AU595064B2 - Novel(1h-imidazol-1-ylmethyl) substituted benzimidazole derivatives - Google Patents
Novel(1h-imidazol-1-ylmethyl) substituted benzimidazole derivatives Download PDFInfo
- Publication number
- AU595064B2 AU595064B2 AU78385/87A AU7838587A AU595064B2 AU 595064 B2 AU595064 B2 AU 595064B2 AU 78385/87 A AU78385/87 A AU 78385/87A AU 7838587 A AU7838587 A AU 7838587A AU 595064 B2 AU595064 B2 AU 595064B2
- Authority
- AU
- Australia
- Prior art keywords
- parts
- formula
- substituted
- alkyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 1h-imidazol-1-ylmethyl Chemical group 0.000 title claims description 85
- 125000003785 benzimidazolyl group Chemical class N1=C(NC2=C1C=CC=C2)* 0.000 title claims description 9
- 229940058303 antinematodal benzimidazole derivative Drugs 0.000 title description 3
- 150000001875 compounds Chemical class 0.000 claims description 203
- 239000002585 base Substances 0.000 claims description 125
- 125000000217 alkyl group Chemical group 0.000 claims description 62
- 229910052739 hydrogen Inorganic materials 0.000 claims description 58
- 239000001257 hydrogen Substances 0.000 claims description 58
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Substances C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 claims description 47
- 238000006243 chemical reaction Methods 0.000 claims description 44
- 239000002253 acid Substances 0.000 claims description 43
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 40
- 150000003839 salts Chemical class 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 32
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 28
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 27
- 125000005843 halogen group Chemical group 0.000 claims description 27
- 125000003545 alkoxy group Chemical group 0.000 claims description 24
- 150000003254 radicals Chemical class 0.000 claims description 24
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 23
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 23
- 229910052751 metal Inorganic materials 0.000 claims description 21
- 239000002184 metal Substances 0.000 claims description 21
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 20
- 239000003098 androgen Substances 0.000 claims description 19
- 229910052799 carbon Inorganic materials 0.000 claims description 17
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 17
- 150000002431 hydrogen Chemical class 0.000 claims description 17
- 150000001412 amines Chemical group 0.000 claims description 15
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 15
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 14
- 239000003638 chemical reducing agent Substances 0.000 claims description 13
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 13
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 claims description 13
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 claims description 11
- 238000006467 substitution reaction Methods 0.000 claims description 11
- 229910052783 alkali metal Inorganic materials 0.000 claims description 10
- 239000012442 inert solvent Substances 0.000 claims description 10
- 230000001419 dependent effect Effects 0.000 claims description 9
- 241000124008 Mammalia Species 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 8
- 238000011065 in-situ storage Methods 0.000 claims description 8
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 claims description 7
- 238000007126 N-alkylation reaction Methods 0.000 claims description 7
- 239000004480 active ingredient Substances 0.000 claims description 7
- 239000003153 chemical reaction reagent Substances 0.000 claims description 7
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 claims description 6
- 239000003513 alkali Substances 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 239000008194 pharmaceutical composition Substances 0.000 claims description 6
- 125000004076 pyridyl group Chemical group 0.000 claims description 6
- 125000001424 substituent group Chemical group 0.000 claims description 6
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 6
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 claims description 5
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 5
- 125000002541 furyl group Chemical group 0.000 claims description 5
- 125000002883 imidazolyl group Chemical group 0.000 claims description 5
- 229910052740 iodine Inorganic materials 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- SNOOUWRIMMFWNE-UHFFFAOYSA-M sodium;6-[(3,4,5-trimethoxybenzoyl)amino]hexanoate Chemical group [Na+].COC1=CC(C(=O)NCCCCCC([O-])=O)=CC(OC)=C1OC SNOOUWRIMMFWNE-UHFFFAOYSA-M 0.000 claims description 5
- 125000000335 thiazolyl group Chemical group 0.000 claims description 5
- 125000001544 thienyl group Chemical group 0.000 claims description 5
- 239000002609 medium Substances 0.000 claims description 4
- 238000007910 systemic administration Methods 0.000 claims description 4
- 238000010934 O-alkylation reaction Methods 0.000 claims description 3
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000003302 alkenyloxy group Chemical group 0.000 claims description 3
- 239000012458 free base Substances 0.000 claims description 3
- 125000000524 functional group Chemical group 0.000 claims description 3
- 231100000252 nontoxic Toxicity 0.000 claims description 3
- 230000003000 nontoxic effect Effects 0.000 claims description 3
- JQUCWIWWWKZNCS-LESHARBVSA-N C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F Chemical compound C(C1=CC=CC=C1)(=O)NC=1SC[C@H]2[C@@](N1)(CO[C@H](C2)C)C=2SC=C(N2)NC(=O)C2=NC=C(C=C2)OC(F)F JQUCWIWWWKZNCS-LESHARBVSA-N 0.000 claims description 2
- 229910014033 C-OH Inorganic materials 0.000 claims description 2
- 229910014570 C—OH Inorganic materials 0.000 claims description 2
- 101100400378 Mus musculus Marveld2 gene Proteins 0.000 claims description 2
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 claims description 2
- 229940079826 hydrogen sulfite Drugs 0.000 claims description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 claims description 2
- 230000009466 transformation Effects 0.000 claims description 2
- 125000004448 alkyl carbonyl group Chemical group 0.000 claims 2
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 claims 2
- XRMDCWJNPDVAFI-UHFFFAOYSA-N 2,2,6,6-tetramethyl-1-oxopiperidin-1-ium-4-ol Chemical compound CC1(C)CC(O)CC(C)(C)[N+]1=O XRMDCWJNPDVAFI-UHFFFAOYSA-N 0.000 claims 1
- 101100294106 Caenorhabditis elegans nhr-3 gene Proteins 0.000 claims 1
- 101150041326 air-2 gene Proteins 0.000 claims 1
- 125000005133 alkynyloxy group Chemical group 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 379
- 239000000203 mixture Substances 0.000 description 185
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 124
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 109
- 239000000243 solution Substances 0.000 description 101
- 239000003480 eluent Substances 0.000 description 98
- 239000000047 product Substances 0.000 description 96
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 87
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 77
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 72
- 229960001701 chloroform Drugs 0.000 description 72
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 62
- 239000011541 reaction mixture Substances 0.000 description 61
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 59
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 57
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 57
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 51
- 239000000741 silica gel Substances 0.000 description 49
- 229910002027 silica gel Inorganic materials 0.000 description 49
- 238000004440 column chromatography Methods 0.000 description 45
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 42
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 41
- 239000000543 intermediate Substances 0.000 description 40
- 239000000284 extract Substances 0.000 description 39
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 38
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 38
- 238000003756 stirring Methods 0.000 description 37
- 239000002904 solvent Substances 0.000 description 34
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 27
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 27
- 238000010992 reflux Methods 0.000 description 27
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 26
- 239000000908 ammonium hydroxide Substances 0.000 description 26
- 239000000706 filtrate Substances 0.000 description 22
- 239000003054 catalyst Substances 0.000 description 21
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 20
- 229960000583 acetic acid Drugs 0.000 description 19
- 229910021529 ammonia Inorganic materials 0.000 description 19
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 19
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 18
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 18
- 235000011054 acetic acid Nutrition 0.000 description 18
- 229920006395 saturated elastomer Polymers 0.000 description 18
- 238000001816 cooling Methods 0.000 description 17
- 238000002360 preparation method Methods 0.000 description 16
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 14
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 14
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 14
- 239000007858 starting material Substances 0.000 description 14
- 238000012360 testing method Methods 0.000 description 14
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 14
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 13
- 239000010410 layer Substances 0.000 description 13
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 12
- MUMGGOZAMZWBJJ-DYKIIFRCSA-N Testostosterone Chemical compound O=C1CC[C@]2(C)[C@H]3CC[C@](C)([C@H](CC4)O)[C@@H]4[C@@H]3CCC2=C1 MUMGGOZAMZWBJJ-DYKIIFRCSA-N 0.000 description 12
- 230000015572 biosynthetic process Effects 0.000 description 12
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 12
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 12
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 9
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 9
- 150000002148 esters Chemical group 0.000 description 9
- 239000005457 ice water Substances 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- 239000012279 sodium borohydride Substances 0.000 description 9
- 229910000033 sodium borohydride Inorganic materials 0.000 description 9
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 8
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 8
- MUBZPKHOEPUJKR-UHFFFAOYSA-L Oxalate Chemical compound [O-]C(=O)C([O-])=O MUBZPKHOEPUJKR-UHFFFAOYSA-L 0.000 description 8
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 8
- 229910000564 Raney nickel Inorganic materials 0.000 description 8
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- 150000001299 aldehydes Chemical class 0.000 description 8
- 239000007787 solid Substances 0.000 description 8
- 239000005909 Kieselgur Substances 0.000 description 7
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 7
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 7
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 230000008020 evaporation Effects 0.000 description 7
- 150000008282 halocarbons Chemical class 0.000 description 7
- 230000002401 inhibitory effect Effects 0.000 description 7
- 150000002576 ketones Chemical class 0.000 description 7
- 229930192474 thiophene Natural products 0.000 description 7
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 6
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 6
- 239000004215 Carbon black (E152) Substances 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 6
- 108010044467 Isoenzymes Proteins 0.000 description 6
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- KPCZJLGGXRGYIE-UHFFFAOYSA-N [C]1=CC=CN=C1 Chemical group [C]1=CC=CN=C1 KPCZJLGGXRGYIE-UHFFFAOYSA-N 0.000 description 6
- 235000019253 formic acid Nutrition 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 229930195733 hydrocarbon Natural products 0.000 description 6
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 6
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- 229910000027 potassium carbonate Inorganic materials 0.000 description 6
- 238000006722 reduction reaction Methods 0.000 description 6
- 229910052708 sodium Inorganic materials 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- 239000012312 sodium hydride Substances 0.000 description 6
- 229910000104 sodium hydride Inorganic materials 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- 239000003826 tablet Substances 0.000 description 6
- 229960003604 testosterone Drugs 0.000 description 6
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 6
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 5
- UMGDCJDMYOKAJW-UHFFFAOYSA-M carbamimidothioate Chemical compound NC([S-])=N UMGDCJDMYOKAJW-UHFFFAOYSA-M 0.000 description 5
- 125000001309 chloro group Chemical group Cl* 0.000 description 5
- 239000012141 concentrate Substances 0.000 description 5
- 235000008504 concentrate Nutrition 0.000 description 5
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 5
- 238000001727 in vivo Methods 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 210000001550 testis Anatomy 0.000 description 5
- WGMHMVLZFAJNOT-UHFFFAOYSA-N 1-ethoxyethylideneazanium;chloride Chemical compound [Cl-].CCOC(C)=[NH2+] WGMHMVLZFAJNOT-UHFFFAOYSA-N 0.000 description 4
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 4
- DCGOMTSIZLGUOK-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-methyl-1h-benzimidazole Chemical compound C1=C2NC(C)=NC2=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 DCGOMTSIZLGUOK-UHFFFAOYSA-N 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 4
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 4
- 102000002004 Cytochrome P-450 Enzyme System Human genes 0.000 description 4
- 108010015742 Cytochrome P-450 Enzyme System Proteins 0.000 description 4
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 4
- 239000002202 Polyethylene glycol Substances 0.000 description 4
- 239000007868 Raney catalyst Substances 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical compound [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 4
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 4
- 230000037396 body weight Effects 0.000 description 4
- 125000001246 bromo group Chemical group Br* 0.000 description 4
- 239000002775 capsule Substances 0.000 description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 4
- 239000006185 dispersion Substances 0.000 description 4
- 125000004185 ester group Chemical group 0.000 description 4
- 150000002430 hydrocarbons Chemical class 0.000 description 4
- 150000002460 imidazoles Chemical class 0.000 description 4
- 230000001965 increasing effect Effects 0.000 description 4
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 4
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 4
- 210000001589 microsome Anatomy 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 150000007530 organic bases Chemical class 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- 230000001590 oxidative effect Effects 0.000 description 4
- 230000000144 pharmacologic effect Effects 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- KMUONIBRACKNSN-UHFFFAOYSA-N potassium dichromate Chemical compound [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O KMUONIBRACKNSN-UHFFFAOYSA-N 0.000 description 4
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Chemical compound [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 4
- MKWJZTFMDWSRIH-UHFFFAOYSA-N (4-fluoro-3-nitrophenyl)methanol Chemical compound OCC1=CC=C(F)C([N+]([O-])=O)=C1 MKWJZTFMDWSRIH-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- HTVCVMGFQCPULE-UHFFFAOYSA-N 4-[imidazol-1-yl(phenyl)methyl]-2-nitroaniline Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 HTVCVMGFQCPULE-UHFFFAOYSA-N 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 239000012359 Methanesulfonyl chloride Substances 0.000 description 3
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- 206010060862 Prostate cancer Diseases 0.000 description 3
- 208000000236 Prostatic Neoplasms Diseases 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 241000700159 Rattus Species 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 125000005907 alkyl ester group Chemical group 0.000 description 3
- 125000005103 alkyl silyl group Chemical group 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000003610 charcoal Substances 0.000 description 3
- 230000002140 halogenating effect Effects 0.000 description 3
- 238000004128 high performance liquid chromatography Methods 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 230000005764 inhibitory process Effects 0.000 description 3
- 125000002346 iodo group Chemical group I* 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 3
- 239000012528 membrane Substances 0.000 description 3
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000003880 polar aprotic solvent Substances 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- KVKMBXFQSACNIJ-UHFFFAOYSA-N (2-methyl-1h-benzimidazol-4-yl)methanol Chemical compound C1=CC=C2NC(C)=NC2=C1CO KVKMBXFQSACNIJ-UHFFFAOYSA-N 0.000 description 2
- GBJNGHWDPVPOHF-UHFFFAOYSA-N (2-phenyl-1-propylbenzimidazol-5-yl)methanol Chemical compound N=1C2=CC(CO)=CC=C2N(CCC)C=1C1=CC=CC=C1 GBJNGHWDPVPOHF-UHFFFAOYSA-N 0.000 description 2
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 2
- CYSGHNMQYZDMIA-UHFFFAOYSA-N 1,3-Dimethyl-2-imidazolidinon Chemical compound CN1CCN(C)C1=O CYSGHNMQYZDMIA-UHFFFAOYSA-N 0.000 description 2
- QFNSJKHGAZXOQH-UHFFFAOYSA-N 1-cyclohexyl-6-(imidazol-1-ylmethyl)-2-methylbenzimidazole Chemical compound C1=C2N(C3CCCCC3)C(C)=NC2=CC=C1CN1C=CN=C1 QFNSJKHGAZXOQH-UHFFFAOYSA-N 0.000 description 2
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 2
- DKJJREPVGXSETR-UHFFFAOYSA-N 2-[n-ethyl-4-(hydroxymethyl)-2-nitroanilino]acetic acid Chemical compound OC(=O)CN(CC)C1=CC=C(CO)C=C1[N+]([O-])=O DKJJREPVGXSETR-UHFFFAOYSA-N 0.000 description 2
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 2
- LOPVGDXYIZNBTQ-UHFFFAOYSA-N 3-nitro-4-(propylamino)benzaldehyde Chemical compound CCCNC1=CC=C(C=O)C=C1[N+]([O-])=O LOPVGDXYIZNBTQ-UHFFFAOYSA-N 0.000 description 2
- HCBZUYSHGIQNTM-UHFFFAOYSA-N 4-(1-imidazol-1-ylpropyl)benzene-1,2-diamine Chemical compound C1=CN=CN1C(CC)C1=CC=C(N)C(N)=C1 HCBZUYSHGIQNTM-UHFFFAOYSA-N 0.000 description 2
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 2
- SPBGFBFESZVJEZ-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1,3-dihydrobenzimidazol-2-one Chemical compound C1=C2NC(=O)NC2=CC=C1CN1C=CN=C1 SPBGFBFESZVJEZ-UHFFFAOYSA-N 0.000 description 2
- BLVFNCOAXVPRSB-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-methyl-1-(thiophen-2-ylmethyl)benzimidazole Chemical compound C1=C2N(CC=3SC=CC=3)C(C)=NC2=CC=C1CN1C=CN=C1 BLVFNCOAXVPRSB-UHFFFAOYSA-N 0.000 description 2
- UQCFYKCLPPESGM-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-methyl-1-phenylbenzimidazole Chemical compound C1=C2N(C=3C=CC=CC=3)C(C)=NC2=CC=C1CN1C=CN=C1 UQCFYKCLPPESGM-UHFFFAOYSA-N 0.000 description 2
- FGJWICDLOGCIBR-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-phenyl-1-(3-phenylprop-2-enoxy)benzimidazole Chemical compound C=1C=CC=CC=1C=CCON(C1=C2)C(C=3C=CC=CC=3)=NC1=CC=C2CN1C=CN=C1 FGJWICDLOGCIBR-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000005711 Benzoic acid Substances 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical class OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 2
- 101100482220 Sulfurisphaera tokodaii (strain DSM 16993 / JCM 10545 / NBRC 100140 / 7) triC gene Proteins 0.000 description 2
- 238000002835 absorbance Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 2
- 239000012346 acetyl chloride Substances 0.000 description 2
- 239000003929 acidic solution Substances 0.000 description 2
- 210000004404 adrenal cortex Anatomy 0.000 description 2
- 125000000304 alkynyl group Chemical group 0.000 description 2
- 150000004645 aluminates Chemical class 0.000 description 2
- 229940030486 androgens Drugs 0.000 description 2
- 239000012736 aqueous medium Substances 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 2
- METKIMKYRPQLGS-UHFFFAOYSA-N atenolol Chemical compound CC(C)NCC(O)COC1=CC=C(CC(N)=O)C=C1 METKIMKYRPQLGS-UHFFFAOYSA-N 0.000 description 2
- 150000001556 benzimidazoles Chemical class 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-M benzoate Chemical compound [O-]C(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-M 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- KLQNJBAFEFFWQZ-UHFFFAOYSA-N benzoic acid;dihydrochloride Chemical compound Cl.Cl.OC(=O)C1=CC=CC=C1 KLQNJBAFEFFWQZ-UHFFFAOYSA-N 0.000 description 2
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical compound OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 2
- 150000004683 dihydrates Chemical class 0.000 description 2
- VNEBWJSWMVTSHK-UHFFFAOYSA-L disodium;3-hydroxynaphthalene-2,7-disulfonate Chemical compound [Na+].[Na+].C1=C(S([O-])(=O)=O)C=C2C=C(S([O-])(=O)=O)C(O)=CC2=C1 VNEBWJSWMVTSHK-UHFFFAOYSA-L 0.000 description 2
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- SFDALSUFTGWIQI-UHFFFAOYSA-N ethyl 2-methyl-1h-benzimidazole-4-carboxylate Chemical compound CCOC(=O)C1=CC=CC2=C1NC(C)=N2 SFDALSUFTGWIQI-UHFFFAOYSA-N 0.000 description 2
- AYTQNBKSIBFKNT-UHFFFAOYSA-N ethyl pyridine-3-carboximidate;dihydrochloride Chemical compound Cl.Cl.CCOC(=N)C1=CC=CN=C1 AYTQNBKSIBFKNT-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 239000008103 glucose Substances 0.000 description 2
- 235000011187 glycerol Nutrition 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000005842 heteroatom Chemical group 0.000 description 2
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 2
- 238000000338 in vitro Methods 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910052500 inorganic mineral Inorganic materials 0.000 description 2
- 230000003993 interaction Effects 0.000 description 2
- 229940079865 intestinal antiinfectives imidazole derivative Drugs 0.000 description 2
- AWJUIBRHMBBTKR-UHFFFAOYSA-N isoquinoline Chemical compound C1=NC=CC2=CC=CC=C21 AWJUIBRHMBBTKR-UHFFFAOYSA-N 0.000 description 2
- 235000014655 lactic acid Nutrition 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- UKWHYYKOEPRTIC-UHFFFAOYSA-N mercury(ii) oxide Chemical compound [Hg]=O UKWHYYKOEPRTIC-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- LXXFTBMQXDUFFB-UHFFFAOYSA-N methyl n-[(4-amino-3-nitrophenyl)-phenylmethyl]-n'-(2,2-dimethoxyethyl)carbamimidothioate Chemical compound C=1C=C(N)C([N+]([O-])=O)=CC=1C(NC(=NCC(OC)OC)SC)C1=CC=CC=C1 LXXFTBMQXDUFFB-UHFFFAOYSA-N 0.000 description 2
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 2
- 230000003228 microsomal effect Effects 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 150000004682 monohydrates Chemical class 0.000 description 2
- PZOVYRVKZAPJIW-UHFFFAOYSA-N n-(5-benzoyl-2-nitrophenyl)acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC(C(=O)C=2C=CC=CC=2)=C1 PZOVYRVKZAPJIW-UHFFFAOYSA-N 0.000 description 2
- MBZBIUHDRBPGKV-UHFFFAOYSA-N n-[4-(1-hydroxy-2-methylpropyl)phenyl]acetamide Chemical compound CC(C)C(O)C1=CC=C(NC(C)=O)C=C1 MBZBIUHDRBPGKV-UHFFFAOYSA-N 0.000 description 2
- 229910017604 nitric acid Inorganic materials 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 229940100688 oral solution Drugs 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 229940068196 placebo Drugs 0.000 description 2
- 239000000902 placebo Substances 0.000 description 2
- 229920000137 polyphosphoric acid Polymers 0.000 description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 2
- 239000004323 potassium nitrate Substances 0.000 description 2
- 235000010333 potassium nitrate Nutrition 0.000 description 2
- 239000012286 potassium permanganate Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- 239000008213 purified water Substances 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 238000010956 selective crystallization Methods 0.000 description 2
- 239000001632 sodium acetate Substances 0.000 description 2
- 235000017281 sodium acetate Nutrition 0.000 description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- ILJOYZVVZZFIKA-UHFFFAOYSA-M sodium;1,1-dioxo-1,2-benzothiazol-3-olate;hydrate Chemical compound O.[Na+].C1=CC=C2C(=O)[N-]S(=O)(=O)C2=C1 ILJOYZVVZZFIKA-UHFFFAOYSA-M 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000006228 supernatant Substances 0.000 description 2
- 239000000829 suppository Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 2
- WGTYBPLFGIVFAS-UHFFFAOYSA-M tetramethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)C WGTYBPLFGIVFAS-UHFFFAOYSA-M 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 239000008215 water for injection Substances 0.000 description 2
- LRZTXKVNCQWSKL-UHFFFAOYSA-N (1-methoxy-2-methylbenzimidazol-5-yl)-phenylmethanone Chemical compound C=1C=C2N(OC)C(C)=NC2=CC=1C(=O)C1=CC=CC=C1 LRZTXKVNCQWSKL-UHFFFAOYSA-N 0.000 description 1
- JPTSQVLPKJSJJJ-UHFFFAOYSA-N (1-phenylbenzimidazol-2-yl)methanol Chemical compound OCC1=NC2=CC=CC=C2N1C1=CC=CC=C1 JPTSQVLPKJSJJJ-UHFFFAOYSA-N 0.000 description 1
- IYFJEWGDTLJUIB-UHFFFAOYSA-N (1-propyl-2-pyridin-3-ylbenzimidazol-5-yl)methanol Chemical compound N=1C2=CC(CO)=CC=C2N(CCC)C=1C1=CC=CN=C1 IYFJEWGDTLJUIB-UHFFFAOYSA-N 0.000 description 1
- ASGMFNBUXDJWJJ-JLCFBVMHSA-N (1R,3R)-3-[[3-bromo-1-[4-(5-methyl-1,3,4-thiadiazol-2-yl)phenyl]pyrazolo[3,4-d]pyrimidin-6-yl]amino]-N,1-dimethylcyclopentane-1-carboxamide Chemical compound BrC1=NN(C2=NC(=NC=C21)N[C@H]1C[C@@](CC1)(C(=O)NC)C)C1=CC=C(C=C1)C=1SC(=NN=1)C ASGMFNBUXDJWJJ-JLCFBVMHSA-N 0.000 description 1
- XMAYWYJOQHXEEK-OZXSUGGESA-N (2R,4S)-ketoconazole Chemical compound C1CN(C(=O)C)CCN1C(C=C1)=CC=C1OC[C@@H]1O[C@@](CN2C=NC=C2)(C=2C(=CC(Cl)=CC=2)Cl)OC1 XMAYWYJOQHXEEK-OZXSUGGESA-N 0.000 description 1
- WWTBZEKOSBFBEM-SPWPXUSOSA-N (2s)-2-[[2-benzyl-3-[hydroxy-[(1r)-2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoyl]amino]-3-(1h-indol-3-yl)propanoic acid Chemical compound N([C@@H](CC=1C2=CC=CC=C2NC=1)C(=O)O)C(=O)C(CP(O)(=O)[C@H](CC=1C=CC=CC=1)NC(=O)OCC=1C=CC=CC=1)CC1=CC=CC=C1 WWTBZEKOSBFBEM-SPWPXUSOSA-N 0.000 description 1
- OENYVXQFYOZWRA-UHFFFAOYSA-N (3,4-diaminophenyl)-(3-fluorophenyl)methanone Chemical compound C1=C(N)C(N)=CC=C1C(=O)C1=CC=CC(F)=C1 OENYVXQFYOZWRA-UHFFFAOYSA-N 0.000 description 1
- LZBLUHYPHHBSDO-UHFFFAOYSA-N (3-amino-4-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC(C(=O)C=2C=CC=CC=2)=C1 LZBLUHYPHHBSDO-UHFFFAOYSA-N 0.000 description 1
- PALMHXHTMSPZGC-UHFFFAOYSA-N (3-fluorophenyl)-(2-methyl-3h-benzimidazol-5-yl)methanone Chemical compound C=1C=C2NC(C)=NC2=CC=1C(=O)C1=CC=CC(F)=C1 PALMHXHTMSPZGC-UHFFFAOYSA-N 0.000 description 1
- NGOOFAMQPUEDJM-UHFFFAOYSA-N (4-amino-3-nitrophenyl)-phenylmethanone Chemical compound C1=C([N+]([O-])=O)C(N)=CC=C1C(=O)C1=CC=CC=C1 NGOOFAMQPUEDJM-UHFFFAOYSA-N 0.000 description 1
- 125000004916 (C1-C6) alkylcarbonyl group Chemical group 0.000 description 1
- 125000006700 (C1-C6) alkylthio group Chemical group 0.000 description 1
- NDQXKKFRNOPRDW-UHFFFAOYSA-N 1,1,1-triethoxyethane Chemical compound CCOC(C)(OCC)OCC NDQXKKFRNOPRDW-UHFFFAOYSA-N 0.000 description 1
- SILNNFMWIMZVEQ-UHFFFAOYSA-N 1,3-dihydrobenzimidazol-2-one Chemical compound C1=CC=C2NC(O)=NC2=C1 SILNNFMWIMZVEQ-UHFFFAOYSA-N 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical class C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- YEVPHFIFGUWSMG-UHFFFAOYSA-N 1-(4-chloro-3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C([N+]([O-])=O)=C1 YEVPHFIFGUWSMG-UHFFFAOYSA-N 0.000 description 1
- VDWUPPPWTMHZNE-UHFFFAOYSA-N 1-(imidazol-1-ylmethyl)benzimidazole Chemical compound C1=NC2=CC=CC=C2N1CN1C=CN=C1 VDWUPPPWTMHZNE-UHFFFAOYSA-N 0.000 description 1
- UYQAGCGLXQZHHV-UHFFFAOYSA-N 1-[(4-amino-3-nitrophenyl)-phenylmethyl]-3-(2,2-dimethoxyethyl)thiourea Chemical compound C=1C=C(N)C([N+]([O-])=O)=CC=1C(NC(=S)NCC(OC)OC)C1=CC=CC=C1 UYQAGCGLXQZHHV-UHFFFAOYSA-N 0.000 description 1
- SZCBDIVMCGFVPW-UHFFFAOYSA-N 1-[4-(aminomethyl)-2,6-di(propan-2-yl)phenyl]-3-[1-butyl-4-(3-methoxyphenyl)-2-oxo-1,8-naphthyridin-3-yl]urea;hydrochloride Chemical compound Cl.CC(C)C=1C=C(CN)C=C(C(C)C)C=1NC(=O)NC=1C(=O)N(CCCC)C2=NC=CC=C2C=1C1=CC=CC(OC)=C1 SZCBDIVMCGFVPW-UHFFFAOYSA-N 0.000 description 1
- VHCQMZOYEMVPOI-UHFFFAOYSA-N 1-benzyl-6-(imidazol-1-ylmethyl)-2-(trifluoromethyl)benzimidazole Chemical compound C1=C2N(CC=3C=CC=CC=3)C(C(F)(F)F)=NC2=CC=C1CN1C=CN=C1 VHCQMZOYEMVPOI-UHFFFAOYSA-N 0.000 description 1
- BXSQQJGLPDXKAO-UHFFFAOYSA-N 1-hydroxy-5-(imidazol-1-ylmethyl)-2-methylbenzimidazole Chemical compound C=1C=C2N(O)C(C)=NC2=CC=1CN1C=CN=C1 BXSQQJGLPDXKAO-UHFFFAOYSA-N 0.000 description 1
- LMSMOHVHIAZHCI-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-methylbenzimidazole Chemical compound C1=C2N(O)C(C)=NC2=CC=C1CN1C=CN=C1 LMSMOHVHIAZHCI-UHFFFAOYSA-N 0.000 description 1
- BNTCXXPEKBQRLU-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-phenylbenzimidazole Chemical compound C1=C2N(O)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 BNTCXXPEKBQRLU-UHFFFAOYSA-N 0.000 description 1
- QCQBLHXYQBUHMM-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-phenylbenzimidazole;hydrate Chemical compound O.C1=C2N(O)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 QCQBLHXYQBUHMM-UHFFFAOYSA-N 0.000 description 1
- CNEHJQNNGORAMI-UHFFFAOYSA-N 1-hydroxy-6-(imidazol-1-ylmethyl)-2-pyridin-4-ylbenzimidazole Chemical compound C1=C2N(O)C(C=3C=CN=CC=3)=NC2=CC=C1CN1C=CN=C1 CNEHJQNNGORAMI-UHFFFAOYSA-N 0.000 description 1
- IRSPCJLMPFDMGD-UHFFFAOYSA-N 1-hydroxybenzimidazole Chemical compound C1=CC=C2N(O)C=NC2=C1 IRSPCJLMPFDMGD-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- QEBYEVQKHRUYPE-UHFFFAOYSA-N 2-(2-chlorophenyl)-5-[(1-methylpyrazol-3-yl)methyl]-4-[[methyl(pyridin-3-ylmethyl)amino]methyl]-1h-pyrazolo[4,3-c]pyridine-3,6-dione Chemical compound C1=CN(C)N=C1CN1C(=O)C=C2NN(C=3C(=CC=CC=3)Cl)C(=O)C2=C1CN(C)CC1=CC=CN=C1 QEBYEVQKHRUYPE-UHFFFAOYSA-N 0.000 description 1
- AZRNESPVUXLXAG-UHFFFAOYSA-N 2-(2-chlorophenyl)-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound ClC1=CC=CC=C1C1=NC2=CC(CN3C=NC=C3)=CC=C2N1 AZRNESPVUXLXAG-UHFFFAOYSA-N 0.000 description 1
- XGLVDUUYFKXKPL-UHFFFAOYSA-N 2-(2-methoxyethoxy)-n,n-bis[2-(2-methoxyethoxy)ethyl]ethanamine Chemical compound COCCOCCN(CCOCCOC)CCOCCOC XGLVDUUYFKXKPL-UHFFFAOYSA-N 0.000 description 1
- AWMBQNHHGQSPDX-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-hydroxy-6-(imidazol-1-ylmethyl)benzimidazole Chemical compound C1=C2N(O)C(C=3C=CC(F)=CC=3)=NC2=CC=C1CN1C=CN=C1 AWMBQNHHGQSPDX-UHFFFAOYSA-N 0.000 description 1
- JDQNDEKBHZMLJL-UHFFFAOYSA-N 2-(4-fluorophenyl)-1-hydroxy-6-[imidazol-1-yl(phenyl)methyl]benzimidazole Chemical compound C1=C2N(O)C(C=3C=CC(F)=CC=3)=NC2=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 JDQNDEKBHZMLJL-UHFFFAOYSA-N 0.000 description 1
- PBCKFMGGJZUPNB-UHFFFAOYSA-N 2-(4-fluorophenyl)-6-[imidazol-1-yl(phenyl)methyl]-1-prop-2-enoxybenzimidazole Chemical compound C1=CC(F)=CC=C1C1=NC2=CC=C(C(C=3C=CC=CC=3)N3C=NC=C3)C=C2N1OCC=C PBCKFMGGJZUPNB-UHFFFAOYSA-N 0.000 description 1
- GIUTUZDGHNZVIA-UHFFFAOYSA-N 2-(ethylamino)acetic acid;hydrochloride Chemical compound Cl.CCNCC(O)=O GIUTUZDGHNZVIA-UHFFFAOYSA-N 0.000 description 1
- XMROKVFPDHQMQL-UHFFFAOYSA-N 2-(n-ethyl-4-formyl-2-nitroanilino)acetic acid Chemical compound OC(=O)CN(CC)C1=CC=C(C=O)C=C1[N+]([O-])=O XMROKVFPDHQMQL-UHFFFAOYSA-N 0.000 description 1
- NAMYKGVDVNBCFQ-UHFFFAOYSA-N 2-bromopropane Chemical compound CC(C)Br NAMYKGVDVNBCFQ-UHFFFAOYSA-N 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- ABFPKTQEQNICFT-UHFFFAOYSA-M 2-chloro-1-methylpyridin-1-ium;iodide Chemical compound [I-].C[N+]1=CC=CC=C1Cl ABFPKTQEQNICFT-UHFFFAOYSA-M 0.000 description 1
- NKQWRIIGICSSSF-UHFFFAOYSA-N 2-chloro-5-(imidazol-1-ylmethyl)-1-methylbenzimidazole Chemical compound C=1C=C2N(C)C(Cl)=NC2=CC=1CN1C=CN=C1 NKQWRIIGICSSSF-UHFFFAOYSA-N 0.000 description 1
- PXICQWWMDWQBBW-UHFFFAOYSA-N 2-chloro-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound C=1C=C2NC(Cl)=NC2=CC=1CN1C=CN=C1 PXICQWWMDWQBBW-UHFFFAOYSA-N 0.000 description 1
- QKGKQENLEAIOFJ-UHFFFAOYSA-N 2-cyclopropyl-6-(imidazol-1-ylmethyl)-1h-benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=2)=CC=C1NC=2C1CC1 QKGKQENLEAIOFJ-UHFFFAOYSA-N 0.000 description 1
- FVTWJXMFYOXOKK-UHFFFAOYSA-N 2-fluoroacetamide Chemical compound NC(=O)CF FVTWJXMFYOXOKK-UHFFFAOYSA-N 0.000 description 1
- RRUXUSZQBIKFAP-UHFFFAOYSA-N 2-methyl-1h-benzimidazole-4-carbaldehyde Chemical compound C1=CC=C2NC(C)=NC2=C1C=O RRUXUSZQBIKFAP-UHFFFAOYSA-N 0.000 description 1
- ZUDLWFMKSANWLP-UHFFFAOYSA-N 2-methyl-6-[(2-methylsulfanylimidazol-1-yl)-phenylmethyl]-1h-benzimidazole Chemical compound CSC1=NC=CN1C(C=1C=C2NC(C)=NC2=CC=1)C1=CC=CC=C1 ZUDLWFMKSANWLP-UHFFFAOYSA-N 0.000 description 1
- MTGVUJNIADCQDL-UHFFFAOYSA-N 2-nitro-n-propyl-4-(propyliminomethyl)aniline Chemical compound CCCNC1=CC=C(C=NCCC)C=C1[N+]([O-])=O MTGVUJNIADCQDL-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical class NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- JLANDIPPCNKLAT-UHFFFAOYSA-N 2-phenyl-1-propylbenzimidazole-5-carbonyl chloride;hydrochloride Chemical compound Cl.N=1C2=CC(C(Cl)=O)=CC=C2N(CCC)C=1C1=CC=CC=C1 JLANDIPPCNKLAT-UHFFFAOYSA-N 0.000 description 1
- VHHXHCHCYABVNW-UHFFFAOYSA-N 2-phenyl-1-propylbenzimidazole-5-carboxylic acid Chemical compound N=1C2=CC(C(O)=O)=CC=C2N(CCC)C=1C1=CC=CC=C1 VHHXHCHCYABVNW-UHFFFAOYSA-N 0.000 description 1
- BOUOQESVDURNSB-UHFFFAOYSA-N 2-pyridin-3-yl-1h-benzimidazole Chemical compound N=1C2=CC=CC=C2NC=1C1=CC=CN=C1 BOUOQESVDURNSB-UHFFFAOYSA-N 0.000 description 1
- DFRAKBCRUYUFNT-UHFFFAOYSA-N 3,8-dicyclohexyl-2,4,7,9-tetrahydro-[1,3]oxazino[5,6-h][1,3]benzoxazine Chemical compound C1CCCCC1N1CC(C=CC2=C3OCN(C2)C2CCCCC2)=C3OC1 DFRAKBCRUYUFNT-UHFFFAOYSA-N 0.000 description 1
- UGNPXUVBAUUUED-UHFFFAOYSA-N 3-[6-(imidazol-1-ylmethyl)-1H-benzimidazol-2-yl]benzoic acid Chemical compound OC(=O)C1=CC=CC(C=2NC3=CC=C(CN4C=NC=C4)C=C3N=2)=C1 UGNPXUVBAUUUED-UHFFFAOYSA-N 0.000 description 1
- NCCPBFIZFBAPTB-UHFFFAOYSA-N 3-amino-4-(propylamino)benzoic acid Chemical compound CCCNC1=CC=C(C(O)=O)C=C1N NCCPBFIZFBAPTB-UHFFFAOYSA-N 0.000 description 1
- RBIGKSZIQCTIJF-UHFFFAOYSA-N 3-formylthiophene Chemical compound O=CC=1C=CSC=1 RBIGKSZIQCTIJF-UHFFFAOYSA-N 0.000 description 1
- LBHKAKGIIQYBMQ-UHFFFAOYSA-N 4-(chloromethyl)-1h-benzimidazole;hydrochloride Chemical compound Cl.ClCC1=CC=CC2=C1N=CN2 LBHKAKGIIQYBMQ-UHFFFAOYSA-N 0.000 description 1
- YVVFQFRDKWFCRW-UHFFFAOYSA-N 4-(chloromethyl)-2-phenyl-1h-benzimidazole Chemical compound N1C=2C(CCl)=CC=CC=2N=C1C1=CC=CC=C1 YVVFQFRDKWFCRW-UHFFFAOYSA-N 0.000 description 1
- YWMBHCUIBAKXIU-UHFFFAOYSA-N 4-(chloromethyl)-2-pyridin-3-yl-1h-benzimidazole;dihydrochloride Chemical compound Cl.Cl.N1C=2C(CCl)=CC=CC=2N=C1C1=CC=CN=C1 YWMBHCUIBAKXIU-UHFFFAOYSA-N 0.000 description 1
- RDDGMCYXVYQPKS-UHFFFAOYSA-N 4-(hydroxymethyl)benzimidazol-2-one Chemical compound OCC1=CC=CC2=NC(=O)N=C12 RDDGMCYXVYQPKS-UHFFFAOYSA-N 0.000 description 1
- YPAZVWHWWKAKRF-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)-1-n-methylbenzene-1,2-diamine Chemical compound C1=C(N)C(NC)=CC=C1CN1C=NC=C1 YPAZVWHWWKAKRF-UHFFFAOYSA-N 0.000 description 1
- HNPKZIDUJAFHKE-UHFFFAOYSA-N 4-(imidazol-1-ylmethyl)benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1CN1C=NC=C1 HNPKZIDUJAFHKE-UHFFFAOYSA-N 0.000 description 1
- SKLUWKYNZNXSLX-UHFFFAOYSA-N 4-Acetamidobenzaldehyde Chemical compound CC(=O)NC1=CC=C(C=O)C=C1 SKLUWKYNZNXSLX-UHFFFAOYSA-N 0.000 description 1
- MOVLIZBBSKYBLW-UHFFFAOYSA-N 4-[(2-methylsulfanylimidazol-1-yl)-phenylmethyl]-2-nitroaniline;hydrochloride Chemical compound Cl.CSC1=NC=CN1C(C=1C=C(C(N)=CC=1)[N+]([O-])=O)C1=CC=CC=C1 MOVLIZBBSKYBLW-UHFFFAOYSA-N 0.000 description 1
- CVPLVHYBWDYIDP-UHFFFAOYSA-N 4-[(2-methylsulfanylimidazol-1-yl)-phenylmethyl]benzene-1,2-diamine Chemical compound CSC1=NC=CN1C(C=1C=C(N)C(N)=CC=1)C1=CC=CC=C1 CVPLVHYBWDYIDP-UHFFFAOYSA-N 0.000 description 1
- GGUIKTLTNIMAHY-UHFFFAOYSA-N 4-[(3-chlorophenyl)-imidazol-1-ylmethyl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1C(N1C=NC=C1)C1=CC=CC(Cl)=C1 GGUIKTLTNIMAHY-UHFFFAOYSA-N 0.000 description 1
- RJTJMHFDXWPNLQ-UHFFFAOYSA-N 4-[imidazol-1-yl(phenyl)methyl]benzene-1,2-diamine Chemical compound C1=C(N)C(N)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 RJTJMHFDXWPNLQ-UHFFFAOYSA-N 0.000 description 1
- HETBKLHJEWXWBM-UHFFFAOYSA-N 4-chloro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=CC=C1Cl HETBKLHJEWXWBM-UHFFFAOYSA-N 0.000 description 1
- MBVFRSJFKMJRHA-UHFFFAOYSA-N 4-fluoro-1-benzofuran-7-carbaldehyde Chemical compound FC1=CC=C(C=O)C2=C1C=CO2 MBVFRSJFKMJRHA-UHFFFAOYSA-N 0.000 description 1
- ILKWFRCNNILIJW-UHFFFAOYSA-N 4-fluoro-3-nitrobenzaldehyde Chemical compound [O-][N+](=O)C1=CC(C=O)=CC=C1F ILKWFRCNNILIJW-UHFFFAOYSA-N 0.000 description 1
- BBYDXOIZLAWGSL-UHFFFAOYSA-N 4-fluorobenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1 BBYDXOIZLAWGSL-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- KDDQRKBRJSGMQE-UHFFFAOYSA-N 4-thiazolyl Chemical group [C]1=CSC=N1 KDDQRKBRJSGMQE-UHFFFAOYSA-N 0.000 description 1
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 1
- IQZSACWHKCETMI-UHFFFAOYSA-N 5-(chloromethyl)-1,3-dihydrobenzimidazol-2-one Chemical compound ClCC1=CC=C2NC(=O)NC2=C1 IQZSACWHKCETMI-UHFFFAOYSA-N 0.000 description 1
- DCWPVCJVHMVVEF-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1-(pyridin-3-ylmethyl)benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=C2)=CC=C1N2CC1=CC=CN=C1 DCWPVCJVHMVVEF-UHFFFAOYSA-N 0.000 description 1
- RDBMOJBMABTGAO-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-1-methoxy-2-phenylbenzimidazole Chemical compound C=1C=C2N(OC)C(C=3C=CC=CC=3)=NC2=CC=1CN1C=CN=C1 RDBMOJBMABTGAO-UHFFFAOYSA-N 0.000 description 1
- YJKWTLJBZCLCPD-UHFFFAOYSA-N 5-(imidazol-1-ylmethyl)-2-phenyl-1-phenylmethoxybenzimidazole Chemical compound C=1C=CC=CC=1CON(C1=CC=2)C(C=3C=CC=CC=3)=NC1=CC=2CN1C=CN=C1 YJKWTLJBZCLCPD-UHFFFAOYSA-N 0.000 description 1
- VKLKXFOZNHEBSW-UHFFFAOYSA-N 5-[[3-[(4-morpholin-4-ylbenzoyl)amino]phenyl]methoxy]pyridine-3-carboxamide Chemical compound O1CCN(CC1)C1=CC=C(C(=O)NC=2C=C(COC=3C=NC=C(C(=O)N)C=3)C=CC=2)C=C1 VKLKXFOZNHEBSW-UHFFFAOYSA-N 0.000 description 1
- OWSSTFMPRICQGU-UHFFFAOYSA-N 5-[imidazol-1-yl(phenyl)methyl]-1,3-dihydrobenzimidazol-2-one Chemical compound C1=C2NC(=O)NC2=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 OWSSTFMPRICQGU-UHFFFAOYSA-N 0.000 description 1
- WUZJFZYOJIQWRB-UHFFFAOYSA-N 6-(1-imidazol-1-ylethyl)-2-methyl-1h-benzimidazole Chemical compound C=1C=C2N=C(C)NC2=CC=1C(C)N1C=CN=C1 WUZJFZYOJIQWRB-UHFFFAOYSA-N 0.000 description 1
- MNUZNGIDYYDPHT-UHFFFAOYSA-N 6-(chloromethyl)-1-methoxybenzimidazole;hydrochloride Chemical compound Cl.C1=C(CCl)C=C2N(OC)C=NC2=C1 MNUZNGIDYYDPHT-UHFFFAOYSA-N 0.000 description 1
- RILXEDZEXIIPRF-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-1-methoxy-2-phenylbenzimidazole Chemical compound C1=C2N(OC)C(C=3C=CC=CC=3)=NC2=CC=C1CN1C=CN=C1 RILXEDZEXIIPRF-UHFFFAOYSA-N 0.000 description 1
- UWOVPQUTAOOROQ-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-1h-benzimidazole-2-carboxylic acid Chemical compound C=1C=C2NC(C(=O)O)=NC2=CC=1CN1C=CN=C1 UWOVPQUTAOOROQ-UHFFFAOYSA-N 0.000 description 1
- VKFARSUPMBXATL-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-phenyl-1-pyrimidin-2-yloxybenzimidazole Chemical compound C1=CN=CN1CC(C=C1N2OC=3N=CC=CN=3)=CC=C1N=C2C1=CC=CC=C1 VKFARSUPMBXATL-UHFFFAOYSA-N 0.000 description 1
- SXQSIYVRFINRSP-UHFFFAOYSA-N 6-(imidazol-1-ylmethyl)-2-pyridin-3-yl-1h-benzimidazole Chemical compound C1=CN=CN1CC(C=C1N=2)=CC=C1NC=2C1=CC=CN=C1 SXQSIYVRFINRSP-UHFFFAOYSA-N 0.000 description 1
- HTKOONXIRDTBSS-UHFFFAOYSA-N 6-[(3-chlorophenyl)-imidazol-1-ylmethyl]-2-methyl-1h-benzimidazole Chemical compound C=1C=C2NC(C)=NC2=CC=1C(N1C=NC=C1)C1=CC=CC(Cl)=C1 HTKOONXIRDTBSS-UHFFFAOYSA-N 0.000 description 1
- BBYJQIINTCEKDQ-UHFFFAOYSA-N 6-[(3-fluorophenyl)-imidazol-1-ylmethyl]-1h-benzimidazole Chemical compound FC1=CC=CC(C(C=2C=C3N=CNC3=CC=2)N2C=NC=C2)=C1 BBYJQIINTCEKDQ-UHFFFAOYSA-N 0.000 description 1
- LAOMGOBQDMBZDI-UHFFFAOYSA-N 6-[(3-fluorophenyl)-imidazol-1-ylmethyl]-2-methyl-1h-benzimidazole Chemical compound C=1C=C2NC(C)=NC2=CC=1C(N1C=NC=C1)C1=CC=CC(F)=C1 LAOMGOBQDMBZDI-UHFFFAOYSA-N 0.000 description 1
- YZPJKDULDNOZEW-UHFFFAOYSA-N 6-[di(imidazol-1-yl)methyl]-2-pyridin-3-yl-1h-benzimidazole Chemical compound C1=NC=CN1C(N1C=NC=C1)C1=CC=C(NC(=N2)C=3C=NC=CC=3)C2=C1 YZPJKDULDNOZEW-UHFFFAOYSA-N 0.000 description 1
- IXBGNPXVSIGYPW-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-1h-benzimidazole Chemical compound C1=NC=CN1C(C=1C=C2N=CNC2=CC=1)C1=CC=CC=C1 IXBGNPXVSIGYPW-UHFFFAOYSA-N 0.000 description 1
- GMKINOPFTBKHCG-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-methoxy-1h-benzimidazole Chemical compound C=1C=C2NC(OC)=NC2=CC=1C(N1C=NC=C1)C1=CC=CC=C1 GMKINOPFTBKHCG-UHFFFAOYSA-N 0.000 description 1
- SNHRVPPNQWGHIK-UHFFFAOYSA-N 6-[imidazol-1-yl(phenyl)methyl]-2-pyridin-2-yl-1h-benzimidazole Chemical compound C1=NC=CN1C(C=1C=C2N=C(NC2=CC=1)C=1N=CC=CC=1)C1=CC=CC=C1 SNHRVPPNQWGHIK-UHFFFAOYSA-N 0.000 description 1
- SVXMQDMLWWGBCU-UHFFFAOYSA-N 6-[imidazol-1-yl(pyridin-3-yl)methyl]-1h-benzimidazole Chemical compound C1=NC=CN1C(C=1C=C2N=CNC2=CC=1)C1=CC=CN=C1 SVXMQDMLWWGBCU-UHFFFAOYSA-N 0.000 description 1
- WMPKHQUMQUMYIJ-UHFFFAOYSA-N 6-[imidazol-1-yl(thiophen-2-yl)methyl]-1h-benzimidazole Chemical compound C1=CSC(C(C=2C=C3NC=NC3=CC=2)N2C=NC=C2)=C1 WMPKHQUMQUMYIJ-UHFFFAOYSA-N 0.000 description 1
- GDUANFXPOZTYKS-UHFFFAOYSA-N 6-bromo-8-[(2,6-difluoro-4-methoxybenzoyl)amino]-4-oxochromene-2-carboxylic acid Chemical compound FC1=CC(OC)=CC(F)=C1C(=O)NC1=CC(Br)=CC2=C1OC(C(O)=O)=CC2=O GDUANFXPOZTYKS-UHFFFAOYSA-N 0.000 description 1
- NJIAKNWTIVDSDA-FQEVSTJZSA-N 7-[4-(1-methylsulfonylpiperidin-4-yl)phenyl]-n-[[(2s)-morpholin-2-yl]methyl]pyrido[3,4-b]pyrazin-5-amine Chemical compound C1CN(S(=O)(=O)C)CCC1C1=CC=C(C=2N=C(NC[C@H]3OCCNC3)C3=NC=CN=C3C=2)C=C1 NJIAKNWTIVDSDA-FQEVSTJZSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- XASOHFCUIQARJT-UHFFFAOYSA-N 8-methoxy-6-[7-(2-morpholin-4-ylethoxy)imidazo[1,2-a]pyridin-3-yl]-2-(2,2,2-trifluoroethyl)-3,4-dihydroisoquinolin-1-one Chemical compound C(N1C(=O)C2=C(OC)C=C(C=3N4C(=NC=3)C=C(C=C4)OCCN3CCOCC3)C=C2CC1)C(F)(F)F XASOHFCUIQARJT-UHFFFAOYSA-N 0.000 description 1
- IRBAWVGZNJIROV-SFHVURJKSA-N 9-(2-cyclopropylethynyl)-2-[[(2s)-1,4-dioxan-2-yl]methoxy]-6,7-dihydropyrimido[6,1-a]isoquinolin-4-one Chemical compound C1=C2C3=CC=C(C#CC4CC4)C=C3CCN2C(=O)N=C1OC[C@@H]1COCCO1 IRBAWVGZNJIROV-SFHVURJKSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 241001480043 Arthrodermataceae Species 0.000 description 1
- IYHHRZBKXXKDDY-UHFFFAOYSA-N BI-605906 Chemical compound N=1C=2SC(C(N)=O)=C(N)C=2C(C(F)(F)CC)=CC=1N1CCC(S(C)(=O)=O)CC1 IYHHRZBKXXKDDY-UHFFFAOYSA-N 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- KCBAMQOKOLXLOX-BSZYMOERSA-N CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O Chemical compound CC1=C(SC=N1)C2=CC=C(C=C2)[C@H](C)NC(=O)[C@@H]3C[C@H](CN3C(=O)[C@H](C(C)(C)C)NC(=O)CCCCCCCCCCNCCCONC(=O)C4=C(C(=C(C=C4)F)F)NC5=C(C=C(C=C5)I)F)O KCBAMQOKOLXLOX-BSZYMOERSA-N 0.000 description 1
- UHNRLQRZRNKOKU-UHFFFAOYSA-N CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O Chemical compound CCN(CC1=NC2=C(N1)C1=CC=C(C=C1N=C2N)C1=NNC=C1)C(C)=O UHNRLQRZRNKOKU-UHFFFAOYSA-N 0.000 description 1
- SCJNYBYSTCRPAO-LXBQGUBHSA-N CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 Chemical compound CN(C)C\C=C\C(=O)NC1=CC=C(N=C1)C(=O)N[C@@]1(C)CCC[C@H](C1)NC1=NC(C2=CNC3=CC=CC=C23)=C(Cl)C=N1 SCJNYBYSTCRPAO-LXBQGUBHSA-N 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- 229940127007 Compound 39 Drugs 0.000 description 1
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 201000005569 Gout Diseases 0.000 description 1
- HTTJABKRGRZYRN-UHFFFAOYSA-N Heparin Chemical compound OC1C(NC(=O)C)C(O)OC(COS(O)(=O)=O)C1OC1C(OS(O)(=O)=O)C(O)C(OC2C(C(OS(O)(=O)=O)C(OC3C(C(O)C(O)C(O3)C(O)=O)OS(O)(=O)=O)C(CO)O2)NS(O)(=O)=O)C(C(O)=O)O1 HTTJABKRGRZYRN-UHFFFAOYSA-N 0.000 description 1
- 206010020112 Hirsutism Diseases 0.000 description 1
- 206010065042 Immune reconstitution inflammatory syndrome Diseases 0.000 description 1
- 102000009151 Luteinizing Hormone Human genes 0.000 description 1
- 108010073521 Luteinizing Hormone Proteins 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- AVYVHIKSFXVDBG-UHFFFAOYSA-N N-benzyl-N-hydroxy-2,2-dimethylbutanamide Chemical compound C(C1=CC=CC=C1)N(C(C(CC)(C)C)=O)O AVYVHIKSFXVDBG-UHFFFAOYSA-N 0.000 description 1
- POFVJRKJJBFPII-UHFFFAOYSA-N N-cyclopentyl-5-[2-[[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]amino]-5-fluoropyrimidin-4-yl]-4-methyl-1,3-thiazol-2-amine Chemical compound C1(CCCC1)NC=1SC(=C(N=1)C)C1=NC(=NC=C1F)NC1=NC=C(C=C1)CN1CCN(CC1)CC POFVJRKJJBFPII-UHFFFAOYSA-N 0.000 description 1
- OPFJDXRVMFKJJO-ZHHKINOHSA-N N-{[3-(2-benzamido-4-methyl-1,3-thiazol-5-yl)-pyrazol-5-yl]carbonyl}-G-dR-G-dD-dD-dD-NH2 Chemical compound S1C(C=2NN=C(C=2)C(=O)NCC(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(=O)N[C@H](CC(O)=O)C(N)=O)=C(C)N=C1NC(=O)C1=CC=CC=C1 OPFJDXRVMFKJJO-ZHHKINOHSA-N 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical group [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- ORNBQBCIOKFOEO-YQUGOWONSA-N Pregnenolone Natural products O=C(C)[C@@H]1[C@@]2(C)[C@H]([C@H]3[C@@H]([C@]4(C)C(=CC3)C[C@@H](O)CC4)CC2)CC1 ORNBQBCIOKFOEO-YQUGOWONSA-N 0.000 description 1
- 244000171263 Ribes grossularia Species 0.000 description 1
- 235000002357 Ribes grossularia Nutrition 0.000 description 1
- 240000007651 Rubus glaucus Species 0.000 description 1
- 235000011034 Rubus glaucus Nutrition 0.000 description 1
- 235000009122 Rubus idaeus Nutrition 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- 239000004280 Sodium formate Substances 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 244000299461 Theobroma cacao Species 0.000 description 1
- 235000009470 Theobroma cacao Nutrition 0.000 description 1
- 108010069102 Thromboxane-A synthase Proteins 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- DRBWRJPFNOBNIO-KOLCDFICSA-N [(2r)-1-[(2r)-2-(pyridine-4-carbonylamino)propanoyl]pyrrolidin-2-yl]boronic acid Chemical compound N([C@H](C)C(=O)N1[C@@H](CCC1)B(O)O)C(=O)C1=CC=NC=C1 DRBWRJPFNOBNIO-KOLCDFICSA-N 0.000 description 1
- CCFJJMXXVSSJST-UHFFFAOYSA-N [3-amino-4-(propylamino)phenyl]methanol Chemical compound CCCNC1=CC=C(CO)C=C1N CCFJJMXXVSSJST-UHFFFAOYSA-N 0.000 description 1
- HKWJAYPQZORGDX-UHFFFAOYSA-N [3-amino-4-(propylamino)phenyl]methyl acetate Chemical compound CCCNC1=CC=C(COC(C)=O)C=C1N HKWJAYPQZORGDX-UHFFFAOYSA-N 0.000 description 1
- GOGJFPPOXCJQQN-UHFFFAOYSA-N [6-(imidazol-1-ylmethyl)-1h-benzimidazol-2-yl]methanol Chemical compound C=1C=C2NC(CO)=NC2=CC=1CN1C=CN=C1 GOGJFPPOXCJQQN-UHFFFAOYSA-N 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- QBYJBZPUGVGKQQ-SJJAEHHWSA-N aldrin Chemical compound C1[C@H]2C=C[C@@H]1[C@H]1[C@@](C3(Cl)Cl)(Cl)C(Cl)=C(Cl)[C@@]3(Cl)[C@H]12 QBYJBZPUGVGKQQ-SJJAEHHWSA-N 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 229910000102 alkali metal hydride Inorganic materials 0.000 description 1
- 150000008046 alkali metal hydrides Chemical class 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000001548 androgenic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003429 antifungal agent Substances 0.000 description 1
- 229940121375 antifungal agent Drugs 0.000 description 1
- 229940054051 antipsychotic indole derivative Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 125000005129 aryl carbonyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000005110 aryl thio group Chemical group 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- XRWSZZJLZRKHHD-WVWIJVSJSA-N asunaprevir Chemical compound O=C([C@@H]1C[C@H](CN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)OC1=NC=C(C2=CC=C(Cl)C=C21)OC)N[C@]1(C(=O)NS(=O)(=O)C2CC2)C[C@H]1C=C XRWSZZJLZRKHHD-WVWIJVSJSA-N 0.000 description 1
- OTKPPUXRIADSGD-PPRNARJGSA-N avoparcina Chemical compound O([C@@H]1C2=CC=C(C(=C2)Cl)OC=2C=C3C=C(C=2O[C@H]2C([C@@H](O)[C@H](O)[C@@H](CO)O2)O[C@@H]2O[C@@H](C)[C@H](O)[C@H](N)C2)OC2=CC=C(C=C2)[C@@H](O)[C@H](C(N[C@H](C(=O)N[C@H]3C(=O)N[C@H]2C(=O)N[C@@H]1C(N[C@@H](C1=CC(O)=CC(O)=C1C=1C(O)=CC=C2C=1)C(O)=O)=O)C=1C=CC(O)=CC=1)=O)NC(=O)[C@H](NC)C=1C=CC(O[C@H]2[C@@H]([C@H](O)[C@@H](O)[C@H](C)O2)O)=CC=1)[C@H]1C[C@@H](N)[C@@H](O)[C@H](C)O1 OTKPPUXRIADSGD-PPRNARJGSA-N 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- PVEDXUXKUSBLFK-UHFFFAOYSA-N benzaldehyde;hydrochloride Chemical compound Cl.O=CC1=CC=CC=C1 PVEDXUXKUSBLFK-UHFFFAOYSA-N 0.000 description 1
- 150000008641 benzimidazolones Chemical group 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- FKPSBYZGRQJIMO-UHFFFAOYSA-M benzyl(triethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC1=CC=CC=C1 FKPSBYZGRQJIMO-UHFFFAOYSA-M 0.000 description 1
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000008033 biological extinction Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- MCQRPQCQMGVWIQ-UHFFFAOYSA-N boron;methylsulfanylmethane Chemical compound [B].CSC MCQRPQCQMGVWIQ-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 1
- XTEOJPUYZWEXFI-UHFFFAOYSA-N butyl n-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]sulfonylcarbamate Chemical compound S1C(CC(C)C)=CC(C=2C=CC(CN3C=NC=C3)=CC=2)=C1S(=O)(=O)NC(=O)OCCCC XTEOJPUYZWEXFI-UHFFFAOYSA-N 0.000 description 1
- 150000003940 butylamines Chemical class 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- 235000012255 calcium oxide Nutrition 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229940087373 calcium oxide Drugs 0.000 description 1
- 238000004364 calculation method Methods 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000496 cardiotonic agent Substances 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 239000006285 cell suspension Substances 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 229940126086 compound 21 Drugs 0.000 description 1
- 229940126208 compound 22 Drugs 0.000 description 1
- 229940125833 compound 23 Drugs 0.000 description 1
- 229940125961 compound 24 Drugs 0.000 description 1
- 229940127573 compound 38 Drugs 0.000 description 1
- 229940125898 compound 5 Drugs 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 238000005947 deacylation reaction Methods 0.000 description 1
- 239000012024 dehydrating agents Substances 0.000 description 1
- 230000037304 dermatophytes Effects 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 150000004985 diamines Chemical class 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-L dithionite(2-) Chemical compound [O-]S(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-L 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- DFBKLUNHFCTMDC-GKRDHZSOSA-N endrin Chemical compound C([C@@H]1[C@H]2[C@@]3(Cl)C(Cl)=C([C@]([C@H]22)(Cl)C3(Cl)Cl)Cl)[C@@H]2[C@H]2[C@@H]1O2 DFBKLUNHFCTMDC-GKRDHZSOSA-N 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- SBNFMGRCKKFSLR-UHFFFAOYSA-N ethyl 2,3-diaminobenzoate Chemical compound CCOC(=O)C1=CC=CC(N)=C1N SBNFMGRCKKFSLR-UHFFFAOYSA-N 0.000 description 1
- RETLCWPMLJPOTP-UHFFFAOYSA-N ethyl 2-chlorobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1Cl RETLCWPMLJPOTP-UHFFFAOYSA-N 0.000 description 1
- UBUUIAKWUGMYHA-UHFFFAOYSA-N ethyl 6-(hydroxymethyl)-1-methoxybenzimidazole-2-carboxylate Chemical compound C1=C(CO)C=C2N(OC)C(C(=O)OCC)=NC2=C1 UBUUIAKWUGMYHA-UHFFFAOYSA-N 0.000 description 1
- MODZVIMSNXSQIH-UHFFFAOYSA-N ethyl benzenecarboximidate;hydron;chloride Chemical compound Cl.CCOC(=N)C1=CC=CC=C1 MODZVIMSNXSQIH-UHFFFAOYSA-N 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- SGEMMELRMUVIHJ-UHFFFAOYSA-N ethyl cyclopropanecarboximidate;hydrochloride Chemical compound Cl.CCOC(=N)C1CC1 SGEMMELRMUVIHJ-UHFFFAOYSA-N 0.000 description 1
- KVFVBPYVNUCWJX-UHFFFAOYSA-M ethyl(trimethyl)azanium;hydroxide Chemical compound [OH-].CC[N+](C)(C)C KVFVBPYVNUCWJX-UHFFFAOYSA-M 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 239000007941 film coated tablet Substances 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- WTDFFADXONGQOM-UHFFFAOYSA-N formaldehyde;hydrochloride Chemical compound Cl.O=C WTDFFADXONGQOM-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 229960002449 glycine Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- 229920000669 heparin Polymers 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- 229940088597 hormone Drugs 0.000 description 1
- 239000005556 hormone Substances 0.000 description 1
- UUBJKHVFGWGJKX-UHFFFAOYSA-N hydrate tetrahydrochloride Chemical compound O.Cl.Cl.Cl.Cl UUBJKHVFGWGJKX-UHFFFAOYSA-N 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- CBOIHMRHGLHBPB-UHFFFAOYSA-N hydroxymethyl Chemical compound O[CH2] CBOIHMRHGLHBPB-UHFFFAOYSA-N 0.000 description 1
- 125000002962 imidazol-1-yl group Chemical group [*]N1C([H])=NC([H])=C1[H] 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229940102223 injectable solution Drugs 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002540 isothiocyanates Chemical class 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 229960004125 ketoconazole Drugs 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 238000012417 linear regression Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 229940040129 luteinizing hormone Drugs 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 229940101209 mercuric oxide Drugs 0.000 description 1
- 229910052987 metal hydride Inorganic materials 0.000 description 1
- 150000004681 metal hydrides Chemical class 0.000 description 1
- 229910000000 metal hydroxide Inorganic materials 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- LKUBWDNDGBVKFK-UHFFFAOYSA-N methyl 1h-benzimidazole-2-carboxylate Chemical compound C1=CC=C2NC(C(=O)OC)=NC2=C1 LKUBWDNDGBVKFK-UHFFFAOYSA-N 0.000 description 1
- JFUXCQSSEVTROW-UHFFFAOYSA-N methyl 2,2,2-trifluoroethanimidate Chemical compound COC(=N)C(F)(F)F JFUXCQSSEVTROW-UHFFFAOYSA-N 0.000 description 1
- IOUJFTUGTATUQL-UHFFFAOYSA-N methyl 2-phenyl-1-propylbenzimidazole-5-carboxylate Chemical compound N=1C2=CC(C(=O)OC)=CC=C2N(CCC)C=1C1=CC=CC=C1 IOUJFTUGTATUQL-UHFFFAOYSA-N 0.000 description 1
- WCMGZCGXOTVBAJ-UHFFFAOYSA-N methyl 6-(imidazol-1-ylmethyl)-1h-benzimidazole-2-carboxylate Chemical compound C=1C=C2NC(C(=O)OC)=NC2=CC=1CN1C=CN=C1 WCMGZCGXOTVBAJ-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- NEGQCMNHXHSFGU-UHFFFAOYSA-N methyl pyridine-2-carboximidate Chemical compound COC(=N)C1=CC=CC=N1 NEGQCMNHXHSFGU-UHFFFAOYSA-N 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 210000003470 mitochondria Anatomy 0.000 description 1
- 230000002438 mitochondrial effect Effects 0.000 description 1
- OFCCYDUUBNUJIB-UHFFFAOYSA-N n,n-diethylcarbamoyl chloride Chemical compound CCN(CC)C(Cl)=O OFCCYDUUBNUJIB-UHFFFAOYSA-N 0.000 description 1
- DUWWHGPELOTTOE-UHFFFAOYSA-N n-(5-chloro-2,4-dimethoxyphenyl)-3-oxobutanamide Chemical compound COC1=CC(OC)=C(NC(=O)CC(C)=O)C=C1Cl DUWWHGPELOTTOE-UHFFFAOYSA-N 0.000 description 1
- ALJKMDCIHIWFTG-UHFFFAOYSA-N n-[2-amino-4-(imidazol-1-ylmethyl)phenyl]acetamide Chemical compound C1=C(N)C(NC(=O)C)=CC=C1CN1C=NC=C1 ALJKMDCIHIWFTG-UHFFFAOYSA-N 0.000 description 1
- IHCHOVVAJBADAH-UHFFFAOYSA-N n-[2-hydroxy-4-(1h-pyrazol-4-yl)phenyl]-6-methoxy-3,4-dihydro-2h-chromene-3-carboxamide Chemical compound C1C2=CC(OC)=CC=C2OCC1C(=O)NC(C(=C1)O)=CC=C1C=1C=NNC=1 IHCHOVVAJBADAH-UHFFFAOYSA-N 0.000 description 1
- HJEZZZOXTCYUHG-UHFFFAOYSA-N n-[3-(imidazol-1-ylmethyl)-2-nitrophenyl]acetamide Chemical compound CC(=O)NC1=CC=CC(CN2C=NC=C2)=C1[N+]([O-])=O HJEZZZOXTCYUHG-UHFFFAOYSA-N 0.000 description 1
- NVHMZOCZCQQSLZ-UHFFFAOYSA-N n-[4-(imidazol-1-ylmethyl)-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1CN1C=NC=C1 NVHMZOCZCQQSLZ-UHFFFAOYSA-N 0.000 description 1
- CUDSDSWQGMNPOT-UHFFFAOYSA-N n-[4-[imidazol-1-yl(phenyl)methyl]-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC=C1C(N1C=NC=C1)C1=CC=CC=C1 CUDSDSWQGMNPOT-UHFFFAOYSA-N 0.000 description 1
- UCZHNRKQUHONDN-UHFFFAOYSA-N n-[5-(imidazol-1-ylmethyl)-2-nitrophenyl]acetamide Chemical compound C1=C([N+]([O-])=O)C(NC(=O)C)=CC(CN2C=NC=C2)=C1 UCZHNRKQUHONDN-UHFFFAOYSA-N 0.000 description 1
- YGBMCLDVRUGXOV-UHFFFAOYSA-N n-[6-[6-chloro-5-[(4-fluorophenyl)sulfonylamino]pyridin-3-yl]-1,3-benzothiazol-2-yl]acetamide Chemical compound C1=C2SC(NC(=O)C)=NC2=CC=C1C(C=1)=CN=C(Cl)C=1NS(=O)(=O)C1=CC=C(F)C=C1 YGBMCLDVRUGXOV-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000002674 ointment Substances 0.000 description 1
- PIDFDZJZLOTZTM-KHVQSSSXSA-N ombitasvir Chemical compound COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C([C@H]2N([C@@H](CC2)C=2C=CC(NC(=O)[C@H]3N(CCC3)C(=O)[C@@H](NC(=O)OC)C(C)C)=CC=2)C=2C=CC(=CC=2)C(C)(C)C)C=C1 PIDFDZJZLOTZTM-KHVQSSSXSA-N 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 229940098462 oral drops Drugs 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 239000003961 penetration enhancing agent Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- NHKJPPKXDNZFBJ-UHFFFAOYSA-N phenyllithium Chemical compound [Li]C1=CC=CC=C1 NHKJPPKXDNZFBJ-UHFFFAOYSA-N 0.000 description 1
- LEVJVKGPFAQPOI-UHFFFAOYSA-N phenylmethanone Chemical compound O=[C]C1=CC=CC=C1 LEVJVKGPFAQPOI-UHFFFAOYSA-N 0.000 description 1
- 239000008363 phosphate buffer Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- LGRFSURHDFAFJT-UHFFFAOYSA-N phthalic anhydride Chemical compound C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 239000008057 potassium phosphate buffer Substances 0.000 description 1
- ZLMJMSJWJFRBEC-OUBTZVSYSA-N potassium-40 Chemical group [40K] ZLMJMSJWJFRBEC-OUBTZVSYSA-N 0.000 description 1
- 229960000249 pregnenolone Drugs 0.000 description 1
- OZZAYJQNMKMUSD-DMISRAGPSA-N pregnenolone succinate Chemical compound C1C=C2C[C@@H](OC(=O)CCC(O)=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 OZZAYJQNMKMUSD-DMISRAGPSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 1
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- SBYHFKPVCBCYGV-UHFFFAOYSA-N quinuclidine Chemical compound C1CC2CCN1CC2 SBYHFKPVCBCYGV-UHFFFAOYSA-N 0.000 description 1
- 238000004366 reverse phase liquid chromatography Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- HLBBKKJFGFRGMU-UHFFFAOYSA-M sodium formate Chemical compound [Na+].[O-]C=O HLBBKKJFGFRGMU-UHFFFAOYSA-M 0.000 description 1
- 235000019254 sodium formate Nutrition 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 239000004544 spot-on Substances 0.000 description 1
- 239000008223 sterile water Substances 0.000 description 1
- 150000003431 steroids Chemical class 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- 150000008163 sugars Chemical class 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 150000003510 tertiary aliphatic amines Chemical class 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000002381 testicular Effects 0.000 description 1
- 229940073455 tetraethylammonium hydroxide Drugs 0.000 description 1
- LRGJRHZIDJQFCL-UHFFFAOYSA-M tetraethylazanium;hydroxide Chemical compound [OH-].CC[N+](CC)(CC)CC LRGJRHZIDJQFCL-UHFFFAOYSA-M 0.000 description 1
- AHJWSRRHTXRLAQ-UHFFFAOYSA-N tetramethoxymethane Chemical compound COC(OC)(OC)OC AHJWSRRHTXRLAQ-UHFFFAOYSA-N 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- HFRXJVQOXRXOPP-UHFFFAOYSA-N thionyl bromide Chemical compound BrS(Br)=O HFRXJVQOXRXOPP-UHFFFAOYSA-N 0.000 description 1
- ZWZVWGITAAIFPS-UHFFFAOYSA-N thiophosgene Chemical compound ClC(Cl)=S ZWZVWGITAAIFPS-UHFFFAOYSA-N 0.000 description 1
- DSNBHJFQCNUKMA-SCKDECHMSA-N thromboxane A2 Chemical compound OC(=O)CCC\C=C/C[C@@H]1[C@@H](/C=C/[C@@H](O)CCCCC)O[C@@H]2O[C@H]1C2 DSNBHJFQCNUKMA-SCKDECHMSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical class CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- 150000003626 triacylglycerols Chemical class 0.000 description 1
- GKASDNZWUGIAMG-UHFFFAOYSA-N triethyl orthoformate Chemical compound CCOC(OCC)OCC GKASDNZWUGIAMG-UHFFFAOYSA-N 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- 125000004953 trihalomethyl group Chemical group 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P17/00—Drugs for dermatological disorders
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P19/00—Drugs for skeletal disorders
- A61P19/06—Antigout agents, e.g. antihyperuricemic or uricosuric agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P35/00—Antineoplastic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P5/00—Drugs for disorders of the endocrine system
- A61P5/24—Drugs for disorders of the endocrine system of the sex hormones
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Veterinary Medicine (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Public Health (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Endocrinology (AREA)
- Diabetes (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Physical Education & Sports Medicine (AREA)
- Dermatology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US90790386A | 1986-09-15 | 1986-09-15 | |
| US907903 | 1986-09-15 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| AU7838587A AU7838587A (en) | 1988-04-14 |
| AU595064B2 true AU595064B2 (en) | 1990-03-22 |
Family
ID=25424835
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AU78385/87A Expired AU595064B2 (en) | 1986-09-15 | 1987-09-14 | Novel(1h-imidazol-1-ylmethyl) substituted benzimidazole derivatives |
Country Status (23)
| Country | Link |
|---|---|
| EP (1) | EP0260744B1 (enExample) |
| JP (1) | JPS6485975A (enExample) |
| KR (1) | KR960014353B1 (enExample) |
| CN (1) | CN1020903C (enExample) |
| AU (1) | AU595064B2 (enExample) |
| BG (1) | BG61321B2 (enExample) |
| CA (1) | CA1323366C (enExample) |
| CY (1) | CY1803A (enExample) |
| DE (1) | DE3783107T2 (enExample) |
| DK (1) | DK174728B1 (enExample) |
| ES (1) | ES2053524T3 (enExample) |
| FI (1) | FI87781C (enExample) |
| GR (1) | GR3006841T3 (enExample) |
| HK (1) | HK123694A (enExample) |
| HU (1) | HU198039B (enExample) |
| IE (1) | IE60514B1 (enExample) |
| IL (1) | IL83892A (enExample) |
| NO (1) | NO167202C (enExample) |
| NZ (1) | NZ221729A (enExample) |
| PH (1) | PH25022A (enExample) |
| PT (1) | PT85692B (enExample) |
| SU (1) | SU1662350A3 (enExample) |
| ZA (1) | ZA876881B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU605406B2 (en) * | 1988-02-12 | 1991-01-10 | Janssen Pharmaceutica N.V. | {5(6)(1H-azole-1-ylmethyl)benzimidazole}carbamates |
| AU623454B2 (en) * | 1988-11-29 | 1992-05-14 | Janssen Pharmaceutica N.V. | Method of treating epithelial disorders |
| AU638510B2 (en) * | 1989-11-17 | 1993-07-01 | Glaxo Group Limited | Indole derivatives |
Families Citing this family (55)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB8827820D0 (en) * | 1988-11-29 | 1988-12-29 | Janssen Pharmaceutica Nv | (1h-azol-1-ylmethyl)substituted quinoline derivatives |
| CA2002864C (en) * | 1988-11-29 | 1999-11-16 | Eddy J. E. Freyne | (1h-azol-1-ylmethyl) substituted quinoline, quinazoline or quinoxaline derivatives |
| FR2643903A1 (fr) * | 1989-03-03 | 1990-09-07 | Union Pharma Scient Appl | Nouveaux derives de benzimidazole, leurs procedes de preparation, intermediaires de synthese, compositions pharmaceutiques les contenant, utiles notamment pour le traitement des maladies cardiovasculaires, et des ulceres duodenaux |
| US5021448A (en) * | 1990-02-22 | 1991-06-04 | Ciba-Geigy Corporation | Method of reducing serum uric acid and/or increasing renal uric acid clearance with thromboxane synthetase inhibitor inhibitor and/or thromboxane receptor antagonist |
| FR2663028B1 (fr) * | 1990-06-08 | 1994-10-14 | Roussel Uclaf | Nouveaux derives de benzimidazole, leur procede de preparation, les nouveaux intermediaires obtenus, leur application a titre de medicaments et les compositions pharmaceutiques les renfermant. |
| US5216003A (en) * | 1992-01-02 | 1993-06-01 | G. D. Searle & Co. | Diacid-containing benzimidazole compounds for treatment of neurotoxic injury |
| WO1995004723A1 (en) * | 1993-08-04 | 1995-02-16 | Yamanouchi Pharmaceutical Co., Ltd. | Imidazolylalkylamine derivative and pharmaceutical composition thereof |
| EP0721943A4 (en) * | 1993-09-30 | 1996-09-04 | Yamanouchi Pharma Co Ltd | AZOLE DERIVATIVE AND PHARMACEUTICAL COMPOSITION CONTAINING THE SAME |
| SG52325A1 (en) * | 1994-02-18 | 1998-09-28 | Janssen Pharmaceutica Nv | Enantiomerically pure(+)-liarozole |
| AU688852B2 (en) * | 1994-02-18 | 1998-03-19 | Janssen Pharmaceutica N.V. | Enantiomerically pure(-)-liarozole |
| GB9418443D0 (en) * | 1994-09-13 | 1994-11-02 | Pfizer Ltd | Therapeutic agents |
| CZ176197A3 (cs) * | 1994-12-22 | 1998-09-16 | Ligand Pharmaceuticals Incorporated | Modulátory steroidových receptorů a způsoby jejich přípravy a použití |
| US6696459B1 (en) | 1994-12-22 | 2004-02-24 | Ligand Pharmaceuticals Inc. | Steroid receptor modulator compounds and methods |
| US5693647A (en) * | 1994-12-22 | 1997-12-02 | Ligand Pharmaceuticals Incorporated | Steroid receptor modulator compounds and methods |
| TW316902B (enExample) * | 1994-12-28 | 1997-10-01 | Janssen Pharmaceutica Nv | |
| PL322028A1 (en) * | 1995-03-01 | 1998-01-05 | Yamanouchi Pharma Co Ltd | Derivatives of imidazoles and pharmaceutic composition containing them |
| US6288100B1 (en) * | 1995-06-06 | 2001-09-11 | American Home Products Corporation | Benzimidazole derivatives |
| DE19535500A1 (de) * | 1995-09-25 | 1997-03-27 | Bayer Ag | Verfahren zur Herstellung von 3-Chlor-3'-nitro-4'-methoxybenzophenon |
| HUP9900625A3 (en) * | 1995-12-28 | 2003-04-28 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives, pharmaceutical compositions containing them and process for preparing the compounds |
| SK282769B6 (sk) * | 1996-06-27 | 2002-12-03 | Janssen Pharmaceutica N. V. | N-[4-(Heteroarylmetyl)fenyl]heteroarylamín, spôsob jeho výroby a použitia, kompozícia na jeho báze |
| FR2751649B1 (fr) * | 1996-07-26 | 1998-08-28 | Adir | Nouveaux derives de benzimidazole, de benzoxazole et de benzothiazole, leur procede de preparation et les compositions pharmaceutiques qui les contiennent |
| IT1286866B1 (it) * | 1996-10-28 | 1998-07-17 | Menarini Farma Ind | Composti furano-eterociclici,loro preparazione ed uso come inibitori di aromatasi |
| HUP0000312A3 (en) * | 1996-11-25 | 2001-12-28 | Procter And Gamble Co Cincinna | Guanidinyl heterocycle compounds useful as alpha-2 adrenoceptor agonists and pharmaceutical compositions containing them |
| WO1998037070A1 (en) * | 1997-02-21 | 1998-08-27 | Takeda Chemical Industries, Ltd. | Fused ring compounds, process for producing the same and use thereof |
| TW453999B (en) | 1997-06-27 | 2001-09-11 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| TR200001645T2 (tr) | 1997-12-11 | 2000-12-21 | Janssen Pharmaceutica N.V. | Retinoyik asit taklidi anilürler. |
| DE19831985A1 (de) | 1998-07-16 | 2000-01-20 | Bayer Ag | Substituierte Benzimidazole, ihre Herstellung und ihre Verwendung als Mittel gegen parasitäre Protozoen |
| US6833373B1 (en) | 1998-12-23 | 2004-12-21 | G.D. Searle & Co. | Method of using an integrin antagonist and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| US6858598B1 (en) | 1998-12-23 | 2005-02-22 | G. D. Searle & Co. | Method of using a matrix metalloproteinase inhibitor and one or more antineoplastic agents as a combination therapy in the treatment of neoplasia |
| AU5314900A (en) * | 1999-06-04 | 2000-12-28 | Elan Pharma International Limited | Compositions and methods for inhibiting cell death |
| NZ521028A (en) | 2000-03-16 | 2004-07-30 | F | Carboxylic acid derivatives as IP antagonists |
| JP3753971B2 (ja) | 2000-11-17 | 2006-03-08 | 武田薬品工業株式会社 | 新規イミダゾール誘導体、その製造法および用途 |
| DE60144246D1 (de) | 2000-11-20 | 2011-04-28 | Takeda Pharmaceutical | Imidazolderivate, verfahren zu deren herstellung und deren verwendung |
| AU2002221080A1 (en) | 2000-12-08 | 2002-06-18 | Masami Kusaka | Substituted thiazole derivatives bearing 3-pyridyl groups, process for preparingthe same and use thereof |
| US7405235B2 (en) | 2001-05-04 | 2008-07-29 | Paratek Pharmaceuticals, Inc. | Transcription factor modulating compounds and methods of use thereof |
| US6492517B1 (en) * | 2001-07-19 | 2002-12-10 | Air Products And Chemicals, Inc. | Method for preparing halomethyl heterocyclic compounds |
| US7253154B2 (en) * | 2001-11-16 | 2007-08-07 | Nippon Chemiphar Co., Ltd. | Substituted thiazolopyrimidines as xanthine oxidase inhibitors |
| JP2006513162A (ja) * | 2002-11-01 | 2006-04-20 | パラテック ファーマシューティカルズ インコーポレイテッド | 転写因子調節化合物およびその使用方法 |
| JP2007500245A (ja) * | 2003-06-10 | 2007-01-11 | スミスクライン ビーチャム コーポレーション | 化合物 |
| FR2860235A1 (fr) * | 2003-09-29 | 2005-04-01 | Yang Ji Chemical Company Ltd | Utilisation d'un compose de formule (i) inhibiteur de l'aromatase a des fins therapeutiques et composes de formule (i) en tant que tels |
| AU2005324492B2 (en) | 2004-04-23 | 2012-06-07 | Paratek Pharmaceuticals, Inc. | Transcription factor modulating compounds and methods of use thereof |
| JP4953456B2 (ja) * | 2004-09-30 | 2012-06-13 | ジヤンセン・フアーマシユーチカ・ナームローゼ・フエンノートシヤツプ | 選択的アンドロゲン受容体モジュレーター(sarm)として有用な新規なベンゾイミダゾール誘導体 |
| CA2582347C (en) * | 2004-09-30 | 2014-09-23 | Janssen Pharmaceutica N.V. | Novel benzimidazole derivatives useful as selective androgen receptor modulators (sarms) |
| PL1984343T3 (pl) * | 2006-01-24 | 2013-08-30 | Janssen Pharmaceutica Nv | 2-podstawione benzimidazole jako selektywne modulatory receptora androgenowego (SARM) |
| US7820821B2 (en) | 2006-02-10 | 2010-10-26 | Transtech Pharma, Inc. | Benzazole derivatives, compositions, and methods of use as aurora kinase inhibitors |
| KR101307497B1 (ko) * | 2006-04-19 | 2013-09-11 | 주식회사 동진쎄미켐 | 디이미다졸계 화합물 및 이를 이용한 유기발광소자 |
| CN100496308C (zh) * | 2006-06-02 | 2009-06-10 | 上海烟草(集团)公司 | 造纸法再造烟叶半逆流多级萃取工艺 |
| EP1992228A1 (en) * | 2007-05-14 | 2008-11-19 | Bayer CropScience AG | Insecticidal substituted thiourea derivatives |
| EP2162450B1 (en) * | 2007-05-23 | 2015-02-25 | Allergan, Inc. | ((bicylicheteroaryl) imidazolyl) methylheteroaryl compounds as adrenergic receptor agonists |
| DE102009038950A1 (de) | 2009-08-26 | 2011-03-03 | Bayer Animal Health Gmbh | Neue antiparasitäre Kombination von Wirkstoffen |
| US9394290B2 (en) * | 2010-10-21 | 2016-07-19 | Universitaet Des Saarlandes Campus Saarbruecken | Selective CYP11B1 inhibitors for the treatment of cortisol dependent diseases |
| EP2760854B1 (en) * | 2011-09-30 | 2017-08-30 | Asana BioSciences, LLC | Imidazole derivatives as cyp17 inhibitors for the treatment of cancer |
| US9199975B2 (en) | 2011-09-30 | 2015-12-01 | Asana Biosciences, Llc | Biaryl imidazole derivatives for regulating CYP17 |
| KR101884447B1 (ko) * | 2015-07-06 | 2018-08-01 | 삼성에스디아이 주식회사 | 모노머, 유기막 조성물, 유기막, 및 패턴형성방법 |
| US20240417486A1 (en) * | 2021-10-04 | 2024-12-19 | Bolt Biotherapeutics, Inc. | Asymmetric bis-benzimidazole sting agonist immunoconjugates and uses thereof |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GR75101B (enExample) * | 1980-10-23 | 1984-07-13 | Pfizer | |
| GB8307865D0 (en) * | 1983-03-22 | 1983-04-27 | Fujisawa Pharmaceutical Co | Benzimidazole derivatives |
| EP0178413A1 (en) * | 1984-08-17 | 1986-04-23 | Beecham Group Plc | Benzimidazoles |
-
1987
- 1987-09-08 NZ NZ221729A patent/NZ221729A/xx unknown
- 1987-09-09 CY CY180387A patent/CY1803A/xx unknown
- 1987-09-09 DE DE8787201702T patent/DE3783107T2/de not_active Expired - Lifetime
- 1987-09-09 ES ES87201702T patent/ES2053524T3/es not_active Expired - Lifetime
- 1987-09-09 EP EP87201702A patent/EP0260744B1/en not_active Expired - Lifetime
- 1987-09-14 AU AU78385/87A patent/AU595064B2/en not_active Expired
- 1987-09-14 SU SU874203300A patent/SU1662350A3/ru active
- 1987-09-14 IE IE248787A patent/IE60514B1/en not_active IP Right Cessation
- 1987-09-14 NO NO873840A patent/NO167202C/no unknown
- 1987-09-14 HU HU874071A patent/HU198039B/hu unknown
- 1987-09-14 ZA ZA876881A patent/ZA876881B/xx unknown
- 1987-09-14 IL IL83892A patent/IL83892A/xx not_active IP Right Cessation
- 1987-09-14 PH PH35811A patent/PH25022A/en unknown
- 1987-09-14 PT PT85692A patent/PT85692B/pt unknown
- 1987-09-14 CA CA000546763A patent/CA1323366C/en not_active Expired - Lifetime
- 1987-09-14 DK DK198704794A patent/DK174728B1/da not_active IP Right Cessation
- 1987-09-14 FI FI873977A patent/FI87781C/fi not_active IP Right Cessation
- 1987-09-14 JP JP62228679A patent/JPS6485975A/ja active Granted
- 1987-09-15 CN CN87106423A patent/CN1020903C/zh not_active Expired - Lifetime
- 1987-09-15 KR KR1019870010180A patent/KR960014353B1/ko not_active Expired - Lifetime
-
1993
- 1993-01-21 GR GR930400092T patent/GR3006841T3/el unknown
- 1993-07-15 BG BG097951A patent/BG61321B2/bg unknown
-
1994
- 1994-11-10 HK HK123694A patent/HK123694A/en not_active IP Right Cessation
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU605406B2 (en) * | 1988-02-12 | 1991-01-10 | Janssen Pharmaceutica N.V. | {5(6)(1H-azole-1-ylmethyl)benzimidazole}carbamates |
| AU623454B2 (en) * | 1988-11-29 | 1992-05-14 | Janssen Pharmaceutica N.V. | Method of treating epithelial disorders |
| AU638510B2 (en) * | 1989-11-17 | 1993-07-01 | Glaxo Group Limited | Indole derivatives |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU595064B2 (en) | Novel(1h-imidazol-1-ylmethyl) substituted benzimidazole derivatives | |
| US4859684A (en) | (1H-imidazol-1-ylmethyl) substituted benzimidazole derivatives and use thereof in treating androgen dependent disorders | |
| CA1307271C (en) | (1h-azo-1-ylmethyl)substituted benzotriazole derivatives | |
| US5591762A (en) | Benzimidazoles useful as angiotensin-11 antagonists | |
| AU615519B2 (en) | 5-lipoxygenase inhibiting 4-(4-phenyl-1-piperazinyl) phenols | |
| US5037829A (en) | (1H-azol-1-ylmethyl) substituted quinazoline derivatives | |
| NZ231441A (en) | Quinolin(one)yl, quinoxalin(one)yl and quinazolin(one)yl-methyl substituted diazole and triazole derivatives | |
| US5151421A (en) | (1h-azol-1-ylmethyl) substituted quinoxaline derivatives | |
| US5008268A (en) | 2-aminopyrimidinone derivatives | |
| US4943574A (en) | (1H-azol-1-ylmethyl) substituted benzotriazole derivatives and pharmaceutical compositions containing them | |
| US5441954A (en) | (1h-azol-1-ylmethyl) substituted quinoline derivatives | |
| US5039677A (en) | 6-(1H-azol-1-ylmethyl)-1-(pyrimidinyloxy)-1H benzotriazoles | |
| US5185346A (en) | (1H-azol-1-ylmethyl)substituted quinoline derivatives | |
| KR960015004B1 (ko) | (1h-이미다졸-1-일메틸)치환된 벤즈이미다졸 유도체의 제조방법 | |
| PH26050A (en) | (1H-azol-1=ylmethyl)substituted benzotriazole derivatives |