CH629486A5 - Verfahren zur herstellung von neuen piperidin-derivaten. - Google Patents
Verfahren zur herstellung von neuen piperidin-derivaten. Download PDFInfo
- Publication number
- CH629486A5 CH629486A5 CH310476A CH310476A CH629486A5 CH 629486 A5 CH629486 A5 CH 629486A5 CH 310476 A CH310476 A CH 310476A CH 310476 A CH310476 A CH 310476A CH 629486 A5 CH629486 A5 CH 629486A5
- Authority
- CH
- Switzerland
- Prior art keywords
- group
- parts
- formula
- aryl
- filtered
- Prior art date
Links
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical class C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 title description 5
- 238000004519 manufacturing process Methods 0.000 title description 2
- -1 alkoxyphenyl radicals Chemical class 0.000 claims description 153
- 150000001875 compounds Chemical class 0.000 claims description 101
- 238000000034 method Methods 0.000 claims description 55
- 239000002253 acid Substances 0.000 claims description 53
- 150000003839 salts Chemical class 0.000 claims description 48
- 238000002360 preparation method Methods 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 39
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 38
- 125000000217 alkyl group Chemical group 0.000 claims description 33
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 33
- 125000004432 carbon atom Chemical group C* 0.000 claims description 32
- 229910052739 hydrogen Inorganic materials 0.000 claims description 24
- 150000002148 esters Chemical group 0.000 claims description 22
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 21
- 239000001257 hydrogen Substances 0.000 claims description 17
- 150000003254 radicals Chemical class 0.000 claims description 16
- 125000005196 alkyl carbonyloxy group Chemical group 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims description 12
- 230000010933 acylation Effects 0.000 claims description 11
- 238000005917 acylation reaction Methods 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 11
- 150000001412 amines Chemical class 0.000 claims description 10
- 239000003960 organic solvent Substances 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 238000009903 catalytic hydrogenation reaction Methods 0.000 claims description 9
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000003545 alkoxy group Chemical group 0.000 claims description 7
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000001769 aryl amino group Chemical group 0.000 claims description 6
- 125000004981 cycloalkylmethyl group Chemical group 0.000 claims description 6
- 150000004820 halides Chemical class 0.000 claims description 6
- 125000005843 halogen group Chemical group 0.000 claims description 6
- 125000001072 heteroaryl group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 5
- 125000005129 aryl carbonyl group Chemical group 0.000 claims description 5
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 150000003053 piperidines Chemical class 0.000 claims description 5
- 239000012279 sodium borohydride Substances 0.000 claims description 5
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 claims description 3
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 2
- 150000007942 carboxylates Chemical class 0.000 claims description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000005241 heteroarylamino group Chemical group 0.000 claims 4
- 150000008065 acid anhydrides Chemical class 0.000 claims 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims 2
- 125000005223 heteroarylcarbonyl group Chemical group 0.000 claims 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 claims 1
- 125000001309 chloro group Chemical group Cl* 0.000 claims 1
- 238000003776 cleavage reaction Methods 0.000 claims 1
- 125000002541 furyl group Chemical group 0.000 claims 1
- 125000005842 heteroatom Chemical group 0.000 claims 1
- 239000012442 inert solvent Substances 0.000 claims 1
- 125000005948 methanesulfonyloxy group Chemical group 0.000 claims 1
- 125000004430 oxygen atom Chemical group O* 0.000 claims 1
- 230000007017 scission Effects 0.000 claims 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 234
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 210
- 239000000203 mixture Substances 0.000 description 192
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 183
- 239000000243 solution Substances 0.000 description 107
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 102
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 100
- 229960001701 chloroform Drugs 0.000 description 96
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 90
- 239000011541 reaction mixture Substances 0.000 description 80
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 72
- 239000000047 product Substances 0.000 description 70
- 239000003480 eluent Substances 0.000 description 67
- 239000000543 intermediate Substances 0.000 description 66
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 63
- 239000002904 solvent Substances 0.000 description 59
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 55
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 53
- 238000004440 column chromatography Methods 0.000 description 53
- 238000010992 reflux Methods 0.000 description 53
- 239000000741 silica gel Substances 0.000 description 53
- 229910002027 silica gel Inorganic materials 0.000 description 53
- 239000000706 filtrate Substances 0.000 description 51
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 49
- 239000000284 extract Substances 0.000 description 47
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 44
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 43
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 42
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 40
- 238000001816 cooling Methods 0.000 description 37
- 238000003756 stirring Methods 0.000 description 37
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 36
- 239000002585 base Substances 0.000 description 35
- 239000003054 catalyst Substances 0.000 description 35
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 29
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 29
- 239000012074 organic phase Substances 0.000 description 29
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 description 28
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 27
- 239000000908 ammonium hydroxide Substances 0.000 description 27
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 27
- 239000002244 precipitate Substances 0.000 description 25
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 24
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 24
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 23
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 23
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 21
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 21
- 229910052799 carbon Inorganic materials 0.000 description 20
- 229910052757 nitrogen Inorganic materials 0.000 description 20
- 239000007858 starting material Substances 0.000 description 20
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 16
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 16
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 16
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 15
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 15
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 229960000583 acetic acid Drugs 0.000 description 14
- 239000005457 ice water Substances 0.000 description 14
- 238000002844 melting Methods 0.000 description 14
- 230000008018 melting Effects 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 12
- 229910000029 sodium carbonate Inorganic materials 0.000 description 12
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 11
- 239000008346 aqueous phase Substances 0.000 description 11
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 11
- WYVAMUWZEOHJOQ-UHFFFAOYSA-N propionic anhydride Chemical compound CCC(=O)OC(=O)CC WYVAMUWZEOHJOQ-UHFFFAOYSA-N 0.000 description 11
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 10
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 10
- 229910052736 halogen Inorganic materials 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 9
- 239000003208 petroleum Substances 0.000 description 9
- 229920006395 saturated elastomer Polymers 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 8
- 238000001914 filtration Methods 0.000 description 8
- 150000002367 halogens Chemical class 0.000 description 8
- 239000011734 sodium Substances 0.000 description 8
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 7
- 229910021529 ammonia Inorganic materials 0.000 description 7
- HTZCNXWZYVXIMZ-UHFFFAOYSA-M benzyl(triethyl)azanium;chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC1=CC=CC=C1 HTZCNXWZYVXIMZ-UHFFFAOYSA-M 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 7
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- ULOZGJWEIWAWML-UHFFFAOYSA-N Noralfentanil Chemical compound C1CNCCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ULOZGJWEIWAWML-UHFFFAOYSA-N 0.000 description 6
- 150000001266 acyl halides Chemical class 0.000 description 6
- 150000001408 amides Chemical class 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- HFNFODVRYCEIQL-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CNCCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 HFNFODVRYCEIQL-UHFFFAOYSA-N 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- BFSVOASYOCHEOV-UHFFFAOYSA-N 2-diethylaminoethanol Chemical compound CCN(CC)CCO BFSVOASYOCHEOV-UHFFFAOYSA-N 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 5
- 238000010934 O-alkylation reaction Methods 0.000 description 5
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 5
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 5
- 150000008064 anhydrides Chemical class 0.000 description 5
- 239000012043 crude product Substances 0.000 description 5
- ZOOSILUVXHVRJE-UHFFFAOYSA-N cyclopropanecarbonyl chloride Chemical compound ClC(=O)C1CC1 ZOOSILUVXHVRJE-UHFFFAOYSA-N 0.000 description 5
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 5
- 125000004494 ethyl ester group Chemical group 0.000 description 5
- ULCFSXQHBSJRKV-UHFFFAOYSA-N methyl 4-anilino-3-methyl-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1C(C)C(C(=O)OC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 ULCFSXQHBSJRKV-UHFFFAOYSA-N 0.000 description 5
- 125000003386 piperidinyl group Chemical group 0.000 description 5
- NNFCIKHAZHQZJG-UHFFFAOYSA-N potassium cyanide Chemical compound [K+].N#[C-] NNFCIKHAZHQZJG-UHFFFAOYSA-N 0.000 description 5
- 239000012312 sodium hydride Substances 0.000 description 5
- 229910000104 sodium hydride Inorganic materials 0.000 description 5
- 239000012258 stirred mixture Substances 0.000 description 5
- 239000006228 supernatant Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 4
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 4
- 150000001350 alkyl halides Chemical class 0.000 description 4
- 230000000202 analgesic effect Effects 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 150000001735 carboxylic acids Chemical class 0.000 description 4
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- UFUASNAHBMBJIX-UHFFFAOYSA-N propan-1-one Chemical group CC[C]=O UFUASNAHBMBJIX-UHFFFAOYSA-N 0.000 description 4
- 125000005767 propoxymethyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])[#8]C([H])([H])* 0.000 description 4
- 125000006239 protecting group Chemical group 0.000 description 4
- 230000000630 rising effect Effects 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- DYLIWHYUXAJDOJ-OWOJBTEDSA-N (e)-4-(6-aminopurin-9-yl)but-2-en-1-ol Chemical compound NC1=NC=NC2=C1N=CN2C\C=C\CO DYLIWHYUXAJDOJ-OWOJBTEDSA-N 0.000 description 3
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- 230000006181 N-acylation Effects 0.000 description 3
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 150000004645 aluminates Chemical class 0.000 description 3
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- IZIAEPZQNMQAGS-UHFFFAOYSA-N ethyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IZIAEPZQNMQAGS-UHFFFAOYSA-N 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 238000005984 hydrogenation reaction Methods 0.000 description 3
- 239000013067 intermediate product Substances 0.000 description 3
- IFQWTLUCYHGSSI-UHFFFAOYSA-N methyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 IFQWTLUCYHGSSI-UHFFFAOYSA-N 0.000 description 3
- 150000004702 methyl esters Chemical class 0.000 description 3
- 150000007522 mineralic acids Chemical class 0.000 description 3
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000001294 propane Substances 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 3
- WTOYUGZUPNQZHG-UHFFFAOYSA-N (4-anilino-1-benzylpiperidin-4-yl)methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 WTOYUGZUPNQZHG-UHFFFAOYSA-N 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 2
- KMXUKZCMNKLUTF-UHFFFAOYSA-N 1-chloro-4-(2-chloroethyl)benzene Chemical compound ClCCC1=CC=C(Cl)C=C1 KMXUKZCMNKLUTF-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- RIMCNXPZHSRMSU-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1(C(O)=O)CCN(CCC=2C=CC=CC=2)CC1 RIMCNXPZHSRMSU-UHFFFAOYSA-N 0.000 description 2
- PHLAURNEKNFKNH-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PHLAURNEKNFKNH-UHFFFAOYSA-N 0.000 description 2
- MWJKXKBVWIHKOB-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCNCC1 MWJKXKBVWIHKOB-UHFFFAOYSA-N 0.000 description 2
- VWCPMNASPOCMNY-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carbonitrile Chemical compound C1CC(C#N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VWCPMNASPOCMNY-UHFFFAOYSA-N 0.000 description 2
- DJVCIHFRPVAFAU-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 DJVCIHFRPVAFAU-UHFFFAOYSA-N 0.000 description 2
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 2
- YKAYMASDSHFOGI-UHFFFAOYSA-N 4-phenylcyclohexan-1-one Chemical compound C1CC(=O)CCC1C1=CC=CC=C1 YKAYMASDSHFOGI-UHFFFAOYSA-N 0.000 description 2
- VRJHQPZVIGNGMX-UHFFFAOYSA-N 4-piperidinone Chemical compound O=C1CCNCC1 VRJHQPZVIGNGMX-UHFFFAOYSA-N 0.000 description 2
- CODISKXAELZSMS-UHFFFAOYSA-N CCC(N)=O.OC(=O)C(O)=O Chemical compound CCC(N)=O.OC(=O)C(O)=O CODISKXAELZSMS-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 2
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-LZFNBGRKSA-N Potassium-45 Chemical group [45K] ZLMJMSJWJFRBEC-LZFNBGRKSA-N 0.000 description 2
- QOSMNYMQXIVWKY-UHFFFAOYSA-N Propyl levulinate Chemical compound CCCOC(=O)CCC(C)=O QOSMNYMQXIVWKY-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- AWMVMTVKBNGEAK-UHFFFAOYSA-N Styrene oxide Chemical compound C1OC1C1=CC=CC=C1 AWMVMTVKBNGEAK-UHFFFAOYSA-N 0.000 description 2
- VVJWPSNDGLSAMC-UHFFFAOYSA-N [4-anilino-1-(2-phenylethyl)piperidin-4-yl]methanol Chemical compound C1CC(CO)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VVJWPSNDGLSAMC-UHFFFAOYSA-N 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 2
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000004657 carbamic acid derivatives Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000005147 halomethylbenzenes Chemical class 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 2
- 150000002576 ketones Chemical class 0.000 description 2
- 229910052744 lithium Inorganic materials 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- CBKLICUQYUTWQL-UHFFFAOYSA-N methyl 3-methyl-1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CC(C)C1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 CBKLICUQYUTWQL-UHFFFAOYSA-N 0.000 description 2
- NPOMYZMTQSCHSC-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=C(OC)C=CC=2)CCN1CCC1=CC=CC=C1 NPOMYZMTQSCHSC-UHFFFAOYSA-N 0.000 description 2
- NPNNCHCGYDKUTA-UHFFFAOYSA-N methyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 NPNNCHCGYDKUTA-UHFFFAOYSA-N 0.000 description 2
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- RLXDCJUIXHSXQD-UHFFFAOYSA-N oxalic acid;hydrate Chemical compound O.OC(=O)C(O)=O.OC(=O)C(O)=O RLXDCJUIXHSXQD-UHFFFAOYSA-N 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 2
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- VHWJSJBTUWUEAL-UHFFFAOYSA-N propanamide;hydrochloride Chemical compound Cl.CCC(N)=O VHWJSJBTUWUEAL-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- BVMUUCRIMILCIA-UHFFFAOYSA-M sodium;4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound [Na+].C1CC(C(=O)[O-])(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 BVMUUCRIMILCIA-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- PMIAMRAWHYEPNH-UHFFFAOYSA-N 1-(2-chloroethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCCl)C=C1 PMIAMRAWHYEPNH-UHFFFAOYSA-N 0.000 description 1
- OMCWIVZSDHKRRQ-UHFFFAOYSA-N 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylic acid Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(O)=O)N(C(=O)CC)C1=CC=CC=C1 OMCWIVZSDHKRRQ-UHFFFAOYSA-N 0.000 description 1
- DNUTZBZXLPWRJG-UHFFFAOYSA-N 1-Piperidine carboxylic acid Chemical compound OC(=O)N1CCCCC1 DNUTZBZXLPWRJG-UHFFFAOYSA-N 0.000 description 1
- OXGXAJRQRJCPGY-UHFFFAOYSA-N 1-[4-anilino-1-(2-phenylethyl)piperidin-4-yl]ethanol Chemical compound C1CC(C(O)C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 OXGXAJRQRJCPGY-UHFFFAOYSA-N 0.000 description 1
- RNXSAXPSGSHBCG-UHFFFAOYSA-N 1-benzyl-4-(3-methoxyanilino)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CC=3C=CC=CC=3)CC2)C(O)=O)=C1 RNXSAXPSGSHBCG-UHFFFAOYSA-N 0.000 description 1
- DICTXEPQAOBPNR-UHFFFAOYSA-N 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 DICTXEPQAOBPNR-UHFFFAOYSA-N 0.000 description 1
- UMPXGSMPVDCSPV-UHFFFAOYSA-N 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylic acid Chemical compound C1CC(C(=O)O)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 UMPXGSMPVDCSPV-UHFFFAOYSA-N 0.000 description 1
- UDRBGVYYKIYOIB-UHFFFAOYSA-N 1-benzyl-4-(4-methoxyanilino)piperidine-4-carboxylic acid Chemical compound C1=CC(OC)=CC=C1NC1(C(O)=O)CCN(CC=2C=CC=CC=2)CC1 UDRBGVYYKIYOIB-UHFFFAOYSA-N 0.000 description 1
- SINMIPRROZGHTC-UHFFFAOYSA-N 1-benzyl-4-(4-methylanilino)piperidine-4-carboxylic acid Chemical compound C1=CC(C)=CC=C1NC1(C(O)=O)CCN(CC=2C=CC=CC=2)CC1 SINMIPRROZGHTC-UHFFFAOYSA-N 0.000 description 1
- LIVHIJCEICYLHB-UHFFFAOYSA-N 1-benzyl-4-(ethoxymethyl)-n-phenylpiperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 LIVHIJCEICYLHB-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 1
- OVSKIKFHRZPJSS-UHFFFAOYSA-N 2,4-D Chemical compound OC(=O)COC1=CC=C(Cl)C=C1Cl OVSKIKFHRZPJSS-UHFFFAOYSA-N 0.000 description 1
- OWUIUYMLDSTENT-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)ethanol Chemical compound CN1C=CC=C1CCO OWUIUYMLDSTENT-UHFFFAOYSA-N 0.000 description 1
- HEBVAMBPYRSREF-UHFFFAOYSA-N 2-(1-methylpyrrol-2-yl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CN1C HEBVAMBPYRSREF-UHFFFAOYSA-N 0.000 description 1
- UGBCLQCZBKPTMP-UHFFFAOYSA-N 2-(furan-2-yl)ethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CO1 UGBCLQCZBKPTMP-UHFFFAOYSA-N 0.000 description 1
- KKOZKXBAPIYWAT-UHFFFAOYSA-N 2-[(4-methylphenyl)sulfonylamino]pentanedioic acid Chemical class CC1=CC=C(S(=O)(=O)NC(CCC(O)=O)C(O)=O)C=C1 KKOZKXBAPIYWAT-UHFFFAOYSA-N 0.000 description 1
- WPDWOCRJBPXJFM-UHFFFAOYSA-N 2-bromo-1-phenylpropan-1-one Chemical compound CC(Br)C(=O)C1=CC=CC=C1 WPDWOCRJBPXJFM-UHFFFAOYSA-N 0.000 description 1
- MNNZINNZIQVULG-UHFFFAOYSA-N 2-chloroethylbenzene Chemical class ClCCC1=CC=CC=C1 MNNZINNZIQVULG-UHFFFAOYSA-N 0.000 description 1
- LFWBXHYTNKEQAI-UHFFFAOYSA-N 2-naphthalen-1-ylethyl 4-methylbenzenesulfonate Chemical compound C1=CC(C)=CC=C1S(=O)(=O)OCCC1=CC=CC2=CC=CC=C12 LFWBXHYTNKEQAI-UHFFFAOYSA-N 0.000 description 1
- VMJOFTHFJMLIKL-UHFFFAOYSA-N 2-thiophen-2-ylethanol Chemical compound OCCC1=CC=CS1 VMJOFTHFJMLIKL-UHFFFAOYSA-N 0.000 description 1
- VIUDTWATMPPKEL-UHFFFAOYSA-N 3-(trifluoromethyl)aniline Chemical compound NC1=CC=CC(C(F)(F)F)=C1 VIUDTWATMPPKEL-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- SFKIMFDURHCIKT-UHFFFAOYSA-N 4-(3-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylic acid Chemical compound COC1=CC=CC(NC2(CCN(CCC=3C=CC=CC=3)CC2)C(O)=O)=C1 SFKIMFDURHCIKT-UHFFFAOYSA-N 0.000 description 1
- SZOXZVPHPPKPAI-UHFFFAOYSA-N 4-(4-fluoroanilino)piperidine-1-carboxamide Chemical compound C1CN(C(=O)N)CCC1NC1=CC=C(F)C=C1 SZOXZVPHPPKPAI-UHFFFAOYSA-N 0.000 description 1
- MECVKUYLWNZQTF-UHFFFAOYSA-N 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCN(CCC=2C=CC=CC=2)CC1 MECVKUYLWNZQTF-UHFFFAOYSA-N 0.000 description 1
- PWPGBBMWCFWLQK-UHFFFAOYSA-N 4-(4-methylanilino)piperidine-4-carboxamide Chemical compound C1=CC(C)=CC=C1NC1(C(N)=O)CCNCC1 PWPGBBMWCFWLQK-UHFFFAOYSA-N 0.000 description 1
- YZDFRHQFQDSJNF-UHFFFAOYSA-N 4-(N-ethoxycarbonylanilino)piperidine-1,4-dicarboxylic acid Chemical compound C(C)OC(=O)N(C1(CCN(CC1)C(=O)O)C(=O)O)C1=CC=CC=C1 YZDFRHQFQDSJNF-UHFFFAOYSA-N 0.000 description 1
- ZMYFEFLPUAJLFD-UHFFFAOYSA-N 4-(N-propanoylanilino)piperidine-4-carboxylic acid Chemical compound C1CNCCC1(C(O)=O)N(C(=O)CC)C1=CC=CC=C1 ZMYFEFLPUAJLFD-UHFFFAOYSA-N 0.000 description 1
- RTFVPKRWERHIPC-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-(2-phenylethyl)piperidin-4-amine;dihydrochloride Chemical compound Cl.Cl.C1CC(COC)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 RTFVPKRWERHIPC-UHFFFAOYSA-N 0.000 description 1
- MKBOBWSGAIPQGV-UHFFFAOYSA-N 4-(methoxymethyl)-n-phenyl-1-propan-2-ylpiperidin-4-amine Chemical compound C=1C=CC=CC=1NC1(COC)CCN(C(C)C)CC1 MKBOBWSGAIPQGV-UHFFFAOYSA-N 0.000 description 1
- DPBWFNDFMCCGGJ-UHFFFAOYSA-N 4-Piperidine carboxamide Chemical compound NC(=O)C1CCNCC1 DPBWFNDFMCCGGJ-UHFFFAOYSA-N 0.000 description 1
- WUBBRNOQWQTFEX-UHFFFAOYSA-N 4-aminosalicylic acid Chemical compound NC1=CC=C(C(O)=O)C(O)=C1 WUBBRNOQWQTFEX-UHFFFAOYSA-N 0.000 description 1
- PPQMZAUSWIDYTH-UHFFFAOYSA-N 4-anilino-1-(2-phenylethyl)piperidine-4-carboxamide Chemical compound C1CC(C(=O)N)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PPQMZAUSWIDYTH-UHFFFAOYSA-N 0.000 description 1
- RUAGYSNGMAXYGV-UHFFFAOYSA-N 4-anilino-1-ethylpiperidine-4-carboxylic acid Chemical compound C1CN(CC)CCC1(C(O)=O)NC1=CC=CC=C1 RUAGYSNGMAXYGV-UHFFFAOYSA-N 0.000 description 1
- OJLQZKRUQUTPFU-UHFFFAOYSA-N 4-anilinopiperidine-1,4-dicarboxylic acid Chemical compound C1(=CC=CC=C1)NC1(CCN(CC1)C(=O)O)C(=O)O OJLQZKRUQUTPFU-UHFFFAOYSA-N 0.000 description 1
- WAIIZELGDHTPRX-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxamide Chemical compound C=1C=CC=CC=1NC1(C(=O)N)CCNCC1 WAIIZELGDHTPRX-UHFFFAOYSA-N 0.000 description 1
- QIJFNINHULHMLY-UHFFFAOYSA-N 4-anilinopiperidine-4-carboxylic acid Chemical compound C=1C=CC=CC=1NC1(C(=O)O)CCNCC1 QIJFNINHULHMLY-UHFFFAOYSA-N 0.000 description 1
- LVQFHDAKZHGEAJ-UHFFFAOYSA-M 4-methylbenzenesulfonate Chemical compound [CH2]C1=CC=C(S([O-])(=O)=O)C=C1 LVQFHDAKZHGEAJ-UHFFFAOYSA-M 0.000 description 1
- FOWOXWLATUAFNQ-UHFFFAOYSA-N 4-oxopiperidine-1-carboxylic acid Chemical compound OC(=O)N1CCC(=O)CC1 FOWOXWLATUAFNQ-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- SJSCFTULPWEICJ-UHFFFAOYSA-N C(C(=O)O)(=O)O.C(C)(=O)C1(CCN(CC1)CCC1=CC=CC=C1)N(C(=O)C1CC1)C1=CC=CC=C1 Chemical compound C(C(=O)O)(=O)O.C(C)(=O)C1(CCN(CC1)CCC1=CC=CC=C1)N(C(=O)C1CC1)C1=CC=CC=C1 SJSCFTULPWEICJ-UHFFFAOYSA-N 0.000 description 1
- LLDRWVXRTDLEJR-UHFFFAOYSA-N C(C(=O)O)(=O)O.C1(CC1)CN1CCC(CC1)(COC)N(C(CC)=O)C1=CC=CC=C1 Chemical compound C(C(=O)O)(=O)O.C1(CC1)CN1CCC(CC1)(COC)N(C(CC)=O)C1=CC=CC=C1 LLDRWVXRTDLEJR-UHFFFAOYSA-N 0.000 description 1
- DOEXOEWMHNEJJD-UHFFFAOYSA-N C(C(=O)O)(=O)O.O=C(CC)C1(CCN(CC1)CCC=1SC=CC1)N(C(CC)=O)C1=CC=CC=C1 Chemical compound C(C(=O)O)(=O)O.O=C(CC)C1(CCN(CC1)CCC=1SC=CC1)N(C(CC)=O)C1=CC=CC=C1 DOEXOEWMHNEJJD-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- WGHDLDNCAOGFKU-UHFFFAOYSA-N CCOC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CN3C)C(=O)O Chemical compound CCOC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CN3C)C(=O)O WGHDLDNCAOGFKU-UHFFFAOYSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical compound NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- LQMPWKIGXLRYLZ-UHFFFAOYSA-N Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 Chemical compound Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 LQMPWKIGXLRYLZ-UHFFFAOYSA-N 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 238000003747 Grignard reaction Methods 0.000 description 1
- 239000007818 Grignard reagent Substances 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 229910017741 MH2O Inorganic materials 0.000 description 1
- 101100332755 Mus musculus Edar gene Proteins 0.000 description 1
- MBWQAAXIGRTPSI-UHFFFAOYSA-N N-[4-(methoxymethyl)-1-[2-(4-methoxyphenyl)ethyl]piperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC(OC)=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 MBWQAAXIGRTPSI-UHFFFAOYSA-N 0.000 description 1
- UTHMMRIABSFDPA-UHFFFAOYSA-N N-[4-(methoxymethyl)-1-octylpiperidin-4-yl]-N-phenylpropanamide oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCCCCCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 UTHMMRIABSFDPA-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- XCGMJRHRZUYFQR-UHFFFAOYSA-N OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=C(C)C=C1 Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=C(C)C=C1 XCGMJRHRZUYFQR-UHFFFAOYSA-N 0.000 description 1
- 101100332756 Oryzias latipes edar gene Proteins 0.000 description 1
- 238000003436 Schotten-Baumann reaction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- 150000001351 alkyl iodides Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- SWLVFNYSXGMGBS-UHFFFAOYSA-N ammonium bromide Chemical compound [NH4+].[Br-] SWLVFNYSXGMGBS-UHFFFAOYSA-N 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- IERVPIYQSPDPFD-UHFFFAOYSA-N benzyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OCC=1C=CC=CC=1)N(C(=O)CC)C1=CC=CC=C1 IERVPIYQSPDPFD-UHFFFAOYSA-N 0.000 description 1
- LDECUSDQMXVUMP-UHFFFAOYSA-N benzyl 3-[6-[[2-(butylamino)-1-[3-methoxycarbonyl-4-(2-methoxy-2-oxoethoxy)phenyl]-2-oxoethyl]-hexylamino]-6-oxohexyl]-4-methyl-2-oxo-6-(4-phenylphenyl)-1,6-dihydropyrimidine-5-carboxylate Chemical compound O=C1NC(C=2C=CC(=CC=2)C=2C=CC=CC=2)C(C(=O)OCC=2C=CC=CC=2)=C(C)N1CCCCCC(=O)N(CCCCCC)C(C(=O)NCCCC)C1=CC=C(OCC(=O)OC)C(C(=O)OC)=C1 LDECUSDQMXVUMP-UHFFFAOYSA-N 0.000 description 1
- JKGWRSWTPWMXSY-UHFFFAOYSA-N benzyl 4-(n-ethoxycarbonylanilino)-4-(methoxymethyl)piperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC=2C=CC=CC=2)CCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 JKGWRSWTPWMXSY-UHFFFAOYSA-N 0.000 description 1
- RQQGYKUQYGGDFL-UHFFFAOYSA-N benzyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(NC=1C=CC=CC=1)C(=O)OCC1=CC=CC=C1 RQQGYKUQYGGDFL-UHFFFAOYSA-N 0.000 description 1
- VLRSOCXRUOGIFG-UHFFFAOYSA-N benzyl 4-anilino-4-(methoxymethyl)piperidine-1-carboxylate Chemical compound C1CC(COC)(NC=2C=CC=CC=2)CCN1C(=O)OCC1=CC=CC=C1 VLRSOCXRUOGIFG-UHFFFAOYSA-N 0.000 description 1
- PPTSBERGOGHCHC-UHFFFAOYSA-N boron lithium Chemical compound [Li].[B] PPTSBERGOGHCHC-UHFFFAOYSA-N 0.000 description 1
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 1
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- YDSDEBIZUNNPOB-UHFFFAOYSA-N carfentanil Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 YDSDEBIZUNNPOB-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- UKJLNMAFNRKWGR-UHFFFAOYSA-N cyclohexatrienamine Chemical group NC1=CC=C=C[CH]1 UKJLNMAFNRKWGR-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 150000008050 dialkyl sulfates Chemical class 0.000 description 1
- 230000029087 digestion Effects 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 229940113088 dimethylacetamide Drugs 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000005745 ethoxymethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])* 0.000 description 1
- CLGLFWDHORMDOL-UHFFFAOYSA-N ethyl 1-(1-phenylpropan-2-yl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1C(C)CC1=CC=CC=C1 CLGLFWDHORMDOL-UHFFFAOYSA-N 0.000 description 1
- AHXIURGQUQSDJD-UHFFFAOYSA-N ethyl 1-benzyl-4-(4-methylanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(C)=CC=2)CCN1CC1=CC=CC=C1 AHXIURGQUQSDJD-UHFFFAOYSA-N 0.000 description 1
- QOYROTCVRDQKJR-UHFFFAOYSA-N ethyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 QOYROTCVRDQKJR-UHFFFAOYSA-N 0.000 description 1
- PXHXLFIYCYFCBF-UHFFFAOYSA-N ethyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PXHXLFIYCYFCBF-UHFFFAOYSA-N 0.000 description 1
- ZLMQQFXTMZXHIB-UHFFFAOYSA-N ethyl 2,4-dioxo-1-phenyl-3-oxa-1,8-diazaspiro[4.5]decane-8-carboxylate Chemical compound C1CN(C(=O)OCC)CCC21C(=O)OC(=O)N2C1=CC=CC=C1 ZLMQQFXTMZXHIB-UHFFFAOYSA-N 0.000 description 1
- FCZCIXQGZOUIDN-UHFFFAOYSA-N ethyl 2-diethoxyphosphinothioyloxyacetate Chemical compound CCOC(=O)COP(=S)(OCC)OCC FCZCIXQGZOUIDN-UHFFFAOYSA-N 0.000 description 1
- OECKZVXWMJFANW-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 OECKZVXWMJFANW-UHFFFAOYSA-N 0.000 description 1
- SPERRCPYPOXSOZ-UHFFFAOYSA-N ethyl 4-(4-fluoroanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=C(F)C=CC=1NC1(C(=O)OCC)CCNCC1 SPERRCPYPOXSOZ-UHFFFAOYSA-N 0.000 description 1
- RCCCDDCOWBHPMR-UHFFFAOYSA-N ethyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 RCCCDDCOWBHPMR-UHFFFAOYSA-N 0.000 description 1
- FCHANJGLLFHTRV-UHFFFAOYSA-N ethyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OCC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 FCHANJGLLFHTRV-UHFFFAOYSA-N 0.000 description 1
- FGZOTFXLYZDEPL-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CS1 FGZOTFXLYZDEPL-UHFFFAOYSA-N 0.000 description 1
- SHYZHCKFTRVKRT-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)-1-prop-2-enylpiperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C=1C=CC=CC=1N(C(=O)CC)C1(C(=O)OCC)CCN(CC=C)CC1 SHYZHCKFTRVKRT-UHFFFAOYSA-N 0.000 description 1
- PCFIEJLWZLGRMK-UHFFFAOYSA-N ethyl 4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C=1C=CC=CC=1N(C(=O)CC)C1(C(=O)OCC)CCNCC1 PCFIEJLWZLGRMK-UHFFFAOYSA-N 0.000 description 1
- ZSHUDZNARDEKAX-UHFFFAOYSA-N ethyl 4-anilino-4-propanoylpiperidine-1-carboxylate Chemical compound C1CN(C(=O)OCC)CCC1(C(=O)CC)NC1=CC=CC=C1 ZSHUDZNARDEKAX-UHFFFAOYSA-N 0.000 description 1
- MGTMBYUHMOYLQI-UHFFFAOYSA-N ethyl N-[4-(methoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-N-phenylcarbamate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 MGTMBYUHMOYLQI-UHFFFAOYSA-N 0.000 description 1
- KRXRKXPHJRLXIZ-UHFFFAOYSA-N ethyl n-[4-(methoxymethyl)piperidin-4-yl]-n-phenylcarbamate Chemical compound C1CNCCC1(COC)N(C(=O)OCC)C1=CC=CC=C1 KRXRKXPHJRLXIZ-UHFFFAOYSA-N 0.000 description 1
- ZEHIJCKXGZDKBT-UHFFFAOYSA-N ethyl n-[4-pentanoyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylcarbamate Chemical compound C1CC(C(=O)CCCC)(N(C(=O)OCC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 ZEHIJCKXGZDKBT-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000012065 filter cake Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 239000013505 freshwater Substances 0.000 description 1
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 150000004795 grignard reagents Chemical class 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- UMJJFEIKYGFCAT-UHFFFAOYSA-N indan-2-one Chemical compound C1=CC=C2CC(=O)CC2=C1 UMJJFEIKYGFCAT-UHFFFAOYSA-N 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- IHLVCKWPAMTVTG-UHFFFAOYSA-N lithium;carbanide Chemical compound [Li+].[CH3-] IHLVCKWPAMTVTG-UHFFFAOYSA-N 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- AYJPDKSKMSRRSZ-UHFFFAOYSA-N methyl 1-(2-hydroxy-2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound C(C(=O)O)(=O)O.OC(CN1CCC(CC1)(C(=O)OC)N(C1=CC=CC=C1)C(CC)=O)C1=CC=CC=C1 AYJPDKSKMSRRSZ-UHFFFAOYSA-N 0.000 description 1
- VKFQFGRAFZXPHL-UHFFFAOYSA-N methyl 1-(2-phenylethyl)-4-[N-propanoyl-3-(trifluoromethyl)anilino]piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC(C(F)(F)F)=C1 VKFQFGRAFZXPHL-UHFFFAOYSA-N 0.000 description 1
- LNGRJEDTWSANLZ-UHFFFAOYSA-N methyl 1-(3-phenylpropyl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CN(CCCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 LNGRJEDTWSANLZ-UHFFFAOYSA-N 0.000 description 1
- AOVNTKNRXQVROB-UHFFFAOYSA-N methyl 1-(4-phenylcyclohexyl)-4-(n-propanoylanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(C2CCC(CC2)C=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 AOVNTKNRXQVROB-UHFFFAOYSA-N 0.000 description 1
- MADXWCPKYMCHCX-UHFFFAOYSA-N methyl 1-[2-(3-methylphenyl)ethyl]-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=C(C)C=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 MADXWCPKYMCHCX-UHFFFAOYSA-N 0.000 description 1
- CXLSUTOBXXFOEV-UHFFFAOYSA-N methyl 1-[2-(4-methylphenyl)ethyl]-4-(n-propanoylanilino)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC(C)=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 CXLSUTOBXXFOEV-UHFFFAOYSA-N 0.000 description 1
- PZTAXFCWFQYJIT-UHFFFAOYSA-N methyl 1-benzyl-4-(4-fluoroanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CC1=CC=CC=C1 PZTAXFCWFQYJIT-UHFFFAOYSA-N 0.000 description 1
- BVPKBZOMDAUYBV-UHFFFAOYSA-N methyl 1-benzyl-4-(4-methoxyanilino)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(OC)=CC=2)CCN1CC1=CC=CC=C1 BVPKBZOMDAUYBV-UHFFFAOYSA-N 0.000 description 1
- VMMBTWYRNBZETA-UHFFFAOYSA-N methyl 1-butyl-4-(N-propanoylanilino)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCCC)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 VMMBTWYRNBZETA-UHFFFAOYSA-N 0.000 description 1
- JWXGBLNGCIGLBH-UHFFFAOYSA-N methyl 3-methyl-4-oxopiperidine-1-carboxylate Chemical compound COC(=O)N1CCC(=O)C(C)C1 JWXGBLNGCIGLBH-UHFFFAOYSA-N 0.000 description 1
- SQYQVMHGGUYZAY-UHFFFAOYSA-N methyl 4-(3-methoxyanilino)piperidine-4-carboxylate Chemical compound C=1C=CC(OC)=CC=1NC1(C(=O)OC)CCNCC1 SQYQVMHGGUYZAY-UHFFFAOYSA-N 0.000 description 1
- LQMWMBAVAZHELP-UHFFFAOYSA-N methyl 4-(4-fluoro-N-propanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=C(F)C=C1 LQMWMBAVAZHELP-UHFFFAOYSA-N 0.000 description 1
- YEQHKOKSOZNVNF-UHFFFAOYSA-N methyl 4-(4-fluoroanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OC)(NC=2C=CC(F)=CC=2)CCN1CCC1=CC=CC=C1 YEQHKOKSOZNVNF-UHFFFAOYSA-N 0.000 description 1
- WUHXITZPBJMGRU-UHFFFAOYSA-N methyl 4-(4-fluoroanilino)piperidine-4-carboxylate Chemical compound C=1C=C(F)C=CC=1NC1(C(=O)OC)CCNCC1 WUHXITZPBJMGRU-UHFFFAOYSA-N 0.000 description 1
- SGDYEKPUQPFDLI-UHFFFAOYSA-N methyl 4-(4-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C1CC(C(=O)OC)(NC=2C=CC(OC)=CC=2)CCN1CCC1=CC=CC=C1 SGDYEKPUQPFDLI-UHFFFAOYSA-N 0.000 description 1
- JCWHBAHRXUVHCC-UHFFFAOYSA-N methyl 4-(4-methoxyanilino)piperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=C(OC)C=CC=1NC1(C(=O)OC)CCNCC1 JCWHBAHRXUVHCC-UHFFFAOYSA-N 0.000 description 1
- QUXAMUASVHKYOB-UHFFFAOYSA-N methyl 4-(4-methylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC)(NC=2C=CC(C)=CC=2)CCN1CCC1=CC=CC=C1 QUXAMUASVHKYOB-UHFFFAOYSA-N 0.000 description 1
- OTQVKFCIWYSLKE-UHFFFAOYSA-N methyl 4-(n-butanoylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)CCC)C1=CC=CC=C1 OTQVKFCIWYSLKE-UHFFFAOYSA-N 0.000 description 1
- AHQUTPZTOSKFAP-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonyl-4-methoxyanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=C(OC)C=C1 AHQUTPZTOSKFAP-UHFFFAOYSA-N 0.000 description 1
- VELBCGIISKTCLS-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-(1-phenylpropan-2-yl)piperidine-4-carboxylate Chemical compound C1CN(C(C)CC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 VELBCGIISKTCLS-UHFFFAOYSA-N 0.000 description 1
- DDAJZJJXAKYKAF-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 DDAJZJJXAKYKAF-UHFFFAOYSA-N 0.000 description 1
- MBSHHKOFTQRAOS-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2SC=CC=2)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 MBSHHKOFTQRAOS-UHFFFAOYSA-N 0.000 description 1
- QAJMZNHUKFQOAG-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-(3-phenylpropyl)piperidine-4-carboxylate Chemical compound C1CN(CCCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 QAJMZNHUKFQOAG-UHFFFAOYSA-N 0.000 description 1
- YFOJBWLQYSHEDJ-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-[2-(2-methylphenyl)ethyl]piperidine-4-carboxylate Chemical compound C1CN(CCC=2C(=CC=CC=2)C)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 YFOJBWLQYSHEDJ-UHFFFAOYSA-N 0.000 description 1
- TYUYSPNKMXPVBQ-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=C(C=CC=2)C(F)(F)F)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 TYUYSPNKMXPVBQ-UHFFFAOYSA-N 0.000 description 1
- WSEHWICMASRMGU-UHFFFAOYSA-N methyl 4-(n-ethoxycarbonylanilino)-1-propan-2-ylpiperidine-4-carboxylate Chemical compound C1CN(C(C)C)CCC1(C(=O)OC)N(C(=O)OCC)C1=CC=CC=C1 WSEHWICMASRMGU-UHFFFAOYSA-N 0.000 description 1
- GJVRZGRJUPGKHG-UHFFFAOYSA-N methyl 4-(n-methoxycarbonylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC)N(C(=O)OC)C1=CC=CC=C1 GJVRZGRJUPGKHG-UHFFFAOYSA-N 0.000 description 1
- BABZHNGIRGHXSO-UHFFFAOYSA-N methyl 4-(n-propanoylanilino)-1-(2-thiophen-2-ylethyl)piperidine-4-carboxylate;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2SC=CC=2)CCC1(C(=O)OC)N(C(=O)CC)C1=CC=CC=C1 BABZHNGIRGHXSO-UHFFFAOYSA-N 0.000 description 1
- DWBZNLFRHNAWPW-UHFFFAOYSA-N methyl 4-[3-(trifluoromethyl)anilino]piperidine-4-carboxylate Chemical compound C=1C=CC(C(F)(F)F)=CC=1NC1(C(=O)OC)CCNCC1 DWBZNLFRHNAWPW-UHFFFAOYSA-N 0.000 description 1
- KVLGIQMTFXBSLU-UHFFFAOYSA-N methyl 4-[n-(cyclopropanecarbonyl)anilino]-1-(2-phenylethyl)piperidine-4-carboxylate;hydrochloride Chemical compound Cl.C1CC(C(=O)OC)(N(C(=O)C2CC2)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 KVLGIQMTFXBSLU-UHFFFAOYSA-N 0.000 description 1
- DOUVSAVSPJJYGQ-UHFFFAOYSA-N methyl 4-anilino-1-propan-2-ylpiperidine-4-carboxylate;dihydrochloride Chemical compound Cl.Cl.C=1C=CC=CC=1NC1(C(=O)OC)CCN(C(C)C)CC1 DOUVSAVSPJJYGQ-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- ORGBRUMLZQRHAY-UHFFFAOYSA-N n-[1-(2-anilinoethyl)-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCNC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ORGBRUMLZQRHAY-UHFFFAOYSA-N 0.000 description 1
- RIGNIZMZYKGGHY-UHFFFAOYSA-N n-[1-benzyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 RIGNIZMZYKGGHY-UHFFFAOYSA-N 0.000 description 1
- AFLKBESYVTWUMU-UHFFFAOYSA-N n-[1-benzyl-4-(methoxymethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CC=2C=CC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 AFLKBESYVTWUMU-UHFFFAOYSA-N 0.000 description 1
- CAXBNVOOBVZOLD-UHFFFAOYSA-N n-[4-(ethoxymethyl)-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CC(COCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 CAXBNVOOBVZOLD-UHFFFAOYSA-N 0.000 description 1
- YLXIOGFTTSNSFW-UHFFFAOYSA-N n-[4-(ethoxymethyl)-1-[2-(1-methylpyrrol-2-yl)ethyl]piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CC(COCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CN1C YLXIOGFTTSNSFW-UHFFFAOYSA-N 0.000 description 1
- KBESXGBNVBNLME-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-(2-naphthalen-1-ylethyl)piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2C3=CC=CC=C3C=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 KBESXGBNVBNLME-UHFFFAOYSA-N 0.000 description 1
- BWRPGSQREAHCKV-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-[2-(1-methylpyrrol-2-yl)ethyl]piperidin-4-yl]-n-phenylpropanamide Chemical compound C1CN(CCC=2N(C=CC=2)C)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 BWRPGSQREAHCKV-UHFFFAOYSA-N 0.000 description 1
- QJUKOQOYOORXMO-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-propan-2-ylpiperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(C(C)C)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 QJUKOQOYOORXMO-UHFFFAOYSA-N 0.000 description 1
- ICCKRZDLWUZYPR-UHFFFAOYSA-N n-[4-(methoxymethyl)-1-propylpiperidin-4-yl]-n-phenylpropanamide;hydrochloride Chemical compound Cl.C1CN(CCC)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 ICCKRZDLWUZYPR-UHFFFAOYSA-N 0.000 description 1
- DPIKFBCGUGZJES-UHFFFAOYSA-N n-[4-acetyl-1-(2-phenylethyl)piperidin-4-yl]-n-phenylpropanamide;oxalic acid Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(C)=O)N(C(=O)CC)C1=CC=CC=C1 DPIKFBCGUGZJES-UHFFFAOYSA-N 0.000 description 1
- YDJXNYNKKXZBMP-UHFFFAOYSA-N n-phenethyl-4-piperidinone Chemical compound C1CC(=O)CCN1CCC1=CC=CC=C1 YDJXNYNKKXZBMP-UHFFFAOYSA-N 0.000 description 1
- PJTTUONVSVGXRW-UHFFFAOYSA-N n-phenyl-1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-amine Chemical compound C1CC(COCC=2C=CC=CC=2)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 PJTTUONVSVGXRW-UHFFFAOYSA-N 0.000 description 1
- LKRMTUUCKBQGFO-UHFFFAOYSA-N n-phenylpiperidin-4-amine Chemical class C1CNCCC1NC1=CC=CC=C1 LKRMTUUCKBQGFO-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000003891 oxalate salts Chemical class 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- HWOCNWRPIUYVDF-UHFFFAOYSA-N oxalic acid N-phenyl-1-(2-phenylethyl)-4-(phenylmethoxymethyl)piperidin-4-amine Chemical compound OC(=O)C(O)=O.C1CC(COCC=2C=CC=CC=2)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 HWOCNWRPIUYVDF-UHFFFAOYSA-N 0.000 description 1
- HFIGUVGJKDDKKB-UHFFFAOYSA-N oxalic acid N-phenyl-N-[1-(2-phenylethyl)-4-propanoylpiperidin-4-yl]propanamide Chemical compound OC(=O)C(O)=O.C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)CC)N(C(=O)CC)C1=CC=CC=C1 HFIGUVGJKDDKKB-UHFFFAOYSA-N 0.000 description 1
- GEVPUGOOGXGPIO-UHFFFAOYSA-N oxalic acid;dihydrate Chemical compound O.O.OC(=O)C(O)=O GEVPUGOOGXGPIO-UHFFFAOYSA-N 0.000 description 1
- PIPVCOVQLQUMQY-UHFFFAOYSA-N oxalic acid;propyl 4-anilino-1-benzylpiperidine-4-carboxylate Chemical compound OC(=O)C(O)=O.C1CC(C(=O)OCCC)(NC=2C=CC=CC=2)CCN1CC1=CC=CC=C1 PIPVCOVQLQUMQY-UHFFFAOYSA-N 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- AHWALFGBDFAJAI-UHFFFAOYSA-N phenyl carbonochloridate Chemical compound ClC(=O)OC1=CC=CC=C1 AHWALFGBDFAJAI-UHFFFAOYSA-N 0.000 description 1
- BCIIMDOZSUCSEN-UHFFFAOYSA-N piperidin-4-amine Chemical compound NC1CCNCC1 BCIIMDOZSUCSEN-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- XBXHCBLBYQEYTI-UHFFFAOYSA-N piperidin-4-ylmethanol Chemical compound OCC1CCNCC1 XBXHCBLBYQEYTI-UHFFFAOYSA-N 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- QROGIFZRVHSFLM-UHFFFAOYSA-N prop-1-enylbenzene Chemical compound CC=CC1=CC=CC=C1 QROGIFZRVHSFLM-UHFFFAOYSA-N 0.000 description 1
- UNTCAZXQXODDDW-UHFFFAOYSA-N prop-2-enyl 4-(n-ethoxycarbonylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OCC=C)N(C(=O)OCC)C1=CC=CC=C1 UNTCAZXQXODDDW-UHFFFAOYSA-N 0.000 description 1
- UQPGCLOZEWKMBO-UHFFFAOYSA-N prop-2-enyl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCC=C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 UQPGCLOZEWKMBO-UHFFFAOYSA-N 0.000 description 1
- AOCZSBRZBSNLOD-UHFFFAOYSA-N propan-2-yl 4-(n-ethoxycarbonylanilino)-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CN(CCC=2C=CC=CC=2)CCC1(C(=O)OC(C)C)N(C(=O)OCC)C1=CC=CC=C1 AOCZSBRZBSNLOD-UHFFFAOYSA-N 0.000 description 1
- VTOVDQCZYVGCIR-UHFFFAOYSA-N propan-2-yl 4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OC(C)C)(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 VTOVDQCZYVGCIR-UHFFFAOYSA-N 0.000 description 1
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- BQCWHLMBFROKFM-UHFFFAOYSA-N propyl 1-(2-hydroxy-2-phenylethyl)-4-(N-propanoylanilino)piperidine-4-carboxylate hydrochloride Chemical compound Cl.C1CC(C(=O)OCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC(O)C1=CC=CC=C1 BQCWHLMBFROKFM-UHFFFAOYSA-N 0.000 description 1
- DFBRRDVLBVIATH-UHFFFAOYSA-N propyl 1-(2-phenylethyl)-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 DFBRRDVLBVIATH-UHFFFAOYSA-N 0.000 description 1
- RWMFGEMCXNIKPR-UHFFFAOYSA-N propyl 1-benzyl-4-(n-propanoylanilino)piperidine-4-carboxylate Chemical compound C1CC(C(=O)OCCC)(N(C(=O)CC)C=2C=CC=CC=2)CCN1CC1=CC=CC=C1 RWMFGEMCXNIKPR-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- HLUKWPFQFJTUCB-UHFFFAOYSA-M sodium;4-anilino-1-(2-phenylethyl)piperidine-4-carboxylate Chemical compound [Na+].C1CC(C(=O)[O-])(NC=2C=CC=CC=2)CCN1CCC1=CC=CC=C1 HLUKWPFQFJTUCB-UHFFFAOYSA-M 0.000 description 1
- GGCSSNBKKAUURC-UHFFFAOYSA-N sufentanil Chemical compound C1CN(CCC=2SC=CC=2)CCC1(COC)N(C(=O)CC)C1=CC=CC=C1 GGCSSNBKKAUURC-UHFFFAOYSA-N 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- KAKQVSNHTBLJCH-UHFFFAOYSA-N trifluoromethanesulfonimidic acid Chemical compound NS(=O)(=O)C(F)(F)F KAKQVSNHTBLJCH-UHFFFAOYSA-N 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/333—Radicals substituted by oxygen or sulfur atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/60—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D211/62—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4
- C07D211/66—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals attached in position 4 having a hetero atom as the second substituent in position 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Pain & Pain Management (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US55851175A | 1975-03-14 | 1975-03-14 | |
| US05/648,685 US3998834A (en) | 1975-03-14 | 1976-01-13 | N-(4-piperidinyl)-n-phenylamides and -carbamates |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH629486A5 true CH629486A5 (de) | 1982-04-30 |
Family
ID=27071767
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH310476A CH629486A5 (de) | 1975-03-14 | 1976-03-12 | Verfahren zur herstellung von neuen piperidin-derivaten. |
Country Status (28)
| Country | Link |
|---|---|
| US (1) | US3998834A (OSRAM) |
| JP (1) | JPS5946217B2 (OSRAM) |
| AT (1) | AT359493B (OSRAM) |
| AU (1) | AU503632B2 (OSRAM) |
| BG (1) | BG28259A3 (OSRAM) |
| CA (1) | CA1080232A (OSRAM) |
| CH (1) | CH629486A5 (OSRAM) |
| CZ (1) | CZ278060B6 (OSRAM) |
| DE (1) | DE2610228A1 (OSRAM) |
| DK (1) | DK148960C (OSRAM) |
| ES (1) | ES446034A1 (OSRAM) |
| FI (1) | FI61481C (OSRAM) |
| FR (1) | FR2303546A1 (OSRAM) |
| GB (1) | GB1538938A (OSRAM) |
| HU (1) | HU172963B (OSRAM) |
| IE (1) | IE42512B1 (OSRAM) |
| IL (1) | IL49204A (OSRAM) |
| IT (1) | IT1057988B (OSRAM) |
| LU (1) | LU74511A1 (OSRAM) |
| NL (1) | NL185279C (OSRAM) |
| NO (1) | NO146162C (OSRAM) |
| NZ (1) | NZ180096A (OSRAM) |
| PH (1) | PH12746A (OSRAM) |
| PL (1) | PL102474B1 (OSRAM) |
| PT (1) | PT64898B (OSRAM) |
| SE (1) | SE426486B (OSRAM) |
| SU (1) | SU1227109A3 (OSRAM) |
| YU (1) | YU39960B (OSRAM) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4179569A (en) * | 1975-03-14 | 1979-12-18 | Janssen Pharmaceutica N.V. | N-(4-piperidinyl)-N-phenylamides |
| US4225606A (en) * | 1975-09-23 | 1980-09-30 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-L-4-piperidinyl)arylacetamides |
| US4208418A (en) * | 1975-09-23 | 1980-06-17 | Janssen Pharmaceutica N.V. | N-Aryl-N-(1-alkyl-4-piperidinyl)arylacetamides |
| FR2389622B1 (OSRAM) * | 1977-05-05 | 1982-05-21 | Janssen Pharmaceutica Nv | |
| US4167574A (en) * | 1978-03-13 | 1979-09-11 | Janssen Pharmaceutica, N.V. | N-phenyl-N-(4-piperidinyl)amides |
| US4584303A (en) * | 1984-04-09 | 1986-04-22 | The Boc Group, Inc. | N-aryl-N-(4-piperidinyl)amides and pharmaceutical compositions and method employing such compounds |
| FR2608602A1 (fr) * | 1986-12-23 | 1988-06-24 | Cerm Cent Europ Rech Mauvernay | Nouvelles 3-piperidineamines ou 3-azepineamines substituees, leur preparation et leurs applications en therapeutique |
| US4921864A (en) * | 1987-11-02 | 1990-05-01 | Boc, Inc. | 4-Phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| USRE33495E (en) * | 1987-11-02 | 1990-12-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-anilino-piperidine compounds and derivatives |
| US5013742A (en) * | 1987-11-02 | 1991-05-07 | Boc, Inc. | 4-phenyl-4-N-(phenyl) amido piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4957929A (en) * | 1987-11-02 | 1990-09-18 | Boc, Inc. | 4-phenyl-4-[N-(phenyl)amido]piperidine compounds and pharmaceutical compositions employing such compounds |
| US4849521A (en) * | 1987-11-02 | 1989-07-18 | Boc, Inc. | Stereoselective preparation of 3-substituted-4-piperidine compounds and derivatives |
| US4791121A (en) * | 1987-11-02 | 1988-12-13 | The Boc Group, Inc. | 4-phenyl-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4801615A (en) * | 1987-12-31 | 1989-01-31 | The Boc Group, Inc. | 4-heterohexacyclic-4-(N-(phenyl)amido) piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US4791120A (en) * | 1987-12-31 | 1988-12-13 | The Boc Group, Inc. | 4-heteropentacyclic-4-[N-(phenyl)amino] piperidine derivatives and pharmaceutical compositions and method employing such compounds |
| US5019583A (en) * | 1989-02-15 | 1991-05-28 | Glaxo Inc. | N-phenyl-N-(4-piperidinyl)amides useful as analgesics |
| USRE34201E (en) * | 1989-04-20 | 1993-03-23 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| US5053411A (en) * | 1989-04-20 | 1991-10-01 | Anaquest, Inc. | N-aryl-N-[4-(1-heterocyclicalkyl)piperidinyl]amides and pharmaceutical compositions and methods employing such compounds |
| US5145967A (en) * | 1989-04-20 | 1992-09-08 | Anaquest, Inc. | Method for preparing 4-alkoxyalkyl-4-phenylaminopiperdines and derivatives thereof |
| US4994471A (en) * | 1989-05-12 | 1991-02-19 | Boc, Inc. | N-aryl-N-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US5100903A (en) * | 1989-05-12 | 1992-03-31 | Anaquest, Inc. | N-aryl-n-(1-substituted-3-alkoxy-4-piperidinyl)amides and pharmaceutical compositions and methods employing such compounds |
| US4939161A (en) * | 1989-05-12 | 1990-07-03 | Boc, Inc. | Analgesic N-aryl-N-[1-substituted-3,5-dimethyl-4-piperidinyl]amides |
| US5126455A (en) * | 1989-12-13 | 1992-06-30 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
| US5039804A (en) * | 1989-12-13 | 1991-08-13 | Glaxo Inc. | Preparation of substituted alkali metal piperidine-4-carboxylates |
| US5130321A (en) * | 1990-12-18 | 1992-07-14 | Glaxo Inc. | Analgesic n-phenyl-n-(3-or 1-3-me-4-piperidinyl)amides |
| US5214148A (en) * | 1990-12-18 | 1993-05-25 | Glaxo Inc. | Analgesic N-phenyl-N-(3-OR1 -3-ME-4-piperidinyl)amides |
| FR2676054B1 (fr) * | 1991-05-03 | 1993-09-03 | Sanofi Elf | Nouveaux composes n-alkylenepiperidino et leurs enantiomeres, procede pour leur preparation et compositions pharmaceutiques les contenant. |
| GB9316863D0 (en) * | 1993-08-13 | 1993-09-29 | Glaxo Group Ltd | Chemical process |
| US5489689A (en) * | 1993-09-30 | 1996-02-06 | Mallinckrodt Chemical, Inc. | Preparation of piperidine derivatives |
| US6541021B1 (en) * | 1999-03-18 | 2003-04-01 | Durect Corporation | Devices and methods for pain management |
| US6835194B2 (en) * | 1999-03-18 | 2004-12-28 | Durect Corporation | Implantable devices and methods for treatment of pain by delivery of fentanyl and fentanyl congeners |
| CA2369691A1 (en) * | 1999-04-09 | 2000-10-19 | Yutaka Miyazaki | 4-hydroxypiperidine derivatives having antiarrhythmic effect |
| US7361666B2 (en) * | 1999-05-25 | 2008-04-22 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US6677332B1 (en) | 1999-05-25 | 2004-01-13 | Sepracor, Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| US6635661B2 (en) | 2000-05-25 | 2003-10-21 | Sepracor Inc. | Heterocyclic analgesic compounds and methods of use thereof |
| WO2001040184A2 (en) * | 1999-12-06 | 2001-06-07 | Mallinckrodt Inc. | Methods for the syntheses of alfentanil, sufentanil and remifentanil |
| US7074803B2 (en) * | 2001-03-02 | 2006-07-11 | Durect Corporation | Opioid formulations |
| US20040102476A1 (en) * | 2002-11-25 | 2004-05-27 | Chan Tai Wah | High concentration formulations of opioids and opioid derivatives |
| JPWO2006030931A1 (ja) * | 2004-09-14 | 2008-05-15 | 日本ケミファ株式会社 | N−置換−n−(4−ピペリジニル)アミド誘導体 |
| JP2008088057A (ja) * | 2005-03-23 | 2008-04-17 | Nippon Chemiphar Co Ltd | N−置換−n−(4−ピペリジニル)アミド誘導体 |
| JP2009515960A (ja) * | 2005-11-17 | 2009-04-16 | マリンクロッド・インコーポレイテッド | レミフェンタニルの合成方法 |
| WO2007087164A2 (en) * | 2006-01-24 | 2007-08-02 | Mallinckrodt Inc. | Process for synthesizing remifentanil |
| EP1867635A1 (en) * | 2006-06-15 | 2007-12-19 | Kern Pharma, S.L. | Process for preparing remifentanil, intermediates thereof, use of said intermediates and processes for their preparation |
| US20080009782A1 (en) * | 2006-06-28 | 2008-01-10 | Alza Corporation | Methods and Devices for Transdermal Electrotransport Delivery of Lofentanil and Carfentanil |
| WO2008005423A1 (en) * | 2006-07-03 | 2008-01-10 | Cambrex Charles City, Inc. | Improved method of making sufentanil |
| EP2125730A2 (en) * | 2006-11-29 | 2009-12-02 | Mallinckrodt Inc. | New process for remifentanil synthesis |
| US20100056574A1 (en) * | 2008-09-04 | 2010-03-04 | Mallinckrodt Inc. | Crystalline Forms of Sufentanil |
| US8299258B2 (en) * | 2008-11-04 | 2012-10-30 | Cambrex Charles City | Method of making piperidine derivatives |
| WO2012037309A2 (en) | 2010-09-17 | 2012-03-22 | Mallinckrodt Llc | Improved process for the preparation of sufentanil base and related compounds |
| EP2455377B1 (de) | 2010-11-11 | 2014-07-09 | hameln rds gmbh | Synthese von Fentanyl Analoga |
| US20120310140A1 (en) | 2010-12-01 | 2012-12-06 | Spinal Modulation, Inc. | Directed delivery of agents to neural anatomy |
| CN110105434B (zh) * | 2013-03-13 | 2024-09-17 | 哈佛大学的校长及成员们 | 钉合且缝合的多肽及其用途 |
| WO2016100823A1 (en) | 2014-12-19 | 2016-06-23 | The Broad Institute, Inc. | Dopamine d2 receptor ligands |
| WO2016100940A1 (en) | 2014-12-19 | 2016-06-23 | The Broad Institute, Inc. | Dopamine d2 receptor ligands |
| CA2986764A1 (en) | 2015-05-27 | 2016-12-01 | Mallinckrodt Llc | Preparation of sufentanil citrate and sufentanil base |
| CN106854203B (zh) * | 2015-12-08 | 2020-12-01 | 江苏恩华药业股份有限公司 | 枸橼酸舒芬太尼的新晶型及其制备方法 |
| PT3199523T (pt) | 2016-01-29 | 2018-11-14 | Bioka S R O | Novo procedimento de fabricação do n-fenil-n-(4-piperidinil) dos derivados de amida, como é a remifentanila e a carfentanila |
| CN108503579B (zh) * | 2018-03-28 | 2021-03-26 | 南京医科大学 | 芬太尼类似物及其应用 |
| CN113214139B (zh) * | 2020-02-03 | 2022-03-04 | 江苏谛奇医药科技有限公司 | 哌啶酰胺类衍生物及其制备方法、其药物组合物、其单晶培养方法及其应用 |
| CR20230125A (es) | 2020-08-14 | 2023-05-11 | Novartis Ag | Derivados de espiropiperidinilo sustituidos con heteroarilo y usos farmacéuticos de los mismos |
| CN114262320A (zh) * | 2021-12-28 | 2022-04-01 | 宜昌人福药业有限责任公司 | 一种利用连续流微通道反应器制备苯胺基哌啶类药物的合成方法 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3171838A (en) * | 1961-10-10 | 1965-03-02 | Res Lab Dr C Janssen N V | Aroylalkyl and hydroxyaralkyl derivatives of 4-(n-arylalkanamido)-piperidines and related compounds |
| BE623427A (OSRAM) * | 1961-10-10 |
-
1976
- 1976-01-13 US US05/648,685 patent/US3998834A/en not_active Expired - Lifetime
- 1976-02-23 NO NO760591A patent/NO146162C/no unknown
- 1976-02-24 NZ NZ180096A patent/NZ180096A/xx unknown
- 1976-02-27 CA CA246,697A patent/CA1080232A/en not_active Expired
- 1976-02-27 SE SE7602740A patent/SE426486B/xx active Protection Beyond IP Right Term
- 1976-03-09 LU LU74511A patent/LU74511A1/xx unknown
- 1976-03-10 FR FR7606870A patent/FR2303546A1/fr active Granted
- 1976-03-10 GB GB9593/76A patent/GB1538938A/en not_active Expired
- 1976-03-11 HU HU76JA00000751A patent/HU172963B/hu unknown
- 1976-03-11 DE DE19762610228 patent/DE2610228A1/de active Granted
- 1976-03-12 IL IL49204A patent/IL49204A/xx unknown
- 1976-03-12 IT IT48556/76A patent/IT1057988B/it active
- 1976-03-12 JP JP51026226A patent/JPS5946217B2/ja not_active Expired
- 1976-03-12 SU SU762332950A patent/SU1227109A3/ru active
- 1976-03-12 YU YU652/76A patent/YU39960B/xx unknown
- 1976-03-12 FI FI760646A patent/FI61481C/fi not_active IP Right Cessation
- 1976-03-12 BG BG032601A patent/BG28259A3/xx unknown
- 1976-03-12 PT PT64898A patent/PT64898B/pt unknown
- 1976-03-12 PL PL1976187910A patent/PL102474B1/pl unknown
- 1976-03-12 IE IE527/76A patent/IE42512B1/en not_active IP Right Cessation
- 1976-03-12 DK DK110376A patent/DK148960C/da not_active IP Right Cessation
- 1976-03-12 NL NLAANVRAGE7602612,A patent/NL185279C/xx not_active IP Right Cessation
- 1976-03-12 ES ES446034A patent/ES446034A1/es not_active Expired
- 1976-03-12 CZ CS761632A patent/CZ278060B6/cs unknown
- 1976-03-12 PH PH18204A patent/PH12746A/en unknown
- 1976-03-12 AT AT184676A patent/AT359493B/de not_active IP Right Cessation
- 1976-03-12 CH CH310476A patent/CH629486A5/de not_active IP Right Cessation
- 1976-03-15 AU AU12006/76A patent/AU503632B2/en not_active Expired
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH629486A5 (de) | Verfahren zur herstellung von neuen piperidin-derivaten. | |
| DE69531331T2 (de) | Phenylpiperidinderivate als neurokinin antagonists | |
| DE69103206T2 (de) | Neue Derivate des Aminopiperidins, Aminopyrrolidins und des Aminoperhydroazepins, Verfahren zur Herstellung und diese enthaltende Arzneimittel. | |
| DE2636614C2 (OSRAM) | ||
| EP0004952B1 (de) | Spiro-(dihydrobenzofuranpiperidine und -pyrrolidine) und deren Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung für Arzneimittel | |
| DE69221919T2 (de) | Piperidin-Derivate | |
| DE2458177A1 (de) | Substituierte 1,3-dihydrospiro eckige klammer auf isobenzofurane eckige klammer zu | |
| CH625787A5 (OSRAM) | ||
| DE3612337A1 (de) | 4h-1-benzopyran-4-on-derivate, ein verfahren zu ihrer herstellung und ihre verwendung als arzneimittel | |
| DE69806141T2 (de) | Indazoleamid-verbindungen als serotoninergene mittel | |
| DE1470124A1 (de) | Verfahren zur Herstellung von neuen Benzimidazolderivaten und ihren Salzen | |
| DE2819210A1 (de) | 4-aminomethyl-1-(3,3,3-triarylpropyl)-4-arylpiperidin und dessen derivate | |
| CH615173A5 (OSRAM) | ||
| DE2002840A1 (de) | 2,3,5-trisubstit,-2'-Hydroxy-6,7-benzomorphane und Verfahren zu deren Herstellung | |
| DE69825746T2 (de) | Verfahren und Zwischenprodukte zur Trennung von Piperidylacetamid-Stereoisomeren | |
| DE68924751T2 (de) | Azacyclische Verbindungen, verwendbar als Arzneimittel. | |
| DD147537A5 (de) | Verfahren zur herstellung von 1,2,4,5-tetra-alkyl-4-aryl-piperidinen | |
| DE2719211C3 (de) | 1-(2-Phenylamino-äthyl)-4-(N-phenyl-N-propionylamino)-piperidine, Verfahren zu ihrer Herstellung und sie enthaltende Arzneimittel | |
| DE2642856C2 (OSRAM) | ||
| DE2628570A1 (de) | 10- eckige klammer auf omega- (benzoylpiperidinyl)-alkyl eckige klammer zu phenothiazine und verfahren zu ihrer herstellung | |
| DE2819873C2 (OSRAM) | ||
| CH417574A (de) | Verfahren zur Herstellung therapeutisch wirksamer Dibenzocycloheptanderivate | |
| DE60107292T2 (de) | Verfahren zur Herstellung von (+)-trans-4-p-Fluorophenyl-3-hydroxymethyl-1-methylpiperidin | |
| CH638184A5 (de) | Verfahren zur herstellung neuer phenylazacycloalkane. | |
| DE2748466A1 (de) | 4a-aryloctahydro-1h-2-pyrindine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |