ES2219525T3 - Derivados de 2-hidroxi-5-aminobifenilo y composiciones oxidantes para el teñido del cabello que los contienen. - Google Patents
Derivados de 2-hidroxi-5-aminobifenilo y composiciones oxidantes para el teñido del cabello que los contienen.Info
- Publication number
- ES2219525T3 ES2219525T3 ES01936066T ES01936066T ES2219525T3 ES 2219525 T3 ES2219525 T3 ES 2219525T3 ES 01936066 T ES01936066 T ES 01936066T ES 01936066 T ES01936066 T ES 01936066T ES 2219525 T3 ES2219525 T3 ES 2219525T3
- Authority
- ES
- Spain
- Prior art keywords
- hydroxy
- amino
- aminobiphenyl
- methylbiphenyl
- dihydroxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000001590 oxidative effect Effects 0.000 title claims abstract description 10
- 239000000203 mixture Substances 0.000 title description 30
- 210000004209 hair Anatomy 0.000 claims abstract description 31
- OUIITAOCYATDMY-UHFFFAOYSA-N 4-amino-2-phenylphenol Chemical group NC1=CC=C(O)C(C=2C=CC=CC=2)=C1 OUIITAOCYATDMY-UHFFFAOYSA-N 0.000 claims abstract description 26
- 102000011782 Keratins Human genes 0.000 claims abstract description 5
- 108010076876 Keratins Proteins 0.000 claims abstract description 5
- 239000000835 fiber Substances 0.000 claims abstract description 5
- 238000004043 dyeing Methods 0.000 claims description 39
- 239000000126 substance Substances 0.000 claims description 37
- 238000010168 coupling process Methods 0.000 claims description 16
- 238000005859 coupling reaction Methods 0.000 claims description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 15
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 claims description 12
- 150000003839 salts Chemical class 0.000 claims description 10
- YNMBFENJNQBPCW-UHFFFAOYSA-N 4-amino-2-(1,3-benzodioxol-5-yl)phenol Chemical compound NC1=CC=C(O)C(C=2C=C3OCOC3=CC=2)=C1 YNMBFENJNQBPCW-UHFFFAOYSA-N 0.000 claims description 8
- RJHNKPWRNNSCDI-UHFFFAOYSA-N 4-amino-2-(3,4-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(N)C(N)=CC=2)=C1 RJHNKPWRNNSCDI-UHFFFAOYSA-N 0.000 claims description 8
- QCIUKXVKSYXERR-UHFFFAOYSA-N 4-amino-2-(3,5-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(N)C=C(N)C=2)=C1 QCIUKXVKSYXERR-UHFFFAOYSA-N 0.000 claims description 8
- 235000010290 biphenyl Nutrition 0.000 claims description 7
- 239000004305 biphenyl Substances 0.000 claims description 6
- HAXBFLYMCGIMRG-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)benzene-1,4-diol Chemical group NC1=CC=C(O)C(C=2C(=CC=C(O)C=2)O)=C1 HAXBFLYMCGIMRG-UHFFFAOYSA-N 0.000 claims description 4
- WEKDDYLNVFKSMY-UHFFFAOYSA-N 3-(5-amino-2-hydroxyphenyl)benzene-1,2-diol Chemical group NC1=CC=C(O)C(C=2C(=C(O)C=CC=2)O)=C1 WEKDDYLNVFKSMY-UHFFFAOYSA-N 0.000 claims description 4
- NBHBXUNTCONPMS-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)benzene-1,2-diol Chemical group NC1=CC=C(O)C(C=2C=C(O)C(O)=CC=2)=C1 NBHBXUNTCONPMS-UHFFFAOYSA-N 0.000 claims description 4
- CZMVCMRMMBOFKD-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C(=CC(O)=CC=2)O)=C1 CZMVCMRMMBOFKD-UHFFFAOYSA-N 0.000 claims description 4
- JFDDJMGDENVCMM-UHFFFAOYSA-N 4-amino-2-(2,3-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=C(N)C=CC=2)N)=C1 JFDDJMGDENVCMM-UHFFFAOYSA-N 0.000 claims description 4
- FXNOGIGDQUESPZ-UHFFFAOYSA-N 4-amino-2-(2,3-dimethoxyphenyl)phenol Chemical group COC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1OC FXNOGIGDQUESPZ-UHFFFAOYSA-N 0.000 claims description 4
- DKSLXCIKORZOQZ-UHFFFAOYSA-N 4-amino-2-(2,3-dimethylphenyl)phenol Chemical group CC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1C DKSLXCIKORZOQZ-UHFFFAOYSA-N 0.000 claims description 4
- MTCGUHLIOKOAMZ-UHFFFAOYSA-N 4-amino-2-(2,4-diaminophenyl)phenol Chemical group NC1=CC(N)=CC=C1C1=CC(N)=CC=C1O MTCGUHLIOKOAMZ-UHFFFAOYSA-N 0.000 claims description 4
- HEHRWKCLGZTWEZ-UHFFFAOYSA-N 4-amino-2-(2,4-dimethoxyphenyl)phenol Chemical group COC1=CC(OC)=CC=C1C1=CC(N)=CC=C1O HEHRWKCLGZTWEZ-UHFFFAOYSA-N 0.000 claims description 4
- OMTGKSHBSMHRTI-UHFFFAOYSA-N 4-amino-2-(2,4-dimethylphenyl)phenol Chemical group CC1=CC(C)=CC=C1C1=CC(N)=CC=C1O OMTGKSHBSMHRTI-UHFFFAOYSA-N 0.000 claims description 4
- XKTILKUKYRRDBV-UHFFFAOYSA-N 4-amino-2-(2,5-diaminophenyl)phenol Chemical group NC1=CC=C(N)C(C=2C(=CC=C(N)C=2)O)=C1 XKTILKUKYRRDBV-UHFFFAOYSA-N 0.000 claims description 4
- YYCPBDLKCVTALI-UHFFFAOYSA-N 4-amino-2-(2,5-dimethoxyphenyl)phenol Chemical group COC1=CC=C(OC)C(C=2C(=CC=C(N)C=2)O)=C1 YYCPBDLKCVTALI-UHFFFAOYSA-N 0.000 claims description 4
- ZBORPSOEPLWCLP-UHFFFAOYSA-N 4-amino-2-(2,5-dimethylphenyl)phenol Chemical group CC1=CC=C(C)C(C=2C(=CC=C(N)C=2)O)=C1 ZBORPSOEPLWCLP-UHFFFAOYSA-N 0.000 claims description 4
- PXAONKFULAFDEM-UHFFFAOYSA-N 4-amino-2-(2,6-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2N)N)=C1 PXAONKFULAFDEM-UHFFFAOYSA-N 0.000 claims description 4
- KXGUSLMRSWGWJE-UHFFFAOYSA-N 4-amino-2-(2,6-dimethoxyphenyl)phenol Chemical group COC1=CC=CC(OC)=C1C1=CC(N)=CC=C1O KXGUSLMRSWGWJE-UHFFFAOYSA-N 0.000 claims description 4
- DQAQEZHPBNGGLL-UHFFFAOYSA-N 4-amino-2-(2,6-dimethylphenyl)phenol Chemical group CC1=CC=CC(C)=C1C1=CC(N)=CC=C1O DQAQEZHPBNGGLL-UHFFFAOYSA-N 0.000 claims description 4
- DVYSQOKCDAFDOF-UHFFFAOYSA-N 4-amino-2-(2-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)O)=C1 DVYSQOKCDAFDOF-UHFFFAOYSA-N 0.000 claims description 4
- AKLYZRIEEOWPGH-UHFFFAOYSA-N 4-amino-2-(3,4-dimethylphenyl)phenol Chemical group C1=C(C)C(C)=CC=C1C1=CC(N)=CC=C1O AKLYZRIEEOWPGH-UHFFFAOYSA-N 0.000 claims description 4
- MSPZHMQMPURHOC-UHFFFAOYSA-N 4-amino-2-(3,5-dimethoxyphenyl)phenol Chemical group COC1=CC(OC)=CC(C=2C(=CC=C(N)C=2)O)=C1 MSPZHMQMPURHOC-UHFFFAOYSA-N 0.000 claims description 4
- OZTLHVYMVYUYEO-UHFFFAOYSA-N 4-amino-2-[4-(2-hydroxyethoxy)phenyl]phenol Chemical group NC1=CC=C(O)C(C=2C=CC(OCCO)=CC=2)=C1 OZTLHVYMVYUYEO-UHFFFAOYSA-N 0.000 claims description 4
- GKYYCYYUISXDGU-UHFFFAOYSA-N 4-amino-2-chloro-6-phenylphenol Chemical group NC1=CC(Cl)=C(O)C(C=2C=CC=CC=2)=C1 GKYYCYYUISXDGU-UHFFFAOYSA-N 0.000 claims description 4
- RFVFQBQPLAMLPQ-UHFFFAOYSA-N 4-amino-2-methyl-6-phenylphenol Chemical group CC1=CC(N)=CC(C=2C=CC=CC=2)=C1O RFVFQBQPLAMLPQ-UHFFFAOYSA-N 0.000 claims description 4
- RHRORMFBBKWBFJ-UHFFFAOYSA-N 4-amino-5-chloro-2-phenylphenol Chemical group C1=C(Cl)C(N)=CC(C=2C=CC=CC=2)=C1O RHRORMFBBKWBFJ-UHFFFAOYSA-N 0.000 claims description 4
- SRCIGBLEKXKNTL-UHFFFAOYSA-N 4-amino-5-methyl-2-phenylphenol Chemical group C1=C(N)C(C)=CC(O)=C1C1=CC=CC=C1 SRCIGBLEKXKNTL-UHFFFAOYSA-N 0.000 claims description 4
- CZQIPSQDABDXAP-UHFFFAOYSA-N 5-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C=C(O)C=C(O)C=2)=C1 CZQIPSQDABDXAP-UHFFFAOYSA-N 0.000 claims description 4
- GAXVAVVWPVYIJJ-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2O)O)=C1 GAXVAVVWPVYIJJ-UHFFFAOYSA-N 0.000 claims description 3
- WTAXACPBNGVHSU-UHFFFAOYSA-N 4-amino-2-(3,4-dimethoxyphenyl)phenol Chemical group C1=C(OC)C(OC)=CC=C1C1=CC(N)=CC=C1O WTAXACPBNGVHSU-UHFFFAOYSA-N 0.000 claims description 3
- LKGFIUAOMYSEJF-UHFFFAOYSA-N 4-amino-2-(4-aminophenyl)phenol Chemical group C1=CC(N)=CC=C1C1=CC(N)=CC=C1O LKGFIUAOMYSEJF-UHFFFAOYSA-N 0.000 claims description 3
- KQKIWZGNBJLCOS-UHFFFAOYSA-N 4-amino-2-(4-hydroxy-2-methylphenyl)phenol Chemical group CC1=CC(O)=CC=C1C1=CC(N)=CC=C1O KQKIWZGNBJLCOS-UHFFFAOYSA-N 0.000 claims description 3
- BZTCYXKUXFHCKD-UHFFFAOYSA-N 4-amino-2-(4-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=CC(O)=CC=2)=C1 BZTCYXKUXFHCKD-UHFFFAOYSA-N 0.000 claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 3
- ZFVWYKGCIJJIJL-UHFFFAOYSA-N 4-amino-2-(3,5-dimethylphenyl)phenol Chemical group CC1=CC(C)=CC(C=2C(=CC=C(N)C=2)O)=C1 ZFVWYKGCIJJIJL-UHFFFAOYSA-N 0.000 claims description 2
- KDKJCTDUUJQJTC-UHFFFAOYSA-N 4-amino-2-(3-nitrophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 KDKJCTDUUJQJTC-UHFFFAOYSA-N 0.000 claims 2
- 239000003795 chemical substances by application Substances 0.000 abstract description 2
- 239000003086 colorant Substances 0.000 abstract 1
- 239000007822 coupling agent Substances 0.000 abstract 1
- PVFOHMXILQEIHX-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-bromophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Br PVFOHMXILQEIHX-UHFFFAOYSA-N 0.000 description 41
- 238000001819 mass spectrum Methods 0.000 description 41
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 30
- 239000000047 product Substances 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 239000000243 solution Substances 0.000 description 16
- 230000008878 coupling Effects 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 238000003786 synthesis reaction Methods 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000007864 aqueous solution Substances 0.000 description 11
- 230000015572 biosynthetic process Effects 0.000 description 11
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 9
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 9
- 239000000975 dye Substances 0.000 description 9
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 8
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 7
- 239000007800 oxidant agent Substances 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 238000002360 preparation method Methods 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 4
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- 150000002191 fatty alcohols Chemical class 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000002453 shampoo Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- 229910052938 sodium sulfate Inorganic materials 0.000 description 4
- 235000011152 sodium sulphate Nutrition 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XWOXROPAWASYJZ-UHFFFAOYSA-N 2-bromo-1-(methoxymethoxy)-4-nitrobenzene Chemical compound COCOC1=CC=C([N+]([O-])=O)C=C1Br XWOXROPAWASYJZ-UHFFFAOYSA-N 0.000 description 3
- FIBBSIRCVZWBML-UHFFFAOYSA-N 4-nitro-2-phenylphenol Chemical group OC1=CC=C([N+]([O-])=O)C=C1C1=CC=CC=C1 FIBBSIRCVZWBML-UHFFFAOYSA-N 0.000 description 3
- DCIPFSYBGTWYCR-UHFFFAOYSA-N 5847-59-6 Chemical compound OC1=CC=C([N+]([O-])=O)C=C1Br DCIPFSYBGTWYCR-UHFFFAOYSA-N 0.000 description 3
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 235000010323 ascorbic acid Nutrition 0.000 description 3
- 229960005070 ascorbic acid Drugs 0.000 description 3
- 239000011668 ascorbic acid Substances 0.000 description 3
- 235000015165 citric acid Nutrition 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000000982 direct dye Substances 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 239000003906 humectant Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- HVRUGFJYCAFAAN-UHFFFAOYSA-N 1-bromo-2-ethylbenzene Chemical compound CCC1=CC=CC=C1Br HVRUGFJYCAFAAN-UHFFFAOYSA-N 0.000 description 2
- URFPRAHGGBYNPW-UHFFFAOYSA-N 1-bromo-4-ethylbenzene Chemical compound CCC1=CC=C(Br)C=C1 URFPRAHGGBYNPW-UHFFFAOYSA-N 0.000 description 2
- BMIBJCFFZPYJHF-UHFFFAOYSA-N 2-methoxy-5-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine Chemical compound COC1=NC=C(C)C=C1B1OC(C)(C)C(C)(C)O1 BMIBJCFFZPYJHF-UHFFFAOYSA-N 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- 229940018563 3-aminophenol Drugs 0.000 description 2
- BYFJQAZKIBIOIW-UHFFFAOYSA-N 4-amino-2-phenylphenol;hydrochloride Chemical group [Cl-].[NH3+]C1=CC=C(O)C(C=2C=CC=CC=2)=C1 BYFJQAZKIBIOIW-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- XJUZRXYOEPSWMB-UHFFFAOYSA-N Chloromethyl methyl ether Chemical compound COCCl XJUZRXYOEPSWMB-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229910002666 PdCl2 Inorganic materials 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- LUSZGTFNYDARNI-UHFFFAOYSA-N Sesamol Chemical compound OC1=CC=C2OCOC2=C1 LUSZGTFNYDARNI-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 235000011054 acetic acid Nutrition 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- -1 aliphatic alcohols Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 229940061627 chloromethyl methyl ether Drugs 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 235000019646 color tone Nutrition 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229940049964 oleate Drugs 0.000 description 2
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000011780 sodium chloride Substances 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- WVOAPRDRMLHUMI-UHFFFAOYSA-N (2-methylnaphthalen-1-yl) acetate Chemical compound C1=CC=C2C(OC(=O)C)=C(C)C=CC2=C1 WVOAPRDRMLHUMI-UHFFFAOYSA-N 0.000 description 1
- SUYJXERPRICYRX-UHFFFAOYSA-N (3-bromophenyl)methanamine Chemical compound NCC1=CC=CC(Br)=C1 SUYJXERPRICYRX-UHFFFAOYSA-N 0.000 description 1
- XGNXYCFREOZBOL-UHFFFAOYSA-N 1,3-benzodioxol-5-amine Chemical compound NC1=CC=C2OCOC2=C1 XGNXYCFREOZBOL-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- HHVMYUPMJJDVPG-UHFFFAOYSA-N 1-(2,5-diaminophenyl)ethanol Chemical compound CC(O)C1=CC(N)=CC=C1N HHVMYUPMJJDVPG-UHFFFAOYSA-N 0.000 description 1
- XTDTYSBVMBQIBT-UHFFFAOYSA-N 1-(4-bromophenyl)ethanol Chemical compound CC(O)C1=CC=C(Br)C=C1 XTDTYSBVMBQIBT-UHFFFAOYSA-N 0.000 description 1
- ZMHFPXBHUQIOSN-UHFFFAOYSA-N 1-[3-(5-amino-2-hydroxyphenyl)phenyl]ethanone;hydrochloride Chemical compound Cl.CC(=O)C1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 ZMHFPXBHUQIOSN-UHFFFAOYSA-N 0.000 description 1
- NIUZVSQOXJIHBL-UHFFFAOYSA-N 1-bromo-2,4-dimethoxybenzene Chemical compound COC1=CC=C(Br)C(OC)=C1 NIUZVSQOXJIHBL-UHFFFAOYSA-N 0.000 description 1
- YSFLQVNTBBUKEA-UHFFFAOYSA-N 1-bromo-2,4-dimethylbenzene Chemical group CC1=CC=C(Br)C(C)=C1 YSFLQVNTBBUKEA-UHFFFAOYSA-N 0.000 description 1
- IPWBFGUBXWMIPR-UHFFFAOYSA-N 1-bromo-2-fluorobenzene Chemical compound FC1=CC=CC=C1Br IPWBFGUBXWMIPR-UHFFFAOYSA-N 0.000 description 1
- HTDQSWDEWGSAMN-UHFFFAOYSA-N 1-bromo-2-methoxybenzene Chemical compound COC1=CC=CC=C1Br HTDQSWDEWGSAMN-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- ALAQDUSTXPEHMH-UHFFFAOYSA-N 1-bromo-2-methylsulfanylbenzene Chemical compound CSC1=CC=CC=C1Br ALAQDUSTXPEHMH-UHFFFAOYSA-N 0.000 description 1
- LMFRTSBQRLSJHC-UHFFFAOYSA-N 1-bromo-3,5-dimethylbenzene Chemical group CC1=CC(C)=CC(Br)=C1 LMFRTSBQRLSJHC-UHFFFAOYSA-N 0.000 description 1
- LQBMPJSTUHWGDE-UHFFFAOYSA-N 1-bromo-3-ethoxybenzene Chemical compound CCOC1=CC=CC(Br)=C1 LQBMPJSTUHWGDE-UHFFFAOYSA-N 0.000 description 1
- QDFKKJYEIFBEFC-UHFFFAOYSA-N 1-bromo-3-fluorobenzene Chemical compound FC1=CC=CC(Br)=C1 QDFKKJYEIFBEFC-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- XLQSXGGDTHANLN-UHFFFAOYSA-N 1-bromo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(Br)C=C1 XLQSXGGDTHANLN-UHFFFAOYSA-N 0.000 description 1
- WVUYYXUATWMVIT-UHFFFAOYSA-N 1-bromo-4-ethoxybenzene Chemical compound CCOC1=CC=C(Br)C=C1 WVUYYXUATWMVIT-UHFFFAOYSA-N 0.000 description 1
- AITNMTXHTIIIBB-UHFFFAOYSA-N 1-bromo-4-fluorobenzene Chemical compound FC1=CC=C(Br)C=C1 AITNMTXHTIIIBB-UHFFFAOYSA-N 0.000 description 1
- BLZNSXFQRKVFRP-UHFFFAOYSA-N 1-bromo-4-methoxy-2-methylbenzene Chemical compound COC1=CC=C(Br)C(C)=C1 BLZNSXFQRKVFRP-UHFFFAOYSA-N 0.000 description 1
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 1
- YEUYZNNBXLMFCW-UHFFFAOYSA-N 1-bromo-4-methylsulfanylbenzene Chemical compound CSC1=CC=C(Br)C=C1 YEUYZNNBXLMFCW-UHFFFAOYSA-N 0.000 description 1
- ZDFBKZUDCQQKAC-UHFFFAOYSA-N 1-bromo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C=C1 ZDFBKZUDCQQKAC-UHFFFAOYSA-N 0.000 description 1
- XHCAGOVGSDHHNP-UHFFFAOYSA-N 1-bromo-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(Br)C=C1 XHCAGOVGSDHHNP-UHFFFAOYSA-N 0.000 description 1
- XAWPKHNOFIWWNZ-UHFFFAOYSA-N 1h-indol-6-ol Chemical compound OC1=CC=C2C=CNC2=C1 XAWPKHNOFIWWNZ-UHFFFAOYSA-N 0.000 description 1
- ORVPXPKEZLTMNW-UHFFFAOYSA-N 1h-indol-7-ol Chemical compound OC1=CC=CC2=C1NC=C2 ORVPXPKEZLTMNW-UHFFFAOYSA-N 0.000 description 1
- LHGQFZQWSOXLEW-UHFFFAOYSA-N 1h-pyrazole-4,5-diamine Chemical class NC=1C=NNC=1N LHGQFZQWSOXLEW-UHFFFAOYSA-N 0.000 description 1
- MJMRSGYLARBUDK-UHFFFAOYSA-N 2,4-dimethoxybenzene-1,3-diamine Chemical compound COC1=CC=C(N)C(OC)=C1N MJMRSGYLARBUDK-UHFFFAOYSA-N 0.000 description 1
- 229940075142 2,5-diaminotoluene Drugs 0.000 description 1
- BXBOXUNPNIJELB-UHFFFAOYSA-N 2,6-dimethoxypyridine-3,5-diamine Chemical compound COC1=NC(OC)=C(N)C=C1N BXBOXUNPNIJELB-UHFFFAOYSA-N 0.000 description 1
- BQHMISUMCDYQTR-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylamino)ethanol Chemical compound OCCNC1=CC=C2OCOC2=C1 BQHMISUMCDYQTR-UHFFFAOYSA-N 0.000 description 1
- ZFFAFXDAFACVBX-UHFFFAOYSA-N 2-(2,4-diamino-5-methylphenoxy)ethanol Chemical compound CC1=CC(OCCO)=C(N)C=C1N ZFFAFXDAFACVBX-UHFFFAOYSA-N 0.000 description 1
- UEANEAODIZOETQ-UHFFFAOYSA-N 2-(2,4-diaminophenoxy)acetic acid Chemical compound NC1=CC=C(OCC(O)=O)C(N)=C1 UEANEAODIZOETQ-UHFFFAOYSA-N 0.000 description 1
- WCPGNFONICRLCL-UHFFFAOYSA-N 2-(2,4-diaminophenoxy)ethanol Chemical compound NC1=CC=C(OCCO)C(N)=C1 WCPGNFONICRLCL-UHFFFAOYSA-N 0.000 description 1
- ADLOWZRDUHSVRU-UHFFFAOYSA-N 2-(2-bromophenyl)ethanol Chemical compound OCCC1=CC=CC=C1Br ADLOWZRDUHSVRU-UHFFFAOYSA-N 0.000 description 1
- VPNFSZXMQLABLM-UHFFFAOYSA-N 2-(2-ethoxyanilino)ethanol Chemical compound CCOC1=CC=CC=C1NCCO VPNFSZXMQLABLM-UHFFFAOYSA-N 0.000 description 1
- SBUMIGFDXJIPLE-UHFFFAOYSA-N 2-(3-amino-4-methoxyanilino)ethanol Chemical compound COC1=CC=C(NCCO)C=C1N SBUMIGFDXJIPLE-UHFFFAOYSA-N 0.000 description 1
- ZTNLMELMADJSAH-UHFFFAOYSA-N 2-(3-aminoanilino)ethanol Chemical compound NC1=CC=CC(NCCO)=C1 ZTNLMELMADJSAH-UHFFFAOYSA-N 0.000 description 1
- JEGKOEYHLJTZGJ-UHFFFAOYSA-N 2-(3-hydroxyanilino)acetamide Chemical compound NC(=O)CNC1=CC=CC(O)=C1 JEGKOEYHLJTZGJ-UHFFFAOYSA-N 0.000 description 1
- KDBUTNSQYYLYOY-UHFFFAOYSA-N 2-(4,5-diaminopyrazol-1-yl)ethanol Chemical compound NC=1C=NN(CCO)C=1N KDBUTNSQYYLYOY-UHFFFAOYSA-N 0.000 description 1
- QYIOGYCRGNHDNK-UHFFFAOYSA-N 2-(4-bromophenoxy)ethanol Chemical compound OCCOC1=CC=C(Br)C=C1 QYIOGYCRGNHDNK-UHFFFAOYSA-N 0.000 description 1
- PMOSJSPFNDUAFY-UHFFFAOYSA-N 2-(4-bromophenyl)ethanol Chemical compound OCCC1=CC=C(Br)C=C1 PMOSJSPFNDUAFY-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- PBBRFJWECSDSDZ-UHFFFAOYSA-N 2-[2,4-diamino-5-(2-hydroxyethoxy)phenoxy]ethanol Chemical compound NC1=CC(N)=C(OCCO)C=C1OCCO PBBRFJWECSDSDZ-UHFFFAOYSA-N 0.000 description 1
- QSQJPVOCPBBFNL-UHFFFAOYSA-N 2-[2-amino-4-(methylamino)phenoxy]ethanol Chemical compound CNC1=CC=C(OCCO)C(N)=C1 QSQJPVOCPBBFNL-UHFFFAOYSA-N 0.000 description 1
- MQMMMSDSVNOFJM-UHFFFAOYSA-N 2-[3-amino-n-(2-hydroxyethyl)anilino]ethanol Chemical compound NC1=CC=CC(N(CCO)CCO)=C1 MQMMMSDSVNOFJM-UHFFFAOYSA-N 0.000 description 1
- PDFQDTGOGSGZPN-UHFFFAOYSA-N 2-[5-(2-hydroxyethylamino)-2,4-dimethoxyanilino]ethanol Chemical compound COC1=CC(OC)=C(NCCO)C=C1NCCO PDFQDTGOGSGZPN-UHFFFAOYSA-N 0.000 description 1
- HCPJEHJGFKWRFM-UHFFFAOYSA-N 2-amino-5-methylphenol Chemical compound CC1=CC=C(N)C(O)=C1 HCPJEHJGFKWRFM-UHFFFAOYSA-N 0.000 description 1
- ALQKEYVDQYGZDN-UHFFFAOYSA-N 2-amino-6-methylphenol Chemical compound CC1=CC=CC(N)=C1O ALQKEYVDQYGZDN-UHFFFAOYSA-N 0.000 description 1
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 1
- QXISTPDUYKNPLU-UHFFFAOYSA-N 2-bromo-1,4-dimethylbenzene Chemical group CC1=CC=C(C)C(Br)=C1 QXISTPDUYKNPLU-UHFFFAOYSA-N 0.000 description 1
- SFGFOJPGCOYQJK-UHFFFAOYSA-N 2-bromo-4-fluoro-1-methylbenzene Chemical compound CC1=CC=C(F)C=C1Br SFGFOJPGCOYQJK-UHFFFAOYSA-N 0.000 description 1
- SWZVJOLLQTWFCW-UHFFFAOYSA-N 2-chlorobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1Cl SWZVJOLLQTWFCW-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- OBCSAIDCZQSFQH-UHFFFAOYSA-N 2-methyl-1,4-phenylenediamine Chemical compound CC1=CC(N)=CC=C1N OBCSAIDCZQSFQH-UHFFFAOYSA-N 0.000 description 1
- ZTMADXFOCUXMJE-UHFFFAOYSA-N 2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=CC=C1O ZTMADXFOCUXMJE-UHFFFAOYSA-N 0.000 description 1
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 1
- CEAZJJWZNUEYAN-UHFFFAOYSA-N 3,5-dimethoxypyridine-2,6-diamine Chemical compound COC1=CC(OC)=C(N)N=C1N CEAZJJWZNUEYAN-UHFFFAOYSA-N 0.000 description 1
- LMLXFTWWTZTUSE-UHFFFAOYSA-N 3-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=C(O)C=CC=C1NCCO LMLXFTWWTZTUSE-UHFFFAOYSA-N 0.000 description 1
- YBJRIYRYCGKUIM-UHFFFAOYSA-N 3-(2-hydroxyethylamino)phenol Chemical compound OCCNC1=CC=CC(O)=C1 YBJRIYRYCGKUIM-UHFFFAOYSA-N 0.000 description 1
- GOIOOIZLSGKBBH-UHFFFAOYSA-N 3-(2-methoxyethylamino)phenol Chemical compound COCCNC1=CC=CC(O)=C1 GOIOOIZLSGKBBH-UHFFFAOYSA-N 0.000 description 1
- YHRACTMMZSGROP-UHFFFAOYSA-N 3-(3-hydroxy-2-methylanilino)propane-1,2-diol Chemical compound CC1=C(O)C=CC=C1NCC(O)CO YHRACTMMZSGROP-UHFFFAOYSA-N 0.000 description 1
- IOTXWNNKKWUPLP-UHFFFAOYSA-N 3-(5-amino-2-hydroxyphenyl)benzonitrile;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=C(C=CC=2)C#N)=C1 IOTXWNNKKWUPLP-UHFFFAOYSA-N 0.000 description 1
- WAVOOWVINKGEHS-UHFFFAOYSA-N 3-(diethylamino)phenol Chemical compound CCN(CC)C1=CC=CC(O)=C1 WAVOOWVINKGEHS-UHFFFAOYSA-N 0.000 description 1
- MESJRHHDBDCQTH-UHFFFAOYSA-N 3-(dimethylamino)phenol Chemical compound CN(C)C1=CC=CC(O)=C1 MESJRHHDBDCQTH-UHFFFAOYSA-N 0.000 description 1
- SYRZWFBWUASJJI-UHFFFAOYSA-N 3-amino-2,4-dichlorophenol Chemical compound NC1=C(Cl)C=CC(O)=C1Cl SYRZWFBWUASJJI-UHFFFAOYSA-N 0.000 description 1
- XYRDGCCCBJITBH-UHFFFAOYSA-N 3-amino-2-chloro-6-methylphenol Chemical compound CC1=CC=C(N)C(Cl)=C1O XYRDGCCCBJITBH-UHFFFAOYSA-N 0.000 description 1
- FLROJJGKUKLCAE-UHFFFAOYSA-N 3-amino-2-methylphenol Chemical compound CC1=C(N)C=CC=C1O FLROJJGKUKLCAE-UHFFFAOYSA-N 0.000 description 1
- STXAVEHFKAXGOX-UHFFFAOYSA-N 3-bromobenzonitrile Chemical compound BrC1=CC=CC(C#N)=C1 STXAVEHFKAXGOX-UHFFFAOYSA-N 0.000 description 1
- MNOJRWOWILAHAV-UHFFFAOYSA-N 3-bromophenol Chemical compound OC1=CC=CC(Br)=C1 MNOJRWOWILAHAV-UHFFFAOYSA-N 0.000 description 1
- LRZCBJYTBUZEFK-UHFFFAOYSA-N 3-n-(2-aminoethyl)benzene-1,3-diamine Chemical compound NCCNC1=CC=CC(N)=C1 LRZCBJYTBUZEFK-UHFFFAOYSA-N 0.000 description 1
- JDDBEGQJCQQHNB-UHFFFAOYSA-N 4,5-dichloro-2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=C(Cl)C(Cl)=C1O JDDBEGQJCQQHNB-UHFFFAOYSA-N 0.000 description 1
- GRLQBYQELUWBIO-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-diol Chemical compound OC1=CC(O)=C(Cl)C=C1Cl GRLQBYQELUWBIO-UHFFFAOYSA-N 0.000 description 1
- BNRMHEDSMWOIMC-UHFFFAOYSA-N 4-(2-aminoethoxy)benzene-1,3-diamine Chemical compound NCCOC1=CC=C(N)C=C1N BNRMHEDSMWOIMC-UHFFFAOYSA-N 0.000 description 1
- ZXRXGFZRWKYPBG-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)benzonitrile;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=CC(=CC=2)C#N)=C1 ZXRXGFZRWKYPBG-UHFFFAOYSA-N 0.000 description 1
- BGGGDHXHMQFBGA-UHFFFAOYSA-N 4-[(2,4-diaminophenoxy)methoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCOC1=CC=C(N)C=C1N BGGGDHXHMQFBGA-UHFFFAOYSA-N 0.000 description 1
- MWKPYVXITDAZLL-UHFFFAOYSA-N 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCCCOC1=CC=C(N)C=C1N MWKPYVXITDAZLL-UHFFFAOYSA-N 0.000 description 1
- DWWHAGIRMKBAQX-UHFFFAOYSA-N 4-amino-2-(1,3-benzodioxol-5-yl)phenol;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=C3OCOC3=CC=2)=C1 DWWHAGIRMKBAQX-UHFFFAOYSA-N 0.000 description 1
- IYSZGCHUZOJDFQ-UHFFFAOYSA-N 4-amino-2-(1h-indol-5-yl)phenol;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=C3C=CNC3=CC=2)=C1 IYSZGCHUZOJDFQ-UHFFFAOYSA-N 0.000 description 1
- YJUQXKQZCRXXOE-UHFFFAOYSA-N 4-amino-2-(2,3-dimethylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1C YJUQXKQZCRXXOE-UHFFFAOYSA-N 0.000 description 1
- MPAXWYZZACTTQM-UHFFFAOYSA-N 4-amino-2-(2,4-dimethoxyphenyl)phenol;hydrochloride Chemical group Cl.COC1=CC(OC)=CC=C1C1=CC(N)=CC=C1O MPAXWYZZACTTQM-UHFFFAOYSA-N 0.000 description 1
- REDWBHKTQBEAHF-UHFFFAOYSA-N 4-amino-2-(2,4-dimethylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC(C)=CC=C1C1=CC(N)=CC=C1O REDWBHKTQBEAHF-UHFFFAOYSA-N 0.000 description 1
- SFBYVIZSLCEQGH-UHFFFAOYSA-N 4-amino-2-(2,5-dimethoxyphenyl)phenol;hydrochloride Chemical group Cl.COC1=CC=C(OC)C(C=2C(=CC=C(N)C=2)O)=C1 SFBYVIZSLCEQGH-UHFFFAOYSA-N 0.000 description 1
- LCOATZPNGVQHQL-UHFFFAOYSA-N 4-amino-2-(2,5-dimethylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC=C(C)C(C=2C(=CC=C(N)C=2)O)=C1 LCOATZPNGVQHQL-UHFFFAOYSA-N 0.000 description 1
- RWPBAOSCVOIAMV-UHFFFAOYSA-N 4-amino-2-(2-ethylphenyl)phenol;hydrochloride Chemical group Cl.CCC1=CC=CC=C1C1=CC(N)=CC=C1O RWPBAOSCVOIAMV-UHFFFAOYSA-N 0.000 description 1
- RTTMUPWCRGJLAQ-UHFFFAOYSA-N 4-amino-2-(2-fluorophenyl)phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C(=CC=CC=2)F)=C1 RTTMUPWCRGJLAQ-UHFFFAOYSA-N 0.000 description 1
- FZPQOPOJOBPLHG-UHFFFAOYSA-N 4-amino-2-(2-methoxyphenyl)phenol;hydrochloride Chemical group Cl.COC1=CC=CC=C1C1=CC(N)=CC=C1O FZPQOPOJOBPLHG-UHFFFAOYSA-N 0.000 description 1
- GAHRSNIGTLKPIK-UHFFFAOYSA-N 4-amino-2-(2-methylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC=CC=C1C1=CC(N)=CC=C1O GAHRSNIGTLKPIK-UHFFFAOYSA-N 0.000 description 1
- BVKUQMUBBONGTE-UHFFFAOYSA-N 4-amino-2-(2-methylsulfanylphenyl)phenol;hydrochloride Chemical group Cl.CSC1=CC=CC=C1C1=CC(N)=CC=C1O BVKUQMUBBONGTE-UHFFFAOYSA-N 0.000 description 1
- GHNFVXXACGHKJL-UHFFFAOYSA-N 4-amino-2-(3,4-dimethylphenyl)phenol;hydrochloride Chemical group Cl.C1=C(C)C(C)=CC=C1C1=CC(N)=CC=C1O GHNFVXXACGHKJL-UHFFFAOYSA-N 0.000 description 1
- QKUSGRVOXJUBRG-UHFFFAOYSA-N 4-amino-2-(3,5-dimethylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC(C)=CC(C=2C(=CC=C(N)C=2)O)=C1 QKUSGRVOXJUBRG-UHFFFAOYSA-N 0.000 description 1
- RBDXVYJXFAHWHI-UHFFFAOYSA-N 4-amino-2-(3-ethoxyphenyl)phenol;hydrochloride Chemical group Cl.CCOC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 RBDXVYJXFAHWHI-UHFFFAOYSA-N 0.000 description 1
- CRQITUPSESKUKH-UHFFFAOYSA-N 4-amino-2-(3-fluorophenyl)phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=C(F)C=CC=2)=C1 CRQITUPSESKUKH-UHFFFAOYSA-N 0.000 description 1
- VIMSOOVPYNUTNT-UHFFFAOYSA-N 4-amino-2-(3-hydroxyphenyl)phenol;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=C(O)C=CC=2)=C1 VIMSOOVPYNUTNT-UHFFFAOYSA-N 0.000 description 1
- CSIYMHXERHJFKH-UHFFFAOYSA-N 4-amino-2-(3-methoxyphenyl)phenol;hydrochloride Chemical group Cl.COC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 CSIYMHXERHJFKH-UHFFFAOYSA-N 0.000 description 1
- RAFJAUASTFGZTK-UHFFFAOYSA-N 4-amino-2-(3-methylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 RAFJAUASTFGZTK-UHFFFAOYSA-N 0.000 description 1
- CNLDLWPMQTUIJB-UHFFFAOYSA-N 4-amino-2-(4-aminophenyl)phenol;hydrochloride Chemical group Cl.C1=CC(N)=CC=C1C1=CC(N)=CC=C1O CNLDLWPMQTUIJB-UHFFFAOYSA-N 0.000 description 1
- PYCZBQIFRDTJTM-UHFFFAOYSA-N 4-amino-2-(4-ethoxyphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(OCC)=CC=C1C1=CC(N)=CC=C1O PYCZBQIFRDTJTM-UHFFFAOYSA-N 0.000 description 1
- BNGTXKXXQKJJJR-UHFFFAOYSA-N 4-amino-2-(4-ethylphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(CC)=CC=C1C1=CC(N)=CC=C1O BNGTXKXXQKJJJR-UHFFFAOYSA-N 0.000 description 1
- NSBDHJXXVFLIQQ-UHFFFAOYSA-N 4-amino-2-(4-fluorophenyl)phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=CC(F)=CC=2)=C1 NSBDHJXXVFLIQQ-UHFFFAOYSA-N 0.000 description 1
- KGVKCEWLUXQLJB-UHFFFAOYSA-N 4-amino-2-(4-hydroxy-2-methylphenyl)phenol;hydrochloride Chemical compound Cl.CC1=CC(O)=CC=C1C1=CC(N)=CC=C1O KGVKCEWLUXQLJB-UHFFFAOYSA-N 0.000 description 1
- ZYXGOKTWERWYIV-UHFFFAOYSA-N 4-amino-2-(4-hydroxyphenyl)phenol;hydrochloride Chemical compound Cl.NC1=CC=C(O)C(C=2C=CC(O)=CC=2)=C1 ZYXGOKTWERWYIV-UHFFFAOYSA-N 0.000 description 1
- WDWIEWVRKSAXJG-UHFFFAOYSA-N 4-amino-2-(4-methoxy-2-methylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC(OC)=CC=C1C1=CC(N)=CC=C1O WDWIEWVRKSAXJG-UHFFFAOYSA-N 0.000 description 1
- FWGJVYDNOZWVKD-UHFFFAOYSA-N 4-amino-2-(4-methoxyphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(OC)=CC=C1C1=CC(N)=CC=C1O FWGJVYDNOZWVKD-UHFFFAOYSA-N 0.000 description 1
- XGKWEOLVPAJUGC-UHFFFAOYSA-N 4-amino-2-(4-methylphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(C)=CC=C1C1=CC(N)=CC=C1O XGKWEOLVPAJUGC-UHFFFAOYSA-N 0.000 description 1
- LDGHKLCRKHULIA-UHFFFAOYSA-N 4-amino-2-(4-methylsulfanylphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(SC)=CC=C1C1=CC(N)=CC=C1O LDGHKLCRKHULIA-UHFFFAOYSA-N 0.000 description 1
- AMTWFWOREGJWNP-UHFFFAOYSA-N 4-amino-2-(4-nitrophenyl)phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=CC(=CC=2)[N+]([O-])=O)=C1 AMTWFWOREGJWNP-UHFFFAOYSA-N 0.000 description 1
- TURZUFMXFYIXQO-UHFFFAOYSA-N 4-amino-2-(4-tert-butylphenyl)phenol;hydrochloride Chemical group Cl.C1=CC(C(C)(C)C)=CC=C1C1=CC(N)=CC=C1O TURZUFMXFYIXQO-UHFFFAOYSA-N 0.000 description 1
- MQDGVLJUVVFCAX-UHFFFAOYSA-N 4-amino-2-(5-fluoro-2-methylphenyl)phenol;hydrochloride Chemical group Cl.CC1=CC=C(F)C=C1C1=CC(N)=CC=C1O MQDGVLJUVVFCAX-UHFFFAOYSA-N 0.000 description 1
- IWBLCNVQKFOQTG-UHFFFAOYSA-N 4-amino-2-[2-(2-hydroxyethyl)phenyl]phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C(=CC=CC=2)CCO)=C1 IWBLCNVQKFOQTG-UHFFFAOYSA-N 0.000 description 1
- MDJAMQYWWCEVAA-UHFFFAOYSA-N 4-amino-2-[3-(aminomethyl)phenyl]phenol;hydrochloride Chemical group Cl.NCC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 MDJAMQYWWCEVAA-UHFFFAOYSA-N 0.000 description 1
- ZTNYBPWUEYMOHV-UHFFFAOYSA-N 4-amino-2-[4-(1-hydroxyethyl)phenyl]phenol;hydrochloride Chemical group Cl.C1=CC(C(O)C)=CC=C1C1=CC(N)=CC=C1O ZTNYBPWUEYMOHV-UHFFFAOYSA-N 0.000 description 1
- QZWVMJGFSPGPGU-UHFFFAOYSA-N 4-amino-2-[4-(2-hydroxyethoxy)phenyl]phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=CC(OCCO)=CC=2)=C1 QZWVMJGFSPGPGU-UHFFFAOYSA-N 0.000 description 1
- ANWCNUBKYSNHAO-UHFFFAOYSA-N 4-amino-2-[4-(2-hydroxyethyl)phenyl]phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=CC(CCO)=CC=2)=C1 ANWCNUBKYSNHAO-UHFFFAOYSA-N 0.000 description 1
- FUECZILFTZSTBS-UHFFFAOYSA-N 4-amino-2-[4-(trifluoromethyl)phenyl]phenol;hydrochloride Chemical group Cl.NC1=CC=C(O)C(C=2C=CC(=CC=2)C(F)(F)F)=C1 FUECZILFTZSTBS-UHFFFAOYSA-N 0.000 description 1
- GPOQODYGMUTOQL-UHFFFAOYSA-N 4-bromo-3-methylphenol Chemical compound CC1=CC(O)=CC=C1Br GPOQODYGMUTOQL-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 1
- HQSCPPCMBMFJJN-UHFFFAOYSA-N 4-bromobenzonitrile Chemical compound BrC1=CC=C(C#N)C=C1 HQSCPPCMBMFJJN-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- AYAKPRUPZTWPLK-UHFFFAOYSA-N 4-ethoxy-6-methylbenzene-1,3-diamine Chemical compound CCOC1=CC(C)=C(N)C=C1N AYAKPRUPZTWPLK-UHFFFAOYSA-N 0.000 description 1
- GPMWAWDEZPFUTN-UHFFFAOYSA-N 4-fluoro-6-methylbenzene-1,3-diamine Chemical compound CC1=CC(F)=C(N)C=C1N GPMWAWDEZPFUTN-UHFFFAOYSA-N 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- NLMQHXUGJIAKTH-UHFFFAOYSA-N 4-hydroxyindole Chemical compound OC1=CC=CC2=C1C=CN2 NLMQHXUGJIAKTH-UHFFFAOYSA-N 0.000 description 1
- JOJAEBZHFWYZAY-UHFFFAOYSA-N 4-methoxy-6-methylbenzene-1,3-diamine Chemical compound COC1=CC(C)=C(N)C=C1N JOJAEBZHFWYZAY-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- SGNZYJXNUURYCH-UHFFFAOYSA-N 5,6-dihydroxyindole Chemical compound C1=C(O)C(O)=CC2=C1NC=C2 SGNZYJXNUURYCH-UHFFFAOYSA-N 0.000 description 1
- YGRFRBUGAPOJDU-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCO)C=C1O YGRFRBUGAPOJDU-UHFFFAOYSA-N 0.000 description 1
- XOVBEQRPIHPGPO-UHFFFAOYSA-N 5-(3-hydroxypropylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCCO)C=C1O XOVBEQRPIHPGPO-UHFFFAOYSA-N 0.000 description 1
- QPHMVRPABQUYGN-UHFFFAOYSA-N 5-amino-2,4-dichlorophenol Chemical compound NC1=CC(O)=C(Cl)C=C1Cl QPHMVRPABQUYGN-UHFFFAOYSA-N 0.000 description 1
- CNEHJJGZSQRWRR-UHFFFAOYSA-N 5-amino-2-(2-hydroxyethoxy)phenol Chemical compound NC1=CC=C(OCCO)C(O)=C1 CNEHJJGZSQRWRR-UHFFFAOYSA-N 0.000 description 1
- SZNMBMXMWVVCOE-UHFFFAOYSA-N 5-amino-2-ethylphenol Chemical compound CCC1=CC=C(N)C=C1O SZNMBMXMWVVCOE-UHFFFAOYSA-N 0.000 description 1
- DBFYESDCPWWCHN-UHFFFAOYSA-N 5-amino-2-methylphenol Chemical compound CC1=CC=C(N)C=C1O DBFYESDCPWWCHN-UHFFFAOYSA-N 0.000 description 1
- WDQMXRWYXILWPT-UHFFFAOYSA-N 5-amino-4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=C(N)C=C1O WDQMXRWYXILWPT-UHFFFAOYSA-N 0.000 description 1
- PERWLJUQQIWGLB-UHFFFAOYSA-N 5-amino-4-ethoxy-2-methylphenol Chemical compound CCOC1=CC(C)=C(O)C=C1N PERWLJUQQIWGLB-UHFFFAOYSA-N 0.000 description 1
- HEAQOCBITATQEW-UHFFFAOYSA-N 5-amino-4-fluoro-2-methylphenol Chemical compound CC1=CC(F)=C(N)C=C1O HEAQOCBITATQEW-UHFFFAOYSA-N 0.000 description 1
- MUHQJMUYRYHUIW-UHFFFAOYSA-N 5-amino-4-methoxy-2-methylphenol Chemical compound COC1=CC(C)=C(O)C=C1N MUHQJMUYRYHUIW-UHFFFAOYSA-N 0.000 description 1
- FBOYMIDCHINJKC-UHFFFAOYSA-N 5-bromo-1,3-benzodioxole Chemical compound BrC1=CC=C2OCOC2=C1 FBOYMIDCHINJKC-UHFFFAOYSA-N 0.000 description 1
- VXWVFZFZYXOBTA-UHFFFAOYSA-N 5-bromo-1h-indole Chemical compound BrC1=CC=C2NC=CC2=C1 VXWVFZFZYXOBTA-UHFFFAOYSA-N 0.000 description 1
- QSZLZSGMAGEPRS-UHFFFAOYSA-N 5-bromo-2,5-dimethoxycyclohexa-1,3-diene Chemical compound COC1=CCC(Br)(OC)C=C1 QSZLZSGMAGEPRS-UHFFFAOYSA-N 0.000 description 1
- LMIQERWZRIFWNZ-UHFFFAOYSA-N 5-hydroxyindole Chemical compound OC1=CC=C2NC=CC2=C1 LMIQERWZRIFWNZ-UHFFFAOYSA-N 0.000 description 1
- TUYBCLHMZFLWRY-UHFFFAOYSA-N 6-bromo-1,3-benzodioxol-5-ol Chemical compound C1=C(Br)C(O)=CC2=C1OCO2 TUYBCLHMZFLWRY-UHFFFAOYSA-N 0.000 description 1
- ATCBPVDYYNJHSG-UHFFFAOYSA-N 6-methoxy-2-n-methylpyridine-2,3-diamine Chemical compound CNC1=NC(OC)=CC=C1N ATCBPVDYYNJHSG-UHFFFAOYSA-N 0.000 description 1
- WEPOCTWSRWLQLL-UHFFFAOYSA-N 6-methoxypyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(N)=N1 WEPOCTWSRWLQLL-UHFFFAOYSA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- 235000014036 Castanea Nutrition 0.000 description 1
- 241001070941 Castanea Species 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 241001465805 Nymphalidae Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000012544 Viola sororia Nutrition 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- 239000006096 absorbing agent Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000004996 alkyl benzenes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229940101006 anhydrous sodium sulfite Drugs 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000987 azo dye Substances 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 229940107161 cholesterol Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 239000006103 coloring component Substances 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000000490 cosmetic additive Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- GPAYUJZHTULNBE-UHFFFAOYSA-N diphenylphosphine Chemical compound C=1C=CC=CC=1PC1=CC=CC=C1 GPAYUJZHTULNBE-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- QELUYTUMUWHWMC-UHFFFAOYSA-N edaravone Chemical compound O=C1CC(C)=NN1C1=CC=CC=C1 QELUYTUMUWHWMC-UHFFFAOYSA-N 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- KTWOOEGAPBSYNW-UHFFFAOYSA-N ferrocene Chemical compound [Fe+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 KTWOOEGAPBSYNW-UHFFFAOYSA-N 0.000 description 1
- FWQHNLCNFPYBCA-UHFFFAOYSA-N fluoran Chemical class C12=CC=CC=C2OC2=CC=CC=C2C11OC(=O)C2=CC=CC=C21 FWQHNLCNFPYBCA-UHFFFAOYSA-N 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- 239000000118 hair dye Substances 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- JXDYKVIHCLTXOP-UHFFFAOYSA-N isatin Chemical compound C1=CC=C2C(=O)C(=O)NC2=C1 JXDYKVIHCLTXOP-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- VGSVNUGKHOVSPK-UHFFFAOYSA-N leukoaminochrome Chemical compound C1=C(O)C(O)=CC2=C1NCC2 VGSVNUGKHOVSPK-UHFFFAOYSA-N 0.000 description 1
- 150000004988 m-phenylenediamines Chemical class 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- ZUVBIBLYOCVYJU-UHFFFAOYSA-N naphthalene-1,7-diol Chemical compound C1=CC=C(O)C2=CC(O)=CC=C21 ZUVBIBLYOCVYJU-UHFFFAOYSA-N 0.000 description 1
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 1
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- VPCDQGACGWYTMC-UHFFFAOYSA-N nitrosyl chloride Chemical compound ClN=O VPCDQGACGWYTMC-UHFFFAOYSA-N 0.000 description 1
- 235000019392 nitrosyl chloride Nutrition 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 150000004989 p-phenylenediamines Chemical class 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- VHNQIURBCCNWDN-UHFFFAOYSA-N pyridine-2,6-diamine Chemical compound NC1=CC=CC(N)=N1 VHNQIURBCCNWDN-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229960001755 resorcinol Drugs 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 229940001482 sodium sulfite Drugs 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/415—Aminophenols
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/10—Preparations for permanently dyeing the hair
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/78—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/80—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/78—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C217/80—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/22—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
- C07C255/59—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10032134 | 2000-07-01 | ||
| DE10032134A DE10032134C1 (de) | 2000-07-01 | 2000-07-01 | 2-Hydroxy-5-amino-biphenyl-Derivate sowie diese Verbindungen enthaltende Oxidationshaarfärbemittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES2219525T3 true ES2219525T3 (es) | 2004-12-01 |
Family
ID=7647508
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES01936066T Expired - Lifetime ES2219525T3 (es) | 2000-07-01 | 2001-03-10 | Derivados de 2-hidroxi-5-aminobifenilo y composiciones oxidantes para el teñido del cabello que los contienen. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US6749644B2 (enExample) |
| EP (1) | EP1208077B1 (enExample) |
| JP (1) | JP2004502666A (enExample) |
| AT (1) | ATE264832T1 (enExample) |
| AU (1) | AU2001262088A1 (enExample) |
| BR (1) | BR0106932A (enExample) |
| CA (1) | CA2383577A1 (enExample) |
| DE (2) | DE10032134C1 (enExample) |
| ES (1) | ES2219525T3 (enExample) |
| MX (1) | MXPA02002199A (enExample) |
| WO (1) | WO2002002507A1 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10048733A1 (de) * | 2000-09-29 | 2002-04-18 | Henkel Kgaa | Oxidationsfärbemittel mit 2-Amino-5-methylphenol |
| DE10141722A1 (de) | 2001-08-25 | 2003-03-06 | Wella Ag | 3-Aminophenol-Derivate enthaltende Oxidationshaarfärbemittel sowie neue 3-Aminophenol-Derivate |
| DE10217270A1 (de) * | 2002-04-18 | 2003-11-06 | Wella Ag | In 2-Stellung substituierte 3-Aminophenol-Derivate sowie diese Verbindungen enthaltende Färbemittel |
| DE102004002604A1 (de) * | 2004-01-15 | 2005-08-04 | Beiersdorf Ag | Visualisierung von Sonnenschutzmitteln auf der Haut |
| US8110015B2 (en) | 2007-05-30 | 2012-02-07 | Illinois Tool Works, Inc. | Method and apparatus for removing contaminants from a reflow apparatus |
| DE102008049675A1 (de) | 2008-09-30 | 2010-04-01 | Markus Dr. Heinrich | Verfahren zur Herstellung von 3-Aminobiphenylen |
| EP2226065A3 (en) | 2010-03-15 | 2010-09-29 | KPSS-Kao Professional Salon Services GmbH | Colouring composition for keratin fibres |
| CN102344411B (zh) * | 2011-08-01 | 2013-05-15 | 宜兴市新宇化工有限公司 | 一种制备2,6-二甲氧基-3,5-二氨基吡啶盐酸盐的方法 |
| CN103239364A (zh) * | 2013-05-31 | 2013-08-14 | 江南大学 | 用于浅色调染发剂的偶合剂 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5033891B2 (enExample) * | 1971-10-29 | 1975-11-04 | ||
| DE2518393A1 (de) * | 1975-04-25 | 1976-11-04 | Henkel & Cie Gmbh | Haarfaerbemittel |
| DE2659056A1 (de) * | 1976-12-27 | 1978-07-06 | Henkel Kgaa | Haarfaerbemittel |
| AU537068B2 (en) * | 1979-10-18 | 1984-06-07 | Warner-Lambert Company | Substituted -5-((7-chloro-4-quinolinyl)amino)-3-(amino- methyl)-(1,1:-biphenyl)-2-ol compounds |
| DE19717222A1 (de) * | 1997-04-24 | 1998-10-29 | Henkel Kgaa | Mittel zum Färben von keratinhaltigen Fasern |
| DE19822041A1 (de) * | 1998-05-16 | 1999-12-23 | Wella Ag | 2,5-Diamino-1-phenylbenzol-Derivate enthaltende Oxidationshaarfärbemittel sowie neue 2,5-Diamino-1-phenylbenzol-Derivate |
-
2000
- 2000-07-01 DE DE10032134A patent/DE10032134C1/de not_active Expired - Fee Related
-
2001
- 2001-03-10 BR BR0106932-2A patent/BR0106932A/pt not_active Application Discontinuation
- 2001-03-10 CA CA002383577A patent/CA2383577A1/en not_active Abandoned
- 2001-03-10 ES ES01936066T patent/ES2219525T3/es not_active Expired - Lifetime
- 2001-03-10 DE DE50102041T patent/DE50102041D1/de not_active Expired - Lifetime
- 2001-03-10 EP EP01936066A patent/EP1208077B1/de not_active Expired - Lifetime
- 2001-03-10 MX MXPA02002199A patent/MXPA02002199A/es active IP Right Grant
- 2001-03-10 JP JP2002507764A patent/JP2004502666A/ja not_active Withdrawn
- 2001-03-10 AU AU2001262088A patent/AU2001262088A1/en not_active Abandoned
- 2001-03-10 WO PCT/EP2001/002704 patent/WO2002002507A1/de not_active Ceased
- 2001-03-10 US US10/049,346 patent/US6749644B2/en not_active Expired - Lifetime
- 2001-03-10 AT AT01936066T patent/ATE264832T1/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE50102041D1 (de) | 2004-05-27 |
| AU2001262088A1 (en) | 2002-01-14 |
| US20020166180A1 (en) | 2002-11-14 |
| US6749644B2 (en) | 2004-06-15 |
| MXPA02002199A (es) | 2002-09-30 |
| CA2383577A1 (en) | 2002-01-10 |
| EP1208077A1 (de) | 2002-05-29 |
| JP2004502666A (ja) | 2004-01-29 |
| ATE264832T1 (de) | 2004-05-15 |
| BR0106932A (pt) | 2002-05-14 |
| EP1208077B1 (de) | 2004-04-21 |
| WO2002002507A1 (de) | 2002-01-10 |
| DE10032134C1 (de) | 2001-12-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| ES2250242T3 (es) | Composicion y procedimiento para teñir fibras de queratina. | |
| ES2222935T3 (es) | Composicion y procedimiento para el teñido de fibras. | |
| US6500213B1 (en) | Oxidizing hair coloring agents containing 2,5-diamino-1-phenylbenzene derivatives and novel 2,5-diamino-1-phenylbenzene derivatives | |
| US6749644B2 (en) | 2-hydroxy-5-amino-biphenyl-derivatives and oxidative hair coloring agents containing said compounds | |
| ES2214405T3 (es) | Derivados de p-diaminobenceno y productos para el teñido que contienen dichos compuestos. | |
| US6685751B2 (en) | Substituted 1,4-diaminobenzene compounds and oxidation dye precursor compositions containing same | |
| ES2241999T3 (es) | Derivados de 1,3-dihidroxibenceno y productos para el teñido de fibras que los contienen. | |
| ES2239075T3 (es) | Derivados p-aminofenol y productos para el teñido que los contienen. | |
| ES2233705T3 (es) | Nuevos derivados de 1,4-diamino-2-alquenilbenceno y colorantes que los contienen. | |
| JP4396924B2 (ja) | 2位‐置換された3‐アミノフェノール誘導体、並びにこれら化合物を含有する染色剤 | |
| US6840965B2 (en) | P-aminophenols and colorants containing said compounds | |
| ES2249420T3 (es) | Derivados n-bencil-p-fenilendiamina que contienen agentes colorantes para fibras de queratina y nuevos derivados n-bencil-p-fenilendiamina. | |
| ES2219520T3 (es) | Nuevos derivados de n-heteroarilmetil-p-fenilendiamina como agentes colorantes oxidativos de fibras. | |
| ES2277948T3 (es) | Agentes colorantes para fibras de queratina que contienen derivados (1,1'-bifenil)-2,4-diamina y nuevos derivados (1,1'-bifenil)-2,4-diamina. | |
| JP3907055B2 (ja) | ケラチン繊維を染色するための薬剤及び方法 | |
| ES2300354T3 (es) | Nuevos derivados de 1,4-diamino-2-(tiazol-2-il)benceno y agentes colorantes que los contienen. | |
| ES2262800T3 (es) | Colorantes de oxidacion para el cabello que contienen derivados 3-aminofenol y nuevos derivados 3-aminofenol. | |
| US7074243B2 (en) | N-benzyl-m-phenylenediamine derivatives and dyes containing said compounds | |
| JP2008511558A (ja) | p−ジアミノベンゼン誘導体及びこれらの化合物を含有する染料薬剤 | |
| HK1061385B (en) | Novel 1,4-diamino-2-alkenyl-benzene derivatives and colorants containing said compounds |