CH500193A - Verfahren zur Herstellung von Chinolinderivaten - Google Patents
Verfahren zur Herstellung von ChinolinderivatenInfo
- Publication number
- CH500193A CH500193A CH1292267A CH1292267A CH500193A CH 500193 A CH500193 A CH 500193A CH 1292267 A CH1292267 A CH 1292267A CH 1292267 A CH1292267 A CH 1292267A CH 500193 A CH500193 A CH 500193A
- Authority
- CH
- Switzerland
- Prior art keywords
- carbon atoms
- alkyl
- radical
- formula
- ethyl
- Prior art date
Links
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 title claims abstract description 6
- 239000003224 coccidiostatic agent Substances 0.000 title 1
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 8
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims abstract description 3
- -1 methoxy, methylthio Chemical group 0.000 claims description 35
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 238000000034 method Methods 0.000 claims description 13
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 150000008065 acid anhydrides Chemical class 0.000 claims description 6
- 229940027991 antiseptic and disinfectant quinoline derivative Drugs 0.000 claims description 6
- 150000003248 quinolines Chemical class 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000005359 phenoxyalkyl group Chemical group 0.000 claims description 3
- 239000002904 solvent Substances 0.000 claims description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 claims description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 2
- 239000000460 chlorine Substances 0.000 claims description 2
- 229910052801 chlorine Inorganic materials 0.000 claims description 2
- 239000003085 diluting agent Substances 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 150000003839 salts Chemical class 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims 3
- 239000000463 material Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- 125000004423 acyloxy group Chemical group 0.000 abstract 2
- 125000003342 alkenyl group Chemical group 0.000 abstract 2
- 125000004414 alkyl thio group Chemical group 0.000 abstract 2
- 125000004429 atom Chemical group 0.000 abstract 2
- 125000005843 halogen group Chemical group 0.000 abstract 2
- 241000499566 Eimeria brunetti Species 0.000 abstract 1
- 125000003302 alkenyloxy group Chemical group 0.000 abstract 1
- 230000001165 anti-coccidial effect Effects 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000005160 aryl oxy alkyl group Chemical group 0.000 abstract 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 abstract 1
- 230000000968 intestinal effect Effects 0.000 abstract 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 6
- 150000001448 anilines Chemical class 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N methanol Natural products OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 6
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 150000004331 4-hydroxyquinolines Chemical class 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 229910000027 potassium carbonate Inorganic materials 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- PBLNBZIONSLZBU-UHFFFAOYSA-N 1-bromododecane Chemical compound CCCCCCCCCCCCBr PBLNBZIONSLZBU-UHFFFAOYSA-N 0.000 description 2
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 2
- 241000224483 Coccidia Species 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- QLJUIUYIMJNBTP-UHFFFAOYSA-N ethyl 4-oxo-7-phenylmethoxy-6-propoxy-1H-quinoline-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC1=C(C=C2C(=C(C=NC2=C1)C(=O)OCC)O)OCCC QLJUIUYIMJNBTP-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- YKXVFWUHKKGVMU-UHFFFAOYSA-N quinolin-4-yl acetate Chemical class C1=CC=C2C(OC(=O)C)=CC=NC2=C1 YKXVFWUHKKGVMU-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- MOHYOXXOKFQHDC-UHFFFAOYSA-N 1-(chloromethyl)-4-methoxybenzene Chemical compound COC1=CC=C(CCl)C=C1 MOHYOXXOKFQHDC-UHFFFAOYSA-N 0.000 description 1
- QASBCTGZKABPKX-UHFFFAOYSA-N 4-(methylsulfanyl)phenol Chemical compound CSC1=CC=C(O)C=C1 QASBCTGZKABPKX-UHFFFAOYSA-N 0.000 description 1
- VHXMMNUZDIWWIK-UHFFFAOYSA-N 4-butyl-3-dodecoxyaniline Chemical compound C(CCCCCCCCCCC)OC=1C=C(N)C=CC=1CCCC VHXMMNUZDIWWIK-UHFFFAOYSA-N 0.000 description 1
- BTJIUGUIPKRLHP-UHFFFAOYSA-N 4-nitrophenol Chemical compound OC1=CC=C([N+]([O-])=O)C=C1 BTJIUGUIPKRLHP-UHFFFAOYSA-N 0.000 description 1
- NBULQXUIIVIHSH-UHFFFAOYSA-N COC1=CC=C(COC=2C=C(N)C=CC=2OCCC)C=C1 Chemical compound COC1=CC=C(COC=2C=C(N)C=CC=2OCCC)C=C1 NBULQXUIIVIHSH-UHFFFAOYSA-N 0.000 description 1
- 208000003495 Coccidiosis Diseases 0.000 description 1
- 241000499563 Eimeria necatrix Species 0.000 description 1
- 241000223932 Eimeria tenella Species 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 206010023076 Isosporiasis Diseases 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- OCBFFGCSTGGPSQ-UHFFFAOYSA-N [CH2]CC Chemical compound [CH2]CC OCBFFGCSTGGPSQ-UHFFFAOYSA-N 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- RMRFFCXPLWYOOY-UHFFFAOYSA-N allyl radical Chemical compound [CH2]C=C RMRFFCXPLWYOOY-UHFFFAOYSA-N 0.000 description 1
- 125000005336 allyloxy group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- YHASWHZGWUONAO-UHFFFAOYSA-N butanoyl butanoate Chemical compound CCCC(=O)OC(=O)CCC YHASWHZGWUONAO-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- LQAWZEZWVLAIHL-UHFFFAOYSA-N diethyl 2-(methoxymethylidene)propanedioate Chemical compound CCOC(=O)C(=COC)C(=O)OCC LQAWZEZWVLAIHL-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- MDRSKRKZWYSTTG-UHFFFAOYSA-N ethyl 4-acetyloxy-7-phenylmethoxy-6-propan-2-yloxyquinoline-3-carboxylate Chemical compound C(C1=CC=CC=C1)OC1=C(C=C2C(=C(C=NC2=C1)C(=O)OCC)OC(C)=O)OC(C)C MDRSKRKZWYSTTG-UHFFFAOYSA-N 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 1
- MFBOGIVSZKQAPD-UHFFFAOYSA-M sodium butyrate Chemical compound [Na+].CCCC([O-])=O MFBOGIVSZKQAPD-UHFFFAOYSA-M 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/48—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
- C07D215/54—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3
- C07D215/56—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen attached in position 3 with oxygen atoms in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Quinoline Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH145270A CH501626A (de) | 1966-09-15 | 1967-09-15 | Verfahren zur Herstellung von Chinolinderivaten |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB4130566A GB1138539A (en) | 1966-09-15 | 1966-09-15 | Quinoline derivatives |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH500193A true CH500193A (de) | 1970-12-15 |
Family
ID=10419075
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1292267A CH500193A (de) | 1966-09-15 | 1967-09-15 | Verfahren zur Herstellung von Chinolinderivaten |
Country Status (8)
| Country | Link |
|---|---|
| BE (1) | BE703887A (enExample) |
| CH (1) | CH500193A (enExample) |
| DE (1) | DE1695286A1 (enExample) |
| FR (1) | FR1573838A (enExample) |
| GB (1) | GB1138539A (enExample) |
| IL (1) | IL28530A (enExample) |
| NL (1) | NL6711776A (enExample) |
| SE (1) | SE333142B (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA947301A (en) * | 1970-01-28 | 1974-05-14 | Sumitomo Chemical Company | Process for the preparation of compound having antibacterial action |
| US10227355B2 (en) * | 2015-02-03 | 2019-03-12 | Council Of Scientific And Industrial Research | Quinoline derivatives and preparation thereof |
-
1966
- 1966-09-15 GB GB4130566A patent/GB1138539A/en not_active Expired
-
1967
- 1967-08-20 IL IL2853067A patent/IL28530A/en unknown
- 1967-08-21 DE DE19671695286 patent/DE1695286A1/de active Pending
- 1967-08-28 NL NL6711776A patent/NL6711776A/xx unknown
- 1967-09-11 SE SE1251667A patent/SE333142B/xx unknown
- 1967-09-14 BE BE703887D patent/BE703887A/xx unknown
- 1967-09-15 FR FR1573838D patent/FR1573838A/fr not_active Expired
- 1967-09-15 CH CH1292267A patent/CH500193A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| BE703887A (enExample) | 1968-03-14 |
| FR1573838A (enExample) | 1969-07-11 |
| DE1695286A1 (de) | 1971-03-18 |
| IL28530A (en) | 1971-11-29 |
| NL6711776A (enExample) | 1968-03-18 |
| SE333142B (sv) | 1971-03-08 |
| GB1138539A (en) | 1969-01-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH616923A5 (enExample) | ||
| DE2405395C2 (de) | 2,2'-Azine von 2,4-Thiazolidindionen | |
| DE1445878A1 (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| CH500193A (de) | Verfahren zur Herstellung von Chinolinderivaten | |
| DE2241241C3 (de) | Thiazolo eckige klammer auf 3.2-a eckige klammer zu -pyrimidinderivate, verfahren zu ihrer herstellung und sie enthaltende arzneimittel | |
| DE830511C (de) | Verfahren zur Herstellung von neuen diquartaeren Salzen von Pyrimidylaminochinolinen | |
| DE2151487A1 (de) | Pharmazeutische Massen | |
| DE1695285A1 (de) | Chinolinderivate und Verfahren zu deren Herstellung | |
| DE1795194A1 (de) | Chinolinderivate und Verfahren zu deren Herstellung | |
| DE1257152B (de) | Verfahren zur Herstellung substituierter Malonsaeurehydrazide | |
| DE2111710B2 (de) | 1 ^-Dioxido-S-methyl-chinoxalin-2-carbonsäure-2-hydroxyethylester und denselben enthaltendes Tierfutter oder denselben enthaltender Tiertrank | |
| AT240373B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| DE1695757C3 (de) | Pyridinmethanolcarbamate und Verfahren zu deren Herstellung | |
| AT215996B (de) | Verfahren zur Herstellung von neuen Pyridinderivaten | |
| CH534158A (de) | Verfahren zur Herstellung von Chinolinderivaten | |
| DE1695080A1 (de) | Verfahren zur Herstellung von neuen N-heterocyclischen Verbindungen | |
| AT221515B (de) | Verfahren zur Herstellung neuer 4-Oxo-1,2,3,4-tetrahydronaphthalin-carbonsäureamide | |
| AT246735B (de) | Verfahren zur Herstellung von neuen Naphthalinderivaten und deren Salzen | |
| DE1123331B (de) | Verfahren zur Herstellung von 1-Aryl-5-alkyl(oder aryl)-1,2,4-triazol-3-carbonsaeurealkylestern | |
| AT226710B (de) | Verfahren zur Herstellung von neuen Dihydrochinoxalonen-(2) und von deren Salzen | |
| CH501626A (de) | Verfahren zur Herstellung von Chinolinderivaten | |
| AT267533B (de) | Verfahren zur Herstellung von Benzodiazepin-Derivaten | |
| AT270635B (de) | Verfahren zur Herstellung von neuen (3-Indolyl)-essigsäureverbindungen | |
| DE2248690A1 (de) | Borverbindungen | |
| CH494761A (de) | Verfahren zur Herstellung von Chinolinderivaten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased |