DE2333534A1 - Verfahren zur herstellung einer nematischen, fluessig-kristallinen mischung - Google Patents
Verfahren zur herstellung einer nematischen, fluessig-kristallinen mischungInfo
- Publication number
- DE2333534A1 DE2333534A1 DE19732333534 DE2333534A DE2333534A1 DE 2333534 A1 DE2333534 A1 DE 2333534A1 DE 19732333534 DE19732333534 DE 19732333534 DE 2333534 A DE2333534 A DE 2333534A DE 2333534 A1 DE2333534 A1 DE 2333534A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- radical
- mixture
- bases
- ion exchange
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000000203 mixture Substances 0.000 title claims description 70
- 238000000034 method Methods 0.000 title claims description 50
- 230000008569 process Effects 0.000 title claims description 25
- -1 alkylamine salt Chemical class 0.000 claims description 43
- 125000004432 carbon atom Chemical group C* 0.000 claims description 28
- 239000003054 catalyst Substances 0.000 claims description 26
- 239000003456 ion exchange resin Substances 0.000 claims description 24
- 229920003303 ion-exchange polymer Polymers 0.000 claims description 24
- 239000002585 base Substances 0.000 claims description 20
- 239000002262 Schiff base Substances 0.000 claims description 19
- 150000004753 Schiff bases Chemical class 0.000 claims description 18
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 claims description 14
- 230000002378 acidificating effect Effects 0.000 claims description 7
- 238000004519 manufacturing process Methods 0.000 claims description 7
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 6
- 238000010438 heat treatment Methods 0.000 claims description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 4
- WEERVPDNCOGWJF-UHFFFAOYSA-N 1,4-bis(ethenyl)benzene Chemical compound C=CC1=CC=C(C=C)C=C1 WEERVPDNCOGWJF-UHFFFAOYSA-N 0.000 claims description 3
- 235000019270 ammonium chloride Nutrition 0.000 claims description 3
- JEVCWSUVFOYBFI-UHFFFAOYSA-N cyanyl Chemical compound N#[C] JEVCWSUVFOYBFI-UHFFFAOYSA-N 0.000 claims description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 claims description 2
- 239000005695 Ammonium acetate Substances 0.000 claims description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 claims description 2
- 235000019257 ammonium acetate Nutrition 0.000 claims description 2
- 229940043376 ammonium acetate Drugs 0.000 claims description 2
- 239000001632 sodium acetate Substances 0.000 claims description 2
- 235000017281 sodium acetate Nutrition 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 19
- 239000011347 resin Substances 0.000 description 15
- 229920005989 resin Polymers 0.000 description 15
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 125000001424 substituent group Chemical group 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 7
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 229920001429 chelating resin Polymers 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 239000000463 material Substances 0.000 description 5
- 238000003822 preparative gas chromatography Methods 0.000 description 5
- 150000003839 salts Chemical class 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 239000004793 Polystyrene Substances 0.000 description 4
- 238000006555 catalytic reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229920000642 polymer Polymers 0.000 description 4
- 150000003254 radicals Chemical class 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 150000001450 anions Chemical group 0.000 description 3
- 150000005840 aryl radicals Chemical class 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 229920002223 polystyrene Polymers 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- YZUPZGFPHUVJKC-UHFFFAOYSA-N 1-bromo-2-methoxyethane Chemical compound COCCBr YZUPZGFPHUVJKC-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000004990 Smectic liquid crystal Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000001728 carbonyl compounds Chemical class 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000011109 contamination Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000005342 ion exchange Methods 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 125000003944 tolyl group Chemical group 0.000 description 2
- 230000007704 transition Effects 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- BRIXOPDYGQCZFO-UHFFFAOYSA-N 4-ethylphenylsulfonic acid Chemical compound CCC1=CC=C(S(O)(=O)=O)C=C1 BRIXOPDYGQCZFO-UHFFFAOYSA-N 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000004988 Nematic liquid crystal Substances 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- SWIJISWYLYXOMK-UHFFFAOYSA-N [4-[(4-methoxycarbonyloxyphenyl)iminomethyl]phenyl] acetate Chemical compound C1=CC(OC(=O)OC)=CC=C1N=CC1=CC=C(OC(C)=O)C=C1 SWIJISWYLYXOMK-UHFFFAOYSA-N 0.000 description 1
- AMHOXZKEIVGXFJ-UHFFFAOYSA-N [4-[(4-pentoxycarbonyloxyphenyl)iminomethyl]phenyl] pentanoate Chemical compound C1=CC(OC(=O)OCCCCC)=CC=C1N=CC1=CC=C(OC(=O)CCCC)C=C1 AMHOXZKEIVGXFJ-UHFFFAOYSA-N 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000003957 anion exchange resin Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 150000003934 aromatic aldehydes Chemical class 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 239000003729 cation exchange resin Substances 0.000 description 1
- 229940023913 cation exchange resins Drugs 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000003098 cholesteric effect Effects 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- WQPDQJCBHQPNCZ-UHFFFAOYSA-N cyclohexa-2,4-dien-1-one Chemical compound O=C1CC=CC=C1 WQPDQJCBHQPNCZ-UHFFFAOYSA-N 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- 125000004989 dicarbonyl group Chemical group 0.000 description 1
- APTVNWGLSRAOFJ-UHFFFAOYSA-M dimethyl(dioctyl)azanium;bromide Chemical compound [Br-].CCCCCCCC[N+](C)(C)CCCCCCCC APTVNWGLSRAOFJ-UHFFFAOYSA-M 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000004973 liquid crystal related substance Substances 0.000 description 1
- 239000011159 matrix material Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- PUKRTMWWICACTN-UHFFFAOYSA-M methyl-tris(2-methylphenyl)azanium;chloride Chemical compound [Cl-].CC1=CC=CC=C1[N+](C)(C=1C(=CC=CC=1)C)C1=CC=CC=C1C PUKRTMWWICACTN-UHFFFAOYSA-M 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 150000001564 phenyl benzoates Chemical class 0.000 description 1
- 229920001467 poly(styrenesulfonates) Polymers 0.000 description 1
- 229920000172 poly(styrenesulfonic acid) Polymers 0.000 description 1
- 239000005518 polymer electrolyte Substances 0.000 description 1
- 239000002952 polymeric resin Substances 0.000 description 1
- 229960002796 polystyrene sulfonate Drugs 0.000 description 1
- 239000011970 polystyrene sulfonate Substances 0.000 description 1
- 229940005642 polystyrene sulfonic acid Drugs 0.000 description 1
- 229920003053 polystyrene-divinylbenzene Polymers 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 238000012545 processing Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000005297 pyrex Substances 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000003011 styrenyl group Chemical group [H]\C(*)=C(/[H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000003107 substituted aryl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 230000009466 transformation Effects 0.000 description 1
- SZYJELPVAFJOGJ-UHFFFAOYSA-N trimethylamine hydrochloride Chemical group Cl.CN(C)C SZYJELPVAFJOGJ-UHFFFAOYSA-N 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/08—Non-steroidal liquid crystal compounds containing at least two non-condensed rings
- C09K19/10—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings
- C09K19/22—Non-steroidal liquid crystal compounds containing at least two non-condensed rings containing at least two benzene rings linked by a chain containing carbon and nitrogen atoms as chain links, e.g. Schiff bases
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Liquid Crystal Substances (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US26826572A | 1972-07-03 | 1972-07-03 | |
| US331438A US3872140A (en) | 1972-07-03 | 1973-02-12 | Liquid crystalline compositions and method |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2333534A1 true DE2333534A1 (de) | 1974-01-24 |
Family
ID=26952977
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732333534 Pending DE2333534A1 (de) | 1972-07-03 | 1973-07-02 | Verfahren zur herstellung einer nematischen, fluessig-kristallinen mischung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3872140A (enExample) |
| JP (1) | JPS4956888A (enExample) |
| CA (1) | CA992737A (enExample) |
| DE (1) | DE2333534A1 (enExample) |
| FR (1) | FR2236557B1 (enExample) |
| GB (1) | GB1431281A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996004351A1 (de) * | 1994-08-05 | 1996-02-15 | Basf Aktiengesellschaft | Verfahren zur herstellung flüssigkristalliner mischungen |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3960752A (en) * | 1972-10-24 | 1976-06-01 | Eastman Kodak Company | Liquid crystal compositions |
| US3960748A (en) * | 1972-10-24 | 1976-06-01 | Eastman Kodak Company | Nematic liquid crystal compositions |
| US4047803A (en) * | 1973-04-24 | 1977-09-13 | Dai Nippon Toryo Kabushiki Kaisha | Nematic liquid crystal compositions |
| US3956167A (en) * | 1973-05-17 | 1976-05-11 | Beckman Instruments, Inc. | Liquid crystal compositions and devices |
| JPS5043076A (enExample) * | 1973-08-20 | 1975-04-18 | ||
| FR2274355A1 (fr) * | 1974-06-14 | 1976-01-09 | Thomson Csf | Melange de cristaux liquides presentant une anisotropie dielectrique positive et une large gamme de mesomorphisme |
| US4043634A (en) * | 1974-07-25 | 1977-08-23 | Dai Nippon Toryo Co., Ltd. | Liquid crystal electro optical element |
| FR2280700A1 (fr) * | 1974-07-31 | 1976-02-27 | Dainippon Toryo Kk | Compositions de liquide nematiquement cristallin |
| US4018507A (en) * | 1974-09-05 | 1977-04-19 | American Micro-Systems, Inc. | Liquid crystal device, composition therefor, and method for preparing the composition |
| US4005032A (en) * | 1974-09-25 | 1977-01-25 | Xerox Corporation | Liquid crystalline composition having mixed cholesteric-nematic properties |
| DE2557267A1 (de) * | 1975-12-19 | 1977-06-30 | Bbc Brown Boveri & Cie | Fluessigkristallsubstanz |
| US4066567A (en) * | 1976-02-04 | 1978-01-03 | Temple University | Liquid crystal cumulative dosimeter |
| GB1587198A (en) * | 1976-11-23 | 1981-04-01 | Ucb Sa | Process for the production of butane-1,4 diol and tetrahydrofuran |
| US4855376A (en) * | 1986-11-21 | 1989-08-08 | Hoechst Celanese Corp. | Side chain liquid crystalline polymers exhibiting nonlinear optical properties |
| US4933112A (en) * | 1986-11-21 | 1990-06-12 | Hoechst Celanese Corp. | Side chain liquid crystalline polymers exhibiting nonlinear optical properties |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2544659A (en) * | 1946-05-14 | 1951-03-13 | John F Dreyer | Dichroic light-polarizing sheet materials and the like and the formation and use thereof |
| US3675987A (en) * | 1971-03-29 | 1972-07-11 | Sperry Rand Corp | Liquid crystal compositions and devices |
-
1973
- 1973-02-12 US US331438A patent/US3872140A/en not_active Expired - Lifetime
- 1973-06-27 CA CA175,082A patent/CA992737A/en not_active Expired
- 1973-07-02 GB GB3142673A patent/GB1431281A/en not_active Expired
- 1973-07-02 DE DE19732333534 patent/DE2333534A1/de active Pending
- 1973-07-03 FR FR7324322A patent/FR2236557B1/fr not_active Expired
- 1973-07-03 JP JP48074486A patent/JPS4956888A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1996004351A1 (de) * | 1994-08-05 | 1996-02-15 | Basf Aktiengesellschaft | Verfahren zur herstellung flüssigkristalliner mischungen |
Also Published As
| Publication number | Publication date |
|---|---|
| US3872140A (en) | 1975-03-18 |
| GB1431281A (en) | 1976-04-07 |
| JPS4956888A (enExample) | 1974-06-03 |
| CA992737A (en) | 1976-07-13 |
| FR2236557A1 (enExample) | 1975-02-07 |
| FR2236557B1 (enExample) | 1977-12-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2333534A1 (de) | Verfahren zur herstellung einer nematischen, fluessig-kristallinen mischung | |
| DE1065179B (de) | Verfahren zur Herstellung harzartiger Produkte | |
| DE1221645B (de) | Verfahren zur Herstellung konzentrierter waessriger Loesungen von aliphatischen tertiaeren Aminoxyden | |
| DE2720437C3 (de) | Verfahren zum Reinigen von Rohdibenzylidensorbit | |
| CH153446A (de) | Verfahren zur Herstellung einer neuen Zelluloselösung und neue Zelluloselösung. | |
| DE2223048A1 (de) | Hydrolytisch und thermisch bestaendige vinylaromatische Sulfonsaeureharze | |
| DE3148629C2 (de) | Verfahren zur Herstellung von 1,3-und 2,4-Dibenzylidensorbiten und-xylitan | |
| DE818118C (de) | Verfahren zur Herstellung von Polymeren | |
| DE649165C (de) | Verfahren zur Herstellung von Estern der Methacrylsaeure mit einwertigen Alkoholen | |
| DE615471C (de) | Verfahren zur Darstellung von basischen Derivaten des Benzodioxans | |
| DE682256C (de) | Verfahren zur Herstellung neuer saurer quartaerer Ammoniumoxalate | |
| DE576214C (de) | Verfahren zur Herstellung von Celluloseloesungen | |
| DE611373C (de) | Verfahren zur Darstellung von Fettsaeurederivaten | |
| AT99681B (de) | Verfahren zur Darstellung von leichtlöslichen Salzen des Chinins. | |
| DE883505C (de) | Verfahren zur Herstellung Schwefel und Stickstoff enthaltender Kondensationsprodukte | |
| DE141101C (enExample) | ||
| DE1643403A1 (de) | Kristallisation von 2,6-Diphenylphenol | |
| AT353094B (de) | Verfahren zur herstellung von papierleim | |
| DE1814575A1 (de) | Verfahren zu der Herstellung eines Salzes von optisch aktivem Lysin | |
| DE486772C (de) | Verfahren zur Darstellung der N-Oxyaethylderivate des 4-Amino-1-oxybenzols | |
| DE2017727C3 (de) | Organische, nematische Verbindungen und Verfahren zu deren Herstellung | |
| DE726175C (de) | Verfahren zur Verringerung der Loeslichkeit bzw. Quellbarkeit von Eiweissstoffen | |
| AT224913B (de) | Verfahren zur Reinigung härtbarer Harzmischungen | |
| DE685361C (de) | Verfahren zur Herstellung von 5-Pyrazolon-4-sulfonsaeuren | |
| DE2019261C3 (de) | Verfahren zur Herstellung von Alkanon- oder Cycloalkanon-oximen durch partielle Reduktion von Nitroalkanen oder Nitrocycloalkanen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |