AT392205B - Arbeitsstuhl - Google Patents
Arbeitsstuhl Download PDFInfo
- Publication number
- AT392205B AT392205B AT2044/84A AT204484A AT392205B AT 392205 B AT392205 B AT 392205B AT 2044/84 A AT2044/84 A AT 2044/84A AT 204484 A AT204484 A AT 204484A AT 392205 B AT392205 B AT 392205B
- Authority
- AT
- Austria
- Prior art keywords
- chair
- backrest
- shell
- section
- seat
- Prior art date
Links
- 230000007246 mechanism Effects 0.000 claims description 20
- 210000001217 buttock Anatomy 0.000 claims description 11
- 210000000078 claw Anatomy 0.000 claims description 9
- 229920003023 plastic Polymers 0.000 claims description 5
- 239000004033 plastic Substances 0.000 claims description 5
- 230000001105 regulatory effect Effects 0.000 claims description 3
- 239000000725 suspension Substances 0.000 claims description 3
- 229910000831 Steel Inorganic materials 0.000 claims description 2
- 239000010959 steel Substances 0.000 claims description 2
- 238000005452 bending Methods 0.000 description 8
- 238000010276 construction Methods 0.000 description 5
- 210000003128 head Anatomy 0.000 description 4
- 210000002414 leg Anatomy 0.000 description 4
- 239000011324 bead Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229910000639 Spring steel Inorganic materials 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 230000036316 preload Effects 0.000 description 2
- 230000006978 adaptation Effects 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 229920002457 flexible plastic Polymers 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- NJPPVKZQTLUDBO-UHFFFAOYSA-N novaluron Chemical compound C1=C(Cl)C(OC(F)(F)C(OC(F)(F)F)F)=CC=C1NC(=O)NC(=O)C1=C(F)C=CC=C1F NJPPVKZQTLUDBO-UHFFFAOYSA-N 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 230000003014 reinforcing effect Effects 0.000 description 1
- 238000009751 slip forming Methods 0.000 description 1
- 230000003319 supportive effect Effects 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47C—CHAIRS; SOFAS; BEDS
- A47C1/00—Chairs adapted for special purposes
- A47C1/02—Reclining or easy chairs
- A47C1/031—Reclining or easy chairs having coupled concurrently adjustable supporting parts
- A47C1/032—Reclining or easy chairs having coupled concurrently adjustable supporting parts the parts being movably-coupled seat and back-rest
- A47C1/03261—Reclining or easy chairs having coupled concurrently adjustable supporting parts the parts being movably-coupled seat and back-rest characterised by elastic means
- A47C1/03277—Reclining or easy chairs having coupled concurrently adjustable supporting parts the parts being movably-coupled seat and back-rest characterised by elastic means with bar or leaf springs
-
- A—HUMAN NECESSITIES
- A47—FURNITURE; DOMESTIC ARTICLES OR APPLIANCES; COFFEE MILLS; SPICE MILLS; SUCTION CLEANERS IN GENERAL
- A47C—CHAIRS; SOFAS; BEDS
- A47C1/00—Chairs adapted for special purposes
- A47C1/02—Reclining or easy chairs
- A47C1/031—Reclining or easy chairs having coupled concurrently adjustable supporting parts
- A47C1/032—Reclining or easy chairs having coupled concurrently adjustable supporting parts the parts being movably-coupled seat and back-rest
- A47C1/03255—Reclining or easy chairs having coupled concurrently adjustable supporting parts the parts being movably-coupled seat and back-rest with a central column, e.g. rocking office chairs
Landscapes
- Health & Medical Sciences (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Chairs Characterized By Structure (AREA)
- Chairs For Special Purposes, Such As Reclining Chairs (AREA)
- Chair Legs, Seat Parts, And Backrests (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH3973/83A CH662257A5 (de) | 1983-07-20 | 1983-07-20 | Arbeitsstuhl. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA204484A ATA204484A (de) | 1990-08-15 |
| AT392205B true AT392205B (de) | 1991-02-25 |
Family
ID=4267419
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT2044/84A AT392205B (de) | 1983-07-20 | 1984-06-25 | Arbeitsstuhl |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4641885A (enExample) |
| JP (1) | JPS6045309A (enExample) |
| AT (1) | AT392205B (enExample) |
| BE (1) | BE900191A (enExample) |
| CA (1) | CA1235644A (enExample) |
| CH (1) | CH662257A5 (enExample) |
| DE (1) | DE3423857A1 (enExample) |
| DK (1) | DK163861C (enExample) |
| FR (1) | FR2549357B1 (enExample) |
| GB (1) | GB2143730B (enExample) |
| IT (1) | IT1174603B (enExample) |
| NL (1) | NL187889C (enExample) |
| SE (1) | SE448339B (enExample) |
| ZA (1) | ZA845083B (enExample) |
Families Citing this family (64)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| USD296161S (en) | 1984-04-09 | 1988-06-14 | Mario Bellini | Chair |
| USD293517S (en) | 1984-07-13 | 1988-01-05 | Mario Bellini | Chair |
| US5567012A (en) * | 1986-04-10 | 1996-10-22 | Steelcase, Inc. | Chair control |
| US4744603A (en) * | 1986-04-10 | 1988-05-17 | Steelcase Inc. | Chair shell with selective back stiffening |
| US4744600A (en) * | 1986-05-06 | 1988-05-17 | Itoki Co., Ltd. | Cushioning mechanism for use with seat of chair and interlocking cushioning mechanism for seat and backrest |
| DE3630503A1 (de) * | 1986-09-08 | 1988-03-10 | Girsberger Holding Ag | Stuhl |
| DE3700448A1 (de) * | 1987-01-09 | 1988-07-21 | Eckhard Hansen | Sitzmoebel |
| US4840426A (en) * | 1987-09-30 | 1989-06-20 | Davis Furniture Industries, Inc. | Office chair |
| JPH04500613A (ja) * | 1988-04-25 | 1992-02-06 | ペリー、チャールズ・オー | もたれ椅子 |
| US5338094A (en) * | 1988-04-25 | 1994-08-16 | Perry Charles O | Flexible reclining chair |
| US4979778A (en) * | 1989-01-17 | 1990-12-25 | Brayton International, Inc. | Synchrotilt chair |
| US5029940A (en) * | 1990-01-16 | 1991-07-09 | Westinghouse Electric Corporation | Chair tilt and chair height control apparatus |
| CA2080248C (en) * | 1990-04-10 | 1996-10-29 | Charles O. Perry | High density stacking flex chair |
| DE4209066C1 (enExample) * | 1992-03-20 | 1993-04-08 | Simon 4807 Borgholzhausen De Desanta | |
| USD346279S (en) | 1992-06-15 | 1994-04-26 | Herman Miller, Inc. | Chair |
| US5716099A (en) * | 1996-08-14 | 1998-02-10 | Novimex Fashion Ltd. | Chair with split reclining seat |
| USD386023S (en) * | 1996-09-13 | 1997-11-11 | Herman Miller, Inc. | Seat and back unit for a chair |
| US5890763A (en) * | 1996-12-11 | 1999-04-06 | Svein Asbj.o slashed.rnsen Produktdesign AS | Arrangement in a pivotable mounting, especially for a chair |
| US5975634A (en) * | 1997-10-24 | 1999-11-02 | Steelcase Development Inc. | Chair including novel back construction |
| USD420523S (en) * | 1998-06-05 | 2000-02-15 | Herman Miller, Inc. | Chair |
| US6224159B1 (en) | 1999-05-12 | 2001-05-01 | Charles Owen Perry | Flexible chair which can be disassembled to a flat configuration |
| AU783829B2 (en) | 2000-09-28 | 2005-12-08 | Formway Furniture Limited | A reclinable chair |
| AUPR054400A0 (en) | 2000-09-29 | 2000-10-26 | Formway Furniture Limited | A castor |
| MY134768A (en) * | 2002-01-17 | 2007-12-31 | Green Continental Furniture M Sdn Bhd | A dining chair with reclining mechanism |
| AU2003216239B2 (en) * | 2002-02-13 | 2007-08-16 | MillerKnoll, Inc | Tilt chair having a flexible back, adjustable armrests and asjustable seat depth, and methods for the use thereof |
| NZ518944A (en) * | 2002-05-14 | 2004-09-24 | Formway Furniture Ltd | Height adjustable arm for chair with outer stem releasably lockable to inner stem by engagement of recesses |
| ES2282833T3 (es) * | 2004-01-26 | 2007-10-16 | Pro-Cord S.P.A. | Silla con respaldo inclinable. |
| US20060202536A1 (en) * | 2005-03-09 | 2006-09-14 | Robert Luchetti Associates, Inc. | Chair with self-adjusting chair back |
| JP4719905B2 (ja) | 2005-10-27 | 2011-07-06 | コクヨ株式会社 | 椅子 |
| JP5002835B2 (ja) | 2005-10-27 | 2012-08-15 | コクヨ株式会社 | 部材の接続構造 |
| JP4747311B2 (ja) | 2005-11-11 | 2011-08-17 | コクヨ株式会社 | 椅子 |
| JP4945781B2 (ja) | 2005-11-11 | 2012-06-06 | コクヨ株式会社 | 椅子 |
| DE102006023981A1 (de) * | 2006-05-22 | 2007-12-06 | Wilkhahn Wilkening + Hahne Gmbh & Co. Kg | Stuhl |
| WO2008026264A1 (en) * | 2006-08-30 | 2008-03-06 | Itoki Corporation | Chair |
| US20100264709A1 (en) * | 2009-04-16 | 2010-10-21 | Steven Pearse | Back extension backrest |
| CN201602410U (zh) * | 2010-02-04 | 2010-10-13 | 周金坤 | 一种办公休闲两用椅 |
| USD657166S1 (en) | 2010-04-13 | 2012-04-10 | Herman Miller, Inc. | Chair |
| US8449037B2 (en) | 2010-04-13 | 2013-05-28 | Herman Miller, Inc. | Seating structure with a contoured flexible backrest |
| USD637423S1 (en) | 2010-04-13 | 2011-05-10 | Herman Miller, Inc. | Chair |
| USD639091S1 (en) | 2010-04-13 | 2011-06-07 | Herman Miller, Inc. | Backrest |
| USD650206S1 (en) | 2010-04-13 | 2011-12-13 | Herman Miller, Inc. | Chair |
| USD652657S1 (en) | 2010-04-13 | 2012-01-24 | Herman Miller, Inc. | Chair |
| USD653061S1 (en) | 2010-04-13 | 2012-01-31 | Herman Miller, Inc. | Chair |
| IT1403471B1 (it) * | 2010-12-03 | 2013-10-17 | Imarc Spa | Meccanismo per sedie da ufficio provvisto di dispositivo di regolazione della forza di oscillazione. |
| US20130001994A1 (en) * | 2011-06-30 | 2013-01-03 | Yao-Chuan Wu | Chair with a Resilient Back |
| DE102012107778B4 (de) * | 2012-08-23 | 2018-08-16 | Haworth Gmbh | Stuhl, insbesondere Bürostuhl |
| US9706845B2 (en) | 2012-09-20 | 2017-07-18 | Steelcase Inc. | Chair assembly |
| US11304528B2 (en) | 2012-09-20 | 2022-04-19 | Steelcase Inc. | Chair assembly with upholstery covering |
| USD697726S1 (en) | 2012-09-20 | 2014-01-21 | Steelcase Inc. | Chair |
| BR112017022038B1 (pt) | 2015-04-13 | 2021-11-03 | Steelcase Inc. | Disposição de assento |
| US11259637B2 (en) | 2015-04-13 | 2022-03-01 | Steelcase Inc. | Seating arrangement |
| US10194750B2 (en) | 2015-04-13 | 2019-02-05 | Steelcase Inc. | Seating arrangement |
| US10143308B2 (en) | 2015-07-23 | 2018-12-04 | Herman Miller, Inc. | Seating device |
| CN105054593A (zh) * | 2015-07-29 | 2015-11-18 | 邱东 | 一种高中学生用的凳子 |
| US9758063B1 (en) * | 2016-02-25 | 2017-09-12 | Lear Corporation | Vehicle seat assembly |
| EP3508095B1 (en) * | 2016-09-01 | 2021-02-24 | UE Furniture Co., Ltd | Chair structure and chair |
| EP3927215B1 (en) | 2019-02-21 | 2025-06-11 | Steelcase Inc. | Body support member |
| WO2020214702A1 (en) | 2019-04-16 | 2020-10-22 | Herman Miller, Inc. | Chair for active engagement of user |
| US11166553B2 (en) * | 2019-06-05 | 2021-11-09 | Davis Furniture Industries, Inc. | Tilting chair |
| US12089741B2 (en) * | 2019-06-17 | 2024-09-17 | Quali Co., Ltd. | Tiltable chair |
| JP7382178B2 (ja) * | 2019-08-30 | 2023-11-16 | 株式会社イトーキ | 椅子 |
| US11357329B2 (en) | 2019-12-13 | 2022-06-14 | Steelcase Inc. | Body support assembly and methods for the use and assembly thereof |
| US11617444B2 (en) | 2020-03-02 | 2023-04-04 | Steelcase Inc. | Body support assembly and methods for the use and assembly thereof |
| WO2022173799A1 (en) | 2021-02-10 | 2022-08-18 | Steelcase Inc. | Body support structure |
Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH558158A (de) * | 1973-05-18 | 1975-01-31 | Bolleter Emil | Stuhl mit rueckenlehne, insbesondere buerostuhl. |
| DE2624492B2 (de) * | 1975-06-13 | 1979-06-21 | Protoned B.V, Amsterdam | Einteilige Sitz-Lehnen-Einheit für einen Stuhl |
| DE2948585A1 (de) * | 1978-12-04 | 1980-06-26 | Center Design Res & Dev | Stuhl |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2824601A (en) * | 1956-05-15 | 1958-02-25 | Thaden Molding Corp | Reclining chair |
| US2956619A (en) * | 1958-10-03 | 1960-10-18 | Cramer Posture Chair Company I | Tilt back chair |
| US3198576A (en) * | 1962-09-21 | 1965-08-03 | Super Sagless Spring Corp | Reclining seating device |
| US3339973A (en) * | 1966-01-05 | 1967-09-05 | Doerner Products Co Ltd | Torsion spring chair control |
| FR1535826A (fr) * | 1967-07-31 | 1968-08-09 | Fauteuil à inclinaison variable | |
| US3542422A (en) * | 1968-06-10 | 1970-11-24 | Hyland C Flint | Unison action recliner |
| CA869338A (en) * | 1969-09-23 | 1971-04-27 | Doerner Products Co. Limited | Chair control with torsion spring with tilting seat and chair back |
| FR2088851A5 (enExample) * | 1970-04-27 | 1972-01-07 | Compin Ets | |
| CH524982A (de) * | 1970-05-20 | 1972-07-15 | Stella Werke Ag | Arbeitsstuhl |
| CA1059892A (en) * | 1975-06-13 | 1979-08-07 | Emilio Ambasz | Chair |
| DE2733322C3 (de) * | 1977-07-23 | 1980-08-07 | Protoned B.V., Amsterdam | Arbeitsstuhl |
| JPS624205Y2 (enExample) * | 1979-04-09 | 1987-01-30 | ||
| DE2925520A1 (de) * | 1979-06-25 | 1981-01-15 | Mauser Waldeck Gmbh | Drehsessel |
| CH645795A5 (en) * | 1979-07-23 | 1984-10-31 | Drabert Soehne | Chair, in particular visual display unit chair |
| US4345733A (en) * | 1980-04-28 | 1982-08-24 | Center For Design Research And Development N.V. | Mounting device for a chair seat |
| DE3036993A1 (de) * | 1980-10-01 | 1982-05-13 | Wilkhahn Wilkening + Hahne GmbH + Co, 3252 Bad Münder | Arbeits-sitzmoebel |
| US4479679A (en) * | 1981-06-08 | 1984-10-30 | Steelcase Inc. | Body weight chair control |
| ATE12168T1 (de) * | 1981-08-19 | 1985-04-15 | Giroflex Entwicklungs Ag | Stuhl. |
| DE8135614U1 (de) * | 1981-12-07 | 1983-11-10 | Gebr. Thonet GmbH, 6000 Frankfurt | Sitzmoebel |
-
1983
- 1983-07-20 CH CH3973/83A patent/CH662257A5/de not_active IP Right Cessation
-
1984
- 1984-06-25 AT AT2044/84A patent/AT392205B/de not_active IP Right Cessation
- 1984-06-27 US US06/624,979 patent/US4641885A/en not_active Expired - Fee Related
- 1984-06-28 DE DE19843423857 patent/DE3423857A1/de active Granted
- 1984-07-03 ZA ZA845083A patent/ZA845083B/xx unknown
- 1984-07-04 CA CA000458058A patent/CA1235644A/en not_active Expired
- 1984-07-10 IT IT21821/84A patent/IT1174603B/it active
- 1984-07-13 DK DK345384A patent/DK163861C/da not_active IP Right Cessation
- 1984-07-13 FR FR8411163A patent/FR2549357B1/fr not_active Expired
- 1984-07-17 NL NLAANVRAGE8402261,A patent/NL187889C/xx not_active IP Right Cessation
- 1984-07-19 JP JP59148715A patent/JPS6045309A/ja active Granted
- 1984-07-19 BE BE0/213356A patent/BE900191A/fr not_active IP Right Cessation
- 1984-07-19 SE SE8403796A patent/SE448339B/sv not_active IP Right Cessation
- 1984-07-20 GB GB08418508A patent/GB2143730B/en not_active Expired
Patent Citations (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH558158A (de) * | 1973-05-18 | 1975-01-31 | Bolleter Emil | Stuhl mit rueckenlehne, insbesondere buerostuhl. |
| DE2624492B2 (de) * | 1975-06-13 | 1979-06-21 | Protoned B.V, Amsterdam | Einteilige Sitz-Lehnen-Einheit für einen Stuhl |
| DE2948585A1 (de) * | 1978-12-04 | 1980-06-26 | Center Design Res & Dev | Stuhl |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1174603B (it) | 1987-07-01 |
| NL8402261A (nl) | 1985-02-18 |
| DK345384A (da) | 1985-01-21 |
| FR2549357B1 (fr) | 1988-09-16 |
| FR2549357A1 (fr) | 1985-01-25 |
| GB8418508D0 (en) | 1984-08-22 |
| SE8403796D0 (sv) | 1984-07-19 |
| DE3423857C2 (enExample) | 1989-08-03 |
| NL187889B (nl) | 1991-09-16 |
| CH662257A5 (de) | 1987-09-30 |
| GB2143730A (en) | 1985-02-20 |
| DK163861C (da) | 1992-09-14 |
| DE3423857A1 (de) | 1985-01-31 |
| SE448339B (sv) | 1987-02-16 |
| BE900191A (fr) | 1985-01-21 |
| GB2143730B (en) | 1987-01-07 |
| DK163861B (da) | 1992-04-13 |
| ZA845083B (en) | 1985-02-27 |
| NL187889C (nl) | 1992-02-17 |
| JPH0375165B2 (enExample) | 1991-11-29 |
| US4641885A (en) | 1987-02-10 |
| DK345384D0 (da) | 1984-07-13 |
| IT8421821A1 (it) | 1986-01-10 |
| SE8403796L (sv) | 1985-01-21 |
| IT8421821A0 (it) | 1984-07-10 |
| JPS6045309A (ja) | 1985-03-11 |
| CA1235644A (en) | 1988-04-26 |
| ATA204484A (de) | 1990-08-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT392205B (de) | Arbeitsstuhl | |
| EP1946676B1 (de) | Stuhl | |
| DE3632131C2 (de) | Funktions-Sitzmöbel | |
| DE69028500T2 (de) | Wippmechanik für einen Stuhl | |
| DE2820063C2 (de) | Stuhl | |
| EP0179357B1 (de) | Sitzmöbel | |
| DE3139448C2 (de) | Stuhl | |
| DE2600274C3 (de) | Stuhl mit verstellbarer Rückenlehne | |
| CH636252A5 (de) | Ergonomischer stuhl. | |
| DE2916897A1 (de) | Sitzmoebel | |
| EP0176816A1 (de) | Stuhl mit rückwärts neigbarem Sitz- und Rückenlehnenträger | |
| EP2040582A1 (de) | Rückenlehne für einen stuhl oder sessel und mit einer derartigen rückenlehne ausgerüsteter stuhl oder sessel | |
| EP0264029B1 (de) | Stuhl | |
| DE102007021782B3 (de) | Synchronmechanik für Bürostühle | |
| DE2539689C3 (de) | Sitzmöbel mit verstellbarer Rückenlehne | |
| EP1209994B1 (de) | Stuhl | |
| DE3116459A1 (de) | Stuhl | |
| EP0591933B1 (de) | Stuhl mit Rückenlehne | |
| DE4424096A1 (de) | Stuhl | |
| DE68918921T2 (de) | Verbesserungen an Stühlen. | |
| DE1169625B (de) | Rueckenlehne mit geformter Flaeche aus elastisch biegsamen Laengsteilen fuer Sitzmoebel od. dgl. | |
| DE2065536A1 (de) | Rueckenstuetze | |
| DE3743013A1 (de) | Sitz-rueckenlehnen-einheit fuer arbeitsstuhl | |
| AT411210B (de) | Stuhl | |
| DE3009073C2 (de) | Verstellbares Liegemöbel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ELJ | Ceased due to non-payment of the annual fee | ||
| RER | Ceased as to paragraph 5 lit. 3 law introducing patent treaties |