DE2254103A1 - Sicherheitsgurt fuer kraftfahrzeuge - Google Patents
Sicherheitsgurt fuer kraftfahrzeugeInfo
- Publication number
- DE2254103A1 DE2254103A1 DE2254103A DE2254103A DE2254103A1 DE 2254103 A1 DE2254103 A1 DE 2254103A1 DE 2254103 A DE2254103 A DE 2254103A DE 2254103 A DE2254103 A DE 2254103A DE 2254103 A1 DE2254103 A1 DE 2254103A1
- Authority
- DE
- Germany
- Prior art keywords
- cable
- safety belt
- belt according
- parts
- motor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 230000002441 reversible effect Effects 0.000 claims description 2
- 239000002775 capsule Substances 0.000 claims 1
- 210000000056 organ Anatomy 0.000 claims 1
- 238000005096 rolling process Methods 0.000 claims 1
- 239000002689 soil Substances 0.000 claims 1
- 238000010276 construction Methods 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- KRQUFUKTQHISJB-YYADALCUSA-N 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one Chemical compound CCC\C(=N/OCC(C)OC1=CC=C(Cl)C=C1)C1=C(O)CC(CC1=O)C1CCCSC1 KRQUFUKTQHISJB-YYADALCUSA-N 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60R—VEHICLES, VEHICLE FITTINGS, OR VEHICLE PARTS, NOT OTHERWISE PROVIDED FOR
- B60R22/00—Safety belts or body harnesses in vehicles
- B60R22/04—Passive restraint systems, i.e. systems both applied and removed automatically, e.g. by movement of the vehicle door
- B60R22/06—Passive restraint systems, i.e. systems both applied and removed automatically, e.g. by movement of the vehicle door having the belt or harness connected to a member slidable in a vehicle-mounted track
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Automotive Seat Belt Assembly (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL717115345A NL142119B (nl) | 1971-11-08 | 1971-11-08 | Veiligheidsgordel voor een motorvoertuig. |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2254103A1 true DE2254103A1 (de) | 1973-05-10 |
Family
ID=19814432
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2254103A Withdrawn DE2254103A1 (de) | 1971-11-08 | 1972-11-04 | Sicherheitsgurt fuer kraftfahrzeuge |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3833239A (enExample) |
| JP (1) | JPS5545413B2 (enExample) |
| DE (1) | DE2254103A1 (enExample) |
| FR (1) | FR2160059A5 (enExample) |
| GB (1) | GB1389318A (enExample) |
| NL (1) | NL142119B (enExample) |
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2156926A1 (de) * | 1971-11-16 | 1973-05-24 | Brose & Co Metallwerk Max | Vorrichtung zum verschieben eines befestigungsbeschlagteiles eines sicherheitsgurtes, insbesondere fuer kraftfahrzeuge |
| DE2643818A1 (de) * | 1976-09-29 | 1978-03-30 | Bayerische Motoren Werke Ag | Kraftfahrzeug mit einem passiven rueckhaltesystem fuer die fahrzeuginsassen, insbesondere von personenkraftwagen |
| DE2825136A1 (de) * | 1978-06-08 | 1979-12-13 | Volkswagenwerk Ag | Passive sicherheitsgurtanordnung fuer die sitze von fahrzeugen, insbesondere personenkraftfahrzeugen |
| DE2940888A1 (de) * | 1979-10-05 | 1981-04-09 | Erwin 2301 Westensee Blüggel | Passives sicherheitsgurt-dreipunktsystem |
| DE3102262A1 (de) * | 1981-01-24 | 1982-08-19 | Robert Bosch Gmbh, 7000 Stuttgart | "aggregat zum verstellen eines sicherheitsgurts in kraftfahrzeugen, zwischen einer anlege- und einer loesestellung" |
| DE3136335A1 (de) * | 1981-09-14 | 1983-04-14 | Repa Feinstanzwerk Gmbh, 7071 Alfdorf | Antriebsvorrichtung zum bewegen des endbeschlages eines passiv-sicherheitsgurtes |
| DE3715538A1 (de) * | 1986-05-13 | 1987-11-19 | American Safety Equip | Sitzgurtsystem und verankerungsvorrichtung dafuer |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3977696A (en) * | 1973-07-11 | 1976-08-31 | Harutoshi Igeta | Seat belt equipment |
| DE2409835A1 (de) * | 1974-03-01 | 1975-11-27 | Autoliv Schwedengurte Gmbh | Gurtschlossanordnung fuer ein passives kraftfahrzeug-sicherheitsgurtsystem |
| DE2437056A1 (de) * | 1974-08-01 | 1976-02-12 | Bosch Gmbh Robert | Sicherheitsgurtsystem |
| JPS5155525A (enExample) * | 1974-11-11 | 1976-05-15 | Nippon Soken | |
| DE2522415C2 (de) * | 1975-05-21 | 1985-03-14 | Volkswagenwerk Ag, 3180 Wolfsburg | Verstellvorrichtung für den Anlenkpunkt eines passiven Sicherheitsgurtes |
| JPS5724599Y2 (enExample) * | 1976-09-03 | 1982-05-28 | ||
| US4193613A (en) * | 1977-09-28 | 1980-03-18 | Allied Chemical Corporation | Motorized passive seat belt system |
| JPS5824604Y2 (ja) * | 1977-12-05 | 1983-05-26 | 株式会社高田工場 | パッシブベルト装置 |
| CA1123798A (en) * | 1977-12-16 | 1982-05-18 | Larry E. Felsing | Passive restraining belt for seated vehicle occupant |
| US4185855A (en) * | 1978-05-15 | 1980-01-29 | General Motors Corporation | Passive seat belt system |
| US4175773A (en) * | 1978-07-10 | 1979-11-27 | General Motors Corporation | Passive seat belt system |
| US4230342A (en) * | 1978-07-12 | 1980-10-28 | Allied Chemical Corporation | Passive seat belt system |
| US4190267A (en) * | 1978-07-12 | 1980-02-26 | Allied Chemical Corporation | Passive seat belt system |
| JPS5528552U (enExample) * | 1978-08-16 | 1980-02-23 | ||
| US4220355A (en) * | 1978-08-24 | 1980-09-02 | American Safety Equipment Corporation | Cam guide for passive shoulder harness |
| US4203618A (en) * | 1978-09-25 | 1980-05-20 | General Motors Corporation | Passive occupant restraint system |
| US4235456A (en) * | 1978-09-27 | 1980-11-25 | General Motors Corporation | Passive occupant restraint system |
| FR2439595A1 (fr) * | 1978-10-25 | 1980-05-23 | Renault | Dispositif de retenue a ceinture de securite |
| JPS5581445U (enExample) * | 1978-12-01 | 1980-06-05 | ||
| US4258933A (en) * | 1978-12-25 | 1981-03-31 | Juichiro Takada | Movable inboard belt guide for use in passive vehicle occupant restraint systems |
| US4218076A (en) * | 1979-03-26 | 1980-08-19 | General Motors Corporation | Passive seat belt system |
| US4201401A (en) * | 1979-03-26 | 1980-05-06 | General Motors Corporation | Passive lap and shoulder belt system |
| US4274657A (en) * | 1979-05-21 | 1981-06-23 | Rockwell International Corporation | Vehicle passive occupant restraining system |
| JPS5643049A (en) * | 1979-09-19 | 1981-04-21 | Nissan Motor Co Ltd | Automobile seat belt |
| US4341399A (en) * | 1980-01-16 | 1982-07-27 | Allied Corporation | Passive seat belt system |
| SE424812B (sv) * | 1980-06-18 | 1982-08-16 | Stil Ind Ab | Anordning vid sekerhetsbelten for fordon |
| GB2182839B (en) * | 1985-11-14 | 1989-10-04 | Autoliv Dev | Improvements in or relating to a safety belt system |
| JPH01158260U (enExample) * | 1988-04-19 | 1989-11-01 | ||
| US4906020A (en) * | 1989-03-10 | 1990-03-06 | Haberer Merle D | Passive restraining barrier arrangement for vehicles |
| US5183291A (en) * | 1991-03-13 | 1993-02-02 | Shah Mrugesh K | Automatic seat and shoulder belt apparatus |
| WO1994022694A1 (en) * | 1993-04-05 | 1994-10-13 | Carraway Bruce H Jr | Automatic motorized lap belt for vehicles |
| US5899098A (en) * | 1996-01-11 | 1999-05-04 | Carter; Robert L. | Tamper resistant combination lock |
| US5640860A (en) * | 1996-01-11 | 1997-06-24 | Carter; Robert L. | Tamper resistant combination lock |
| DE19615655A1 (de) * | 1996-04-19 | 1997-10-23 | Takata Europ Gmbh | Sicherheitsgurtsystem |
| IT1401203B1 (it) * | 2010-07-27 | 2013-07-12 | Vincenzotti | Dispositivo di allacciamento motorizzato delle cinture di sicurezza di un veicolo di trasporto. |
| US10625428B2 (en) * | 2018-06-26 | 2020-04-21 | Amazon Technologies, Inc. | End effector with selectively deformable interface |
| US11180110B2 (en) * | 2018-09-12 | 2021-11-23 | Ford Global Technologies, Llc | Vehicle buckle assembly |
| US12017605B2 (en) * | 2022-09-15 | 2024-06-25 | Ford Global Technologies, Llc | Slidable seatbelt assembly for a wheelchair |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1168991A (en) * | 1965-07-26 | 1969-10-29 | Humber Ltd | Improvements in or relating to Suspension Systems for Motor Vehicles |
| US3680883A (en) * | 1971-02-25 | 1972-08-01 | Gen Motors Corp | Vehicle passive occupant restraining belt arrangement |
| US3684310A (en) * | 1971-02-25 | 1972-08-15 | Gen Motors Corp | Vehicle passive occupant restraining belt arrangement |
-
1971
- 1971-11-08 NL NL717115345A patent/NL142119B/xx not_active IP Right Cessation
-
1972
- 1972-11-03 GB GB5070372A patent/GB1389318A/en not_active Expired
- 1972-11-04 DE DE2254103A patent/DE2254103A1/de not_active Withdrawn
- 1972-11-07 US US00304345A patent/US3833239A/en not_active Expired - Lifetime
- 1972-11-07 FR FR7239340A patent/FR2160059A5/fr not_active Expired
- 1972-11-08 JP JP11195872A patent/JPS5545413B2/ja not_active Expired
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2156926A1 (de) * | 1971-11-16 | 1973-05-24 | Brose & Co Metallwerk Max | Vorrichtung zum verschieben eines befestigungsbeschlagteiles eines sicherheitsgurtes, insbesondere fuer kraftfahrzeuge |
| DE2643818A1 (de) * | 1976-09-29 | 1978-03-30 | Bayerische Motoren Werke Ag | Kraftfahrzeug mit einem passiven rueckhaltesystem fuer die fahrzeuginsassen, insbesondere von personenkraftwagen |
| DE2825136A1 (de) * | 1978-06-08 | 1979-12-13 | Volkswagenwerk Ag | Passive sicherheitsgurtanordnung fuer die sitze von fahrzeugen, insbesondere personenkraftfahrzeugen |
| DE2940888A1 (de) * | 1979-10-05 | 1981-04-09 | Erwin 2301 Westensee Blüggel | Passives sicherheitsgurt-dreipunktsystem |
| DE3102262A1 (de) * | 1981-01-24 | 1982-08-19 | Robert Bosch Gmbh, 7000 Stuttgart | "aggregat zum verstellen eines sicherheitsgurts in kraftfahrzeugen, zwischen einer anlege- und einer loesestellung" |
| DE3136335A1 (de) * | 1981-09-14 | 1983-04-14 | Repa Feinstanzwerk Gmbh, 7071 Alfdorf | Antriebsvorrichtung zum bewegen des endbeschlages eines passiv-sicherheitsgurtes |
| DE3715538A1 (de) * | 1986-05-13 | 1987-11-19 | American Safety Equip | Sitzgurtsystem und verankerungsvorrichtung dafuer |
| DE3715538C2 (de) * | 1986-05-13 | 1998-07-16 | American Safety Equip | Sitzgurtsystem und Verankerungsvorrichtung dafür |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5545413B2 (enExample) | 1980-11-18 |
| NL7115345A (enExample) | 1973-05-10 |
| GB1389318A (en) | 1975-04-03 |
| JPS4858519A (enExample) | 1973-08-16 |
| FR2160059A5 (enExample) | 1973-06-22 |
| NL142119B (nl) | 1974-05-15 |
| US3833239A (en) | 1974-09-03 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2254103A1 (de) | Sicherheitsgurt fuer kraftfahrzeuge | |
| DE102017005905B4 (de) | Sitz für ein Kraftfahrzeug | |
| DE102014115126A1 (de) | Elektromotorisch verstellbare Stützeinrichtung | |
| DE2263291C3 (de) | Passive Sicherheitsgurtsystem | |
| DE2206631B2 (de) | Automatische anlegevorrichtung fuer sicherheitsgurte | |
| DE10112918A1 (de) | Fahrzeugsitz | |
| DE102013110096A1 (de) | Aufstellhebelmechanik mit Bowdenzug | |
| DE1957744A1 (de) | Verstellbarer Stuhl | |
| DE2260243A1 (de) | Passiver sicherheitsgurt fuer kraftfahrzeuge oder dergleichen | |
| DE2211707A1 (de) | Kraftfahrzeugsicherheitsgurt | |
| EP3009052A1 (de) | Elektromotorische verstellvorrichtung | |
| DE3029734A1 (de) | Fahrzeugsitz, insbesondere fuer flugzeuge und omnibusse | |
| DE102004015450A1 (de) | Kraftfahrzeugsitz | |
| DE102012019485A1 (de) | Komfortsitz für ein Kraftfahrzeug | |
| DE2622556A1 (de) | Fahrzeug, insbesondere kraftfahrzeug, mit im wesentlichen horizontal verstellbaren sitzen | |
| DE2239334C3 (de) | Sich selbsttätig anlegende Sicherheitsgurteinrichtung | |
| DE2211426A1 (de) | Sicherheitsgurt für Kraftfahrzeuge | |
| DE102004015451B4 (de) | Kraftfahrzeugsitz | |
| DE3141702A1 (de) | Vorrichtung zur hoehenverstellung des oberen befestigungs- oder umlenkbeschlages fuer den schultergurt eines sicherheitsgurtsystems | |
| DE3429426A1 (de) | Kraftfahrzeug-vordersitz mit einem sicherheitsgurtsystem | |
| DE2415654A1 (de) | Sicherheits-gurtsystem fuer kraftfahrzeuge | |
| DE10049910A1 (de) | Gurtanbietevorrichtung für einen Sicherheitsgurt | |
| DE2925484A1 (de) | Sicherheitshaltevorrichtung fuer einen fahrzeugsitz | |
| DE7918120U1 (de) | Sicherheitshaltevorrichtung für einen Fahrzeugsitz | |
| DE102004034624B3 (de) | Vorrichtung zum Verstellen einer Sitzposition |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OGA | New person/name/address of the applicant | ||
| OD | Request for examination | ||
| 8130 | Withdrawal |