CH626650A5 - - Google Patents
Download PDFInfo
- Publication number
- CH626650A5 CH626650A5 CH1689374A CH1689374A CH626650A5 CH 626650 A5 CH626650 A5 CH 626650A5 CH 1689374 A CH1689374 A CH 1689374A CH 1689374 A CH1689374 A CH 1689374A CH 626650 A5 CH626650 A5 CH 626650A5
- Authority
- CH
- Switzerland
- Prior art keywords
- amino
- group
- acid
- formula
- coupling component
- Prior art date
Links
- 239000002253 acid Substances 0.000 claims description 55
- 239000000975 dye Substances 0.000 claims description 42
- 230000008878 coupling Effects 0.000 claims description 24
- 238000010168 coupling process Methods 0.000 claims description 24
- 238000005859 coupling reaction Methods 0.000 claims description 24
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 18
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 238000000034 method Methods 0.000 claims description 14
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 13
- 150000001875 compounds Chemical class 0.000 claims description 11
- 229910052757 nitrogen Inorganic materials 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 9
- 230000008569 process Effects 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 8
- VMKJWLXVLHBJNK-UHFFFAOYSA-N cyanuric fluoride Chemical compound FC1=NC(F)=NC(F)=N1 VMKJWLXVLHBJNK-UHFFFAOYSA-N 0.000 claims description 7
- 150000002431 hydrogen Chemical class 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 150000001412 amines Chemical class 0.000 claims description 5
- 125000004432 carbon atom Chemical group C* 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 150000005840 aryl radicals Chemical class 0.000 claims description 4
- 239000007859 condensation product Substances 0.000 claims description 4
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 3
- 150000002790 naphthalenes Chemical class 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 claims description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims 1
- 150000004985 diamines Chemical class 0.000 claims 1
- 229910052760 oxygen Inorganic materials 0.000 claims 1
- 239000001301 oxygen Substances 0.000 claims 1
- APXBXAJWVZTKSE-UHFFFAOYSA-N pyridine-2,3,4-triamine Chemical class NC1=CC=NC(N)=C1N APXBXAJWVZTKSE-UHFFFAOYSA-N 0.000 claims 1
- WLFXSECCHULRRO-UHFFFAOYSA-N pyridine-2,6-diol Chemical compound OC1=CC=CC(O)=N1 WLFXSECCHULRRO-UHFFFAOYSA-N 0.000 claims 1
- 229910052717 sulfur Inorganic materials 0.000 claims 1
- 239000011593 sulfur Substances 0.000 claims 1
- -1 amino-azo Chemical class 0.000 description 48
- 150000003254 radicals Chemical class 0.000 description 17
- 239000000243 solution Substances 0.000 description 16
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 150000004699 copper complex Chemical class 0.000 description 10
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 10
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 9
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 9
- 239000010949 copper Substances 0.000 description 9
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 8
- 229910052804 chromium Inorganic materials 0.000 description 8
- 239000011651 chromium Substances 0.000 description 8
- 229910052802 copper Inorganic materials 0.000 description 8
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 6
- 150000004056 anthraquinones Chemical class 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 235000002639 sodium chloride Nutrition 0.000 description 6
- 125000000542 sulfonic acid group Chemical group 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 150000001555 benzenes Chemical class 0.000 description 5
- 125000002843 carboxylic acid group Chemical group 0.000 description 5
- 238000009833 condensation Methods 0.000 description 5
- 230000005494 condensation Effects 0.000 description 5
- 230000007062 hydrolysis Effects 0.000 description 5
- 238000006460 hydrolysis reaction Methods 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000011780 sodium chloride Substances 0.000 description 5
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 4
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methylaniline Chemical compound CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 4
- 125000002252 acyl group Chemical group 0.000 description 4
- 239000000987 azo dye Substances 0.000 description 4
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 4
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 4
- 238000004043 dyeing Methods 0.000 description 4
- 239000004744 fabric Substances 0.000 description 4
- 125000005843 halogen group Chemical group 0.000 description 4
- 238000010438 heat treatment Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 230000007935 neutral effect Effects 0.000 description 4
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 4
- 150000003021 phthalic acid derivatives Chemical class 0.000 description 4
- VOPSFYWMOIKYEM-UHFFFAOYSA-N 2,5-diaminobenzene-1,4-disulfonic acid Chemical compound NC1=CC(S(O)(=O)=O)=C(N)C=C1S(O)(=O)=O VOPSFYWMOIKYEM-UHFFFAOYSA-N 0.000 description 3
- HVBSAKJJOYLTQU-UHFFFAOYSA-N 4-aminobenzenesulfonic acid Chemical compound NC1=CC=C(S(O)(=O)=O)C=C1 HVBSAKJJOYLTQU-UHFFFAOYSA-N 0.000 description 3
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 3
- PJANXHGTPQOBST-VAWYXSNFSA-N Stilbene Natural products C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 3
- 125000003545 alkoxy group Chemical group 0.000 description 3
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 3
- 229920002678 cellulose Polymers 0.000 description 3
- 239000001913 cellulose Substances 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 125000001624 naphthyl group Chemical group 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 235000021286 stilbenes Nutrition 0.000 description 3
- 210000002268 wool Anatomy 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical group C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 2
- JWAZRIHNYRIHIV-UHFFFAOYSA-N 2-naphthol Chemical compound C1=CC=CC2=CC(O)=CC=C21 JWAZRIHNYRIHIV-UHFFFAOYSA-N 0.000 description 2
- ZAJAQTYSTDTMCU-UHFFFAOYSA-N 3-aminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1 ZAJAQTYSTDTMCU-UHFFFAOYSA-N 0.000 description 2
- RZVHIXYEVGDQDX-UHFFFAOYSA-N 9,10-anthraquinone Chemical class C1=CC=C2C(=O)C3=CC=CC=C3C(=O)C2=C1 RZVHIXYEVGDQDX-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 239000004215 Carbon black (E152) Substances 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 2
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M Potassium chloride Chemical compound [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- DZBUGLKDJFMEHC-UHFFFAOYSA-N acridine Chemical compound C1=CC=CC2=CC3=CC=CC=C3N=C21 DZBUGLKDJFMEHC-UHFFFAOYSA-N 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000000732 arylene group Chemical group 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- 150000004696 coordination complex Chemical class 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 239000003599 detergent Substances 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- ICIDZHMCYAIUIJ-UHFFFAOYSA-N dinaphthalen-1-yldiazene Chemical compound C1=CC=C2C(N=NC=3C4=CC=CC=C4C=CC=3)=CC=CC2=C1 ICIDZHMCYAIUIJ-UHFFFAOYSA-N 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 2
- 239000000543 intermediate Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- YYHJPNVCYHVPJK-UHFFFAOYSA-N naphthalen-1-yl-(2-phenylnaphthalen-1-yl)diazene Chemical class C1=CC=CC=C1C1=CC=C(C=CC=C2)C2=C1N=NC1=CC=CC2=CC=CC=C12 YYHJPNVCYHVPJK-UHFFFAOYSA-N 0.000 description 2
- VILFVXYKHXVYAB-UHFFFAOYSA-N naphthalene-2,7-disulfonic acid Chemical compound C1=CC(S(O)(=O)=O)=CC2=CC(S(=O)(=O)O)=CC=C21 VILFVXYKHXVYAB-UHFFFAOYSA-N 0.000 description 2
- 239000001005 nitro dye Substances 0.000 description 2
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- PJANXHGTPQOBST-UHFFFAOYSA-N stilbene Chemical compound C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 2
- 229950000244 sulfanilic acid Drugs 0.000 description 2
- 238000006277 sulfonation reaction Methods 0.000 description 2
- AKEJUJNQAAGONA-UHFFFAOYSA-N sulfur trioxide Chemical compound O=S(=O)=O AKEJUJNQAAGONA-UHFFFAOYSA-N 0.000 description 2
- XOAAWQZATWQOTB-UHFFFAOYSA-N taurine Chemical compound NCCS(O)(=O)=O XOAAWQZATWQOTB-UHFFFAOYSA-N 0.000 description 2
- QAUVXDIEJLLPQG-UHFFFAOYSA-N (3-carbamoyl-2-hydroxy-6-oxo-1h-pyridin-4-yl)methanesulfonic acid Chemical compound NC(=O)C1=C(O)N=C(O)C=C1CS(O)(=O)=O QAUVXDIEJLLPQG-UHFFFAOYSA-N 0.000 description 1
- FIDRAVVQGKNYQK-UHFFFAOYSA-N 1,2,3,4-tetrahydrotriazine Chemical compound C1NNNC=C1 FIDRAVVQGKNYQK-UHFFFAOYSA-N 0.000 description 1
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- VJDQIBUPTBGINF-UHFFFAOYSA-N 1,3-dioxo-2-benzofuran-5-sulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(=O)OC(=O)C2=C1 VJDQIBUPTBGINF-UHFFFAOYSA-N 0.000 description 1
- UGEHFOSBNBEWMP-UHFFFAOYSA-N 2,3-diaminobenzenesulfonic acid Chemical compound NC1=CC=CC(S(O)(=O)=O)=C1N UGEHFOSBNBEWMP-UHFFFAOYSA-N 0.000 description 1
- QIFDCILTTXPUSC-UHFFFAOYSA-N 2-(methylamino)ethyl hydrogen sulfate Chemical compound CNCCOS(O)(=O)=O QIFDCILTTXPUSC-UHFFFAOYSA-N 0.000 description 1
- FECNOIODIVNEKI-UHFFFAOYSA-N 2-[(2-aminobenzoyl)amino]benzoic acid Chemical class NC1=CC=CC=C1C(=O)NC1=CC=CC=C1C(O)=O FECNOIODIVNEKI-UHFFFAOYSA-N 0.000 description 1
- SKZSFCVUIPNMKJ-UHFFFAOYSA-N 2-[(7-amino-1-hydroxy-3-sulfonaphthalen-2-yl)diazenyl]benzene-1,4-disulfonic acid Chemical compound OC=1C2=CC(N)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC(S(O)(=O)=O)=CC=C1S(O)(=O)=O SKZSFCVUIPNMKJ-UHFFFAOYSA-N 0.000 description 1
- XFAWFWZQPYCAPS-UHFFFAOYSA-N 2-[[1-(3-aminophenyl)-3-methyl-5-oxo-4H-pyrazol-4-yl]diazenyl]benzene-1,4-disulfonic acid Chemical compound NC=1C=C(C=CC=1)N1N=C(C(C1=O)N=NC1=C(C=CC(=C1)S(=O)(=O)O)S(=O)(=O)O)C XFAWFWZQPYCAPS-UHFFFAOYSA-N 0.000 description 1
- HTSAIYNUUSUYAJ-UHFFFAOYSA-N 2-acetamido-5-aminobenzenesulfonic acid Chemical compound CC(=O)NC1=CC=C(N)C=C1S(O)(=O)=O HTSAIYNUUSUYAJ-UHFFFAOYSA-N 0.000 description 1
- ZSHBMZSRGYTTDI-UHFFFAOYSA-N 2-amino-5-hydroxy-6-[[2-methoxy-5-methyl-4-[(2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-1,7-disulfonic acid Chemical compound NC1=C(C=2C=C(C(=C(C2C=C1)O)N=NC1=C(C=C(C(=C1)C)N=NC1=C(C=CC=C1)S(=O)(=O)O)OC)S(=O)(=O)O)S(=O)(=O)O ZSHBMZSRGYTTDI-UHFFFAOYSA-N 0.000 description 1
- ZMCHBSMFKQYNKA-UHFFFAOYSA-N 2-aminobenzenesulfonic acid Chemical compound NC1=CC=CC=C1S(O)(=O)=O ZMCHBSMFKQYNKA-UHFFFAOYSA-N 0.000 description 1
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 1
- AJHPGXZOIAYYDW-UHFFFAOYSA-N 3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid Chemical compound CC(C)(C)OC(=O)NC(C(O)=O)CC1=CC=CC=C1C#N AJHPGXZOIAYYDW-UHFFFAOYSA-N 0.000 description 1
- IRGXCZQWHGTCIF-UHFFFAOYSA-N 3-[(4,6-diamino-3-cyanopyridin-2-yl)amino]benzenesulfonic acid Chemical compound NC1=CC(N)=C(C#N)C(NC=2C=C(C=CC=2)S(O)(=O)=O)=N1 IRGXCZQWHGTCIF-UHFFFAOYSA-N 0.000 description 1
- RSJOQQZQYGPSOF-UHFFFAOYSA-N 3-[(4-acetamido-2-sulfophenyl)diazenyl]-4-hydroxy-7-(methylamino)naphthalene-2-sulfonic acid Chemical compound OS(=O)(=O)C1=CC2=CC(NC)=CC=C2C(O)=C1N=NC1=CC=C(NC(C)=O)C=C1S(O)(=O)=O RSJOQQZQYGPSOF-UHFFFAOYSA-N 0.000 description 1
- XXZDPVOWJBCNQC-UHFFFAOYSA-N 3-[(4-amino-2-methylphenyl)diazenyl]naphthalene-1,5-disulfonic acid Chemical compound CC1=CC(N)=CC=C1N=NC1=CC(S(O)(=O)=O)=C(C=CC=C2S(O)(=O)=O)C2=C1 XXZDPVOWJBCNQC-UHFFFAOYSA-N 0.000 description 1
- RVRQTUBQRRUMGK-UHFFFAOYSA-N 3-acetamido-8-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=CC(O)=C2C=C(S(O)(=O)=O)C(NC(=O)C)=CC2=C1 RVRQTUBQRRUMGK-UHFFFAOYSA-N 0.000 description 1
- USWINTIHFQKJTR-UHFFFAOYSA-N 3-hydroxynaphthalene-2,7-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C2C=C(S(O)(=O)=O)C(O)=CC2=C1 USWINTIHFQKJTR-UHFFFAOYSA-N 0.000 description 1
- FAXDZWQIWUSWJH-UHFFFAOYSA-N 3-methoxypropan-1-amine Chemical compound COCCCN FAXDZWQIWUSWJH-UHFFFAOYSA-N 0.000 description 1
- NHLAPJMCARJFOG-UHFFFAOYSA-N 3-methyl-1,4-dihydropyrazol-5-one Chemical compound CC1=NNC(=O)C1 NHLAPJMCARJFOG-UHFFFAOYSA-N 0.000 description 1
- FRKPCXYPIHAOFI-UHFFFAOYSA-N 3-methylaniline Chemical compound [CH2]C1=CC=CC(N)=C1 FRKPCXYPIHAOFI-UHFFFAOYSA-N 0.000 description 1
- SDGNNLQZAPXALR-UHFFFAOYSA-N 3-sulfophthalic acid Chemical class OC(=O)C1=CC=CC(S(O)(=O)=O)=C1C(O)=O SDGNNLQZAPXALR-UHFFFAOYSA-N 0.000 description 1
- YADSWTKOIHUSDX-UHFFFAOYSA-N 4,6-diaminobenzene-1,3-disulfonic acid Chemical compound NC1=CC(N)=C(S(O)(=O)=O)C=C1S(O)(=O)=O YADSWTKOIHUSDX-UHFFFAOYSA-N 0.000 description 1
- KRLKXOLFFQWKPZ-UHFFFAOYSA-N 4-(bromomethyl)pyridine Chemical compound BrCC1=CC=NC=C1 KRLKXOLFFQWKPZ-UHFFFAOYSA-N 0.000 description 1
- RXNKCIBVUNMMAD-UHFFFAOYSA-N 4-[9-(4-amino-3-fluorophenyl)fluoren-9-yl]-2-fluoroaniline Chemical compound C1=C(F)C(N)=CC=C1C1(C=2C=C(F)C(N)=CC=2)C2=CC=CC=C2C2=CC=CC=C21 RXNKCIBVUNMMAD-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-PZFLKRBQSA-N 4-amino-3,5-ditritiobenzoic acid Chemical compound [3H]c1cc(cc([3H])c1N)C(O)=O ALYNCZNDIQEVRV-PZFLKRBQSA-N 0.000 description 1
- NHHOHOZBHYGTET-UHFFFAOYSA-N 4-amino-6-[(4-chloro-2-sulfophenyl)diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OC1=C2C(N)=CC=C(S(O)(=O)=O)C2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(Cl)C=C1S(O)(=O)=O NHHOHOZBHYGTET-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical compound NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 1
- BUVOCOQOYNGMCO-UHFFFAOYSA-N 4-benzamido-5-hydroxynaphthalene-1,7-disulfonic acid Chemical compound C=12C(O)=CC(S(O)(=O)=O)=CC2=C(S(O)(=O)=O)C=CC=1NC(=O)C1=CC=CC=C1 BUVOCOQOYNGMCO-UHFFFAOYSA-N 0.000 description 1
- HIMMCCJEMMCUJS-UHFFFAOYSA-N 4-fluorotriazine Chemical compound FC1=CC=NN=N1 HIMMCCJEMMCUJS-UHFFFAOYSA-N 0.000 description 1
- XHHWJFFOFMYBHG-UHFFFAOYSA-N 4-hydroxy-3-[(4-methoxy-2-sulfophenyl)diazenyl]-6-(methylamino)naphthalene-2-sulfonic acid Chemical compound OC=1C2=CC(NC)=CC=C2C=C(S(O)(=O)=O)C=1N=NC1=CC=C(OC)C=C1S(O)(=O)=O XHHWJFFOFMYBHG-UHFFFAOYSA-N 0.000 description 1
- FEPBITJSIHRMRT-UHFFFAOYSA-N 4-hydroxybenzenesulfonic acid Chemical compound OC1=CC=C(S(O)(=O)=O)C=C1 FEPBITJSIHRMRT-UHFFFAOYSA-N 0.000 description 1
- SXCSXKQTOUHQIY-UHFFFAOYSA-N 4-hydroxynaphthalene-1,7-disulfonic acid Chemical compound OS(=O)(=O)C1=CC=C2C(O)=CC=C(S(O)(=O)=O)C2=C1 SXCSXKQTOUHQIY-UHFFFAOYSA-N 0.000 description 1
- ZENWTXGAHINRMX-UHFFFAOYSA-N 5-(4-nitrobenzoyl)-2-benzofuran-1,3-dione Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)C1=CC=C(C(=O)OC2=O)C2=C1 ZENWTXGAHINRMX-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- WZNRCYVMHBODTD-UHFFFAOYSA-N 5-acetamido-3-[(3-amino-4-sulfophenyl)diazenyl]-4-hydroxynaphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(NC(=O)C)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=C(S(O)(=O)=O)C(N)=C1 WZNRCYVMHBODTD-UHFFFAOYSA-N 0.000 description 1
- ISTNBIUEOOWHHO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[(2-sulfophenyl)diazenyl]naphthalene-2,7-disulfonic acid Chemical compound OC1=C2C(N)=CC(S(O)(=O)=O)=CC2=CC(S(O)(=O)=O)=C1N=NC1=CC=CC=C1S(O)(=O)=O ISTNBIUEOOWHHO-UHFFFAOYSA-N 0.000 description 1
- ZTTJTIAKGUQOMO-UHFFFAOYSA-N 5-amino-4-hydroxy-3-[[2-methoxy-5-methyl-4-[(2-sulfophenyl)diazenyl]phenyl]diazenyl]naphthalene-2,7-disulfonic acid Chemical compound COc1cc(N=Nc2ccccc2S(O)(=O)=O)c(C)cc1N=Nc1c(O)c2c(N)cc(cc2cc1S(O)(=O)=O)S(O)(=O)=O ZTTJTIAKGUQOMO-UHFFFAOYSA-N 0.000 description 1
- YKVBYISUDGOVDM-UHFFFAOYSA-N 6-acetamido-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=C(O)C2=CC(NC(=O)C)=CC=C21 YKVBYISUDGOVDM-UHFFFAOYSA-N 0.000 description 1
- KZCSUEYBKAPKNH-UHFFFAOYSA-N 6-aminonaphthalene-1,3-disulfonic acid Chemical compound OS(=O)(=O)C1=CC(S(O)(=O)=O)=CC2=CC(N)=CC=C21 KZCSUEYBKAPKNH-UHFFFAOYSA-N 0.000 description 1
- ZLHGMJOGMLVDFS-UHFFFAOYSA-N 7-benzamido-4-hydroxynaphthalene-2-sulfonic acid Chemical compound C=1C=C2C(O)=CC(S(O)(=O)=O)=CC2=CC=1NC(=O)C1=CC=CC=C1 ZLHGMJOGMLVDFS-UHFFFAOYSA-N 0.000 description 1
- SROYVYGZVXMVOA-UHFFFAOYSA-N 9,10-dioxoanthracene-1,6-disulfonic acid Chemical compound O=C1C2=CC(S(=O)(=O)O)=CC=C2C(=O)C2=C1C=CC=C2S(O)(=O)=O SROYVYGZVXMVOA-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 229920003043 Cellulose fiber Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- DMBHHRLKUKUOEG-UHFFFAOYSA-N N-phenyl aniline Natural products C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- DYRDKSSFIWVSNM-UHFFFAOYSA-N acetoacetanilide Chemical compound CC(=O)CC(=O)NC1=CC=CC=C1 DYRDKSSFIWVSNM-UHFFFAOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 125000003282 alkyl amino group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 125000001769 aryl amino group Chemical group 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 125000000609 carbazolyl group Chemical class C1(=CC=CC=2C3=CC=CC=C3NC12)* 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001868 cobalt Chemical class 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- GJQPMPFPNINLKP-UHFFFAOYSA-N diclofenamide Chemical compound NS(=O)(=O)C1=CC(Cl)=C(Cl)C(S(N)(=O)=O)=C1 GJQPMPFPNINLKP-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical group 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- KBOPZPXVLCULAV-UHFFFAOYSA-N mesalamine Chemical compound NC1=CC=C(O)C(C(O)=O)=C1 KBOPZPXVLCULAV-UHFFFAOYSA-N 0.000 description 1
- 229960004963 mesalazine Drugs 0.000 description 1
- JJYPMNFTHPTTDI-UHFFFAOYSA-N meta-toluidine Natural products CC1=CC=CC(N)=C1 JJYPMNFTHPTTDI-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- HDZGCSFEDULWCS-UHFFFAOYSA-N monomethylhydrazine Chemical compound CNN HDZGCSFEDULWCS-UHFFFAOYSA-N 0.000 description 1
- WYYGKEQESDLJCE-UHFFFAOYSA-N n-ethylethanamine;morpholine Chemical compound CCNCC.C1COCCN1 WYYGKEQESDLJCE-UHFFFAOYSA-N 0.000 description 1
- VBEGHXKAFSLLGE-UHFFFAOYSA-N n-phenylnitramide Chemical compound [O-][N+](=O)NC1=CC=CC=C1 VBEGHXKAFSLLGE-UHFFFAOYSA-N 0.000 description 1
- HYFMZOAPNQAXHU-UHFFFAOYSA-N naphthalene-1,7-disulfonic acid Chemical compound C1=CC=C(S(O)(=O)=O)C2=CC(S(=O)(=O)O)=CC=C21 HYFMZOAPNQAXHU-UHFFFAOYSA-N 0.000 description 1
- KVBGVZZKJNLNJU-UHFFFAOYSA-N naphthalene-2-sulfonic acid Chemical compound C1=CC=CC2=CC(S(=O)(=O)O)=CC=C21 KVBGVZZKJNLNJU-UHFFFAOYSA-N 0.000 description 1
- 150000002828 nitro derivatives Chemical class 0.000 description 1
- 239000001048 orange dye Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 238000009980 pad dyeing Methods 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 150000003022 phthalic acids Chemical class 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- 235000011164 potassium chloride Nutrition 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 239000004627 regenerated cellulose Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- LJRGBERXYNQPJI-UHFFFAOYSA-M sodium;3-nitrobenzenesulfonate Chemical compound [Na+].[O-][N+](=O)C1=CC=CC(S([O-])(=O)=O)=C1 LJRGBERXYNQPJI-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000010186 staining Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229960003080 taurine Drugs 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B62/00—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves
- C09B62/02—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring
- C09B62/04—Reactive dyes, i.e. dyes which form covalent bonds with the substrates or which polymerise with themselves with the reactive group directly attached to a heterocyclic ring to a triazine ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Treatments For Attaching Organic Compounds To Fibrous Goods (AREA)
Priority Applications (22)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1689374A CH626650A5 (d) | 1974-12-18 | 1974-12-18 | |
GB51352/75A GB1526840A (en) | 1974-12-18 | 1975-12-15 | Reactive triazine dyestuffs |
IT5270975A IT1060524B (it) | 1974-12-18 | 1975-12-16 | Coloranti reattivi e procedimento per la loro produzione ed applicazione |
CA241,822A CA1077469A (en) | 1974-12-18 | 1975-12-16 | Reactive dyestuffs, their manufacture and use |
DE2556640A DE2556640C2 (de) | 1974-12-18 | 1975-12-16 | Reaktivfarbstoffe, deren Herstellung und Verwendung |
AR261637A AR229806A1 (es) | 1974-12-18 | 1975-12-16 | Colorantes reactivos con las fibras de la serie mono-o poliazo,complejo azometalico,ftalocianina o antraquinona que contienen un grupo monofluor-s-triazinilo,procedimiento para su obtencion y composiciones que los contienen |
FR7538479A FR2295094A1 (fr) | 1974-12-18 | 1975-12-16 | Colorants reactifs, procede pour les preparer et leur utilisation |
DE2560422A DE2560422C2 (de) | 1974-12-18 | 1975-12-16 | Reaktivfarbstoffe, deren Herstellung und Verwendung |
ES443587A ES443587A1 (es) | 1974-12-18 | 1975-12-17 | Procedimiento para la preparacion de colorantes reactivos. |
MX17911875A MX150762A (es) | 1974-12-18 | 1975-12-17 | Procedimiento para preparar colorantes reactivos de la serie de triazina |
MX179117A MX150282A (es) | 1974-12-18 | 1975-12-17 | Procedimiento para preparar colorantes reactivos de la serie de la triazina |
MX17911675A MX150761A (es) | 1974-12-18 | 1975-12-17 | Procedimiento para preparar colorantes reactivos de la serie de la triazina |
BE162802A BE836713A (fr) | 1974-12-18 | 1975-12-17 | Colorants reactifs, procede pour les preparer et leur utilisation |
BR7508382*A BR7508382A (pt) | 1974-12-18 | 1975-12-17 | Processo para a preparacao de corantes e sua aplicacao |
CS758671A CS193535B2 (en) | 1974-12-18 | 1975-12-18 | Process for preparing reactive dyes |
JP50151711A JPS612701B2 (d) | 1974-12-18 | 1975-12-18 | |
IN40/CAL/76A IN144464B (d) | 1974-12-18 | 1976-01-06 | |
US05/953,049 US4261889A (en) | 1974-12-18 | 1978-10-19 | Reactive dyestuffs, their manufacture and use |
CH362781A CH628669A5 (de) | 1974-12-18 | 1981-06-03 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371781A CH628671A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371681A CH628670A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
JP58143942A JPS5962669A (ja) | 1974-12-18 | 1983-08-08 | 反応性染料の製法 |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1689374A CH626650A5 (d) | 1974-12-18 | 1974-12-18 |
Publications (1)
Publication Number | Publication Date |
---|---|
CH626650A5 true CH626650A5 (d) | 1981-11-30 |
Family
ID=4421126
Family Applications (4)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH1689374A CH626650A5 (d) | 1974-12-18 | 1974-12-18 | |
CH362781A CH628669A5 (de) | 1974-12-18 | 1981-06-03 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371781A CH628671A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371681A CH628670A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
Family Applications After (3)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH362781A CH628669A5 (de) | 1974-12-18 | 1981-06-03 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371781A CH628671A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
CH371681A CH628670A5 (de) | 1974-12-18 | 1981-06-05 | Verfahren zur herstellung von reaktivfarbstoffen. |
Country Status (14)
Country | Link |
---|---|
US (1) | US4261889A (d) |
JP (2) | JPS612701B2 (d) |
AR (1) | AR229806A1 (d) |
BE (1) | BE836713A (d) |
BR (1) | BR7508382A (d) |
CA (1) | CA1077469A (d) |
CH (4) | CH626650A5 (d) |
CS (1) | CS193535B2 (d) |
DE (2) | DE2560422C2 (d) |
ES (1) | ES443587A1 (d) |
FR (1) | FR2295094A1 (d) |
GB (1) | GB1526840A (d) |
IN (1) | IN144464B (d) |
MX (1) | MX150282A (d) |
Families Citing this family (32)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CH627205A5 (en) * | 1976-06-25 | 1981-12-31 | Ciba Geigy Ag | Process for preparing fibre-reactive azo dyes |
CH617929A5 (d) * | 1976-10-15 | 1980-06-30 | Ciba Geigy Ag | |
DE2654351A1 (de) * | 1976-12-01 | 1978-06-08 | Bayer Ag | Anthrachinon-reaktivfarbstoffe |
DE2655089C2 (de) * | 1976-12-04 | 1984-08-16 | Bayer Ag, 5090 Leverkusen | Azoreaktivfarbstoffe |
DE2657146A1 (de) * | 1976-12-16 | 1978-06-22 | Bayer Ag | Anthrachinon-reaktivfarbstoffe |
DE2729011C2 (de) | 1977-06-28 | 1987-01-15 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
DE2729240C2 (de) * | 1977-06-29 | 1982-07-29 | Bayer Ag, 5090 Leverkusen | Azo-Reaktivfarbstoffe |
DE2733109C2 (de) * | 1977-07-22 | 1983-01-20 | Bayer Ag, 5090 Leverkusen | Faserreaktive Disazofarbstoffe, deren Herstellung und Verwendung |
CH637679A5 (de) * | 1977-07-22 | 1983-08-15 | Bayer Ag | Faserreaktive disazofarbstoffe. |
LU78082A1 (de) * | 1977-09-06 | 1979-05-23 | Ciba Geigy Ag | Farbstoffe,deren herstellung und verwendung |
LU78115A1 (de) * | 1977-09-12 | 1979-05-23 | Ciba Geigy Ag | Azofarbstoffe,deren herstellung und verwendung |
DE2749647A1 (de) * | 1977-11-05 | 1979-05-10 | Bayer Ag | Reaktivfarbstoffe |
CH638555A5 (de) * | 1978-06-19 | 1983-09-30 | Ciba Geigy Ag | Reaktivfarbstoffe und deren herstellung. |
IT1116249B (it) * | 1978-06-19 | 1986-02-10 | Ciba Geigy Ag | Colopanti reattivi e procedimento per la loro produzione ed applicazione |
DE2828227A1 (de) | 1978-06-28 | 1980-01-10 | Bayer Ag | Phthalocyanin-reaktivfarbstoffe |
DE2838616A1 (de) * | 1978-09-05 | 1980-03-13 | Bayer Ag | Faserreaktive azofarbstoffe |
DE2839562A1 (de) * | 1978-09-12 | 1980-03-27 | Bayer Ag | Faserreaktive azofarbstoffe |
DE2849068C2 (de) * | 1978-11-11 | 1985-06-20 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
DE2853823A1 (de) | 1978-12-13 | 1980-07-03 | Bayer Ag | Verfahren zur herstellung von phthalocyanin-reaktivfarbstoffen |
DE2901546A1 (de) | 1979-01-16 | 1980-07-24 | Bayer Ag | Reaktivfarbstoffe |
DE2901481A1 (de) | 1979-01-16 | 1980-07-24 | Bayer Ag | Reaktivfarbstoffe |
US4676803A (en) * | 1979-07-07 | 1987-06-30 | Bayer Aktiengesellschaft | Reactive azo dyestuffs, free from anionic groups and containing a basic group and halogenotriazinyl radical and useful for dyeing cellulose/polyester |
DE3010161A1 (de) * | 1980-03-17 | 1981-09-24 | Bayer Ag, 5090 Leverkusen | Farbstoffe, verfahren zu ihrer herstellung sowie ihre verwendung zum faerben hydroxylgruppen- oder stickstoffhaltiger materialien |
DE3370641D1 (en) * | 1982-06-09 | 1987-05-07 | Ciba Geigy Ag | Process for dyeing or printing fibrous textile materials with reactive dyes |
EP0105027B1 (de) * | 1982-08-25 | 1987-05-06 | Ciba-Geigy Ag | Reaktivfarbstoffe, deren Herstellung und Verwendung |
DE3460464D1 (en) * | 1983-04-15 | 1986-09-18 | Ciba Geigy Ag | Reactive dyes, their preparation and their use |
DE3666700D1 (en) * | 1985-12-24 | 1989-12-07 | Ciba Geigy Ag | Process for the preparation of reactive dyes |
GB2228738B (en) * | 1989-02-24 | 1992-06-17 | Sandoz Ltd | Anionic dioxazine compounds |
DE3917046A1 (de) * | 1989-05-25 | 1990-11-29 | Bayer Ag | Verfahren zur herstellung von substituierten 2,4-diamino-6-fluor-s-triazinen |
GB9602787D0 (en) * | 1996-02-12 | 1996-04-10 | Clariant Finance Bvi Ltd | Organic compounds |
KR100499643B1 (ko) * | 2002-05-30 | 2005-07-05 | (주)경인양행 | 다중치환 아닐린 화합물 및 그것의 제조방법 |
CN102260415A (zh) * | 2010-05-26 | 2011-11-30 | 苏州巴米特信息科技有限公司 | 低盐染色染料 |
Family Cites Families (10)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US3109841A (en) * | 1959-07-31 | 1963-11-05 | Du Pont | Bleach-fast, fiber-reactive orange to red diazo dyes |
DE1930491U (de) | 1963-06-08 | 1966-01-05 | Bruno Pfrommer | Vorrichtung zum abstellen von strick- und wirkmaschinen. |
CH438533A (de) * | 1963-07-10 | 1967-06-30 | Geigy Ag J R | Verfahren zur Herstellung reaktiver Azofarbstoffe |
DE1644208C3 (de) * | 1967-04-19 | 1978-06-01 | Bayer Ag, 5090 Leverkusen | Reaktivfarbstoffe |
US4115378A (en) * | 1967-04-19 | 1978-09-19 | Bayer Aktiengesellschaft | Water soluble reactive axodyestuffs containing a fluorotriazinyl group attached via a nitrogen bridge to the dyestuff molecule |
DE1644616A1 (de) * | 1967-06-02 | 1970-12-17 | Bayer Ag | Anthrachinon-Reaktivfarbstoffe |
CH552035A (de) * | 1968-07-15 | 1974-07-31 | Ciba Geigy Ag | Verfahren zur herstellung von azofarbstoffen. |
BE757602A (fr) * | 1969-10-17 | 1971-04-16 | Geigy Ag J R | Colorants reactifs et leur preparation |
US3966705A (en) * | 1974-01-04 | 1976-06-29 | Ciba-Geigy Corporation | Disulfo naphthalene containing fiber-reactive tetrazo dyes |
CH606347A5 (d) * | 1975-01-15 | 1978-10-31 | Ciba Geigy Ag |
-
1974
- 1974-12-18 CH CH1689374A patent/CH626650A5/de not_active IP Right Cessation
-
1975
- 1975-12-15 GB GB51352/75A patent/GB1526840A/en not_active Expired
- 1975-12-16 AR AR261637A patent/AR229806A1/es active
- 1975-12-16 CA CA241,822A patent/CA1077469A/en not_active Expired
- 1975-12-16 DE DE2560422A patent/DE2560422C2/de not_active Expired
- 1975-12-16 FR FR7538479A patent/FR2295094A1/fr active Granted
- 1975-12-16 DE DE2556640A patent/DE2556640C2/de not_active Expired
- 1975-12-17 BE BE162802A patent/BE836713A/xx not_active IP Right Cessation
- 1975-12-17 BR BR7508382*A patent/BR7508382A/pt unknown
- 1975-12-17 ES ES443587A patent/ES443587A1/es not_active Expired
- 1975-12-17 MX MX179117A patent/MX150282A/es unknown
- 1975-12-18 CS CS758671A patent/CS193535B2/cs unknown
- 1975-12-18 JP JP50151711A patent/JPS612701B2/ja not_active Expired
-
1976
- 1976-01-06 IN IN40/CAL/76A patent/IN144464B/en unknown
-
1978
- 1978-10-19 US US05/953,049 patent/US4261889A/en not_active Expired - Lifetime
-
1981
- 1981-06-03 CH CH362781A patent/CH628669A5/de not_active IP Right Cessation
- 1981-06-05 CH CH371781A patent/CH628671A5/de not_active IP Right Cessation
- 1981-06-05 CH CH371681A patent/CH628670A5/de not_active IP Right Cessation
-
1983
- 1983-08-08 JP JP58143942A patent/JPS5962669A/ja active Granted
Also Published As
Publication number | Publication date |
---|---|
AR229806A1 (es) | 1983-11-30 |
IN144464B (d) | 1978-05-06 |
JPS5962669A (ja) | 1984-04-10 |
GB1526840A (en) | 1978-10-04 |
CS193535B2 (en) | 1979-10-31 |
ES443587A1 (es) | 1977-07-16 |
US4261889A (en) | 1981-04-14 |
CH628671A5 (de) | 1982-03-15 |
DE2556640C2 (de) | 1983-10-27 |
JPS637581B2 (d) | 1988-02-17 |
CH628670A5 (de) | 1982-03-15 |
MX150282A (es) | 1984-04-10 |
BR7508382A (pt) | 1976-09-08 |
FR2295094B1 (d) | 1979-02-02 |
CH628669A5 (de) | 1982-03-15 |
BE836713A (fr) | 1976-06-17 |
JPS5188517A (d) | 1976-08-03 |
DE2560422C2 (de) | 1986-01-30 |
JPS612701B2 (d) | 1986-01-27 |
CA1077469A (en) | 1980-05-13 |
DE2556640A1 (de) | 1976-07-29 |
FR2295094A1 (fr) | 1976-07-16 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CH626650A5 (d) | ||
DE2927102C2 (d) | ||
DE1644208C3 (de) | Reaktivfarbstoffe | |
DE2611550C2 (de) | Faserreaktive Farbstoffe, deren Herstellung und Verwendung | |
DE2614550B2 (de) | Neue Reaktivfarbstoffe, ihre Herstellung und Verwendung zum Färben und Bedrucken von Cellulose sowie natürlichen und synthetischen Polyamidsubstraten | |
CH660016A5 (de) | Reaktivfarbstoffe und deren herstellung. | |
DE2650555A1 (de) | Faserreaktive farbstoffe, deren herstellung und verwendung | |
DE1644203B2 (de) | Reaktivfarbstoffe | |
DE1289929B (de) | Verfahren zur Herstellung von faserreaktiven organischen Farbstoffen | |
DE2653199A1 (de) | Faserreaktive farbstoffe, deren herstellung und verwendung | |
CH638825A5 (de) | Farbstoffe, sowie deren herstellung. | |
DE1223971B (de) | Verfahren zur Herstellung kupferhaltiger, faserreaktiver Monoazofarbstoffe | |
CH467838A (de) | Verfahren zur Herstellung metallfreier Azofarbstoffe | |
DE2331518A1 (de) | Neue farbstoffe, deren herstellung und verwendung | |
CH629839A5 (en) | Process for preparing fibre-reactive azo dyes | |
EP0024668A2 (de) | Reaktivfarbstoffe und deren Verwendung zum Färben und Bedrucken von hydroxylgruppen- und stickstoffhaltigen Materialien | |
CH635859A5 (de) | Azofarbstoffe sowie deren herstellung. | |
DE1419795C3 (de) | Verfahren zur Herstellung von Disazoreaktivfarbstoffen | |
DE2102217C3 (de) | Reaktivfarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung | |
AT225314B (de) | Verfahren zur Herstellung von neuen reaktiven Azo-, Anthrachinon- oder Phthalocyaninfarbstoffen | |
DE1544499C3 (de) | Reaktivfarbstoffe | |
DE1544505C3 (de) | Reaktivfarbstoffe und Verfahren zu deren Herstellung und Anwendung | |
DE2516557A1 (de) | Faserreaktive farbstoffe, deren herstellung und verwendung | |
CH624138A5 (en) | Process for the preparation of fibre-reactive dyes | |
CH615450A5 (en) | Process for preparing fibre-reactive dyes |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PL | Patent ceased | ||
PL | Patent ceased |