DE2063857B2 - -imidazole - Google Patents
-imidazoleInfo
- Publication number
- DE2063857B2 DE2063857B2 DE2063857A DE2063857A DE2063857B2 DE 2063857 B2 DE2063857 B2 DE 2063857B2 DE 2063857 A DE2063857 A DE 2063857A DE 2063857 A DE2063857 A DE 2063857A DE 2063857 B2 DE2063857 B2 DE 2063857B2
- Authority
- DE
- Germany
- Prior art keywords
- acid
- treatment
- carried out
- compounds
- imidazole
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000002253 acid Substances 0.000 claims description 12
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 8
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 description 19
- 239000000460 chlorine Substances 0.000 description 14
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- 238000002474 experimental method Methods 0.000 description 8
- 150000002576 ketones Chemical class 0.000 description 8
- 238000012360 testing method Methods 0.000 description 8
- 239000002904 solvent Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 241000233866 Fungi Species 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 239000012153 distilled water Substances 0.000 description 5
- -1 lithium aluminum hydride Chemical compound 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 3
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000001298 alcohols Chemical class 0.000 description 3
- 230000000844 anti-bacterial effect Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- QSWSKDXFOIOXKW-UHFFFAOYSA-N 1h-imidazole;nitric acid Chemical compound O[N+]([O-])=O.C1=CNC=N1 QSWSKDXFOIOXKW-UHFFFAOYSA-N 0.000 description 2
- 241000894006 Bacteria Species 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 240000005979 Hordeum vulgare Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- 241000283973 Oryctolagus cuniculus Species 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 150000001447 alkali salts Chemical class 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000011156 evaluation Methods 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 230000000855 fungicidal effect Effects 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 239000002054 inoculum Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N thiocyanic acid Chemical compound SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- QBYIENPQHBMVBV-HFEGYEGKSA-N (2R)-2-hydroxy-2-phenylacetic acid Chemical compound O[C@@H](C(O)=O)c1ccccc1.O[C@@H](C(O)=O)c1ccccc1 QBYIENPQHBMVBV-HFEGYEGKSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- PKRSYEPBQPFNRB-UHFFFAOYSA-N 2-phenoxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC1=CC=CC=C1 PKRSYEPBQPFNRB-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 102000004877 Insulin Human genes 0.000 description 1
- 108090001061 Insulin Proteins 0.000 description 1
- 241000638919 Kleinia stapeliiformis Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- SUAKHGWARZSWIH-UHFFFAOYSA-N N,N‐diethylformamide Chemical compound CCN(CC)C=O SUAKHGWARZSWIH-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000927555 Olsenella uli Species 0.000 description 1
- 241001069939 Phalces Species 0.000 description 1
- BELBBZDIHDAJOR-UHFFFAOYSA-N Phenolsulfonephthalein Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2S(=O)(=O)O1 BELBBZDIHDAJOR-UHFFFAOYSA-N 0.000 description 1
- IWYDHOAUDWTVEP-UHFFFAOYSA-N R-2-phenyl-2-hydroxyacetic acid Natural products OC(=O)C(O)C1=CC=CC=C1 IWYDHOAUDWTVEP-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229960004909 aminosalicylic acid Drugs 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical compound CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 229940071870 hydroiodic acid Drugs 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000004026 insulin derivative Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 229960002510 mandelic acid Drugs 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 235000015097 nutrients Nutrition 0.000 description 1
- 235000008935 nutritious Nutrition 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229960003531 phenolsulfonphthalein Drugs 0.000 description 1
- 235000021573 pickled cucumbers Nutrition 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000012137 tryptone Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US265670A | 1970-01-13 | 1970-01-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2063857A1 DE2063857A1 (de) | 1971-07-22 |
| DE2063857B2 true DE2063857B2 (de) | 1979-02-22 |
Family
ID=21701838
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2063857A Pending DE2063857B2 (de) | 1970-01-13 | 1970-12-24 | -imidazole |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3658813A (enExample) |
| JP (1) | JPS5039665B1 (enExample) |
| AT (1) | AT299194B (enExample) |
| BE (1) | BE761412R (enExample) |
| CS (1) | CS194656B2 (enExample) |
| DE (1) | DE2063857B2 (enExample) |
| DK (3) | DK140213B (enExample) |
| FR (1) | FR2081427B2 (enExample) |
| GB (1) | GB1318590A (enExample) |
| NL (1) | NL169071C (enExample) |
| OA (1) | OA03898A (enExample) |
| SU (1) | SU408476A3 (enExample) |
| ZA (1) | ZA71174B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2429523A1 (de) * | 1973-06-21 | 1975-01-16 | Boots Co Ltd | Fungicide zubereitungen |
| DE2541833A1 (de) * | 1974-09-23 | 1976-04-01 | Syntex Inc | 1- eckige klammer auf beta-(r-thio)- phenylaethyl eckige klammer zu -imidazole und deren derivate |
| DE2757113A1 (de) * | 1977-12-21 | 1979-06-28 | Siegfried Ag | Imidazolylvinylaether und verfahren zu ihrer herstellung |
Families Citing this family (82)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2037610A1 (de) * | 1970-07-29 | 1972-02-03 | Bayer Ag | Neue alpha-substituierte Benzyl-azole, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE2242454A1 (de) * | 1972-08-29 | 1974-03-07 | Bayer Ag | 1-aethyl-imidazole, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel |
| DE2306495A1 (de) * | 1973-02-09 | 1974-08-15 | Bayer Ag | Fungizide mittel |
| DE2333354C2 (de) * | 1973-06-30 | 1983-12-15 | Bayer Ag, 5090 Leverkusen | 2-Aryloxy-2-(imidazol-1-yl)-äthanole sowie deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| DE2350123C2 (de) * | 1973-10-05 | 1983-04-14 | Bayer Ag, 5090 Leverkusen | 1-Propyl-imidazol-Derivate und deren Salze, Verfahren zu ihrer Herstellung und ihre Verwendung als Fungizide |
| US3991202A (en) * | 1974-01-31 | 1976-11-09 | Janssen Pharmaceutica N.V. | Imidazolium salts |
| US3927017A (en) * | 1974-06-27 | 1975-12-16 | Janssen Pharmaceutica Nv | 1-({62 -Aryl-{62 -R-ethyl)imidazoles |
| DE2431407C2 (de) * | 1974-06-29 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | 1,2,4-Triazol-1-yl-alkanone und -alkanole, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide |
| US4017631A (en) * | 1974-11-19 | 1977-04-12 | Janssen Pharmaceutica N.V. | Imidazolium salts |
| CA1065873A (en) * | 1975-01-27 | 1979-11-06 | Janssen Pharmaceutica Naamloze Vennootschap | Imidazole derivatives |
| US4085209A (en) * | 1975-02-05 | 1978-04-18 | Rohm And Haas Company | Preparation and safening effect of 1-substituted imidazole metal salt complexes |
| GB1475271A (en) * | 1975-04-30 | 1977-06-01 | Pfizer Ltd | 1-aryl-2-1-imidazolyl-alkyl ethers and thioethers and their use as antifungal agents |
| US4055652A (en) * | 1975-07-07 | 1977-10-25 | Syntex (U.S.A.) Inc. | 1-[β(R-thio)phenethyl]imidazoles and derivatives thereof |
| US4045568A (en) * | 1975-07-28 | 1977-08-30 | Syntex (U.S.A.) Inc. | Derivatives of substituted N-alkyl imidazoles |
| US4078071A (en) * | 1976-03-08 | 1978-03-07 | Syntex (U.S.A.) Inc. | Derivatives of substituted N-alkyl imidazoles |
| MX3866E (es) * | 1975-07-28 | 1981-08-26 | Syntex Inc | Metodo mejorado para preparar derivados de imidazoles n-alquil sustituidos |
| US4079143A (en) * | 1975-08-26 | 1978-03-14 | Imperial Chemical Industries Limited | Fungicidal 1H-1,2,4-triazoles |
| NZ181916A (en) * | 1975-09-10 | 1979-01-11 | Ici Ltd | 1-substituted-1,2,4-triazoles and fungicidal compositions |
| GB1563199A (en) * | 1975-09-10 | 1980-03-19 | Ici Ltd | 1,2,4 triazole compounds and their use as pesticides |
| DE2547953A1 (de) * | 1975-10-27 | 1977-04-28 | Bayer Ag | (1-phenyl-2-triazolyl-aethyl)-aether- derivate, verfahren zu ihrer herstellung und ihre verwendung als fungizide |
| IE44186B1 (en) * | 1975-12-03 | 1981-09-09 | Ici Ltd | 1,2,4-triazolyl alkanols and their use as pesticides |
| GB1559820A (en) * | 1975-12-09 | 1980-01-30 | Lilly Industries Ltd | Fungicidal compositions |
| JPS5845428B2 (ja) * | 1976-01-01 | 1983-10-08 | シンテツクス(ユ−、エス、エイ)インコ−ポレ−テツド | 真菌または細菌の発育を阻止する化合物 |
| US4039677A (en) * | 1976-03-01 | 1977-08-02 | Syntex (U.S.A.) Inc. | Novel 1-phenethylimidazoles |
| US4038409A (en) * | 1976-03-01 | 1977-07-26 | Syntex (U.S.A.) Inc. | 1-phenethylimidazoles |
| US4172141A (en) * | 1976-03-17 | 1979-10-23 | Syntex (U.S.A.) Inc. | N-(naphthylethyl)imidazole derivatives |
| FI54759C (fi) | 1976-04-13 | 1979-03-12 | Kemira Oy | Fungicid |
| DE2623129C3 (de) * | 1976-05-22 | 1980-04-10 | Nordmark-Werke Gmbh, 2000 Hamburg | U-Diphenyl-3-(imidazol-l-yl) -propan-2-ole, Verfahren zu ihrer Herstellung und diese enthaltende Arzneimittel |
| DE2628421A1 (de) * | 1976-06-24 | 1978-01-05 | Bayer Ag | Antimikrobielle mittel |
| AU515134B2 (en) * | 1976-08-10 | 1981-03-19 | Janssen Pharmaceutica N.V. | 1-(2-aryl-2-r-ethyl)-1h-1,2,4-triazoles |
| DE2643563A1 (de) * | 1976-09-28 | 1978-03-30 | Bayer Ag | Alpha-(4-biphenylyl)-benzyl-azolium- salze, verfahren zu ihrer herstellung sowie ihre verwendung zur bekaempfung von mikroorganismen |
| US4123542A (en) * | 1977-01-19 | 1978-10-31 | Syntex (U.S.A.) Inc. | Derivatives of N-alkyl imidazoles |
| DE2839388A1 (de) * | 1978-09-11 | 1980-03-27 | Siegfried Ag | Imidazolylvinylaether und deren verwendung |
| DE2714290A1 (de) * | 1977-03-31 | 1978-10-05 | Bayer Ag | Fungizide mittel |
| US4598085A (en) * | 1977-04-27 | 1986-07-01 | Janssen Pharmaceutica N.V. | Fungicidal 1-(2-aryl-2-R-ethyl)-1H-1,2,4-triazoles |
| DE2720868A1 (de) * | 1977-05-10 | 1978-11-23 | Bayer Ag | Antimikrobielle mittel |
| US4150153A (en) * | 1977-05-13 | 1979-04-17 | Syntex (U.S.A.) Inc. | 1-(Naphthylethyl)imidazole derivatives |
| DE2736122A1 (de) * | 1977-08-11 | 1979-02-22 | Basf Ag | Fungizide |
| DE2860862D1 (en) * | 1977-10-13 | 1981-10-29 | Siegfried Ag | Imidazolylethylene-oxyalkyloxy derivatives and their thio analogues, methods for their preparation and pharmaceutical compositions containing them |
| US4213991A (en) * | 1978-05-30 | 1980-07-22 | Syntex (U.S.A.) Inc. | Derivatives of substituted N-alkyl imidazoles and compositions and methods containing the same |
| US4159380A (en) * | 1978-07-10 | 1979-06-26 | E. R. Squibb & Sons, Inc. | Imidazolylethoxy derivatives of pyrazolo[3,4-b]pyridine-5-methanols |
| US4215220A (en) * | 1978-09-11 | 1980-07-29 | Cilag-Chemie A.G. | 1-(2-Oxysubstituted-3-anilinopropyl)-imidazoles |
| US4272545A (en) * | 1979-02-02 | 1981-06-09 | Syntex (U.S.A.) Inc. | Derivatives of thienyl- and furyl-substituted N-butyl and N-phenyl imidazoles |
| DE2926280A1 (de) * | 1979-06-29 | 1981-01-08 | Basf Ag | Fungizide alpha -triazolylglykolderivate, ihre herstellung und verwendung |
| US4282230A (en) * | 1979-11-15 | 1981-08-04 | E. R. Squibb & Sons, Inc. | Imidazolylethoxy derivatives of quinoline-2- or 4-methanols, antimicrobial compositions containing them and method for treating bacterial or fungal infections with them |
| DE2948206A1 (de) | 1979-11-30 | 1981-06-25 | Basf Ag, 6700 Ludwigshafen | Fungizide (gamma) -azolyl-verbindungen, ihre herstellung und verwendung |
| US4248881A (en) * | 1979-12-20 | 1981-02-03 | E. R. Squibb & Sons, Inc. | Imidazolylethoxymethyl derivatives of pyrazole |
| NZ196075A (en) * | 1980-02-04 | 1982-12-07 | Janssen Pharmaceutica Nv | Agent to protect wood coatings and detergents from micro-organisms using a triazole |
| DE3019049A1 (de) * | 1980-05-19 | 1981-12-03 | Basf Ag, 6700 Ludwigshafen | Neue azolverbindungen |
| DE3049542A1 (de) * | 1980-12-31 | 1982-07-29 | Basf Ag, 6700 Ludwigshafen | Azolylalkyl-2,3-dihydrobenzofurane, diese enthaltende fungizide und verfahren zu ihrer herstellung |
| DE3126022A1 (de) * | 1981-07-02 | 1983-01-13 | Basf Ag, 6700 Ludwigshafen | Azolverbindungen, verfahren zu ihrer herstellung und diese enthaltende fungizide |
| DE3126478A1 (de) | 1981-07-04 | 1983-01-20 | Basf Ag, 6700 Ludwigshafen | Azolderivate, verfahren zu ihrer herstellung und diese enthaltende fungizide |
| DE3130215A1 (de) * | 1981-07-31 | 1983-02-17 | Basf Ag, 6700 Ludwigshafen | Phenylketenacetale und diese enthaltende fungizide |
| US4417050A (en) * | 1981-11-23 | 1983-11-22 | Chevron Research Company | Fungicidal, herbicidal and plant growth-regulating pyrimidyl-containing ethers |
| DE3208142A1 (de) * | 1982-03-06 | 1983-09-08 | Bayer Ag, 5090 Leverkusen | Fungizide mittel |
| US4542146A (en) * | 1982-04-29 | 1985-09-17 | Janssen Pharmaceutica N.V. | Process for the protection of wood and coatings against deterioration by microorganisms |
| US4510148A (en) * | 1982-06-12 | 1985-04-09 | Pfizer Inc. | 2-Heterocyclic-1,3-bis(1H-1,2,4-triazol-1-yl)-propan-2-ols as antifungal agents |
| US4584008A (en) * | 1982-07-14 | 1986-04-22 | Chevron Research Company | Aldol adducts containing triazole groups |
| AT376436B (de) * | 1982-11-05 | 1984-11-26 | Laevosan Gmbh & Co Kg | Verfahren zur herstellung neuer thiophen-2carbons[urederivate und pharmazeutisch vertraeglicher saeure- oder basenadditionssalze davon |
| DE3321840A1 (de) * | 1983-06-16 | 1984-12-20 | Institut für Innovationssysteme und Produktentwicklung C.P. Wieland und Dr. C. Zillich, 8000 München | Wasch- und reinigungsmittel mit antimycetischer wirkung |
| DE3410925A1 (de) * | 1984-03-24 | 1985-10-03 | Basf Ag, 6700 Ludwigshafen | N-((2,3-dihydrobenzofuran)-2-yl)-azolylharnstoffe und diese enthaltende fungizide |
| DE3415486A1 (de) * | 1984-04-26 | 1985-10-31 | Basf Ag, 6700 Ludwigshafen | Azolverbindungen, verfahren zu ihrer herstellung und diese enthaltende fungizide |
| DE3421179A1 (de) * | 1984-06-07 | 1985-12-12 | Basf Ag, 6700 Ludwigshafen | Azolylnitrile und diese enthaltende fungizide |
| US4766140A (en) * | 1984-06-18 | 1988-08-23 | Eli Lilly And Company | Method of inhibiting aromatase |
| GB2176106A (en) * | 1985-06-05 | 1986-12-17 | Uniroyal Ltd | Fungicides comprising carboxamidothiazoles |
| DE3628545A1 (de) * | 1985-09-23 | 1987-04-23 | Hoechst Ag | Arylmethylazole und deren salze, verfahren zu ihrer herstellung, sie enthaltende mittel und ihre verwendung |
| DE3620657A1 (de) * | 1986-06-20 | 1988-01-07 | Basf Ag | Triazolylethylether und diese enthaltende fungizide |
| DE3707151A1 (de) * | 1987-03-06 | 1988-09-15 | Hoechst Ag | 1-(1-aryl-2-hydroxy-ethyl)-imidazole und deren salze, verfahren zu ihrer herstellung, diese verbindungen enthaltende arzneimittel und ihre verwendung |
| US5013746A (en) * | 1988-04-08 | 1991-05-07 | Janssen Pharmaceutica N.V. | Imazalil containing synergistic compositions |
| US5179114A (en) * | 1988-06-04 | 1993-01-12 | Basf Aktiengesellschaft | α-Hydroxyazolylethyloxiranes and fungicides containing these compounds |
| DE3932552A1 (de) * | 1989-09-29 | 1991-04-11 | Basf Ag | Verfahren zur herstellung von 1-hydroxyimidazol |
| DE3939525A1 (de) * | 1989-11-30 | 1991-06-06 | Hoechst Ag | Mit mehrfach ungesaettigten resten substituierte aryl-alkyl-azole, verfahren zu ihrer herstellung und ihre verwendung |
| US5531995A (en) * | 1992-10-29 | 1996-07-02 | Makhteshim Chemical Works Ltd. | Low ecotoxic formulations of pesticides |
| US5747523A (en) * | 1996-01-24 | 1998-05-05 | Guilford Pharmaceuticals Inc. | Substituted ethyl α,α-diarylmethyl ether derivatives |
| UA62978C2 (en) | 1997-09-08 | 2004-01-15 | Janssen Pharmaceutica Nv | Synergistic compositions comprising imazalil and epoxiconazole |
| EP0986965A1 (en) * | 1998-09-18 | 2000-03-22 | Janssen Pharmaceutica N.V. | Antifungal food coatings |
| US6207695B1 (en) * | 1998-12-31 | 2001-03-27 | Celgene Corporation | Chiral imidazole fungicidal compositions and methods for their use |
| RU2223646C2 (ru) * | 1998-12-31 | 2004-02-20 | Селген Корпорейшн | Фунгицидные композиции на основе хиральных имидазолов и способы их применения |
| DE10103832A1 (de) * | 2000-05-11 | 2001-11-15 | Bayer Ag | Fungizide Wirkstoffkombinationen |
| MX2009002351A (es) * | 2008-03-07 | 2009-09-25 | Plant Protectants Llc | Metodos para proteger cultivos de la descomposicion microbiana de post cosecha. |
| US20100047412A1 (en) * | 2008-08-20 | 2010-02-25 | Plant Protectants, Llc | Post Harvest Treatment of Fruit |
| US9675080B2 (en) * | 2009-03-20 | 2017-06-13 | Verdesian Life Sciences U.S., Llc | Methods for delaying maturity of crops |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU557755A3 (ru) * | 1968-08-19 | 1977-05-05 | Янссен Фармасьютика Н.В. (Фирма) | Способ получени производных имидазола |
-
1970
- 1970-01-13 US US2656A patent/US3658813A/en not_active Expired - Lifetime
- 1970-12-24 DE DE2063857A patent/DE2063857B2/de active Pending
- 1970-12-29 JP JP45121998A patent/JPS5039665B1/ja active Pending
- 1970-12-30 GB GB6185470A patent/GB1318590A/en not_active Expired
-
1971
- 1971-01-05 NL NLAANVRAGE7100072,A patent/NL169071C/xx not_active IP Right Cessation
- 1971-01-06 CS CS7175A patent/CS194656B2/cs unknown
- 1971-01-08 FR FR7100449A patent/FR2081427B2/fr not_active Expired
- 1971-01-11 DK DK8371A patent/DK140213B/da not_active IP Right Cessation
- 1971-01-11 BE BE761412A patent/BE761412R/xx active
- 1971-01-11 DK DK8371A patent/DK140213C/da active
- 1971-01-12 AT AT18271A patent/AT299194B/de not_active IP Right Cessation
- 1971-01-12 ZA ZA710174A patent/ZA71174B/xx unknown
- 1971-01-12 SU SU1611951A patent/SU408476A3/ru active
- 1971-07-06 OA OA54294A patent/OA03898A/xx unknown
-
1975
- 1975-12-19 DK DK579675A patent/DK579675A/da unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2429523A1 (de) * | 1973-06-21 | 1975-01-16 | Boots Co Ltd | Fungicide zubereitungen |
| DE2541833A1 (de) * | 1974-09-23 | 1976-04-01 | Syntex Inc | 1- eckige klammer auf beta-(r-thio)- phenylaethyl eckige klammer zu -imidazole und deren derivate |
| DE2757113A1 (de) * | 1977-12-21 | 1979-06-28 | Siegfried Ag | Imidazolylvinylaether und verfahren zu ihrer herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5039665B1 (enExample) | 1975-12-18 |
| NL169071B (nl) | 1982-01-04 |
| CS194656B2 (en) | 1979-12-31 |
| DK140213B (da) | 1979-07-09 |
| GB1318590A (en) | 1973-05-31 |
| AT299194B (de) | 1972-06-12 |
| NL169071C (nl) | 1982-06-01 |
| DK140213C (da) | 1980-01-14 |
| DE2063857A1 (de) | 1971-07-22 |
| US3658813A (en) | 1972-04-25 |
| SU408476A3 (enExample) | 1973-12-10 |
| NL7100072A (enExample) | 1971-07-15 |
| ZA71174B (en) | 1972-08-30 |
| FR2081427B2 (enExample) | 1974-08-23 |
| FR2081427A2 (enExample) | 1971-12-03 |
| OA03898A (fr) | 1975-08-14 |
| BE761412R (enExample) | 1971-07-12 |
| DK579675A (da) | 1975-12-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2063857B2 (de) | -imidazole | |
| DE2529689C2 (de) | Pyrazolinverbindungen | |
| DE1940388C3 (de) | l-(ß-Aryl) äthylimidazolderivate, ihre Herstellung und diese enthaltende fungizide und bakterizide Mittel | |
| DE2166398C3 (de) | 43-Tetrazolo [1,5-a] chinoline und Verfahren zu ihrer Herstellung | |
| DE2504114C2 (enExample) | ||
| DE2510525C3 (de) | Quartäre 2-Alkylimidazoliumsalze | |
| DE2134332C3 (de) | 0-(N-Methylcarbamoyl)-carbäthoxychlorformaldoxim, Verfahren zu seiner Herstellung und diese Verbindung enthaltende Mittel | |
| DE2533275A1 (de) | Quaternaere phosphoniumsalze, verfahren zu ihrer herstellung und diese salze enthaltende zusammensetzungen | |
| DE2463023C2 (de) | S-Triazolo-[5,1-a]-isochinolinderivate, deren Salze und Verfahren zu deren Herstellung | |
| DE2530243A1 (de) | Verwendung von n-substituierten aminoalkanolen als antimikrobielle wirkstoffe | |
| DE2265029C3 (de) | Verfahren zur Bekämpfung von pflanzenpathogenen Pilzen | |
| DE3414933C2 (de) | Quaternäre Ammoniumverbindung und Desinfektionslösung, die eine quaternäre Ammoniumverbindung in wäßriger Lösung enthält | |
| DE69520485T2 (de) | Lagerstabile Biozidzusammensetzung und Verfahren zu ihrer Herstellung | |
| DE1643384A1 (de) | Algizide Mittel | |
| DE2063857C3 (de) | -imidazole | |
| DE2244778C3 (de) | 1 -n-Dodecylaminomethyl-2-aminocyclopentan, dessen Herstellung und Verwendung als mikrobicider Wirkstoff | |
| DE69627761T2 (de) | Zusammensetzung und Verfahren zur Verminderung der Sterilität und zur Stimulierung der Blüte von Maispflanzen | |
| DE3785704T2 (de) | Substituiertes benzimidazolfungizid. | |
| DE2263596A1 (de) | Mikrobicid wirksames gemisch | |
| DE1620606A1 (de) | Verfahren zur Herstellung von Aminoacylcyetosamin derivaten | |
| DE884858C (de) | Desinfektions- und Konservierungsmittel | |
| DE1668616B2 (de) | Bisdithiocarbamte, verfahren zu deren herstellung und diese enthaltendes fungizides mittel | |
| DE2620379A1 (de) | 4-exo-hydroxy-endo-tricyclo eckige klammer auf 5.2.2.0 hoch 2,6 eckige klammer zu undec-8-en und verfahren zu seiner herstellung | |
| DE2139246A1 (de) | Verfahren zur Herstellung neuer Phosphorsaureamidester | |
| DE1493745A1 (de) | Verfahren zur Herstellung von N-Pentachlorphenylaminammoniumsalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OI | Miscellaneous see part 1 | ||
| BI | Miscellaneous see part 2 |