DE1246658B - Bleichaktivatoren - Google Patents
BleichaktivatorenInfo
- Publication number
- DE1246658B DE1246658B DEU4035A DEU0004035A DE1246658B DE 1246658 B DE1246658 B DE 1246658B DE U4035 A DEU4035 A DE U4035A DE U0004035 A DEU0004035 A DE U0004035A DE 1246658 B DE1246658 B DE 1246658B
- Authority
- DE
- Germany
- Prior art keywords
- added
- ester
- sodium
- solution
- esters
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 19
- 239000012190 activator Substances 0.000 title claims description 4
- 150000002148 esters Chemical class 0.000 claims description 37
- 229910052760 oxygen Inorganic materials 0.000 claims description 15
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 14
- 239000001301 oxygen Substances 0.000 claims description 14
- 239000000203 mixture Substances 0.000 claims description 8
- 239000011734 sodium Substances 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 claims description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 4
- 150000001735 carboxylic acids Chemical class 0.000 claims description 4
- 150000002895 organic esters Chemical class 0.000 claims description 4
- 239000012153 distilled water Substances 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- 239000004133 Sodium thiosulphate Substances 0.000 claims description 2
- CXDBXTHJTZQPOJ-UHFFFAOYSA-M [Na+].CC=C.CC=C.CC=C.CC=C.[O-]S(=O)(=O)C1=CC=CC=C1 Chemical compound [Na+].CC=C.CC=C.CC=C.CC=C.[O-]S(=O)(=O)C1=CC=CC=C1 CXDBXTHJTZQPOJ-UHFFFAOYSA-M 0.000 claims description 2
- 229960000583 acetic acid Drugs 0.000 claims description 2
- 239000012362 glacial acetic acid Substances 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- 239000011630 iodine Substances 0.000 claims description 2
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 2
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 2
- 229920002472 Starch Polymers 0.000 claims 1
- 230000008034 disappearance Effects 0.000 claims 1
- 238000010907 mechanical stirring Methods 0.000 claims 1
- 235000019698 starch Nutrition 0.000 claims 1
- 239000008107 starch Substances 0.000 claims 1
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 18
- 238000004061 bleaching Methods 0.000 description 12
- 238000002310 reflectometry Methods 0.000 description 11
- 239000003795 chemical substances by application Substances 0.000 description 10
- 239000004744 fabric Substances 0.000 description 9
- 239000000243 solution Substances 0.000 description 9
- 238000012360 testing method Methods 0.000 description 9
- 239000012459 cleaning agent Substances 0.000 description 8
- 239000003599 detergent Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 239000000126 substance Substances 0.000 description 6
- 125000004185 ester group Chemical group 0.000 description 5
- 239000000344 soap Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000001083 [(2R,3R,4S,5R)-1,2,4,5-tetraacetyloxy-6-oxohexan-3-yl] acetate Substances 0.000 description 4
- UAOKXEHOENRFMP-ZJIFWQFVSA-N [(2r,3r,4s,5r)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O UAOKXEHOENRFMP-ZJIFWQFVSA-N 0.000 description 4
- -1 aliphatic alcohols Chemical class 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 241001122767 Theaceae Species 0.000 description 3
- XQASBJQMONZJSS-UHFFFAOYSA-N acetic acid 2,2,2-trichloroacetaldehyde Chemical compound C(C)(=O)O.C(C)(=O)O.O=CC(Cl)(Cl)Cl XQASBJQMONZJSS-UHFFFAOYSA-N 0.000 description 3
- 150000001299 aldehydes Chemical class 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 235000019441 ethanol Nutrition 0.000 description 3
- 239000004615 ingredient Substances 0.000 description 3
- 150000002989 phenols Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000004753 textile Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 229910019142 PO4 Inorganic materials 0.000 description 2
- 239000004115 Sodium Silicate Substances 0.000 description 2
- PPSNSGXAFDMBHM-REWJHTLYSA-N [(2r,3r,4s,5r)-3,4,5-triacetyloxy-1-hydroxy-6-oxohexan-2-yl] acetate Chemical compound CC(=O)O[C@H](CO)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C=O PPSNSGXAFDMBHM-REWJHTLYSA-N 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- SUMDYPCJJOFFON-UHFFFAOYSA-N isethionic acid Chemical compound OCCS(O)(=O)=O SUMDYPCJJOFFON-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- PYOZTOXFQNWBIS-UHFFFAOYSA-N phenol;sodium Chemical compound [Na].OC1=CC=CC=C1 PYOZTOXFQNWBIS-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 2
- 239000012418 sodium perborate tetrahydrate Substances 0.000 description 2
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 2
- 229910052911 sodium silicate Inorganic materials 0.000 description 2
- 235000019832 sodium triphosphate Nutrition 0.000 description 2
- IBDSNZLUHYKHQP-UHFFFAOYSA-N sodium;3-oxidodioxaborirane;tetrahydrate Chemical compound O.O.O.O.[Na+].[O-]B1OO1 IBDSNZLUHYKHQP-UHFFFAOYSA-N 0.000 description 2
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 2
- PNBOBRKDXRJMTL-UHFFFAOYSA-N (2-nitrophenyl) benzoate Chemical compound [O-][N+](=O)C1=CC=CC=C1OC(=O)C1=CC=CC=C1 PNBOBRKDXRJMTL-UHFFFAOYSA-N 0.000 description 1
- OHWWOZGHMUITKG-UHFFFAOYSA-N (4-bromophenyl) benzoate Chemical compound C1=CC(Br)=CC=C1OC(=O)C1=CC=CC=C1 OHWWOZGHMUITKG-UHFFFAOYSA-N 0.000 description 1
- MISFQCBPASYYGV-UHFFFAOYSA-N (4-phenylphenyl) acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C1=CC=CC=C1 MISFQCBPASYYGV-UHFFFAOYSA-N 0.000 description 1
- BZJTUOGZUKFLQT-UHFFFAOYSA-N 1,3,5,7-tetramethylcyclooctane Chemical group CC1CC(C)CC(C)CC(C)C1 BZJTUOGZUKFLQT-UHFFFAOYSA-N 0.000 description 1
- AAGNGQHUXRGJEP-UHFFFAOYSA-N 2,2-diacetyloxyethyl acetate Chemical compound CC(=O)OCC(OC(C)=O)OC(C)=O AAGNGQHUXRGJEP-UHFFFAOYSA-N 0.000 description 1
- GXXXUZIRGXYDFP-UHFFFAOYSA-M 2-(4-methylphenyl)acetate Chemical compound CC1=CC=C(CC([O-])=O)C=C1 GXXXUZIRGXYDFP-UHFFFAOYSA-M 0.000 description 1
- QSOVSKMNRYAVJR-UHFFFAOYSA-N 2-benzoyloxybenzoic acid Chemical compound OC(=O)C1=CC=CC=C1OC(=O)C1=CC=CC=C1 QSOVSKMNRYAVJR-UHFFFAOYSA-N 0.000 description 1
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 1
- BSYNRYMUTXBXSQ-UHFFFAOYSA-N Aspirin Chemical compound CC(=O)OC1=CC=CC=C1C(O)=O BSYNRYMUTXBXSQ-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 229930091371 Fructose Natural products 0.000 description 1
- 239000005715 Fructose Substances 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- HETCEOQFVDFGSY-UHFFFAOYSA-N Isopropenyl acetate Chemical compound CC(=C)OC(C)=O HETCEOQFVDFGSY-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 1
- ZIJKGAXBCRWEOL-SAXBRCJISA-N Sucrose octaacetate Chemical compound CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](COC(=O)C)O[C@@]1(COC(C)=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 ZIJKGAXBCRWEOL-SAXBRCJISA-N 0.000 description 1
- 239000001344 [(2S,3S,4R,5R)-4-acetyloxy-2,5-bis(acetyloxymethyl)-2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxolan-3-yl] acetate Substances 0.000 description 1
- NJVBTKVPPOFGAT-BRSBDYLESA-N [(2r,3r,4r,5r)-2,3,4,5,6-pentaacetyloxyhexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)COC(C)=O NJVBTKVPPOFGAT-BRSBDYLESA-N 0.000 description 1
- NJVBTKVPPOFGAT-XMTFNYHQSA-N [(2s,3r,4r,5r)-2,3,4,5,6-pentaacetyloxyhexyl] acetate Chemical compound CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)COC(C)=O NJVBTKVPPOFGAT-XMTFNYHQSA-N 0.000 description 1
- XRYSDRCNTMEYFH-UHFFFAOYSA-N [acetyloxy(phenyl)methyl] acetate Chemical compound CC(=O)OC(OC(C)=O)C1=CC=CC=C1 XRYSDRCNTMEYFH-UHFFFAOYSA-N 0.000 description 1
- QXVHTLWZMVGLJR-UHFFFAOYSA-N acetic acid 4-nitrobenzaldehyde Chemical compound CC(O)=O.CC(O)=O.[O-][N+](=O)C1=CC=C(C=O)C=C1 QXVHTLWZMVGLJR-UHFFFAOYSA-N 0.000 description 1
- ZWVNRWDGPAIALC-UHFFFAOYSA-N acetic acid furan-2-carbaldehyde Chemical compound CC(O)=O.CC(O)=O.O=CC1=CC=CO1 ZWVNRWDGPAIALC-UHFFFAOYSA-N 0.000 description 1
- IPBVNPXQWQGGJP-UHFFFAOYSA-N acetic acid phenyl ester Natural products CC(=O)OC1=CC=CC=C1 IPBVNPXQWQGGJP-UHFFFAOYSA-N 0.000 description 1
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000002723 alicyclic group Chemical group 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 150000001733 carboxylic acid esters Chemical class 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000002016 disaccharides Chemical class 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002085 enols Chemical group 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 229940045996 isethionic acid Drugs 0.000 description 1
- 150000002772 monosaccharides Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- HWGNBUXHKFFFIH-UHFFFAOYSA-I pentasodium;[oxido(phosphonatooxy)phosphoryl] phosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O HWGNBUXHKFFFIH-UHFFFAOYSA-I 0.000 description 1
- NBFNGRDFKUJVIN-VAWYXSNFSA-N phenyl (e)-3-phenylprop-2-enoate Chemical compound C=1C=CC=CC=1/C=C/C(=O)OC1=CC=CC=C1 NBFNGRDFKUJVIN-VAWYXSNFSA-N 0.000 description 1
- FCJSHPDYVMKCHI-UHFFFAOYSA-N phenyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OC1=CC=CC=C1 FCJSHPDYVMKCHI-UHFFFAOYSA-N 0.000 description 1
- YYHDAWBGVZLMAD-UHFFFAOYSA-N phenyl furan-2-carboxylate Chemical compound C=1C=COC=1C(=O)OC1=CC=CC=C1 YYHDAWBGVZLMAD-UHFFFAOYSA-N 0.000 description 1
- QEJPOSAIULNDLU-UHFFFAOYSA-N phenyl pyridine-3-carboxylate Chemical compound C=1C=CN=CC=1C(=O)OC1=CC=CC=C1 QEJPOSAIULNDLU-UHFFFAOYSA-N 0.000 description 1
- WLJVXDMOQOGPHL-UHFFFAOYSA-M phenylacetate Chemical compound [O-]C(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-M 0.000 description 1
- 229940049953 phenylacetate Drugs 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 description 1
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 description 1
- 229960001922 sodium perborate Drugs 0.000 description 1
- 229940045872 sodium percarbonate Drugs 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 1
- YKLJGMBLPUQQOI-UHFFFAOYSA-M sodium;oxidooxy(oxo)borane Chemical compound [Na+].[O-]OB=O YKLJGMBLPUQQOI-UHFFFAOYSA-M 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 229940013883 sucrose octaacetate Drugs 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 125000006000 trichloroethyl group Chemical group 0.000 description 1
- 239000001226 triphosphate Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/391—Oxygen-containing compounds
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/10—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen
- D06L4/12—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen combined with specific additives
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB348682X | 1955-07-27 | ||
| GB220256X | 1956-02-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1246658B true DE1246658B (de) | 1967-08-10 |
Family
ID=26255659
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU4035A Pending DE1246658B (de) | 1955-07-27 | 1956-07-26 | Bleichaktivatoren |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US2955905A (show.php) |
| BE (1) | BE549817A (show.php) |
| CH (1) | CH348682A (show.php) |
| DE (1) | DE1246658B (show.php) |
| FR (1) | FR1155228A (show.php) |
| GB (1) | GB836988A (show.php) |
| NL (2) | NL113890C (show.php) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2344990A1 (de) * | 1972-09-14 | 1974-03-21 | Kao Corp | Mischungen zum aktivieren anorganischer peroxydbleichmittel |
| DE2701133A1 (de) * | 1977-01-13 | 1978-07-20 | Schuelke & Mayr Gmbh | Lagerfaehige, beim loesen in wasser eine loesung mit hoher antimikrobieller wirkung ergebende mischung |
| EP0492000A1 (en) * | 1990-12-28 | 1992-07-01 | AUSIMONT S.p.A. | Process for increasing the bleaching efficiency of an inorganic persalt |
Families Citing this family (149)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB855735A (en) * | 1958-05-09 | 1960-12-07 | Unilever Ltd | Bleaching processes and compositions |
| BE621901A (show.php) * | 1961-08-31 | |||
| BE631982A (show.php) * | 1962-05-07 | |||
| US3256198A (en) * | 1963-04-22 | 1966-06-14 | Monsanto Co | Compositions containing an oxygen releasing compound and an organic carbonate |
| DK128287A (show.php) * | 1967-10-24 | |||
| US3528115A (en) * | 1967-12-22 | 1970-09-15 | Du Pont | Bleaching fabrics with peracetic acid formed in situ thereon |
| US3974082A (en) * | 1972-08-21 | 1976-08-10 | Colgate-Palmolive Company | Bleaching compositions |
| JPS5313355B2 (show.php) * | 1974-03-18 | 1978-05-09 | ||
| US3960743A (en) * | 1974-04-23 | 1976-06-01 | Kao Soap Co., Ltd. | Bleaching composition |
| US4179390A (en) * | 1976-10-06 | 1979-12-18 | The Procter & Gamble Company | Laundry additive product |
| US4111651A (en) * | 1977-10-03 | 1978-09-05 | Fmc Corporation | Sulfonic anhydrides in peroxygen bleaching |
| US4110074A (en) * | 1977-10-03 | 1978-08-29 | Fmc Corporation | Mixed carboxylic/sulfonic anhydrides in peroxygen bleaching |
| DE2817858C2 (de) * | 1978-04-24 | 1986-01-30 | Schülke & Mayr GmbH, 2000 Norderstedt | Lagerfähiges, antimikrobielles Konzentrat auf Persäurebasis |
| US4207070A (en) * | 1978-10-10 | 1980-06-10 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4215003A (en) * | 1978-11-20 | 1980-07-29 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4212757A (en) * | 1978-12-22 | 1980-07-15 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| US4202786A (en) * | 1978-12-22 | 1980-05-13 | Fmc Corporation | Peroxygen bleaching and compositions therefor |
| EP0028432B1 (en) | 1979-11-03 | 1984-01-18 | THE PROCTER & GAMBLE COMPANY | Granular laundry compositions |
| US4283301A (en) * | 1980-07-02 | 1981-08-11 | The Procter & Gamble Company | Bleaching process and compositions |
| US4367156A (en) * | 1980-07-02 | 1983-01-04 | The Procter & Gamble Company | Bleaching process and compositions |
| ATE12517T1 (de) | 1980-12-09 | 1985-04-15 | Unilever Nv | Bleichmittelaktivatorgranulate. |
| US4395261A (en) * | 1982-01-13 | 1983-07-26 | Fmc Corporation | Vapor hydrogen peroxide bleach delivery |
| EP0095904B1 (en) * | 1982-06-01 | 1986-09-03 | The Procter & Gamble Company | Detergent liquors and compositions for use therein |
| US4412934A (en) | 1982-06-30 | 1983-11-01 | The Procter & Gamble Company | Bleaching compositions |
| GR81844B (show.php) | 1983-03-26 | 1984-12-12 | Procter & Gamble | |
| GB8328654D0 (en) * | 1983-10-26 | 1983-11-30 | Interox Chemicals Ltd | Hydrogen peroxide compositions |
| US4539130A (en) * | 1983-12-22 | 1985-09-03 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| GB2152041B (en) | 1983-12-22 | 1987-11-11 | Procter & Gamble | X-substituted derivatives of carboxylic acids used as peroxygen bleach activators |
| US4483778A (en) * | 1983-12-22 | 1984-11-20 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| US4486327A (en) * | 1983-12-22 | 1984-12-04 | The Procter & Gamble Company | Bodies containing stabilized bleach activators |
| GB8415909D0 (en) * | 1984-06-21 | 1984-07-25 | Procter & Gamble Ltd | Peracid compounds |
| GB8619153D0 (en) * | 1986-08-06 | 1986-09-17 | Unilever Plc | Fabric conditioning composition |
| GB8619152D0 (en) * | 1986-08-06 | 1986-09-17 | Unilever Plc | Conditioning fabrics |
| US4790952A (en) * | 1986-08-14 | 1988-12-13 | The Clorox Company | Alkyl monoperoxysuccinic acid precursors and method of synthesis |
| US4751015A (en) * | 1987-03-17 | 1988-06-14 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| US4818426A (en) * | 1987-03-17 | 1989-04-04 | Lever Brothers Company | Quaternary ammonium or phosphonium substituted peroxy carbonic acid precursors and their use in detergent bleach compositions |
| GB8728386D0 (en) * | 1987-12-04 | 1988-01-13 | Unilever Plc | Phosphate-free detergent bleach compositions |
| US4889651A (en) * | 1988-01-21 | 1989-12-26 | Colgate-Palmolive Company | Acetylated sugar ethers as bleach activators and detergency boosters |
| US5047168A (en) * | 1988-01-21 | 1991-09-10 | Colgate-Palmolive Co. | Sugar ethers as bleach stable detergency boosters |
| EP0331229B1 (en) * | 1988-03-01 | 1993-08-18 | Unilever N.V. | Quaternary ammonium compounds for use in bleaching systems |
| DE68919506D1 (de) * | 1988-04-14 | 1995-01-12 | Unilever Nv | Waschmittelzusammensetzungen für Gewebe. |
| US4927559A (en) * | 1988-04-14 | 1990-05-22 | Lever Brothers Company | Low perborate to precursor ratio bleach systems |
| DK27789D0 (da) * | 1989-01-23 | 1989-01-23 | Novo Industri As | Detergent - sammensaetning |
| US5078907A (en) * | 1989-11-01 | 1992-01-07 | Lever Brothers Company, Division Of Conopco, Inc. | Unsymmetrical dicarboxylic esters as bleach precursors |
| GB9003741D0 (en) * | 1990-02-19 | 1990-04-18 | Unilever Plc | Bleach activation |
| US5055217A (en) * | 1990-11-20 | 1991-10-08 | Lever Brothers Company, Division Of Conopco, Inc. | Polymer protected bleach precursors |
| US5069812A (en) * | 1990-12-10 | 1991-12-03 | Lever Brothers Company | Bleach/builder precursors |
| EP0517969A1 (en) * | 1991-06-10 | 1992-12-16 | AUSIMONT S.p.A. | Process for increasing the bleaching efficiency of an inorganic persalt or of hydrogen peroxide |
| EP0525239B1 (en) * | 1991-07-31 | 1997-07-09 | AUSIMONT S.p.A. | Process for increasing the bleaching efficiency of an inorganic persalt |
| GB9116939D0 (en) * | 1991-08-06 | 1991-09-18 | Unilever Plc | Bleach precursors and bleaching compositions |
| RU2108320C1 (ru) * | 1991-12-13 | 1998-04-10 | Дзе Проктер Энд Гэмбл Компани | Активатор пероксида водорода и композиция для отбеливания или дезинфекции на его основе |
| SK278834B6 (sk) * | 1992-01-17 | 1998-03-04 | Unilever Nv | Časticová bieliaca detergentná zmes |
| CZ280593B6 (cs) * | 1992-01-17 | 1996-02-14 | Unilever Nv | Částicové detergenční směsi |
| US5302375A (en) * | 1992-11-19 | 1994-04-12 | Colgate-Palmolive Company | Oral composition having improved tooth whitening effect |
| GB9302442D0 (en) * | 1993-02-08 | 1993-03-24 | Warwick Int Group | Oxidising agents |
| US5372740A (en) * | 1993-09-03 | 1994-12-13 | Lever Brothers Company, Division Of Conopco, Inc. | Homogeneous liquid automatic dishwashing detergent composition based on sodium potassium tripolyphosphate |
| US5480576A (en) * | 1993-10-14 | 1996-01-02 | Lever Brothers Company, Division Of Conopco, Inc. | 1,3-N azole containing detergent compositions |
| US5374369A (en) * | 1993-10-14 | 1994-12-20 | Lever Brothers Company, Division Of Conopco, Inc. | Silver anti-tarnishing detergent composition |
| US5468410A (en) * | 1993-10-14 | 1995-11-21 | Angevaare; Petrus A. | Purine class compounds in detergent compositions |
| US5399746A (en) * | 1994-02-07 | 1995-03-21 | Witco Corporation | Diquaternary bleach activators and compositions containing them |
| GB2294268A (en) | 1994-07-07 | 1996-04-24 | Procter & Gamble | Bleaching composition for dishwasher use |
| EP0693549A1 (en) | 1994-07-19 | 1996-01-24 | The Procter & Gamble Company | Solid bleach activator compositions |
| US5520835A (en) * | 1994-08-31 | 1996-05-28 | The Procter & Gamble Company | Automatic dishwashing compositions comprising multiquaternary bleach activators |
| DE69525371T2 (de) * | 1994-11-29 | 2002-11-14 | S.C. Johnson & Son, Inc. | Lacton/peroxid-bleichlösung, ein bleichsystem zur bildung dieser lösung, sowie ein verfahren zur bereitung und verwendung dieser lösung |
| EP0717102A1 (en) | 1994-12-09 | 1996-06-19 | The Procter & Gamble Company | Liquid automatic dishwashing detergent composition containing diacyl peroxides |
| DK0796317T3 (da) * | 1994-12-09 | 2000-06-05 | Procter & Gamble | Diacylperoxidpartikelholdig sammensætning til automatisk opvask |
| US5856282A (en) * | 1994-12-22 | 1999-01-05 | The Procter & Gamble Company | Silicone compositions |
| WO1996033259A1 (en) * | 1995-04-17 | 1996-10-24 | The Procter & Gamble Company | Preparation and use of composite particles containing diacyl peroxide |
| US5705091A (en) * | 1995-09-11 | 1998-01-06 | The Clorox Company | Alkoxylated peracid activators |
| US5663133A (en) * | 1995-11-06 | 1997-09-02 | The Procter & Gamble Company | Process for making automatic dishwashing composition containing diacyl peroxide |
| US5750483A (en) | 1995-12-06 | 1998-05-12 | Basf Corporation | Non-phosphate machine dishwashing compositions containing polycarboxylate polymers and nonionic graft copolymers of vinyl acetate and polyalkylene oxide |
| EP0778340A3 (en) | 1995-12-06 | 1999-10-27 | Basf Corporation | Improved non-phosphate machine dishwashing compositions containing copolymers of alkylene oxide adducts of allyl alcohol and acrylic acid |
| DE19600159A1 (de) | 1996-01-04 | 1997-07-10 | Hoechst Ag | Bleichmittelsysteme enthaltend Bis- und Tris-(mu-oxo)-di-Mangan-Komplexsalze |
| DE19605526A1 (de) | 1996-02-15 | 1997-08-21 | Hoechst Ag | Ammoniumnitrile und deren Verwendung als Bleichaktivatoren |
| DE19606343A1 (de) | 1996-02-21 | 1997-08-28 | Hoechst Ag | Bleichmittel |
| NL1002494C2 (nl) * | 1996-02-29 | 1997-09-01 | Inst Voor Agrotech Onderzoek | Werkwijze voor het oxideren van zetmeel. |
| US5850086A (en) * | 1996-06-21 | 1998-12-15 | Regents Of The University Of Minnesota | Iron complexes for bleach activation and stereospecific oxidation |
| EP0923634A2 (en) | 1996-07-24 | 1999-06-23 | The Procter & Gamble Company | Sprayable, liquid or gel detergent compositions containing bleach |
| DE19635070A1 (de) * | 1996-08-30 | 1998-03-05 | Clariant Gmbh | Flüssige Bleichmittelsuspension |
| GB2320254A (en) | 1996-12-12 | 1998-06-17 | Procter & Gamble | Process for making tabletted detergent compositions |
| US6221341B1 (en) * | 1997-11-19 | 2001-04-24 | Oraceutical Llc | Tooth whitening compositions |
| DE19801049A1 (de) * | 1998-01-14 | 1999-07-15 | Clariant Gmbh | Verwendung von Formamidinium-Salzen als Bleichaktivatoren |
| GB0011527D0 (en) | 2000-05-12 | 2000-06-28 | Unilever Plc | Bleach catalyst and composition and method for bleaching a substrate |
| WO2002072746A1 (en) | 2001-03-14 | 2002-09-19 | Unilever Plc | Bleaching catalysts with unsaturated surfactant and antioxidants |
| GB0106285D0 (en) | 2001-03-14 | 2001-05-02 | Unilever Plc | Air bleaching catalysts with moderating agent |
| CN1326983C (zh) | 2002-05-02 | 2007-07-18 | 宝洁公司 | 洗涤剂组合物及其组分 |
| US20030220214A1 (en) * | 2002-05-23 | 2003-11-27 | Kofi Ofosu-Asante | Method of cleaning using gel detergent compositions containing acyl peroxide |
| US7297166B2 (en) | 2003-06-25 | 2007-11-20 | Depuy Products, Inc. | Assembly tool for modular implants and associated method |
| US8998919B2 (en) | 2003-06-25 | 2015-04-07 | DePuy Synthes Products, LLC | Assembly tool for modular implants, kit and associated method |
| US7582092B2 (en) * | 2003-06-25 | 2009-09-01 | Depuy Products, Inc. | Assembly tool for modular implants and associated method |
| US8556912B2 (en) | 2007-10-30 | 2013-10-15 | DePuy Synthes Products, LLC | Taper disengagement tool |
| US8518050B2 (en) | 2007-10-31 | 2013-08-27 | DePuy Synthes Products, LLC | Modular taper assembly device |
| US8492324B2 (en) | 2008-04-09 | 2013-07-23 | Basf Se | Use of metal hydrazide complex compounds as oxidation catalysts |
| GB0918914D0 (en) | 2009-10-28 | 2009-12-16 | Revolymer Ltd | Composite |
| US8533921B2 (en) | 2010-06-15 | 2013-09-17 | DePuy Synthes Products, LLC | Spiral assembly tool |
| ES2651319T3 (es) | 2010-06-28 | 2018-01-25 | Basf Se | Composición blanqueadora libre de metales |
| US9095452B2 (en) | 2010-09-01 | 2015-08-04 | DePuy Synthes Products, Inc. | Disassembly tool |
| CN103328455B (zh) | 2010-12-13 | 2016-02-24 | 巴斯夫欧洲公司 | 漂白催化剂 |
| EP3357337B1 (en) | 2010-12-29 | 2025-10-22 | Ecolab USA Inc. | Generation of peroxycarboxylic acids at alkaline ph, and their use as textile bleaching and antimicrobial agents |
| US8877254B2 (en) | 2010-12-29 | 2014-11-04 | Ecolab Usa Inc. | In situ generation of peroxycarboxylic acids at alkaline pH, and methods of use thereof |
| US8889900B2 (en) | 2010-12-29 | 2014-11-18 | Ecolab Usa Inc. | Sugar ester peracid on site generator and formulator |
| EP2856976A1 (en) | 2011-04-06 | 2015-04-08 | DePuy Synthes Products, LLC | Instrument assembly for implanting a revision hip prosthesis |
| GB201106409D0 (en) | 2011-04-15 | 2011-06-01 | Revolymer Ltd | Novel composite |
| US9321664B2 (en) | 2011-12-20 | 2016-04-26 | Ecolab Usa Inc. | Stable percarboxylic acid compositions and uses thereof |
| EP2831000A4 (en) | 2012-03-30 | 2016-03-30 | Ecolab Usa Inc | USE OF PERCONDIC ACID / HYDROGEN PEROXIDE AND PEROXIDE REDUCERS FOR THE TREATMENT OF DRILLING LIQUIDS, FRACKING LIQUIDS, REFILL WATER AND DISPOSAL WATER |
| EP2850056A1 (en) | 2012-05-18 | 2015-03-25 | Warwick International Group Limited | Activation of peroxygen bleach |
| US8822719B1 (en) | 2013-03-05 | 2014-09-02 | Ecolab Usa Inc. | Peroxycarboxylic acid compositions suitable for inline optical or conductivity monitoring |
| US10165774B2 (en) | 2013-03-05 | 2019-01-01 | Ecolab Usa Inc. | Defoamer useful in a peracid composition with anionic surfactants |
| US20140256811A1 (en) | 2013-03-05 | 2014-09-11 | Ecolab Usa Inc. | Efficient stabilizer in controlling self accelerated decomposition temperature of peroxycarboxylic acid compositions with mineral acids |
| EP2806018A1 (en) | 2013-05-20 | 2014-11-26 | The Procter & Gamble Company | Encapsulates |
| US20140338134A1 (en) | 2013-05-20 | 2014-11-20 | The Procter & Gamble Company | Encapsulates |
| NO3011004T3 (show.php) | 2013-06-20 | 2017-12-23 | ||
| CN105452432B (zh) | 2013-08-16 | 2020-04-28 | 切姆森蒂有限公司 | 组合物 |
| EP3068857B1 (en) | 2013-11-11 | 2019-06-19 | Ecolab USA Inc. | High alkaline warewash detergent with enhanced scale control and soil dispersion |
| MX2017008062A (es) | 2014-12-18 | 2018-01-09 | Ecolab Usa Inc | Generacion de acido peroxiformico a traves de formiato de alcohol polihidrico. |
| US11040902B2 (en) | 2014-12-18 | 2021-06-22 | Ecolab Usa Inc. | Use of percarboxylic acids for scale prevention in treatment systems |
| CA2971416C (en) | 2014-12-18 | 2024-01-23 | Ecolab Usa Inc. | Methods for forming peroxyformic acid and uses thereof |
| US9890350B2 (en) | 2015-10-28 | 2018-02-13 | Ecolab Usa Inc. | Methods of using a soil release polymer in a neutral or low alkaline prewash |
| WO2017076771A1 (en) | 2015-11-03 | 2017-05-11 | Basf Se | Bleach catalysts |
| EP3176157A1 (en) | 2015-12-01 | 2017-06-07 | Basf Se | Bleach catalysts |
| WO2017182295A1 (en) | 2016-04-18 | 2017-10-26 | Basf Se | Liquid cleaning compositions |
| WO2017186480A1 (en) | 2016-04-26 | 2017-11-02 | Basf Se | Metal free bleaching composition |
| IT201600070454A1 (it) | 2016-07-06 | 2016-10-06 | 3V Sigma Spa | Attivatori di composti perossigenati |
| EP3372663A1 (en) | 2017-03-10 | 2018-09-12 | Basf Se | Bleach catalysts |
| EP3806637A1 (en) | 2018-06-15 | 2021-04-21 | Ecolab USA Inc. | On site generated performic acid compositions for teat treatment |
| WO2020041545A1 (en) | 2018-08-22 | 2020-02-27 | Ecolab Usa Inc. | Hydrogen peroxide and peracid stabilization with molecules based on a pyridine carboxylic acid at c-3, -4 or -5 |
| EP3918128B1 (en) | 2019-01-31 | 2025-08-27 | Ecolab USA Inc. | Laundry machine kit to enable control of water levels, recirculation, and spray of chemistry |
| EP3918126B1 (en) | 2019-01-31 | 2024-05-15 | Ecolab USA Inc. | Rinse water reuse system and methods of use |
| CA3128194C (en) | 2019-01-31 | 2024-05-14 | Ecolab Usa Inc. | Controller for a rinse water reuse system and methods of use |
| EP4379116A3 (en) | 2019-01-31 | 2024-07-24 | Ecolab USA Inc. | Controlling water levels and detergent concentration in a wash cycle |
| JP7385682B2 (ja) | 2019-05-31 | 2023-11-22 | エコラボ ユーエスエー インコーポレイティド | 導電率測定による過酸濃度の監視方法および過酸組成物 |
| WO2021026410A1 (en) | 2019-08-07 | 2021-02-11 | Ecolab Usa Inc. | Polymeric and solid-supported chelators for stabilization of peracid-containing compositions |
| AU2021227116A1 (en) | 2020-02-28 | 2022-09-01 | Catexel Technologies Limited | Degradative method |
| US12171225B2 (en) | 2020-05-29 | 2024-12-24 | Ecolab Usa Inc. | Biocidal compositions with hydronium ion sources for biofilm control |
| EP3967742A1 (en) | 2020-09-15 | 2022-03-16 | WeylChem Performance Products GmbH | Compositions comprising bleaching catalyst, manufacturing process thereof, and bleaching and cleaning agent comprising same |
| EP4008765A1 (en) | 2020-12-07 | 2022-06-08 | WeylChem Performance Products GmbH | Compositions comprising protonated triazacyclic compounds and bleaching agent and cleaning agent comprising same |
| EP4267709A1 (en) | 2020-12-23 | 2023-11-01 | Ecolab USA Inc. | Soil removal on cotton via treatment in the rinse step for enhanced cleaning in the subsequent wash |
| WO2023122196A1 (en) | 2021-12-22 | 2023-06-29 | Ecolab Usa Inc. | Compositions comprising multiple charged cationic compounds for soil release |
| EP4296343A1 (en) | 2022-06-24 | 2023-12-27 | WeylChem Performance Products GmbH | Compositions comprising protonated triazacyclic compounds and manganese(ii) acetate, manufacturing thereof, and bleaching and cleaning agent comprising same |
| EP4669690A1 (en) | 2023-02-21 | 2025-12-31 | Basf Se | MODIFIED ALCOXYLATED POLYAMINES OR MODIFIED ALCOXYLATED POLYAMINES |
| WO2024175401A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| WO2024175409A1 (en) | 2023-02-21 | 2024-08-29 | Basf Se | Modified hyperbranched alkoxylated polyalkylene imines |
| CN120882779A (zh) | 2023-03-13 | 2025-10-31 | 巴斯夫欧洲公司 | 烷氧基化含氮聚合物及其用途 |
| CN120981505A (zh) | 2023-05-05 | 2025-11-18 | 巴斯夫欧洲公司 | 可生物降解的多元醇丙氧基化物、其制备、用途以及包含它们的组合物 |
| WO2024256175A1 (en) | 2023-06-13 | 2024-12-19 | Basf Se | Stabilized cleaning compositions comprising edds and enzymes and their use |
| WO2025125117A1 (en) | 2023-12-15 | 2025-06-19 | Basf Se | Biodegradable propoxylated ethylenediamines, their preparation, uses, and compositions comprising them |
| WO2025131888A1 (en) | 2023-12-19 | 2025-06-26 | Basf Se | Modified alkoxylated polyalkylene imines or modified alkoxylated polyamines |
| WO2025195856A1 (en) | 2024-03-19 | 2025-09-25 | Basf Se | Compositions of guerbet alkyl sulfates and their use |
| WO2025202032A1 (en) | 2024-03-26 | 2025-10-02 | Basf Se | Biodegradable alkoxylated polyols, their preparation, uses, and compositions comprising them |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR748282A (fr) * | 1932-04-25 | 1933-07-01 | Ig Farbenindustrie Ag | Procédé pour la conservation de l'eau oxygénée |
| GB425804A (en) * | 1933-07-28 | 1935-03-21 | Bohme H Th Ag | A process for the preparation of washing agents |
| GB451026A (en) * | 1933-12-29 | 1936-07-27 | Ehrhart Franz | Improvements in the process of bleaching organic materials |
| DE691616C (de) * | 1934-02-01 | 1940-06-01 | Leipziger Wollkaemmerei | Verfahren zum Bleichen von natuerlichem oder kuenstlichem Textilgut |
| DE738889C (de) * | 1938-01-12 | 1944-11-18 | Degussa | Verfahren zum Bleichen von inkrustenfreiem Cellulosefasergut |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2763650A (en) * | 1956-09-18 | Derivatives of x | ||
| US2153416A (en) * | 1936-05-22 | 1939-04-04 | Hatters Fur Exchange Inc | Treatment of animal and vegetable fibers |
| US2371545A (en) * | 1942-09-26 | 1945-03-13 | Pennsylvania Salt Mfg Co | Hydrogen peroxide bleach |
| US2448252A (en) * | 1946-08-02 | 1948-08-31 | Du Pont | Preparation of peracid solutions |
-
0
- NL NL209345D patent/NL209345A/xx unknown
- BE BE549817D patent/BE549817A/xx unknown
- NL NL113890D patent/NL113890C/xx active
-
1955
- 1955-07-27 GB GB21686/55A patent/GB836988A/en not_active Expired
-
1956
- 1956-07-25 US US599934A patent/US2955905A/en not_active Expired - Lifetime
- 1956-07-25 CH CH348682D patent/CH348682A/de unknown
- 1956-07-26 FR FR1155228D patent/FR1155228A/fr not_active Expired
- 1956-07-26 DE DEU4035A patent/DE1246658B/de active Pending
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR748282A (fr) * | 1932-04-25 | 1933-07-01 | Ig Farbenindustrie Ag | Procédé pour la conservation de l'eau oxygénée |
| GB425804A (en) * | 1933-07-28 | 1935-03-21 | Bohme H Th Ag | A process for the preparation of washing agents |
| GB451026A (en) * | 1933-12-29 | 1936-07-27 | Ehrhart Franz | Improvements in the process of bleaching organic materials |
| DE691616C (de) * | 1934-02-01 | 1940-06-01 | Leipziger Wollkaemmerei | Verfahren zum Bleichen von natuerlichem oder kuenstlichem Textilgut |
| DE738889C (de) * | 1938-01-12 | 1944-11-18 | Degussa | Verfahren zum Bleichen von inkrustenfreiem Cellulosefasergut |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2344990A1 (de) * | 1972-09-14 | 1974-03-21 | Kao Corp | Mischungen zum aktivieren anorganischer peroxydbleichmittel |
| DE2701133A1 (de) * | 1977-01-13 | 1978-07-20 | Schuelke & Mayr Gmbh | Lagerfaehige, beim loesen in wasser eine loesung mit hoher antimikrobieller wirkung ergebende mischung |
| EP0492000A1 (en) * | 1990-12-28 | 1992-07-01 | AUSIMONT S.p.A. | Process for increasing the bleaching efficiency of an inorganic persalt |
| US5342542A (en) * | 1990-12-28 | 1994-08-30 | Ausimont S.P.A. | Process for increasing the bleaching efficiency of persalts by using a partially acetylated sucrose as a bleach activator |
Also Published As
| Publication number | Publication date |
|---|---|
| US2955905A (en) | 1960-10-11 |
| NL113890C (show.php) | |
| NL209345A (show.php) | |
| BE549817A (show.php) | |
| GB836988A (en) | 1960-06-09 |
| FR1155228A (fr) | 1958-04-24 |
| CH348682A (de) | 1960-09-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1246658B (de) | Bleichaktivatoren | |
| DE69126778T2 (de) | Verfahren zur Erhöhung der Bleichwirksamkeit eines inorganischen Persalzes | |
| DE2344990C3 (de) | Mittel zum Aktivieren von anorganischen Peroxydbleichmitteln | |
| DE69434227T3 (de) | Durchsichtige, isotrope, wässrige Bleichmittelzusammensetzung | |
| DE1444024A1 (de) | Bleich- und Reinigungsmittel | |
| DE2657043A1 (de) | Bleichmittel und verfahren zum reinigen von geweben | |
| DE1291317B (de) | Verfahren zum Bleichen von Textilien | |
| DE2420009C3 (show.php) | ||
| DE1105092B (de) | Waschmittel mit Bleichwirkung | |
| DE2450524B2 (de) | Festes, schaumbildendes bleichmittel | |
| DE1692006A1 (de) | Bleichendes Reinigungsmittel | |
| DE2508412C3 (de) | Lagerbeständiges festes Bleichmittel | |
| DE2420647B2 (de) | Bleichmittel | |
| DE2124587A1 (show.php) | ||
| DE2161726B2 (de) | Waschmittel mit verringertem oder ohne Gehalt an Phosphaten | |
| DE2530539C3 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE2531870A1 (de) | Bleichmittelzusammensetzung enthaltend ein wasserstoffperoxyd-addukt | |
| DE2510184A1 (de) | Schaeumende bleichmittelmischung | |
| DE2128945A1 (de) | Bleichmittel | |
| DE2214500C2 (de) | Bleichendes Waschmittel | |
| DE69030443T2 (de) | Verfahren zur Erhöhung der Bleichwirksamkeit von anorganischen Persalzen | |
| DE1289815B (de) | Stabile waessrige Bleichmittelloesung | |
| DE2909861A1 (de) | Abfangmittel fuer wasch- und spuelmittel, die persalze enthalten | |
| DE1768962C3 (de) | Triacylierte Hydroxylamine und deren Verwendung als Aktivatoren für anorganische Perverbindungen | |
| CH573663A5 (show.php) |