CH644573A5 - Verfahren zur herstellung eines bindemittels fuer die verwendung in dick- bzw. rohschlamm, moertel und beton mit einem niedrigen wasser/zement-gewichtsverhaeltnis. - Google Patents
Verfahren zur herstellung eines bindemittels fuer die verwendung in dick- bzw. rohschlamm, moertel und beton mit einem niedrigen wasser/zement-gewichtsverhaeltnis. Download PDFInfo
- Publication number
- CH644573A5 CH644573A5 CH424180A CH424180A CH644573A5 CH 644573 A5 CH644573 A5 CH 644573A5 CH 424180 A CH424180 A CH 424180A CH 424180 A CH424180 A CH 424180A CH 644573 A5 CH644573 A5 CH 644573A5
- Authority
- CH
- Switzerland
- Prior art keywords
- concrete
- slag
- binder
- cement
- added
- Prior art date
Links
- 239000004567 concrete Substances 0.000 title claims description 47
- 239000011230 binding agent Substances 0.000 title claims description 45
- 239000004568 cement Substances 0.000 title claims description 43
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 title claims description 19
- 239000004570 mortar (masonry) Substances 0.000 title claims description 5
- 239000010802 sludge Substances 0.000 title claims description 3
- 238000004519 manufacturing process Methods 0.000 title description 4
- 239000002893 slag Substances 0.000 claims description 53
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 51
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 21
- 238000000034 method Methods 0.000 claims description 17
- 238000000227 grinding Methods 0.000 claims description 16
- 239000000654 additive Substances 0.000 claims description 9
- 159000000011 group IA salts Chemical class 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 7
- 239000004014 plasticizer Substances 0.000 claims description 7
- 229920000867 polyelectrolyte Polymers 0.000 claims description 6
- 239000002994 raw material Substances 0.000 claims description 6
- 229910000288 alkali metal carbonate Inorganic materials 0.000 claims description 3
- 150000008041 alkali metal carbonates Chemical class 0.000 claims description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims 1
- 238000002360 preparation method Methods 0.000 claims 1
- 238000006703 hydration reaction Methods 0.000 description 15
- 230000036571 hydration Effects 0.000 description 14
- 229920001732 Lignosulfonate Polymers 0.000 description 12
- 239000003795 chemical substances by application Substances 0.000 description 11
- 239000010881 fly ash Substances 0.000 description 10
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 9
- 235000011941 Tilia x europaea Nutrition 0.000 description 9
- 239000003513 alkali Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 9
- 239000004571 lime Substances 0.000 description 9
- 239000000203 mixture Substances 0.000 description 8
- 238000001723 curing Methods 0.000 description 7
- 239000011398 Portland cement Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- STCOOQWBFONSKY-UHFFFAOYSA-N tributyl phosphate Chemical compound CCCCOP(=O)(OCCCC)OCCCC STCOOQWBFONSKY-UHFFFAOYSA-N 0.000 description 6
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 5
- 239000000920 calcium hydroxide Substances 0.000 description 5
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 5
- 235000011116 calcium hydroxide Nutrition 0.000 description 5
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 4
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 4
- 238000005260 corrosion Methods 0.000 description 4
- 230000002349 favourable effect Effects 0.000 description 4
- 238000013007 heat curing Methods 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000012190 activator Substances 0.000 description 3
- 229920005610 lignin Polymers 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000001133 acceleration Effects 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- -1 anhydrite and gypsum Chemical class 0.000 description 2
- 239000006227 byproduct Substances 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 239000003623 enhancer Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 150000004679 hydroxides Chemical class 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 235000019357 lignosulphonate Nutrition 0.000 description 2
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 230000009257 reactivity Effects 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 2
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 2
- 239000002699 waste material Substances 0.000 description 2
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- 229910000805 Pig iron Inorganic materials 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229910052925 anhydrite Inorganic materials 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 230000002301 combined effect Effects 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000005056 compaction Methods 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- CBYZIWCZNMOEAV-UHFFFAOYSA-N formaldehyde;naphthalene Chemical compound O=C.C1=CC=CC2=CC=CC=C21 CBYZIWCZNMOEAV-UHFFFAOYSA-N 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229910052602 gypsum Inorganic materials 0.000 description 1
- 239000010440 gypsum Substances 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 description 1
- 229920005611 kraft lignin Polymers 0.000 description 1
- 229910052808 lithium carbonate Inorganic materials 0.000 description 1
- 230000035800 maturation Effects 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003415 peat Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 239000011505 plaster Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000011178 precast concrete Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B7/00—Hydraulic cements
- C04B7/12—Natural pozzuolanas; Natural pozzuolana cements; Artificial pozzuolanas or artificial pozzuolana cements other than those obtained from waste or combustion residues, e.g. burned clay; Treating inorganic materials to improve their pozzuolanic characteristics
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B28/00—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements
- C04B28/02—Compositions of mortars, concrete or artificial stone, containing inorganic binders or the reaction product of an inorganic and an organic binder, e.g. polycarboxylate cements containing hydraulic cements other than calcium sulfates
- C04B28/08—Slag cements
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B7/00—Hydraulic cements
- C04B7/12—Natural pozzuolanas; Natural pozzuolana cements; Artificial pozzuolanas or artificial pozzuolana cements other than those obtained from waste or combustion residues, e.g. burned clay; Treating inorganic materials to improve their pozzuolanic characteristics
- C04B7/13—Mixtures thereof with inorganic cementitious materials, e.g. Portland cements
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B7/00—Hydraulic cements
- C04B7/14—Cements containing slag
- C04B7/147—Metallurgical slag
- C04B7/153—Mixtures thereof with other inorganic cementitious materials or other activators
- C04B7/1535—Mixtures thereof with other inorganic cementitious materials or other activators with alkali metal containing activators, e.g. sodium hydroxide or waterglass
-
- C—CHEMISTRY; METALLURGY
- C04—CEMENTS; CONCRETE; ARTIFICIAL STONE; CERAMICS; REFRACTORIES
- C04B—LIME, MAGNESIA; SLAG; CEMENTS; COMPOSITIONS THEREOF, e.g. MORTARS, CONCRETE OR LIKE BUILDING MATERIALS; ARTIFICIAL STONE; CERAMICS; REFRACTORIES; TREATMENT OF NATURAL STONE
- C04B7/00—Hydraulic cements
- C04B7/14—Cements containing slag
- C04B7/147—Metallurgical slag
- C04B7/153—Mixtures thereof with other inorganic cementitious materials or other activators
- C04B7/17—Mixtures thereof with other inorganic cementitious materials or other activators with calcium oxide containing activators
- C04B7/19—Portland cements
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02P—CLIMATE CHANGE MITIGATION TECHNOLOGIES IN THE PRODUCTION OR PROCESSING OF GOODS
- Y02P40/00—Technologies relating to the processing of minerals
- Y02P40/10—Production of cement, e.g. improving or optimising the production methods; Cement grinding
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y02—TECHNOLOGIES OR APPLICATIONS FOR MITIGATION OR ADAPTATION AGAINST CLIMATE CHANGE
- Y02W—CLIMATE CHANGE MITIGATION TECHNOLOGIES RELATED TO WASTEWATER TREATMENT OR WASTE MANAGEMENT
- Y02W30/00—Technologies for solid waste management
- Y02W30/50—Reuse, recycling or recovery technologies
- Y02W30/91—Use of waste materials as fillers for mortars or concrete
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Ceramic Engineering (AREA)
- Structural Engineering (AREA)
- Materials Engineering (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Combustion & Propulsion (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Curing Cements, Concrete, And Artificial Stone (AREA)
- Adhesives Or Adhesive Processes (AREA)
- Soil Conditioners And Soil-Stabilizing Materials (AREA)
- Processing Of Solid Wastes (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI791747A FI65984B (fi) | 1979-05-31 | 1979-05-31 | Foerfarande foer framstaellning av ett laempligt bindemedel for laettflytande betong |
| FI793452A FI65770B (fi) | 1979-11-05 | 1979-11-05 | Foerfarande foer framstaellning av bindemedel foer betongframstaellning |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH644573A5 true CH644573A5 (de) | 1984-08-15 |
Family
ID=26157044
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH424180A CH644573A5 (de) | 1979-05-31 | 1980-05-30 | Verfahren zur herstellung eines bindemittels fuer die verwendung in dick- bzw. rohschlamm, moertel und beton mit einem niedrigen wasser/zement-gewichtsverhaeltnis. |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US4306912A (enEXAMPLES) |
| AR (1) | AR220055A1 (enEXAMPLES) |
| AT (1) | AT392637B (enEXAMPLES) |
| AU (1) | AU537598B2 (enEXAMPLES) |
| BR (1) | BR8003407A (enEXAMPLES) |
| CA (1) | CA1150327A (enEXAMPLES) |
| CH (1) | CH644573A5 (enEXAMPLES) |
| CS (1) | CS259505B2 (enEXAMPLES) |
| DD (1) | DD151150A5 (enEXAMPLES) |
| DE (1) | DE3020384C2 (enEXAMPLES) |
| DK (1) | DK155185C (enEXAMPLES) |
| ES (1) | ES8103717A1 (enEXAMPLES) |
| FR (1) | FR2457845B1 (enEXAMPLES) |
| GB (1) | GB2051031B (enEXAMPLES) |
| GR (1) | GR68405B (enEXAMPLES) |
| IN (1) | IN152973B (enEXAMPLES) |
| IT (1) | IT1174776B (enEXAMPLES) |
| MX (1) | MX154208A (enEXAMPLES) |
| NL (1) | NL8003179A (enEXAMPLES) |
| NO (1) | NO150676C (enEXAMPLES) |
| PL (1) | PL126493B1 (enEXAMPLES) |
| RO (1) | RO84532B (enEXAMPLES) |
| SE (1) | SE447097B (enEXAMPLES) |
Families Citing this family (112)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57100968A (en) * | 1980-12-16 | 1982-06-23 | Denki Kagaku Kogyo Kk | Manufacture of formed body using steel slag as bonding material |
| US4410365A (en) * | 1981-08-28 | 1983-10-18 | Glukhovsky Viktor D | Binder |
| AU572111B2 (en) * | 1983-01-21 | 1988-05-05 | A.V. Syntec Pty. Ltd. | Modifiers for cementitious materials |
| FR2570071A1 (fr) * | 1984-09-07 | 1986-03-14 | Schlumberger Cie Dowell | Compositions pour lutter contre le filtrat des laitiers de ciment utilises pour la cimentation de puits |
| ATE42533T1 (de) * | 1984-10-27 | 1989-05-15 | Huels Chemische Werke Ag | Spritzbeton. |
| US4842649A (en) * | 1987-10-02 | 1989-06-27 | Pyrament, Inc. | Cement composition curable at low temperatures |
| US4997484A (en) * | 1987-12-11 | 1991-03-05 | Lone Star Industries, Inc. | Hydraulic cement and composition employing the same |
| AU615501B2 (en) * | 1987-12-11 | 1991-10-03 | Lone Star Industries, Inc. | Hydraulic cement and composition employing the same |
| US4897119A (en) * | 1988-01-11 | 1990-01-30 | Geochemical Corporation | Aqueous dispersion of ground slag |
| US5106423A (en) * | 1988-12-02 | 1992-04-21 | Geochemical Corporation | Formation grouting method and composition useful therefor |
| CA2006579A1 (en) * | 1988-12-23 | 1990-06-23 | Servalius J. P. Brouns | Cement, method of preparing such cement and method of making products using such cement |
| US4868039B1 (en) * | 1988-12-29 | 2000-04-25 | Caribank | Structural panel incorporating glay grog and vermiculite and method for making said panel |
| FI88284C (fi) * | 1989-10-26 | 1993-04-26 | Partek Sementti Oy | Foerfarande foer framstaellning av ett aktivt finmaterial avsett foer framstaellning av betong |
| JP2668598B2 (ja) * | 1989-12-08 | 1997-10-27 | 日本化薬株式会社 | 水硬性組成物及び高強度複合材料 |
| US5121795A (en) * | 1991-01-08 | 1992-06-16 | Halliburton Company | Squeeze cementing |
| US5127473A (en) * | 1991-01-08 | 1992-07-07 | Halliburton Services | Repair of microannuli and cement sheath |
| US5086850A (en) * | 1991-01-08 | 1992-02-11 | Halliburton Company | Well bore drilling direction changing method |
| US5238064A (en) * | 1991-01-08 | 1993-08-24 | Halliburton Company | Squeeze cementing |
| US5125455A (en) * | 1991-01-08 | 1992-06-30 | Halliburton Services | Primary cementing |
| US5123487A (en) * | 1991-01-08 | 1992-06-23 | Halliburton Services | Repairing leaks in casings |
| US5536310A (en) * | 1991-11-27 | 1996-07-16 | Sandoz Ltd. | Cementitious compositions containing fly ash |
| US5556458A (en) * | 1991-11-27 | 1996-09-17 | Sandoz Ltd. | Cementitious compositions |
| FR2694552B1 (fr) * | 1992-08-05 | 1994-10-28 | Vicat | Liants hydrauliques à prise et durcissement rapides, leur préparation et leur utilisation pour la préparation de mortiers et bétons. |
| US5478391A (en) * | 1993-03-26 | 1995-12-26 | Cement Technology Corporation | Cementitious materials and method of making the same |
| US5366547A (en) * | 1993-05-24 | 1994-11-22 | U.S. Army Corps Of Engineers As Represented By The Secretary Of The Army | Setting control for alkali-activated silicate binders |
| US5374308A (en) * | 1993-05-27 | 1994-12-20 | Kirkpatrick; William D. | Blended hydraulic cement for both general and special applications |
| US5352288A (en) * | 1993-06-07 | 1994-10-04 | Dynastone Lc | Low-cost, high early strength, acid-resistant pozzolanic cement |
| US5578122A (en) * | 1994-02-14 | 1996-11-26 | The University Of Texas System | Methods of producing concretes containing class C fly ash that are stable in sulphate environments |
| US5554352A (en) * | 1995-05-09 | 1996-09-10 | Construction Material Resources | Processed silica as a natural pozzolan for use as a cementitious component in concrete and concrete products |
| US5531824A (en) * | 1995-05-25 | 1996-07-02 | Burkes; J. Pate | Method of increasing density and strength of highly siliceous cement-based materials |
| US6033467A (en) * | 1995-06-26 | 2000-03-07 | Fenicem Minerals Inc. | Method of making cement or mine backfill from base metal smelter slag |
| US5593493A (en) * | 1995-06-26 | 1997-01-14 | Krofchak; David | Method of making concrete from base metal smelter slag |
| US5605570A (en) * | 1995-07-20 | 1997-02-25 | U.S. Army Corps Of Engineers As Represented By The Secretary Of The Army | Alkali-activated glassy silicate foamed concrete |
| CA2240291C (en) * | 1995-12-13 | 2004-10-26 | Geo Specialty Chemicals, Inc. | Method of making blended cement compositons |
| US5820668A (en) * | 1995-12-22 | 1998-10-13 | Ib Technologies Llc | Inorganic binder composition, production and uses thereof |
| RU2124485C1 (ru) * | 1996-04-22 | 1999-01-10 | Братский Индустриальный Институт | Вяжущее |
| CZ268598A3 (cs) * | 1996-11-29 | 1999-02-17 | "Holderbank" Financiere Glarus Ag | Cementová směs |
| RU2133233C1 (ru) * | 1996-12-10 | 1999-07-20 | Пензенский государственный архитектурно-строительный институт | Бесклинкерное композиционное вяжущее |
| RU2125026C1 (ru) * | 1996-12-24 | 1999-01-20 | Братский Индустриальный Институт | Вяжущее |
| RU2139263C1 (ru) * | 1997-07-24 | 1999-10-10 | Пензенская государственная архитектурно-строительная академия | Бесклинкерное композиционное вяжущее |
| RU2130904C1 (ru) * | 1997-11-12 | 1999-05-27 | Братский Индустриальный Институт | Вяжущее |
| US6176920B1 (en) | 1998-06-12 | 2001-01-23 | Smartboard Building Products Inc. | Cementitious structural panel and method of its manufacture |
| EP1165455A1 (en) | 1998-12-08 | 2002-01-02 | McNulty, William J. Jr. | Inorganic cementitious material |
| BR0108483A (pt) * | 2000-02-18 | 2003-04-22 | Willie W Stroup | Mistura de cimento de escória de cúpula e métodos de fabricação e utilização da mesma |
| FR2813881B1 (fr) * | 2000-09-13 | 2003-04-25 | Cie Du Sol | Un procede pour limiter le relargage de matieres organiques dans l'environnement lors de la realisation de fondations, et beton susceptible d'etre mis en oeuvre dans ledit procede |
| US6740155B1 (en) | 2001-08-24 | 2004-05-25 | Isg Resources, Inc. | Method of delaying the set time of cement and the compositions produced therefrom |
| US6827776B1 (en) | 2001-08-24 | 2004-12-07 | Isg Resources, Inc. | Method for accelerating setting of cement and the compositions produced therefrom |
| RU2278835C2 (ru) * | 2001-09-13 | 2006-06-27 | Вопфингер Штайн- Унд Калькверке Шмид Унд Ко. | Гидравлическое связующее |
| US7261771B2 (en) * | 2002-01-09 | 2007-08-28 | Nanostrata Inc. | Method of controlling the viscosity of a cementitious mixture using oppositely-charged polyelectrolytes |
| RU2217396C1 (ru) * | 2002-03-11 | 2003-11-27 | Тверской государственный технический университет | Стеновой материал |
| FR2839970B1 (fr) | 2002-05-27 | 2005-07-22 | Joseph Davidovits | Ciment geopolymerique a base de poly(sialate-disiloxo) et procede d'obtention |
| RU2237631C2 (ru) * | 2002-12-26 | 2004-10-10 | Братский государственный технический университет | Вяжущее |
| RU2237633C2 (ru) * | 2002-12-26 | 2004-10-10 | Братский государственный технический университет | Вяжущее |
| RU2237632C2 (ru) * | 2002-12-26 | 2004-10-10 | Братский государственный технический университет | Вяжущее |
| RU2247697C1 (ru) * | 2003-06-30 | 2005-03-10 | Ивановский государственный химико-технологический университет | Щлакощелочное вяжущее |
| RU2247094C1 (ru) * | 2003-07-22 | 2005-02-27 | Красноярская государственная архитектурно-строительная академия | Бетонная смесь |
| RU2259970C1 (ru) * | 2004-01-26 | 2005-09-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный технический университет" | Способ приготовления бетонной смеси |
| RU2259971C1 (ru) * | 2004-01-26 | 2005-09-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный технический университет" | Способ приготовления бетонной смеси |
| AT413535B (de) * | 2004-04-05 | 2006-03-15 | Holcim Ltd | Hydraulisches bindemittel sowie verfahren zu dessen herstellung |
| US8029618B2 (en) * | 2004-09-21 | 2011-10-04 | Saudi Arabian Oil Company | Manufacture of Portland cement using spent claus catalyst |
| RU2287498C1 (ru) * | 2005-07-15 | 2006-11-20 | Федеральное государственное образовательное учреждение высшего профессионального образования "Казанский государственный архитектурно-строительный университет" ФГОУ ВПО КГАСУ | Вяжущее |
| RU2302396C1 (ru) * | 2005-11-01 | 2007-07-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| RU2308427C1 (ru) * | 2006-02-17 | 2007-10-20 | Закрытое акционерное общество "Корона-СМ" | Вяжущее |
| MX2008011133A (es) * | 2006-03-01 | 2008-12-18 | Cementech Pty Ltd | Matriz para elementos de albañileria y metodo de fabricacion de la misma. |
| RU2307098C1 (ru) * | 2006-03-22 | 2007-09-27 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| RU2323182C1 (ru) * | 2006-08-03 | 2008-04-27 | Юлия Алексеевна Щепочкина | Вяжущее |
| RU2320623C1 (ru) * | 2006-11-02 | 2008-03-27 | Юлия Алексеевна Щепочкина | Сырьевая смесь для получения легких бетонов |
| RU2330822C1 (ru) * | 2006-11-07 | 2008-08-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| RU2320593C1 (ru) * | 2006-11-07 | 2008-03-27 | Юлия Алексеевна Щепочкина | Вяжущее |
| RU2330821C1 (ru) * | 2006-11-07 | 2008-08-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| US20080148997A1 (en) * | 2006-12-22 | 2008-06-26 | Blackburn David R | Gypsum compositions with naphthalene sulfonate and modifiers |
| RU2329980C1 (ru) * | 2006-12-25 | 2008-07-27 | Юлия Алексеевна Щепочкина | Шлакопортландцемент |
| RU2332372C1 (ru) * | 2007-01-25 | 2008-08-27 | Юлия Алексеевна Щепочкина | Вяжущее |
| RU2346904C2 (ru) * | 2007-03-26 | 2009-02-20 | Государственное образовательное учреждение высшего профессионального образования Восточно-Сибирский государственный технологический университет | Способ получения гидроактивированного композиционного зольного вяжущего |
| RU2372302C2 (ru) * | 2007-12-24 | 2009-11-10 | Государственное образовательное учреждение высшего профессионального образования "Магнитогорский государственный технический университет им. Г.И. Носова" | Вяжущее |
| RU2366627C1 (ru) * | 2008-03-31 | 2009-09-10 | Государственное образовательное учреждение высшего профессионального образования "Сибирский государственный индустриальный университет" | Вяжущее |
| RU2370466C1 (ru) * | 2008-05-21 | 2009-10-20 | Рафик Анверович Ибрагимов | Шлакощелочное вяжущее "граунд" и способ его получения (варианты) |
| RU2370465C1 (ru) * | 2008-05-21 | 2009-10-20 | Игорь Иванович Романенко | Шлакощелочное вяжущее "граунд-м" и способ его получения |
| RU2374201C1 (ru) * | 2008-06-09 | 2009-11-27 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Сырьевая смесь для приготовления жаростойкого бетона |
| RU2374209C1 (ru) * | 2008-06-25 | 2009-11-27 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Способ получения жаростойкого бетона |
| RU2376267C1 (ru) * | 2008-06-25 | 2009-12-20 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Способ получения жаростойкого бетона |
| CN102459510B (zh) * | 2009-06-09 | 2014-08-20 | 竹本油脂株式会社 | 使用高炉渣水泥而得的地基改良用浆料组合物以及使用其的掺土水泥浆料的制造方法 |
| RU2416580C1 (ru) * | 2009-12-21 | 2011-04-20 | Анатолий Прокопьевич Коробейников | Вяжущее и способ приготовления его |
| KR101014869B1 (ko) * | 2010-01-13 | 2011-02-15 | 전남대학교산학협력단 | 복합 알칼리 활성화제를 포함하는 무시멘트 알칼리 활성결합재, 이를 이용한 모르타르 또는 콘크리트 |
| RU2417179C1 (ru) * | 2010-02-24 | 2011-04-27 | Юлия Алексеевна Щепочкина | Сырьевая смесь для производства кирпича |
| RU2440319C1 (ru) * | 2010-05-31 | 2012-01-20 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Способ получения вяжущего |
| RU2430043C1 (ru) * | 2010-08-20 | 2011-09-27 | Анатолий Прокопьевич Коробейников | Вяжущее бесклинкерное |
| RU2458875C2 (ru) * | 2010-09-28 | 2012-08-20 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| RU2452702C1 (ru) * | 2010-10-01 | 2012-06-10 | Витаутас Валентинович Сенкус | Вяжущее и способ его приготовления для производства декоративного бетона |
| RU2471740C2 (ru) * | 2011-02-28 | 2013-01-10 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Сырьевая смесь для приготовления кислотостойкого золошлакового бетона |
| RU2458877C1 (ru) * | 2011-02-28 | 2012-08-20 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Вяжущее |
| RU2479532C2 (ru) * | 2011-05-03 | 2013-04-20 | Государственное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Сырьевая смесь для приготовления золошлакового бетона |
| RU2482089C1 (ru) * | 2012-02-22 | 2013-05-20 | Юлия Алексеевна Щепочкина | Сырьевая смесь для изготовления материала, имитирующего природный камень |
| RU2481295C1 (ru) * | 2012-02-22 | 2013-05-10 | Юлия Алексеевна Щепочкина | Сырьевая смесь для изготовления материала, имитирующего природный камень |
| RU2503639C1 (ru) * | 2012-10-05 | 2014-01-10 | Юлия Алексеевна Щепочкина | Бетонная смесь |
| RU2500642C1 (ru) * | 2012-10-05 | 2013-12-10 | Юлия Алексеевна Щепочкина | Бетонная смесь |
| RU2506240C1 (ru) * | 2012-10-08 | 2014-02-10 | Юлия Алексеевна Щепочкина | Сырьевая смесь для имитации природного камня |
| WO2014067991A1 (de) * | 2012-11-05 | 2014-05-08 | Sika Technology Ag | Mahlhilfsmittel für zementklinker auf basis von polycarboxylatethern und/oder ligninsulfonaten |
| RU2553130C2 (ru) * | 2013-08-20 | 2015-06-10 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Способ получения золошлакового бетона |
| RU2554967C2 (ru) * | 2013-08-20 | 2015-07-10 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Сырьевая смесь для приготовления коррозионностойкого золощелочного бетона |
| RU2553817C2 (ru) * | 2013-08-20 | 2015-06-20 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Братский государственный университет" | Сырьевая смесь для приготовления золошлакового бетона |
| RU2543833C2 (ru) * | 2014-05-13 | 2015-03-10 | Владимир Иванович Лунев | Способ получения золоцемента |
| RU2550706C1 (ru) * | 2014-05-13 | 2015-05-10 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Липецкий государственный технический университет" (ЛГТУ) | Способ переработки "пыли" отвального сталеплавильного шлака |
| EP3070065A1 (de) * | 2015-03-17 | 2016-09-21 | HeidelbergCement AG | Verzögerermischung für alkali-aktivierte bindemittel |
| FR3034094B1 (fr) | 2015-03-27 | 2020-10-09 | Hoffmann Jb Tech | Composition pour materiau de construction a base de metakaolin, procede de fabrication associe et utilisation pour la realisation d'elements de construction |
| CN105819812A (zh) * | 2016-02-26 | 2016-08-03 | 李春松 | 一种无机保温材料 |
| CN105621997A (zh) * | 2016-02-26 | 2016-06-01 | 李春松 | 一种阻燃保温材料 |
| RU2610019C1 (ru) * | 2016-02-29 | 2017-02-07 | Юлия Алексеевна Щепочкина | Сырьевая смесь для изготовления материала, имитирующего природный камень |
| CN106336167A (zh) * | 2016-08-23 | 2017-01-18 | 陈广圣 | 一种高抗裂混凝土 |
| EP3296278A1 (en) | 2016-09-16 | 2018-03-21 | HeidelbergCement AG | Retarder for alkali activated binder |
| RU2715061C2 (ru) * | 2017-03-15 | 2020-02-25 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Череповецкий государственный университет" | Бетонная смесь |
| RU2743159C1 (ru) * | 2019-12-27 | 2021-02-15 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Российский химико-технологический университет имени Д.И. Менделеева (РХТУ им. Д.И. Менделеева) | Шлакощелочный материал для строительных изделий и способ его получения |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB560258A (en) * | 1942-09-24 | 1944-03-28 | Frederick Charles Hyppolite Ka | Improvements in compositions for use instead of water for mixing with cement, concrete and the like and methods of making the same |
| US2646360A (en) * | 1949-08-29 | 1953-07-21 | Phillips Petroleum Co | Low-water-loss cement slurry |
| DE1008638B (de) * | 1954-08-17 | 1957-05-16 | Buechtemann & Co Inh Buechtema | Verfahren zum Beschleunigen des Abbindens von Zementmoerteln |
| GB1280655A (en) * | 1969-03-27 | 1972-07-05 | Research Corp | Cement composition and method |
| US3689294A (en) * | 1971-06-14 | 1972-09-05 | Stephen Braunauer | Portland cement compositions and method |
| BE794660A (fr) * | 1972-01-29 | 1973-07-30 | Basf Ag | Fluidifiant pour liants mineraux |
| US4032351A (en) * | 1974-07-24 | 1977-06-28 | Auzel Francois F | Rare earth ceramic for frequency conversion of radiation |
| US3959004A (en) * | 1975-04-21 | 1976-05-25 | Westvaco Corporation | Process for producing low porosity cement |
| US4032353A (en) * | 1975-04-21 | 1977-06-28 | Westvaco Corporation | Low porosity aggregate-containing cement composition and process for producing same |
| DK156876A (da) * | 1975-04-21 | 1976-10-22 | Westvaco Corp | Cement af lav porositet og fremgangsmade til fremstilling deraf |
| US3960582A (en) * | 1975-04-21 | 1976-06-01 | Westvaco Corporation | Low porosity cement and process for producing same |
| IT1045175B (it) * | 1975-06-13 | 1980-05-10 | Ikede Anstalt | Additivo per impasti di leganti inorganici quali paste malte calcestruzzi e simili e metodo per preparare impasti contenenti detto additivo |
| US4169747A (en) * | 1975-10-21 | 1979-10-02 | United States Gypsum Company | Composition for accelerating the setting of calcined gypsum and the product formed thereby |
| DE2557143A1 (de) * | 1975-12-18 | 1977-07-28 | Ceske Vysoke Uceni Technick Pr | Zementgemisch und verfahren zu seiner herstellung |
| US4019918A (en) * | 1976-02-02 | 1977-04-26 | Martin Marietta Corporation | Portland cement compositions |
| SE432925B (sv) * | 1977-03-30 | 1984-04-30 | Ceskoslovenska Akademie Ved | Bindemedel baserat pa mald cemintklinker |
-
1980
- 1980-05-24 GR GR62047A patent/GR68405B/el unknown
- 1980-05-26 CA CA000352694A patent/CA1150327A/en not_active Expired
- 1980-05-27 SE SE8003922A patent/SE447097B/sv not_active Application Discontinuation
- 1980-05-27 AU AU58804/80A patent/AU537598B2/en not_active Ceased
- 1980-05-27 DD DD80221396A patent/DD151150A5/de unknown
- 1980-05-28 IN IN626/CAL/80A patent/IN152973B/en unknown
- 1980-05-28 FR FR8011826A patent/FR2457845B1/fr not_active Expired
- 1980-05-29 CS CS803794A patent/CS259505B2/cs unknown
- 1980-05-29 DE DE3020384A patent/DE3020384C2/de not_active Expired
- 1980-05-29 PL PL1980224590A patent/PL126493B1/pl unknown
- 1980-05-29 IT IT48830/80A patent/IT1174776B/it active
- 1980-05-29 GB GB8017513A patent/GB2051031B/en not_active Expired
- 1980-05-29 NO NO801600A patent/NO150676C/no unknown
- 1980-05-29 AR AR281230A patent/AR220055A1/es active
- 1980-05-30 NL NL8003179A patent/NL8003179A/nl not_active Application Discontinuation
- 1980-05-30 DK DK234880A patent/DK155185C/da active
- 1980-05-30 ES ES491990A patent/ES8103717A1/es not_active Expired
- 1980-05-30 CH CH424180A patent/CH644573A5/de not_active IP Right Cessation
- 1980-05-30 AT AT2876/80A patent/AT392637B/de not_active IP Right Cessation
- 1980-05-30 US US06/154,879 patent/US4306912A/en not_active Expired - Lifetime
- 1980-05-30 BR BR8003407A patent/BR8003407A/pt unknown
- 1980-05-30 MX MX182592A patent/MX154208A/es unknown
- 1980-05-31 RO RO101294A patent/RO84532B/ro unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT392637B (de) | Verfahren zur herstellung eines bindemittels zur verwendung in dick- bzw. rohschlamm, moertel oder beton | |
| DE68903482T2 (de) | Zement, verfahren zur herstellung dieses zements und verfahren zur herstellung von produkten mit diesem zement. | |
| DE69407418T2 (de) | ERSTARRUNGS- UND HäRTUNGSBESCHLEUNIGER FüR SILIKATISCHE HYDRAULISCHE BINDEMITTEL | |
| DE3821657C2 (enEXAMPLES) | ||
| DE60204853T2 (de) | Zement-artiges material | |
| EP2746237B1 (de) | Anreger fuer Zement | |
| AT511689B1 (de) | Hydraulisches bindemittel | |
| WO2003000617A1 (de) | Verfahren zur beschleunigung des abbindens und erhärtens von hydraulischen bindemitteln und diese enthaltenden gemischen | |
| EP3109216B1 (de) | Erstarrungs- und erhaertungsbeschleuniger fuer hydraulische bindemittel | |
| EP1866262A1 (de) | Erstarrungs- und erhärtungsbeschleuniger für hydraulische bindemittel sowie dessen verwendung und verfahren zu dessen herstellung | |
| DE3743467A1 (de) | Verfahren zur herstellung eines baustoffs und bindemittels mit erhoehter wasserbestaendigkeit | |
| DE19501100C2 (de) | Spritzbetonbindemittelmischung | |
| DE3049003A1 (de) | Hydraulische anorganische masse | |
| WO2015177232A1 (de) | Beschleuniger für hydraulische bindemittel mit langer verarbeitungszeit und sehr hoher frühfestigkeit | |
| DE2341493C3 (de) | Hydraulischer Zement mit hoher Anfangsfestigkeit | |
| CH654821A5 (de) | Bindemittel fuer ein baustoffgemisch. | |
| DE69315078T2 (de) | Schnellhärtende hydraulische bindemittel und diese enthaltende bindemischungen, deren herstellung und verwendung zur herstellung von mörtel und beton | |
| DE10124149B4 (de) | Selbstnivellierende Anhydritfließestrichmischung | |
| DE10115827C5 (de) | Verfahren zur Herstellung von Porenbeton | |
| DE2900613C2 (de) | Verfahren zum Herstellen eines faserverstärkten, ausgehärteten Gips-Formkörpers | |
| DE2953652C1 (de) | Hydraulische anorganische Masse | |
| AT378766B (de) | Verfahren zur herstellung von spritzbeton | |
| DE3221463A1 (de) | Verfahren zur herstellung eines leichtbaustoffes | |
| DE2625067C3 (de) | Verfullmasse auf Zementbasis mit hohen Wasser-Bindemittelwerten | |
| DE1224190B (de) | Verfahren zur Aufbereitung von synthetischem Gips |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |