CA2202058C - Cyclic hexapeptides having antibiotic activity - Google Patents
Cyclic hexapeptides having antibiotic activity Download PDFInfo
- Publication number
- CA2202058C CA2202058C CA002202058A CA2202058A CA2202058C CA 2202058 C CA2202058 C CA 2202058C CA 002202058 A CA002202058 A CA 002202058A CA 2202058 A CA2202058 A CA 2202058A CA 2202058 C CA2202058 C CA 2202058C
- Authority
- CA
- Canada
- Prior art keywords
- alkoxy
- phenyl
- substituted
- alkyl
- nmr
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 230000003115 biocidal effect Effects 0.000 title description 2
- 125000004122 cyclic group Chemical group 0.000 title description 2
- 238000002360 preparation method Methods 0.000 claims abstract description 316
- 150000001875 compounds Chemical class 0.000 claims abstract description 130
- 150000003839 salts Chemical class 0.000 claims abstract description 42
- 229920001184 polypeptide Polymers 0.000 claims abstract description 17
- 102000004196 processed proteins & peptides Human genes 0.000 claims abstract description 17
- 108090000765 processed proteins & peptides Proteins 0.000 claims abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 10
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 4
- 230000000069 prophylactic effect Effects 0.000 claims abstract description 4
- 230000001225 therapeutic effect Effects 0.000 claims abstract description 4
- 241001465754 Metazoa Species 0.000 claims abstract description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 320
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 281
- -1 indolylcarbonyl Chemical group 0.000 claims description 184
- 125000000217 alkyl group Chemical group 0.000 claims description 132
- 125000001424 substituent group Chemical group 0.000 claims description 130
- 125000001589 carboacyl group Chemical group 0.000 claims description 113
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 74
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims description 51
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 29
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 28
- 125000001624 naphthyl group Chemical group 0.000 claims description 27
- 125000001038 naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 claims description 23
- 125000004193 piperazinyl group Chemical group 0.000 claims description 18
- 125000004043 oxo group Chemical group O=* 0.000 claims description 17
- 125000005936 piperidyl group Chemical group 0.000 claims description 17
- 125000006529 (C3-C6) alkyl group Chemical group 0.000 claims description 15
- 125000005862 (C1-C6)alkanoyl group Chemical group 0.000 claims description 13
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 claims description 12
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 12
- 125000003226 pyrazolyl group Chemical group 0.000 claims description 11
- 125000004076 pyridyl group Chemical group 0.000 claims description 10
- 125000002971 oxazolyl group Chemical group 0.000 claims description 9
- 125000002098 pyridazinyl group Chemical group 0.000 claims description 9
- 125000001425 triazolyl group Chemical group 0.000 claims description 8
- 125000001715 oxadiazolyl group Chemical group 0.000 claims description 7
- 125000000842 isoxazolyl group Chemical group 0.000 claims description 6
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 claims description 5
- 125000004925 dihydropyridyl group Chemical group N1(CC=CC=C1)* 0.000 claims description 5
- 125000002632 imidazolidinyl group Chemical group 0.000 claims description 5
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 5
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 5
- 125000000719 pyrrolidinyl group Chemical group 0.000 claims description 5
- 125000001113 thiadiazolyl group Chemical group 0.000 claims description 5
- 125000003277 amino group Chemical group 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical group 0.000 claims description 4
- 125000002883 imidazolyl group Chemical group 0.000 claims description 4
- 125000003831 tetrazolyl group Chemical group 0.000 claims description 4
- 125000000335 thiazolyl group Chemical group 0.000 claims description 4
- 239000004480 active ingredient Substances 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000001786 isothiazolyl group Chemical group 0.000 claims description 3
- 125000001422 pyrrolinyl group Chemical group 0.000 claims description 3
- 125000005872 benzooxazolyl group Chemical group 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 2
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 2
- 159000000000 sodium salts Chemical class 0.000 claims description 2
- 206010017533 Fungal infection Diseases 0.000 claims 3
- 208000031888 Mycoses Diseases 0.000 claims 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 3
- 239000003814 drug Substances 0.000 claims 2
- 125000001475 halogen functional group Chemical group 0.000 claims 2
- 244000000010 microbial pathogen Species 0.000 claims 1
- 230000000845 anti-microbial effect Effects 0.000 abstract description 6
- 230000000843 anti-fungal effect Effects 0.000 abstract description 4
- 208000035473 Communicable disease Diseases 0.000 abstract description 3
- 206010035660 Pneumocystis Infections Diseases 0.000 abstract description 3
- 206010073756 Pneumocystis jirovecii infection Diseases 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 3
- 229920001503 Glucan Polymers 0.000 abstract 1
- 208000005384 Pneumocystis Pneumonia Diseases 0.000 abstract 1
- 206010073755 Pneumocystis jirovecii pneumonia Diseases 0.000 abstract 1
- 201000000317 pneumocystosis Diseases 0.000 abstract 1
- IAZDPXIOMUYVGZ-WFGJKAKNSA-N Dimethyl sulfoxide Chemical compound [2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] IAZDPXIOMUYVGZ-WFGJKAKNSA-N 0.000 description 464
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 177
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 174
- 101150041968 CDC13 gene Proteins 0.000 description 172
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 168
- 125000003118 aryl group Chemical group 0.000 description 146
- 239000000203 mixture Substances 0.000 description 101
- 230000002829 reductive effect Effects 0.000 description 90
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 84
- 235000019341 magnesium sulphate Nutrition 0.000 description 84
- 239000011734 sodium Substances 0.000 description 82
- 239000000243 solution Substances 0.000 description 81
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 81
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 77
- 238000000921 elemental analysis Methods 0.000 description 77
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 73
- 125000003435 aroyl group Chemical group 0.000 description 58
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 56
- 125000000623 heterocyclic group Chemical group 0.000 description 55
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 55
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 51
- 229910052757 nitrogen Inorganic materials 0.000 description 47
- 239000011541 reaction mixture Substances 0.000 description 46
- 125000004433 nitrogen atom Chemical group N* 0.000 description 44
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 43
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 42
- 239000012267 brine Substances 0.000 description 42
- 239000012044 organic layer Substances 0.000 description 42
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 42
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 41
- 239000012964 benzotriazole Substances 0.000 description 39
- 239000002253 acid Substances 0.000 description 38
- 125000002911 monocyclic heterocycle group Chemical group 0.000 description 38
- 229910052739 hydrogen Inorganic materials 0.000 description 35
- 239000000706 filtrate Substances 0.000 description 34
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 33
- 238000001914 filtration Methods 0.000 description 29
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 28
- BJFLSHMHTPAZHO-UHFFFAOYSA-N benzotriazole Chemical compound [CH]1C=CC=C2N=NN=C21 BJFLSHMHTPAZHO-UHFFFAOYSA-N 0.000 description 27
- 239000000725 suspension Substances 0.000 description 27
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 26
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 26
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical class CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 26
- 238000004440 column chromatography Methods 0.000 description 24
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 23
- 125000004430 oxygen atom Chemical group O* 0.000 description 21
- 239000002244 precipitate Substances 0.000 description 21
- 239000002904 solvent Substances 0.000 description 21
- 229910052717 sulfur Inorganic materials 0.000 description 20
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 18
- 229920006395 saturated elastomer Polymers 0.000 description 18
- 125000004434 sulfur atom Chemical group 0.000 description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 17
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 15
- 238000004458 analytical method Methods 0.000 description 13
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 13
- 239000000843 powder Substances 0.000 description 13
- 239000000047 product Substances 0.000 description 13
- 238000006243 chemical reaction Methods 0.000 description 12
- VHYFNPMBLIVWCW-UHFFFAOYSA-N 4-dimethylaminopyridine Substances CN(C)C1=CC=NC=C1 VHYFNPMBLIVWCW-UHFFFAOYSA-N 0.000 description 10
- 239000007864 aqueous solution Substances 0.000 description 10
- 238000001816 cooling Methods 0.000 description 10
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 10
- 125000005447 octyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 10
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 10
- 239000007787 solid Substances 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 9
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 150000002148 esters Chemical class 0.000 description 9
- 125000004194 piperazin-1-yl group Chemical group [H]N1C([H])([H])C([H])([H])N(*)C([H])([H])C1([H])[H] 0.000 description 9
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 9
- 239000005711 Benzoic acid Substances 0.000 description 8
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 8
- 229960000583 acetic acid Drugs 0.000 description 8
- 125000004104 aryloxy group Chemical group 0.000 description 8
- 125000004429 atom Chemical group 0.000 description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 8
- 239000000499 gel Substances 0.000 description 8
- 125000005843 halogen group Chemical group 0.000 description 8
- 235000010233 benzoic acid Nutrition 0.000 description 7
- 125000005446 heptyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 7
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 7
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 7
- 239000007858 starting material Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 6
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 6
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 6
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 6
- 239000005457 ice water Substances 0.000 description 6
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 6
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 5
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 5
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 5
- NIXOWILDQLNWCW-UHFFFAOYSA-N 2-Propenoic acid Natural products OC(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 125000004466 alkoxycarbonylamino group Chemical group 0.000 description 5
- 125000004432 carbon atom Chemical group C* 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 125000002541 furyl group Chemical group 0.000 description 5
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 5
- 239000003456 ion exchange resin Substances 0.000 description 5
- 229920003303 ion-exchange polymer Polymers 0.000 description 5
- 150000004702 methyl esters Chemical class 0.000 description 5
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 5
- 229910000027 potassium carbonate Inorganic materials 0.000 description 5
- UWYZHKAOTLEWKK-UHFFFAOYSA-N 1,2,3,4-tetrahydroisoquinoline Chemical group C1=CC=C2CNCCC2=C1 UWYZHKAOTLEWKK-UHFFFAOYSA-N 0.000 description 4
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 4
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 4
- 241000206607 Porphyra umbilicalis Species 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- 125000003342 alkenyl group Chemical group 0.000 description 4
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 4
- 229910052799 carbon Inorganic materials 0.000 description 4
- 125000003104 hexanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 238000001990 intravenous administration Methods 0.000 description 4
- 239000012299 nitrogen atmosphere Substances 0.000 description 4
- 150000002923 oximes Chemical class 0.000 description 4
- 238000000746 purification Methods 0.000 description 4
- 239000011369 resultant mixture Substances 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 4
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 4
- 125000003774 valeryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- PVRFWXFHUOIQLV-UHFFFAOYSA-N 1-amino-3-(4-octylphenyl)urea Chemical compound CCCCCCCCC1=CC=C(NC(=O)NN)C=C1 PVRFWXFHUOIQLV-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 150000008065 acid anhydrides Chemical class 0.000 description 3
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 3
- 125000001769 aryl amino group Chemical group 0.000 description 3
- FFBHFFJDDLITSX-UHFFFAOYSA-N benzyl N-[2-hydroxy-4-(3-oxomorpholin-4-yl)phenyl]carbamate Chemical compound OC1=C(NC(=O)OCC2=CC=CC=C2)C=CC(=C1)N1CCOCC1=O FFBHFFJDDLITSX-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 238000000855 fermentation Methods 0.000 description 3
- 230000004151 fermentation Effects 0.000 description 3
- 125000003707 hexyloxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 3
- 238000007918 intramuscular administration Methods 0.000 description 3
- 125000002757 morpholinyl group Chemical group 0.000 description 3
- 239000011664 nicotinic acid Substances 0.000 description 3
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 3
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 3
- 125000005425 toluyl group Chemical group 0.000 description 3
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 3
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004506 1,2,5-oxadiazolyl group Chemical group 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 125000001781 1,3,4-oxadiazolyl group Chemical group 0.000 description 2
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- QHLVAKZJUURIQO-UHFFFAOYSA-N 1-(4-octoxyphenyl)piperazine Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCNCC1 QHLVAKZJUURIQO-UHFFFAOYSA-N 0.000 description 2
- QQQSUVSRXPLWAH-UHFFFAOYSA-N 1-[4-(4-heptylphenyl)phenyl]ethanone Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(C)=O)C=C1 QQQSUVSRXPLWAH-UHFFFAOYSA-N 0.000 description 2
- RJQRJLCQHIMUQO-UHFFFAOYSA-N 1-bromo-4-(4-heptylphenyl)benzene Chemical group C1=CC(CCCCCCC)=CC=C1C1=CC=C(Br)C=C1 RJQRJLCQHIMUQO-UHFFFAOYSA-N 0.000 description 2
- VXJTWTJULLKDPY-UHFFFAOYSA-N 1-bromo-4-(4-pentylphenyl)benzene Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(Br)C=C1 VXJTWTJULLKDPY-UHFFFAOYSA-N 0.000 description 2
- UXQBXLHGTWIYNR-UHFFFAOYSA-N 1-bromo-4-[4-(7-bromoheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 UXQBXLHGTWIYNR-UHFFFAOYSA-N 0.000 description 2
- SNKZHWDUNHXAMY-UHFFFAOYSA-N 1-bromo-4-[4-(8-bromooctoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 SNKZHWDUNHXAMY-UHFFFAOYSA-N 0.000 description 2
- VMKOFRJSULQZRM-UHFFFAOYSA-N 1-bromooctane Chemical compound CCCCCCCCBr VMKOFRJSULQZRM-UHFFFAOYSA-N 0.000 description 2
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 2
- MKSWQHOPSDCVMS-UHFFFAOYSA-N 1-ethynyl-4-pentoxybenzene Chemical group CCCCCOC1=CC=C(C#C)C=C1 MKSWQHOPSDCVMS-UHFFFAOYSA-N 0.000 description 2
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 description 2
- IUNJCFABHJZSKB-UHFFFAOYSA-N 2,4-dihydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C(O)=C1 IUNJCFABHJZSKB-UHFFFAOYSA-N 0.000 description 2
- SMNDYUVBFMFKNZ-UHFFFAOYSA-N 2-furoic acid Chemical compound OC(=O)C1=CC=CO1 SMNDYUVBFMFKNZ-UHFFFAOYSA-N 0.000 description 2
- DVFWRZHZHULTLX-UHFFFAOYSA-N 3-(4-bromophenyl)-5-(4-pentoxyphenyl)-1,2-oxazole Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(Br)=CC=2)=NO1 DVFWRZHZHULTLX-UHFFFAOYSA-N 0.000 description 2
- PWGPANWHHZDAIP-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]propanoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 PWGPANWHHZDAIP-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- ZVTRGFJIJKDEMD-UHFFFAOYSA-N 4-[3-(4-hexoxyphenyl)-1h-pyrazol-5-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(O)=O)=NN1 ZVTRGFJIJKDEMD-UHFFFAOYSA-N 0.000 description 2
- IEPCABVQANKPNT-UHFFFAOYSA-N 4-[4-(8-bromooctoxy)phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C1=CC=C(OCCCCCCCCBr)C=C1 IEPCABVQANKPNT-UHFFFAOYSA-N 0.000 description 2
- PDTXSIGPZDVVIX-UHFFFAOYSA-N 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoic acid Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(O)=O)=NO1 PDTXSIGPZDVVIX-UHFFFAOYSA-N 0.000 description 2
- ZKSQOKZGDNEDJQ-UHFFFAOYSA-N 4-hexoxybenzohydrazide Chemical compound CCCCCCOC1=CC=C(C(=O)NN)C=C1 ZKSQOKZGDNEDJQ-UHFFFAOYSA-N 0.000 description 2
- HCXJFMDOHDNDCC-UHFFFAOYSA-N 5-$l^{1}-oxidanyl-3,4-dihydropyrrol-2-one Chemical group O=C1CCC(=O)[N]1 HCXJFMDOHDNDCC-UHFFFAOYSA-N 0.000 description 2
- UWYDUSKEEPMFNU-UHFFFAOYSA-N 6-heptoxynaphthalene-2-carbonyl chloride Chemical compound C1=C(C(Cl)=O)C=CC2=CC(OCCCCCCC)=CC=C21 UWYDUSKEEPMFNU-UHFFFAOYSA-N 0.000 description 2
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 2
- 101150008415 CALCA gene Proteins 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- UEXCJVNBTNXOEH-UHFFFAOYSA-N Ethynylbenzene Chemical group C#CC1=CC=CC=C1 UEXCJVNBTNXOEH-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 2
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 2
- 125000003354 benzotriazolyl group Chemical group N1N=NC2=C1C=CC=C2* 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000004230 chromenyl group Chemical group O1C(C=CC2=CC=CC=C12)* 0.000 description 2
- 101150084411 crn1 gene Proteins 0.000 description 2
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N diphenyl Chemical compound C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- RILLRPWNMMZZBV-UHFFFAOYSA-N ethyl 1-(4-hexoxyphenyl)-4-oxopiperidine-3-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1N1CC(C(=O)OCC)C(=O)CC1 RILLRPWNMMZZBV-UHFFFAOYSA-N 0.000 description 2
- WQSOFWIIBNJWSS-UHFFFAOYSA-N ethyl 3-amino-4-hydroxybenzoate Chemical compound CCOC(=O)C1=CC=C(O)C(N)=C1 WQSOFWIIBNJWSS-UHFFFAOYSA-N 0.000 description 2
- GHMHKOHJAFFUCP-UHFFFAOYSA-N ethyl 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(=O)OCC)=NO1 GHMHKOHJAFFUCP-UHFFFAOYSA-N 0.000 description 2
- OAYLNYINCPYISS-UHFFFAOYSA-N ethyl acetate;hexane Chemical compound CCCCCC.CCOC(C)=O OAYLNYINCPYISS-UHFFFAOYSA-N 0.000 description 2
- LEQAOMBKQFMDFZ-UHFFFAOYSA-N glyoxal Chemical compound O=CC=O LEQAOMBKQFMDFZ-UHFFFAOYSA-N 0.000 description 2
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 2
- 125000003406 indolizinyl group Chemical group C=1(C=CN2C=CC=CC12)* 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000005956 isoquinolyl group Chemical group 0.000 description 2
- 125000004284 isoxazol-3-yl group Chemical group [H]C1=C([H])C(*)=NO1 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Inorganic materials O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- IOPLHGOSNCJOOO-UHFFFAOYSA-N methyl 3,4-diaminobenzoate Chemical compound COC(=O)C1=CC=C(N)C(N)=C1 IOPLHGOSNCJOOO-UHFFFAOYSA-N 0.000 description 2
- VVHXCSFDEMZQFY-UHFFFAOYSA-N methyl 4-(hydroxyiminomethyl)benzoate Chemical compound COC(=O)C1=CC=C(C=NO)C=C1 VVHXCSFDEMZQFY-UHFFFAOYSA-N 0.000 description 2
- CVXXHXPNTZBZEL-UHFFFAOYSA-N methyl 4-carbonochloridoylbenzoate Chemical compound COC(=O)C1=CC=C(C(Cl)=O)C=C1 CVXXHXPNTZBZEL-UHFFFAOYSA-N 0.000 description 2
- OMKOCPWIXVQHHX-UHFFFAOYSA-N methyl 6-hept-1-ynylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(C#CCCCCC)=CC=C21 OMKOCPWIXVQHHX-UHFFFAOYSA-N 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 150000007530 organic bases Chemical class 0.000 description 2
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 description 2
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000004115 pentoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 2
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical compound OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 2
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 2
- 150000003016 phosphoric acids Chemical class 0.000 description 2
- 229910003446 platinum oxide Inorganic materials 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 238000010992 reflux Methods 0.000 description 2
- 239000011347 resin Substances 0.000 description 2
- 229920005989 resin Polymers 0.000 description 2
- 239000011593 sulfur Substances 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 125000001984 thiazolidinyl group Chemical group 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- WJKHJLXJJJATHN-UHFFFAOYSA-N triflic anhydride Chemical compound FC(F)(F)S(=O)(=O)OS(=O)(=O)C(F)(F)F WJKHJLXJJJATHN-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- VCGRFBXVSFAGGA-UHFFFAOYSA-N (1,1-dioxo-1,4-thiazinan-4-yl)-[6-[[3-(4-fluorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]pyridin-3-yl]methanone Chemical compound CC=1ON=C(C=2C=CC(F)=CC=2)C=1COC(N=C1)=CC=C1C(=O)N1CCS(=O)(=O)CC1 VCGRFBXVSFAGGA-UHFFFAOYSA-N 0.000 description 1
- XICOPJZLUVZIGC-UHFFFAOYSA-N (2-nonyl-1,3-benzoxazol-5-yl)-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound N1=[N+]([O-])C2=CC=CC=C2N1C(=O)C1=CC=C(OC(CCCCCCCCC)=N2)C2=C1 XICOPJZLUVZIGC-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- VFCANFOUSHVCKC-UHFFFAOYSA-N (3,4-dipentoxyphenyl)-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=C(OCCCCC)C(OCCCCC)=CC=C1C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 VFCANFOUSHVCKC-UHFFFAOYSA-N 0.000 description 1
- VZEPZIRFHZJREF-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[4-(4-phenylcyclohexyl)piperazin-1-yl]phenyl]methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1N(CC1)CCN1C(CC1)CCC1C1=CC=CC=C1 VZEPZIRFHZJREF-UHFFFAOYSA-N 0.000 description 1
- YTDRFIFPDYISQX-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[4-[8-(tetrazol-2-yl)octoxy]phenyl]phenyl]methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1C(C=C1)=CC=C1OCCCCCCCCN1N=CN=N1 YTDRFIFPDYISQX-UHFFFAOYSA-N 0.000 description 1
- QCYUORFAXPPMLW-UHFFFAOYSA-N (3-oxidobenzotriazol-3-ium-1-yl)-[4-[5-[4-(4-propoxyphenyl)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]methanone Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C=2OC(=NN=2)C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 QCYUORFAXPPMLW-UHFFFAOYSA-N 0.000 description 1
- ZLNLODKRFLDQDX-IBGZPJMESA-N (3s)-3-hydroxy-1-(3-oxidobenzotriazol-3-ium-1-yl)hexadecan-1-one Chemical compound C1=CC=C2N(C(=O)C[C@@H](O)CCCCCCCCCCCCC)N=[N+]([O-])C2=C1 ZLNLODKRFLDQDX-IBGZPJMESA-N 0.000 description 1
- ZJYIVHWYSNWCSX-LBPRGKRZSA-N (3s)-7-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonyl]-3,4-dihydro-1h-isoquinoline-3-carboxylic acid Chemical compound OC1=CC=C2C[C@@H](C(O)=O)N(C(=O)OC(C)(C)C)CC2=C1 ZJYIVHWYSNWCSX-LBPRGKRZSA-N 0.000 description 1
- PQCXFUXRTRESBD-UHFFFAOYSA-N (4-methoxycarbonylphenyl)boronic acid Chemical compound COC(=O)C1=CC=C(B(O)O)C=C1 PQCXFUXRTRESBD-UHFFFAOYSA-N 0.000 description 1
- VGRXAHXMIDCTNV-UHFFFAOYSA-N (6-chlorobenzotriazol-1-yl) 4-chlorobenzenesulfonate Chemical compound C1=CC(Cl)=CC=C1S(=O)(=O)ON1C2=CC(Cl)=CC=C2N=N1 VGRXAHXMIDCTNV-UHFFFAOYSA-N 0.000 description 1
- FPTLXNXYTSEYKS-OVCLIPMQSA-N (e)-3-[4-(4-hex-5-enoxyphenyl)phenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1C1=CC=C(OCCCCC=C)C=C1 FPTLXNXYTSEYKS-OVCLIPMQSA-N 0.000 description 1
- RPPDKOWDJNJJTA-WOJGMQOQSA-N (e)-3-[4-[4-(6-fluorohexoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)\C=C\C(C=C1)=CC=C1C1=CC=C(OCCCCCCF)C=C1 RPPDKOWDJNJJTA-WOJGMQOQSA-N 0.000 description 1
- VNAYIIFSISFFEL-VGOFMYFVSA-N (e)-3-[4-[4-(6-fluorohexoxy)phenyl]phenyl]prop-2-enoic acid Chemical compound C1=CC(/C=C/C(=O)O)=CC=C1C1=CC=C(OCCCCCCF)C=C1 VNAYIIFSISFFEL-VGOFMYFVSA-N 0.000 description 1
- HQFZRJBEYYRMLR-XDHOZWIPSA-N (e)-3-[4-[4-(6-methoxyhexoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C1=CC(OCCCCCCOC)=CC=C1C(C=C1)=CC=C1\C=C\C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 HQFZRJBEYYRMLR-XDHOZWIPSA-N 0.000 description 1
- CUZVYLKXUNFGOM-XDHOZWIPSA-N (e)-3-[4-[4-(7-fluoroheptoxy)phenyl]phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)\C=C\C(C=C1)=CC=C1C1=CC=C(OCCCCCCCF)C=C1 CUZVYLKXUNFGOM-XDHOZWIPSA-N 0.000 description 1
- BTSSKYNPVOVRDN-ZCXUNETKSA-N (z)-3-[4-(4-heptylphenyl)phenyl]but-2-enoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(\C)=C/C(O)=O)C=C1 BTSSKYNPVOVRDN-ZCXUNETKSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 125000004511 1,2,3-thiadiazolyl group Chemical group 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 125000004517 1,2,5-thiadiazolyl group Chemical group 0.000 description 1
- BDNKZNFMNDZQMI-UHFFFAOYSA-N 1,3-diisopropylcarbodiimide Chemical compound CC(C)N=C=NC(C)C BDNKZNFMNDZQMI-UHFFFAOYSA-N 0.000 description 1
- AGEIEHTVRJHTIV-UHFFFAOYSA-N 1-(3-oxidobenzotriazol-3-ium-1-yl)-3-[4-(4-pentoxyphenyl)phenyl]prop-2-en-1-one Chemical compound C1=CC(OCCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 AGEIEHTVRJHTIV-UHFFFAOYSA-N 0.000 description 1
- QAVOXXMITVAYCL-UHFFFAOYSA-N 1-(3-oxidobenzotriazol-3-ium-1-yl)-3-[4-(4-pentylphenyl)phenyl]prop-2-en-1-one Chemical compound C1=CC(CCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 QAVOXXMITVAYCL-UHFFFAOYSA-N 0.000 description 1
- CRUVZSXCXPWZAC-UHFFFAOYSA-N 1-(4-cyclohexylphenyl)piperazine Chemical compound C1CCCCC1C1=CC=C(N2CCNCC2)C=C1 CRUVZSXCXPWZAC-UHFFFAOYSA-N 0.000 description 1
- ACFUNONLPCBJDR-UHFFFAOYSA-N 1-(4-hexoxyphenyl)piperidin-4-one Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCC(=O)CC1 ACFUNONLPCBJDR-UHFFFAOYSA-N 0.000 description 1
- PFVJQJDAFGYXEV-UHFFFAOYSA-N 1-(4-hexylphenyl)piperazine;dihydrobromide Chemical compound Br.Br.C1=CC(CCCCCC)=CC=C1N1CCNCC1 PFVJQJDAFGYXEV-UHFFFAOYSA-N 0.000 description 1
- UPLBTVYITAGXGL-UHFFFAOYSA-N 1-bromo-4-(4-butoxyphenyl)benzene Chemical group C1=CC(OCCCC)=CC=C1C1=CC=C(Br)C=C1 UPLBTVYITAGXGL-UHFFFAOYSA-N 0.000 description 1
- BPYRRARMEFLXFA-UHFFFAOYSA-N 1-bromo-4-[4-(5-bromopentoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 BPYRRARMEFLXFA-UHFFFAOYSA-N 0.000 description 1
- KNNBCWVKTHEAKP-UHFFFAOYSA-N 1-bromo-4-[4-(6-bromohexoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCBr)=CC=C1C1=CC=C(Br)C=C1 KNNBCWVKTHEAKP-UHFFFAOYSA-N 0.000 description 1
- NVVVHPJZHYYYLI-UHFFFAOYSA-N 1-bromo-4-[4-(7-fluoroheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCF)=CC=C1C1=CC=C(Br)C=C1 NVVVHPJZHYYYLI-UHFFFAOYSA-N 0.000 description 1
- ITSFDFNBRHKPLN-UHFFFAOYSA-N 1-bromo-4-[4-(7-methoxyheptoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(Br)C=C1 ITSFDFNBRHKPLN-UHFFFAOYSA-N 0.000 description 1
- FQWMSISJKKMMAY-UHFFFAOYSA-N 1-bromo-4-[4-(8-methoxyoctoxy)phenyl]benzene Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=CC=C(Br)C=C1 FQWMSISJKKMMAY-UHFFFAOYSA-N 0.000 description 1
- SVHXPGWTCYKGGU-UHFFFAOYSA-N 1-ethynyl-4-(4-pentylphenyl)benzene Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(C#C)C=C1 SVHXPGWTCYKGGU-UHFFFAOYSA-N 0.000 description 1
- WQUQANRAAFHDNF-UHFFFAOYSA-N 1-heptyl-4-iodopyrazole Chemical compound CCCCCCCN1C=C(I)C=N1 WQUQANRAAFHDNF-UHFFFAOYSA-N 0.000 description 1
- SNUSZUYTMHKCPM-UHFFFAOYSA-N 1-hydroxypyridin-2-one Chemical compound ON1C=CC=CC1=O SNUSZUYTMHKCPM-UHFFFAOYSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- NUMXHEUHHRTBQT-AATRIKPKSA-N 2,4-dimethoxy-1-[(e)-2-nitroethenyl]benzene Chemical compound COC1=CC=C(\C=C\[N+]([O-])=O)C(OC)=C1 NUMXHEUHHRTBQT-AATRIKPKSA-N 0.000 description 1
- HNVIQLPOGUDBSU-UHFFFAOYSA-N 2,6-dimethylmorpholine Chemical compound CC1CNCC(C)O1 HNVIQLPOGUDBSU-UHFFFAOYSA-N 0.000 description 1
- FEPVDSQKTSBMKK-UHFFFAOYSA-N 2-(4-hexoxyphenyl)-3h-benzimidazole-5-carboxylic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(O)=O)C=C2N1 FEPVDSQKTSBMKK-UHFFFAOYSA-N 0.000 description 1
- CCCNSSCOAQLYDF-UHFFFAOYSA-N 2-(4-octoxyphenoxy)-1-(3-oxidobenzotriazol-3-ium-1-yl)ethanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1OCC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 CCCNSSCOAQLYDF-UHFFFAOYSA-N 0.000 description 1
- ZVNRMMKUQPXARN-UHFFFAOYSA-N 2-(4-octoxyphenoxy)acetic acid Chemical compound CCCCCCCCOC1=CC=C(OCC(O)=O)C=C1 ZVNRMMKUQPXARN-UHFFFAOYSA-N 0.000 description 1
- CLGYXJLTRJDOEL-UHFFFAOYSA-N 2-(6-octoxypyridin-3-yl)-1,3-benzoxazole-5-carboxylic acid Chemical compound C1=NC(OCCCCCCCC)=CC=C1C1=NC2=CC(C(O)=O)=CC=C2O1 CLGYXJLTRJDOEL-UHFFFAOYSA-N 0.000 description 1
- OXQGTIUCKGYOAA-UHFFFAOYSA-N 2-Ethylbutanoic acid Chemical compound CCC(CC)C(O)=O OXQGTIUCKGYOAA-UHFFFAOYSA-N 0.000 description 1
- WKYPGMRZXGMVQA-UHFFFAOYSA-N 2-[4-(4-heptylphenyl)phenyl]-2-oxoacetic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(=O)C(O)=O)C=C1 WKYPGMRZXGMVQA-UHFFFAOYSA-N 0.000 description 1
- RMHAFACFZBGDDL-UHFFFAOYSA-N 2-[4-(4-octylphenyl)-5-oxo-1,2,4-triazol-1-yl]acetic acid Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(O)=O)N=C1 RMHAFACFZBGDDL-UHFFFAOYSA-N 0.000 description 1
- DQLXHSRVVQUSHR-UHFFFAOYSA-N 2-ethynyl-6-heptoxynaphthalene Chemical group C1=C(C#C)C=CC2=CC(OCCCCCCC)=CC=C21 DQLXHSRVVQUSHR-UHFFFAOYSA-N 0.000 description 1
- QIPBUORAZAUNLL-UHFFFAOYSA-N 2-hydroxy-4-octoxybenzaldehyde Chemical compound CCCCCCCCOC1=CC=C(C=O)C(O)=C1 QIPBUORAZAUNLL-UHFFFAOYSA-N 0.000 description 1
- SBTKMQWDHADPNF-UHFFFAOYSA-N 2-methyl-2-(4-octoxyphenoxy)-1-(3-oxidobenzotriazol-3-ium-1-yl)propan-1-one Chemical compound C1=CC(OCCCCCCCC)=CC=C1OC(C)(C)C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 SBTKMQWDHADPNF-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ILWROKQKEDTIKB-UHFFFAOYSA-N 2-pentan-2-yloxy-1-phenylethanone Chemical compound CCCC(C)OCC(=O)C1=CC=CC=C1 ILWROKQKEDTIKB-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- PDMYKAFCDWAAID-UHFFFAOYSA-N 3,4-dipentoxybenzoic acid Chemical compound CCCCCOC1=CC=C(C(O)=O)C=C1OCCCCC PDMYKAFCDWAAID-UHFFFAOYSA-N 0.000 description 1
- NSHAOELVDPKZIC-UHFFFAOYSA-N 3-(2-ethyl-1,2-oxazol-2-ium-5-yl)benzenesulfonic acid;hydroxide Chemical compound [OH-].O1[N+](CC)=CC=C1C1=CC=CC(S(O)(=O)=O)=C1 NSHAOELVDPKZIC-UHFFFAOYSA-N 0.000 description 1
- ZODPRHWKXOVAAN-UHFFFAOYSA-N 3-(6-heptoxynaphthalen-2-yl)prop-2-enoic acid Chemical compound C1=C(C=CC(O)=O)C=CC2=CC(OCCCCCCC)=CC=C21 ZODPRHWKXOVAAN-UHFFFAOYSA-N 0.000 description 1
- GJFBPEQRLGLNJE-UHFFFAOYSA-N 3-(6-heptoxynaphthalen-2-yl)propanoic acid Chemical compound C1=C(CCC(O)=O)C=CC2=CC(OCCCCCCC)=CC=C21 GJFBPEQRLGLNJE-UHFFFAOYSA-N 0.000 description 1
- FPQQSJJWHUJYPU-UHFFFAOYSA-N 3-(dimethylamino)propyliminomethylidene-ethylazanium;chloride Chemical compound Cl.CCN=C=NCCCN(C)C FPQQSJJWHUJYPU-UHFFFAOYSA-N 0.000 description 1
- HOKMTWJLJUSSLY-UHFFFAOYSA-N 3-[2-(4-hexylanilino)ethyl]-1,3-oxazolidin-2-one;hydrochloride Chemical compound Cl.C1=CC(CCCCCC)=CC=C1NCCN1C(=O)OCC1 HOKMTWJLJUSSLY-UHFFFAOYSA-N 0.000 description 1
- GMFMOGFXYQJZNZ-UHFFFAOYSA-N 3-[4-(4-butoxyphenyl)phenyl]-1-(3-oxidobenzotriazol-3-ium-1-yl)prop-2-en-1-one Chemical compound C1=CC(OCCCC)=CC=C1C(C=C1)=CC=C1C=CC(=O)N1C2=CC=CC=C2[N+]([O-])=N1 GMFMOGFXYQJZNZ-UHFFFAOYSA-N 0.000 description 1
- OFUJQNIYHRBBFU-UHFFFAOYSA-N 3-[4-(4-heptylphenyl)phenyl]propanoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 OFUJQNIYHRBBFU-UHFFFAOYSA-N 0.000 description 1
- KGRZYPOLYXJKAB-UHFFFAOYSA-N 3-[4-(4-pentoxyphenyl)phenyl]propanoic acid Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(CCC(O)=O)C=C1 KGRZYPOLYXJKAB-UHFFFAOYSA-N 0.000 description 1
- MWIWHZXYIFPWQF-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]prop-2-enoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C=CC(O)=O)C=C1 MWIWHZXYIFPWQF-UHFFFAOYSA-N 0.000 description 1
- BEUGGHYDMAZKJF-UHFFFAOYSA-N 3-[4-(4-pentylphenyl)phenyl]prop-2-ynoic acid Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C#CC(O)=O)C=C1 BEUGGHYDMAZKJF-UHFFFAOYSA-N 0.000 description 1
- NGTZFLWMWXTVOY-UHFFFAOYSA-N 3-fluoro-4-[4-(4-hexoxyphenyl)piperazin-1-yl]benzoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(OCCCCCC)=CC=C1N1CCN(C=2C(=CC(=CC=2)C(O)=O)F)CC1 NGTZFLWMWXTVOY-UHFFFAOYSA-N 0.000 description 1
- RAFNCAQESSDNCC-UHFFFAOYSA-N 3-fluoro-4-[4-(4-hydroxyphenyl)piperazin-1-yl]benzoic acid;dihydrobromide Chemical compound Br.Br.FC1=CC(C(=O)O)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 RAFNCAQESSDNCC-UHFFFAOYSA-N 0.000 description 1
- UHQJLSAZNHYLFW-UHFFFAOYSA-N 3-fluoro-4-[4-(4-methoxyphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C(=CC(=CC=2)C#N)F)CC1 UHQJLSAZNHYLFW-UHFFFAOYSA-N 0.000 description 1
- VEXCLXOUWMYCPS-UHFFFAOYSA-N 3-methyl-1-(3-oxidobenzotriazol-3-ium-1-yl)tridec-2-en-1-one Chemical compound C1=CC=C2N(C(=O)C=C(C)CCCCCCCCCC)N=[N+]([O-])C2=C1 VEXCLXOUWMYCPS-UHFFFAOYSA-N 0.000 description 1
- ZDRQLAQHRMGIKF-UHFFFAOYSA-N 4-(1-heptylpyrazol-4-yl)benzoic acid Chemical compound C1=NN(CCCCCCC)C=C1C1=CC=C(C(O)=O)C=C1 ZDRQLAQHRMGIKF-UHFFFAOYSA-N 0.000 description 1
- XVROSBHWACAQRL-UHFFFAOYSA-N 4-(4-heptylphenyl)benzoic acid Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(O)=O)C=C1 XVROSBHWACAQRL-UHFFFAOYSA-N 0.000 description 1
- JSFQGNDVWUWKMY-UHFFFAOYSA-N 4-(4-octylphenyl)-1h-1,2,4-triazol-5-one Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)NN=C1 JSFQGNDVWUWKMY-UHFFFAOYSA-N 0.000 description 1
- YDOAWSTWKLBZHC-UHFFFAOYSA-N 4-(4-octylphenyl)-2-[2-(3-oxidobenzotriazol-3-ium-1-yl)-2-oxoethyl]-1,2,4-triazol-3-one Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(=O)N2C3=CC=CC=C3[N+]([O-])=N2)N=C1 YDOAWSTWKLBZHC-UHFFFAOYSA-N 0.000 description 1
- USLZAESUXAJUQT-UHFFFAOYSA-N 4-(4-propoxyphenyl)benzohydrazide Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C(=O)NN)C=C1 USLZAESUXAJUQT-UHFFFAOYSA-N 0.000 description 1
- KMYOGIILYYCAGY-UHFFFAOYSA-N 4-(5-nonyl-1,3,4-oxadiazol-2-yl)benzoic acid Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(O)=O)C=C1 KMYOGIILYYCAGY-UHFFFAOYSA-N 0.000 description 1
- IGIJSFNBEUBMGB-UHFFFAOYSA-N 4-(cyclohexyliminomethylideneamino)-n,n-diethylcyclohexan-1-amine Chemical compound C1CC(N(CC)CC)CCC1N=C=NC1CCCCC1 IGIJSFNBEUBMGB-UHFFFAOYSA-N 0.000 description 1
- ZJYYDMKIBGAUCA-UHFFFAOYSA-N 4-(pentyloxy)benzene-1-carbohydrazide Chemical compound CCCCCOC1=CC=C(C(=O)NN)C=C1 ZJYYDMKIBGAUCA-UHFFFAOYSA-N 0.000 description 1
- DJRKHTCUXRGYEU-UHFFFAOYSA-N 4-Hexyloxyaniline Chemical compound CCCCCCOC1=CC=C(N)C=C1 DJRKHTCUXRGYEU-UHFFFAOYSA-N 0.000 description 1
- IGWVTENILPBXJK-UHFFFAOYSA-N 4-[3-(4-hexoxyphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NOC(C=2C=CC(=CC=2)C(O)=O)=N1 IGWVTENILPBXJK-UHFFFAOYSA-N 0.000 description 1
- KRZZFHBQRFLGFB-UHFFFAOYSA-N 4-[4-(4-butoxyphenyl)phenyl]benzoic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(O)=O)C=C1 KRZZFHBQRFLGFB-UHFFFAOYSA-N 0.000 description 1
- JKWOBDIWOIKNMF-UHFFFAOYSA-N 4-[4-(4-hexylphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(CCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C#N)CC1 JKWOBDIWOIKNMF-UHFFFAOYSA-N 0.000 description 1
- GKKDPUXAHZTMDA-UHFFFAOYSA-N 4-[4-(4-hydroxyphenyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 GKKDPUXAHZTMDA-UHFFFAOYSA-N 0.000 description 1
- OTSBRMIZLFWKLW-UHFFFAOYSA-N 4-[4-(4-octoxyphenyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C(O)=O)CC1 OTSBRMIZLFWKLW-UHFFFAOYSA-N 0.000 description 1
- YAYPIAMVDAPXIL-UHFFFAOYSA-N 4-[4-(4-octoxyphenyl)piperazin-1-yl]benzonitrile Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C#N)CC1 YAYPIAMVDAPXIL-UHFFFAOYSA-N 0.000 description 1
- VLQVFMAPZWAKMW-UHFFFAOYSA-N 4-[4-(4-pentoxyphenyl)piperazin-1-yl]benzoic acid;dihydrochloride Chemical compound Cl.Cl.C1=CC(OCCCCC)=CC=C1N1CCN(C=2C=CC(=CC=2)C(O)=O)CC1 VLQVFMAPZWAKMW-UHFFFAOYSA-N 0.000 description 1
- LYVSLZGLJNJAIT-UHFFFAOYSA-N 4-[4-(4-phenylcyclohexyl)piperazin-1-yl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1N1CCN(C2CCC(CC2)C=2C=CC=CC=2)CC1 LYVSLZGLJNJAIT-UHFFFAOYSA-N 0.000 description 1
- BBYPSSOHZOYSLV-UHFFFAOYSA-N 4-[4-(6-phenylpyridazin-3-yl)oxyphenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OC1=CC=C(C=2C=CC=CC=2)N=N1 BBYPSSOHZOYSLV-UHFFFAOYSA-N 0.000 description 1
- JQLDDMPJIABJPT-UHFFFAOYSA-N 4-[4-(6-propoxyhexoxy)phenyl]benzoic acid Chemical compound C1=CC(OCCCCCCOCCC)=CC=C1C1=CC=C(C(O)=O)C=C1 JQLDDMPJIABJPT-UHFFFAOYSA-N 0.000 description 1
- LXEIWYDDRKIJPV-UHFFFAOYSA-N 4-[4-(8-oxo-8-piperidin-1-yloctoxy)phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OCCCCCCCC(=O)N1CCCCC1 LXEIWYDDRKIJPV-UHFFFAOYSA-N 0.000 description 1
- DAFGUIPDFPZTEG-UHFFFAOYSA-N 4-[4-[8-(1,2,4-triazol-1-yl)octoxy]phenyl]benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1C(C=C1)=CC=C1OCCCCCCCCN1N=CN=C1 DAFGUIPDFPZTEG-UHFFFAOYSA-N 0.000 description 1
- XFPBZYIDFWFBOA-UHFFFAOYSA-N 4-[5-(4-hexoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)O1 XFPBZYIDFWFBOA-UHFFFAOYSA-N 0.000 description 1
- JJYMAZPWFNSWSF-UHFFFAOYSA-N 4-[5-(4-octoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)O1 JJYMAZPWFNSWSF-UHFFFAOYSA-N 0.000 description 1
- UGHHSCGTCCBZGA-UHFFFAOYSA-N 4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)S1 UGHHSCGTCCBZGA-UHFFFAOYSA-N 0.000 description 1
- UXBMCTOADKRHBZ-UHFFFAOYSA-N 4-[5-[4-(4-propoxyphenyl)phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCC)=CC=C1C1=CC=C(C=2SC(=NN=2)C=2C=CC(=CC=2)C(O)=O)C=C1 UXBMCTOADKRHBZ-UHFFFAOYSA-N 0.000 description 1
- SFMJCBKNKOWTOT-UHFFFAOYSA-N 4-[5-[4-(8-methoxyoctoxy)phenyl]-1,3,4-thiadiazol-2-yl]benzoic acid Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(O)=O)S1 SFMJCBKNKOWTOT-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- 229960000549 4-dimethylaminophenol Drugs 0.000 description 1
- GWXUVWKBVROFDM-UHFFFAOYSA-N 4-hexoxybenzaldehyde Chemical compound CCCCCCOC1=CC=C(C=O)C=C1 GWXUVWKBVROFDM-UHFFFAOYSA-N 0.000 description 1
- ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 4-hexoxybenzenecarboximidamide;hydrochloride Chemical compound Cl.CCCCCCOC1=CC=C(C(N)=N)C=C1 ZBOKEVFJYLXVJQ-UHFFFAOYSA-N 0.000 description 1
- HBQUXMZZODHFMJ-UHFFFAOYSA-N 4-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC=C(C(O)=O)C=C1 HBQUXMZZODHFMJ-UHFFFAOYSA-N 0.000 description 1
- DQQOONVCLQZWOY-UHFFFAOYSA-N 4-hexoxybenzoyl chloride Chemical compound CCCCCCOC1=CC=C(C(Cl)=O)C=C1 DQQOONVCLQZWOY-UHFFFAOYSA-N 0.000 description 1
- UQRONKZLYKUEMO-UHFFFAOYSA-N 4-methyl-1-(2,4,6-trimethylphenyl)pent-4-en-2-one Chemical group CC(=C)CC(=O)Cc1c(C)cc(C)cc1C UQRONKZLYKUEMO-UHFFFAOYSA-N 0.000 description 1
- HFRUPPHPJRZOCM-UHFFFAOYSA-N 4-octoxyphenol Chemical compound CCCCCCCCOC1=CC=C(O)C=C1 HFRUPPHPJRZOCM-UHFFFAOYSA-N 0.000 description 1
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 1
- YAPVGSXODFOBBR-UHFFFAOYSA-N 4-pentoxybenzaldehyde Chemical compound CCCCCOC1=CC=C(C=O)C=C1 YAPVGSXODFOBBR-UHFFFAOYSA-N 0.000 description 1
- NLDYZVXJDDWPJI-UHFFFAOYSA-N 4-piperidin-1-ylbenzohydrazide Chemical compound C1=CC(C(=O)NN)=CC=C1N1CCCCC1 NLDYZVXJDDWPJI-UHFFFAOYSA-N 0.000 description 1
- NSPMIYGKQJPBQR-UHFFFAOYSA-N 4H-1,2,4-triazole Chemical compound C=1N=CNN=1 NSPMIYGKQJPBQR-UHFFFAOYSA-N 0.000 description 1
- UHPMCKVQTMMPCG-UHFFFAOYSA-N 5,8-dihydroxy-2-methoxy-6-methyl-7-(2-oxopropyl)naphthalene-1,4-dione Chemical compound CC1=C(CC(C)=O)C(O)=C2C(=O)C(OC)=CC(=O)C2=C1O UHPMCKVQTMMPCG-UHFFFAOYSA-N 0.000 description 1
- PNWUVMQJFCWBOY-UHFFFAOYSA-N 5-[4-(4-butoxyphenyl)phenyl]furan-2-carboxylic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2OC(=CC=2)C(O)=O)C=C1 PNWUVMQJFCWBOY-UHFFFAOYSA-N 0.000 description 1
- FPPLUUPWGRRIIN-UHFFFAOYSA-N 5-hydroxy-1-benzothiophene-2-carboxylic acid Chemical compound OC1=CC=C2SC(C(=O)O)=CC2=C1 FPPLUUPWGRRIIN-UHFFFAOYSA-N 0.000 description 1
- MGNMPIQWBOVLFX-UHFFFAOYSA-N 5-methoxy-1-benzothiophene-2-carboxamide Chemical compound COC1=CC=C2SC(C(N)=O)=CC2=C1 MGNMPIQWBOVLFX-UHFFFAOYSA-N 0.000 description 1
- TZVWFVNRJGQBDZ-UHFFFAOYSA-N 5-octoxy-1-benzothiophene-2-carboxylic acid Chemical compound CCCCCCCCOC1=CC=C2SC(C(O)=O)=CC2=C1 TZVWFVNRJGQBDZ-UHFFFAOYSA-N 0.000 description 1
- YKGKZQHPSPKBRS-UHFFFAOYSA-N 6-(8-methoxyoctoxy)naphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(OCCCCCCCCOC)=CC=C21 YKGKZQHPSPKBRS-UHFFFAOYSA-N 0.000 description 1
- CPNHCZANGMBQLB-UHFFFAOYSA-N 6-[4-(4-butoxyphenyl)phenyl]pyridine-3-carboxylic acid Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2N=CC(=CC=2)C(O)=O)C=C1 CPNHCZANGMBQLB-UHFFFAOYSA-N 0.000 description 1
- UJLHMYSJHQTVGT-UHFFFAOYSA-N 6-[4-(4-heptoxyphenyl)piperazin-1-yl]pyridine-3-carboxylic acid Chemical compound C1=CC(OCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(O)=O)CC1 UJLHMYSJHQTVGT-UHFFFAOYSA-N 0.000 description 1
- OURHICMQMQBYDD-UHFFFAOYSA-N 6-heptylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(CCCCCCC)=CC=C21 OURHICMQMQBYDD-UHFFFAOYSA-N 0.000 description 1
- ZJJWBEVVSDIYCS-UHFFFAOYSA-N 6-hexylnaphthalene-2-carboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(CCCCCC)=CC=C21 ZJJWBEVVSDIYCS-UHFFFAOYSA-N 0.000 description 1
- CYJRNFFLTBEQSQ-UHFFFAOYSA-N 8-(3-methyl-1-benzothiophen-5-yl)-N-(4-methylsulfonylpyridin-3-yl)quinoxalin-6-amine Chemical compound CS(=O)(=O)C1=C(C=NC=C1)NC=1C=C2N=CC=NC2=C(C=1)C=1C=CC2=C(C(=CS2)C)C=1 CYJRNFFLTBEQSQ-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- 241000186046 Actinomyces Species 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- JCMQZYHTGVPSGY-OVCLIPMQSA-N C1=CC(/C=C/C(=O)OC)=CC=C1C1=CC=C(OCCCCCCF)C=C1 Chemical compound C1=CC(/C=C/C(=O)OC)=CC=C1C1=CC=C(OCCCCCCF)C=C1 JCMQZYHTGVPSGY-OVCLIPMQSA-N 0.000 description 1
- RPEVDUSDGACMRH-LICLKQGHSA-N C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 Chemical compound C1=CC(OCCCCCCCOC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 RPEVDUSDGACMRH-LICLKQGHSA-N 0.000 description 1
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 description 1
- MBWRHUSKMKZTLJ-XYPYZODXSA-N CCCCC[C@H]1CC[C@H](C(=O)NN)CC1 Chemical compound CCCCC[C@H]1CC[C@H](C(=O)NN)CC1 MBWRHUSKMKZTLJ-XYPYZODXSA-N 0.000 description 1
- 241000222120 Candida <Saccharomycetales> Species 0.000 description 1
- 241000222122 Candida albicans Species 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 241001158911 Coleophoma sp. Species 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- 229910021595 Copper(I) iodide Inorganic materials 0.000 description 1
- 241001337994 Cryptococcus <scale insect> Species 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- HDFFVHSMHLDSLO-UHFFFAOYSA-N Dibenzyl phosphate Chemical compound C=1C=CC=CC=1COP(=O)(O)OCC1=CC=CC=C1 HDFFVHSMHLDSLO-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical class C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical compound C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- ASMQGLCHMVWBQR-UHFFFAOYSA-N Diphenyl phosphate Chemical compound C=1C=CC=CC=1OP(=O)(O)OC1=CC=CC=C1 ASMQGLCHMVWBQR-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000223218 Fusarium Species 0.000 description 1
- WHUUTDBJXJRKMK-UHFFFAOYSA-N Glutamic acid Natural products OC(=O)C(N)CCC(O)=O WHUUTDBJXJRKMK-UHFFFAOYSA-N 0.000 description 1
- 241000228402 Histoplasma Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241000555676 Malassezia Species 0.000 description 1
- 101100043756 Metarhizium robertsii (strain ARSEF 23 / ATCC MYA-3075) subE gene Proteins 0.000 description 1
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 1
- 241000235395 Mucor Species 0.000 description 1
- AMQJEAYHLZJPGS-UHFFFAOYSA-N N-Pentanol Chemical compound CCCCCO AMQJEAYHLZJPGS-UHFFFAOYSA-N 0.000 description 1
- AYCPARAPKDAOEN-LJQANCHMSA-N N-[(1S)-2-(dimethylamino)-1-phenylethyl]-6,6-dimethyl-3-[(2-methyl-4-thieno[3,2-d]pyrimidinyl)amino]-1,4-dihydropyrrolo[3,4-c]pyrazole-5-carboxamide Chemical compound C1([C@H](NC(=O)N2C(C=3NN=C(NC=4C=5SC=CC=5N=C(C)N=4)C=3C2)(C)C)CN(C)C)=CC=CC=C1 AYCPARAPKDAOEN-LJQANCHMSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- PHCBEOGBQHYFOQ-UHFFFAOYSA-N ON=CC(C=C1)=CC=C1Br.Cl Chemical compound ON=CC(C=C1)=CC=C1Br.Cl PHCBEOGBQHYFOQ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 206010035664 Pneumonia Diseases 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 101100054666 Streptomyces halstedii sch3 gene Proteins 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical compound OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical class OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- NUOITAPZZREUHB-ZZTVPSNHSA-N [(16R)-1-methoxy-18-(3-oxidobenzotriazol-3-ium-1-yl)-18-oxo-16-phenylmethoxyoctadecyl]carbamic acid Chemical compound C(C1=CC=CC=C1)O[C@@H](CC(=O)N1N=[N+](C2=C1C=CC=C2)[O-])CCCCCCCCCCCCCCC(OC)NC(=O)O NUOITAPZZREUHB-ZZTVPSNHSA-N 0.000 description 1
- RCDVMGKQZXRFFS-UHFFFAOYSA-N [2-(4-hexoxyphenyl)-1,3-benzoxazol-5-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC(C(=O)N3C4=CC=CC=C4[N+]([O-])=N3)=CC=C2O1 RCDVMGKQZXRFFS-UHFFFAOYSA-N 0.000 description 1
- MCHBIIHSIALIAR-UHFFFAOYSA-N [2-(4-hexoxyphenyl)-3h-benzimidazol-5-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(=O)N3C4=CC=CC=C4[N+]([O-])=N3)C=C2N1 MCHBIIHSIALIAR-UHFFFAOYSA-N 0.000 description 1
- PLYSQUYKMUHJRF-UHFFFAOYSA-N [2-(4-hexylphenyl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(CCCCCC)=CC=C1C1=CC=CC=C1C(=O)N1C2=CC=CC=C2[N+]([O-])=N1 PLYSQUYKMUHJRF-UHFFFAOYSA-N 0.000 description 1
- NAGIHWCWUMTCBC-UHFFFAOYSA-N [3-(4-octoxyphenyl)-2,5-dioxopyrrolidin-1-yl] hydrogen carbonate Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1C(=O)N(OC(O)=O)C(=O)C1 NAGIHWCWUMTCBC-UHFFFAOYSA-N 0.000 description 1
- MWEWQDMVKHCOSZ-UHFFFAOYSA-N [4-(4-heptylphenyl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(CCCCCCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 MWEWQDMVKHCOSZ-UHFFFAOYSA-N 0.000 description 1
- WUSJFDCDUOHBPD-UHFFFAOYSA-N [4-(5-nonyl-1,3,4-oxadiazol-2-yl)phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WUSJFDCDUOHBPD-UHFFFAOYSA-N 0.000 description 1
- FQYALAYSGVPARL-UHFFFAOYSA-N [4-[2-(4-hexoxyphenyl)pyrimidin-4-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=CC(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)=N1 FQYALAYSGVPARL-UHFFFAOYSA-N 0.000 description 1
- WJSIULJLENASJR-UHFFFAOYSA-N [4-[3-(4-hexoxyphenyl)-1h-pyrazol-5-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NNC(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)=C1 WJSIULJLENASJR-UHFFFAOYSA-N 0.000 description 1
- GCSDRULGDNBYMR-UHFFFAOYSA-N [4-[4-(4-butoxyphenyl)phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 GCSDRULGDNBYMR-UHFFFAOYSA-N 0.000 description 1
- XQMRMZWNELKAIZ-UHFFFAOYSA-N [4-[4-(4-cyclohexylphenyl)piperazin-1-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C12=CC=CC=C2[N+]([O-])=NN1C(=O)C(C=C1)=CC=C1N(CC1)CCN1C(C=C1)=CC=C1C1CCCCC1 XQMRMZWNELKAIZ-UHFFFAOYSA-N 0.000 description 1
- OCBVZLAURCOAHB-UHFFFAOYSA-N [4-[4-(5-methoxypentoxy)phenyl]phenyl]boronic acid Chemical compound C1=CC(OCCCCCOC)=CC=C1C1=CC=C(B(O)O)C=C1 OCBVZLAURCOAHB-UHFFFAOYSA-N 0.000 description 1
- AGQJYXDYYXKDRV-UHFFFAOYSA-N [4-[4-(6-methoxyhexoxy)phenyl]phenyl]boronic acid Chemical compound C1=CC(OCCCCCCOC)=CC=C1C1=CC=C(B(O)O)C=C1 AGQJYXDYYXKDRV-UHFFFAOYSA-N 0.000 description 1
- WNRGGOKCTNJGMY-UHFFFAOYSA-N [4-[4-[4-(6-methoxyhexoxy)phenyl]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCOC)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WNRGGOKCTNJGMY-UHFFFAOYSA-N 0.000 description 1
- WBERCTSVJLCBJJ-UHFFFAOYSA-N [4-[4-[8-(2,6-dimethylmorpholin-4-yl)octoxy]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1C(C)OC(C)CN1CCCCCCCCOC1=CC=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 WBERCTSVJLCBJJ-UHFFFAOYSA-N 0.000 description 1
- SIGBZCVCKKKRFD-UHFFFAOYSA-N [4-[4-[8-(2-ethoxyethoxy)octoxy]phenyl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCCOCCOCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=C1 SIGBZCVCKKKRFD-UHFFFAOYSA-N 0.000 description 1
- NSDRWIFMUWNFAY-UHFFFAOYSA-N [4-[5-(4-octoxyphenyl)-1,3,4-thiadiazol-2-yl]phenyl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)S1 NSDRWIFMUWNFAY-UHFFFAOYSA-N 0.000 description 1
- ATZVJULTBLIUPS-UHFFFAOYSA-N [5-[4-(4-hexoxyphenyl)piperazin-1-yl]pyridin-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCN(C=2C=NC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)CC1 ATZVJULTBLIUPS-UHFFFAOYSA-N 0.000 description 1
- ZZDHCAQJASOHBL-UHFFFAOYSA-N [6-(4-heptoxyphenyl)pyridin-3-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=CC=C(C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)C=N1 ZZDHCAQJASOHBL-UHFFFAOYSA-N 0.000 description 1
- XVLAYOKCKRVSOO-UHFFFAOYSA-N [6-(8-methoxyoctoxy)naphthalen-2-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound N1=[N+]([O-])C2=CC=CC=C2N1C(=O)C1=CC2=CC=C(OCCCCCCCCOC)C=C2C=C1 XVLAYOKCKRVSOO-UHFFFAOYSA-N 0.000 description 1
- ZPEFJOYFIWGZQA-UHFFFAOYSA-N [6-[4-(4-octoxyphenyl)piperazin-1-yl]pyridin-3-yl]-(3-oxidobenzotriazol-3-ium-1-yl)methanone Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(=O)N2C3=CC=CC=C3[N+]([O-])=N2)CC1 ZPEFJOYFIWGZQA-UHFFFAOYSA-N 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- PBCJIPOGFJYBJE-UHFFFAOYSA-N acetonitrile;hydrate Chemical compound O.CC#N PBCJIPOGFJYBJE-UHFFFAOYSA-N 0.000 description 1
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 125000003647 acryloyl group Chemical group O=C([*])C([H])=C([H])[H] 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000005428 anthryl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C3C(*)=C([H])C([H])=C([H])C3=C([H])C2=C1[H] 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 125000001124 arachidoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000000668 atmospheric pressure chemical ionisation mass spectrometry Methods 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000003943 azolyl group Chemical group 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical class C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 1
- WARCRYXKINZHGQ-UHFFFAOYSA-N benzohydrazide Chemical compound NNC(=O)C1=CC=CC=C1 WARCRYXKINZHGQ-UHFFFAOYSA-N 0.000 description 1
- KLQNJBAFEFFWQZ-UHFFFAOYSA-N benzoic acid;dihydrochloride Chemical compound Cl.Cl.OC(=O)C1=CC=CC=C1 KLQNJBAFEFFWQZ-UHFFFAOYSA-N 0.000 description 1
- 125000005874 benzothiadiazolyl group Chemical group 0.000 description 1
- LQICGOKNCGVNAE-UHFFFAOYSA-N benzotriazol-1-yl-[4-[5-[4-(8-methoxyoctoxy)phenyl]-1,3,4-oxadiazol-2-yl]phenyl]methanone Chemical compound C1=CC(OCCCCCCCCOC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)N2C3=CC=CC=C3N=N2)O1 LQICGOKNCGVNAE-UHFFFAOYSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- PFYXSUNOLOJMDX-UHFFFAOYSA-N bis(2,5-dioxopyrrolidin-1-yl) carbonate Chemical compound O=C1CCC(=O)N1OC(=O)ON1C(=O)CCC1=O PFYXSUNOLOJMDX-UHFFFAOYSA-N 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 210000000621 bronchi Anatomy 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 229940095731 candida albicans Drugs 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 1
- QQVDYSUDFZZPSU-UHFFFAOYSA-M chloromethylidene(dimethyl)azanium;chloride Chemical compound [Cl-].C[N+](C)=CCl QQVDYSUDFZZPSU-UHFFFAOYSA-M 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- LSXDOTMGLUJQCM-UHFFFAOYSA-M copper(i) iodide Chemical compound I[Cu] LSXDOTMGLUJQCM-UHFFFAOYSA-M 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229940045803 cuprous chloride Drugs 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- IPIVAXLHTVNRBS-UHFFFAOYSA-N decanoyl chloride Chemical compound CCCCCCCCCC(Cl)=O IPIVAXLHTVNRBS-UHFFFAOYSA-N 0.000 description 1
- 125000003074 decanoyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C(*)=O 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- WYACBZDAHNBPPB-UHFFFAOYSA-N diethyl oxalate Chemical compound CCOC(=O)C(=O)OCC WYACBZDAHNBPPB-UHFFFAOYSA-N 0.000 description 1
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 1
- 238000003113 dilution method Methods 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- OREAFAJWWJHCOT-UHFFFAOYSA-N dimethylmalonic acid Chemical compound OC(=O)C(C)(C)C(O)=O OREAFAJWWJHCOT-UHFFFAOYSA-N 0.000 description 1
- HCUYBXPSSCRKRF-UHFFFAOYSA-N diphosgene Chemical compound ClC(=O)OC(Cl)(Cl)Cl HCUYBXPSSCRKRF-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008298 dragée Substances 0.000 description 1
- 210000005069 ears Anatomy 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002169 ethanolamines Chemical class 0.000 description 1
- ODQSOTBFWCNPKF-UHFFFAOYSA-N ethyl 2-(4-hexoxyphenyl)-1,3-benzoxazole-5-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC(C(=O)OCC)=CC=C2O1 ODQSOTBFWCNPKF-UHFFFAOYSA-N 0.000 description 1
- OSLQGOBYIDZZTD-UHFFFAOYSA-N ethyl 2-(6-octoxypyridin-3-yl)-1,3-benzoxazole-5-carboxylate Chemical compound C1=NC(OCCCCCCCC)=CC=C1C1=NC2=CC(C(=O)OCC)=CC=C2O1 OSLQGOBYIDZZTD-UHFFFAOYSA-N 0.000 description 1
- GGJAUSTVMDKDTM-UHFFFAOYSA-N ethyl 2-[4-(4-octylphenyl)-5-oxo-1,2,4-triazol-1-yl]acetate Chemical compound C1=CC(CCCCCCCC)=CC=C1N1C(=O)N(CC(=O)OCC)N=C1 GGJAUSTVMDKDTM-UHFFFAOYSA-N 0.000 description 1
- RDULEYWUGKOCMR-UHFFFAOYSA-N ethyl 2-chloro-3-oxobutanoate Chemical compound CCOC(=O)C(Cl)C(C)=O RDULEYWUGKOCMR-UHFFFAOYSA-N 0.000 description 1
- NTHCRGDBZGKGNG-UHFFFAOYSA-N ethyl 3-(n-(3-ethoxy-3-oxopropyl)-4-hexoxyanilino)propanoate Chemical compound CCCCCCOC1=CC=C(N(CCC(=O)OCC)CCC(=O)OCC)C=C1 NTHCRGDBZGKGNG-UHFFFAOYSA-N 0.000 description 1
- PWLIDNJVLQJKIS-UHFFFAOYSA-N ethyl 4-[3-(dimethylamino)prop-2-enoyl]benzoate Chemical group CCOC(=O)C1=CC=C(C(=O)C=CN(C)C)C=C1 PWLIDNJVLQJKIS-UHFFFAOYSA-N 0.000 description 1
- GLOAPLPTWAXAIG-UHFFFAOYSA-N ethyl 4-acetylbenzoate Chemical compound CCOC(=O)C1=CC=C(C(C)=O)C=C1 GLOAPLPTWAXAIG-UHFFFAOYSA-N 0.000 description 1
- IXJHHMIKLJPXMW-UHFFFAOYSA-N ethyl 6-[4-(4-hexoxyphenyl)piperazin-1-yl]pyridazine-3-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1N1CCN(C=2N=NC(=CC=2)C(=O)OCC)CC1 IXJHHMIKLJPXMW-UHFFFAOYSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- WMYNMYVRWWCRPS-UHFFFAOYSA-N ethynoxyethane Chemical group CCOC#C WMYNMYVRWWCRPS-UHFFFAOYSA-N 0.000 description 1
- 239000003889 eye drop Substances 0.000 description 1
- 229940012356 eye drops Drugs 0.000 description 1
- 238000004992 fast atom bombardment mass spectroscopy Methods 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013922 glutamic acid Nutrition 0.000 description 1
- 239000004220 glutamic acid Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- YVXHZKKCZYLQOP-UHFFFAOYSA-N hept-1-yne Chemical compound CCCCCC#C YVXHZKKCZYLQOP-UHFFFAOYSA-N 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- DCPMPXBYPZGNDC-UHFFFAOYSA-N hydron;methanediimine;chloride Chemical compound Cl.N=C=N DCPMPXBYPZGNDC-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 125000001977 isobenzofuranyl group Chemical group C=1(OC=C2C=CC=CC12)* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- SRJOCJYGOFTFLH-UHFFFAOYSA-N isonipecotic acid Chemical compound OC(=O)C1CCNCC1 SRJOCJYGOFTFLH-UHFFFAOYSA-N 0.000 description 1
- GWYFCOCPABKNJV-UHFFFAOYSA-N isovaleric acid Chemical compound CC(C)CC(O)=O GWYFCOCPABKNJV-UHFFFAOYSA-N 0.000 description 1
- 125000004499 isoxazol-5-yl group Chemical group O1N=CC=C1* 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000400 lauroyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- KNFPLMFTXFVFPA-UHFFFAOYSA-N lithium;bis(2-methylpropyl)azanide Chemical compound CC(C)CN([Li])CC(C)C KNFPLMFTXFVFPA-UHFFFAOYSA-N 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 1
- DHWRKYAZTBDRKA-VGOFMYFVSA-N methyl (E)-3-[4-(4-butoxyphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(\C=C\C(=O)OC)C=C1 DHWRKYAZTBDRKA-VGOFMYFVSA-N 0.000 description 1
- WZBUGBMBPXARJR-UHFFFAOYSA-N methyl 2-(4-hexoxyphenyl)-3h-benzimidazole-5-carboxylate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC2=CC=C(C(=O)OC)C=C2N1 WZBUGBMBPXARJR-UHFFFAOYSA-N 0.000 description 1
- OQNUTBBRDVILAY-UHFFFAOYSA-N methyl 2-nonyl-3h-benzimidazole-5-carboxylate Chemical compound C1=C(C(=O)OC)C=C2NC(CCCCCCCCC)=NC2=C1 OQNUTBBRDVILAY-UHFFFAOYSA-N 0.000 description 1
- VURTXDMCDUXUKM-UHFFFAOYSA-N methyl 3,4-dipentoxybenzoate Chemical compound CCCCCOC1=CC=C(C(=O)OC)C=C1OCCCCC VURTXDMCDUXUKM-UHFFFAOYSA-N 0.000 description 1
- JZUXUPZONYEBIP-UHFFFAOYSA-N methyl 3-(6-heptoxynaphthalen-2-yl)propanoate Chemical compound C1=C(CCC(=O)OC)C=CC2=CC(OCCCCCCC)=CC=C21 JZUXUPZONYEBIP-UHFFFAOYSA-N 0.000 description 1
- CLCNNGUQZLFXBQ-UHFFFAOYSA-N methyl 3-[4-(4-pentoxyphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(C=CC(=O)OC)C=C1 CLCNNGUQZLFXBQ-UHFFFAOYSA-N 0.000 description 1
- PKWJLGJNZNVUBD-UHFFFAOYSA-N methyl 3-[4-(4-pentoxyphenyl)phenyl]propanoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC=C(CCC(=O)OC)C=C1 PKWJLGJNZNVUBD-UHFFFAOYSA-N 0.000 description 1
- VRRBSYXFKWJTLW-UHFFFAOYSA-N methyl 3-[4-(4-pentylphenyl)phenyl]prop-2-enoate Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(C=CC(=O)OC)C=C1 VRRBSYXFKWJTLW-UHFFFAOYSA-N 0.000 description 1
- UIEPULRPIPFXGJ-UHFFFAOYSA-N methyl 3-[4-(4-pentylphenyl)phenyl]propanoate Chemical compound C1=CC(CCCCC)=CC=C1C1=CC=C(CCC(=O)OC)C=C1 UIEPULRPIPFXGJ-UHFFFAOYSA-N 0.000 description 1
- SSKROZKPITVKMK-UHFFFAOYSA-N methyl 4-(1-heptylpyrazol-4-yl)benzoate Chemical compound C1=NN(CCCCCCC)C=C1C1=CC=C(C(=O)OC)C=C1 SSKROZKPITVKMK-UHFFFAOYSA-N 0.000 description 1
- WWHGRCXLJLLWOX-UHFFFAOYSA-N methyl 4-(5-nonyl-1,3,4-oxadiazol-2-yl)benzoate Chemical compound O1C(CCCCCCCCC)=NN=C1C1=CC=C(C(=O)OC)C=C1 WWHGRCXLJLLWOX-UHFFFAOYSA-N 0.000 description 1
- HGVBEQHEDXPHBI-UHFFFAOYSA-N methyl 4-(hydrazinecarbonyl)benzoate Chemical compound COC(=O)C1=CC=C(C(=O)NN)C=C1 HGVBEQHEDXPHBI-UHFFFAOYSA-N 0.000 description 1
- WNYDFMUZTKXZNM-UHFFFAOYSA-N methyl 4-[(decanoylamino)carbamoyl]benzoate Chemical compound CCCCCCCCCC(=O)NNC(=O)C1=CC=C(C(=O)OC)C=C1 WNYDFMUZTKXZNM-UHFFFAOYSA-N 0.000 description 1
- RJZGFGGJJGEFFT-UHFFFAOYSA-N methyl 4-[2-(4-hexoxyphenyl)pyrimidin-4-yl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NC=CC(C=2C=CC(=CC=2)C(=O)OC)=N1 RJZGFGGJJGEFFT-UHFFFAOYSA-N 0.000 description 1
- DDWVXFQATJTOFS-UHFFFAOYSA-N methyl 4-[3-(4-hexoxyphenyl)-3-oxopropanoyl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)CC(=O)C1=CC=C(C(=O)OC)C=C1 DDWVXFQATJTOFS-UHFFFAOYSA-N 0.000 description 1
- MYSHSAIDZYLUKW-UHFFFAOYSA-N methyl 4-[3-oxo-3-(4-pentoxyphenyl)propanoyl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C(=O)CC(=O)C1=CC=C(C(=O)OC)C=C1 MYSHSAIDZYLUKW-UHFFFAOYSA-N 0.000 description 1
- XBJCOFOSYJQAFA-UHFFFAOYSA-N methyl 4-[4-(5-bromopentoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C1=CC=C(OCCCCCBr)C=C1 XBJCOFOSYJQAFA-UHFFFAOYSA-N 0.000 description 1
- SSKKHIDDPNRCLR-UHFFFAOYSA-N methyl 4-[4-(5-phenoxypentoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C(C=C1)=CC=C1OCCCCCOC1=CC=CC=C1 SSKKHIDDPNRCLR-UHFFFAOYSA-N 0.000 description 1
- ZOBQOLMFGUPNTI-UHFFFAOYSA-N methyl 4-[4-(8-bromooctoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C1=CC=C(OCCCCCCCCBr)C=C1 ZOBQOLMFGUPNTI-UHFFFAOYSA-N 0.000 description 1
- CIXYXCKHJMKPKG-UHFFFAOYSA-N methyl 4-[4-(8-oxo-8-piperidin-1-yloctoxy)phenyl]benzoate Chemical compound C1=CC(C(=O)OC)=CC=C1C(C=C1)=CC=C1OCCCCCCCC(=O)N1CCCCC1 CIXYXCKHJMKPKG-UHFFFAOYSA-N 0.000 description 1
- AIBMXQRTBASMNP-UHFFFAOYSA-N methyl 4-[5-(4-hexoxyphenyl)-1,3,4-oxadiazol-2-yl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C1=NN=C(C=2C=CC(=CC=2)C(=O)OC)O1 AIBMXQRTBASMNP-UHFFFAOYSA-N 0.000 description 1
- JLCLOAYOQLRDSK-UHFFFAOYSA-N methyl 4-[5-(4-pentoxyphenyl)-1,2-oxazol-3-yl]benzoate Chemical compound C1=CC(OCCCCC)=CC=C1C1=CC(C=2C=CC(=CC=2)C(=O)OC)=NO1 JLCLOAYOQLRDSK-UHFFFAOYSA-N 0.000 description 1
- RUTXRPSNXSBXSF-UHFFFAOYSA-N methyl 4-[[(4-hexoxybenzoyl)amino]carbamoyl]benzoate Chemical compound C1=CC(OCCCCCC)=CC=C1C(=O)NNC(=O)C1=CC=C(C(=O)OC)C=C1 RUTXRPSNXSBXSF-UHFFFAOYSA-N 0.000 description 1
- FEIOASZZURHTHB-UHFFFAOYSA-N methyl 4-formylbenzoate Chemical compound COC(=O)C1=CC=C(C=O)C=C1 FEIOASZZURHTHB-UHFFFAOYSA-N 0.000 description 1
- IVYQLXCACCEQHM-UHFFFAOYSA-N methyl 4-hexoxybenzoate Chemical compound CCCCCCOC1=CC=C(C(=O)OC)C=C1 IVYQLXCACCEQHM-UHFFFAOYSA-N 0.000 description 1
- PJMMXLPXRYKMLD-UHFFFAOYSA-N methyl 5-[4-(4-butoxyphenyl)phenyl]furan-2-carboxylate Chemical compound C1=CC(OCCCC)=CC=C1C1=CC=C(C=2OC(=CC=2)C(=O)OC)C=C1 PJMMXLPXRYKMLD-UHFFFAOYSA-N 0.000 description 1
- UIZHVPVXYAJVBS-UHFFFAOYSA-N methyl 6-(4-heptoxyphenyl)pyridine-3-carboxylate Chemical compound C1=CC(OCCCCCCC)=CC=C1C1=CC=C(C(=O)OC)C=N1 UIZHVPVXYAJVBS-UHFFFAOYSA-N 0.000 description 1
- MPUYLLIQJZUWBZ-UHFFFAOYSA-N methyl 6-(8-bromooctoxy)naphthalene-2-carboxylate Chemical compound C1=C(OCCCCCCCCBr)C=CC2=CC(C(=O)OC)=CC=C21 MPUYLLIQJZUWBZ-UHFFFAOYSA-N 0.000 description 1
- WPRSDVPSRCCIEQ-UHFFFAOYSA-N methyl 6-(8-methoxyoctoxy)naphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(OCCCCCCCCOC)=CC=C21 WPRSDVPSRCCIEQ-UHFFFAOYSA-N 0.000 description 1
- BKWOEKNWNWAWLV-UHFFFAOYSA-N methyl 6-[4-(4-hydroxyphenyl)piperazin-1-yl]pyridine-3-carboxylate Chemical compound N1=CC(C(=O)OC)=CC=C1N1CCN(C=2C=CC(O)=CC=2)CC1 BKWOEKNWNWAWLV-UHFFFAOYSA-N 0.000 description 1
- YVKJWGVIRXYAKV-UHFFFAOYSA-N methyl 6-[4-(4-octoxyphenyl)piperazin-1-yl]pyridine-3-carboxylate Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C=2N=CC(=CC=2)C(=O)OC)CC1 YVKJWGVIRXYAKV-UHFFFAOYSA-N 0.000 description 1
- PZDVVVLVCQRQSV-UHFFFAOYSA-N methyl 6-[4-[4-(8-bromooctoxy)phenyl]piperazin-1-yl]pyridine-3-carboxylate Chemical compound N1=CC(C(=O)OC)=CC=C1N1CCN(C=2C=CC(OCCCCCCCCBr)=CC=2)CC1 PZDVVVLVCQRQSV-UHFFFAOYSA-N 0.000 description 1
- MKSIUKCSAHIELM-UHFFFAOYSA-N methyl 6-heptylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(CCCCCCC)=CC=C21 MKSIUKCSAHIELM-UHFFFAOYSA-N 0.000 description 1
- OTGJDXGQXHXPLL-UHFFFAOYSA-N methyl 6-hex-1-ynylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(C#CCCCC)=CC=C21 OTGJDXGQXHXPLL-UHFFFAOYSA-N 0.000 description 1
- HYWOJVCLXAQCPV-UHFFFAOYSA-N methyl 6-hexylnaphthalene-2-carboxylate Chemical compound C1=C(C(=O)OC)C=CC2=CC(CCCCCC)=CC=C21 HYWOJVCLXAQCPV-UHFFFAOYSA-N 0.000 description 1
- UKZOPQRTQJERQC-UHFFFAOYSA-N methyl 6-hydroxynaphthalene-2-carboxylate Chemical compound C1=C(O)C=CC2=CC(C(=O)OC)=CC=C21 UKZOPQRTQJERQC-UHFFFAOYSA-N 0.000 description 1
- PXKNNGRTOQEZFY-UHFFFAOYSA-N methyl 7-octoxy-2-oxochromene-3-carboxylate Chemical compound C1=C(C(=O)OC)C(=O)OC2=CC(OCCCCCCCC)=CC=C21 PXKNNGRTOQEZFY-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- XMJHPCRAQCTCFT-UHFFFAOYSA-N methyl chloroformate Chemical compound COC(Cl)=O XMJHPCRAQCTCFT-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000001419 myristoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XPIHNCHVIZFNFJ-UHFFFAOYSA-N n'-hydroxy-4-octoxybenzenecarboximidamide Chemical compound CCCCCCCCOC1=CC=C(C(=N)NO)C=C1 XPIHNCHVIZFNFJ-UHFFFAOYSA-N 0.000 description 1
- UHAAFJWANJYDIS-UHFFFAOYSA-N n,n'-diethylmethanediimine Chemical compound CCN=C=NCC UHAAFJWANJYDIS-UHFFFAOYSA-N 0.000 description 1
- VMESOKCXSYNAKD-UHFFFAOYSA-N n,n-dimethylhydroxylamine Chemical compound CN(C)O VMESOKCXSYNAKD-UHFFFAOYSA-N 0.000 description 1
- PSHKMPUSSFXUIA-UHFFFAOYSA-N n,n-dimethylpyridin-2-amine Chemical compound CN(C)C1=CC=CC=N1 PSHKMPUSSFXUIA-UHFFFAOYSA-N 0.000 description 1
- NJGRNRAXMBFJJY-UHFFFAOYSA-N n-(2-azaniumylethyl)carbamodithioate Chemical compound NCCNC(S)=S NJGRNRAXMBFJJY-UHFFFAOYSA-N 0.000 description 1
- FTNFEHXDETWERN-UHFFFAOYSA-N n-[bis(aziridin-1-yl)phosphoryl]-2,6-dimethyl-5-[(4-propan-2-yloxyphenyl)methyl]pyrimidin-4-amine Chemical compound C1=CC(OC(C)C)=CC=C1CC1=C(C)N=C(C)N=C1NP(=O)(N1CC1)N1CC1 FTNFEHXDETWERN-UHFFFAOYSA-N 0.000 description 1
- 125000005184 naphthylamino group Chemical group C1(=CC=CC2=CC=CC=C12)N* 0.000 description 1
- 125000004923 naphthylmethyl group Chemical group C1(=CC=CC2=CC=CC=C12)C* 0.000 description 1
- 125000005186 naphthyloxy group Chemical group C1(=CC=CC2=CC=CC=C12)O* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 239000006199 nebulizer Substances 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- XITQUSLLOSKDTB-UHFFFAOYSA-N nitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=CC=C(Cl)C=C1Cl XITQUSLLOSKDTB-UHFFFAOYSA-N 0.000 description 1
- 125000001196 nonadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002801 octanoyl group Chemical group C(CCCCCCC)(=O)* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 1
- SEVSMVUOKAMPDO-UHFFFAOYSA-N para-Acetoxybenzaldehyde Natural products CC(=O)OC1=CC=C(C=O)C=C1 SEVSMVUOKAMPDO-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- WEYVCQFUGFRXOM-UHFFFAOYSA-N perazine Chemical compound C1CN(C)CCN1CCCN1C2=CC=CC=C2SC2=CC=CC=C21 WEYVCQFUGFRXOM-UHFFFAOYSA-N 0.000 description 1
- 229960002195 perazine Drugs 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 125000005954 phenoxathiinyl group Chemical group 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- CEMSSDOOIJDOBQ-UHFFFAOYSA-N phenyl n-(4-octylphenyl)carbamate Chemical compound C1=CC(CCCCCCCC)=CC=C1NC(=O)OC1=CC=CC=C1 CEMSSDOOIJDOBQ-UHFFFAOYSA-N 0.000 description 1
- CMPQUABWPXYYSH-UHFFFAOYSA-N phenyl phosphate Chemical compound OP(O)(=O)OC1=CC=CC=C1 CMPQUABWPXYYSH-UHFFFAOYSA-N 0.000 description 1
- WRAQQYDMVSCOTE-UHFFFAOYSA-N phenyl prop-2-enoate Chemical compound C=CC(=O)OC1=CC=CC=C1 WRAQQYDMVSCOTE-UHFFFAOYSA-N 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 125000001129 phenylbutoxy group Chemical group [*]OC([H])([H])C([H])([H])C([H])([H])C([H])([H])C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- OJMIONKXNSYLSR-UHFFFAOYSA-N phosphorous acid Chemical compound OP(O)O OJMIONKXNSYLSR-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- SIOXPEMLGUPBBT-UHFFFAOYSA-N picolinic acid Chemical compound OC(=O)C1=CC=CC=N1 SIOXPEMLGUPBBT-UHFFFAOYSA-N 0.000 description 1
- 125000004482 piperidin-4-yl group Chemical group N1CCC(CC1)* 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000002953 preparative HPLC Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 1
- 125000004289 pyrazol-3-yl group Chemical group [H]N1N=C(*)C([H])=C1[H] 0.000 description 1
- 125000003072 pyrazolidinyl group Chemical group 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000005493 quinolyl group Chemical group 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000001226 reprecipitation Methods 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 102220109092 rs372989037 Human genes 0.000 description 1
- 102220114166 rs754921704 Human genes 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- XGVXKJKTISMIOW-ZDUSSCGKSA-N simurosertib Chemical compound N1N=CC(C=2SC=3C(=O)NC(=NC=3C=2)[C@H]2N3CCC(CC3)C2)=C1C XGVXKJKTISMIOW-ZDUSSCGKSA-N 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 230000000087 stabilizing effect Effects 0.000 description 1
- 125000003696 stearoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- JSBPGDXOXSDAFB-UHFFFAOYSA-N tert-butyl 4-(4-octoxyphenyl)piperazine-1-carboxylate Chemical compound C1=CC(OCCCCCCCC)=CC=C1N1CCN(C(=O)OC(C)(C)C)CC1 JSBPGDXOXSDAFB-UHFFFAOYSA-N 0.000 description 1
- OVIPBGIXYIUXDX-UHFFFAOYSA-N tert-butyl 4-(4-phenylcyclohexyl)piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C1CCC(C=2C=CC=CC=2)CC1 OVIPBGIXYIUXDX-UHFFFAOYSA-N 0.000 description 1
- LJKXCXOKTGVAHI-UHFFFAOYSA-N tert-butyl 4-[4-(phenoxycarbonylamino)phenyl]piperazine-1-carboxylate Chemical compound C1CN(C(=O)OC(C)(C)C)CCN1C(C=C1)=CC=C1NC(=O)OC1=CC=CC=C1 LJKXCXOKTGVAHI-UHFFFAOYSA-N 0.000 description 1
- FRYGEZWYUGOZES-UHFFFAOYSA-N tert-butyl 4-[4-[1-(4-methylpentyl)-5-oxo-1,2,4-triazol-4-yl]phenyl]piperazine-1-carboxylate Chemical compound O=C1N(CCCC(C)C)N=CN1C1=CC=C(N2CCN(CC2)C(=O)OC(C)(C)C)C=C1 FRYGEZWYUGOZES-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 125000001973 tert-pentyl group Chemical group [H]C([H])([H])C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 125000005247 tetrazinyl group Chemical group N1=NN=NC(=C1)* 0.000 description 1
- 150000003536 tetrazoles Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000002562 thickening agent Substances 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- XJDNKRIXUMDJCW-UHFFFAOYSA-J titanium tetrachloride Chemical compound Cl[Ti](Cl)(Cl)Cl XJDNKRIXUMDJCW-UHFFFAOYSA-J 0.000 description 1
- VXUYXOFXAQZZMF-UHFFFAOYSA-N titanium(IV) isopropoxide Chemical compound CC(C)O[Ti](OC(C)C)(OC(C)C)OC(C)C VXUYXOFXAQZZMF-UHFFFAOYSA-N 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000000699 topical effect Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- YNJBWRMUSHSURL-UHFFFAOYSA-N trichloroacetic acid Chemical compound OC(=O)C(Cl)(Cl)Cl YNJBWRMUSHSURL-UHFFFAOYSA-N 0.000 description 1
- 125000002889 tridecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- GGUBFICZYGKNTD-UHFFFAOYSA-N triethyl phosphonoacetate Chemical compound CCOC(=O)CP(=O)(OCC)OCC GGUBFICZYGKNTD-UHFFFAOYSA-N 0.000 description 1
- VVRBLMQPRNPMSX-UHFFFAOYSA-N trimethyl-[2-[4-(4-pentylphenyl)phenyl]ethynyl]silane Chemical group C1=CC(CCCCC)=CC=C1C1=CC=C(C#C[Si](C)(C)C)C=C1 VVRBLMQPRNPMSX-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- NHDIQVFFNDKAQU-UHFFFAOYSA-N tripropan-2-yl borate Chemical compound CC(C)OB(OC(C)C)OC(C)C NHDIQVFFNDKAQU-UHFFFAOYSA-N 0.000 description 1
- 238000001665 trituration Methods 0.000 description 1
- 125000000297 undecanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
- 239000003643 water by type Substances 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 125000001834 xanthenyl group Chemical group C1=CC=CC=2OC3=CC=CC=C3C(C12)* 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07K—PEPTIDES
- C07K7/00—Peptides having 5 to 20 amino acids in a fully defined sequence; Derivatives thereof
- C07K7/50—Cyclic peptides containing at least one abnormal peptide link
- C07K7/54—Cyclic peptides containing at least one abnormal peptide link with at least one abnormal peptide link in the ring
- C07K7/56—Cyclic peptides containing at least one abnormal peptide link with at least one abnormal peptide link in the ring the cyclisation not occurring through 2,4-diamino-butanoic acid
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
- A61K38/04—Peptides having up to 20 amino acids in a fully defined sequence; Derivatives thereof
- A61K38/12—Cyclic peptides, e.g. bacitracins; Polymyxins; Gramicidins S, C; Tyrocidins A, B or C
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/10—Antimycotics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K38/00—Medicinal preparations containing peptides
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Proteomics, Peptides & Aminoacids (AREA)
- Biophysics (AREA)
- Pharmacology & Pharmacy (AREA)
- Animal Behavior & Ethology (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Biochemistry (AREA)
- Genetics & Genomics (AREA)
- Molecular Biology (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oncology (AREA)
- Communicable Diseases (AREA)
- Gastroenterology & Hepatology (AREA)
- Engineering & Computer Science (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Immunology (AREA)
- Epidemiology (AREA)
- Medicines That Contain Protein Lipid Enzymes And Other Medicines (AREA)
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Preparation Of Compounds By Using Micro-Organisms (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Medicines Containing Material From Animals Or Micro-Organisms (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9420425A GB9420425D0 (en) | 1994-10-07 | 1994-10-07 | New compound |
| GB9420425.2 | 1994-10-07 | ||
| GB9508745.8 | 1995-04-28 | ||
| GBGB9508745.8A GB9508745D0 (en) | 1995-04-28 | 1995-04-28 | New compound |
| PCT/JP1995/001983 WO1996011210A1 (en) | 1994-10-07 | 1995-09-29 | Cyclic hexapeptides having antibiotic activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| CA2202058A1 CA2202058A1 (en) | 1996-04-18 |
| CA2202058C true CA2202058C (en) | 2007-11-06 |
Family
ID=26305774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA002202058A Expired - Lifetime CA2202058C (en) | 1994-10-07 | 1995-09-29 | Cyclic hexapeptides having antibiotic activity |
Country Status (26)
| Country | Link |
|---|---|
| US (2) | US6107458A (OSRAM) |
| EP (1) | EP0788511B1 (OSRAM) |
| JP (2) | JP2897427B2 (OSRAM) |
| KR (1) | KR100353303B1 (OSRAM) |
| CN (1) | CN1203089C (OSRAM) |
| AR (1) | AR041770A1 (OSRAM) |
| AT (1) | ATE229541T1 (OSRAM) |
| AU (1) | AU696949B2 (OSRAM) |
| BR (2) | BRPI9504791B8 (OSRAM) |
| CA (1) | CA2202058C (OSRAM) |
| DE (2) | DE122008000025I2 (OSRAM) |
| DK (1) | DK0788511T3 (OSRAM) |
| ES (1) | ES2187575T3 (OSRAM) |
| FI (1) | FI119988B (OSRAM) |
| FR (1) | FR08C0028I2 (OSRAM) |
| HU (1) | HU228151B1 (OSRAM) |
| IL (1) | IL115484A (OSRAM) |
| LU (1) | LU91452I2 (OSRAM) |
| MX (1) | MX9702531A (OSRAM) |
| NL (1) | NL300352I2 (OSRAM) |
| NO (2) | NO328483B1 (OSRAM) |
| OA (1) | OA10475A (OSRAM) |
| PT (1) | PT788511E (OSRAM) |
| RU (1) | RU2165423C2 (OSRAM) |
| TR (1) | TR199501229A2 (OSRAM) |
| WO (1) | WO1996011210A1 (OSRAM) |
Families Citing this family (61)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5696084A (en) * | 1996-08-16 | 1997-12-09 | Abbott Laboratories | Amino-lipopetide antifungal agents |
| AUPO371596A0 (en) * | 1996-11-19 | 1996-12-12 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| AUPO381496A0 (en) * | 1996-11-25 | 1996-12-19 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| EP0994101A4 (en) * | 1997-06-18 | 2002-05-02 | Fujisawa Pharmaceutical Co | NEW PREPARATION PROCESS |
| CA2320416A1 (en) * | 1998-02-09 | 1999-08-12 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| AU756792B2 (en) * | 1998-02-09 | 2003-01-23 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| DE60024414T2 (de) * | 1999-02-11 | 2006-06-14 | Emisphere Tech Inc | Oxadiazolverbindungen und -zusammensetzungen zur abgabe von wirkstoffen |
| US7084279B1 (en) * | 1999-02-11 | 2006-08-01 | Emisphere Technologies Inc. | Oxadiazole compounds and compositions for delivering active agents |
| AUPP999799A0 (en) | 1999-04-27 | 1999-05-20 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| AUPQ066399A0 (en) | 1999-05-31 | 1999-06-24 | Fujisawa Pharmaceutical Co., Ltd. | Antifungal combination use |
| TWI233805B (en) | 1999-07-01 | 2005-06-11 | Fujisawa Pharmaceutical Co | Stabilized pharmaceutical composition in lyophilized form as antifungal agent |
| JP2003505468A (ja) | 1999-07-27 | 2003-02-12 | アヴェンティス ファルマ ドイチェラント ゲーエムベーハー | 新規なシクロヘキサペプチド化合物、それらの製造方法及びそれらの医薬品としての使用 |
| AUPQ462399A0 (en) * | 1999-12-13 | 2000-01-13 | Fujisawa Pharmaceutical Co., Ltd. | New use |
| TWI250992B (en) * | 2000-02-21 | 2006-03-11 | Astellas Pharma Inc | Polypeptide compounds for the prophylactic and/or therapeutic treatment of infectious diseases caused by pathogenic microorganisms |
| ES2191516B1 (es) * | 2000-07-28 | 2005-01-01 | Consejo Superior De Investigaciones Cientificas | Antibioticos antifungicos de naturaleza peptidica inhibidores de la germinacion y el crecimiento de hongos fitopatogenos. |
| AUPQ938700A0 (en) * | 2000-08-14 | 2000-09-07 | Fujisawa Pharmaceutical Co., Ltd. | Antifungal combination use |
| DE60234812D1 (de) | 2001-01-29 | 2010-02-04 | Shionogi & Co | Arzneipräparat, das als wirkstoff 5-methyl-1-phenyl-2-(1h)-pyridon enthält |
| JP2005053782A (ja) * | 2001-08-31 | 2005-03-03 | Fujisawa Pharmaceut Co Ltd | 環状リポペプチド化合物の新規結晶 |
| IL163666A0 (en) | 2002-02-22 | 2005-12-18 | New River Pharmaceuticals Inc | Active agent delivery systems and methods for protecting and administering active agents |
| WO2004014879A1 (en) * | 2002-08-08 | 2004-02-19 | Fujisawa Pharmaceutical Co., Ltd. | New process |
| AU2003903205A0 (en) * | 2003-06-23 | 2003-07-10 | Fujisawa Pharmaceutical Co., Ltd. | New compound |
| DE602004010915T2 (de) * | 2003-07-22 | 2008-12-11 | Theravance, Inc., South San Francisco | Verwendung eines antimykotischen echinocandin-mittels in kombination mit einem antibakteriellen glycopeptid-mittel |
| JP2007504460A (ja) * | 2003-09-05 | 2007-03-01 | メルク エンド カムパニー インコーポレーテッド | 固定相及び該固定相を用いた精製プロセス |
| JP4765627B2 (ja) * | 2003-09-22 | 2011-09-07 | Msd株式会社 | 新規ピペリジン誘導体 |
| US7476673B2 (en) * | 2003-12-30 | 2009-01-13 | Allergan, Inc. | Disubstituted chalcone oximes as selective agonists of RARγ retinoid receptors |
| JP2007538103A (ja) * | 2004-05-20 | 2007-12-27 | ザ スクリップス リサーチ インスティテュート | トランスサイレチン安定化 |
| MX2007003332A (es) | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como inhibidores de estearoil-coa-desaturasa. |
| EP1799667B1 (en) | 2004-09-20 | 2013-03-20 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as therapeutic agents |
| MX2007003319A (es) | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos y su uso como agentes terapeuticos. |
| JP4958786B2 (ja) | 2004-09-20 | 2012-06-20 | ゼノン・ファーマシューティカルズ・インコーポレイテッド | 複素環誘導体および治療薬としてのそれらの使用 |
| EP2289510A1 (en) | 2004-09-20 | 2011-03-02 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives for the treatment of diseases mediated by stearoyl-coa desaturase enzymes |
| EP2269610A3 (en) | 2004-09-20 | 2011-03-09 | Xenon Pharmaceuticals Inc. | Heterocyclic derivatives and their use as stearoyl-coa desaturase inhibitors |
| MX2007003327A (es) | 2004-09-20 | 2007-06-05 | Xenon Pharmaceuticals Inc | Derivados heterociclicos, y su uso como mediadores de estearoil-coa desaturasa. |
| EP1815206B1 (en) * | 2004-10-13 | 2016-04-06 | PTC Therapeutics, Inc. | Compounds for nonsense suppression, and methods for their use |
| BRPI0611187A2 (pt) | 2005-06-03 | 2010-08-24 | Xenon Pharmaceuticals Inc | derivados aminotiazàis como inibidores da estearoil-coa desaturase humana |
| EP1932833B1 (en) * | 2005-10-07 | 2012-08-01 | Kissei Pharmaceutical Co., Ltd. | Nitrogenated heterocyclic compound and pharmaceutical composition comprising the same |
| CN101516387B (zh) * | 2006-07-26 | 2014-06-04 | 桑多斯股份公司 | 卡泊芬净制剂 |
| US8853392B2 (en) | 2007-06-03 | 2014-10-07 | Vanderbilt University | Benzamide mGluR5 positive allosteric modulators and methods of making and using same |
| HUE036519T2 (hu) | 2007-08-13 | 2018-07-30 | Monsanto Technology Llc | Készítmények és eljárások nematódák irtására |
| CA2704562A1 (en) * | 2007-10-29 | 2009-05-07 | Astellas Pharma Inc. | Polypeptide compound |
| US8034806B2 (en) | 2007-11-02 | 2011-10-11 | Vanderbilt University | Bicyclic mGluR5 positive allosteric modulators and methods of making and using same |
| WO2010008831A2 (en) * | 2008-06-24 | 2010-01-21 | Irm Llc | Compounds and methods for modulating g protein-coupled receptors |
| US9394340B2 (en) | 2009-03-24 | 2016-07-19 | Cadila Healthcare Limited | Purification process for lipopeptides |
| BR112013023531A2 (pt) * | 2011-04-04 | 2016-12-06 | Xellia Pharmaceuticals Aps | processo de um único vaso para a fabricação de micafungina ou de um sal desta |
| US9132163B2 (en) | 2011-04-20 | 2015-09-15 | Xellia Pharmaceuticals Aps | Method for purification of Micafungin |
| CN102775476B (zh) * | 2011-05-12 | 2015-01-07 | 上海天伟生物制药有限公司 | 一种米卡芬净钠盐的制备方法 |
| EP2709609B1 (en) | 2011-05-17 | 2017-10-04 | Shionogi & Co., Ltd. | Heterocyclic compounds |
| HUE029720T2 (en) * | 2011-09-09 | 2017-03-28 | Sandoz Ag | Preparation of micafungin intermediates |
| CN102627688B (zh) | 2012-03-30 | 2014-12-31 | 上海天伟生物制药有限公司 | 一种高纯度环肽化合物及其制备方法和用途 |
| CN102659930B (zh) | 2012-03-30 | 2014-04-23 | 上海天伟生物制药有限公司 | 一种高纯度环肽类物质的晶体及其制备方法和用途 |
| CN102627689B (zh) * | 2012-03-30 | 2014-08-06 | 上海天伟生物制药有限公司 | 一种环肽类化合物的水合物及其制备方法和用途 |
| EP3150621A4 (en) * | 2014-05-29 | 2017-12-27 | Shanghai Techwell Biopharmaceutical Co., Ltd | Composition of cyclic peptide compound, preparation method for same, and uses thereof |
| EP3150623B1 (en) * | 2014-05-29 | 2019-04-03 | Shanghai Techwell Biopharmaceutical Co., Ltd | Solvate of cyclic peptide compound, preparation method for same, and uses thereof |
| EP3226885A4 (en) * | 2014-10-07 | 2018-07-18 | Alaparthi, Lakshmi Prasad | Intermediates and processes to prepare micafungin |
| CA2937365C (en) | 2016-03-29 | 2018-09-18 | F. Hoffmann-La Roche Ag | Granulate formulation of 5-methyl-1-phenyl-2-(1h)-pyridone and method of making the same |
| PT3554474T (pt) | 2016-12-16 | 2024-02-12 | Baxter Healthcare Sa | Composições de micafungina |
| EP3485873A1 (en) | 2017-11-17 | 2019-05-22 | Cadila Healthcare Limited | Stable pharmaceutical injectable compositions of micafungin |
| CN108752430B (zh) * | 2018-05-31 | 2022-02-18 | 杭州中美华东制药有限公司 | 米卡芬净钠新晶型及其制备方法 |
| WO2020013116A1 (ja) * | 2018-07-10 | 2020-01-16 | 京都薬品工業株式会社 | Ptp-1b阻害剤およびその用途 |
| CN110734408A (zh) * | 2019-10-22 | 2020-01-31 | 重庆康乐制药有限公司 | 一种米卡芬净类衍生物侧链中间体的制备方法 |
| CN115785226B (zh) * | 2021-09-09 | 2026-02-24 | 上海天伟生物制药有限公司 | 一种棘白菌素药物杂质及其制备、纯化方法和应用 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU1574603A1 (ru) * | 1988-08-11 | 1990-06-30 | Ивановский Химико-Технологический Институт | Способ получени мезо-тетраарилоктаметилпорфиринов |
| IL98506A (en) * | 1990-06-18 | 1996-09-12 | Fujisawa Pharmaceutical Co | Cyclic peptide antibiotics processes for the preparation thereof and pharmaceutical compositions containing them |
| IL122315A (en) * | 1992-03-19 | 2002-03-10 | Lilly Co Eli | Cyclic peptides and antifungal pharmaceutical compositions containing them |
-
1995
- 1995-09-29 JP JP8512472A patent/JP2897427B2/ja not_active Expired - Lifetime
- 1995-09-29 CA CA002202058A patent/CA2202058C/en not_active Expired - Lifetime
- 1995-09-29 CN CNB95196643XA patent/CN1203089C/zh not_active Expired - Lifetime
- 1995-09-29 EP EP95932935A patent/EP0788511B1/en not_active Expired - Lifetime
- 1995-09-29 WO PCT/JP1995/001983 patent/WO1996011210A1/en not_active Ceased
- 1995-09-29 RU RU97107338/04A patent/RU2165423C2/ru active Protection Beyond IP Right Term
- 1995-09-29 DE DE122008000025C patent/DE122008000025I2/de active Active
- 1995-09-29 DE DE69529172T patent/DE69529172T2/de not_active Expired - Lifetime
- 1995-09-29 KR KR1019970702213A patent/KR100353303B1/ko not_active Expired - Lifetime
- 1995-09-29 DK DK95932935T patent/DK0788511T3/da active
- 1995-09-29 MX MX9702531A patent/MX9702531A/es unknown
- 1995-09-29 HU HU9800338A patent/HU228151B1/hu active Protection Beyond IP Right Term
- 1995-09-29 PT PT95932935T patent/PT788511E/pt unknown
- 1995-09-29 ES ES95932935T patent/ES2187575T3/es not_active Expired - Lifetime
- 1995-09-29 AU AU35780/95A patent/AU696949B2/en not_active Expired
- 1995-09-29 AT AT95932935T patent/ATE229541T1/de active
- 1995-09-29 US US08/809,723 patent/US6107458A/en not_active Expired - Lifetime
- 1995-10-02 IL IL11548495A patent/IL115484A/xx not_active IP Right Cessation
- 1995-10-06 BR BRPI9504791A patent/BRPI9504791B8/pt not_active IP Right Cessation
- 1995-10-06 AR ARP9501333763A patent/AR041770A1/es unknown
- 1995-10-06 BR BRPI9504791-3A patent/BR9504791B1/pt active IP Right Grant
- 1995-10-06 TR TR95/01229A patent/TR199501229A2/xx unknown
-
1997
- 1997-04-04 FI FI971397A patent/FI119988B/fi not_active IP Right Cessation
- 1997-04-04 NO NO19971544A patent/NO328483B1/no not_active IP Right Cessation
- 1997-04-17 OA OA60989A patent/OA10475A/en unknown
-
1998
- 1998-05-19 JP JP13675698A patent/JP3518665B2/ja not_active Expired - Lifetime
-
1999
- 1999-02-11 US US09/248,267 patent/US6265536B1/en not_active Expired - Lifetime
-
2008
- 2008-06-03 NL NL300352C patent/NL300352I2/nl unknown
- 2008-06-04 LU LU91452C patent/LU91452I2/fr unknown
- 2008-06-27 FR FR08C0028C patent/FR08C0028I2/fr active Active
-
2010
- 2010-08-09 NO NO2010016C patent/NO2010016I2/no unknown
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0788511B1 (en) | Cyclic hexapeptides having antibiotic activity | |
| CA2044746C (en) | Polypeptide compound and a process for preparation thereof | |
| JP3551469B2 (ja) | 新規ポリペプチド化合物及びその塩 | |
| US6232290B1 (en) | Cyclic hexapeptides with antimicrobial activity | |
| KR100250921B1 (ko) | 타키키닌 길항활성을 갖는 펩타이드 | |
| US5741775A (en) | Cyclohexapeptidyl aminoalkyl ethers | |
| JP2004526728A (ja) | 抗菌活性を有する環状ヘキサペプチド化合物 | |
| US6743776B2 (en) | Cyclohexapeptides having antimicrobial activity | |
| JP3906690B2 (ja) | 環状ヘキサペプチド誘導体 | |
| JPH0570495A (ja) | 環式ヘキサペプチド化合物 | |
| WO1995000536A1 (en) | Peptide compounds | |
| US5952299A (en) | Cyclic peptide nuclei and derivatives thereof | |
| US5654400A (en) | Process for making peptide compounds having tachykinin antagonistic activity | |
| JP2005524640A (ja) | 新規化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| EEER | Examination request | ||
| MKEX | Expiry |
Effective date: 20150929 |