CA1068701A - Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives - Google Patents
Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivativesInfo
- Publication number
- CA1068701A CA1068701A CA246,703A CA246703A CA1068701A CA 1068701 A CA1068701 A CA 1068701A CA 246703 A CA246703 A CA 246703A CA 1068701 A CA1068701 A CA 1068701A
- Authority
- CA
- Canada
- Prior art keywords
- acid
- oxo
- hexahydro
- methyl
- process according
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims abstract description 21
- 238000002360 preparation method Methods 0.000 title description 5
- 239000002253 acid Substances 0.000 claims abstract description 38
- 150000003839 salts Chemical class 0.000 claims abstract description 15
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims abstract description 6
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 6
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 6
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 6
- 239000001301 oxygen Substances 0.000 claims abstract description 6
- 229910052698 phosphorus Inorganic materials 0.000 claims abstract description 6
- 239000011574 phosphorus Substances 0.000 claims abstract description 6
- 230000003301 hydrolyzing effect Effects 0.000 claims abstract description 5
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 5
- 239000011593 sulfur Substances 0.000 claims abstract description 5
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 24
- 238000006243 chemical reaction Methods 0.000 claims description 19
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 14
- 235000011007 phosphoric acid Nutrition 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 7
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- CHKVPAROMQMJNQ-UHFFFAOYSA-M potassium bisulfate Chemical compound [K+].OS([O-])(=O)=O CHKVPAROMQMJNQ-UHFFFAOYSA-M 0.000 claims description 4
- 229910000343 potassium bisulfate Inorganic materials 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 3
- XBFJARLCBIBXMG-UHFFFAOYSA-N 3,4-dihydropyrido[3,4-f]quinoxaline Chemical class C1=CN=CC2=C(N=CCN3)C3=CC=C21 XBFJARLCBIBXMG-UHFFFAOYSA-N 0.000 claims description 2
- 235000011149 sulphuric acid Nutrition 0.000 claims description 2
- 229910052739 hydrogen Inorganic materials 0.000 claims 3
- 239000001257 hydrogen Substances 0.000 claims 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 230000001476 alcoholic effect Effects 0.000 claims 2
- 150000001340 alkali metals Chemical class 0.000 claims 2
- 239000002904 solvent Substances 0.000 claims 2
- 150000002431 hydrogen Chemical class 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 abstract description 32
- 150000001875 compounds Chemical class 0.000 abstract description 8
- 230000007062 hydrolysis Effects 0.000 abstract description 5
- 238000006460 hydrolysis reaction Methods 0.000 abstract description 5
- 230000000507 anthelmentic effect Effects 0.000 abstract description 3
- 229940124339 anthelmintic agent Drugs 0.000 abstract description 2
- 239000000921 anthelmintic agent Substances 0.000 abstract description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 26
- 239000000243 solution Substances 0.000 description 9
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- -1 alkyl radical Chemical class 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 229910052938 sodium sulfate Inorganic materials 0.000 description 5
- 235000011152 sodium sulphate Nutrition 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- GTRDOUXISKJZGL-UHFFFAOYSA-N 1,2,3,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-4-one Chemical compound C1=CC=C2C3CNCC(=O)N3CCC2=C1 GTRDOUXISKJZGL-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 239000002026 chloroform extract Substances 0.000 description 3
- 150000003951 lactams Chemical group 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- XPPKVPWEQAFLFU-UHFFFAOYSA-N diphosphoric acid Chemical compound OP(O)(=O)OP(O)(O)=O XPPKVPWEQAFLFU-UHFFFAOYSA-N 0.000 description 2
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 238000005984 hydrogenation reaction Methods 0.000 description 2
- 150000002537 isoquinolines Chemical class 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 238000006798 ring closing metathesis reaction Methods 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- 125000004215 2,4-difluorophenyl group Chemical group [H]C1=C([H])C(*)=C(F)C([H])=C1F 0.000 description 1
- SXAMGRAIZSSWIH-UHFFFAOYSA-N 2-[3-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,2,4-oxadiazol-5-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NOC(=N1)CC(=O)N1CC2=C(CC1)NN=N2 SXAMGRAIZSSWIH-UHFFFAOYSA-N 0.000 description 1
- CJWDCOSZJPAVOA-UHFFFAOYSA-N 2-acetyl-1h-isoquinoline-1-carbonitrile Chemical compound C1=CC=C2C(C#N)N(C(=O)C)C=CC2=C1 CJWDCOSZJPAVOA-UHFFFAOYSA-N 0.000 description 1
- SUCYGZUQJXUYID-UHFFFAOYSA-N 2-benzoyl-3,4-dihydro-1h-isoquinoline-1-carbonitrile Chemical compound C1CC2=CC=CC=C2C(C#N)N1C(=O)C1=CC=CC=C1 SUCYGZUQJXUYID-UHFFFAOYSA-N 0.000 description 1
- XEYCCEDRIDKXEV-UHFFFAOYSA-N 2-benzoyl-3,6,7,11b-tetrahydro-1h-pyrazino[2,1-a]isoquinolin-4-one Chemical compound C1C(C2=CC=CC=C2CC2)N2C(=O)CN1C(=O)C1=CC=CC=C1 XEYCCEDRIDKXEV-UHFFFAOYSA-N 0.000 description 1
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 1
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- NXTNASSYJUXJDV-UHFFFAOYSA-N 3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1 NXTNASSYJUXJDV-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000002619 bicyclic group Chemical group 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 150000001860 citric acid derivatives Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 238000003402 intramolecular cyclocondensation reaction Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229910000402 monopotassium phosphate Inorganic materials 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 150000003017 phosphorus Chemical class 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- CCSONKKTCMHYFI-UHFFFAOYSA-N pyrido[3,4-f]quinoxaline Chemical class C1=NC=C2C3=NC=CN=C3C=CC2=C1 CCSONKKTCMHYFI-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- WBHQBSYUUJJSRZ-UHFFFAOYSA-M sodium bisulfate Chemical compound [Na+].OS([O-])(=O)=O WBHQBSYUUJJSRZ-UHFFFAOYSA-M 0.000 description 1
- 229910000342 sodium bisulfate Inorganic materials 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 150000003463 sulfur Chemical class 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/02—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains two hetero rings
- C07D471/04—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D217/00—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems
- C07D217/02—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines
- C07D217/06—Heterocyclic compounds containing isoquinoline or hydrogenated isoquinoline ring systems with only hydrogen atoms or radicals containing only carbon and hydrogen atoms, directly attached to carbon atoms of the nitrogen-containing ring; Alkylene-bis-isoquinolines with the ring nitrogen atom acylated by carboxylic or carbonic acids, or with sulfur or nitrogen analogues thereof, e.g. carbamates
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2508947A DE2508947C3 (de) | 1975-03-01 | 1975-03-01 | Verfahren zur Herstellung von 4-Oxo-1,2,3,6,7, 11b-hexahydro-4H-pyrazino [2,1-a] isochinolinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1068701A true CA1068701A (en) | 1979-12-25 |
Family
ID=5940184
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA246,703A Expired CA1068701A (en) | 1975-03-01 | 1976-02-27 | Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US4049659A (enExample) |
| JP (1) | JPS5940155B2 (enExample) |
| AT (1) | AT358043B (enExample) |
| BE (1) | BE839004A (enExample) |
| CA (1) | CA1068701A (enExample) |
| CH (1) | CH602727A5 (enExample) |
| CS (1) | CS194236B2 (enExample) |
| DE (1) | DE2508947C3 (enExample) |
| DK (1) | DK137275C (enExample) |
| ES (1) | ES445591A1 (enExample) |
| FI (1) | FI60866C (enExample) |
| FR (1) | FR2303014A1 (enExample) |
| GB (1) | GB1495236A (enExample) |
| HU (1) | HU175127B (enExample) |
| IE (1) | IE42959B1 (enExample) |
| LU (1) | LU74448A1 (enExample) |
| NL (1) | NL186696C (enExample) |
| SE (1) | SE422579B (enExample) |
| YU (1) | YU50576A (enExample) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4196291A (en) * | 1973-12-17 | 1980-04-01 | Merck Patent Gesellschaft Mit Beschraenkter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4141978A (en) * | 1973-12-17 | 1979-02-27 | Merck Patent Gesellschaft Mit Beschrankter Haftung | 2-Acyl-4-oxo-pyrazino-isoquinoline derivatives and process for the preparation thereof |
| US4162319A (en) * | 1974-08-28 | 1979-07-24 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Ring substituted pyrazino-isoquinoline derivatives and their preparation |
| DE3916549C1 (enExample) * | 1989-05-20 | 1990-05-17 | Daimler-Benz Aktiengesellschaft, 7000 Stuttgart, De | |
| CN100503582C (zh) * | 2005-03-01 | 2009-06-24 | 江苏工业学院 | 吡喹酮合成工艺 |
| CN101691367B (zh) * | 2009-08-31 | 2013-07-24 | 中国人民解放军第二军医大学 | 具有抗真菌活性的哌嗪并[2,1-a]异喹啉类化合物或其盐类 |
| WO2012081035A2 (en) * | 2010-12-13 | 2012-06-21 | Sequent Scientific Limited | A process for preparation of praziquantel |
| US10035798B2 (en) | 2015-02-12 | 2018-07-31 | Zhejiang Hisun Pharmaceutical Co., Ltd. | Preparation method for praziquantel and intermediate compounds thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2331713A1 (de) * | 1973-06-22 | 1975-01-23 | Merck Patent Gmbh | Pyrazinoisochinolin-derivat |
-
1975
- 1975-03-01 DE DE2508947A patent/DE2508947C3/de not_active Expired
-
1976
- 1976-02-23 CS CS761180A patent/CS194236B2/cs unknown
- 1976-02-25 DK DK79476A patent/DK137275C/da active
- 1976-02-25 FR FR7605247A patent/FR2303014A1/fr active Granted
- 1976-02-26 SE SE7602535A patent/SE422579B/xx not_active IP Right Cessation
- 1976-02-27 CA CA246,703A patent/CA1068701A/en not_active Expired
- 1976-02-27 ES ES445591A patent/ES445591A1/es not_active Expired
- 1976-02-27 FI FI760519A patent/FI60866C/fi not_active IP Right Cessation
- 1976-02-27 IE IE398/76A patent/IE42959B1/en unknown
- 1976-02-27 AT AT147576A patent/AT358043B/de not_active IP Right Cessation
- 1976-02-27 YU YU00505/76A patent/YU50576A/xx unknown
- 1976-02-27 JP JP51022039A patent/JPS5940155B2/ja not_active Expired
- 1976-02-27 LU LU74448A patent/LU74448A1/xx unknown
- 1976-02-27 US US05/662,009 patent/US4049659A/en not_active Expired - Lifetime
- 1976-02-27 GB GB7831/76A patent/GB1495236A/en not_active Expired
- 1976-02-27 BE BE164697A patent/BE839004A/xx not_active IP Right Cessation
- 1976-03-01 NL NLAANVRAGE7602101,A patent/NL186696C/xx not_active IP Right Cessation
- 1976-03-01 HU HU76ME1959A patent/HU175127B/hu unknown
- 1976-03-01 CH CH251576A patent/CH602727A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL186696B (nl) | 1990-09-03 |
| DE2508947B2 (de) | 1981-05-07 |
| DK137275C (da) | 1978-07-17 |
| NL7602101A (nl) | 1976-09-03 |
| FR2303014A1 (fr) | 1976-10-01 |
| FI60866C (fi) | 1982-04-13 |
| IE42959B1 (en) | 1980-11-19 |
| SE7602535L (sv) | 1976-09-02 |
| JPS51110600A (en) | 1976-09-30 |
| BE839004A (fr) | 1976-08-27 |
| FI760519A7 (enExample) | 1976-09-02 |
| DE2508947A1 (de) | 1976-09-09 |
| AT358043B (de) | 1980-08-11 |
| DK79476A (da) | 1976-09-02 |
| SE422579B (sv) | 1982-03-15 |
| DK137275B (da) | 1978-02-13 |
| FR2303014B1 (enExample) | 1978-05-19 |
| US4049659A (en) | 1977-09-20 |
| CH602727A5 (enExample) | 1978-07-31 |
| ES445591A1 (es) | 1977-06-01 |
| FI60866B (fi) | 1981-12-31 |
| GB1495236A (en) | 1977-12-14 |
| ATA147576A (de) | 1980-01-15 |
| CS194236B2 (en) | 1979-11-30 |
| DE2508947C3 (de) | 1982-02-25 |
| IE42959L (en) | 1976-09-01 |
| JPS5940155B2 (ja) | 1984-09-28 |
| HU175127B (hu) | 1980-05-28 |
| NL186696C (nl) | 1991-02-01 |
| YU50576A (en) | 1982-05-31 |
| LU74448A1 (enExample) | 1977-09-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU451244A3 (ru) | Способ получени производных фенилимидазолилалкила | |
| US4152326A (en) | Cyclic sulphonyloxyimides | |
| US4155909A (en) | 2-Alkyl nicotinoids and processes for their production | |
| CA1068701A (en) | Process for the preparation of 4-oxo-hexahydro-pyrazinoisoquinoline derivatives | |
| US4380632A (en) | Method of preparing quinolines, naphthyridines and other nitrogen bi-heterocyclic compounds | |
| CA2368815A1 (en) | Novel synthesis and crystallization of piperazine ring-containing compounds | |
| US3433801A (en) | 1-aryl-3-(n-lower alkyl amino) pyrrolidines | |
| US4212804A (en) | Process for the preparation of optionally substituted 2,3-indolinediones | |
| US2528940A (en) | Pyrrolidylethyl indole compounds | |
| US4165322A (en) | Alkylation of aniline with a lactone in the presence of water | |
| US3158618A (en) | Nu-(acylamino)-ephedrines | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| IL27999A (en) | Naphthyl-and tetrahydronaphthyl-formamidines | |
| US2418548A (en) | X-amino-s-arylpyrimidine | |
| US4118501A (en) | Thiazolidine derivatives | |
| US3939172A (en) | 4-Aminothiazole | |
| US3244725A (en) | 4, 5-diacyl-3-hydroxy-3-pyrrolin-2-ones | |
| US3081308A (en) | 5-carbocyclic-3-imidomethyloxazolidines and process | |
| US3419561A (en) | 2,3,4,4a,5,6,10b-heptahydro-1-oxaphenanthridines and production thereof | |
| KR100452077B1 (ko) | 방향족니트릴의제조방법 | |
| CA1100508A (en) | Process of obtaining r,s-2,3,5,6-tetrahydro-6-phenyl- imidazo (2,1-b)-thiazole | |
| US4697013A (en) | Condensed as-triazine derivatives | |
| US4156735A (en) | Thiazolidine derivatives | |
| US4185020A (en) | 5-(4-Nitrophenyl)-2-furanmethanamines derivatives | |
| CA1162543A (en) | Process for the preparation of apovincaminic acid esters |