DE1226877B - Photographische Silberhalogenidemulsion - Google Patents
Photographische SilberhalogenidemulsionInfo
- Publication number
- DE1226877B DE1226877B DEP30723A DEP0030723A DE1226877B DE 1226877 B DE1226877 B DE 1226877B DE P30723 A DEP30723 A DE P30723A DE P0030723 A DEP0030723 A DE P0030723A DE 1226877 B DE1226877 B DE 1226877B
- Authority
- DE
- Germany
- Prior art keywords
- silver halide
- soluble
- silver
- insoluble
- photographic emulsion
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004332 silver Substances 0.000 title claims description 184
- 229910052709 silver Inorganic materials 0.000 title claims description 184
- -1 Silver halide Chemical class 0.000 title claims description 164
- 239000000839 emulsion Substances 0.000 title claims description 72
- 239000006185 dispersion Substances 0.000 claims description 56
- 150000002894 organic compounds Chemical class 0.000 claims description 42
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 42
- 239000013078 crystal Substances 0.000 claims description 38
- 150000001875 compounds Chemical class 0.000 claims description 35
- 229920000159 gelatin Polymers 0.000 claims description 34
- 235000019322 gelatine Nutrition 0.000 claims description 34
- 108010010803 Gelatin Proteins 0.000 claims description 33
- 239000008273 gelatin Substances 0.000 claims description 33
- 235000011852 gelatine desserts Nutrition 0.000 claims description 33
- AKHNMLFCWUSKQB-UHFFFAOYSA-L sodium thiosulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=S AKHNMLFCWUSKQB-UHFFFAOYSA-L 0.000 claims description 32
- 235000019345 sodium thiosulphate Nutrition 0.000 claims description 32
- CYCKHTAVNBPQDB-UHFFFAOYSA-N 4-phenyl-3H-thiazole-2-thione Chemical compound S1C(S)=NC(C=2C=CC=CC=2)=C1 CYCKHTAVNBPQDB-UHFFFAOYSA-N 0.000 claims description 26
- 239000000203 mixture Substances 0.000 claims description 22
- 238000000034 method Methods 0.000 claims description 20
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical class SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 20
- 229910021607 Silver chloride Inorganic materials 0.000 claims description 15
- HKZLPVFGJNLROG-UHFFFAOYSA-M silver monochloride Chemical compound [Cl-].[Ag+] HKZLPVFGJNLROG-UHFFFAOYSA-M 0.000 claims description 15
- 239000004133 Sodium thiosulphate Substances 0.000 claims description 14
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 11
- 239000005708 Sodium hypochlorite Substances 0.000 claims description 7
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 claims description 7
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical group SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 claims description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N aminothiocarboxamide Natural products NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 claims description 5
- 238000012545 processing Methods 0.000 claims description 5
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical group [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 4
- 239000000084 colloidal system Substances 0.000 claims description 4
- 238000004090 dissolution Methods 0.000 claims description 4
- 229910052717 sulfur Inorganic materials 0.000 claims description 4
- 239000011593 sulfur Substances 0.000 claims description 4
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical group [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- SJOOOZPMQAWAOP-UHFFFAOYSA-N [Ag].BrCl Chemical compound [Ag].BrCl SJOOOZPMQAWAOP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- 230000005855 radiation Effects 0.000 claims description 3
- 229910052711 selenium Chemical group 0.000 claims description 3
- 150000003585 thioureas Chemical class 0.000 claims description 3
- RFCQDOVPMUSZMN-UHFFFAOYSA-N 2-Naphthalenethiol Chemical compound C1=CC=CC2=CC(S)=CC=C21 RFCQDOVPMUSZMN-UHFFFAOYSA-N 0.000 claims description 2
- 238000013019 agitation Methods 0.000 claims description 2
- 230000015572 biosynthetic process Effects 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical group [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims 1
- 239000003433 contraceptive agent Substances 0.000 claims 1
- 230000002254 contraceptive effect Effects 0.000 claims 1
- 229910052757 nitrogen Inorganic materials 0.000 claims 1
- 125000004433 nitrogen atom Chemical group N* 0.000 claims 1
- 125000003396 thiol group Chemical group [H]S* 0.000 claims 1
- 239000000243 solution Substances 0.000 description 76
- 238000012360 testing method Methods 0.000 description 51
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 36
- 239000000463 material Substances 0.000 description 30
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 27
- 238000011282 treatment Methods 0.000 description 23
- ADZWSOLPGZMUMY-UHFFFAOYSA-M silver bromide Chemical compound [Ag]Br ADZWSOLPGZMUMY-UHFFFAOYSA-M 0.000 description 18
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 16
- 230000003287 optical effect Effects 0.000 description 13
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 12
- 230000008569 process Effects 0.000 description 11
- 239000003638 chemical reducing agent Substances 0.000 description 10
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 230000008901 benefit Effects 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- 238000010998 test method Methods 0.000 description 7
- 230000000694 effects Effects 0.000 description 6
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(1+) nitrate Chemical compound [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 6
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 5
- ZRKMQKLGEQPLNS-UHFFFAOYSA-N 1-Pentanethiol Chemical compound CCCCCS ZRKMQKLGEQPLNS-UHFFFAOYSA-N 0.000 description 5
- ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 4-methyl-1-phenylpyrazolidin-3-one Chemical compound N1C(=O)C(C)CN1C1=CC=CC=C1 ZZEYCGJAYIHIAZ-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 5
- OIDPCXKPHYRNKH-UHFFFAOYSA-J chrome alum Chemical compound [K]OS(=O)(=O)O[Cr]1OS(=O)(=O)O1 OIDPCXKPHYRNKH-UHFFFAOYSA-J 0.000 description 5
- 239000012153 distilled water Substances 0.000 description 5
- 238000001035 drying Methods 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 239000000523 sample Substances 0.000 description 5
- 229920002554 vinyl polymer Polymers 0.000 description 5
- CBSLBOWGJCQDRN-UHFFFAOYSA-N 2-methyl-n-(4-sulfanylphenyl)propanamide Chemical compound CC(C)C(=O)NC1=CC=C(S)C=C1 CBSLBOWGJCQDRN-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 150000001241 acetals Chemical class 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- ZEUDGVUWMXAXEF-UHFFFAOYSA-L bromo(chloro)silver Chemical compound Cl[Ag]Br ZEUDGVUWMXAXEF-UHFFFAOYSA-L 0.000 description 4
- 239000013068 control sample Substances 0.000 description 4
- 238000011161 development Methods 0.000 description 4
- 238000007865 diluting Methods 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- LQZPSWMMTICWHD-UHFFFAOYSA-N 1,3-dibenzylthiourea Chemical compound C=1C=CC=CC=1CNC(=S)NCC1=CC=CC=C1 LQZPSWMMTICWHD-UHFFFAOYSA-N 0.000 description 3
- GGZHVNZHFYCSEV-UHFFFAOYSA-N 1-Phenyl-5-mercaptotetrazole Chemical compound SC1=NN=NN1C1=CC=CC=C1 GGZHVNZHFYCSEV-UHFFFAOYSA-N 0.000 description 3
- FLFWJIBUZQARMD-UHFFFAOYSA-N 2-mercapto-1,3-benzoxazole Chemical compound C1=CC=C2OC(S)=NC2=C1 FLFWJIBUZQARMD-UHFFFAOYSA-N 0.000 description 3
- ZNWDVQFYQPYNBN-UHFFFAOYSA-N C(C(C)C)(=O)NC1=CC2=C(N=C(S2)S)C=C1 Chemical compound C(C(C)C)(=O)NC1=CC2=C(N=C(S2)S)C=C1 ZNWDVQFYQPYNBN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 238000012822 chemical development Methods 0.000 description 3
- 238000005345 coagulation Methods 0.000 description 3
- 230000015271 coagulation Effects 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 230000002349 favourable effect Effects 0.000 description 3
- 238000001556 precipitation Methods 0.000 description 3
- 229910001961 silver nitrate Inorganic materials 0.000 description 3
- 230000003381 solubilizing effect Effects 0.000 description 3
- 239000011550 stock solution Substances 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- PMBXCGGQNSVESQ-UHFFFAOYSA-N 1-Hexanethiol Chemical compound CCCCCCS PMBXCGGQNSVESQ-UHFFFAOYSA-N 0.000 description 2
- GIROESBYMDYHRL-UHFFFAOYSA-N 2,2-dimethyl-n-(4-sulfanylphenyl)propanamide Chemical compound CC(C)(C)C(=O)NC1=CC=C(S)C=C1 GIROESBYMDYHRL-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- VRVRGVPWCUEOGV-UHFFFAOYSA-N 2-aminothiophenol Chemical compound NC1=CC=CC=C1S VRVRGVPWCUEOGV-UHFFFAOYSA-N 0.000 description 2
- JKFYKCYQEWQPTM-UHFFFAOYSA-N 2-azaniumyl-2-(4-fluorophenyl)acetate Chemical compound OC(=O)C(N)C1=CC=C(F)C=C1 JKFYKCYQEWQPTM-UHFFFAOYSA-N 0.000 description 2
- BDFAOUQQXJIZDG-UHFFFAOYSA-N 2-methylpropane-1-thiol Chemical compound CC(C)CS BDFAOUQQXJIZDG-UHFFFAOYSA-N 0.000 description 2
- WCDSVWRUXWCYFN-UHFFFAOYSA-N 4-aminobenzenethiol Chemical compound NC1=CC=C(S)C=C1 WCDSVWRUXWCYFN-UHFFFAOYSA-N 0.000 description 2
- FTBCOQFMQSTCQQ-UHFFFAOYSA-N 4-bromobenzenethiol Chemical compound SC1=CC=C(Br)C=C1 FTBCOQFMQSTCQQ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- SFBAPLDMMQQLQP-UHFFFAOYSA-N C(CCCCCCC)(=O)NC1=CC=C(C=C1)S Chemical compound C(CCCCCCC)(=O)NC1=CC=C(C=C1)S SFBAPLDMMQQLQP-UHFFFAOYSA-N 0.000 description 2
- BQHWNJZBVYGWCV-UHFFFAOYSA-N C1(=CC=CC2=CC=CC=C12)C(=O)NC1=CC=C(C=C1)S Chemical compound C1(=CC=CC2=CC=CC=C12)C(=O)NC1=CC=C(C=C1)S BQHWNJZBVYGWCV-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- ZZGRQTUZIRAELU-UHFFFAOYSA-N N-(4-sulfanylphenyl)dodecanamide Chemical compound C(CCCCCCCCCCC)(=O)NC1=CC=C(C=C1)S ZZGRQTUZIRAELU-UHFFFAOYSA-N 0.000 description 2
- AMHCMYWSIHIRQC-UHFFFAOYSA-N N-(4-sulfanylphenyl)hexanamide Chemical compound C(CCCCC)(=O)NC1=CC=C(C=C1)S AMHCMYWSIHIRQC-UHFFFAOYSA-N 0.000 description 2
- 239000004372 Polyvinyl alcohol Substances 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229910021612 Silver iodide Inorganic materials 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- DHKHKXVYLBGOIT-UHFFFAOYSA-N acetaldehyde Diethyl Acetal Natural products CCOC(C)OCC DHKHKXVYLBGOIT-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 235000011126 aluminium potassium sulphate Nutrition 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 230000003321 amplification Effects 0.000 description 2
- 238000003287 bathing Methods 0.000 description 2
- OIPQUBBCOVJSNS-UHFFFAOYSA-L bromo(iodo)silver Chemical compound Br[Ag]I OIPQUBBCOVJSNS-UHFFFAOYSA-L 0.000 description 2
- WERYXYBDKMZEQL-UHFFFAOYSA-N butane-1,4-diol Chemical compound OCCCCO WERYXYBDKMZEQL-UHFFFAOYSA-N 0.000 description 2
- WQAQPCDUOCURKW-UHFFFAOYSA-N butanethiol Chemical compound CCCCS WQAQPCDUOCURKW-UHFFFAOYSA-N 0.000 description 2
- 238000004364 calculation method Methods 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 238000003199 nucleic acid amplification method Methods 0.000 description 2
- 229920000728 polyester Polymers 0.000 description 2
- 229920006267 polyester film Polymers 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920002451 polyvinyl alcohol Polymers 0.000 description 2
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 2
- 229940050271 potassium alum Drugs 0.000 description 2
- GRLPQNLYRHEGIJ-UHFFFAOYSA-J potassium aluminium sulfate Chemical compound [Al+3].[K+].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O GRLPQNLYRHEGIJ-UHFFFAOYSA-J 0.000 description 2
- 239000001103 potassium chloride Substances 0.000 description 2
- 235000011164 potassium chloride Nutrition 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 230000005070 ripening Effects 0.000 description 2
- 150000003378 silver Chemical class 0.000 description 2
- 229940045105 silver iodide Drugs 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- QTTAKXPPGQAQPS-UHFFFAOYSA-N (2-ethylphenyl)methanethiol Chemical compound CCC1=CC=CC=C1CS QTTAKXPPGQAQPS-UHFFFAOYSA-N 0.000 description 1
- PJUDFYDAJBQPEA-UHFFFAOYSA-N (2-methylphenyl)methanethiol Chemical compound CC1=CC=CC=C1CS PJUDFYDAJBQPEA-UHFFFAOYSA-N 0.000 description 1
- CYXJEHCKVOQFOV-UHFFFAOYSA-N (4-amino-2-methylphenyl) hydrogen sulfate Chemical compound CC1=CC(N)=CC=C1OS(O)(=O)=O CYXJEHCKVOQFOV-UHFFFAOYSA-N 0.000 description 1
- DRNRNRPJNRQTKC-UHFFFAOYSA-N (4-ethylphenyl)methanethiol Chemical compound CCC1=CC=C(CS)C=C1 DRNRNRPJNRQTKC-UHFFFAOYSA-N 0.000 description 1
- AGFYZLVFPSGUIX-UHFFFAOYSA-N (4-methylphenyl)methanethiol Chemical compound CC1=CC=C(CS)C=C1 AGFYZLVFPSGUIX-UHFFFAOYSA-N 0.000 description 1
- FPZXQVCYHDMIIA-UHFFFAOYSA-N 1,1-diphenylthiourea Chemical compound C=1C=CC=CC=1N(C(=S)N)C1=CC=CC=C1 FPZXQVCYHDMIIA-UHFFFAOYSA-N 0.000 description 1
- BIGYLAKFCGVRAN-UHFFFAOYSA-N 1,3,4-thiadiazolidine-2,5-dithione Chemical compound S=C1NNC(=S)S1 BIGYLAKFCGVRAN-UHFFFAOYSA-N 0.000 description 1
- WYMLGVPROUZGCI-UHFFFAOYSA-N 1,3-bis(2-ethylphenyl)thiourea Chemical compound CCC1=CC=CC=C1NC(=S)NC1=CC=CC=C1CC WYMLGVPROUZGCI-UHFFFAOYSA-N 0.000 description 1
- DZZWKUMHMSNBSG-UHFFFAOYSA-N 1,3-bis(prop-2-enyl)thiourea Chemical compound C=CCNC(=S)NCC=C DZZWKUMHMSNBSG-UHFFFAOYSA-N 0.000 description 1
- BNSNUHPJRKTRNT-UHFFFAOYSA-N 1,3-dianilinothiourea Chemical compound C=1C=CC=CC=1NNC(=S)NNC1=CC=CC=C1 BNSNUHPJRKTRNT-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- RNGRBOULPSEYNL-UHFFFAOYSA-N 1,3-dioctylthiourea Chemical compound CCCCCCCCNC(=S)NCCCCCCCC RNGRBOULPSEYNL-UHFFFAOYSA-N 0.000 description 1
- WGJCBBASTRWVJL-UHFFFAOYSA-N 1,3-thiazolidine-2-thione Chemical compound SC1=NCCS1 WGJCBBASTRWVJL-UHFFFAOYSA-N 0.000 description 1
- YFBUDXNMBTUSOC-UHFFFAOYSA-N 1,4-dihydroquinoxaline-2,3-dithione Chemical compound C1=CC=C2NC(=S)C(=S)NC2=C1 YFBUDXNMBTUSOC-UHFFFAOYSA-N 0.000 description 1
- QRMPKOFEUHIBNM-UHFFFAOYSA-N 1,4-dimethylcyclohexane Chemical group CC1CCC(C)CC1 QRMPKOFEUHIBNM-UHFFFAOYSA-N 0.000 description 1
- UOFGSWVZMUXXIY-UHFFFAOYSA-N 1,5-Diphenyl-3-thiocarbazone Chemical compound C=1C=CC=CC=1N=NC(=S)NNC1=CC=CC=C1 UOFGSWVZMUXXIY-UHFFFAOYSA-N 0.000 description 1
- DDWXNUFFAFBJDG-UHFFFAOYSA-N 1-acetyl-2-sulfanylideneimidazolidin-4-one Chemical compound CC(=O)N1CC(=O)NC1=S DDWXNUFFAFBJDG-UHFFFAOYSA-N 0.000 description 1
- KIJJAHDWPAWNGH-UHFFFAOYSA-N 1-ethyl-1-naphthalen-1-ylthiourea Chemical compound C1=CC=C2C(N(C(N)=S)CC)=CC=CC2=C1 KIJJAHDWPAWNGH-UHFFFAOYSA-N 0.000 description 1
- OROCFDLTBPBLFS-UHFFFAOYSA-N 1-ethyl-3-phenylthiourea Chemical compound CCNC(=S)NC1=CC=CC=C1 OROCFDLTBPBLFS-UHFFFAOYSA-N 0.000 description 1
- RJTICPGQFMYYEG-UHFFFAOYSA-N 1-phenyl-3-prop-2-enylthiourea Chemical compound C=CCNC(=S)NC1=CC=CC=C1 RJTICPGQFMYYEG-UHFFFAOYSA-N 0.000 description 1
- KXZSVYHFYHTNBI-UHFFFAOYSA-N 1h-quinoline-2-thione Chemical compound C1=CC=CC2=NC(S)=CC=C21 KXZSVYHFYHTNBI-UHFFFAOYSA-N 0.000 description 1
- YAJYJWXEWKRTPO-UHFFFAOYSA-N 2,3,3,4,4,5-hexamethylhexane-2-thiol Chemical compound CC(C)C(C)(C)C(C)(C)C(C)(C)S YAJYJWXEWKRTPO-UHFFFAOYSA-N 0.000 description 1
- QZLAEIZEPJAELS-UHFFFAOYSA-N 2,4,4-trimethylpentane-2-thiol Chemical compound CC(C)(C)CC(C)(C)S QZLAEIZEPJAELS-UHFFFAOYSA-N 0.000 description 1
- PSYGHMBJXWRQFD-UHFFFAOYSA-N 2-(2-sulfanylacetyl)oxyethyl 2-sulfanylacetate Chemical compound SCC(=O)OCCOC(=O)CS PSYGHMBJXWRQFD-UHFFFAOYSA-N 0.000 description 1
- UCJMHYXRQZYNNL-UHFFFAOYSA-N 2-Ethyl-1-hexanethiol Chemical compound CCCCC(CC)CS UCJMHYXRQZYNNL-UHFFFAOYSA-N 0.000 description 1
- LXUNZSDDXMPKLP-UHFFFAOYSA-N 2-Methylbenzenethiol Chemical compound CC1=CC=CC=C1S LXUNZSDDXMPKLP-UHFFFAOYSA-N 0.000 description 1
- QUSTYFNPKBDELJ-UHFFFAOYSA-N 2-Pentanethiol Chemical compound CCCC(C)S QUSTYFNPKBDELJ-UHFFFAOYSA-N 0.000 description 1
- VEUMANXWQDHAJV-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCN=CC1=CC=CC=C1O VEUMANXWQDHAJV-UHFFFAOYSA-N 0.000 description 1
- VJIKFWJCVWFZIN-UHFFFAOYSA-N 2-ethylsulfanylacetic acid Chemical compound CCSCC(O)=O VJIKFWJCVWFZIN-UHFFFAOYSA-N 0.000 description 1
- SHHKMWMIKILKQW-UHFFFAOYSA-N 2-formylbenzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1C=O SHHKMWMIKILKQW-UHFFFAOYSA-N 0.000 description 1
- DYAOREPNYXXCOA-UHFFFAOYSA-N 2-sulfanylundecanoic acid Chemical compound CCCCCCCCCC(S)C(O)=O DYAOREPNYXXCOA-UHFFFAOYSA-N 0.000 description 1
- WRXOZRLZDJAYDR-UHFFFAOYSA-N 3-methylbenzenethiol Chemical compound CC1=CC=CC(S)=C1 WRXOZRLZDJAYDR-UHFFFAOYSA-N 0.000 description 1
- HQXQVKSGCXSRGH-UHFFFAOYSA-N 3h-1,3-benzothiazole-2-thione;1-(diaminomethylidene)-2-phenylguanidine Chemical compound C1=CC=C2SC(=S)NC2=C1.NC(N)=NC(N)=NC1=CC=CC=C1 HQXQVKSGCXSRGH-UHFFFAOYSA-N 0.000 description 1
- CLEJZSNZYFJMKD-UHFFFAOYSA-N 3h-1,3-oxazole-2-thione Chemical class SC1=NC=CO1 CLEJZSNZYFJMKD-UHFFFAOYSA-N 0.000 description 1
- VZXOZSQDJJNBRC-UHFFFAOYSA-N 4-chlorobenzenethiol Chemical compound SC1=CC=C(Cl)C=C1 VZXOZSQDJJNBRC-UHFFFAOYSA-N 0.000 description 1
- SROUFSRLNWYQHI-UHFFFAOYSA-N 4-methoxy-n-(4-sulfanylphenyl)benzamide Chemical compound C1=CC(OC)=CC=C1C(=O)NC1=CC=C(S)C=C1 SROUFSRLNWYQHI-UHFFFAOYSA-N 0.000 description 1
- NIAAGQAEVGMHPM-UHFFFAOYSA-N 4-methylbenzene-1,2-dithiol Chemical compound CC1=CC=C(S)C(S)=C1 NIAAGQAEVGMHPM-UHFFFAOYSA-N 0.000 description 1
- WLHCBQAPPJAULW-UHFFFAOYSA-N 4-methylbenzenethiol Chemical compound CC1=CC=C(S)C=C1 WLHCBQAPPJAULW-UHFFFAOYSA-N 0.000 description 1
- OAZWGANOZRJBNF-UHFFFAOYSA-N 4-nitro-n-(4-sulfanylphenyl)benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NC1=CC=C(S)C=C1 OAZWGANOZRJBNF-UHFFFAOYSA-N 0.000 description 1
- AXBVSRMHOPMXBA-UHFFFAOYSA-N 4-nitrothiophenol Chemical compound [O-][N+](=O)C1=CC=C(S)C=C1 AXBVSRMHOPMXBA-UHFFFAOYSA-N 0.000 description 1
- FZXZNIDUTACSLM-UHFFFAOYSA-N 4-nonylbenzenethiol Chemical compound CCCCCCCCCC1=CC=C(S)C=C1 FZXZNIDUTACSLM-UHFFFAOYSA-N 0.000 description 1
- MKQSUDRDROCFNK-UHFFFAOYSA-N 4-phenyl-1,3,4-thiadiazinane-2-thione Chemical compound C1CSC(=S)NN1C1=CC=CC=C1 MKQSUDRDROCFNK-UHFFFAOYSA-N 0.000 description 1
- YGYKJHCECBCELB-UHFFFAOYSA-N 4-phenyl-1,3,4-thiadiazolidine-2-thione Chemical compound C1SC(S)=NN1C1=CC=CC=C1 YGYKJHCECBCELB-UHFFFAOYSA-N 0.000 description 1
- KKIGUVBJOHCXSP-UHFFFAOYSA-N 4-phenylthiosemicarbazide Chemical compound NNC(=S)NC1=CC=CC=C1 KKIGUVBJOHCXSP-UHFFFAOYSA-N 0.000 description 1
- DUZJXKYBSMFDIU-UHFFFAOYSA-N 4-tert-butyl-2-methylbenzenethiol Chemical compound CC1=CC(C(C)(C)C)=CC=C1S DUZJXKYBSMFDIU-UHFFFAOYSA-N 0.000 description 1
- GNXBFFHXJDZGEK-UHFFFAOYSA-N 4-tert-butylbenzenethiol Chemical compound CC(C)(C)C1=CC=C(S)C=C1 GNXBFFHXJDZGEK-UHFFFAOYSA-N 0.000 description 1
- YANSPMBIFXPLFE-UHFFFAOYSA-N 5,6-dimethoxy-3h-1,3-benzothiazole-2-thione Chemical compound C1=C(OC)C(OC)=CC2=C1SC(S)=N2 YANSPMBIFXPLFE-UHFFFAOYSA-N 0.000 description 1
- HOJIICWYDFQRKH-UHFFFAOYSA-N 5-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)sulfanyl]-3h-1,3,4-thiadiazole-2-thione Chemical compound S1C(=S)NN=C1SC1=NNC(=S)S1 HOJIICWYDFQRKH-UHFFFAOYSA-N 0.000 description 1
- BXDMTLVCACMNJO-UHFFFAOYSA-N 5-amino-1,3-dihydrobenzimidazole-2-thione Chemical compound NC1=CC=C2NC(S)=NC2=C1 BXDMTLVCACMNJO-UHFFFAOYSA-N 0.000 description 1
- YPXQSGWOGQPLQO-UHFFFAOYSA-N 5-nitro-1,3-dihydrobenzimidazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2N=C(S)NC2=C1 YPXQSGWOGQPLQO-UHFFFAOYSA-N 0.000 description 1
- IDPNFKLUBIKHSW-UHFFFAOYSA-N 6-amino-3h-1,3-benzothiazole-2-thione Chemical compound NC1=CC=C2N=C(S)SC2=C1 IDPNFKLUBIKHSW-UHFFFAOYSA-N 0.000 description 1
- ZHUWXKIPGGZNJW-UHFFFAOYSA-N 6-methylheptyl 3-sulfanylpropanoate Chemical compound CC(C)CCCCCOC(=O)CCS ZHUWXKIPGGZNJW-UHFFFAOYSA-N 0.000 description 1
- IUNVCWLKOOCPIT-UHFFFAOYSA-N 6-methylheptylsulfanyl 2-hydroxyacetate Chemical compound CC(C)CCCCCSOC(=O)CO IUNVCWLKOOCPIT-UHFFFAOYSA-N 0.000 description 1
- QPOZGXKWWKLJDK-UHFFFAOYSA-N 6-nitro-3h-1,3-benzothiazole-2-thione Chemical compound [O-][N+](=O)C1=CC=C2NC(=S)SC2=C1 QPOZGXKWWKLJDK-UHFFFAOYSA-N 0.000 description 1
- PIVQQUNOTICCSA-UHFFFAOYSA-N ANTU Chemical compound C1=CC=C2C(NC(=S)N)=CC=CC2=C1 PIVQQUNOTICCSA-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229920002307 Dextran Polymers 0.000 description 1
- 239000004375 Dextrin Substances 0.000 description 1
- 229920001353 Dextrin Polymers 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical compound [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- VPIAKHNXCOTPAY-UHFFFAOYSA-N Heptane-1-thiol Chemical compound CCCCCCCS VPIAKHNXCOTPAY-UHFFFAOYSA-N 0.000 description 1
- KFFQABQEJATQAT-UHFFFAOYSA-N N,N'-dibutylthiourea Chemical compound CCCCNC(=S)NCCCC KFFQABQEJATQAT-UHFFFAOYSA-N 0.000 description 1
- FCSHMCFRCYZTRQ-UHFFFAOYSA-N N,N'-diphenylthiourea Chemical compound C=1C=CC=CC=1NC(=S)NC1=CC=CC=C1 FCSHMCFRCYZTRQ-UHFFFAOYSA-N 0.000 description 1
- IPCRBOOJBPETMF-UHFFFAOYSA-N N-acetylthiourea Chemical compound CC(=O)NC(N)=S IPCRBOOJBPETMF-UHFFFAOYSA-N 0.000 description 1
- FULZLIGZKMKICU-UHFFFAOYSA-N N-phenylthiourea Chemical compound NC(=S)NC1=CC=CC=C1 FULZLIGZKMKICU-UHFFFAOYSA-N 0.000 description 1
- 229910004835 Na2B4O7 Inorganic materials 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- YNPNZTXNASCQKK-UHFFFAOYSA-N Phenanthrene Natural products C1=CC=C2C3=CC=CC=C3C=CC2=C1 YNPNZTXNASCQKK-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- YIMQCDZDWXUDCA-UHFFFAOYSA-N [4-(hydroxymethyl)cyclohexyl]methanol Chemical compound OCC1CCC(CO)CC1 YIMQCDZDWXUDCA-UHFFFAOYSA-N 0.000 description 1
- QMJDEXCUIQJLGO-UHFFFAOYSA-N [4-(methylamino)phenyl] hydrogen sulfate Chemical compound CNC1=CC=C(OS(O)(=O)=O)C=C1 QMJDEXCUIQJLGO-UHFFFAOYSA-N 0.000 description 1
- WDLUEZJSSHTKAP-UHFFFAOYSA-N acetaldehyde;1,1-diethoxyethane Chemical compound CC=O.CCOC(C)OCC WDLUEZJSSHTKAP-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000012644 addition polymerization Methods 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- MWPLVEDNUUSJAV-UHFFFAOYSA-N anthracene Natural products C1=CC=CC2=CC3=CC=CC=C3C=C21 MWPLVEDNUUSJAV-UHFFFAOYSA-N 0.000 description 1
- 238000013459 approach Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000000981 basic dye Substances 0.000 description 1
- GFIWXLPJOFXZEI-UHFFFAOYSA-N benzene-1,4-diol 4-methyl-1-phenylpyrazolidin-3-one Chemical compound C1(O)=CC=C(O)C=C1.CC1C(NN(C1)C1=CC=CC=C1)=O GFIWXLPJOFXZEI-UHFFFAOYSA-N 0.000 description 1
- UIJGNTRUPZPVNG-UHFFFAOYSA-N benzenecarbothioic s-acid Chemical compound SC(=O)C1=CC=CC=C1 UIJGNTRUPZPVNG-UHFFFAOYSA-N 0.000 description 1
- WDODWFPDZYSKIA-UHFFFAOYSA-N benzeneselenol Chemical compound [SeH]C1=CC=CC=C1 WDODWFPDZYSKIA-UHFFFAOYSA-N 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- LOCHFZBWPCLPAN-UHFFFAOYSA-N butane-2-thiol Chemical compound CCC(C)S LOCHFZBWPCLPAN-UHFFFAOYSA-N 0.000 description 1
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N butyric aldehyde Natural products CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 238000005234 chemical deposition Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000536 complexating effect Effects 0.000 description 1
- 239000008139 complexing agent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000007822 coupling agent Substances 0.000 description 1
- ZXJXZNDDNMQXFV-UHFFFAOYSA-M crystal violet Chemical compound [Cl-].C1=CC(N(C)C)=CC=C1[C+](C=1C=CC(=CC=1)N(C)C)C1=CC=C(N(C)C)C=C1 ZXJXZNDDNMQXFV-UHFFFAOYSA-M 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- VSARMWHOISBCGR-UHFFFAOYSA-N cyclohexane-1,1-dithiol Chemical compound SC1(S)CCCCC1 VSARMWHOISBCGR-UHFFFAOYSA-N 0.000 description 1
- VTXVGVNLYGSIAR-UHFFFAOYSA-N decane-1-thiol Chemical compound CCCCCCCCCCS VTXVGVNLYGSIAR-UHFFFAOYSA-N 0.000 description 1
- 235000019425 dextrin Nutrition 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- WQABCVAJNWAXTE-UHFFFAOYSA-N dimercaprol Chemical compound OCC(S)CS WQABCVAJNWAXTE-UHFFFAOYSA-N 0.000 description 1
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical compound [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- UQGFMSUEHSUPRD-UHFFFAOYSA-N disodium;3,7-dioxido-2,4,6,8,9-pentaoxa-1,3,5,7-tetraborabicyclo[3.3.1]nonane Chemical compound [Na+].[Na+].O1B([O-])OB2OB([O-])OB1O2 UQGFMSUEHSUPRD-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- VYXSBFYARXAAKO-UHFFFAOYSA-N ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate;hydron;chloride Chemical compound [Cl-].C1=2C=C(C)C(NCC)=CC=2OC2=CC(=[NH+]CC)C(C)=CC2=C1C1=CC=CC=C1C(=O)OCC VYXSBFYARXAAKO-UHFFFAOYSA-N 0.000 description 1
- UAYKGOMDUQLCJS-UHFFFAOYSA-N ethylsulfanyl acetate Chemical compound CCSOC(C)=O UAYKGOMDUQLCJS-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000834 fixative Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000004676 glycans Chemical class 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 229920001480 hydrophilic copolymer Polymers 0.000 description 1
- 238000003384 imaging method Methods 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 210000000936 intestine Anatomy 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- MKIJJIMOAABWGF-UHFFFAOYSA-N methyl 2-sulfanylacetate Chemical compound COC(=O)CS MKIJJIMOAABWGF-UHFFFAOYSA-N 0.000 description 1
- CXKWCBBOMKCUKX-UHFFFAOYSA-M methylene blue Chemical compound [Cl-].C1=CC(N(C)C)=CC2=[S+]C3=CC(N(C)C)=CC=C3N=C21 CXKWCBBOMKCUKX-UHFFFAOYSA-M 0.000 description 1
- 229960000907 methylthioninium chloride Drugs 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- PJUIMOJAAPLTRJ-UHFFFAOYSA-N monothioglycerol Chemical compound OCC(O)CS PJUIMOJAAPLTRJ-UHFFFAOYSA-N 0.000 description 1
- IIVNZXCXHJAXHD-UHFFFAOYSA-N n-(2-sulfanylidene-3h-1,3-benzothiazol-6-yl)acetamide Chemical compound CC(=O)NC1=CC=C2N=C(S)SC2=C1 IIVNZXCXHJAXHD-UHFFFAOYSA-N 0.000 description 1
- ZTPPOODTZGGFIU-UHFFFAOYSA-N n-(2-sulfanylidene-3h-1,3-benzothiazol-6-yl)dodecanamide Chemical compound CCCCCCCCCCCC(=O)NC1=CC=C2NC(=S)SC2=C1 ZTPPOODTZGGFIU-UHFFFAOYSA-N 0.000 description 1
- SHLGNFLVXSLLPN-UHFFFAOYSA-N n-(2-sulfanylidene-3h-1,3-benzothiazol-6-yl)octanamide Chemical compound CCCCCCCC(=O)NC1=CC=C2NC(=S)SC2=C1 SHLGNFLVXSLLPN-UHFFFAOYSA-N 0.000 description 1
- AYEQJLOHMLYKAV-UHFFFAOYSA-N n-(4-sulfanylphenyl)acetamide Chemical compound CC(=O)NC1=CC=C(S)C=C1 AYEQJLOHMLYKAV-UHFFFAOYSA-N 0.000 description 1
- NBQLIFMKYAIJQK-UHFFFAOYSA-N n-(4-sulfanylphenyl)cyclohexanecarboxamide Chemical compound C1=CC(S)=CC=C1NC(=O)C1CCCCC1 NBQLIFMKYAIJQK-UHFFFAOYSA-N 0.000 description 1
- DLVKRCGYGJZXFK-UHFFFAOYSA-N n-phenyl-2-sulfanylacetamide Chemical compound SCC(=O)NC1=CC=CC=C1 DLVKRCGYGJZXFK-UHFFFAOYSA-N 0.000 description 1
- BOQKCADLPNLYCZ-UHFFFAOYSA-N n-phenylbenzenecarbothioamide Chemical compound C=1C=CC=CC=1C(=S)NC1=CC=CC=C1 BOQKCADLPNLYCZ-UHFFFAOYSA-N 0.000 description 1
- MWCGLTCRJJFXKR-UHFFFAOYSA-N n-phenylethanethioamide Chemical compound CC(=S)NC1=CC=CC=C1 MWCGLTCRJJFXKR-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- ZVEZMVFBMOOHAT-UHFFFAOYSA-N nonane-1-thiol Chemical compound CCCCCCCCCS ZVEZMVFBMOOHAT-UHFFFAOYSA-N 0.000 description 1
- KZCOBXFFBQJQHH-UHFFFAOYSA-N octane-1-thiol Chemical compound CCCCCCCCS KZCOBXFFBQJQHH-UHFFFAOYSA-N 0.000 description 1
- 238000010979 pH adjustment Methods 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- CUQCMXFWIMOWRP-UHFFFAOYSA-N phenyl biguanide Chemical compound NC(N)=NC(N)=NC1=CC=CC=C1 CUQCMXFWIMOWRP-UHFFFAOYSA-N 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 239000004848 polyfunctional curative Substances 0.000 description 1
- 229920001282 polysaccharide Polymers 0.000 description 1
- 239000005017 polysaccharide Substances 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920001289 polyvinyl ether Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000011056 potassium acetate Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 150000003142 primary aromatic amines Chemical class 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- SUVIGLJNEAMWEG-UHFFFAOYSA-N propane-1-thiol Chemical compound CCCS SUVIGLJNEAMWEG-UHFFFAOYSA-N 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- KIWUVOGUEXMXSV-UHFFFAOYSA-N rhodanine Chemical compound O=C1CSC(=S)N1 KIWUVOGUEXMXSV-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 239000011669 selenium Substances 0.000 description 1
- 229940065287 selenium compound Drugs 0.000 description 1
- 150000003346 selenoethers Chemical class 0.000 description 1
- IYKVLICPFCEZOF-UHFFFAOYSA-N selenourea Chemical compound NC(N)=[Se] IYKVLICPFCEZOF-UHFFFAOYSA-N 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 1
- VPQBLCVGUWPDHV-UHFFFAOYSA-N sodium selenide Chemical compound [Na+].[Na+].[Se-2] VPQBLCVGUWPDHV-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- GEHJYWRUCIMESM-UHFFFAOYSA-L sodium sulfite Chemical compound [Na+].[Na+].[O-]S([O-])=O GEHJYWRUCIMESM-UHFFFAOYSA-L 0.000 description 1
- 235000010265 sodium sulphite Nutrition 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000005063 solubilization Methods 0.000 description 1
- 230000007928 solubilization Effects 0.000 description 1
- 238000001179 sorption measurement Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000006228 supernatant Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 description 1
- YUKQRDCYNOVPGJ-UHFFFAOYSA-N thioacetamide Chemical compound CC(N)=S YUKQRDCYNOVPGJ-UHFFFAOYSA-N 0.000 description 1
- DLFVBJFMPXGRIB-UHFFFAOYSA-N thioacetamide Natural products CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 1
- 150000003556 thioamides Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 150000007944 thiolates Chemical class 0.000 description 1
- NJRXVEJTAYWCQJ-UHFFFAOYSA-N thiomalic acid Chemical compound OC(=O)CC(S)C(O)=O NJRXVEJTAYWCQJ-UHFFFAOYSA-N 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- NBOMNTLFRHMDEZ-UHFFFAOYSA-N thiosalicylic acid Chemical compound OC(=O)C1=CC=CC=C1S NBOMNTLFRHMDEZ-UHFFFAOYSA-N 0.000 description 1
- 229940103494 thiosalicylic acid Drugs 0.000 description 1
- 238000001771 vacuum deposition Methods 0.000 description 1
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 230000003313 weakening effect Effects 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C391/00—Compounds containing selenium
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/32—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/68—Benzothiazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D293/00—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms
- C07D293/10—Heterocyclic compounds containing rings having nitrogen and selenium or nitrogen and tellurium, with or without oxygen or sulfur atoms, as the ring hetero atoms condensed with carbocyclic rings or ring systems
- C07D293/12—Selenazoles; Hydrogenated selenazoles
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03C—PHOTOSENSITIVE MATERIALS FOR PHOTOGRAPHIC PURPOSES; PHOTOGRAPHIC PROCESSES, e.g. CINE, X-RAY, COLOUR, STEREO-PHOTOGRAPHIC PROCESSES; AUXILIARY PROCESSES IN PHOTOGRAPHY
- G03C1/00—Photosensitive materials
- G03C1/005—Silver halide emulsions; Preparation thereof; Physical treatment thereof; Incorporation of additives therein
- G03C1/492—Photosoluble emulsions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
- Silver Salt Photography Or Processing Solution Therefor (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US15813261A | 1961-12-08 | 1961-12-08 | |
| US236418A US3155516A (en) | 1961-12-08 | 1962-11-08 | Photographic products |
| US236417A US3155515A (en) | 1961-12-08 | 1962-11-08 | Photographic products |
| US236420A US3155507A (en) | 1961-12-08 | 1962-11-08 | Photographic processes |
| US236412A US3155514A (en) | 1961-12-08 | 1962-11-08 | Photographic compositions and elements |
| US317824A US3155519A (en) | 1961-12-08 | 1963-10-21 | Photographic compositions, layers and elements |
| NL6408533A NL6408533A (show.php) | 1961-12-08 | 1964-07-24 | |
| US388919A US3418124A (en) | 1961-12-08 | 1964-08-11 | High contrast direct positive by using active cations in silver halide solvent |
| US390460A US3384485A (en) | 1961-12-08 | 1964-08-18 | Silver halide emulsions photosolubilized with optical sensitizing dyes and silver mercaptides |
| US403661A US3284206A (en) | 1961-12-08 | 1964-10-13 | Image yielding layers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1226877B true DE1226877B (de) | 1966-10-13 |
Family
ID=27580572
Family Applications (5)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP30721A Pending DE1261397B (de) | 1961-12-08 | 1962-12-07 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP30723A Pending DE1226877B (de) | 1961-12-08 | 1962-12-07 | Photographische Silberhalogenidemulsion |
| DEP37430A Pending DE1294186B (de) | 1961-12-08 | 1965-08-10 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP37479A Pending DE1293581B (de) | 1961-12-08 | 1965-08-18 | Photographische Silberhalogenidemulsion |
| DEP37856A Pending DE1293582B (de) | 1961-12-08 | 1965-10-13 | Photographische Silberhalogenidemulsion |
Family Applications Before (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP30721A Pending DE1261397B (de) | 1961-12-08 | 1962-12-07 | Photographisches Verfahren zur Herstellung positiver Bilder |
Family Applications After (3)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEP37430A Pending DE1294186B (de) | 1961-12-08 | 1965-08-10 | Photographisches Verfahren zur Herstellung positiver Bilder |
| DEP37479A Pending DE1293581B (de) | 1961-12-08 | 1965-08-18 | Photographische Silberhalogenidemulsion |
| DEP37856A Pending DE1293582B (de) | 1961-12-08 | 1965-10-13 | Photographische Silberhalogenidemulsion |
Country Status (5)
| Country | Link |
|---|---|
| US (8) | US3155514A (show.php) |
| BE (1) | BE670823A (show.php) |
| DE (5) | DE1261397B (show.php) |
| FR (1) | FR89467E (show.php) |
| GB (4) | GB1031902A (show.php) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1281842B (de) * | 1964-06-22 | 1968-10-31 | Du Pont | Fotografisches Aufzeichnungsmaterial mit einer fotoloeslichen Schicht |
| DE1293582B (de) * | 1961-12-08 | 1969-04-24 | Du Pont | Photographische Silberhalogenidemulsion |
| DE1296515B (de) * | 1964-10-13 | 1969-05-29 | Du Pont | Photographische Silberhalogenidemulsion |
| DE1296514B (de) * | 1964-10-13 | 1969-05-29 | Du Pont | Photographische Silberhalogenidemulsion |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3379529A (en) * | 1963-02-28 | 1968-04-23 | Eastman Kodak Co | Photographic inhibitor-releasing developers |
| US3368898A (en) * | 1963-10-17 | 1968-02-13 | Gen Aniline & Film Corp | Autopositive film and paper and emulsions therefor |
| US3341574A (en) * | 1964-09-18 | 1967-09-12 | Celanese Corp | Di-(neopentylglycol mononeoheptanoate)azelate |
| US3394005A (en) * | 1964-10-16 | 1968-07-23 | Du Pont | Increased development rate of photosoluble silver halide emulsions by the action of water-soluble iodide |
| US3377169A (en) * | 1965-03-30 | 1968-04-09 | Du Pont | Copper thallium and lead halide and pseudohalides photosoluble crystals |
| US3458318A (en) * | 1965-08-02 | 1969-07-29 | Eastman Kodak Co | Supersensitized silver halide emulsions |
| US3451819A (en) * | 1965-08-09 | 1969-06-24 | Du Pont | Photosoluble silver halide emulsion made spontaneously developable with amine boranes |
| US3464822A (en) * | 1965-09-13 | 1969-09-02 | Du Pont | Process for making electrically conductive images |
| GB1178800A (en) * | 1966-03-01 | 1970-01-21 | Minnesota Mining & Mfg | Improvements in or relating to Copying Materials |
| US3486895A (en) * | 1966-04-29 | 1969-12-30 | Du Pont | Process for obtaining artistic effects in photosoluble direct positive silver halide emulsions |
| US3495982A (en) * | 1967-06-23 | 1970-02-17 | Du Pont | Process for dissolution development using thiourea compounds as dmax maintainers |
| US3628956A (en) * | 1967-12-08 | 1971-12-21 | Du Pont | Process for preparing direct positive images by photosolubilization |
| US3862352A (en) * | 1968-04-16 | 1975-01-21 | Itek Corp | Photographically prepared electrical circuits wherein the photosensitive material is a photoconductor |
| US3647439A (en) * | 1968-10-01 | 1972-03-07 | Eastman Kodak Co | Photographic element, composition and process |
| US3649289A (en) * | 1968-10-21 | 1972-03-14 | Eastman Kodak Co | Photographic materials |
| US3653899A (en) * | 1968-11-12 | 1972-04-04 | Eastman Kodak Co | Photographic materials and processes |
| US3640717A (en) * | 1969-06-05 | 1972-02-08 | Itek Corp | Photographic reversal process employing organic mercaptan compounds |
| US3652279A (en) * | 1969-07-18 | 1972-03-28 | Du Pont | Nitrogen-containing dmax maintainers for use in photosoluble emulsions |
| US4014699A (en) * | 1973-05-17 | 1977-03-29 | Ciba-Geigy Ag | Preparation for the processing of photographic materials |
| GB1548395A (en) * | 1975-05-29 | 1979-07-11 | Eastman Kodak Co | Photographic materials |
| GB1580212A (en) * | 1976-03-29 | 1980-11-26 | Agfa Gevaert | Antifogging and/or stabilizing compounds for silver halide photography |
| JPS53134430A (en) * | 1977-04-27 | 1978-11-24 | Mitsubishi Paper Mills Ltd | Silver halide photosensitive materials for multiilayer color photograph |
| DE2931690A1 (de) * | 1979-08-04 | 1981-02-19 | Agfa Gevaert Ag | Photographische emulsion, verfahren zur herstellung sowie photographische materialien |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE473000C (de) * | 1926-05-21 | 1929-03-08 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von lichtempfindlichen Silbersalzemulsionen |
| US2843491A (en) * | 1956-05-23 | 1958-07-15 | Eastman Kodak Co | 2-mercapto-1, 3, 4-oxadiazoles as antifoggants |
Family Cites Families (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE548323C (de) * | 1929-02-25 | 1932-04-09 | Kodak Akt Ges | Verfahren zum Stabilisieren einer Silberhalogenemulsion |
| US2025876A (en) * | 1931-04-11 | 1935-12-31 | Du Pont | Preparation of aryl-amines |
| US2131038A (en) * | 1932-05-26 | 1938-09-27 | Eastman Kodak Co | Photographic emulsion containing alkyl quaternary salts of thiazoles and the like asantifoggants |
| GB477628A (en) * | 1936-08-14 | 1938-01-04 | Albert Steigmann | Method of preventing yellow stain in photographs |
| US2214446A (en) * | 1938-05-10 | 1940-09-10 | Gen Aniline & Film Corp | Photographic development of silver halide layers |
| US2195150A (en) * | 1938-06-16 | 1940-03-26 | Ilford Ltd | Stabilization of photographic emulsions |
| US2520358A (en) * | 1948-09-04 | 1950-08-29 | Eastman Kodak Co | Heterocyclic bis acetones, thioacetones, and selenoacetones |
| US2710256A (en) * | 1951-04-25 | 1955-06-07 | Gen Aniline & Film Corp | Photographic print-out process |
| BE511060A (show.php) * | 1951-04-30 | |||
| US2985661A (en) * | 1956-02-06 | 1961-05-23 | American Cyanamid Co | Preparation of 2(omicron-aminophenyl)-benzimidazole |
| BE555103A (show.php) * | 1956-02-18 | |||
| US3038800A (en) * | 1957-12-19 | 1962-06-12 | Eastman Kodak Co | Photopolymerization of olefinicallyunsaturated monomers by silver halides |
| BE582161A (show.php) * | 1958-08-29 | |||
| NL245101A (show.php) * | 1958-11-07 | |||
| BE602317A (show.php) * | 1960-04-11 | |||
| US3046130A (en) * | 1960-05-12 | 1962-07-24 | Gen Aniline & Film Corp | Photographic materials containing a chemical sensitizer |
| US3155518A (en) * | 1963-10-21 | 1964-11-03 | Du Pont | Silver halide compositions, layers and elements |
| FR89467E (show.php) * | 1961-12-08 |
-
0
- FR FR89467D patent/FR89467E/fr active Active
-
1962
- 1962-11-08 US US236412A patent/US3155514A/en not_active Expired - Lifetime
- 1962-11-08 US US236417A patent/US3155515A/en not_active Expired - Lifetime
- 1962-11-08 US US236420A patent/US3155507A/en not_active Expired - Lifetime
- 1962-11-08 US US236418A patent/US3155516A/en not_active Expired - Lifetime
- 1962-12-07 DE DEP30721A patent/DE1261397B/de active Pending
- 1962-12-07 GB GB46344/62A patent/GB1031902A/en not_active Expired
- 1962-12-07 DE DEP30723A patent/DE1226877B/de active Pending
- 1962-12-07 GB GB46345/62A patent/GB1031903A/en not_active Expired
-
1963
- 1963-10-21 US US317824A patent/US3155519A/en not_active Expired - Lifetime
-
1964
- 1964-08-11 US US388919A patent/US3418124A/en not_active Expired - Lifetime
- 1964-08-18 US US390460A patent/US3384485A/en not_active Expired - Lifetime
- 1964-10-13 US US403661A patent/US3284206A/en not_active Expired - Lifetime
-
1965
- 1965-08-10 DE DEP37430A patent/DE1294186B/de active Pending
- 1965-08-10 GB GB34231/65A patent/GB1111226A/en not_active Expired
- 1965-08-18 DE DEP37479A patent/DE1293581B/de active Pending
- 1965-10-12 BE BE670823D patent/BE670823A/xx unknown
- 1965-10-12 GB GB43289/65A patent/GB1124772A/en not_active Expired
- 1965-10-13 DE DEP37856A patent/DE1293582B/de active Pending
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE473000C (de) * | 1926-05-21 | 1929-03-08 | I G Farbenindustrie Akt Ges | Verfahren zur Herstellung von lichtempfindlichen Silbersalzemulsionen |
| US2843491A (en) * | 1956-05-23 | 1958-07-15 | Eastman Kodak Co | 2-mercapto-1, 3, 4-oxadiazoles as antifoggants |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1293582B (de) * | 1961-12-08 | 1969-04-24 | Du Pont | Photographische Silberhalogenidemulsion |
| DE1293581B (de) * | 1961-12-08 | 1969-04-24 | Du Pont | Photographische Silberhalogenidemulsion |
| DE1281842B (de) * | 1964-06-22 | 1968-10-31 | Du Pont | Fotografisches Aufzeichnungsmaterial mit einer fotoloeslichen Schicht |
| DE1296515B (de) * | 1964-10-13 | 1969-05-29 | Du Pont | Photographische Silberhalogenidemulsion |
| DE1296514B (de) * | 1964-10-13 | 1969-05-29 | Du Pont | Photographische Silberhalogenidemulsion |
Also Published As
| Publication number | Publication date |
|---|---|
| DE1261397B (de) | 1968-02-15 |
| DE1293582B (de) | 1969-04-24 |
| BE670823A (show.php) | 1966-04-12 |
| GB1031902A (en) | 1966-06-02 |
| US3155514A (en) | 1964-11-03 |
| US3155516A (en) | 1964-11-03 |
| US3155519A (en) | 1964-11-03 |
| DE1293581B (de) | 1969-04-24 |
| GB1031903A (en) | 1966-06-02 |
| US3155515A (en) | 1964-11-03 |
| GB1111226A (en) | 1968-04-24 |
| GB1124772A (en) | 1968-08-21 |
| US3155507A (en) | 1964-11-03 |
| US3384485A (en) | 1968-05-21 |
| US3418124A (en) | 1968-12-24 |
| DE1294186B (de) | 1969-09-11 |
| FR89467E (show.php) | |
| US3284206A (en) | 1966-11-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1226877B (de) | Photographische Silberhalogenidemulsion | |
| DE1255484B (de) | Lichtempfindliches photographisches Material mit mindestens einer lichtempfindlichen Silbersalzemulsionsschicht | |
| DE1547780B2 (de) | Verschleierte direktpositive photographische Silberhalogenidemulsion | |
| DE2422765A1 (de) | Photographische silberhalogenidemulsion | |
| DE1522405A1 (de) | Silberhalogenidemulsionen und solche Emulsionen enthaltendes photographisches Material | |
| DE2026252B2 (de) | Schnellverarbeitung von photographischem Material | |
| DE1170778B (de) | Silberhalogenid-Auskopieremulsion mit einem Gehalt an einem Schwermetallsalz | |
| DE1597541A1 (de) | Verwendung von Alkalisalzen mehrbasischer,mindestens eine Hydroxylgruppe aufweisender,organischer Saeuren als Oxydationsinhibitoren bei der Entwicklung photographischer Materialien | |
| DE3343360A1 (de) | Verfahren zur entwicklung eines photographischen lichtempflindlichen silberhalogenidmaterials und photographisches lichtempflindliches silberhalogenidmaterial | |
| DE2200504A1 (de) | Photographisches Aufzeichnungsmaterial | |
| DE1572125B2 (de) | Fotografisches Material für die Herstellung direktpositiver Bilder | |
| DE1447629A1 (de) | Photographisches Material | |
| DE1472757C3 (de) | Verfahren zur Herstellung photo graphischer Bilder | |
| DE1547735A1 (de) | Photographische Entwicklerloesung | |
| DE1772720A1 (de) | Photographisches Schnellentwicklungsverfahren | |
| DE2932650A1 (de) | Verfahren zur herstellung von monodispersen photographischen silberhalogenidemulsionen mit verbesserter empfindlichkeit | |
| DE1064807B (de) | Photographisches Silbersalz-Diffusionsuebertragungsverfahren | |
| EP0005200B1 (de) | Photographisches Silberhalogenidmaterial und Verfahren zur Herstellung | |
| DE1597540A1 (de) | Verwendung von Oniumhalogeniden als Silberhalogenidkomplexbildner zum Stabilisieren photographischer Silberhalogenidbilder | |
| DE2164275A1 (de) | Photographisches lichtempfindliches direktes Umkehrsilberhalogenidmaterial | |
| DE1235737B (de) | Verfahren zur Schleierverhuetung und Stabilisierung lichtempfindlicher Materialien mit mindestens einer Halogensilberemulsionsschicht und photographischer Halogensilberemulsionen sowie photographische Materialien hierfuer | |
| DE1547902A1 (de) | Lichtempfindliche photographische Zubereitung | |
| DE1296980B (de) | Verfahren zur Herstellung von negativen Bildern | |
| DE1291196B (de) | Lichtentwickelbare, direkt kopierende Silberhalogenidemulsion | |
| CH479898A (de) | Photographisches Verfahren |