DE2508947C3 - Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen - Google Patents
Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinenInfo
- Publication number
- DE2508947C3 DE2508947C3 DE2508947A DE2508947A DE2508947C3 DE 2508947 C3 DE2508947 C3 DE 2508947C3 DE 2508947 A DE2508947 A DE 2508947A DE 2508947 A DE2508947 A DE 2508947A DE 2508947 C3 DE2508947 C3 DE 2508947C3
- Authority
- DE
- Germany
- Prior art keywords
- hexahydro
- pyrazino
- oxo
- acid
- isoquinoline
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 4
- GTRDOUXISKJZGL-UHFFFAOYSA-N 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one Chemical class C1=CC=C2C3CNCC(=O)N3CCC2=C1 GTRDOUXISKJZGL-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 claims description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 150000001875 compounds Chemical class 0.000 claims description 8
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 150000002537 isoquinolines Chemical class 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 26
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 23
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 16
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 235000011007 phosphoric acid Nutrition 0.000 description 12
- -1 aliphatic alkyl radical Chemical class 0.000 description 11
- 239000000243 solution Substances 0.000 description 10
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 150000007513 acids Chemical class 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 125000004432 carbon atom Chemical group C* 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 125000000217 alkyl group Chemical group 0.000 description 5
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000008346 aqueous phase Substances 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical class [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 150000003951 lactams Chemical group 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- 229910052717 sulfur Inorganic materials 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 230000000507 anthelmentic effect Effects 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 description 2
- 229910000343 potassium bisulfate Inorganic materials 0.000 description 2
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- SUCYGZUQJXUYID-UHFFFAOYSA-N 2-benzoyl-3,4-dihydro-1h-isoquinoline-1-carbonitrile Chemical compound C1CC2=CC=CC=C2C(C#N)N1C(=O)C1=CC=CC=C1 SUCYGZUQJXUYID-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000008043 acidic salts Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- 239000002026 chloroform extract Substances 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- APGUSRKQFBWUPZ-UHFFFAOYSA-K disulfooxyalumanyl hydrogen sulfate Chemical compound [Al+3].OS([O-])(=O)=O.OS([O-])(=O)=O.OS([O-])(=O)=O APGUSRKQFBWUPZ-UHFFFAOYSA-K 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- OMRRUNXAWXNVFW-UHFFFAOYSA-N fluoridochlorine Chemical compound ClF OMRRUNXAWXNVFW-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- XONPDZSGENTBNJ-UHFFFAOYSA-N molecular hydrogen;sodium Chemical compound [Na].[H][H] XONPDZSGENTBNJ-UHFFFAOYSA-N 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003009 phosphonic acids Chemical class 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2508947A DE2508947C3 (de) | 1975-03-01 | 1975-03-01 | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen |
| CS761180A CS194236B2 (en) | 1975-03-01 | 1976-02-23 | Method of preparing derivatives of 4-oxo-hexahydro-4h-pyrazino-isoquinoline |
| FR7605247A FR2303014A1 (fr) | 1975-03-01 | 1976-02-25 | Procede de preparation de derives de 4-oxo-hexahydro-pyrazino-isoquinoleine |
| DK79476A DK137275C (da) | 1975-03-01 | 1976-02-25 | Fremgangsmaade til fremstilling af 4-oxo-hexahydropyrazinoisoquinolinderivater |
| SE7602535A SE422579B (sv) | 1975-03-01 | 1976-02-26 | Forfarande for framstellning av 4-oxo-hexahydro-pyrazino(2,1-a)isokinolinderivat |
| US05/662,009 US4049659A (en) | 1975-03-01 | 1976-02-27 | Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives |
| IE398/76A IE42959B1 (en) | 1975-03-01 | 1976-02-27 | Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives |
| CA246,703A CA1068701A (en) | 1975-03-01 | 1976-02-27 | Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives |
| ES445591A ES445591A1 (es) | 1975-03-01 | 1976-02-27 | Procedimiento para la obtencion de derivados de 4-oxo-hexa- hidro-pirazi-noisoquinolina. |
| AT147576A AT358043B (de) | 1975-03-01 | 1976-02-27 | Verfahren zur herstellung von 4-oxohexahydro- -pyrazinoisochinolinderivaten und ihren physiologisch unbedenklichen salzen |
| YU00505/76A YU50576A (en) | 1975-03-01 | 1976-02-27 | Process for obtaining derivatives of 4-oxohexahydro-piperazinoisoquinoline |
| JP51022039A JPS5940155B2 (ja) | 1975-03-01 | 1976-02-27 | 4−オキソヘキサヒドロピラジノイソキノリン誘導体の製造方法 |
| BE164697A BE839004A (fr) | 1975-03-01 | 1976-02-27 | Procede de preparation de 4-oxo-hexahydropyrazino-isoquinoleine |
| FI760519A FI60866C (fi) | 1975-03-01 | 1976-02-27 | Foerfarande foer framstaellning av 4-oxo-1,2,3,6,7,11b-hexahydro-4h-pyrazino-(2,1-a)isokinoliner vilka aer mellanprodukter vid framstaellning av 2-acyl-4-oxo-1,2,3,6,7,11b-hexahydro-4h-pyrazino(2,1-a)isokinoliner anvaendbara saosom antihelmintika |
| GB7831/76A GB1495236A (en) | 1975-03-01 | 1976-02-27 | Process for the preparation of 4-oxo-hexa-hydro-pyrazinoisoquinoline derivatives |
| LU74448A LU74448A1 (enExample) | 1975-03-01 | 1976-02-27 | |
| CH251576A CH602727A5 (enExample) | 1975-03-01 | 1976-03-01 | |
| HU76ME1959A HU175127B (hu) | 1975-03-01 | 1976-03-01 | Sposob poluchenija proizvodnykh 4-okso-1,2,3,6,7,11b-geksagidro-4h-pirazino/2,1-a/-izokhinolina |
| NLAANVRAGE7602101,A NL186696C (nl) | 1975-03-01 | 1976-03-01 | Werkwijze voor het bereiden van 4-oxohexahydro-pyrazinoisochinolinederivaten. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2508947A DE2508947C3 (de) | 1975-03-01 | 1975-03-01 | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2508947A1 DE2508947A1 (de) | 1976-09-09 |
| DE2508947B2 DE2508947B2 (de) | 1981-05-07 |
| DE2508947C3 true DE2508947C3 (de) | 1982-02-25 |
Family
ID=5940184
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2508947A Expired DE2508947C3 (de) | 1975-03-01 | 1975-03-01 | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4049659A (enExample) |
| JP (1) | JPS5940155B2 (enExample) |
| AT (1) | AT358043B (enExample) |
| BE (1) | BE839004A (enExample) |
| CA (1) | CA1068701A (enExample) |
| CH (1) | CH602727A5 (enExample) |
| CS (1) | CS194236B2 (enExample) |
| DE (1) | DE2508947C3 (enExample) |
| DK (1) | DK137275C (enExample) |
| ES (1) | ES445591A1 (enExample) |
| FI (1) | FI60866C (enExample) |
| FR (1) | FR2303014A1 (enExample) |
| GB (1) | GB1495236A (enExample) |
| HU (1) | HU175127B (enExample) |
| IE (1) | IE42959B1 (enExample) |
| LU (1) | LU74448A1 (enExample) |
| NL (1) | NL186696C (enExample) |
| SE (1) | SE422579B (enExample) |
| YU (1) | YU50576A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4196291A (en) * | 1973-12-17 | 1980-04-01 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4141978A (en) * | 1973-12-17 | 1979-02-27 | Merck Patent Gesellschaft Mit Beschrankter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4162319A (en) * | 1974-08-28 | 1979-07-24 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Ring substituted pyrazino-isoquinoline derivatives and their preparation |
| DE3916549C1 (enExample) * | 1989-05-20 | 1990-05-17 | Daimler-Benz Aktiengesellschaft, 7000 Stuttgart, De | |
| CN100503582C (zh) * | 2005-03-01 | 2009-06-24 | 江苏工业学院 | 吡喹酮合成工艺 |
| CN101691367B (zh) * | 2009-08-31 | 2013-07-24 | 中国人民解放军第二军医大学 | 具有抗真菌活性的哌嗪并[2,1-a]异喹啉类化合物或其盐类 |
| WO2012081035A2 (en) * | 2010-12-13 | 2012-06-21 | Sequent Scientific Limited | A process for preparation of praziquantel |
| US10035798B2 (en) | 2015-02-12 | 2018-07-31 | Zhejiang Hisun Pharmaceutical Co., Ltd. | Preparation method for praziquantel and intermediate compounds thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2331713A1 (de) * | 1973-06-22 | 1975-01-23 | Merck Patent Gmbh | Pyrazinoisochinolin-derivat |
-
1975
- 1975-03-01 DE DE2508947A patent/DE2508947C3/de not_active Expired
-
1976
- 1976-02-23 CS CS761180A patent/CS194236B2/cs unknown
- 1976-02-25 DK DK79476A patent/DK137275C/da active
- 1976-02-25 FR FR7605247A patent/FR2303014A1/fr active Granted
- 1976-02-26 SE SE7602535A patent/SE422579B/xx not_active IP Right Cessation
- 1976-02-27 CA CA246,703A patent/CA1068701A/en not_active Expired
- 1976-02-27 ES ES445591A patent/ES445591A1/es not_active Expired
- 1976-02-27 FI FI760519A patent/FI60866C/fi not_active IP Right Cessation
- 1976-02-27 IE IE398/76A patent/IE42959B1/en unknown
- 1976-02-27 AT AT147576A patent/AT358043B/de not_active IP Right Cessation
- 1976-02-27 YU YU00505/76A patent/YU50576A/xx unknown
- 1976-02-27 JP JP51022039A patent/JPS5940155B2/ja not_active Expired
- 1976-02-27 LU LU74448A patent/LU74448A1/xx unknown
- 1976-02-27 US US05/662,009 patent/US4049659A/en not_active Expired - Lifetime
- 1976-02-27 GB GB7831/76A patent/GB1495236A/en not_active Expired
- 1976-02-27 BE BE164697A patent/BE839004A/xx not_active IP Right Cessation
- 1976-03-01 NL NLAANVRAGE7602101,A patent/NL186696C/xx not_active IP Right Cessation
- 1976-03-01 HU HU76ME1959A patent/HU175127B/hu unknown
- 1976-03-01 CH CH251576A patent/CH602727A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL186696B (nl) | 1990-09-03 |
| DE2508947B2 (de) | 1981-05-07 |
| DK137275C (da) | 1978-07-17 |
| CA1068701A (en) | 1979-12-25 |
| NL7602101A (nl) | 1976-09-03 |
| FR2303014A1 (fr) | 1976-10-01 |
| FI60866C (fi) | 1982-04-13 |
| IE42959B1 (en) | 1980-11-19 |
| SE7602535L (sv) | 1976-09-02 |
| JPS51110600A (en) | 1976-09-30 |
| BE839004A (fr) | 1976-08-27 |
| FI760519A7 (enExample) | 1976-09-02 |
| DE2508947A1 (de) | 1976-09-09 |
| AT358043B (de) | 1980-08-11 |
| DK79476A (da) | 1976-09-02 |
| SE422579B (sv) | 1982-03-15 |
| DK137275B (da) | 1978-02-13 |
| FR2303014B1 (enExample) | 1978-05-19 |
| US4049659A (en) | 1977-09-20 |
| CH602727A5 (enExample) | 1978-07-31 |
| ES445591A1 (es) | 1977-06-01 |
| FI60866B (fi) | 1981-12-31 |
| GB1495236A (en) | 1977-12-14 |
| ATA147576A (de) | 1980-01-15 |
| CS194236B2 (en) | 1979-11-30 |
| IE42959L (en) | 1976-09-01 |
| JPS5940155B2 (ja) | 1984-09-28 |
| HU175127B (hu) | 1980-05-28 |
| NL186696C (nl) | 1991-02-01 |
| YU50576A (en) | 1982-05-31 |
| LU74448A1 (enExample) | 1977-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2741270A1 (de) | Verfahren zum synthetisieren von methotrexat | |
| DE1695753B2 (de) | Verfahren zur Herstellung von 6,6disubstituierten 2,2-Dimethyl-4-oxopiperidinen | |
| DE1620694B2 (de) | Verfahren zur Herstellung von 5-Methyl-7-diäthylamino-s-triazolo [1,5-a] pyrimidin und seinen Salzen mit Säuren | |
| DE2508947C3 (de) | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen | |
| DE2431192C2 (de) | O,O-DiäthylS-[6-chlor-1,3-benzoxazolon-3-yl-methyl]-dithiophosphat | |
| DE2365302C3 (de) | Verfahren zur herstellung von 2- amino-nicotino-nitrilen | |
| DE1795193A1 (de) | Verfahren zur Herstellung von Morphinanderivaten | |
| DE1116221B (de) | Verfahren zur Herstellung von ªú¼ª-Pentamethylenbutyrolacton bzw. Salzen der 3,3-Pentamethylen-4-hydroxybuttersaeure | |
| DE883901C (de) | Verfahren zur Herstellung von Chinolyl-3-dialkylphosphaten und deren Salzen | |
| CH629743A5 (de) | Verfahren zur herstellung von optisch aktiven anthracyclinonen. | |
| DE1470367A1 (de) | Verfahren zur Herstellung von in 5-Stellung substituierten 5,6-Dihydro-6-oxopyrido[2,3-b][1,4]benzoxazepinen | |
| DE1228238B (de) | Verfahren zur Herstellung von als Schlafmittel verwendbaren halogenhaltigen primaeren Phosphorsaeureestern | |
| DE2618721C2 (de) | Benzo(b)-bicyclo[3,3,1]nonene, Verfahren zu deren Herstellung und pharmazeutische Mittel, die diese Verbindungen enthalten | |
| DE1770563C3 (de) | Verfahren zur Herstellung von 14-Hydroxy-dihydro-ebeta-thebainoM-methyläther | |
| DE915336C (de) | Verfahren zur Herstellung von 6-Methoxy-8-(aminoalkylamino)-chinolinen | |
| DE1801305A1 (de) | Verfahren zur Herstellung von 7-Chlor-2,3-dihydro-1-methyl-5-o-trifluormethylphenyl-1 H-1,4-benzodiazepin | |
| DE1595980C3 (de) | Phosphorsäureester des 4H-m-Dioxinoeckige Klammer auf 4,5-c eckige Klammer zu -pyridins, deren Herstellung und Verwendung | |
| AT357543B (de) | Verfahren zur herstellung von pyrimidin- derivaten und deren salzen | |
| DE1745780C3 (de) | l-Sulfonyläthyl^-methyl-S-nitroimidazole und Verfahren zu ihrer Herstellung | |
| AT376224B (de) | Verfahren zur herstellung neuer o-aryl-nphosphonmethylglycinnitrile bzw. deren sauren und alkalischen salzen | |
| DE2118365C3 (de) | m-Benzoylphenylessigsäureester, Verfahren zu ihrer Herstellung und pharmazeutische Zusammensetzungen | |
| CH630075A5 (en) | Process for the preparation of N,N-dimethyl-3-(4-bromophenyl)-3-(3-pyridyl)allylamine | |
| DE2064107A1 (de) | Verfahren zur Herstellung von Cephem-4-carbonsäureestern | |
| CH646167A5 (de) | Verfahren zur herstellung von apovincaminsaeureestern. | |
| DE3934957A1 (de) | Verfahren zur herstellung von 3-trichlormethyl-pyridin |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) |