CH617452A5 - - Google Patents
Download PDFInfo
- Publication number
- CH617452A5 CH617452A5 CH1431374A CH1431374A CH617452A5 CH 617452 A5 CH617452 A5 CH 617452A5 CH 1431374 A CH1431374 A CH 1431374A CH 1431374 A CH1431374 A CH 1431374A CH 617452 A5 CH617452 A5 CH 617452A5
- Authority
- CH
- Switzerland
- Prior art keywords
- pyrimidine
- cyano
- straight
- carbon atoms
- mixture according
- Prior art date
Links
- 125000004432 carbon atom Chemical group C* 0.000 claims description 69
- 150000001875 compounds Chemical class 0.000 claims description 62
- 239000000203 mixture Substances 0.000 claims description 57
- -1 n-pentyloxy, n-hexyloxy Chemical group 0.000 claims description 53
- 125000000217 alkyl group Chemical group 0.000 claims description 41
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 claims description 40
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 125000004423 acyloxy group Chemical group 0.000 claims description 20
- HHPCNRKYVYWYAU-UHFFFAOYSA-N 4-cyano-4'-pentylbiphenyl Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(C#N)C=C1 HHPCNRKYVYWYAU-UHFFFAOYSA-N 0.000 claims description 18
- 125000005910 alkyl carbonate group Chemical group 0.000 claims description 16
- RGONNDWSVOCREF-UHFFFAOYSA-N 4-(5-pentylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCCCC)=CN=C1C1=CC=C(C#N)C=C1 RGONNDWSVOCREF-UHFFFAOYSA-N 0.000 claims description 13
- YYXBAYZPDQVLAE-UHFFFAOYSA-N 2-(4-hexylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=C(C#N)C=N1 YYXBAYZPDQVLAE-UHFFFAOYSA-N 0.000 claims description 11
- VSNGFYYRBATOTN-UHFFFAOYSA-N 4-(5-heptylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 VSNGFYYRBATOTN-UHFFFAOYSA-N 0.000 claims description 11
- 239000000126 substance Substances 0.000 claims description 11
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 10
- VWJMXUYCJCQLLY-UHFFFAOYSA-N 2-(4-pentylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCCC)=CC=C1C1=NC=C(C#N)C=N1 VWJMXUYCJCQLLY-UHFFFAOYSA-N 0.000 claims description 9
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 claims description 9
- 150000002148 esters Chemical class 0.000 claims description 9
- LBFLIDCXWNVNLB-UHFFFAOYSA-N 2-(4-butoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCC)=CC=C1C1=NC=C(C#N)C=N1 LBFLIDCXWNVNLB-UHFFFAOYSA-N 0.000 claims description 7
- BSKDQEJRUNEAQO-UHFFFAOYSA-N 2-(4-butylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCC)=CC=C1C1=NC=C(C#N)C=N1 BSKDQEJRUNEAQO-UHFFFAOYSA-N 0.000 claims description 7
- 238000002360 preparation method Methods 0.000 claims description 7
- ZGOWXOZNUNZPAV-UHFFFAOYSA-N 4-(4-heptylphenyl)benzonitrile Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(C#N)C=C1 ZGOWXOZNUNZPAV-UHFFFAOYSA-N 0.000 claims description 6
- 238000000034 method Methods 0.000 claims description 6
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- OIRIIWRPWWSCPD-UHFFFAOYSA-N 2-(4-propylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCC)=CC=C1C1=NC=C(C#N)C=N1 OIRIIWRPWWSCPD-UHFFFAOYSA-N 0.000 claims description 5
- MAYOJSWIHDBLSY-UHFFFAOYSA-N 4-(5-hexylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCCCCC)=CN=C1C1=CC=C(C#N)C=C1 MAYOJSWIHDBLSY-UHFFFAOYSA-N 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- MGEQCYFPPOWIEZ-UHFFFAOYSA-N 2-(4-pentoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCC)=CC=C1C1=NC=C(C#N)C=N1 MGEQCYFPPOWIEZ-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 239000000460 chlorine Substances 0.000 claims description 4
- 229910052740 iodine Inorganic materials 0.000 claims description 4
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 claims description 4
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 4
- CNHDIAIOKMXOLK-UHFFFAOYSA-N toluquinol Chemical compound CC1=CC(O)=CC=C1O CNHDIAIOKMXOLK-UHFFFAOYSA-N 0.000 claims description 4
- RYSIQVHNOVJIFG-UHFFFAOYSA-N 1-heptyl-4-phenylcyclohexa-2,4-diene-1-carbonitrile Chemical group C1=CC(CCCCCCC)(C#N)CC=C1C1=CC=CC=C1 RYSIQVHNOVJIFG-UHFFFAOYSA-N 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 3
- JPBFKTCKZLMJED-UHFFFAOYSA-N 4-(4-heptoxyphenyl)benzonitrile Chemical group C1=CC(OCCCCCCC)=CC=C1C1=CC=C(C#N)C=C1 JPBFKTCKZLMJED-UHFFFAOYSA-N 0.000 claims description 2
- WNPUCDQWHSMXIN-UHFFFAOYSA-N 4-[(4-propylphenyl)methylideneamino]benzonitrile Chemical compound C1=CC(CCC)=CC=C1C=NC1=CC=C(C#N)C=C1 WNPUCDQWHSMXIN-UHFFFAOYSA-N 0.000 claims description 2
- NWVVVBRKAWDGAB-UHFFFAOYSA-N hydroquinone methyl ether Natural products COC1=CC=C(O)C=C1 NWVVVBRKAWDGAB-UHFFFAOYSA-N 0.000 claims description 2
- ZQLDNJKHLQOJGE-UHFFFAOYSA-N 4-octylbenzoic acid Chemical compound CCCCCCCCC1=CC=C(C(O)=O)C=C1 ZQLDNJKHLQOJGE-UHFFFAOYSA-N 0.000 claims 2
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 claims 1
- AVTDOVBURKPMSX-UHFFFAOYSA-N 3-heptyl-4-phenylbenzonitrile Chemical group CCCCCCCC1=CC(C#N)=CC=C1C1=CC=CC=C1 AVTDOVBURKPMSX-UHFFFAOYSA-N 0.000 claims 1
- GPGGNNIMKOVSAG-UHFFFAOYSA-N 4-(4-octoxyphenyl)benzonitrile Chemical group C1=CC(OCCCCCCCC)=CC=C1C1=CC=C(C#N)C=C1 GPGGNNIMKOVSAG-UHFFFAOYSA-N 0.000 claims 1
- GYTQATZRVCZAKR-UHFFFAOYSA-N 4-[(4-butylphenyl)methylideneamino]benzonitrile Chemical compound C1=CC(CCCC)=CC=C1C=NC1=CC=C(C#N)C=C1 GYTQATZRVCZAKR-UHFFFAOYSA-N 0.000 claims 1
- BPMBNLJJRKCCRT-UHFFFAOYSA-N 4-phenylbenzonitrile Chemical group C1=CC(C#N)=CC=C1C1=CC=CC=C1 BPMBNLJJRKCCRT-UHFFFAOYSA-N 0.000 claims 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 claims 1
- 230000001419 dependent effect Effects 0.000 claims 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 80
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 69
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 36
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 35
- 239000000243 solution Substances 0.000 description 34
- 238000006243 chemical reaction Methods 0.000 description 33
- 239000007858 starting material Substances 0.000 description 33
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 30
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 30
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 28
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 24
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 24
- 230000008018 melting Effects 0.000 description 22
- 238000002844 melting Methods 0.000 description 22
- 239000011541 reaction mixture Substances 0.000 description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 19
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 19
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 17
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 17
- 238000003756 stirring Methods 0.000 description 17
- 239000013078 crystal Substances 0.000 description 16
- 239000000155 melt Substances 0.000 description 16
- 238000010992 reflux Methods 0.000 description 14
- 239000004990 Smectic liquid crystal Substances 0.000 description 13
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 12
- 125000004429 atom Chemical group 0.000 description 12
- 230000007717 exclusion Effects 0.000 description 12
- SCVFZCLFOSHCOH-UHFFFAOYSA-M potassium acetate Chemical compound [K+].CC([O-])=O SCVFZCLFOSHCOH-UHFFFAOYSA-M 0.000 description 12
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 10
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 10
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 229910021529 ammonia Inorganic materials 0.000 description 9
- 230000007935 neutral effect Effects 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 6
- 238000001816 cooling Methods 0.000 description 6
- 238000004821 distillation Methods 0.000 description 6
- 239000001257 hydrogen Substances 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 6
- 235000011056 potassium acetate Nutrition 0.000 description 6
- 229920006395 saturated elastomer Polymers 0.000 description 6
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 5
- 230000002378 acidificating effect Effects 0.000 description 5
- LTMHNWPUDSTBKD-UHFFFAOYSA-N diethyl 2-(ethoxymethylidene)propanedioate Chemical compound CCOC=C(C(=O)OCC)C(=O)OCC LTMHNWPUDSTBKD-UHFFFAOYSA-N 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 239000000741 silica gel Substances 0.000 description 5
- 229910002027 silica gel Inorganic materials 0.000 description 5
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 4
- 102100022404 E3 ubiquitin-protein ligase Midline-1 Human genes 0.000 description 4
- 101710102210 E3 ubiquitin-protein ligase Midline-1 Proteins 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 4
- 239000006227 byproduct Substances 0.000 description 4
- 239000003990 capacitor Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000002244 precipitate Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- AOJFQRQNPXYVLM-UHFFFAOYSA-N pyridin-1-ium;chloride Chemical compound [Cl-].C1=CC=[NH+]C=C1 AOJFQRQNPXYVLM-UHFFFAOYSA-N 0.000 description 4
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- HIKJBZUXMYBAIL-UHFFFAOYSA-N 3-(4-hexylphenyl)prop-2-enoic acid Chemical compound CCCCCCC1=CC=C(C=CC(O)=O)C=C1 HIKJBZUXMYBAIL-UHFFFAOYSA-N 0.000 description 3
- AWNRWPLYMABILG-UHFFFAOYSA-N 4-(4-heptylpyrimidin-2-yl)benzoic acid Chemical compound CCCCCCCC1=CC=NC(C=2C=CC(=CC=2)C(O)=O)=N1 AWNRWPLYMABILG-UHFFFAOYSA-N 0.000 description 3
- ZJEFILYXLZSVJZ-UHFFFAOYSA-N 4-chloropyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=CN=C1Cl ZJEFILYXLZSVJZ-UHFFFAOYSA-N 0.000 description 3
- CVNOWLNNPYYEOH-UHFFFAOYSA-N 4-cyanophenol Chemical compound OC1=CC=C(C#N)C=C1 CVNOWLNNPYYEOH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 238000004140 cleaning Methods 0.000 description 3
- 230000018044 dehydration Effects 0.000 description 3
- 238000006297 dehydration reaction Methods 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 229910052736 halogen Inorganic materials 0.000 description 3
- 150000002367 halogens Chemical class 0.000 description 3
- 239000004973 liquid crystal related substance Substances 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- IIVUJUOJERNGQX-UHFFFAOYSA-N pyrimidine-5-carboxylic acid Chemical compound OC(=O)C1=CN=CN=C1 IIVUJUOJERNGQX-UHFFFAOYSA-N 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- WCJUJMPIFZMWOZ-UHFFFAOYSA-N 1-pentyl-4-phenylcyclohexa-2,4-diene-1-carbonitrile Chemical group C1=CC(CCCCC)(C#N)CC=C1C1=CC=CC=C1 WCJUJMPIFZMWOZ-UHFFFAOYSA-N 0.000 description 2
- YOHHRYUEXZWDRY-UHFFFAOYSA-N 2-(4-heptylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 YOHHRYUEXZWDRY-UHFFFAOYSA-N 0.000 description 2
- AOGLHEUFDNEXOC-UHFFFAOYSA-N 2-(4-heptylphenyl)pyrimidine-5-carboxamide Chemical compound C1=CC(CCCCCCC)=CC=C1C1=NC=C(C(N)=O)C=N1 AOGLHEUFDNEXOC-UHFFFAOYSA-N 0.000 description 2
- WDVUTSPKHBUTKG-UHFFFAOYSA-N 2-(4-heptylphenyl)pyrimidine-5-carboxylic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=NC=C(C(O)=O)C=N1 WDVUTSPKHBUTKG-UHFFFAOYSA-N 0.000 description 2
- GNPMRDPPLWHZOG-UHFFFAOYSA-N 2-(4-hexylphenyl)pyrimidine-5-carboxamide Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=C(C(N)=O)C=N1 GNPMRDPPLWHZOG-UHFFFAOYSA-N 0.000 description 2
- XMMZSDRQCFGODE-UHFFFAOYSA-N 2-(4-pentylphenyl)pyrimidine-5-carboxamide Chemical compound C1=CC(CCCCC)=CC=C1C1=NC=C(C(N)=O)C=N1 XMMZSDRQCFGODE-UHFFFAOYSA-N 0.000 description 2
- IMGZUSNTHIVXDL-UHFFFAOYSA-N 2-(4-pentylphenyl)pyrimidine-5-carboxylic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=NC=C(C(O)=O)C=N1 IMGZUSNTHIVXDL-UHFFFAOYSA-N 0.000 description 2
- VLWDPGULDDHWMP-UHFFFAOYSA-N 2-(4-propoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCC)=CC=C1C1=NC=C(C#N)C=N1 VLWDPGULDDHWMP-UHFFFAOYSA-N 0.000 description 2
- QPFDPJJNUKGHBB-UHFFFAOYSA-N 2-(ethoxymethylidene)nonanal Chemical compound CCCCCCCC(C=O)=COCC QPFDPJJNUKGHBB-UHFFFAOYSA-N 0.000 description 2
- IPQKEGWWCUGHJQ-UHFFFAOYSA-N 4-(4-butylpyrimidin-2-yl)benzamide Chemical compound CCCCC1=CC=NC(C=2C=CC(=CC=2)C(N)=O)=N1 IPQKEGWWCUGHJQ-UHFFFAOYSA-N 0.000 description 2
- ZRMIETZFPZGBEB-UHFFFAOYSA-N 4-(4-hydroxyphenyl)benzonitrile Chemical group C1=CC(O)=CC=C1C1=CC=C(C#N)C=C1 ZRMIETZFPZGBEB-UHFFFAOYSA-N 0.000 description 2
- LGZVXDCVOZLFAW-UHFFFAOYSA-N 4-(5-butylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCCC)=CN=C1C1=CC=C(C#N)C=C1 LGZVXDCVOZLFAW-UHFFFAOYSA-N 0.000 description 2
- SEBTZFGCLRTNBV-UHFFFAOYSA-N 4-(5-octylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 SEBTZFGCLRTNBV-UHFFFAOYSA-N 0.000 description 2
- PRLHVXKHKAROHU-UHFFFAOYSA-N 4-butylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCC1=CC=C(C(N)=N)C=C1 PRLHVXKHKAROHU-UHFFFAOYSA-N 0.000 description 2
- IYIAWOSYBLPUNL-UHFFFAOYSA-N 4-carbamimidoylbenzamide;hydrochloride Chemical compound Cl.NC(=N)C1=CC=C(C(N)=O)C=C1 IYIAWOSYBLPUNL-UHFFFAOYSA-N 0.000 description 2
- WZWIQYMTQZCSKI-UHFFFAOYSA-N 4-cyanobenzaldehyde Chemical compound O=CC1=CC=C(C#N)C=C1 WZWIQYMTQZCSKI-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- HGINCPLSRVDWNT-UHFFFAOYSA-N Acrolein Chemical compound C=CC=O HGINCPLSRVDWNT-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 229910052786 argon Inorganic materials 0.000 description 2
- 125000000649 benzylidene group Chemical group [H]C(=[*])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- YNESATAKKCNGOF-UHFFFAOYSA-N lithium bis(trimethylsilyl)amide Chemical compound [Li+].C[Si](C)(C)[N-][Si](C)(C)C YNESATAKKCNGOF-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 229910052698 phosphorus Inorganic materials 0.000 description 2
- 239000011574 phosphorus Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- SWIDWYDWKMYMLV-UHFFFAOYSA-N (4-aminophenyl) methyl carbonate Chemical compound COC(=O)OC1=CC=C(N)C=C1 SWIDWYDWKMYMLV-UHFFFAOYSA-N 0.000 description 1
- UDLMSNNWUVRQAZ-UHFFFAOYSA-N (4-formylphenyl) hydrogen carbonate Chemical compound OC(=O)OC1=CC=C(C=O)C=C1 UDLMSNNWUVRQAZ-UHFFFAOYSA-N 0.000 description 1
- VMJNTFXCTXAXTC-UHFFFAOYSA-N 2,2-difluoro-1,3-benzodioxole-5-carbonitrile Chemical group C1=C(C#N)C=C2OC(F)(F)OC2=C1 VMJNTFXCTXAXTC-UHFFFAOYSA-N 0.000 description 1
- UIJPWDSKPZLJAN-UHFFFAOYSA-N 2-(1,4-dioxan-2-yl)ethanol Chemical compound OCCC1COCCO1 UIJPWDSKPZLJAN-UHFFFAOYSA-N 0.000 description 1
- RGSLQEAKPIFJRD-UHFFFAOYSA-N 2-(4-butoxyphenyl)-4-chloropyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCC)=CC=C1C1=NC=C(C#N)C(Cl)=N1 RGSLQEAKPIFJRD-UHFFFAOYSA-N 0.000 description 1
- NRBSJYVKPGLYMA-UHFFFAOYSA-N 2-(4-butylphenyl)pyrimidine-5-carboxamide Chemical compound C1=CC(CCCC)=CC=C1C1=NC=C(C(N)=O)C=N1 NRBSJYVKPGLYMA-UHFFFAOYSA-N 0.000 description 1
- JPSCCKVZKCJDHR-UHFFFAOYSA-N 2-(4-ethoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCC)=CC=C1C1=NC=C(C#N)C=N1 JPSCCKVZKCJDHR-UHFFFAOYSA-N 0.000 description 1
- DVYGJFZRRHYBCU-UHFFFAOYSA-N 2-(4-heptoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 DVYGJFZRRHYBCU-UHFFFAOYSA-N 0.000 description 1
- BSJFBXRAHBUODL-UHFFFAOYSA-N 2-(4-heptylphenyl)pyrimidine-5-carbonyl chloride Chemical compound C1=CC(CCCCCCC)=CC=C1C1=NC=C(C(Cl)=O)C=N1 BSJFBXRAHBUODL-UHFFFAOYSA-N 0.000 description 1
- BMQAEENBKMIKLI-UHFFFAOYSA-N 2-(4-hexoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 BMQAEENBKMIKLI-UHFFFAOYSA-N 0.000 description 1
- NDECETGHYPFNRK-UHFFFAOYSA-N 2-(4-hexylphenyl)pyrimidine Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=CC=N1 NDECETGHYPFNRK-UHFFFAOYSA-N 0.000 description 1
- DJKONKMRNSRJKX-UHFFFAOYSA-N 2-(4-hexylphenyl)pyrimidine-5-carbonyl chloride Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=C(C(Cl)=O)C=N1 DJKONKMRNSRJKX-UHFFFAOYSA-N 0.000 description 1
- FOYJDDBRGGFCCH-UHFFFAOYSA-N 2-(4-hexylphenyl)pyrimidine-5-carboxylic acid Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=C(C(O)=O)C=N1 FOYJDDBRGGFCCH-UHFFFAOYSA-N 0.000 description 1
- FWDAWWXFLFQBFG-UHFFFAOYSA-N 2-(4-nonoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 FWDAWWXFLFQBFG-UHFFFAOYSA-N 0.000 description 1
- MTOSIVOFTXMEDQ-UHFFFAOYSA-N 2-(4-nonylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 MTOSIVOFTXMEDQ-UHFFFAOYSA-N 0.000 description 1
- QHVCBJSOCSKSOC-UHFFFAOYSA-N 2-(4-octoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 QHVCBJSOCSKSOC-UHFFFAOYSA-N 0.000 description 1
- ROGXQLSGBXIGLW-UHFFFAOYSA-N 2-(4-octylphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(CCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 ROGXQLSGBXIGLW-UHFFFAOYSA-N 0.000 description 1
- WLOYHCWKLPBUAD-UHFFFAOYSA-N 2-(4-pentylphenyl)pyrimidine-5-carbonyl chloride Chemical compound C1=CC(CCCCC)=CC=C1C1=NC=C(C(Cl)=O)C=N1 WLOYHCWKLPBUAD-UHFFFAOYSA-N 0.000 description 1
- PUBXBFQIQBCVPK-UHFFFAOYSA-N 2-(4-propylphenyl)pyrimidine-5-carboxamide Chemical compound C1=CC(CCC)=CC=C1C1=NC=C(C(N)=O)C=N1 PUBXBFQIQBCVPK-UHFFFAOYSA-N 0.000 description 1
- ZUXMVRWBJXRKST-UHFFFAOYSA-N 2-(4-propylphenyl)pyrimidine-5-carboxylic acid Chemical compound C1=CC(CCC)=CC=C1C1=NC=C(C(O)=O)C=N1 ZUXMVRWBJXRKST-UHFFFAOYSA-N 0.000 description 1
- YVCLRNJQIURSKF-UHFFFAOYSA-N 2-(diethoxymethyl)-3-hydroxyprop-2-enenitrile Chemical compound CCOC(OCC)C(=CO)C#N YVCLRNJQIURSKF-UHFFFAOYSA-N 0.000 description 1
- QMYAMVRTUWRYIL-UHFFFAOYSA-N 2-(ethoxymethylidene)octanal Chemical compound CCCCCCC(C=O)=COCC QMYAMVRTUWRYIL-UHFFFAOYSA-N 0.000 description 1
- YIFCWYUSYGFFMH-UHFFFAOYSA-N 2-(ethoxymethylidene)propanedioic acid Chemical compound CCOC=C(C(O)=O)C(O)=O YIFCWYUSYGFFMH-UHFFFAOYSA-N 0.000 description 1
- JLWMMYZWEHHTFF-UHFFFAOYSA-N 2-[6-(3-carbamimidoylphenoxy)-4-[di(propan-2-yl)amino]-3,5-difluoropyridin-2-yl]oxy-5-(2-methylpropylcarbamoyl)benzoic acid Chemical compound OC(=O)C1=CC(C(=O)NCC(C)C)=CC=C1OC1=NC(OC=2C=C(C=CC=2)C(N)=N)=C(F)C(N(C(C)C)C(C)C)=C1F JLWMMYZWEHHTFF-UHFFFAOYSA-N 0.000 description 1
- BHYIQMFSOGUTRT-UHFFFAOYSA-N 2-formyl-3-hydroxyprop-2-enenitrile Chemical compound OC=C(C=O)C#N BHYIQMFSOGUTRT-UHFFFAOYSA-N 0.000 description 1
- AIVVQILZOXQOAF-UHFFFAOYSA-N 2-heptylpropanedial Chemical compound CCCCCCCC(C=O)C=O AIVVQILZOXQOAF-UHFFFAOYSA-N 0.000 description 1
- JUVLJSBPZOBFNU-UHFFFAOYSA-N 2-hexylpropanedial Chemical compound CCCCCCC(C=O)C=O JUVLJSBPZOBFNU-UHFFFAOYSA-N 0.000 description 1
- WBOXEOCWOCJQNK-UHFFFAOYSA-N 3,3-diethoxypropanenitrile Chemical compound CCOC(CC#N)OCC WBOXEOCWOCJQNK-UHFFFAOYSA-N 0.000 description 1
- BHRKWWLBXDZCST-UHFFFAOYSA-N 3-(4-hexylphenyl)prop-2-enoyl chloride Chemical compound CCCCCCC1=CC=C(C=CC(Cl)=O)C=C1 BHRKWWLBXDZCST-UHFFFAOYSA-N 0.000 description 1
- GLGVASKFXIKAIA-UHFFFAOYSA-N 4-(4-heptylpyrimidin-2-yl)benzamide Chemical compound CCCCCCCC1=CC=NC(C=2C=CC(=CC=2)C(N)=O)=N1 GLGVASKFXIKAIA-UHFFFAOYSA-N 0.000 description 1
- PDQAFMPWBSUMFK-UHFFFAOYSA-N 4-(4-hexylpyrimidin-2-yl)benzamide Chemical compound CCCCCCC1=CC=NC(C=2C=CC(=CC=2)C(N)=O)=N1 PDQAFMPWBSUMFK-UHFFFAOYSA-N 0.000 description 1
- OLQOPLNISLBZGE-UHFFFAOYSA-N 4-(4-octylpyrimidin-2-yl)benzamide Chemical compound CCCCCCCCC1=CC=NC(C=2C=CC(=CC=2)C(N)=O)=N1 OLQOPLNISLBZGE-UHFFFAOYSA-N 0.000 description 1
- OPGAKNHQEGAGBO-UHFFFAOYSA-N 4-(4-pentylpyrimidin-2-yl)benzamide Chemical compound CCCCCC1=CC=NC(C=2C=CC(=CC=2)C(N)=O)=N1 OPGAKNHQEGAGBO-UHFFFAOYSA-N 0.000 description 1
- HBUJOLOTFQGKKO-UHFFFAOYSA-N 4-(5-butoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCCCC)=CN=C1C1=CC=C(C#N)C=C1 HBUJOLOTFQGKKO-UHFFFAOYSA-N 0.000 description 1
- RJUPQRQHCKECHC-UHFFFAOYSA-N 4-(5-ethoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCC)=CN=C1C1=CC=C(C#N)C=C1 RJUPQRQHCKECHC-UHFFFAOYSA-N 0.000 description 1
- BAUQTBLWRGUTQP-UHFFFAOYSA-N 4-(5-heptoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 BAUQTBLWRGUTQP-UHFFFAOYSA-N 0.000 description 1
- MXVKABKRLQECLI-UHFFFAOYSA-N 4-(5-octoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCCCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 MXVKABKRLQECLI-UHFFFAOYSA-N 0.000 description 1
- SXDBMNDWZRLKKM-UHFFFAOYSA-N 4-(5-pentoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCCCCC)=CN=C1C1=CC=C(C#N)C=C1 SXDBMNDWZRLKKM-UHFFFAOYSA-N 0.000 description 1
- DLHVHFLKOQCVBC-UHFFFAOYSA-N 4-(5-propoxypyrimidin-2-yl)benzonitrile Chemical compound N1=CC(OCCC)=CN=C1C1=CC=C(C#N)C=C1 DLHVHFLKOQCVBC-UHFFFAOYSA-N 0.000 description 1
- NHQUJEQINIHXMP-UHFFFAOYSA-N 4-(5-propylpyrimidin-2-yl)benzonitrile Chemical compound N1=CC(CCC)=CN=C1C1=CC=C(C#N)C=C1 NHQUJEQINIHXMP-UHFFFAOYSA-N 0.000 description 1
- YBAZINRZQSAIAY-UHFFFAOYSA-N 4-aminobenzonitrile Chemical compound NC1=CC=C(C#N)C=C1 YBAZINRZQSAIAY-UHFFFAOYSA-N 0.000 description 1
- YBDTUKQVMPWEBC-UHFFFAOYSA-N 4-chloro-2-(4-heptoxyphenyl)pyrimidine-5-carbonitrile Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=NC=C(C#N)C(Cl)=N1 YBDTUKQVMPWEBC-UHFFFAOYSA-N 0.000 description 1
- YSBQUPLNWRIAMX-UHFFFAOYSA-N 4-ethoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCOC1=CC=C(C(N)=N)C=C1 YSBQUPLNWRIAMX-UHFFFAOYSA-N 0.000 description 1
- FBDIVWUJDOZGJB-UHFFFAOYSA-N 4-heptylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCCCCC1=CC=C(C(N)=N)C=C1 FBDIVWUJDOZGJB-UHFFFAOYSA-N 0.000 description 1
- ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 4-hexoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCCCOC1=CC=C(C(N)=N)C=C1 ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 0.000 description 1
- KRNAJRBXIMJEFF-UHFFFAOYSA-N 4-hexylbenzaldehyde Chemical compound CCCCCCC1=CC=C(C=O)C=C1 KRNAJRBXIMJEFF-UHFFFAOYSA-N 0.000 description 1
- PPKXLWZBHTYSSL-UHFFFAOYSA-N 4-hexylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCCCC1=CC=C(C(N)=N)C=C1 PPKXLWZBHTYSSL-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- VBLWCVVIHQWWFM-UHFFFAOYSA-N 4-propoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCOC1=CC=C(C(N)=N)C=C1 VBLWCVVIHQWWFM-UHFFFAOYSA-N 0.000 description 1
- OWBZTQZODPJBSZ-UHFFFAOYSA-N 4-propylbenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCC1=CC=C(C(N)=N)C=C1 OWBZTQZODPJBSZ-UHFFFAOYSA-N 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-M Butyrate Chemical compound CCCC([O-])=O FERIUCNNQQJTOY-UHFFFAOYSA-M 0.000 description 1
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Natural products CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 1
- ULBIAHNKURNVKJ-UHFFFAOYSA-N C(=O)(O)OC1=CC=C(C(=O)Cl)C=C1 Chemical compound C(=O)(O)OC1=CC=C(C(=O)Cl)C=C1 ULBIAHNKURNVKJ-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical compound N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- 229910017912 NH2OH Inorganic materials 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 241000033695 Sige Species 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- VLKFMLNFFNJMGK-UHFFFAOYSA-N [2-(4-cyanophenyl)pyrimidin-5-yl] acetate Chemical compound N1=CC(OC(=O)C)=CN=C1C1=CC=C(C#N)C=C1 VLKFMLNFFNJMGK-UHFFFAOYSA-N 0.000 description 1
- CSAZVWUUBLTMEH-UHFFFAOYSA-N [2-(4-cyanophenyl)pyrimidin-5-yl] hexanoate Chemical compound N1=CC(OC(=O)CCCCC)=CN=C1C1=CC=C(C#N)C=C1 CSAZVWUUBLTMEH-UHFFFAOYSA-N 0.000 description 1
- SHIYDAAQECMVOV-UHFFFAOYSA-N [2-(4-cyanophenyl)pyrimidin-5-yl] nonanoate Chemical compound N1=CC(OC(=O)CCCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 SHIYDAAQECMVOV-UHFFFAOYSA-N 0.000 description 1
- SOHSMXJDIONEJY-UHFFFAOYSA-N [2-(4-cyanophenyl)pyrimidin-5-yl] octanoate Chemical compound N1=CC(OC(=O)CCCCCCC)=CN=C1C1=CC=C(C#N)C=C1 SOHSMXJDIONEJY-UHFFFAOYSA-N 0.000 description 1
- SPOBENLJKODHLF-UHFFFAOYSA-N [4-(5-cyanopyrimidin-2-yl)phenyl] acetate Chemical compound C1=CC(OC(=O)C)=CC=C1C1=NC=C(C#N)C=N1 SPOBENLJKODHLF-UHFFFAOYSA-N 0.000 description 1
- KKVZDKJDGVWOEX-UHFFFAOYSA-N [4-(5-cyanopyrimidin-2-yl)phenyl] heptanoate Chemical compound C1=CC(OC(=O)CCCCCC)=CC=C1C1=NC=C(C#N)C=N1 KKVZDKJDGVWOEX-UHFFFAOYSA-N 0.000 description 1
- RSZROMDNMGFLJA-UHFFFAOYSA-N [4-(5-cyanopyrimidin-2-yl)phenyl] hexanoate Chemical compound C1=CC(OC(=O)CCCCC)=CC=C1C1=NC=C(C#N)C=N1 RSZROMDNMGFLJA-UHFFFAOYSA-N 0.000 description 1
- QROAWAZLEXITAP-UHFFFAOYSA-N [4-(5-cyanopyrimidin-2-yl)phenyl] nonanoate Chemical compound C1=CC(OC(=O)CCCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 QROAWAZLEXITAP-UHFFFAOYSA-N 0.000 description 1
- SOVKBUFXTMVEGH-UHFFFAOYSA-N [4-(5-cyanopyrimidin-2-yl)phenyl] octanoate Chemical compound C1=CC(OC(=O)CCCCCCC)=CC=C1C1=NC=C(C#N)C=N1 SOVKBUFXTMVEGH-UHFFFAOYSA-N 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 125000000218 acetic acid group Chemical group C(C)(=O)* 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 229940040526 anhydrous sodium acetate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- YFNONBGXNFCTMM-UHFFFAOYSA-N butoxybenzene Chemical group CCCCOC1=CC=CC=C1 YFNONBGXNFCTMM-UHFFFAOYSA-N 0.000 description 1
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- WGLUMOCWFMKWIL-UHFFFAOYSA-N dichloromethane;methanol Chemical compound OC.ClCCl WGLUMOCWFMKWIL-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000005684 electric field Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- LUXOKLVIAMUTMI-UHFFFAOYSA-N ethyl 2-(4-butylphenyl)-6-oxo-1h-pyrimidine-5-carboxylate Chemical compound C1=CC(CCCC)=CC=C1C1=NC=C(C(=O)OCC)C(O)=N1 LUXOKLVIAMUTMI-UHFFFAOYSA-N 0.000 description 1
- DXJURTGOUIVTPT-UHFFFAOYSA-N ethyl 2-(4-butylphenyl)pyrimidine-5-carboxylate Chemical compound C1=CC(CCCC)=CC=C1C1=NC=C(C(=O)OCC)C=N1 DXJURTGOUIVTPT-UHFFFAOYSA-N 0.000 description 1
- PFSIOINTDFOFAL-UHFFFAOYSA-N ethyl 2-(4-heptylphenyl)pyrimidine-5-carboxylate Chemical compound C1=CC(CCCCCCC)=CC=C1C1=NC=C(C(=O)OCC)C=N1 PFSIOINTDFOFAL-UHFFFAOYSA-N 0.000 description 1
- WCWKDFYCCBAYIX-UHFFFAOYSA-N ethyl 2-(4-hexylphenyl)pyrimidine-5-carboxylate Chemical compound C1=CC(CCCCCC)=CC=C1C1=NC=C(C(=O)OCC)C=N1 WCWKDFYCCBAYIX-UHFFFAOYSA-N 0.000 description 1
- VZEVSOYNMJQTKE-UHFFFAOYSA-N ethyl 2-(4-pentylphenyl)pyrimidine-5-carboxylate Chemical compound C1=CC(CCCCC)=CC=C1C1=NC=C(C(=O)OCC)C=N1 VZEVSOYNMJQTKE-UHFFFAOYSA-N 0.000 description 1
- VQMSRIKOCOZKBX-UHFFFAOYSA-N ethyl 2-(4-propylphenyl)pyrimidine-5-carboxylate Chemical compound C1=CC(CCC)=CC=C1C1=NC=C(C(=O)OCC)C=N1 VQMSRIKOCOZKBX-UHFFFAOYSA-N 0.000 description 1
- AZJAMMCCAZZXIK-UHFFFAOYSA-N ethyl 4-chloropyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=CN=C1Cl AZJAMMCCAZZXIK-UHFFFAOYSA-N 0.000 description 1
- PLMIZYMXBHSARX-UHFFFAOYSA-N ethyl 6-oxo-1h-pyrimidine-5-carboxylate Chemical compound CCOC(=O)C1=CN=CNC1=O PLMIZYMXBHSARX-UHFFFAOYSA-N 0.000 description 1
- 229960003750 ethyl chloride Drugs 0.000 description 1
- 230000005496 eutectics Effects 0.000 description 1
- WBJINCZRORDGAQ-UHFFFAOYSA-N formic acid ethyl ester Natural products CCOC=O WBJINCZRORDGAQ-UHFFFAOYSA-N 0.000 description 1
- 125000004005 formimidoyl group Chemical group [H]\N=C(/[H])* 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 210000002837 heart atrium Anatomy 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Natural products C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000005499 phosphonyl group Chemical group 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- QDXGKRWDQCEABB-UHFFFAOYSA-N pyrimidine-5-carboxamide Chemical compound NC(=O)C1=CN=CN=C1 QDXGKRWDQCEABB-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000004043 responsiveness Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-N trans-cinnamic acid Chemical class OC(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-N 0.000 description 1
- 238000001291 vacuum drying Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/42—Mixtures of liquid crystal compounds covered by two or more of the preceding groups C09K19/06 - C09K19/40
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/51—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition
- C07C45/511—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups
- C07C45/515—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by pyrolysis, rearrangement or decomposition involving transformation of singly bound oxygen functional groups to >C = O groups the singly bound functional group being an acetalised, ketalised hemi-acetalised, or hemi-ketalised hydroxyl group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/02—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen
- C07C47/12—Saturated compounds having —CHO groups bound to acyclic carbon atoms or to hydrogen containing more than one —CHO group
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C47/00—Compounds having —CHO groups
- C07C47/20—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms
- C07C47/277—Unsaturated compounds having —CHO groups bound to acyclic carbon atoms containing ether groups, groups, groups, or groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
- C07C51/377—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by splitting-off hydrogen or functional groups; by hydrogenolysis of functional groups
- C07C51/38—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by splitting-off hydrogen or functional groups; by hydrogenolysis of functional groups by decarboxylation
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/26—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/30—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/32—One oxygen, sulfur or nitrogen atom
- C07D239/34—One oxygen atom
- C07D239/36—One oxygen atom as doubly bound oxygen atom or as unsubstituted hydroxy radical
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09K—MATERIALS FOR MISCELLANEOUS APPLICATIONS, NOT PROVIDED FOR ELSEWHERE
- C09K19/00—Liquid crystal materials
- C09K19/04—Liquid crystal materials characterised by the chemical structure of the liquid crystal components, e.g. by a specific unit
- C09K19/06—Non-steroidal liquid crystal compounds
- C09K19/34—Non-steroidal liquid crystal compounds containing at least one heterocyclic ring
- C09K19/3441—Non-steroidal liquid crystal compounds containing at least one heterocyclic ring having nitrogen as hetero atom
- C09K19/345—Non-steroidal liquid crystal compounds containing at least one heterocyclic ring having nitrogen as hetero atom the heterocyclic ring being a six-membered aromatic ring containing two nitrogen atoms
- C09K19/3458—Uncondensed pyrimidines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Crystallography & Structural Chemistry (AREA)
- Materials Engineering (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Liquid Crystal Substances (AREA)
- Liquid Crystal (AREA)
Priority Applications (24)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1431374A CH617452A5 (sv) | 1974-10-25 | 1974-10-25 | |
ZA00756410A ZA756410B (en) | 1974-10-25 | 1975-10-09 | Phenyl pyrimidines |
AU85670/75A AU476921B2 (en) | 1974-10-25 | 1975-10-13 | Phenyl pyrimidines |
IT28443/75A IT1043486B (it) | 1974-10-25 | 1975-10-20 | Fenil pirimidine |
US05/624,354 US3997536A (en) | 1974-10-25 | 1975-10-21 | Phenyl-pyrimidines |
DD7500198028A DD128698A5 (de) | 1974-10-25 | 1975-10-23 | Nematisches gemisch |
DD189021A DD124731A5 (sv) | 1974-10-25 | 1975-10-23 | |
SE7511902A SE417962B (sv) | 1974-10-25 | 1975-10-23 | Fenylpyrimidiner for elektro-optiska endamal |
FR7532424A FR2309543A1 (fr) | 1974-10-25 | 1975-10-23 | Nouvelles phenylpyrimidines, leur procede de preparation et leur application electro-optique |
ES442044A ES442044A1 (es) | 1974-10-25 | 1975-10-24 | Un procedimiento para la preparacion de fenil-pirimidinas. |
GB4382275A GB1473990A (en) | 1974-10-25 | 1975-10-24 | Phenyl-pyrimidines |
DK479675A DK479675A (da) | 1974-10-25 | 1975-10-24 | Phenylpyrimidiner |
BE161221A BE834837A (fr) | 1974-10-25 | 1975-10-24 | Phenylpyrimidines |
JP50127576A JPS5180870A (en) | 1974-10-25 | 1975-10-24 | Fueniruupirimijinno seizohoho |
CA238,291A CA1042889A (en) | 1974-10-25 | 1975-10-24 | Phenyl pyrimidines |
AT814575A AT349475B (de) | 1974-10-25 | 1975-10-24 | Verfahren zur herstellung von neuen phenylpyrimidinen |
DE2547737A DE2547737C2 (de) | 1974-10-25 | 1975-10-24 | Phenylpyrimidine |
NLAANVRAGE7512497,A NL176172C (nl) | 1974-10-25 | 1975-10-24 | Werkwijze voor het bereiden van mengsels met nematische eigenschappen en het bereiden van daarvoor geschikte pyrimidine-verbindingen. |
US05/721,257 US4066570A (en) | 1974-10-25 | 1976-09-08 | Phenyl-pyrimidines |
DK382677A DK382677A (da) | 1974-10-25 | 1977-08-29 | Flydende krystallinske blandinger |
HK72/78A HK7278A (en) | 1974-10-25 | 1978-02-10 | Phenyl-pyrimidines |
JP1997678A JPS53114788A (en) | 1974-10-25 | 1978-02-24 | Nematic liquid crystal matter mixture |
JP1997778A JPS53101385A (en) | 1974-10-25 | 1978-02-24 | Method of producing phenyllpyrimidine |
AT556178A AT362429B (de) | 1974-10-25 | 1978-07-31 | Nematisches gemisch fuer elektrooptische zwecke |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CH1431374A CH617452A5 (sv) | 1974-10-25 | 1974-10-25 |
Publications (1)
Publication Number | Publication Date |
---|---|
CH617452A5 true CH617452A5 (sv) | 1980-05-30 |
Family
ID=4399774
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CH1431374A CH617452A5 (sv) | 1974-10-25 | 1974-10-25 |
Country Status (18)
Country | Link |
---|---|
US (1) | US3997536A (sv) |
JP (3) | JPS5180870A (sv) |
AT (1) | AT349475B (sv) |
AU (1) | AU476921B2 (sv) |
BE (1) | BE834837A (sv) |
CA (1) | CA1042889A (sv) |
CH (1) | CH617452A5 (sv) |
DD (2) | DD124731A5 (sv) |
DE (1) | DE2547737C2 (sv) |
DK (2) | DK479675A (sv) |
ES (1) | ES442044A1 (sv) |
FR (1) | FR2309543A1 (sv) |
GB (1) | GB1473990A (sv) |
HK (1) | HK7278A (sv) |
IT (1) | IT1043486B (sv) |
NL (1) | NL176172C (sv) |
SE (1) | SE417962B (sv) |
ZA (1) | ZA756410B (sv) |
Families Citing this family (56)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4062798A (en) * | 1975-09-19 | 1977-12-13 | Hoffmann-La Roche Inc. | Phenylpyrimidine derivatives |
US4180475A (en) * | 1976-02-26 | 1979-12-25 | Hoffmann La Roche | Liquid crystal mixtures |
US4052396A (en) * | 1976-11-22 | 1977-10-04 | Ciba-Geigy Corporation | Process for the production of 2-alkyl or 2-cycloalkyl-4-methyl-6-hydroxypyrimidines |
US4052397A (en) * | 1976-11-22 | 1977-10-04 | Ciba-Geigy Corporation | Process for the production of 2-alkyl or 2-cycloalkyl-4-methyl-6-hydroxypyrimidines |
JPS5411887A (en) * | 1977-06-29 | 1979-01-29 | Sharp Corp | Liquid crystal composition |
DD138558A1 (de) * | 1977-12-08 | 1979-11-07 | Frank Kuschel | Nematische fluessig-kristalline gemische |
JPS5483694A (en) * | 1977-12-16 | 1979-07-03 | Hitachi Ltd | Nematic liquid crystal body for display device |
JPS5941983B2 (ja) * | 1978-02-17 | 1984-10-11 | 大日本インキ化学工業株式会社 | トランス(エカトリアル↓−エカトリアル)1,4↓−ジ置換シクロヘキサン誘導体 |
US4309539A (en) * | 1978-03-13 | 1982-01-05 | Hoffmann-La Roche Inc. | Pyrimidine derivatives |
US4163848A (en) * | 1978-08-08 | 1979-08-07 | Ciba-Geigy Corporation | Process for the production of 2-alkyl- or cycloalkyl-4-methyl-6-hydroxypyrimidines |
JPS5534206A (en) * | 1978-08-30 | 1980-03-10 | Hitachi Ltd | Nematic liquid crystal for display unit |
DE2944905A1 (de) * | 1978-12-13 | 1980-10-23 | Werk Fernsehelektronik Veb | Kristallin-fluessige substituierte 1,3-dioxane und diese enthaltende gemische |
CA1120478A (en) * | 1979-02-05 | 1982-03-23 | Arthur Boller | Cyclohexyl pyrimidines |
DE3014912A1 (de) * | 1979-05-15 | 1980-11-27 | Werk Fernsehelektronik Veb | Nematische fluessigkristalline 5-cyan- 2- eckige klammer auf 4-acyloxyphenyl eckige klammer zu -pyrimidine und diese enthaltende gemische |
DE3063497D1 (en) * | 1979-08-20 | 1983-07-07 | Werk Fernsehelektronik Veb | Nematic crystalline-liquid 5-alkyl-2-(4-acyloxyphenyl)-pyrimidines for opto-electronic arrangements and process for their preparation |
US4364838A (en) * | 1979-11-14 | 1982-12-21 | Hoffmann-La Roche Inc. | Liquid crystal mixtures |
CH652400A5 (en) * | 1979-11-14 | 1985-11-15 | Hoffmann La Roche | Phenyldioxanes, and liquid-crystalline mixtures containing them |
DE2951099A1 (de) * | 1979-12-19 | 1981-06-25 | Merck Patent Gmbh, 6100 Darmstadt | Tetrahydrochinazoline, verfahren zu ihrer herstellung, diese enthaltende fluessigkristalline dielektrika und elektrooptisches anzeigeelement |
JPS56113768A (en) * | 1980-02-15 | 1981-09-07 | Seiko Epson Corp | Compound |
JPS56116774A (en) * | 1980-02-19 | 1981-09-12 | Seiko Epson Corp | Nematic liquid crystal composition |
US4335011A (en) * | 1980-03-28 | 1982-06-15 | Timex Corporation | Cyclohexyl-dioxane liquid crystalline compounds |
US4335012A (en) * | 1980-04-03 | 1982-06-15 | Timex Corporation | 5-Substituted-2-(4-cyanophenyl)-1,3-dioxanes |
DE3023989A1 (de) * | 1980-06-26 | 1982-01-21 | Merck Patent Gmbh, 6100 Darmstadt | Fluessigkristallines dielektrikum |
CH645102A5 (de) * | 1980-10-14 | 1984-09-14 | Hoffmann La Roche | Disubstituierte pyrimidine. |
JPS5790082A (en) * | 1980-11-26 | 1982-06-04 | Seiko Epson Corp | Liquid crystal composition |
JPS57117583A (en) * | 1981-01-12 | 1982-07-22 | Seiko Epson Corp | Liquid crystal composition |
US4452718A (en) * | 1981-07-31 | 1984-06-05 | Hoffmann-La Roche Inc. | Pyridazines |
CH651025A5 (de) * | 1982-05-14 | 1985-08-30 | Hoffmann La Roche | Pyridazine und ihre verwendung als komponenten fluessigkristalliner gemische. |
US4528114A (en) * | 1981-12-18 | 1985-07-09 | Hoffmann-La Roche Inc. | Acetylenes |
US5227484A (en) * | 1982-01-14 | 1993-07-13 | Merck Patent Gmbh | Anisotropic compounds having nematic phase and liquid crystal mixtures |
JPS58128356A (ja) * | 1982-01-28 | 1983-07-30 | Ube Ind Ltd | 2−アルコキシメチレン−3,3−ジアルコキシブロパンニトリル類 |
GB2120242A (en) * | 1982-04-30 | 1983-11-30 | Erba Farmitalia | Ergoline derivatives |
JPS5939876A (ja) * | 1982-08-26 | 1984-03-05 | Chisso Corp | ピリミジン誘導体 |
GB2133004B (en) * | 1982-11-04 | 1986-06-11 | Ici Plc | Process for the extraction of metal values and novel metal extractants |
DE3465192D1 (en) * | 1983-03-16 | 1987-09-10 | Hoffmann La Roche | Liquid crystal components having an alkenyl chain |
US4581155A (en) * | 1983-03-31 | 1986-04-08 | Chisso Corporation | Halogenopyrimidine derivatives |
DE3315295A1 (de) * | 1983-04-27 | 1984-10-31 | Merck Patent Gmbh, 6100 Darmstadt | Fluorhaltige pyrimidinderivate |
DE3481055D1 (de) * | 1983-08-22 | 1990-02-22 | Chisso Corp | 2,3-dicyan-5-substituierte pyrazine und diese enthaltende fluessigkristall-zusammensetzung. |
JPS60146877A (ja) * | 1984-01-11 | 1985-08-02 | Chisso Corp | 2―置換―6―(5―置換―2―ピリミジニル)ナフタリン |
US4609485A (en) * | 1984-02-17 | 1986-09-02 | Chisso Corporation | Bipyrimidinyl derivatives |
DE3411571A1 (de) * | 1984-03-29 | 1985-10-10 | Merck Patent Gmbh, 6100 Darmstadt | Pyrimidine |
EP0169327B1 (de) * | 1984-05-25 | 1988-01-13 | F. HOFFMANN-LA ROCHE & CO. Aktiengesellschaft | Phenylisothiocyanate |
US4725688A (en) * | 1984-06-07 | 1988-02-16 | Seiko Instruments Inc. | Liquid crystal compound |
JPS61215372A (ja) * | 1985-03-20 | 1986-09-25 | Teikoku Chem Ind Corp Ltd | 液晶化合物 |
JPS61152659A (ja) * | 1984-12-27 | 1986-07-11 | Chisso Corp | 1,4−ジピリミジニルベンゼン誘導体 |
DE3500909A1 (de) * | 1985-01-12 | 1986-07-17 | Merck Patent Gmbh, 6100 Darmstadt | Pyrimidine |
US4715984A (en) * | 1985-01-22 | 1987-12-29 | Merck Patent Gesellschaft Mit Beschrankter Haftung | Liquid-crystalline dihydroazines |
JPS61197563A (ja) * | 1985-02-27 | 1986-09-01 | Chisso Corp | トリフルオロメチルフエニル基をもつピリミジン誘導体 |
JPS61233689A (ja) * | 1985-03-22 | 1986-10-17 | メルク・パテント・ゲゼルシヤフト・ミツト・ベシユレンクテル・ハフツング | 複素環式ホウ素化合物 |
EP0195974B1 (de) * | 1985-03-26 | 1989-11-29 | F. Hoffmann-La Roche Ag | Alkenylsubstituierte Phenylisothiocyanate und Benzonitrile |
US4980082A (en) * | 1986-09-02 | 1990-12-25 | Seiko Instruments Inc. | Ferroelectric SmC liquid crystal composition which comprises pyrimidinylphenyl ester compounds |
CA1341098C (en) * | 1988-08-25 | 2000-09-12 | Kazuhiko Sakaguchi | Liquid crystal composition and use thereof |
DE3928267A1 (de) * | 1989-08-26 | 1991-02-28 | Merck Patent Gmbh | 5-oxy-2-phenylpyrimidine und fluessigkristallines medium |
JPH07278545A (ja) * | 1994-04-14 | 1995-10-24 | Chisso Corp | ネマテック液晶組成物 |
CN103965111A (zh) * | 2014-05-05 | 2014-08-06 | 淮海工学院 | 一种含有水杨醛席夫碱的双子季铵盐及其制备方法 |
EP3166611B1 (en) * | 2014-07-08 | 2020-09-16 | Dow AgroSciences LLC | Process for the preparation of 4-alkoxy-3-hydroxypicolinic acids |
Family Cites Families (2)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CH593495A5 (sv) * | 1971-12-22 | 1977-12-15 | Werk Fernsehelektronik Veb | |
DD107563A1 (sv) * | 1973-09-27 | 1974-08-05 |
-
1974
- 1974-10-25 CH CH1431374A patent/CH617452A5/de not_active IP Right Cessation
-
1975
- 1975-10-09 ZA ZA00756410A patent/ZA756410B/xx unknown
- 1975-10-13 AU AU85670/75A patent/AU476921B2/en not_active Expired
- 1975-10-20 IT IT28443/75A patent/IT1043486B/it active
- 1975-10-21 US US05/624,354 patent/US3997536A/en not_active Expired - Lifetime
- 1975-10-23 SE SE7511902A patent/SE417962B/sv unknown
- 1975-10-23 DD DD189021A patent/DD124731A5/xx unknown
- 1975-10-23 FR FR7532424A patent/FR2309543A1/fr active Granted
- 1975-10-23 DD DD7500198028A patent/DD128698A5/xx unknown
- 1975-10-24 CA CA238,291A patent/CA1042889A/en not_active Expired
- 1975-10-24 DE DE2547737A patent/DE2547737C2/de not_active Expired
- 1975-10-24 ES ES442044A patent/ES442044A1/es not_active Expired
- 1975-10-24 NL NLAANVRAGE7512497,A patent/NL176172C/xx not_active IP Right Cessation
- 1975-10-24 JP JP50127576A patent/JPS5180870A/ja active Granted
- 1975-10-24 AT AT814575A patent/AT349475B/de not_active IP Right Cessation
- 1975-10-24 DK DK479675A patent/DK479675A/da not_active Application Discontinuation
- 1975-10-24 BE BE161221A patent/BE834837A/xx unknown
- 1975-10-24 GB GB4382275A patent/GB1473990A/en not_active Expired
-
1977
- 1977-08-29 DK DK382677A patent/DK382677A/da not_active Application Discontinuation
-
1978
- 1978-02-10 HK HK72/78A patent/HK7278A/xx unknown
- 1978-02-24 JP JP1997778A patent/JPS53101385A/ja active Pending
- 1978-02-24 JP JP1997678A patent/JPS53114788A/ja active Pending
Also Published As
Publication number | Publication date |
---|---|
US3997536A (en) | 1976-12-14 |
FR2309543B1 (sv) | 1978-04-07 |
DE2547737C2 (de) | 1982-09-16 |
DK479675A (da) | 1976-04-26 |
DD128698A5 (de) | 1977-12-07 |
ZA756410B (en) | 1976-09-29 |
SE417962B (sv) | 1981-04-27 |
CA1042889A (en) | 1978-11-21 |
JPS53114788A (en) | 1978-10-06 |
AU476921B2 (en) | 1976-10-07 |
HK7278A (en) | 1978-02-17 |
DE2547737A1 (de) | 1976-04-29 |
NL176172C (nl) | 1985-03-01 |
ES442044A1 (es) | 1977-06-16 |
ATA814575A (de) | 1978-09-15 |
NL176172B (nl) | 1984-10-01 |
NL7512497A (nl) | 1976-04-27 |
AT349475B (de) | 1979-04-10 |
DD124731A5 (sv) | 1977-03-09 |
JPS556631B2 (sv) | 1980-02-18 |
BE834837A (fr) | 1976-04-26 |
JPS5180870A (en) | 1976-07-15 |
GB1473990A (en) | 1977-05-18 |
IT1043486B (it) | 1980-02-20 |
JPS53101385A (en) | 1978-09-04 |
DK382677A (da) | 1977-08-29 |
AU8567075A (en) | 1976-10-07 |
SE7511902L (sv) | 1976-04-26 |
FR2309543A1 (fr) | 1976-11-26 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CH617452A5 (sv) | ||
US4062798A (en) | Phenylpyrimidine derivatives | |
EP0126949B1 (de) | Fluorhaltige Pyrimidinderivate | |
EP0227717B1 (de) | Stickstoffhaltige heterocyclische ester | |
DE3590176C1 (de) | Ethan- und Methoxyderivate und diese enthaltende FK-Mischungen | |
EP0154840B1 (de) | Flüssigkristalline Verbindungen | |
EP0256097B1 (de) | Vinylen-Verbindungen und flüssigkristalline Phase | |
US4462923A (en) | Disubstituted pyrimidines | |
DE3342631A1 (de) | Thienothiophenderivate | |
DD151937A5 (de) | Fluessigkristalline gemische | |
EP0047817A2 (de) | Hydrierte Naphthaline, deren Herstellung und Verwendung sowie derartige Naphthaline enthaltende Gemische | |
DD241423A5 (de) | Fluessigkristalline phase enthaltend pyrimidine | |
US4211666A (en) | Liquid crystal compounds | |
EP0482024B1 (de) | Chirale oder achirale ringverbindungen | |
DD260079A5 (de) | Fluessigkristalline phase | |
EP0158137A2 (de) | Pyrimidine | |
US4623477A (en) | Ester compounds having a pyrimidine ring | |
DD254590A5 (de) | Chirale getiltete smektische fluessigkristalline phase | |
US4066570A (en) | Phenyl-pyrimidines | |
DE2459374A1 (de) | Fluessigkristalline verbindungen | |
AT362429B (de) | Nematisches gemisch fuer elektrooptische zwecke | |
CH622548A5 (en) | Liquid-crystal mixtures | |
AT356120B (de) | Verfahren zur herstellung von neuen pyrimidin- derivaten | |
DE3434335A1 (de) | Fluessigkristalline phase | |
DE3632411A1 (de) | Verfahren zur herstellung von ethanderivaten |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PUE | Assignment |
Owner name: F. HOFFMANN-LA ROCHE AG |
|
PL | Patent ceased |