DE763205A - - Google Patents
Info
- Publication number
- DE763205A DE763205A DE763205A DE 763205 A DE763205 A DE 763205A DE 763205 A DE763205 A DE 763205A
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- tetrahydrofuran
- alcohol
- abs
- hydrochloric acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 9
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 6
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 4
- 235000019253 formic acid Nutrition 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000012429 reaction media Substances 0.000 claims description 2
- BNUFNCYQXCXQSV-UHFFFAOYSA-N 3,3-dichlorooxolane Chemical compound ClC1(Cl)CCOC1 BNUFNCYQXCXQSV-UHFFFAOYSA-N 0.000 claims 1
- 101100178984 Caenorhabditis elegans hyl-2 gene Proteins 0.000 claims 1
- FWUKTPVTANTBJJ-UHFFFAOYSA-N n-[(4-amino-2-methylpyrimidin-5-yl)methyl]methanethioamide Chemical compound CC1=NC=C(CNC=S)C(N)=N1 FWUKTPVTANTBJJ-UHFFFAOYSA-N 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 4
- 229940075930 picrate Drugs 0.000 description 3
- OXNIZHLAWKMVMX-UHFFFAOYSA-M picrate anion Chemical compound [O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O OXNIZHLAWKMVMX-UHFFFAOYSA-M 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N tetrahydrofuran Substances C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- JZRWCGZRTZMZEH-UHFFFAOYSA-N thiamine Chemical compound CC1=C(CCO)SC=[N+]1CC1=CN=C(C)N=C1N JZRWCGZRTZMZEH-UHFFFAOYSA-N 0.000 description 2
- PUBJPJACIBRCNA-UHFFFAOYSA-N 2,3-dichloro-2-methyloxolane Chemical compound CC1(Cl)OCCC1Cl PUBJPJACIBRCNA-UHFFFAOYSA-N 0.000 description 1
- FPHNWFFKQCPXPI-UHFFFAOYSA-N 3-chlorooxolane Chemical compound ClC1CCOC1 FPHNWFFKQCPXPI-UHFFFAOYSA-N 0.000 description 1
- 241000282461 Canis lupus Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- PADMMUFPGNGRGI-UHFFFAOYSA-N dunnite Chemical compound [NH4+].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C=C1[N+]([O-])=O PADMMUFPGNGRGI-UHFFFAOYSA-N 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- WFIZEGIEIOHZCP-UHFFFAOYSA-M potassium formate Chemical compound [K+].[O-]C=O WFIZEGIEIOHZCP-UHFFFAOYSA-M 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000033764 rhythmic process Effects 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 1
- 239000011782 vitamin Substances 0.000 description 1
- 229930003231 vitamin Natural products 0.000 description 1
- 235000013343 vitamin Nutrition 0.000 description 1
- 229940088594 vitamin Drugs 0.000 description 1
- 150000003722 vitamin derivatives Chemical class 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE763205A (OSRAM) | ||
| DE839036C (de) | Verfahren zur Herstellung von Nicotinsaeuretetrahydrofurfurylester | |
| DE824056C (de) | Verfahren zur Herstellung von mandelsaurem Hexamethylentetramin | |
| DE878943C (de) | Verfahren zur Herstellung ungesaettigter Nitrile | |
| DE940831C (de) | Verfahren zur Herstellung eines Pyridopyrimidindions | |
| DE804807C (de) | Verfahren zur Herstellung von ª‡-Keto-ª€-oxycarbonsaeuren | |
| DE925474C (de) | Verfahren zur Herstellung von Aminoacetal | |
| DE442655C (de) | Verfahren zur Herstellung von Cyclohexenylalkylbarbitursaeuren | |
| DE1088972B (de) | Verfahren zur Herstellung von ª†, ª†, ª†-Triphenylpropylaminen | |
| DE536891C (de) | Verfahren zur Darstellung von Pyridinderivaten | |
| DE712745C (de) | Verfahren zur Herstellung von Chromanen | |
| DE2139084B2 (de) | Verfahren zur Herstellung von 4,4-Diphenyl-piperidinen | |
| DE744282C (de) | Verfahren zur Herstellung von cyclisch substituierten Tetrazolen | |
| DE613736C (de) | Verfahren zur Darstellung von Verbindungen der Hydrouracilreihe | |
| DE671841C (de) | Verfahren zur Herstellung von N-Alkyl- und N-Aralkylabkoemmlingen des Aminoaethylephedrins | |
| DE396507C (de) | Verfahren zur Darstellung von Pyrazolonderivaten | |
| DE961167C (de) | Verfahren zur Reduktion von Verbindungen mit konjugierten Doppel- und Dreifachbindungen der Vitamin A-Reihe | |
| AT319960B (de) | Verfahren zur Herstellung von neuen Pyridazinverbindungen | |
| DE912222C (de) | Verfahren zur Herstellung von therapeutisch wertvollen Abkoemmlingen des 2-Methyl-4-aminonaphthols-(1) | |
| DE515544C (de) | Verfahren zur Darstellung von Reduktionsprodukten N-acetylierter Indoxyle | |
| DE501280C (de) | Verfahren zur Darstellung von 4-(B-Oxyaethylamino-) 1-oxybenzol | |
| DE848043C (de) | Verfahren zur Herstellung von Formylverbindungen des 2,6-Dioxy-4,5-diaminopyrimidinsund seiner Methylderivate | |
| DE957842C (de) | Verfahren zur Herstellung von neuen Octahydropyridopyrimidinverbindungen | |
| DE1445426C (de) | Verfahren zur Herstellnng von Den vaten der 2 Thiobarbitursaure | |
| DE699249C (de) | Verfahren zur Herstellung von Abkoemmlingen des ª‰-(o-Oxyphenyl)-isopropylamins |