DE2001960C3 - - Google Patents
Info
- Publication number
- DE2001960C3 DE2001960C3 DE19702001960 DE2001960A DE2001960C3 DE 2001960 C3 DE2001960 C3 DE 2001960C3 DE 19702001960 DE19702001960 DE 19702001960 DE 2001960 A DE2001960 A DE 2001960A DE 2001960 C3 DE2001960 C3 DE 2001960C3
- Authority
- DE
- Germany
- Prior art keywords
- acid
- same
- parts
- sulfonic acid
- amino
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims 1
- 239000002253 acid Substances 0.000 description 71
- 239000000975 dye Substances 0.000 description 37
- -1 acetylamino, ureido Chemical group 0.000 description 26
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 24
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 22
- 150000004985 diamines Chemical class 0.000 description 22
- 239000000203 mixture Substances 0.000 description 22
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 18
- 150000001875 compounds Chemical group 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 16
- 238000000034 method Methods 0.000 description 15
- QPKNFEVLZVJGBM-UHFFFAOYSA-N 2-aminonaphthalen-1-ol Chemical compound C1=CC=CC2=C(O)C(N)=CC=C21 QPKNFEVLZVJGBM-UHFFFAOYSA-N 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 13
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 12
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 12
- 125000000542 sulfonic acid group Chemical group 0.000 description 12
- 239000011230 binding agent Substances 0.000 description 11
- 230000008878 coupling Effects 0.000 description 11
- 238000010168 coupling process Methods 0.000 description 11
- 238000005859 coupling reaction Methods 0.000 description 11
- 238000011282 treatment Methods 0.000 description 11
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 10
- 239000000725 suspension Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- 150000002790 naphthalenes Chemical class 0.000 description 9
- 229910000029 sodium carbonate Inorganic materials 0.000 description 9
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 8
- 239000004753 textile Substances 0.000 description 8
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 7
- 239000000460 chlorine Substances 0.000 description 7
- 238000009833 condensation Methods 0.000 description 7
- 230000005494 condensation Effects 0.000 description 7
- 229940018564 m-phenylenediamine Drugs 0.000 description 7
- 239000000463 material Substances 0.000 description 7
- IPQWXJDRMKGSFI-UHFFFAOYSA-N 3,5-diamino-4-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(S(O)(=O)=O)C=C1N IPQWXJDRMKGSFI-UHFFFAOYSA-N 0.000 description 6
- 150000001412 amines Chemical class 0.000 description 6
- 229910052801 chlorine Inorganic materials 0.000 description 6
- 125000001309 chloro group Chemical group Cl* 0.000 description 6
- 239000011780 sodium chloride Substances 0.000 description 6
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 5
- JVMSQRAXNZPDHF-UHFFFAOYSA-N 2,4-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N)=C1 JVMSQRAXNZPDHF-UHFFFAOYSA-N 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- 238000004043 dyeing Methods 0.000 description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- 239000000985 reactive dye Substances 0.000 description 5
- HEAHMJLHQCESBZ-UHFFFAOYSA-N 2,5-diaminobenzenesulfonic acid Chemical compound NC1=CC=C(N)C(S(O)(=O)=O)=C1 HEAHMJLHQCESBZ-UHFFFAOYSA-N 0.000 description 4
- KNOUFVBOBNEGMH-UHFFFAOYSA-N 3,7-diaminonaphthalene-1,5-disulfonic acid Chemical compound C1=C(N)C=C(S(O)(=O)=O)C2=CC(N)=CC(S(O)(=O)=O)=C21 KNOUFVBOBNEGMH-UHFFFAOYSA-N 0.000 description 4
- 229910006069 SO3H Inorganic materials 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000012736 aqueous medium Substances 0.000 description 4
- 150000001555 benzenes Chemical class 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 239000001913 cellulose Substances 0.000 description 4
- 229920002678 cellulose Polymers 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- 238000006460 hydrolysis reaction Methods 0.000 description 4
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 3
- 150000003918 triazines Chemical class 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- KJCVRFUGPWSIIH-UHFFFAOYSA-N 1-naphthol Chemical compound C1=CC=C2C(O)=CC=CC2=C1 KJCVRFUGPWSIIH-UHFFFAOYSA-N 0.000 description 2
- UONVFNLDGRWLKF-UHFFFAOYSA-N 2,5-diaminobenzoic acid Chemical compound NC1=CC=C(N)C(C(O)=O)=C1 UONVFNLDGRWLKF-UHFFFAOYSA-N 0.000 description 2
- JPXCBDAQNYPLDJ-UHFFFAOYSA-N 2-[(2-aminophenyl)diazenyl]naphthalen-1-ol Chemical class NC1=C(C=CC=C1)N=NC1=C(C2=CC=CC=C2C=C1)O JPXCBDAQNYPLDJ-UHFFFAOYSA-N 0.000 description 2
- OBCSAIDCZQSFQH-UHFFFAOYSA-N 2-methyl-1,4-phenylenediamine Chemical compound CC1=CC(N)=CC=C1N OBCSAIDCZQSFQH-UHFFFAOYSA-N 0.000 description 2
- UENRXLSRMCSUSN-UHFFFAOYSA-N 3,5-diaminobenzoic acid Chemical compound NC1=CC(N)=CC(C(O)=O)=C1 UENRXLSRMCSUSN-UHFFFAOYSA-N 0.000 description 2
- MBJAPGAZEWPEFB-UHFFFAOYSA-N 5-amino-2-(4-amino-2-sulfophenyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC(N)=CC=C1C1=CC=C(N)C=C1S(O)(=O)=O MBJAPGAZEWPEFB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 125000004836 hexamethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[*:1] 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- ZPBSAMLXSQCSOX-UHFFFAOYSA-N naphthalene-1,3,6-trisulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 ZPBSAMLXSQCSOX-UHFFFAOYSA-N 0.000 description 2
- 125000001624 naphthyl group Chemical group 0.000 description 2
- 235000010288 sodium nitrite Nutrition 0.000 description 2
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 description 2
- HRXKRNGNAMMEHJ-UHFFFAOYSA-K trisodium citrate Chemical compound [Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O HRXKRNGNAMMEHJ-UHFFFAOYSA-K 0.000 description 2
- FDMXADMEKAUMIV-NSCUHMNNSA-N (e)-prop-1-ene-1,2-diamine Chemical compound C\C(N)=C/N FDMXADMEKAUMIV-NSCUHMNNSA-N 0.000 description 1
- QBIAZVPERXOGAL-OWOJBTEDSA-N (e)-prop-1-ene-1,3-diamine Chemical compound NC\C=C\N QBIAZVPERXOGAL-OWOJBTEDSA-N 0.000 description 1
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 1
- VOPSFYWMOIKYEM-UHFFFAOYSA-N 2,5-diaminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O VOPSFYWMOIKYEM-UHFFFAOYSA-N 0.000 description 1
- RUIORNJZACFMNF-UHFFFAOYSA-N 2-amino-3-phenyldiazenylnaphthalen-1-ol Chemical compound C1(=CC=CC=C1)N=NC=1C(=C(C2=CC=CC=C2C1)O)N RUIORNJZACFMNF-UHFFFAOYSA-N 0.000 description 1
- YAIKCRUPEVOINQ-UHFFFAOYSA-N 2-aminonaphthalene-1,5-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC2=C(S(O)(=O)=O)C(N)=CC=C21 YAIKCRUPEVOINQ-UHFFFAOYSA-N 0.000 description 1
- HTSVYUUXJSMGQC-UHFFFAOYSA-N 2-chloro-1,3,5-triazine Chemical compound ClC1=NC=NC=N1 HTSVYUUXJSMGQC-UHFFFAOYSA-N 0.000 description 1
- AFUHLZJMSIKUOK-UHFFFAOYSA-N 3,5-diamino-2-methylbenzenesulfonic acid Chemical compound CC1=C(N)C=C(N)C=C1S(O)(=O)=O AFUHLZJMSIKUOK-UHFFFAOYSA-N 0.000 description 1
- FEPBHKRVKRRCOU-UHFFFAOYSA-N 3-[(5-amino-2-sulfophenyl)diazenyl]-5-benzamido-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C(N=NC=2C(=CC3=CC(=CC(NC(=O)C=4C=CC=CC=4)=C3C=2O)S(O)(=O)=O)S(O)(=O)=O)=C1 FEPBHKRVKRRCOU-UHFFFAOYSA-N 0.000 description 1
- IHDBZCJYSHDCKF-UHFFFAOYSA-N 4,6-dichlorotriazine Chemical class ClC1=CC(Cl)=NN=N1 IHDBZCJYSHDCKF-UHFFFAOYSA-N 0.000 description 1
- RXNKCIBVUNMMAD-UHFFFAOYSA-N 4-[9-(4-amino-3-fluorophenyl)fluoren-9-yl]-2-fluoroaniline Chemical compound C1=C(F)C(N)=CC=C1C1(C=2C=C(F)C(N)=CC=2)C2=CC=CC=C2C2=CC=CC=C21 RXNKCIBVUNMMAD-UHFFFAOYSA-N 0.000 description 1
- WXAIEIRYBSKHDP-UHFFFAOYSA-N 4-phenyl-n-(4-phenylphenyl)-n-[4-[4-(4-phenyl-n-(4-phenylphenyl)anilino)phenyl]phenyl]aniline Chemical compound C1=CC=CC=C1C1=CC=C(N(C=2C=CC(=CC=2)C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC(=CC=2)N(C=2C=CC(=CC=2)C=2C=CC=CC=2)C=2C=CC(=CC=2)C=2C=CC=CC=2)C=C1 WXAIEIRYBSKHDP-UHFFFAOYSA-N 0.000 description 1
- WZNRCYVMHBODTD-UHFFFAOYSA-N 5-acetamido-3-[(3-amino-4-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(S(O)(=O)=O)C(N)=C1 WZNRCYVMHBODTD-UHFFFAOYSA-N 0.000 description 1
- KNOSDSTVBVXKJQ-UHFFFAOYSA-N 6-amino-2-(naphthalen-2-yldiazenyl)naphthalen-1-ol Chemical compound NC=1C=C2C=CC(=C(C2=CC1)O)N=NC1=CC2=CC=CC=C2C=C1 KNOSDSTVBVXKJQ-UHFFFAOYSA-N 0.000 description 1
- DOBIZWYVJFIYOV-UHFFFAOYSA-N 7-hydroxynaphthalene-1,3-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(S(O)(=O)=O)C2=CC(O)=CC=C21 DOBIZWYVJFIYOV-UHFFFAOYSA-N 0.000 description 1
- PGRPZZVSKKGSGH-UHFFFAOYSA-N CC(=O)NC1=C(C=CC(=C1)N)N=NC2=CC3=C(C=C(C=C3S(=O)(=O)O)S(=O)(=O)O)C(=C2)S(=O)(=O)O Chemical compound CC(=O)NC1=C(C=CC(=C1)N)N=NC2=CC3=C(C=C(C=C3S(=O)(=O)O)S(=O)(=O)O)C(=C2)S(=O)(=O)O PGRPZZVSKKGSGH-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 238000004061 bleaching Methods 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003608 fece Anatomy 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000001044 red dye Substances 0.000 description 1
- 238000005185 salting out Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2664/69A GB1283771A (en) | 1969-01-16 | 1969-01-16 | New reactive disazo dyestuffs |
| GB266469 | 1970-01-06 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2001960A1 DE2001960A1 (de) | 1970-07-30 |
| DE2001960B2 DE2001960B2 (de) | 1976-07-01 |
| DE2001960C3 true DE2001960C3 (enExample) | 1977-02-24 |
Family
ID=9743600
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19702001960 Granted DE2001960B2 (de) | 1969-01-16 | 1970-01-16 | Azotriazinyl-reaktivfarbstoffe und deren verwendung zum faerben von cellulose-textilstoffen |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3647778A (enExample) |
| BR (1) | BR7016100D0 (enExample) |
| CH (3) | CH542268A (enExample) |
| CS (3) | CS178065B2 (enExample) |
| DE (1) | DE2001960B2 (enExample) |
| ES (3) | ES375496A1 (enExample) |
| FR (1) | FR2028479A1 (enExample) |
| GB (1) | GB1283771A (enExample) |
| NL (1) | NL155298B (enExample) |
| PL (1) | PL80765B1 (enExample) |
Families Citing this family (39)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3936436A (en) * | 1969-12-22 | 1976-02-03 | Imperial Chemical Industries Limited | Water-soluble azo dyestuffs containing triazine and 3-azo-2,6-dihydroxypyrid-6-one radicals |
| JPS5653032B2 (enExample) * | 1973-05-24 | 1981-12-16 | ||
| US3966705A (en) * | 1974-01-04 | 1976-06-29 | Ciba-Geigy Corporation | Disulfo naphthalene containing fiber-reactive tetrazo dyes |
| FR2297233A1 (fr) * | 1975-01-08 | 1976-08-06 | Ciba Geigy Ag | Colorants disazoiques reactifs sur fibres, leur procede de preparation et leur utilisation |
| CH606347A5 (enExample) * | 1975-01-15 | 1978-10-31 | Ciba Geigy Ag | |
| ES446171A1 (es) * | 1975-03-20 | 1977-10-16 | Ciba Geigy | Procedimiento para la preparacion de colorantes fibrorreac- tivos. |
| JPS5857464B2 (ja) * | 1975-12-29 | 1983-12-20 | 日本化薬株式会社 | ハンノウセイアゾセンリヨウノセイホウ |
| DE3043915A1 (de) * | 1979-12-06 | 1981-06-11 | Sandoz-Patent-GmbH, 7850 Lörrach | Halo-triazinyl verbindungen |
| US5395925A (en) * | 1980-10-07 | 1995-03-07 | Sandoz Ltd. | Asymmetric sulfo group-containing disazo compounds containing two 6-halo-1,3,5-triazinyl groups |
| CH646989A5 (de) * | 1980-10-07 | 1984-12-28 | Sandoz Ag | Unsymmetrische halo-triazinyl-verbindungen. |
| JPS5825357A (ja) * | 1981-08-07 | 1983-02-15 | Nippon Kayaku Co Ltd | 反応性ジスアゾ化合物及びそれを用いるセルロ−ス系繊維の染色法 |
| CH656629A5 (de) * | 1981-08-08 | 1986-07-15 | Sandoz Ag | Tetrakisazoverbindungen mit brueckenglied, verfahren zur herstellung und verwendung. |
| FR2518106B1 (fr) * | 1981-12-11 | 1986-12-05 | Sandoz Sa | Procede de teinture et d'impression de substrats organiques a l'aide de colorants directs bisazoiques |
| DE3604858A1 (de) * | 1985-12-28 | 1987-07-02 | Hoechst Ag | Wasserloesliche azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| US4808193A (en) * | 1985-12-28 | 1989-02-28 | Hoechst Aktiengesellschaft | Process for dyeing hydroxy-containing fiber material with water-soluble dis-azo reactive dye compound |
| GB8619914D0 (en) * | 1986-08-15 | 1986-09-24 | Ici Plc | Reactive dyes |
| US5196033A (en) * | 1986-08-15 | 1993-03-23 | Imperial Chemical Industries Plc | BIS-azotriazinyl reactive dyes having an N-alkyl-phenylenediamine link for cellulose textiles |
| ES2038784T3 (es) * | 1987-07-03 | 1993-08-01 | Ciba-Geigy Ag | Colorantes reactivos, procedimiento para su obtencion y empleo. |
| US5269816A (en) * | 1988-12-02 | 1993-12-14 | Imperial Chemical Industries Plc | Process for coloring textile materials |
| GB8828222D0 (en) * | 1988-12-02 | 1989-01-05 | Ici Plc | Reactive dyes |
| US5175262A (en) * | 1989-03-13 | 1992-12-29 | Basf Aktiengesellschaft | Doubled reactive dyes |
| EP0458743A3 (en) * | 1990-05-21 | 1992-10-21 | Ciba-Geigy Ag | Reactive dyestuffs, methods of their preparation and use |
| EP0735107B1 (de) * | 1990-09-25 | 2000-08-30 | Ciba Specialty Chemicals Holding Inc. | Faserreaktive Farbstoffe und deren Verwendung |
| GB9114837D0 (en) * | 1991-07-09 | 1991-08-28 | Ici Plc | Compounds |
| DE4140117C1 (enExample) * | 1991-12-05 | 1993-01-28 | Bayer Ag, 5090 Leverkusen, De | |
| SG49671A1 (en) * | 1991-12-20 | 2000-10-24 | Ciba Sc Holding Ag | Process for dyeing or printing hydroxyl group containing fibre materials |
| ATE136324T1 (de) * | 1992-03-06 | 1996-04-15 | Zeneca Ltd | Tintenzusammensetzungen |
| DE59309959D1 (de) * | 1992-08-19 | 2000-04-06 | Ciba Sc Holding Ag | Faserreaktive Farbstoffe, deren Herstellung und Verwendung |
| GB9325454D0 (en) * | 1993-01-12 | 1994-02-16 | Zeneca Ltd | Azo compound |
| US5843217A (en) * | 1996-10-11 | 1998-12-01 | Minolta Co., Ltd. | Ink for ink jet recording |
| GB9715831D0 (en) * | 1997-07-25 | 1997-10-01 | Basf Ag | Reactive diamine-linked monazo dyes |
| GB9715830D0 (en) * | 1997-07-25 | 1997-10-01 | Basf Ag | Reactive dyes containing piperazine |
| GB9816780D0 (en) * | 1998-07-31 | 1998-09-30 | Basf Ag | Reactive dyes containing a linkage |
| ES2221490T3 (es) * | 1998-12-11 | 2004-12-16 | Clariant Finance (Bvi) Limited | Colorantes disazoicos reactivos con las fibras. |
| US6068667A (en) * | 1999-05-05 | 2000-05-30 | Everlight Usa, Inc. | Mixtures of symmetrical and unsymmetrical red reactive dyes |
| GB0018508D0 (en) * | 2000-07-27 | 2000-09-13 | Basf Ag | Reactive trisazo dyes |
| GB0111573D0 (en) * | 2001-05-11 | 2001-07-04 | Dystar Textilfarben Gmbh & Co | Fibre reactive scarlet azo dyes |
| CN102898868A (zh) * | 2012-10-31 | 2013-01-30 | 无锡润新染料有限公司 | 一种活性橙染料及其制备方法 |
| CN106833012B (zh) * | 2016-12-05 | 2018-08-31 | 泰兴锦云染料有限公司 | 一种活性黄染料及其制备和应用 |
-
1969
- 1969-01-16 GB GB2664/69A patent/GB1283771A/en not_active Expired
-
1970
- 1970-01-10 PL PL1970138100A patent/PL80765B1/pl unknown
- 1970-01-12 US US2390A patent/US3647778A/en not_active Expired - Lifetime
- 1970-01-16 CS CS341A patent/CS178065B2/cs unknown
- 1970-01-16 CS CS2233A patent/CS178098B2/cs unknown
- 1970-01-16 CH CH63270A patent/CH542268A/de not_active IP Right Cessation
- 1970-01-16 BR BR216100/70A patent/BR7016100D0/pt unknown
- 1970-01-16 DE DE19702001960 patent/DE2001960B2/de active Granted
- 1970-01-16 CH CH488673A patent/CH541610A/de not_active IP Right Cessation
- 1970-01-16 FR FR7001654A patent/FR2028479A1/fr active Pending
- 1970-01-16 ES ES375496A patent/ES375496A1/es not_active Expired
- 1970-01-16 CH CH488773A patent/CH541611A/de not_active IP Right Cessation
- 1970-01-16 CS CS2234A patent/CS178099B2/cs unknown
- 1970-01-16 NL NL707000663A patent/NL155298B/xx not_active IP Right Cessation
- 1970-04-11 ES ES378465A patent/ES378465A1/es not_active Expired
- 1970-04-11 ES ES378464A patent/ES378464A1/es not_active Expired
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2001960C3 (enExample) | ||
| DE2001960B2 (de) | Azotriazinyl-reaktivfarbstoffe und deren verwendung zum faerben von cellulose-textilstoffen | |
| EP0040806B1 (de) | Wasserlösliche farbige Verbindungen, Verfahren zu deren Herstellung und ihre Verwendung als Farbstoffe | |
| DE2927102C2 (enExample) | ||
| DE2614550C3 (de) | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten | |
| EP0511523B1 (de) | Azofarbstoffe mit mehreren reaktiven Ankergruppen | |
| DE2650555A1 (de) | Faserreaktive farbstoffe, deren herstellung und verwendung | |
| DE1644203B2 (de) | Reaktivfarbstoffe | |
| DE2653199A1 (de) | Faserreaktive farbstoffe, deren herstellung und verwendung | |
| DE1150164B (de) | Verfahren zur Herstellung von reaktiven Farbstoffen | |
| DE1223971B (de) | Verfahren zur Herstellung kupferhaltiger, faserreaktiver Monoazofarbstoffe | |
| DE1794315A1 (de) | Reaktive Triazinfarbstoffe | |
| DE2331518A1 (de) | Neue farbstoffe, deren herstellung und verwendung | |
| DE2422762A1 (de) | Reaktivfarbstoffe | |
| DE3107265A1 (de) | Reaktivfarbstoffe, verfahren zu ihrer herstellung und ihre verwendung zum faerben oder bedrucken von fasermaterialien | |
| CH635859A5 (de) | Azofarbstoffe sowie deren herstellung. | |
| DE1419794B2 (de) | Verfahren zur Herstellung von Disazoreaktivfarbstoffen und deren Verwendung | |
| DE2734679C2 (de) | Faserreaktive Azofarbstoffe, deren Herstellung und Verwendung | |
| DE3510180A1 (de) | Wasserloesliche azoverbindungen, verfahren zu deren herstellung und ihre verwendung als farbstoffe | |
| DE1153842B (de) | Verfahren zur Herstellung von Azofarbstoffen | |
| AT200686B (de) | Verfahren zur Herstellung neuer, wasserlöslicher Disazofarbstoffe | |
| AT225314B (de) | Verfahren zur Herstellung von neuen reaktiven Azo-, Anthrachinon- oder Phthalocyaninfarbstoffen | |
| DE2000518A1 (de) | Reaktivfarbstoffe | |
| CH445690A (de) | Verfahren zur Herstellung neuer Azofarbstoffe | |
| DE1644269A1 (de) | Verfahren zur Herstellung von Azofarbstoffen |