DE1136990B - Verfahren zur Herstellung von metallbeladenen zeolithischen Molekularsieben - Google Patents
Verfahren zur Herstellung von metallbeladenen zeolithischen MolekularsiebenInfo
- Publication number
- DE1136990B DE1136990B DEU6507A DEU0006507A DE1136990B DE 1136990 B DE1136990 B DE 1136990B DE U6507 A DEU6507 A DE U6507A DE U0006507 A DEU0006507 A DE U0006507A DE 1136990 B DE1136990 B DE 1136990B
- Authority
- DE
- Germany
- Prior art keywords
- metal
- molecular sieves
- molecular sieve
- chromium
- cations
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 title claims description 52
- 239000002808 molecular sieve Substances 0.000 title claims description 48
- 229910052751 metal Inorganic materials 0.000 title claims description 36
- 239000002184 metal Substances 0.000 title claims description 36
- 238000000034 method Methods 0.000 title claims description 17
- 230000008569 process Effects 0.000 title claims description 8
- 238000002360 preparation method Methods 0.000 title description 2
- 150000001768 cations Chemical class 0.000 claims description 22
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 19
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 11
- 229910052804 chromium Inorganic materials 0.000 claims description 11
- 239000011651 chromium Substances 0.000 claims description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 8
- 229910052697 platinum Inorganic materials 0.000 claims description 8
- 150000001412 amines Chemical class 0.000 claims description 7
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 claims description 6
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 claims description 6
- 229910052737 gold Inorganic materials 0.000 claims description 6
- 239000010931 gold Substances 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 229910052707 ruthenium Inorganic materials 0.000 claims description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 4
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 claims description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims description 4
- 229910052793 cadmium Inorganic materials 0.000 claims description 4
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052802 copper Inorganic materials 0.000 claims description 4
- 239000010949 copper Substances 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 239000011133 lead Substances 0.000 claims description 4
- 229910052759 nickel Inorganic materials 0.000 claims description 4
- 229910052763 palladium Inorganic materials 0.000 claims description 4
- 229910052709 silver Inorganic materials 0.000 claims description 4
- 239000004332 silver Substances 0.000 claims description 4
- 239000011135 tin Substances 0.000 claims description 4
- 229910052718 tin Inorganic materials 0.000 claims description 4
- 229910052725 zinc Inorganic materials 0.000 claims description 4
- 239000011701 zinc Substances 0.000 claims description 4
- 229910052762 osmium Inorganic materials 0.000 claims description 3
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 claims description 3
- 229910052703 rhodium Inorganic materials 0.000 claims description 3
- 239000010948 rhodium Substances 0.000 claims description 3
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 2
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 2
- 230000003647 oxidation Effects 0.000 claims description 2
- 238000007254 oxidation reaction Methods 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- 239000010457 zeolite Substances 0.000 description 27
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 23
- 229910021536 Zeolite Inorganic materials 0.000 description 21
- 239000013078 crystal Substances 0.000 description 14
- 229910052708 sodium Inorganic materials 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- 239000003054 catalyst Substances 0.000 description 12
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 9
- -1 B. a metal ion Chemical class 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 8
- 150000002739 metals Chemical class 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 6
- 239000011148 porous material Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000007864 aqueous solution Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000001257 hydrogen Substances 0.000 description 5
- 229910052739 hydrogen Inorganic materials 0.000 description 5
- 239000000203 mixture Substances 0.000 description 5
- 238000006722 reduction reaction Methods 0.000 description 5
- 238000001179 sorption measurement Methods 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000012153 distilled water Substances 0.000 description 4
- 238000005342 ion exchange Methods 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 230000004913 activation Effects 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000006555 catalytic reaction Methods 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 230000009467 reduction Effects 0.000 description 3
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- WGLPBDUCMAPZCE-UHFFFAOYSA-N Trioxochromium Chemical compound O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 description 2
- 239000002156 adsorbate Substances 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910000323 aluminium silicate Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910000423 chromium oxide Inorganic materials 0.000 description 2
- AWSVSEFXGLCNMF-UHFFFAOYSA-H chromium(3+) ethane-1,2-diamine trisulfate Chemical compound S(=O)(=O)([O-])[O-].[Cr+3].C(CN)N.C(CN)N.C(CN)N.S(=O)(=O)([O-])[O-].S(=O)(=O)([O-])[O-].[Cr+3] AWSVSEFXGLCNMF-UHFFFAOYSA-H 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000012013 faujasite Substances 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- ACDVNLCTXBOVNW-UHFFFAOYSA-L platinum(2+);dichloride;hydrate Chemical compound O.Cl[Pt]Cl ACDVNLCTXBOVNW-UHFFFAOYSA-L 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 2
- 238000011282 treatment Methods 0.000 description 2
- ZYECOAILUNWEAL-NUDFZHEQSA-N (4z)-4-[[2-methoxy-5-(phenylcarbamoyl)phenyl]hydrazinylidene]-n-(3-nitrophenyl)-3-oxonaphthalene-2-carboxamide Chemical compound COC1=CC=C(C(=O)NC=2C=CC=CC=2)C=C1N\N=C(C1=CC=CC=C1C=1)/C(=O)C=1C(=O)NC1=CC=CC([N+]([O-])=O)=C1 ZYECOAILUNWEAL-NUDFZHEQSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229910004283 SiO 4 Inorganic materials 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 229910052786 argon Inorganic materials 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- UOUJSJZBMCDAEU-UHFFFAOYSA-N chromium(3+);oxygen(2-) Chemical class [O-2].[O-2].[O-2].[Cr+3].[Cr+3] UOUJSJZBMCDAEU-UHFFFAOYSA-N 0.000 description 1
- 239000012459 cleaning agent Substances 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 238000006356 dehydrogenation reaction Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 230000001627 detrimental effect Effects 0.000 description 1
- CGSVCNBINHWWFW-UHFFFAOYSA-M dimethyl-(2-phenoxyethyl)-(thiophen-2-ylmethyl)azanium;chloride Chemical compound [Cl-].C=1C=CSC=1C[N+](C)(C)CCOC1=CC=CC=C1 CGSVCNBINHWWFW-UHFFFAOYSA-M 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 230000036571 hydration Effects 0.000 description 1
- 238000006703 hydration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- GPRLSGONYQIRFK-UHFFFAOYSA-N hydron Chemical compound [H+] GPRLSGONYQIRFK-UHFFFAOYSA-N 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 230000003340 mental effect Effects 0.000 description 1
- 229910021645 metal ion Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- PIBWKRNGBLPSSY-UHFFFAOYSA-L palladium(II) chloride Chemical compound Cl[Pd]Cl PIBWKRNGBLPSSY-UHFFFAOYSA-L 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 238000006250 specific catalysis Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J29/00—Catalysts comprising molecular sieves
- B01J29/04—Catalysts comprising molecular sieves having base-exchange properties, e.g. crystalline zeolites
- B01J29/06—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof
- B01J29/061—Crystalline aluminosilicate zeolites; Isomorphous compounds thereof containing metallic elements added to the zeolite
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B01—PHYSICAL OR CHEMICAL PROCESSES OR APPARATUS IN GENERAL
- B01J—CHEMICAL OR PHYSICAL PROCESSES, e.g. CATALYSIS OR COLLOID CHEMISTRY; THEIR RELEVANT APPARATUS
- B01J20/00—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof
- B01J20/02—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof comprising inorganic material
- B01J20/10—Solid sorbent compositions or filter aid compositions; Sorbents for chromatography; Processes for preparing, regenerating or reactivating thereof comprising inorganic material comprising silica or silicate
- B01J20/16—Alumino-silicates
- B01J20/18—Synthetic zeolitic molecular sieves
- B01J20/186—Chemical treatments in view of modifying the properties of the sieve, e.g. increasing the stability or the activity, also decreasing the activity
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Inorganic Chemistry (AREA)
- Analytical Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Silicates, Zeolites, And Molecular Sieves (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US762952A US3200082A (en) | 1958-09-24 | 1958-09-24 | Metal loading of molecular sieves |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1136990B true DE1136990B (de) | 1962-09-27 |
Family
ID=25066490
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEU6507A Pending DE1136990B (de) | 1958-09-24 | 1959-09-18 | Verfahren zur Herstellung von metallbeladenen zeolithischen Molekularsieben |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3200082A (enExample) |
| AT (1) | AT244308B (enExample) |
| BE (1) | BE582198A (enExample) |
| CH (1) | CH410883A (enExample) |
| DE (1) | DE1136990B (enExample) |
| FR (1) | FR1243031A (enExample) |
| GB (1) | GB937748A (enExample) |
| NL (1) | NL243444A (enExample) |
| SE (1) | SE301959B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3242641A (en) * | 1962-10-24 | 1966-03-29 | Monsanto Co | Purification of polymerizable olefin hydrocarbons |
| DE1256824B (de) | 1960-11-29 | 1967-12-21 | Union Oil Co | Verfahren zum Hydrocracken von Kohlenwasserstoffen |
| DE1273513B (de) * | 1963-03-27 | 1968-07-25 | Union Carbide Corp | Verfahren zur Hydrospaltung von n-Pentan, n-Hexan, n-Heptan und n-Octan in Gegenwartvon Wasserstoff und Platin als Katalysator |
Families Citing this family (26)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3373109A (en) * | 1963-10-29 | 1968-03-12 | Mobil Oil Corp | Crystalline aluminosilicate catalyst |
| US3273314A (en) * | 1964-06-29 | 1966-09-20 | Dow Chemical Co | Removal of alkynes from gaseous streams with a silver carboxylate ion exchange resin |
| US3367885A (en) * | 1966-02-21 | 1968-02-06 | Union Carbide Corp | Hydrocarbon conversion catalysts |
| US3426511A (en) * | 1966-08-31 | 1969-02-11 | Westinghouse Electric Corp | Isolation trap |
| GB1482930A (en) * | 1974-05-21 | 1977-08-17 | Laporte Industries Ltd | Removing metal ions from solution |
| US4565793A (en) * | 1975-09-03 | 1986-01-21 | Exxon Research And Engineering Co. | Composite zeolitic magnetic material |
| IT1074824B (it) * | 1977-02-01 | 1985-04-20 | Snam Progetti | Metodo di preparazione di "clusters" metallo-carbonilici immobilizzati in zeoliti e loro impiego come catalizzatori eterogenei |
| US4294725A (en) * | 1979-11-20 | 1981-10-13 | University Of Delaware | Catalyst, method for catalyst manufacture and use |
| EP0040935B1 (en) * | 1980-05-23 | 1985-07-24 | Mitsubishi Jukogyo Kabushiki Kaisha | Oxygen adsorbent and process for the separation of oxygen and nitrogen using same |
| US4632911A (en) * | 1982-04-15 | 1986-12-30 | Mobil Oil Corporation | Shape-selective photoassisted heterogenous catalyst compositions |
| DE3222143A1 (de) * | 1982-06-11 | 1983-12-15 | Basf Ag, 6700 Ludwigshafen | Kobalt enthaltende traegerkatalysatoren, deren herstellung und verwendung |
| US4595668A (en) * | 1983-11-10 | 1986-06-17 | Exxon Research And Engineering Co. | Bound zeolite catalyst |
| US4595670A (en) * | 1983-11-10 | 1986-06-17 | Exxon Research And Engineering Co. | Zeolite catalyst |
| US4670412A (en) * | 1985-07-15 | 1987-06-02 | Mobil Oil Corporation | Modification of crystalline microporous zeolites |
| US4892567A (en) * | 1988-08-15 | 1990-01-09 | Mobil Oil Corporation | Simultaneous removal of mercury and water from fluids |
| US5013334A (en) * | 1990-01-09 | 1991-05-07 | Uop | Methane purification by pressure swing adsorption |
| US5171333A (en) * | 1990-01-09 | 1992-12-15 | Uop | Methane purification by pressure swing adsorption |
| US5167942A (en) * | 1990-11-21 | 1992-12-01 | Board Of Regents, The University Of Texas System | Methods for the preparation of molecular sieves, including zeolites, using metal chelate complexes |
| US5196621A (en) * | 1991-04-19 | 1993-03-23 | The Dow Chemical Company | Process for the cyclodimerization of 1,3-butadienes to 4-vinylcyclohexenes |
| US5329057A (en) * | 1991-04-19 | 1994-07-12 | The Dow Chemical Company | Process for the cyclodimerization of 1,3-butadienes to 4-vinylcyclohexenes |
| US5322628A (en) * | 1992-09-08 | 1994-06-21 | Mobil Oil Corporation | Method for simultaneously drying and removing metallic and organic mercury from fluids |
| US5550093A (en) * | 1995-06-14 | 1996-08-27 | National Science Council | Preparation of supported gold catalysts for carbon monoxide oxidation |
| US8232221B2 (en) * | 2006-07-14 | 2012-07-31 | Governors Of The University Of Alberta | Zeolite supported metallic nanodots |
| CA2625152A1 (en) | 2007-11-15 | 2009-05-15 | The Governors Of The University Of Alberta | Zeolite supported metallic nanodots |
| WO2012035004A2 (en) * | 2010-09-17 | 2012-03-22 | Shell Internationale Research Maatschappij B.V. | Hydrocracking catalyst composition |
| CN114588930B (zh) * | 2022-03-09 | 2023-07-21 | 华南理工大学 | 一种全硅ZSM-5分子筛负载Pd及其制备方法和应用 |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT72523B (de) * | 1914-03-26 | 1916-10-10 | Basf Ag | Ausführung katalytischer Verfahren. |
| CH136363A (fr) * | 1926-11-24 | 1929-11-15 | Selden Co | Procédé pour l'oxydation catalytique de composés organiques. |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1840450A (en) * | 1926-03-18 | 1932-01-12 | Selden Co | Zeolite product |
| US1920795A (en) * | 1929-09-16 | 1933-08-01 | Selden Co | Production of hydrocyanic acid |
| US2306610A (en) * | 1941-02-24 | 1942-12-29 | Barrer Richard Maling | Fractionation of mixtures of hydrocarbons |
| US2413134A (en) * | 1943-09-22 | 1946-12-24 | Barrer Richard Maling | Process for the manufacture of crystalline absorbents |
| US2617712A (en) * | 1949-06-18 | 1952-11-11 | Houdry Process Corp | Potassium zeolites |
| US2882243A (en) * | 1953-12-24 | 1959-04-14 | Union Carbide Corp | Molecular sieve adsorbents |
| US2882244A (en) * | 1953-12-24 | 1959-04-14 | Union Carbide Corp | Molecular sieve adsorbents |
-
0
- NL NL243444D patent/NL243444A/xx unknown
-
1958
- 1958-09-24 US US762952A patent/US3200082A/en not_active Expired - Lifetime
-
1959
- 1959-08-28 FR FR803832A patent/FR1243031A/fr not_active Expired
- 1959-08-31 CH CH7758259A patent/CH410883A/fr unknown
- 1959-08-31 BE BE582198D patent/BE582198A/xx unknown
- 1959-09-18 DE DEU6507A patent/DE1136990B/de active Pending
- 1959-09-21 AT AT21064A patent/AT244308B/de active
- 1959-09-22 SE SE8824/59A patent/SE301959B/xx unknown
- 1959-09-23 GB GB32329/59A patent/GB937748A/en not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AT72523B (de) * | 1914-03-26 | 1916-10-10 | Basf Ag | Ausführung katalytischer Verfahren. |
| CH136363A (fr) * | 1926-11-24 | 1929-11-15 | Selden Co | Procédé pour l'oxydation catalytique de composés organiques. |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1256824B (de) | 1960-11-29 | 1967-12-21 | Union Oil Co | Verfahren zum Hydrocracken von Kohlenwasserstoffen |
| US3242641A (en) * | 1962-10-24 | 1966-03-29 | Monsanto Co | Purification of polymerizable olefin hydrocarbons |
| DE1273513B (de) * | 1963-03-27 | 1968-07-25 | Union Carbide Corp | Verfahren zur Hydrospaltung von n-Pentan, n-Hexan, n-Heptan und n-Octan in Gegenwartvon Wasserstoff und Platin als Katalysator |
Also Published As
| Publication number | Publication date |
|---|---|
| BE582198A (enExample) | 1959-12-16 |
| GB937748A (en) | 1963-09-25 |
| SE301959B (enExample) | 1968-07-01 |
| US3200082A (en) | 1965-08-10 |
| CH410883A (fr) | 1966-04-15 |
| FR1243031A (fr) | 1960-10-07 |
| NL243444A (enExample) | |
| AT244308B (de) | 1965-12-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1136990B (de) | Verfahren zur Herstellung von metallbeladenen zeolithischen Molekularsieben | |
| DE1467175C3 (de) | Zeolithisches Molekularsieb | |
| DE1184743B (de) | Verfahren zur Herstellung von dekationisierten zeolithischen Aluminosilicaten | |
| DE1767464C3 (de) | Kristallines zeolithisches Molekularsieb vom Typ Zeolith X | |
| DE1542194C3 (de) | Verfahren zur Herstellung eines nicht-kristallinen Kieselsäure Tonerde-Crackkatalysators | |
| DE1277223B (de) | Verfahren zur Herstellung von kristallinen Zeolithen | |
| DE1273494B (de) | Verfahren zur Verbesserung der katalytischen Aktivitaet von kristallinen Aluminosilikat-Katalysatoren | |
| DE3215069A1 (de) | Synthetische, kristalline metallsilikat- und -borsilikat-zusammensetzung und ihre herstellung | |
| AT233527B (de) | Verfahren zur Herstellung von zeolithischen Molekularsieben | |
| DE2609680C3 (de) | Verfahren zur Herstellung von Acenaphthengemischen | |
| DE2854879A1 (de) | Katalysator zur entalkylierung von aromatischen kohlenwasserstoffen mit wasser | |
| DE1297792B (de) | Verfahren zum katalytischen Kracken eines Kohlenwasserstoffoels | |
| DE1302402C2 (de) | Entwaessertes synthetisches zeolithisches molekularsieb | |
| DE1467176C3 (de) | Synthetisches zeolithisches Molekularsieb | |
| AT281243B (de) | Dreidimensionales, kristallines zeolithisches Molekularsieb zum Veredeln von Kohlenwasserstoffen | |
| DE1417723C (de) | Verfahren zur Herstellung eines Katalysators auf der Basis eines kristallinen Aluminosilicatzeolithe!! | |
| AT257790B (de) | Verfahren zur Reformierung von Kohlenwasserstoffmischungen | |
| DE957588C (de) | Verfahren zur Herstellung eines Kohlenwasserstoff- Umwandlungskatalysators | |
| DE1295533B (de) | Verfahren zur Herstellung von synthetischen y-Zeolithen | |
| DE1145152B (de) | Verfahren zur Herstellung von metallbeladenen zeolithischen Molekularsieben | |
| AT250308B (de) | Entwässertes metallhältiges zeolithisches Molekularsieb | |
| DE2307389C3 (de) | Verfahren zur Herstellung von Kohlenwasserstoffumwandlungskatalysatoren | |
| DE1467182C (de) | Kristallines zeohthisches de kationisiertes Metallalumimumsilikat Molekularsieb und Verfahren zu seiner Herstellung Ausscheidung aus 1443183 | |
| DE1467180C (de) | Entwässertes synthetisches zeolithisches Molekularsieb. Änm: Union Carbide Corp., New York, N. Y. (V.StA.) | |
| AT287156B (de) | Dreidimensionales, kristallines, zeolithisches molekularsieb zum veredeln von kohlenwasserstoffen |