的靶向Prdx2降解剂及其制备方法与医药用途 | |
| ES2383604T3 (es) | Derivados de purina | |
| EP0532530B1 (en) | Derivatives of 6-aminooctahydroindolizinetriol | |
| Wiley et al. | Structure-activity relationships of nogalamycin analogs | |
| PT89120B (pt) | Processo para a preparacao de novos derivados flavonoides 2-piperazinil-2-oxo-etileno substituidos | |
| Narurkar et al. | Synthesis, physicochemical properties, and cytotoxicity of a series of 5′-ester prodrugs of 5-iodo-2′-deoxyuridine | |
| FI66347B (fi) | Foerfarande foer framstaellning av tetracyklo(4,3,0,02,4,03,7)nonanaminoderivat anvaendbara saosom antivirusmedel | |
| JP2640953B2 (ja) | 芳香族複素環化合物 | |
| KR810000819B1 (ko) | 신규 카르보스티릴 유도체의 제조 방법 | |
| EP0004270B1 (en) | Streptovaricin c derivatives, a process for their preparation and antiviral compositions containing them | |
| US4792570A (en) | 3- and 4-biphenyloxyaminoalkanes and related compounds as anti-inflammatory and analgetic agents | |
| US6242425B1 (en) | Quinolinone glycoside, production process, and anti-allergic agent | |
| JPS6059912B2 (ja) | カルボスチリル誘導体 | |
| EP0408714B1 (en) | Heterocyclic sulphonylnitromethanes, process for their preparation and pharmaceutical compositions | |
| Moffett et al. | Antispasmodics. VIII. Scopolamine Derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: OTSUKA PHARMACEUTICAL CO. LTD. |