CH467802A - Verfahren zur Herstellung von neuen heterocyclischen Verbindungen - Google Patents
Verfahren zur Herstellung von neuen heterocyclischen VerbindungenInfo
- Publication number
- CH467802A CH467802A CH1163965A CH1163965A CH467802A CH 467802 A CH467802 A CH 467802A CH 1163965 A CH1163965 A CH 1163965A CH 1163965 A CH1163965 A CH 1163965A CH 467802 A CH467802 A CH 467802A
- Authority
- CH
- Switzerland
- Prior art keywords
- formula
- sodium
- compounds
- preparation
- suspension
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims description 10
- 238000002360 preparation method Methods 0.000 title claims description 5
- 150000002391 heterocyclic compounds Chemical class 0.000 title description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 21
- 150000001875 compounds Chemical class 0.000 claims description 15
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 10
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 10
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 9
- 239000011734 sodium Substances 0.000 claims description 9
- 229910052708 sodium Inorganic materials 0.000 claims description 9
- 239000000725 suspension Substances 0.000 claims description 8
- -1 alkyimercapto Chemical group 0.000 claims description 7
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 229910000028 potassium bicarbonate Inorganic materials 0.000 claims description 4
- 235000015497 potassium bicarbonate Nutrition 0.000 claims description 4
- 239000011736 potassium bicarbonate Substances 0.000 claims description 4
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052801 chlorine Inorganic materials 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 claims description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 238000010438 heat treatment Methods 0.000 claims description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 10
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000001704 evaporation Methods 0.000 description 3
- 230000008020 evaporation Effects 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- SBASXUCJHJRPEV-UHFFFAOYSA-N 2-(2-methoxyethoxy)ethanol Chemical compound COCCOCCO SBASXUCJHJRPEV-UHFFFAOYSA-N 0.000 description 2
- FRVUMMQKVXXSKW-UHFFFAOYSA-N 4H-thieno[2,3-b][1,4]benzothiazine Chemical compound S1C=CC2=C1SC1=C(N2)C=CC=C1 FRVUMMQKVXXSKW-UHFFFAOYSA-N 0.000 description 2
- GSSMVDVXEPWURP-UHFFFAOYSA-N 6-methylsulfonyl-4H-thieno[2,3-b][1,4]benzothiazine Chemical compound CS(=O)(=O)C=1C=CC2=C(NC3=C(S2)SC=C3)C1 GSSMVDVXEPWURP-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- GUUVPOWQJOLRAS-UHFFFAOYSA-N Diphenyl disulfide Chemical compound C=1C=CC=CC=1SSC1=CC=CC=C1 GUUVPOWQJOLRAS-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- MWUXSHHQAYIFBG-UHFFFAOYSA-N Nitric oxide Chemical compound O=[N] MWUXSHHQAYIFBG-UHFFFAOYSA-N 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000010411 cooking Methods 0.000 description 2
- 229910001873 dinitrogen Inorganic materials 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- RMVRSNDYEFQCLF-UHFFFAOYSA-N phenyl mercaptan Natural products SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- JAANTSGNTKWLFA-UHFFFAOYSA-N 1-chloro-4-methylsulfonyl-2-nitrobenzene Chemical compound CS(=O)(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 JAANTSGNTKWLFA-UHFFFAOYSA-N 0.000 description 1
- UYIHKIRPUMUUJX-UHFFFAOYSA-N 3-bromo-2-nitrothiophene Chemical compound [O-][N+](=O)C=1SC=CC=1Br UYIHKIRPUMUUJX-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 229910052977 alkali metal sulfide Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000004414 alkyl thio group Chemical group 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- FBOSKQVOIHEWAX-UHFFFAOYSA-N benzothiazine Chemical compound C1=CC=C2N=CCSC2=C1 FBOSKQVOIHEWAX-UHFFFAOYSA-N 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D513/00—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00
- C07D513/02—Heterocyclic compounds containing in the condensed system at least one hetero ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for in groups C07D463/00, C07D477/00 or C07D499/00 - C07D507/00 in which the condensed system contains two hetero rings
- C07D513/04—Ortho-condensed systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Gasification And Melting Of Waste (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1163965A CH467802A (de) | 1964-10-01 | 1965-08-18 | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen |
| GB39033/65A GB1116525A (en) | 1964-10-01 | 1965-09-13 | 4h-thieno[2,3-b][1,4]benzothiazines and a process for their production |
| US489382A US3349087A (en) | 1964-10-01 | 1965-09-22 | Thieno-benzothiazine derivatives |
| OA52198A OA01825A (fr) | 1964-10-01 | 1965-09-28 | Nouvelles thiéno-benzothiazines substituées et leur préparation. |
| DE1965S0099707 DE1620308A1 (de) | 1964-10-01 | 1965-09-28 | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen |
| FR33107A FR1448552A (fr) | 1964-10-01 | 1965-09-29 | Nouvelles thiéno-benzothiazines substituées et leur préparation |
| BE670312A BE670312A (oth) | 1964-10-01 | 1965-09-29 | |
| NO65159905A NO115212B (oth) | 1964-10-01 | 1965-09-30 | |
| IL24388A IL24388A (en) | 1964-10-01 | 1965-09-30 | 4h-thieno(2,3-b)(1,4)benzothiazine compounds and a process for their production |
| AT887765A AT262991B (de) | 1964-10-01 | 1965-09-30 | Verfahren zur Herstellung von neuen Thienobenzothiazinderivaten |
| NL6512671A NL6512671A (oth) | 1964-10-01 | 1965-09-30 |
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1276564A CH447174A (de) | 1964-10-01 | 1964-10-01 | Verfahren zur Herstellung von neuen Thieno-benzothiazin-Derivaten |
| CH1363464 | 1964-10-21 | ||
| CH1663164 | 1964-12-23 | ||
| CH449665 | 1965-04-01 | ||
| CH449765 | 1965-04-01 | ||
| CH1163865 | 1965-08-18 | ||
| CH1163965A CH467802A (de) | 1964-10-01 | 1965-08-18 | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH467802A true CH467802A (de) | 1969-01-31 |
Family
ID=27561090
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH1163965A CH467802A (de) | 1964-10-01 | 1965-08-18 | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3349087A (oth) |
| BE (1) | BE670312A (oth) |
| CH (1) | CH467802A (oth) |
| DE (1) | DE1620308A1 (oth) |
| GB (1) | GB1116525A (oth) |
| IL (1) | IL24388A (oth) |
| NL (1) | NL6512671A (oth) |
| NO (1) | NO115212B (oth) |
| OA (1) | OA01825A (oth) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH452531A (de) * | 1964-10-09 | 1968-03-15 | Sandoz Ag | Verfahren zur Herstellung von neuen Thieno-benzothiazin-Derivaten |
| DE3111513A1 (de) * | 1981-03-24 | 1982-10-21 | Bayer Ag, 5090 Leverkusen | Neue stabilisatoren |
| CA2144013A1 (en) * | 1994-03-09 | 1995-09-10 | Yuzo Yagi | Hexahydropyrano [3, 2-b][1,4]benzothiazine derivative |
| CN119315041A (zh) | 2017-01-27 | 2025-01-14 | Cps科技控股有限公司 | 电池板栅 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2461460A (en) * | 1949-02-08 | N-acixphenothiazines | ||
| US2997468A (en) * | 1958-11-06 | 1961-08-22 | Olin Mathieson | Preparation of phenothiazines |
-
1965
- 1965-08-18 CH CH1163965A patent/CH467802A/de unknown
- 1965-09-13 GB GB39033/65A patent/GB1116525A/en not_active Expired
- 1965-09-22 US US489382A patent/US3349087A/en not_active Expired - Lifetime
- 1965-09-28 DE DE1965S0099707 patent/DE1620308A1/de active Pending
- 1965-09-28 OA OA52198A patent/OA01825A/xx unknown
- 1965-09-29 BE BE670312A patent/BE670312A/xx unknown
- 1965-09-30 IL IL24388A patent/IL24388A/xx unknown
- 1965-09-30 NO NO65159905A patent/NO115212B/no unknown
- 1965-09-30 NL NL6512671A patent/NL6512671A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| GB1116525A (en) | 1968-06-06 |
| NO115212B (oth) | 1968-09-02 |
| DE1620308A1 (de) | 1970-03-12 |
| US3349087A (en) | 1967-10-24 |
| BE670312A (oth) | 1966-03-29 |
| NL6512671A (oth) | 1966-04-04 |
| OA01825A (fr) | 1970-01-14 |
| IL24388A (en) | 1969-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH374699A (de) | Verfahren zur Herstellung von Disulfamylanilin-Verbindungen | |
| CH467802A (de) | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen | |
| DE2756783A1 (de) | Sulfamoylbenzoesaeuren | |
| AT162912B (de) | Verfahren zur Herstellung neuer Hydrazinverbindungen und ihrer Derivate | |
| AT262991B (de) | Verfahren zur Herstellung von neuen Thienobenzothiazinderivaten | |
| AT321926B (de) | Verfahren zur herstellung von pyridazinon-derivaten mit herbizider wirkung | |
| AT215983B (de) | Verfahren zur Herstellung von neuen Benzophenonsulfonamiden | |
| AT228190B (de) | Verfahren zur Herstellung von neuen Hydrazinderivaten und ihren Salzen | |
| DE2233482A1 (de) | Verfahren zur herstellung von benzodiazepin-derivaten | |
| AT258910B (de) | Verfahren zur Herstellung von Benzo-dihydro-thiadiazin-Derivaten | |
| AT219038B (de) | Verfahren zur Herstellung von neuen Isoindolinderivaten | |
| AT238190B (de) | Verfahren zur Herstellung von neuen β-Carbolin-carbonsäureamid-Derivaten | |
| AT284848B (de) | Verfahren zur Herstellung 3-substituierter 1,2,3,4-Tetrahydro- bzw. 1,2-Dihydro-chinoxalin-2-one | |
| AT239243B (de) | Verfahren zur Herstellung von 2, 3-Dicyan-1, 4-dithia-anthrahydrochinon und -anthrachinon | |
| AT236958B (de) | Verfahren zur Herstellung von neuen 5-Phenyl-2-hydroxy-6-amino-pyrimidinderivaten | |
| AT223619B (de) | Verfahren zur Herstellung von 3,4-Dihydro-1,2,4-benzothiadiazin-1,1-dioxyden | |
| AT230370B (de) | Verfahren zur Herstellung von neuen Sulfonamiden | |
| AT203487B (de) | Verfahren zur Herstellung von neuen Isothiocyanaten | |
| AT204552B (de) | Verfahren zur Herstellung von neuen, heterocyclischen Bis-sulfonamiden | |
| AT230357B (de) | Verfahren zur Herstellung von neuen Benzoesäurederivaten | |
| AT219039B (de) | Verfahren zur Herstellung von neuen Isoindolinderivaten | |
| AT216000B (de) | Verfahren zur Herstellung von 6-Chlor-7-sulfonamido-1,2,4-benzothiadiazin-1,1-dioxyden | |
| AT380239B (de) | Verfahren zur herstellung von neuen chinolonverbindungen | |
| AT226719B (de) | Verfahren zur Herstellung von neuen Pyridazinabkömmlingen | |
| AT239228B (de) | Verfahren zur Herstellung von 7-Sulfamyl-3, 4-dihydro-1, 2, 4-benzothiadiazin-1, 1-dioxyden |