DE1004617B - Verfahren zur Herstellung von basischen Derivaten von 2-Arylindolen - Google Patents
Verfahren zur Herstellung von basischen Derivaten von 2-ArylindolenInfo
- Publication number
- DE1004617B DE1004617B DEG14408A DEG0014408A DE1004617B DE 1004617 B DE1004617 B DE 1004617B DE G14408 A DEG14408 A DE G14408A DE G0014408 A DEG0014408 A DE G0014408A DE 1004617 B DE1004617 B DE 1004617B
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- phenyl
- imidazolinyl
- general formula
- molecular weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 3
- 150000001875 compounds Chemical class 0.000 claims description 17
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 8
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical group 0.000 claims description 6
- 239000001257 hydrogen Substances 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 6
- -1 alkali metal salt Chemical class 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 229910052783 alkali metal Inorganic materials 0.000 claims description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 2
- 230000007717 exclusion Effects 0.000 claims description 2
- 239000000155 melt Substances 0.000 claims description 2
- 230000004048 modification Effects 0.000 claims description 2
- 238000012986 modification Methods 0.000 claims description 2
- 239000001301 oxygen Substances 0.000 claims description 2
- 229910052760 oxygen Inorganic materials 0.000 claims description 2
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 claims description 2
- 241000251730 Chondrichthyes Species 0.000 claims 1
- 125000005843 halogen group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 12
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 5
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 5
- 239000000243 solution Substances 0.000 description 5
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 238000000354 decomposition reaction Methods 0.000 description 4
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- UFQDKRWQSFLPQY-UHFFFAOYSA-N 4,5-dihydro-1h-imidazol-3-ium;chloride Chemical compound Cl.C1CN=CN1 UFQDKRWQSFLPQY-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Chemical group OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 125000002636 imidazolinyl group Chemical group 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- VQRBXYBBGHOGFT-UHFFFAOYSA-N 1-(chloromethyl)-2-methylbenzene Chemical compound CC1=CC=CC=C1CCl VQRBXYBBGHOGFT-UHFFFAOYSA-N 0.000 description 1
- FFMBYMANYCDCMK-UHFFFAOYSA-N 2,5-dihydro-1h-imidazole Chemical compound C1NCN=C1 FFMBYMANYCDCMK-UHFFFAOYSA-N 0.000 description 1
- YBUJBAYMXKVSSM-UHFFFAOYSA-N 2-(3-methoxyphenyl)-2,3-dihydro-1h-indole Chemical compound COC1=CC=CC(C2NC3=CC=CC=C3C2)=C1 YBUJBAYMXKVSSM-UHFFFAOYSA-N 0.000 description 1
- GHCCHMFFNHOXEU-UHFFFAOYSA-N 2-(chloromethyl)-4,5-dihydro-1H-imidazole hydrochloride Chemical compound Cl.ClCC1=NCCN1 GHCCHMFFNHOXEU-UHFFFAOYSA-N 0.000 description 1
- XSAYZAUNJMRRIR-UHFFFAOYSA-N 2-acetylnaphthalene Chemical compound C1=CC=CC2=CC(C(=O)C)=CC=C21 XSAYZAUNJMRRIR-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 1
- KLLLJCACIRKBDT-UHFFFAOYSA-N 2-phenyl-1H-indole Chemical compound N1C2=CC=CC=C2C=C1C1=CC=CC=C1 KLLLJCACIRKBDT-UHFFFAOYSA-N 0.000 description 1
- XZPFOJPRFUSEIH-UHFFFAOYSA-N 2-phenyl-2,3-dihydro-1h-indole Chemical compound N1C2=CC=CC=C2CC1C1=CC=CC=C1 XZPFOJPRFUSEIH-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- KTVVBUZEEYTRHU-UHFFFAOYSA-N 3-methyl-4,5-dihydro-1h-imidazol-3-ium;chloride Chemical compound [Cl-].C[N+]1=CNCC1 KTVVBUZEEYTRHU-UHFFFAOYSA-N 0.000 description 1
- MYTGFBZJLDLWQG-UHFFFAOYSA-N 5-chloro-1h-indole Chemical compound ClC1=CC=C2NC=CC2=C1 MYTGFBZJLDLWQG-UHFFFAOYSA-N 0.000 description 1
- YMCIVAPEOZDEGH-UHFFFAOYSA-N 5-chloro-2,3-dihydro-1h-indole Chemical compound ClC1=CC=C2NCCC2=C1 YMCIVAPEOZDEGH-UHFFFAOYSA-N 0.000 description 1
- KOHJTHKYURIHGN-UHFFFAOYSA-N 5-chloro-2-(4-chlorophenyl)-1h-indole Chemical compound C1=CC(Cl)=CC=C1C1=CC2=CC(Cl)=CC=C2N1 KOHJTHKYURIHGN-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 208000003098 Ganglion Cysts Diseases 0.000 description 1
- 206010020772 Hypertension Diseases 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- 208000005400 Synovial Cyst Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000006286 aqueous extract Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 1
- FFSAXUULYPJSKH-UHFFFAOYSA-N butyrophenone Chemical compound CCCC(=O)C1=CC=CC=C1 FFSAXUULYPJSKH-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid group Chemical group C(CC(O)(C(=O)O)CC(=O)O)(=O)O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- AFAXGSQYZLGZPG-UHFFFAOYSA-N ethanedisulfonic acid Chemical compound OS(=O)(=O)CCS(O)(=O)=O AFAXGSQYZLGZPG-UHFFFAOYSA-N 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 208000031169 hemorrhagic disease Diseases 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000001631 hypertensive effect Effects 0.000 description 1
- 150000002462 imidazolines Chemical class 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- SIAPCJWMELPYOE-UHFFFAOYSA-N lithium hydride Chemical compound [LiH] SIAPCJWMELPYOE-UHFFFAOYSA-N 0.000 description 1
- 229910000103 lithium hydride Inorganic materials 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 229940083254 peripheral vasodilators imidazoline derivative Drugs 0.000 description 1
- WCNLCIJMFAJCPX-UHFFFAOYSA-N pethidine hydrochloride Chemical compound Cl.C=1C=CC=CC=1C1(C(=O)OCC)CCN(C)CC1 WCNLCIJMFAJCPX-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 238000004659 sterilization and disinfection Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 230000000304 vasodilatating effect Effects 0.000 description 1
- 239000000052 vinegar Substances 0.000 description 1
- 235000021419 vinegar Nutrition 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K31/00—Medicinal preparations containing organic active ingredients
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Epidemiology (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Indole Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (3)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH753919X | 1953-05-13 | ||
| US42910254A | 1954-05-11 | 1954-05-11 | |
| US576513A US2808413A (en) | 1953-05-13 | 1956-03-20 | Imidazoline derivatives of 2-aryl indolines |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1004617B true DE1004617B (de) | 1957-03-21 |
Family
ID=32329396
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEG14408A Pending DE1004617B (de) | 1953-05-13 | 1954-05-12 | Verfahren zur Herstellung von basischen Derivaten von 2-Arylindolen |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US2808413A (enExample) |
| BE (1) | BE528814A (enExample) |
| CH (2) | CH319060A (enExample) |
| DE (1) | DE1004617B (enExample) |
| FR (1) | FR1167012A (enExample) |
| GB (1) | GB753919A (enExample) |
| NL (1) | NL90166C (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0106243A1 (de) * | 1982-10-13 | 1984-04-25 | Bayer Ag | Azolyl-methylamine, ihre Herstellung und Verwendung in mikrobiziden Mitteln |
| WO2007054453A3 (en) * | 2005-11-11 | 2007-07-19 | Hoffmann La Roche | Carbocyclic fused cyclic amines as inhibitors of the coagulation factor xa |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL90166C (enExample) * | 1953-05-13 | |||
| US3043849A (en) * | 1959-04-20 | 1962-07-10 | Upjohn Co | 3-(3-substituted amino-1-propenyl) indoles |
| NL263867A (enExample) * | 1960-04-22 | |||
| NL301813A (enExample) * | 1962-12-14 | 1900-01-01 | ||
| US3404156A (en) * | 1966-02-23 | 1968-10-01 | Sterling Drug Inc | Imidazolin-2-yl-alkyl-substituted indoles |
| US3478208A (en) * | 1967-01-04 | 1969-11-11 | Atomic Energy Commission | 2-aryl indoles and methods for their use |
| US3377247A (en) * | 1967-04-28 | 1968-04-09 | Dow Chemical Co | Antidepressant method |
| BE755270A (fr) * | 1969-08-27 | 1971-02-25 | Sandoz Sa | Nouveaux derives du benzo(cd)indole, leur preparation et medicaments contenant ces derives |
| EP0135105B1 (de) * | 1983-08-09 | 1988-08-10 | Ciba-Geigy Ag | Mittel zur Bekämpfung von Insekten und Vertretern der Ordnung Akarina, welche als aktive Komponente 2-(1-Indolinyl-methyl)-imidazoline oder deren Salzen enthalten |
| GB9022858D0 (en) * | 1990-10-20 | 1990-12-05 | Reckitt & Colmann Prod Ltd | Derivatives of indoles |
| US6410562B1 (en) | 1998-12-18 | 2002-06-25 | Eli Lilly And Company | Hypoglycemic imidazoline compounds |
| US20040009976A1 (en) * | 2002-04-30 | 2004-01-15 | Kumiko Takeuchi | Hypoglycemic imidazoline compounds |
| CN115322131B (zh) * | 2022-04-21 | 2023-08-22 | 温州大学 | β-氟代吲哚丙烯酰胺化合物的合成方法 |
Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE833652C (de) * | 1947-12-24 | 1952-03-10 | Ciba A G | Verfahren zur Herstellung neuer Imidazoline |
| DE842062B (de) | 1948-12-25 | 1952-05-08 | Ciba Aktiengesellschaft, Basel (Schweiz) | Verfahren zur Herstellung von 2 - (N, N - Diphenylaminomethyl) - imidazolinen |
| CH283320A (de) * | 1947-01-31 | 1952-05-31 | Ciba Geigy | Verfahren zur Herstellung eines neuen Imidazolins. |
| DE842943C (de) * | 1947-02-14 | 1952-07-03 | Ciba Geigy | Verfahren zur Herstellung neuer Imidazoline |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2505247A (en) * | 1950-04-25 | Process fob the preparation of | ||
| GB377255A (en) * | 1931-04-14 | 1932-07-14 | Wilfred William Groves | Manufacture of therapeutically active compounds |
| GB608295A (en) * | 1945-06-06 | 1948-09-13 | Ciba Ltd | Manufacture of imidazolines |
| NL90166C (enExample) * | 1953-05-13 |
-
0
- NL NL90166D patent/NL90166C/xx active
- US US2751393D patent/US2751393A/en not_active Expired - Lifetime
- BE BE528814D patent/BE528814A/xx unknown
-
1953
- 1953-05-13 CH CH319060D patent/CH319060A/de unknown
- 1953-12-17 CH CH324080D patent/CH324080A/de unknown
-
1954
- 1954-05-11 GB GB13708/54A patent/GB753919A/en not_active Expired
- 1954-05-12 DE DEG14408A patent/DE1004617B/de active Pending
- 1954-05-12 FR FR1167012D patent/FR1167012A/fr not_active Expired
-
1956
- 1956-03-20 US US576513A patent/US2808413A/en not_active Expired - Lifetime
Patent Citations (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH283320A (de) * | 1947-01-31 | 1952-05-31 | Ciba Geigy | Verfahren zur Herstellung eines neuen Imidazolins. |
| DE842943C (de) * | 1947-02-14 | 1952-07-03 | Ciba Geigy | Verfahren zur Herstellung neuer Imidazoline |
| DE833652C (de) * | 1947-12-24 | 1952-03-10 | Ciba A G | Verfahren zur Herstellung neuer Imidazoline |
| DE842062B (de) | 1948-12-25 | 1952-05-08 | Ciba Aktiengesellschaft, Basel (Schweiz) | Verfahren zur Herstellung von 2 - (N, N - Diphenylaminomethyl) - imidazolinen |
Non-Patent Citations (2)
| Title |
|---|
| deutsche Patentschrift 842 062 |
| deutsche Patentschrift 842 943 |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0106243A1 (de) * | 1982-10-13 | 1984-04-25 | Bayer Ag | Azolyl-methylamine, ihre Herstellung und Verwendung in mikrobiziden Mitteln |
| US4599427A (en) * | 1982-10-13 | 1986-07-08 | Bayer Aktiengesellschaft | Microbicidal azolylmethylamines |
| WO2007054453A3 (en) * | 2005-11-11 | 2007-07-19 | Hoffmann La Roche | Carbocyclic fused cyclic amines as inhibitors of the coagulation factor xa |
Also Published As
| Publication number | Publication date |
|---|---|
| CH319060A (de) | 1957-01-31 |
| FR1167012A (fr) | 1958-11-19 |
| NL90166C (enExample) | |
| BE528814A (enExample) | |
| CH324080A (de) | 1957-08-31 |
| US2808413A (en) | 1957-10-01 |
| GB753919A (en) | 1956-08-01 |
| US2751393A (en) | 1956-06-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1004617B (de) | Verfahren zur Herstellung von basischen Derivaten von 2-Arylindolen | |
| DE1146057B (de) | Verfahren zur Herstellung von 5-Hydroxy-ª-methyltryptophanen und deren Salzen | |
| DE1963182A1 (de) | Neue N-Phenylindolin-Derivate und deren Verwendung als Arzneimittel | |
| DE2230426A1 (de) | Verfahren zur herstellung neuer heterocyclischer verbindungen | |
| CH623307A5 (enExample) | ||
| CH472404A (de) | Verfahren zur Herstellung neuer Indolderivate | |
| CH455822A (de) | Verfahren zur Herstellung von Triarylalkanderivaten | |
| DE828550C (de) | Verfahren zur Herstellung von neuen quartaeren Salzen der vom Anilin abgeleiteten AEther | |
| DE971002C (de) | Verfahren zur Herstellung von Thioxanthonen | |
| AT235280B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| DE1248053B (de) | Verfahren zur Herstellung von Indolyl-(3)-aminoaethylketonen | |
| DE953800C (de) | Verfahren zur Herstellung neuer Pyridazone | |
| AT237601B (de) | Verfahren zur Herstellung von 2-Phenyläthylaminderivaten | |
| AT235284B (de) | Verfahren zur Herstellung neuer Indolderivate | |
| DE2200204A1 (de) | Verfahren zur Herstellung neuer heterozyklischer Verbindungen | |
| CH615422A5 (enExample) | ||
| AT303025B (de) | Verfahren zur herstellung neuer indolderivate und ihrer saeureadditionssalze | |
| AT236954B (de) | Verfahren zur Herstellung von Chinolizinderivaten | |
| AT206439B (de) | Verfahren zur Herstellung von neuen, racemischen oder optisch aktiven Piperidyl-(2)-arylmethanoläthern | |
| AT300763B (de) | Verfahren zur Herstellung von neuen 5-(1'-Hydroxy-2'-arylalkyl-oder -aryloxyalkylaminoäthyl)-salicylamiden und deren Säureadditionssalzen | |
| DE1620090C (de) | Verfahren zur Herstellung von Imidazo hdinonderivaten und ihren Salzen | |
| DE1620090B1 (de) | Verfahren zur Herstellung von Imidazolidinonderivaten und ihren Salzen | |
| AT252233B (de) | Verfahren zur Herstellung von neuen basisch substituierten Pseudoindolen | |
| DD207544A1 (de) | Verfahren zur herstellung neuer benzimidazol-derivate | |
| CH387634A (de) | Verfahren zur Herstellung neuer basischer Indol-Derivate |