MXPA02002199A - Derivados de 2-hidroxi-5-amino-bifenilo asi como agentes para tenir el cabello por oxidacion, que contienen esos compuestos. - Google Patents
Derivados de 2-hidroxi-5-amino-bifenilo asi como agentes para tenir el cabello por oxidacion, que contienen esos compuestos.Info
- Publication number
- MXPA02002199A MXPA02002199A MXPA02002199A MXPA02002199A MXPA02002199A MX PA02002199 A MXPA02002199 A MX PA02002199A MX PA02002199 A MXPA02002199 A MX PA02002199A MX PA02002199 A MXPA02002199 A MX PA02002199A MX PA02002199 A MXPA02002199 A MX PA02002199A
- Authority
- MX
- Mexico
- Prior art keywords
- group
- hydroxy
- carbon atoms
- amino
- biphenyl
- Prior art date
Links
- 210000004209 hair Anatomy 0.000 title claims abstract description 27
- 150000001875 compounds Chemical class 0.000 title claims description 12
- 230000001590 oxidative effect Effects 0.000 title abstract description 3
- 239000004150 EU approved colour Substances 0.000 title 1
- 229940006093 opthalmologic coloring agent diagnostic Drugs 0.000 title 1
- OUIITAOCYATDMY-UHFFFAOYSA-N 4-amino-2-phenylphenol Chemical group NC1=CC=C(O)C(C=2C=CC=CC=2)=C1 OUIITAOCYATDMY-UHFFFAOYSA-N 0.000 claims abstract description 10
- 102000011782 Keratins Human genes 0.000 claims abstract description 5
- 108010076876 Keratins Proteins 0.000 claims abstract description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 62
- 239000000975 dye Substances 0.000 claims description 44
- 229910052739 hydrogen Inorganic materials 0.000 claims description 41
- 239000001257 hydrogen Substances 0.000 claims description 40
- 239000004305 biphenyl Substances 0.000 claims description 33
- 239000000126 substance Substances 0.000 claims description 28
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 26
- 150000002431 hydrogen Chemical class 0.000 claims description 24
- 150000003254 radicals Chemical class 0.000 claims description 20
- 125000000217 alkyl group Chemical group 0.000 claims description 16
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 13
- 125000003277 amino group Chemical group 0.000 claims description 13
- 230000008878 coupling Effects 0.000 claims description 12
- 238000010168 coupling process Methods 0.000 claims description 12
- 238000005859 coupling reaction Methods 0.000 claims description 12
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 11
- 125000005113 hydroxyalkoxy group Chemical group 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 8
- 125000005843 halogen group Chemical group 0.000 claims description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 8
- 125000004990 dihydroxyalkyl group Chemical group 0.000 claims description 7
- 230000003647 oxidation Effects 0.000 claims description 7
- 238000007254 oxidation reaction Methods 0.000 claims description 7
- 238000004043 dyeing Methods 0.000 claims description 6
- 101100439663 Arabidopsis thaliana CHR7 gene Proteins 0.000 claims description 4
- 125000003282 alkyl amino group Chemical group 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 239000000835 fiber Substances 0.000 claims description 4
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 4
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 4
- XPDWGBQVDMORPB-UHFFFAOYSA-N Fluoroform Chemical group FC(F)F XPDWGBQVDMORPB-UHFFFAOYSA-N 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000002560 nitrile group Chemical group 0.000 claims description 3
- 125000004663 dialkyl amino group Chemical group 0.000 claims 2
- LKGFIUAOMYSEJF-UHFFFAOYSA-N 4-amino-2-(4-aminophenyl)phenol Chemical group C1=CC(N)=CC=C1C1=CC(N)=CC=C1O LKGFIUAOMYSEJF-UHFFFAOYSA-N 0.000 claims 1
- KQKIWZGNBJLCOS-UHFFFAOYSA-N 4-amino-2-(4-hydroxy-2-methylphenyl)phenol Chemical group CC1=CC(O)=CC=C1C1=CC(N)=CC=C1O KQKIWZGNBJLCOS-UHFFFAOYSA-N 0.000 claims 1
- BZTCYXKUXFHCKD-UHFFFAOYSA-N 4-amino-2-(4-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=CC(O)=CC=2)=C1 BZTCYXKUXFHCKD-UHFFFAOYSA-N 0.000 claims 1
- 239000003795 chemical substances by application Substances 0.000 abstract description 5
- 238000004040 coloring Methods 0.000 abstract description 4
- 239000007822 coupling agent Substances 0.000 abstract 1
- 238000001819 mass spectrum Methods 0.000 description 39
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 29
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N EtOH Substances CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 25
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 23
- -1 diamino-dihydroxy-phenylenes Chemical class 0.000 description 22
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 19
- 229910052794 bromium Inorganic materials 0.000 description 19
- 239000000203 mixture Substances 0.000 description 19
- 239000000243 solution Substances 0.000 description 16
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical class [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N benzene Substances C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 239000007864 aqueous solution Substances 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 11
- 238000003786 synthesis reaction Methods 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 10
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 9
- 235000002639 sodium chloride Nutrition 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 8
- 239000000118 hair dye Substances 0.000 description 8
- 235000019439 ethyl acetate Nutrition 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 239000007800 oxidant agent Substances 0.000 description 6
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- 239000012074 organic phase Substances 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 4
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 4
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 4
- 235000010323 ascorbic acid Nutrition 0.000 description 4
- 229960005070 ascorbic acid Drugs 0.000 description 4
- 239000011668 ascorbic acid Substances 0.000 description 4
- 239000006103 coloring component Substances 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 150000007524 organic acids Chemical class 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000002453 shampoo Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 3
- 101150041968 CDC13 gene Proteins 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000006185 dispersion Substances 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000011780 sodium chloride Substances 0.000 description 3
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 239000002562 thickening agent Substances 0.000 description 3
- GHOKWGTUZJEAQD-ZETCQYMHSA-N (D)-(+)-Pantothenic acid Chemical compound OCC(C)(C)[C@@H](O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-ZETCQYMHSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- LUBJCRLGQSPQNN-UHFFFAOYSA-N 1-Phenylurea Chemical compound NC(=O)NC1=CC=CC=C1 LUBJCRLGQSPQNN-UHFFFAOYSA-N 0.000 description 2
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 2
- CMLFRMDBDNHMRA-UHFFFAOYSA-N 2h-1,2-benzoxazine Chemical compound C1=CC=C2C=CNOC2=C1 CMLFRMDBDNHMRA-UHFFFAOYSA-N 0.000 description 2
- CWLKGDAVCFYWJK-UHFFFAOYSA-N 3-aminophenol Chemical compound NC1=CC=CC(O)=C1 CWLKGDAVCFYWJK-UHFFFAOYSA-N 0.000 description 2
- 229940018563 3-aminophenol Drugs 0.000 description 2
- BDNYHCLBPVARRO-UHFFFAOYSA-N 4-amino-2-(2-fluorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)F)=C1 BDNYHCLBPVARRO-UHFFFAOYSA-N 0.000 description 2
- DVYSQOKCDAFDOF-UHFFFAOYSA-N 4-amino-2-(2-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)O)=C1 DVYSQOKCDAFDOF-UHFFFAOYSA-N 0.000 description 2
- FXJDOKHAQQNYEF-UHFFFAOYSA-N 4-amino-2-(3-aminophenyl)phenol Chemical group NC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 FXJDOKHAQQNYEF-UHFFFAOYSA-N 0.000 description 2
- LWKDURXMFZMLNI-UHFFFAOYSA-N 4-amino-2-(3-chlorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(Cl)C=CC=2)=C1 LWKDURXMFZMLNI-UHFFFAOYSA-N 0.000 description 2
- IKQOEYMZKVSOGX-UHFFFAOYSA-N 4-amino-2-(3-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(O)C=CC=2)=C1 IKQOEYMZKVSOGX-UHFFFAOYSA-N 0.000 description 2
- SRQLBVISKTWNNX-UHFFFAOYSA-N 4-amino-2-(3-methoxyphenyl)phenol Chemical group COC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 SRQLBVISKTWNNX-UHFFFAOYSA-N 0.000 description 2
- SPLIFXAPPAZYAG-UHFFFAOYSA-N 4-amino-2-(3-methylphenyl)phenol Chemical group CC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 SPLIFXAPPAZYAG-UHFFFAOYSA-N 0.000 description 2
- XSGJVFPBTXJYER-UHFFFAOYSA-N 4-amino-2-(3-methylsulfanylphenyl)phenol Chemical group CSC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 XSGJVFPBTXJYER-UHFFFAOYSA-N 0.000 description 2
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 2
- PVFOHMXILQEIHX-UHFFFAOYSA-N 8-[(6-bromo-1,3-benzodioxol-5-yl)sulfanyl]-9-[2-(2-bromophenyl)ethyl]purin-6-amine Chemical compound C=1C=2OCOC=2C=C(Br)C=1SC1=NC=2C(N)=NC=NC=2N1CCC1=CC=CC=C1Br PVFOHMXILQEIHX-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241001070941 Castanea Species 0.000 description 2
- 235000014036 Castanea Nutrition 0.000 description 2
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 229910002666 PdCl2 Inorganic materials 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 2
- 239000003086 colorant Substances 0.000 description 2
- 239000006071 cream Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 2
- 230000037308 hair color Effects 0.000 description 2
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 2
- 235000019341 magnesium sulphate Nutrition 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 2
- 229940096992 potassium oleate Drugs 0.000 description 2
- MLICVSDCCDDWMD-KVVVOXFISA-M potassium;(z)-octadec-9-enoate Chemical compound [K+].CCCCCCCC\C=C/CCCCCCCC([O-])=O MLICVSDCCDDWMD-KVVVOXFISA-M 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L sodium carbonate Substances [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000011975 tartaric acid Substances 0.000 description 2
- 235000002906 tartaric acid Nutrition 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- MGSRCZKZVOBKFT-UHFFFAOYSA-N thymol Chemical compound CC(C)C1=CC=C(C)C=C1O MGSRCZKZVOBKFT-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- QWUBHVHMEXEYEX-UHFFFAOYSA-N (3-bromo-4-hydroxyphenyl)carbamic acid Chemical compound OC(=O)NC1=CC=C(O)C(Br)=C1 QWUBHVHMEXEYEX-UHFFFAOYSA-N 0.000 description 1
- SUYJXERPRICYRX-UHFFFAOYSA-N (3-bromophenyl)methanamine Chemical compound NCC1=CC=CC(Br)=C1 SUYJXERPRICYRX-UHFFFAOYSA-N 0.000 description 1
- MSMJEQQYVMQBSR-UHFFFAOYSA-N (4-hydroxyphenyl)carbamic acid Chemical compound OC(=O)NC1=CC=C(O)C=C1 MSMJEQQYVMQBSR-UHFFFAOYSA-N 0.000 description 1
- SJHPCNCNNSSLPL-CSKARUKUSA-N (4e)-4-(ethoxymethylidene)-2-phenyl-1,3-oxazol-5-one Chemical compound O1C(=O)C(=C/OCC)\N=C1C1=CC=CC=C1 SJHPCNCNNSSLPL-CSKARUKUSA-N 0.000 description 1
- IAKOZHOLGAGEJT-UHFFFAOYSA-N 1,1,1-trichloro-2,2-bis(p-methoxyphenyl)-Ethane Chemical compound C1=CC(OC)=CC=C1C(C(Cl)(Cl)Cl)C1=CC=C(OC)C=C1 IAKOZHOLGAGEJT-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- ASHRVEUMINIGNW-UHFFFAOYSA-N 1,4-dimethyl-2-phenylbenzene Chemical group CC1=CC=C(C)C(C=2C=CC=CC=2)=C1 ASHRVEUMINIGNW-UHFFFAOYSA-N 0.000 description 1
- FRASJONUBLZVQX-UHFFFAOYSA-N 1,4-dioxonaphthalene Natural products C1=CC=C2C(=O)C=CC(=O)C2=C1 FRASJONUBLZVQX-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- BOKGTLAJQHTOKE-UHFFFAOYSA-N 1,5-dihydroxynaphthalene Chemical compound C1=CC=C2C(O)=CC=CC2=C1O BOKGTLAJQHTOKE-UHFFFAOYSA-N 0.000 description 1
- DBMWNANFZQEHDV-UHFFFAOYSA-N 1-aminocyclohexa-2,4-dien-1-ol Chemical compound NC1(O)CC=CC=C1 DBMWNANFZQEHDV-UHFFFAOYSA-N 0.000 description 1
- HTDQSWDEWGSAMN-UHFFFAOYSA-N 1-bromo-2-methoxybenzene Chemical compound COC1=CC=CC=C1Br HTDQSWDEWGSAMN-UHFFFAOYSA-N 0.000 description 1
- QSSXJPIWXQTSIX-UHFFFAOYSA-N 1-bromo-2-methylbenzene Chemical compound CC1=CC=CC=C1Br QSSXJPIWXQTSIX-UHFFFAOYSA-N 0.000 description 1
- LMFRTSBQRLSJHC-UHFFFAOYSA-N 1-bromo-3,5-dimethylbenzene Chemical group CC1=CC(C)=CC(Br)=C1 LMFRTSBQRLSJHC-UHFFFAOYSA-N 0.000 description 1
- PLDWAJLZAAHOGG-UHFFFAOYSA-N 1-bromo-3-methoxybenzene Chemical compound COC1=CC=CC(Br)=C1 PLDWAJLZAAHOGG-UHFFFAOYSA-N 0.000 description 1
- WJIFKOVZNJTSGO-UHFFFAOYSA-N 1-bromo-3-methylbenzene Chemical compound CC1=CC=CC(Br)=C1 WJIFKOVZNJTSGO-UHFFFAOYSA-N 0.000 description 1
- BLZNSXFQRKVFRP-UHFFFAOYSA-N 1-bromo-4-methoxy-2-methylbenzene Chemical compound COC1=CC=C(Br)C(C)=C1 BLZNSXFQRKVFRP-UHFFFAOYSA-N 0.000 description 1
- ZBTMRBYMKUEVEU-UHFFFAOYSA-N 1-bromo-4-methylbenzene Chemical compound CC1=CC=C(Br)C=C1 ZBTMRBYMKUEVEU-UHFFFAOYSA-N 0.000 description 1
- ZDFBKZUDCQQKAC-UHFFFAOYSA-N 1-bromo-4-nitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Br)C=C1 ZDFBKZUDCQQKAC-UHFFFAOYSA-N 0.000 description 1
- XAWPKHNOFIWWNZ-UHFFFAOYSA-N 1h-indol-6-ol Chemical compound OC1=CC=C2C=CNC2=C1 XAWPKHNOFIWWNZ-UHFFFAOYSA-N 0.000 description 1
- LHGQFZQWSOXLEW-UHFFFAOYSA-N 1h-pyrazole-4,5-diamine Chemical class NC=1C=NNC=1N LHGQFZQWSOXLEW-UHFFFAOYSA-N 0.000 description 1
- BXBOXUNPNIJELB-UHFFFAOYSA-N 2,6-dimethoxypyridine-3,5-diamine Chemical compound COC1=NC(OC)=C(N)C=C1N BXBOXUNPNIJELB-UHFFFAOYSA-N 0.000 description 1
- BQHMISUMCDYQTR-UHFFFAOYSA-N 2-(1,3-benzodioxol-5-ylamino)ethanol Chemical compound OCCNC1=CC=C2OCOC2=C1 BQHMISUMCDYQTR-UHFFFAOYSA-N 0.000 description 1
- ADLOWZRDUHSVRU-UHFFFAOYSA-N 2-(2-bromophenyl)ethanol Chemical compound OCCC1=CC=CC=C1Br ADLOWZRDUHSVRU-UHFFFAOYSA-N 0.000 description 1
- ZTNLMELMADJSAH-UHFFFAOYSA-N 2-(3-aminoanilino)ethanol Chemical compound NC1=CC=CC(NCCO)=C1 ZTNLMELMADJSAH-UHFFFAOYSA-N 0.000 description 1
- JEGKOEYHLJTZGJ-UHFFFAOYSA-N 2-(3-hydroxyanilino)acetamide Chemical compound NC(=O)CNC1=CC=CC(O)=C1 JEGKOEYHLJTZGJ-UHFFFAOYSA-N 0.000 description 1
- PVEYGFKVWLNSTK-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)-6-methylphenol Chemical group CC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1O PVEYGFKVWLNSTK-UHFFFAOYSA-N 0.000 description 1
- GAXVAVVWPVYIJJ-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2O)O)=C1 GAXVAVVWPVYIJJ-UHFFFAOYSA-N 0.000 description 1
- HAXBFLYMCGIMRG-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)benzene-1,4-diol Chemical group NC1=CC=C(O)C(C=2C(=CC=C(O)C=2)O)=C1 HAXBFLYMCGIMRG-UHFFFAOYSA-N 0.000 description 1
- LEUSKIRWDOWIQP-UHFFFAOYSA-N 2-(5-amino-2-hydroxyphenyl)benzonitrile Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)C#N)=C1 LEUSKIRWDOWIQP-UHFFFAOYSA-N 0.000 description 1
- PDFQDTGOGSGZPN-UHFFFAOYSA-N 2-[5-(2-hydroxyethylamino)-2,4-dimethoxyanilino]ethanol Chemical compound COC1=CC(OC)=C(NCCO)C=C1NCCO PDFQDTGOGSGZPN-UHFFFAOYSA-N 0.000 description 1
- GRQJGJUSTVRVJO-UHFFFAOYSA-N 2-amino-5-(5-amino-2-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(O)C(N)=CC=2)=C1 GRQJGJUSTVRVJO-UHFFFAOYSA-N 0.000 description 1
- DTRVNTKRDRQQKN-UHFFFAOYSA-N 2-amino-6-(5-amino-2-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=C(N)C=CC=2)O)=C1 DTRVNTKRDRQQKN-UHFFFAOYSA-N 0.000 description 1
- BMTSZVZQNMNPCT-UHFFFAOYSA-N 2-aminopyridin-3-ol Chemical compound NC1=NC=CC=C1O BMTSZVZQNMNPCT-UHFFFAOYSA-N 0.000 description 1
- QXISTPDUYKNPLU-UHFFFAOYSA-N 2-bromo-1,4-dimethylbenzene Chemical group CC1=CC=C(C)C(Br)=C1 QXISTPDUYKNPLU-UHFFFAOYSA-N 0.000 description 1
- XWOXROPAWASYJZ-UHFFFAOYSA-N 2-bromo-1-(methoxymethoxy)-4-nitrobenzene Chemical compound COCOC1=CC=C([N+]([O-])=O)C=C1Br XWOXROPAWASYJZ-UHFFFAOYSA-N 0.000 description 1
- QLRKALMVPCQTMU-UHFFFAOYSA-N 2-bromo-1-fluoro-4-methylbenzene Chemical compound CC1=CC=C(F)C(Br)=C1 QLRKALMVPCQTMU-UHFFFAOYSA-N 0.000 description 1
- SWZVJOLLQTWFCW-UHFFFAOYSA-N 2-chlorobenzene-1,3-diol Chemical compound OC1=CC=CC(O)=C1Cl SWZVJOLLQTWFCW-UHFFFAOYSA-N 0.000 description 1
- QCDWFXQBSFUVSP-UHFFFAOYSA-N 2-phenoxyethanol Chemical compound OCCOC1=CC=CC=C1 QCDWFXQBSFUVSP-UHFFFAOYSA-N 0.000 description 1
- HEMGYNNCNNODNX-UHFFFAOYSA-N 3,4-diaminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1N HEMGYNNCNNODNX-UHFFFAOYSA-N 0.000 description 1
- CEAZJJWZNUEYAN-UHFFFAOYSA-N 3,5-dimethoxypyridine-2,6-diamine Chemical compound COC1=CC(OC)=C(N)N=C1N CEAZJJWZNUEYAN-UHFFFAOYSA-N 0.000 description 1
- LMLXFTWWTZTUSE-UHFFFAOYSA-N 3-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=C(O)C=CC=C1NCCO LMLXFTWWTZTUSE-UHFFFAOYSA-N 0.000 description 1
- GOIOOIZLSGKBBH-UHFFFAOYSA-N 3-(2-methoxyethylamino)phenol Chemical compound COCCNC1=CC=CC(O)=C1 GOIOOIZLSGKBBH-UHFFFAOYSA-N 0.000 description 1
- YHRACTMMZSGROP-UHFFFAOYSA-N 3-(3-hydroxy-2-methylanilino)propane-1,2-diol Chemical compound CC1=C(O)C=CC=C1NCC(O)CO YHRACTMMZSGROP-UHFFFAOYSA-N 0.000 description 1
- WEKDDYLNVFKSMY-UHFFFAOYSA-N 3-(5-amino-2-hydroxyphenyl)benzene-1,2-diol Chemical group NC1=CC=C(O)C(C=2C(=C(O)C=CC=2)O)=C1 WEKDDYLNVFKSMY-UHFFFAOYSA-N 0.000 description 1
- ZAKRQVGRLXCQOS-UHFFFAOYSA-N 3-(5-amino-2-hydroxyphenyl)benzonitrile Chemical group NC1=CC=C(O)C(C=2C=C(C=CC=2)C#N)=C1 ZAKRQVGRLXCQOS-UHFFFAOYSA-N 0.000 description 1
- QTLOTIDMMGECSL-UHFFFAOYSA-N 3-amino-2-(5-amino-2-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2N)O)=C1 QTLOTIDMMGECSL-UHFFFAOYSA-N 0.000 description 1
- FLROJJGKUKLCAE-UHFFFAOYSA-N 3-amino-2-methylphenol Chemical compound CC1=C(N)C=CC=C1O FLROJJGKUKLCAE-UHFFFAOYSA-N 0.000 description 1
- STXAVEHFKAXGOX-UHFFFAOYSA-N 3-bromobenzonitrile Chemical compound BrC1=CC=CC(C#N)=C1 STXAVEHFKAXGOX-UHFFFAOYSA-N 0.000 description 1
- MNOJRWOWILAHAV-UHFFFAOYSA-N 3-bromophenol Chemical compound OC1=CC=CC(Br)=C1 MNOJRWOWILAHAV-UHFFFAOYSA-N 0.000 description 1
- QOXOZONBQWIKDA-UHFFFAOYSA-N 3-hydroxypropyl Chemical group [CH2]CCO QOXOZONBQWIKDA-UHFFFAOYSA-N 0.000 description 1
- LRZCBJYTBUZEFK-UHFFFAOYSA-N 3-n-(2-aminoethyl)benzene-1,3-diamine Chemical compound NCCNC1=CC=CC(N)=C1 LRZCBJYTBUZEFK-UHFFFAOYSA-N 0.000 description 1
- JDDBEGQJCQQHNB-UHFFFAOYSA-N 4,5-dichloro-2-methylbenzene-1,3-diol Chemical compound CC1=C(O)C=C(Cl)C(Cl)=C1O JDDBEGQJCQQHNB-UHFFFAOYSA-N 0.000 description 1
- GRLQBYQELUWBIO-UHFFFAOYSA-N 4,6-dichlorobenzene-1,3-diol Chemical compound OC1=CC(O)=C(Cl)C=C1Cl GRLQBYQELUWBIO-UHFFFAOYSA-N 0.000 description 1
- BNRMHEDSMWOIMC-UHFFFAOYSA-N 4-(2-aminoethoxy)benzene-1,3-diamine Chemical compound NCCOC1=CC=C(N)C=C1N BNRMHEDSMWOIMC-UHFFFAOYSA-N 0.000 description 1
- CZMVCMRMMBOFKD-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C(=CC(O)=CC=2)O)=C1 CZMVCMRMMBOFKD-UHFFFAOYSA-N 0.000 description 1
- URVPDQRZIPAURD-UHFFFAOYSA-N 4-(5-amino-2-hydroxyphenyl)benzonitrile Chemical group NC1=CC=C(O)C(C=2C=CC(=CC=2)C#N)=C1 URVPDQRZIPAURD-UHFFFAOYSA-N 0.000 description 1
- MWKPYVXITDAZLL-UHFFFAOYSA-N 4-[3-(2,4-diaminophenoxy)propoxy]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1OCCCOC1=CC=C(N)C=C1N MWKPYVXITDAZLL-UHFFFAOYSA-N 0.000 description 1
- JFDDJMGDENVCMM-UHFFFAOYSA-N 4-amino-2-(2,3-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=C(N)C=CC=2)N)=C1 JFDDJMGDENVCMM-UHFFFAOYSA-N 0.000 description 1
- XKTILKUKYRRDBV-UHFFFAOYSA-N 4-amino-2-(2,5-diaminophenyl)phenol Chemical group NC1=CC=C(N)C(C=2C(=CC=C(N)C=2)O)=C1 XKTILKUKYRRDBV-UHFFFAOYSA-N 0.000 description 1
- PXAONKFULAFDEM-UHFFFAOYSA-N 4-amino-2-(2,6-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2N)N)=C1 PXAONKFULAFDEM-UHFFFAOYSA-N 0.000 description 1
- UBPLYUXFOFFQTP-UHFFFAOYSA-N 4-amino-2-(2-amino-5-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=C(O)C=2)N)=C1 UBPLYUXFOFFQTP-UHFFFAOYSA-N 0.000 description 1
- PWTYFZAUVIPWBW-UHFFFAOYSA-N 4-amino-2-(2-aminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)N)=C1 PWTYFZAUVIPWBW-UHFFFAOYSA-N 0.000 description 1
- YAIDJNQGOBIQEF-UHFFFAOYSA-N 4-amino-2-(2-chlorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)Cl)=C1 YAIDJNQGOBIQEF-UHFFFAOYSA-N 0.000 description 1
- XRPLKYAGGOPSSN-UHFFFAOYSA-N 4-amino-2-(2-methoxy-3-methylphenyl)phenol Chemical group COC1=C(C)C=CC=C1C1=CC(N)=CC=C1O XRPLKYAGGOPSSN-UHFFFAOYSA-N 0.000 description 1
- FERYBNHVGYTXLA-UHFFFAOYSA-N 4-amino-2-(2-methoxyphenyl)phenol Chemical group COC1=CC=CC=C1C1=CC(N)=CC=C1O FERYBNHVGYTXLA-UHFFFAOYSA-N 0.000 description 1
- ZRTVBMOXTNYVMJ-UHFFFAOYSA-N 4-amino-2-(2-methylphenyl)phenol Chemical group CC1=CC=CC=C1C1=CC(N)=CC=C1O ZRTVBMOXTNYVMJ-UHFFFAOYSA-N 0.000 description 1
- CNPLKGWBVUDMST-UHFFFAOYSA-N 4-amino-2-(2-methylsulfanylphenyl)phenol Chemical group CSC1=CC=CC=C1C1=CC(N)=CC=C1O CNPLKGWBVUDMST-UHFFFAOYSA-N 0.000 description 1
- RPYYLLIZCYGYQM-UHFFFAOYSA-N 4-amino-2-(2-nitrophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C(=CC=CC=2)[N+]([O-])=O)=C1 RPYYLLIZCYGYQM-UHFFFAOYSA-N 0.000 description 1
- RJHNKPWRNNSCDI-UHFFFAOYSA-N 4-amino-2-(3,4-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(N)C(N)=CC=2)=C1 RJHNKPWRNNSCDI-UHFFFAOYSA-N 0.000 description 1
- AKLYZRIEEOWPGH-UHFFFAOYSA-N 4-amino-2-(3,4-dimethylphenyl)phenol Chemical group C1=C(C)C(C)=CC=C1C1=CC(N)=CC=C1O AKLYZRIEEOWPGH-UHFFFAOYSA-N 0.000 description 1
- QCIUKXVKSYXERR-UHFFFAOYSA-N 4-amino-2-(3,5-diaminophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(N)C=C(N)C=2)=C1 QCIUKXVKSYXERR-UHFFFAOYSA-N 0.000 description 1
- MSPZHMQMPURHOC-UHFFFAOYSA-N 4-amino-2-(3,5-dimethoxyphenyl)phenol Chemical group COC1=CC(OC)=CC(C=2C(=CC=C(N)C=2)O)=C1 MSPZHMQMPURHOC-UHFFFAOYSA-N 0.000 description 1
- ZFVWYKGCIJJIJL-UHFFFAOYSA-N 4-amino-2-(3,5-dimethylphenyl)phenol Chemical group CC1=CC(C)=CC(C=2C(=CC=C(N)C=2)O)=C1 ZFVWYKGCIJJIJL-UHFFFAOYSA-N 0.000 description 1
- QKUSGRVOXJUBRG-UHFFFAOYSA-N 4-amino-2-(3,5-dimethylphenyl)phenol;hydrochloride Chemical class Cl.CC1=CC(C)=CC(C=2C(=CC=C(N)C=2)O)=C1 QKUSGRVOXJUBRG-UHFFFAOYSA-N 0.000 description 1
- SWUZSMZQKMKCIR-UHFFFAOYSA-N 4-amino-2-(3-amino-5-hydroxyphenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(O)C=C(N)C=2)=C1 SWUZSMZQKMKCIR-UHFFFAOYSA-N 0.000 description 1
- DDGKNFZSHDGESN-UHFFFAOYSA-N 4-amino-2-(3-fluorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(F)C=CC=2)=C1 DDGKNFZSHDGESN-UHFFFAOYSA-N 0.000 description 1
- UZTRRMJNWAZVEU-UHFFFAOYSA-N 4-amino-2-(3-methoxy-4-methylphenyl)phenol Chemical group C1=C(C)C(OC)=CC(C=2C(=CC=C(N)C=2)O)=C1 UZTRRMJNWAZVEU-UHFFFAOYSA-N 0.000 description 1
- KDKJCTDUUJQJTC-UHFFFAOYSA-N 4-amino-2-(3-nitrophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=C(C=CC=2)[N+]([O-])=O)=C1 KDKJCTDUUJQJTC-UHFFFAOYSA-N 0.000 description 1
- ULTJYOHUEAJHKB-UHFFFAOYSA-N 4-amino-2-(4-chlorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=CC(Cl)=CC=2)=C1 ULTJYOHUEAJHKB-UHFFFAOYSA-N 0.000 description 1
- YYTMERHJDWESKA-UHFFFAOYSA-N 4-amino-2-(4-fluorophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=CC(F)=CC=2)=C1 YYTMERHJDWESKA-UHFFFAOYSA-N 0.000 description 1
- OIRVTRIKMVVEDV-UHFFFAOYSA-N 4-amino-2-(4-methylphenyl)phenol Chemical group C1=CC(C)=CC=C1C1=CC(N)=CC=C1O OIRVTRIKMVVEDV-UHFFFAOYSA-N 0.000 description 1
- VFAAMIONTTXXQT-UHFFFAOYSA-N 4-amino-2-(4-methylsulfanylphenyl)phenol Chemical group C1=CC(SC)=CC=C1C1=CC(N)=CC=C1O VFAAMIONTTXXQT-UHFFFAOYSA-N 0.000 description 1
- PVSKVTXRTGQQOJ-UHFFFAOYSA-N 4-amino-2-(4-nitrophenyl)phenol Chemical group NC1=CC=C(O)C(C=2C=CC(=CC=2)[N+]([O-])=O)=C1 PVSKVTXRTGQQOJ-UHFFFAOYSA-N 0.000 description 1
- RMHQKTAMFXQMQJ-UHFFFAOYSA-N 4-amino-2-[2-(aminomethyl)phenyl]phenol Chemical group NCC1=CC=CC=C1C1=CC(N)=CC=C1O RMHQKTAMFXQMQJ-UHFFFAOYSA-N 0.000 description 1
- AUOLBVLKSOGDTH-UHFFFAOYSA-N 4-amino-2-[3-(aminomethyl)phenyl]phenol Chemical group NCC1=CC=CC(C=2C(=CC=C(N)C=2)O)=C1 AUOLBVLKSOGDTH-UHFFFAOYSA-N 0.000 description 1
- ZTNYBPWUEYMOHV-UHFFFAOYSA-N 4-amino-2-[4-(1-hydroxyethyl)phenyl]phenol;hydrochloride Chemical group Cl.C1=CC(C(O)C)=CC=C1C1=CC(N)=CC=C1O ZTNYBPWUEYMOHV-UHFFFAOYSA-N 0.000 description 1
- ANWCNUBKYSNHAO-UHFFFAOYSA-N 4-amino-2-[4-(2-hydroxyethyl)phenyl]phenol;hydrochloride Chemical class Cl.NC1=CC=C(O)C(C=2C=CC(CCO)=CC=2)=C1 ANWCNUBKYSNHAO-UHFFFAOYSA-N 0.000 description 1
- DAWSUFSUERUKGO-UHFFFAOYSA-N 4-amino-2-[4-(aminomethyl)phenyl]phenol Chemical group C1=CC(CN)=CC=C1C1=CC(N)=CC=C1O DAWSUFSUERUKGO-UHFFFAOYSA-N 0.000 description 1
- GKYYCYYUISXDGU-UHFFFAOYSA-N 4-amino-2-chloro-6-phenylphenol Chemical group NC1=CC(Cl)=C(O)C(C=2C=CC=CC=2)=C1 GKYYCYYUISXDGU-UHFFFAOYSA-N 0.000 description 1
- BYFJQAZKIBIOIW-UHFFFAOYSA-N 4-amino-2-phenylphenol;hydrochloride Chemical compound [Cl-].[NH3+]C1=CC=C(O)C(C=2C=CC=CC=2)=C1 BYFJQAZKIBIOIW-UHFFFAOYSA-N 0.000 description 1
- RHRORMFBBKWBFJ-UHFFFAOYSA-N 4-amino-5-chloro-2-phenylphenol Chemical group C1=C(Cl)C(N)=CC(C=2C=CC=CC=2)=C1O RHRORMFBBKWBFJ-UHFFFAOYSA-N 0.000 description 1
- SRCIGBLEKXKNTL-UHFFFAOYSA-N 4-amino-5-methyl-2-phenylphenol Chemical group C1=C(N)C(C)=CC(O)=C1C1=CC=CC=C1 SRCIGBLEKXKNTL-UHFFFAOYSA-N 0.000 description 1
- GPOQODYGMUTOQL-UHFFFAOYSA-N 4-bromo-3-methylphenol Chemical compound CC1=CC(O)=CC=C1Br GPOQODYGMUTOQL-UHFFFAOYSA-N 0.000 description 1
- WDFQBORIUYODSI-UHFFFAOYSA-N 4-bromoaniline Chemical compound NC1=CC=C(Br)C=C1 WDFQBORIUYODSI-UHFFFAOYSA-N 0.000 description 1
- QJPJQTDYNZXKQF-UHFFFAOYSA-N 4-bromoanisole Chemical compound COC1=CC=C(Br)C=C1 QJPJQTDYNZXKQF-UHFFFAOYSA-N 0.000 description 1
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical compound OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 description 1
- JQVAPEJNIZULEK-UHFFFAOYSA-N 4-chlorobenzene-1,3-diol Chemical compound OC1=CC=C(Cl)C(O)=C1 JQVAPEJNIZULEK-UHFFFAOYSA-N 0.000 description 1
- QGNGOGOOPUYKMC-UHFFFAOYSA-N 4-hydroxy-6-methylaniline Chemical compound CC1=CC(O)=CC=C1N QGNGOGOOPUYKMC-UHFFFAOYSA-N 0.000 description 1
- YGRFRBUGAPOJDU-UHFFFAOYSA-N 5-(2-hydroxyethylamino)-2-methylphenol Chemical compound CC1=CC=C(NCCO)C=C1O YGRFRBUGAPOJDU-UHFFFAOYSA-N 0.000 description 1
- CZQIPSQDABDXAP-UHFFFAOYSA-N 5-(5-amino-2-hydroxyphenyl)benzene-1,3-diol Chemical group NC1=CC=C(O)C(C=2C=C(O)C=C(O)C=2)=C1 CZQIPSQDABDXAP-UHFFFAOYSA-N 0.000 description 1
- QPHMVRPABQUYGN-UHFFFAOYSA-N 5-amino-2,4-dichlorophenol Chemical compound NC1=CC(O)=C(Cl)C=C1Cl QPHMVRPABQUYGN-UHFFFAOYSA-N 0.000 description 1
- MJNFWXIXHASBGI-UHFFFAOYSA-N 5-amino-2-(5-amino-2-hydroxyphenyl)phenol Chemical group OC1=CC(N)=CC=C1C1=CC(N)=CC=C1O MJNFWXIXHASBGI-UHFFFAOYSA-N 0.000 description 1
- WDQMXRWYXILWPT-UHFFFAOYSA-N 5-amino-4-chloro-2-methylphenol Chemical compound CC1=CC(Cl)=C(N)C=C1O WDQMXRWYXILWPT-UHFFFAOYSA-N 0.000 description 1
- PERWLJUQQIWGLB-UHFFFAOYSA-N 5-amino-4-ethoxy-2-methylphenol Chemical compound CCOC1=CC(C)=C(O)C=C1N PERWLJUQQIWGLB-UHFFFAOYSA-N 0.000 description 1
- TUYBCLHMZFLWRY-UHFFFAOYSA-N 6-bromo-1,3-benzodioxol-5-ol Chemical compound C1=C(Br)C(O)=CC2=C1OCO2 TUYBCLHMZFLWRY-UHFFFAOYSA-N 0.000 description 1
- ATCBPVDYYNJHSG-UHFFFAOYSA-N 6-methoxy-2-n-methylpyridine-2,3-diamine Chemical compound CNC1=NC(OC)=CC=C1N ATCBPVDYYNJHSG-UHFFFAOYSA-N 0.000 description 1
- WEPOCTWSRWLQLL-UHFFFAOYSA-N 6-methoxypyridine-2,3-diamine Chemical compound COC1=CC=C(N)C(N)=N1 WEPOCTWSRWLQLL-UHFFFAOYSA-N 0.000 description 1
- 101100162703 Caenorhabditis elegans ani-1 gene Proteins 0.000 description 1
- GHOKWGTUZJEAQD-UHFFFAOYSA-N Chick antidermatitis factor Natural products OCC(C)(C)C(O)C(=O)NCCC(O)=O GHOKWGTUZJEAQD-UHFFFAOYSA-N 0.000 description 1
- 239000005493 Chloridazon (aka pyrazone) Substances 0.000 description 1
- 241000207199 Citrus Species 0.000 description 1
- 239000004971 Cross linker Substances 0.000 description 1
- 102100025027 E3 ubiquitin-protein ligase TRIM69 Human genes 0.000 description 1
- 101000830203 Homo sapiens E3 ubiquitin-protein ligase TRIM69 Proteins 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 240000007817 Olea europaea Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Chemical class 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 235000012544 Viola sororia Nutrition 0.000 description 1
- 241001106476 Violaceae Species 0.000 description 1
- DGEZNRSVGBDHLK-UHFFFAOYSA-N [1,10]phenanthroline Chemical compound C1=CN=C2C3=NC=CC=C3C=CC2=C1 DGEZNRSVGBDHLK-UHFFFAOYSA-N 0.000 description 1
- KTXOMTYYRXOZPI-UHFFFAOYSA-N [Na].CCCCCCCCCCCC[Na] Chemical compound [Na].CCCCCCCCCCCC[Na] KTXOMTYYRXOZPI-UHFFFAOYSA-N 0.000 description 1
- 238000010521 absorption reaction Methods 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000005189 alkyl hydroxy group Chemical group 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 125000005012 alkyl thioether group Chemical group 0.000 description 1
- 125000005211 alkyl trimethyl ammonium group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 235000006708 antioxidants Nutrition 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- MBXXQYJBFRRFCK-UHFFFAOYSA-N benzyl fluoride Chemical compound FCC1=CC=CC=C1 MBXXQYJBFRRFCK-UHFFFAOYSA-N 0.000 description 1
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 1
- 229960003237 betaine Drugs 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000000160 carbon, hydrogen and nitrogen elemental analysis Methods 0.000 description 1
- 239000003093 cationic surfactant Substances 0.000 description 1
- 239000001913 cellulose Chemical class 0.000 description 1
- 229920002678 cellulose Chemical class 0.000 description 1
- 229960000541 cetyl alcohol Drugs 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- FCYRSDMGOLYDHL-UHFFFAOYSA-N chloromethoxyethane Chemical compound CCOCCl FCYRSDMGOLYDHL-UHFFFAOYSA-N 0.000 description 1
- 229940107161 cholesterol Drugs 0.000 description 1
- 235000012000 cholesterol Nutrition 0.000 description 1
- 235000020971 citrus fruits Nutrition 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 239000000490 cosmetic additive Substances 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 239000003431 cross linking reagent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 125000003963 dichloro group Chemical group Cl* 0.000 description 1
- NPOMSUOUAZCMBL-UHFFFAOYSA-N dichloromethane;ethoxyethane Chemical compound ClCCl.CCOCC NPOMSUOUAZCMBL-UHFFFAOYSA-N 0.000 description 1
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 150000002085 enols Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- YNULVPOFBWAWCL-UHFFFAOYSA-N ethyl acetate;potassium Chemical compound [K].CCOC(C)=O YNULVPOFBWAWCL-UHFFFAOYSA-N 0.000 description 1
- 229940058172 ethylbenzene Drugs 0.000 description 1
- 210000003746 feather Anatomy 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hcl hcl Chemical compound Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- ZUVBIBLYOCVYJU-UHFFFAOYSA-N naphthalene-1,7-diol Chemical compound C1=CC=C(O)C2=CC(O)=CC=C21 ZUVBIBLYOCVYJU-UHFFFAOYSA-N 0.000 description 1
- JRNGUTKWMSBIBF-UHFFFAOYSA-N naphthalene-2,3-diol Chemical compound C1=CC=C2C=C(O)C(O)=CC2=C1 JRNGUTKWMSBIBF-UHFFFAOYSA-N 0.000 description 1
- DFQICHCWIIJABH-UHFFFAOYSA-N naphthalene-2,7-diol Chemical compound C1=CC(O)=CC2=CC(O)=CC=C21 DFQICHCWIIJABH-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000001005 nitro dye Substances 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 229940055726 pantothenic acid Drugs 0.000 description 1
- 235000019161 pantothenic acid Nutrition 0.000 description 1
- 239000011713 pantothenic acid Substances 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- LIGACIXOYTUXAW-UHFFFAOYSA-N phenacyl bromide Chemical compound BrCC(=O)C1=CC=CC=C1 LIGACIXOYTUXAW-UHFFFAOYSA-N 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229960005323 phenoxyethanol Drugs 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 229910000073 phosphorus hydride Inorganic materials 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 239000003223 protective agent Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 210000003491 skin Anatomy 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- FQFILJKFZCVHNH-UHFFFAOYSA-N tert-butyl n-[3-[(5-bromo-2-chloropyrimidin-4-yl)amino]propyl]carbamate Chemical compound CC(C)(C)OC(=O)NCCCNC1=NC(Cl)=NC=C1Br FQFILJKFZCVHNH-UHFFFAOYSA-N 0.000 description 1
- 125000000101 thioether group Chemical group 0.000 description 1
- YXFVVABEGXRONW-UHFFFAOYSA-N toluene Substances CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 1
- 230000002110 toxicologic effect Effects 0.000 description 1
- 231100000027 toxicology Toxicity 0.000 description 1
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical compound [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 description 1
- 229960004418 trolamine Drugs 0.000 description 1
- 239000000341 volatile oil Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/50—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to atoms of the carbocyclic ring
- C07D317/58—Radicals substituted by nitrogen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/415—Aminophenols
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q5/00—Preparations for care of the hair
- A61Q5/10—Preparations for permanently dyeing the hair
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/78—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two hydroxy groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/74—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C215/76—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring
- C07C215/80—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton of the same non-condensed six-membered aromatic ring containing at least two amino groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C217/00—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton
- C07C217/78—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton
- C07C217/80—Compounds containing amino and etherified hydroxy groups bound to the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of six-membered aromatic rings of the same carbon skeleton having amino groups and etherified hydroxy groups bound to carbon atoms of non-condensed six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C225/00—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones
- C07C225/22—Compounds containing amino groups and doubly—bound oxygen atoms bound to the same carbon skeleton, at least one of the doubly—bound oxygen atoms not being part of a —CHO group, e.g. amino ketones having amino groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
- C07C255/49—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C255/58—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton
- C07C255/59—Carboxylic acid nitriles having cyano groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing cyano groups and singly-bound nitrogen atoms, not being further bound to other hetero atoms, bound to the carbon skeleton the carbon skeleton being further substituted by singly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/31—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atom of at least one of the thio groups bound to a carbon atom of a six-membered aromatic ring of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/04—Indoles; Hydrogenated indoles
- C07D209/08—Indoles; Hydrogenated indoles with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to carbon atoms of the hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Birds (AREA)
- Epidemiology (AREA)
- Cosmetics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE10032134A DE10032134C1 (de) | 2000-07-01 | 2000-07-01 | 2-Hydroxy-5-amino-biphenyl-Derivate sowie diese Verbindungen enthaltende Oxidationshaarfärbemittel |
| PCT/EP2001/002704 WO2002002507A1 (de) | 2000-07-01 | 2001-03-10 | 2-hydroxy-5-amino-biphenyl-derivate sowie diese verbindungen enthaltende oxidationshaarfärbemittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| MXPA02002199A true MXPA02002199A (es) | 2002-09-30 |
Family
ID=7647508
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| MXPA02002199A MXPA02002199A (es) | 2000-07-01 | 2001-03-10 | Derivados de 2-hidroxi-5-amino-bifenilo asi como agentes para tenir el cabello por oxidacion, que contienen esos compuestos. |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US6749644B2 (enExample) |
| EP (1) | EP1208077B1 (enExample) |
| JP (1) | JP2004502666A (enExample) |
| AT (1) | ATE264832T1 (enExample) |
| AU (1) | AU2001262088A1 (enExample) |
| BR (1) | BR0106932A (enExample) |
| CA (1) | CA2383577A1 (enExample) |
| DE (2) | DE10032134C1 (enExample) |
| ES (1) | ES2219525T3 (enExample) |
| MX (1) | MXPA02002199A (enExample) |
| WO (1) | WO2002002507A1 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE10048733A1 (de) * | 2000-09-29 | 2002-04-18 | Henkel Kgaa | Oxidationsfärbemittel mit 2-Amino-5-methylphenol |
| DE10141722A1 (de) * | 2001-08-25 | 2003-03-06 | Wella Ag | 3-Aminophenol-Derivate enthaltende Oxidationshaarfärbemittel sowie neue 3-Aminophenol-Derivate |
| DE10217270A1 (de) | 2002-04-18 | 2003-11-06 | Wella Ag | In 2-Stellung substituierte 3-Aminophenol-Derivate sowie diese Verbindungen enthaltende Färbemittel |
| DE102004002604A1 (de) * | 2004-01-15 | 2005-08-04 | Beiersdorf Ag | Visualisierung von Sonnenschutzmitteln auf der Haut |
| US8110015B2 (en) | 2007-05-30 | 2012-02-07 | Illinois Tool Works, Inc. | Method and apparatus for removing contaminants from a reflow apparatus |
| DE102008049675A1 (de) | 2008-09-30 | 2010-04-01 | Markus Dr. Heinrich | Verfahren zur Herstellung von 3-Aminobiphenylen |
| EP2226065A3 (en) * | 2010-03-15 | 2010-09-29 | KPSS-Kao Professional Salon Services GmbH | Colouring composition for keratin fibres |
| CN102344411B (zh) * | 2011-08-01 | 2013-05-15 | 宜兴市新宇化工有限公司 | 一种制备2,6-二甲氧基-3,5-二氨基吡啶盐酸盐的方法 |
| CN103239364A (zh) * | 2013-05-31 | 2013-08-14 | 江南大学 | 用于浅色调染发剂的偶合剂 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5033891B2 (enExample) * | 1971-10-29 | 1975-11-04 | ||
| DE2518393A1 (de) * | 1975-04-25 | 1976-11-04 | Henkel & Cie Gmbh | Haarfaerbemittel |
| DE2659056A1 (de) * | 1976-12-27 | 1978-07-06 | Henkel Kgaa | Haarfaerbemittel |
| ATE4422T1 (de) * | 1979-10-18 | 1983-08-15 | Warner-Lambert Company | Substituierte 5-((7-chlor-4-chinolinyl)amino)-3(aminomethyl)-(1,1'-biphenyl)-2-ol-verbindungen verfahren zu ihrer herstellung; und die verbindungen enthaltende pharmazeutische zusammensetzungen. |
| DE19717222A1 (de) * | 1997-04-24 | 1998-10-29 | Henkel Kgaa | Mittel zum Färben von keratinhaltigen Fasern |
| DE19822041A1 (de) * | 1998-05-16 | 1999-12-23 | Wella Ag | 2,5-Diamino-1-phenylbenzol-Derivate enthaltende Oxidationshaarfärbemittel sowie neue 2,5-Diamino-1-phenylbenzol-Derivate |
-
2000
- 2000-07-01 DE DE10032134A patent/DE10032134C1/de not_active Expired - Fee Related
-
2001
- 2001-03-10 AU AU2001262088A patent/AU2001262088A1/en not_active Abandoned
- 2001-03-10 BR BR0106932-2A patent/BR0106932A/pt not_active Application Discontinuation
- 2001-03-10 US US10/049,346 patent/US6749644B2/en not_active Expired - Lifetime
- 2001-03-10 MX MXPA02002199A patent/MXPA02002199A/es active IP Right Grant
- 2001-03-10 CA CA002383577A patent/CA2383577A1/en not_active Abandoned
- 2001-03-10 WO PCT/EP2001/002704 patent/WO2002002507A1/de not_active Ceased
- 2001-03-10 EP EP01936066A patent/EP1208077B1/de not_active Expired - Lifetime
- 2001-03-10 AT AT01936066T patent/ATE264832T1/de not_active IP Right Cessation
- 2001-03-10 DE DE50102041T patent/DE50102041D1/de not_active Expired - Lifetime
- 2001-03-10 ES ES01936066T patent/ES2219525T3/es not_active Expired - Lifetime
- 2001-03-10 JP JP2002507764A patent/JP2004502666A/ja not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| DE50102041D1 (de) | 2004-05-27 |
| ATE264832T1 (de) | 2004-05-15 |
| EP1208077B1 (de) | 2004-04-21 |
| ES2219525T3 (es) | 2004-12-01 |
| CA2383577A1 (en) | 2002-01-10 |
| AU2001262088A1 (en) | 2002-01-14 |
| BR0106932A (pt) | 2002-05-14 |
| DE10032134C1 (de) | 2001-12-13 |
| US20020166180A1 (en) | 2002-11-14 |
| US6749644B2 (en) | 2004-06-15 |
| JP2004502666A (ja) | 2004-01-29 |
| EP1208077A1 (de) | 2002-05-29 |
| WO2002002507A1 (de) | 2002-01-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6500213B1 (en) | Oxidizing hair coloring agents containing 2,5-diamino-1-phenylbenzene derivatives and novel 2,5-diamino-1-phenylbenzene derivatives | |
| RU2146124C1 (ru) | 3-замещенные п-аминофенолы в качестве предшественника окислительного красителя при окраске кератиновых волокон и красящая композиция на их основе | |
| MXPA01000558A (es) | NUEVO INTERMEDIARIO PRIMARIO PARA EL USO EN EL TEnIDO OXIDATIVO DEL CABELLO. | |
| MXPA02002199A (es) | Derivados de 2-hidroxi-5-amino-bifenilo asi como agentes para tenir el cabello por oxidacion, que contienen esos compuestos. | |
| CA2253981C (en) | Novel bis-(2,4-diaminophenoxy) benzenes and their use as coupling components in oxidative hair coloring compositions and methods | |
| US6699296B2 (en) | P-diaminobenzene derivatives and dyes containing said compounds | |
| US6685751B2 (en) | Substituted 1,4-diaminobenzene compounds and oxidation dye precursor compositions containing same | |
| AU2002214975B2 (en) | Novel 1,4-Diamino-2-alkenyl-benzene derivatives and colorants containing said compounds | |
| CA2482530C (en) | 3-aminophenol derivatives substituted in the 2-position, and dyes containing these compounds | |
| AU2001239307B2 (en) | N-benzyl-P-phenylenediamine-derivatives containing colouring agents for keratin fibres and novel N-benzyl-P-phenylenediamine-derivatives | |
| ES2239075T3 (es) | Derivados p-aminofenol y productos para el teñido que los contienen. | |
| US6840965B2 (en) | P-aminophenols and colorants containing said compounds | |
| US7074243B2 (en) | N-benzyl-m-phenylenediamine derivatives and dyes containing said compounds | |
| AU2002254993B2 (en) | Oxidation hair dyes containing 3-aminophenol derivatives, and novel 3-aminophenol derivatives | |
| CA2436432A1 (en) | Colouring agents for keratin fibers containing (1,1'-biphenyl)-2,4-diamine derivatives in addition to novel (1,1'-biphenyl)-2,4-diamine-derivatives | |
| AU2005282015A1 (en) | P-diaminobenzole-derivatives and dyes containing said compounds |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| FG | Grant or registration |