SE434945B - Karbostyrilderivat - Google Patents
KarbostyrilderivatInfo
- Publication number
- SE434945B SE434945B SE7902794A SE7902794A SE434945B SE 434945 B SE434945 B SE 434945B SE 7902794 A SE7902794 A SE 7902794A SE 7902794 A SE7902794 A SE 7902794A SE 434945 B SE434945 B SE 434945B
- Authority
- SE
- Sweden
- Prior art keywords
- carbon atoms
- crystals
- dihydrocarbostyril
- propoxy
- group
- Prior art date
Links
- LISFMEBWQUVKPJ-UHFFFAOYSA-N quinolin-2-ol Chemical class C1=CC=C2NC(=O)C=CC2=C1 LISFMEBWQUVKPJ-UHFFFAOYSA-N 0.000 title claims description 47
- -1 3,4,5-trimethoxybenzoyloxy Chemical group 0.000 claims description 144
- 125000004432 carbon atom Chemical group C* 0.000 claims description 66
- 239000003795 chemical substances by application Substances 0.000 claims description 37
- 125000000217 alkyl group Chemical group 0.000 claims description 31
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 19
- 239000000739 antihistaminic agent Substances 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 15
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 15
- 230000000694 effects Effects 0.000 claims description 15
- 229910052736 halogen Inorganic materials 0.000 claims description 15
- 150000002367 halogens Chemical class 0.000 claims description 15
- 239000001257 hydrogen Substances 0.000 claims description 15
- 229910052739 hydrogen Inorganic materials 0.000 claims description 15
- 230000001105 regulatory effect Effects 0.000 claims description 14
- 210000003169 central nervous system Anatomy 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 13
- 125000004423 acyloxy group Chemical group 0.000 claims description 11
- 230000001387 anti-histamine Effects 0.000 claims description 11
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 claims description 9
- 150000003839 salts Chemical class 0.000 claims description 9
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 125000003342 alkenyl group Chemical group 0.000 claims description 7
- 238000006467 substitution reaction Methods 0.000 claims description 7
- 125000003545 alkoxy group Chemical group 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 6
- 125000000304 alkynyl group Chemical group 0.000 claims description 6
- 229940125715 antihistaminic agent Drugs 0.000 claims description 6
- 125000003884 phenylalkyl group Chemical group 0.000 claims description 6
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 125000002252 acyl group Chemical group 0.000 claims description 4
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 claims description 3
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 2
- 125000005606 carbostyryl group Chemical group 0.000 claims 1
- 125000000547 substituted alkyl group Chemical group 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 301
- 239000013078 crystal Substances 0.000 description 270
- 150000001875 compounds Chemical class 0.000 description 217
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 162
- 238000006243 chemical reaction Methods 0.000 description 111
- 235000019441 ethanol Nutrition 0.000 description 108
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 105
- 125000002572 propoxy group Chemical group [*]OC([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 78
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 72
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 57
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 53
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 49
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 48
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 48
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 47
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 42
- 239000000243 solution Substances 0.000 description 42
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 40
- 239000011541 reaction mixture Substances 0.000 description 38
- 239000002904 solvent Substances 0.000 description 35
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 33
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 32
- 238000001953 recrystallisation Methods 0.000 description 31
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 30
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 30
- 238000001914 filtration Methods 0.000 description 27
- 238000004821 distillation Methods 0.000 description 26
- 239000000203 mixture Substances 0.000 description 25
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 24
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 24
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 24
- 238000000034 method Methods 0.000 description 24
- MDKXBBPLEGPIRI-UHFFFAOYSA-N ethoxyethane;methanol Chemical compound OC.CCOCC MDKXBBPLEGPIRI-UHFFFAOYSA-N 0.000 description 23
- 125000004193 piperazinyl group Chemical group 0.000 description 23
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 22
- NTYJJOPFIAHURM-UHFFFAOYSA-N Histamine Chemical compound NCCC1=CN=CN1 NTYJJOPFIAHURM-UHFFFAOYSA-N 0.000 description 22
- 241000699670 Mus sp. Species 0.000 description 20
- 238000010992 reflux Methods 0.000 description 20
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 17
- 150000007514 bases Chemical class 0.000 description 17
- 238000002844 melting Methods 0.000 description 17
- 230000008018 melting Effects 0.000 description 17
- UXTMROKLAAOEQO-UHFFFAOYSA-N chloroform;ethanol Chemical compound CCO.ClC(Cl)Cl UXTMROKLAAOEQO-UHFFFAOYSA-N 0.000 description 16
- 239000010410 layer Substances 0.000 description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 16
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 14
- 230000002140 halogenating effect Effects 0.000 description 14
- 235000011121 sodium hydroxide Nutrition 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- 239000012442 inert solvent Substances 0.000 description 12
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 12
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 12
- 235000017557 sodium bicarbonate Nutrition 0.000 description 12
- 238000003756 stirring Methods 0.000 description 12
- NAWXUBYGYWOOIX-SFHVURJKSA-N (2s)-2-[[4-[2-(2,4-diaminoquinazolin-6-yl)ethyl]benzoyl]amino]-4-methylidenepentanedioic acid Chemical compound C1=CC2=NC(N)=NC(N)=C2C=C1CCC1=CC=C(C(=O)N[C@@H](CC(=C)C(O)=O)C(O)=O)C=C1 NAWXUBYGYWOOIX-SFHVURJKSA-N 0.000 description 11
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 11
- 125000005843 halogen group Chemical group 0.000 description 11
- 229960001340 histamine Drugs 0.000 description 11
- 239000007858 starting material Substances 0.000 description 11
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 10
- 235000009518 sodium iodide Nutrition 0.000 description 10
- 239000008096 xylene Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 9
- 239000007864 aqueous solution Substances 0.000 description 9
- 230000037396 body weight Effects 0.000 description 9
- 238000001816 cooling Methods 0.000 description 9
- 229910000104 sodium hydride Inorganic materials 0.000 description 9
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 8
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 8
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 8
- 238000000354 decomposition reaction Methods 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- 229910000027 potassium carbonate Inorganic materials 0.000 description 8
- 235000011181 potassium carbonates Nutrition 0.000 description 8
- 235000011118 potassium hydroxide Nutrition 0.000 description 8
- 239000002244 precipitate Substances 0.000 description 8
- 238000002360 preparation method Methods 0.000 description 8
- 229910000029 sodium carbonate Inorganic materials 0.000 description 8
- 235000017550 sodium carbonate Nutrition 0.000 description 8
- 239000012312 sodium hydride Substances 0.000 description 8
- 125000004204 2-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C(OC([H])([H])[H])C([H])=C1[H] 0.000 description 7
- TZOYXRMEFDYWDQ-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)CCC2=C1 TZOYXRMEFDYWDQ-UHFFFAOYSA-N 0.000 description 7
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 7
- 241000699666 Mus <mouse, genus> Species 0.000 description 7
- 239000007924 injection Substances 0.000 description 7
- 238000002347 injection Methods 0.000 description 7
- YZTJYBJCZXZGCT-UHFFFAOYSA-N phenylpiperazine Chemical compound C1CNCCN1C1=CC=CC=C1 YZTJYBJCZXZGCT-UHFFFAOYSA-N 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 6
- 244000215068 Acacia senegal Species 0.000 description 6
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 6
- 229920000084 Gum arabic Polymers 0.000 description 6
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 6
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- 229920002472 Starch Polymers 0.000 description 6
- 235000010489 acacia gum Nutrition 0.000 description 6
- 239000000205 acacia gum Substances 0.000 description 6
- 239000008103 glucose Substances 0.000 description 6
- 235000001727 glucose Nutrition 0.000 description 6
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 6
- 239000008101 lactose Substances 0.000 description 6
- 239000012044 organic layer Substances 0.000 description 6
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 6
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 235000019698 starch Nutrition 0.000 description 6
- 239000008107 starch Substances 0.000 description 6
- 239000000725 suspension Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 5
- 239000000460 chlorine Substances 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- PSLIMVZEAPALCD-UHFFFAOYSA-N ethanol;ethoxyethane Chemical compound CCO.CCOCC PSLIMVZEAPALCD-UHFFFAOYSA-N 0.000 description 5
- 238000010438 heat treatment Methods 0.000 description 5
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 5
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 5
- 150000003512 tertiary amines Chemical class 0.000 description 5
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 4
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 4
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 4
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 description 4
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 4
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 150000001298 alcohols Chemical class 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 239000007884 disintegrant Substances 0.000 description 4
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 4
- 238000009472 formulation Methods 0.000 description 4
- 230000007062 hydrolysis Effects 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 229920001223 polyethylene glycol Polymers 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 210000000813 small intestine Anatomy 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 125000005424 tosyloxy group Chemical group S(=O)(=O)(C1=CC=C(C)C=C1)O* 0.000 description 4
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 description 3
- WNWHHMBRJJOGFJ-UHFFFAOYSA-N 16-methylheptadecan-1-ol Chemical class CC(C)CCCCCCCCCCCCCCCO WNWHHMBRJJOGFJ-UHFFFAOYSA-N 0.000 description 3
- 125000006201 3-phenylpropyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- JHWVAWUKMRXHCM-UHFFFAOYSA-N 5-(3-chloropropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCCl JHWVAWUKMRXHCM-UHFFFAOYSA-N 0.000 description 3
- NQCVIXJSFZMILF-UHFFFAOYSA-N 7-(3-chloropropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(OCCCCl)=CC=C21 NQCVIXJSFZMILF-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 206010002091 Anaesthesia Diseases 0.000 description 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 3
- 244000060011 Cocos nucifera Species 0.000 description 3
- 235000013162 Cocos nucifera Nutrition 0.000 description 3
- 108010010803 Gelatin Proteins 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 230000037005 anaesthesia Effects 0.000 description 3
- 125000003118 aryl group Chemical group 0.000 description 3
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 125000004106 butoxy group Chemical group [*]OC([H])([H])C([H])([H])C(C([H])([H])[H])([H])[H] 0.000 description 3
- 235000014121 butter Nutrition 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- WORJEOGGNQDSOE-UHFFFAOYSA-N chloroform;methanol Chemical compound OC.ClC(Cl)Cl WORJEOGGNQDSOE-UHFFFAOYSA-N 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 239000011248 coating agent Substances 0.000 description 3
- 238000000576 coating method Methods 0.000 description 3
- 238000004440 column chromatography Methods 0.000 description 3
- 239000003085 diluting agent Substances 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- ZYBWTEQKHIADDQ-UHFFFAOYSA-N ethanol;methanol Chemical compound OC.CCO ZYBWTEQKHIADDQ-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000008273 gelatin Substances 0.000 description 3
- 229920000159 gelatin Polymers 0.000 description 3
- 235000019322 gelatine Nutrition 0.000 description 3
- 235000011852 gelatine desserts Nutrition 0.000 description 3
- 229960003878 haloperidol Drugs 0.000 description 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 3
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 3
- 239000003326 hypnotic agent Substances 0.000 description 3
- 230000000147 hypnotic effect Effects 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 229910052760 oxygen Inorganic materials 0.000 description 3
- 239000003208 petroleum Substances 0.000 description 3
- 239000008194 pharmaceutical composition Substances 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000002504 physiological saline solution Substances 0.000 description 3
- 239000006187 pill Substances 0.000 description 3
- 239000011736 potassium bicarbonate Substances 0.000 description 3
- 235000015497 potassium bicarbonate Nutrition 0.000 description 3
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 3
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 3
- XTUSEBKMEQERQV-UHFFFAOYSA-N propan-2-ol;hydrate Chemical compound O.CC(C)O XTUSEBKMEQERQV-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000741 silica gel Substances 0.000 description 3
- 229910002027 silica gel Inorganic materials 0.000 description 3
- 239000000829 suppository Substances 0.000 description 3
- 208000024891 symptom Diseases 0.000 description 3
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 3
- XWUYPTBLYBFMST-UHFFFAOYSA-N (2-oxo-3,4-dihydro-1h-quinolin-5-yl) acetate Chemical compound N1C(=O)CCC2=C1C=CC=C2OC(=O)C XWUYPTBLYBFMST-UHFFFAOYSA-N 0.000 description 2
- 125000002861 (C1-C4) alkanoyl group Chemical group 0.000 description 2
- QSTMOHFZTDLSBZ-UHFFFAOYSA-N 1-(3,4,5-trimethoxyphenyl)piperazine Chemical compound COC1=C(OC)C(OC)=CC(N2CCNCC2)=C1 QSTMOHFZTDLSBZ-UHFFFAOYSA-N 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 2
- FUMPJRHQRZIMBV-UHFFFAOYSA-N 2-[4-[3-[(2-oxo-3,4-dihydro-1h-quinolin-5-yl)oxy]propyl]piperazin-1-yl]ethyl acetate Chemical compound C1CN(CCOC(=O)C)CCN1CCCOC1=CC=CC2=C1CCC(=O)N2 FUMPJRHQRZIMBV-UHFFFAOYSA-N 0.000 description 2
- 125000004198 2-fluorophenyl group Chemical group [H]C1=C([H])C(F)=C(*)C([H])=C1[H] 0.000 description 2
- 125000005809 3,4,5-trimethoxyphenyl group Chemical group [H]C1=C(OC([H])([H])[H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 2
- CHAFTLQYFPHLHF-UHFFFAOYSA-N 3,4-dihydro-1h-quinolin-2-one;ethanol Chemical compound CCO.C1=CC=C2NC(=O)CCC2=C1 CHAFTLQYFPHLHF-UHFFFAOYSA-N 0.000 description 2
- HDHQZCHIXUUSMK-UHFFFAOYSA-N 4-hydroxy-2-quinolone Chemical compound C1=CC=C2C(O)=CC(=O)NC2=C1 HDHQZCHIXUUSMK-UHFFFAOYSA-N 0.000 description 2
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- CLUIFTRWDGBDDJ-UHFFFAOYSA-N 5,6-dichloro-8-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C(Cl)=C(Cl)C=C2OC CLUIFTRWDGBDDJ-UHFFFAOYSA-N 0.000 description 2
- ZUVVOROWFCTPEL-UHFFFAOYSA-N 5-(3-piperazin-1-ylpropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCN1CCNCC1 ZUVVOROWFCTPEL-UHFFFAOYSA-N 0.000 description 2
- HKTZKESTBBPIET-UHFFFAOYSA-N 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=CC=2NC(=O)CCC=2C=1OCC(O)CN(CC1)CCN1C1=CC=CC=C1 HKTZKESTBBPIET-UHFFFAOYSA-N 0.000 description 2
- GTADJKVNUKGLND-UHFFFAOYSA-N 5-[3-(4-phenyl-1,4-diazepan-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCN(CC1)CCCN1C1=CC=CC=C1 GTADJKVNUKGLND-UHFFFAOYSA-N 0.000 description 2
- LTORGEQZMPTSFL-UHFFFAOYSA-N 5-[3-[4-(2-hydroxyethyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(CCO)CCN1CCCOC1=CC=CC2=C1CCC(=O)N2 LTORGEQZMPTSFL-UHFFFAOYSA-N 0.000 description 2
- UTTJAIFHRUAFED-UHFFFAOYSA-N 5-hydroxy-3,4-dihydro-2(1h)-quinolinone Chemical compound N1C(=O)CCC2=C1C=CC=C2O UTTJAIFHRUAFED-UHFFFAOYSA-N 0.000 description 2
- WIFRWNDBJXMOBF-UHFFFAOYSA-N 6-chloro-7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=C(O)C(Cl)=C2 WIFRWNDBJXMOBF-UHFFFAOYSA-N 0.000 description 2
- KGIYNTJWXKLQPM-UHFFFAOYSA-N 7-[3-[4-(2,5-dichlorophenyl)piperazin-1-yl]propoxy]-1H-quinolin-2-one Chemical compound ClC1=C(C=C(C=C1)Cl)N1CCN(CC1)CCCOC1=CC=C2C=CC(NC2=C1)=O KGIYNTJWXKLQPM-UHFFFAOYSA-N 0.000 description 2
- CUIKMKFHNHPLPY-UHFFFAOYSA-N 8-bromo-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2O CUIKMKFHNHPLPY-UHFFFAOYSA-N 0.000 description 2
- JBLUTMBJJMMYRZ-UHFFFAOYSA-N 8-chloro-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Cl)=CC=C2O JBLUTMBJJMMYRZ-UHFFFAOYSA-N 0.000 description 2
- XLMZJLNORGIFRZ-UHFFFAOYSA-N 8-chloro-5-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Cl)=CC=C2OC XLMZJLNORGIFRZ-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 208000035285 Allergic Seasonal Rhinitis Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 241000700199 Cavia porcellus Species 0.000 description 2
- 206010010774 Constipation Diseases 0.000 description 2
- 206010010904 Convulsion Diseases 0.000 description 2
- 229920002261 Corn starch Polymers 0.000 description 2
- BRLQWZUYTZBJKN-UHFFFAOYSA-N Epichlorohydrin Chemical compound ClCC1CO1 BRLQWZUYTZBJKN-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 241000206672 Gelidium Species 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- MFESCIUQSIBMSM-UHFFFAOYSA-N I-BCP Chemical compound ClCCCBr MFESCIUQSIBMSM-UHFFFAOYSA-N 0.000 description 2
- 241001466453 Laminaria Species 0.000 description 2
- 235000019759 Maize starch Nutrition 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 239000002202 Polyethylene glycol Substances 0.000 description 2
- 208000003251 Pruritus Diseases 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 208000024780 Urticaria Diseases 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 235000010419 agar Nutrition 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910001516 alkali metal iodide Inorganic materials 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- 230000000202 analgesic effect Effects 0.000 description 2
- 229940035676 analgesics Drugs 0.000 description 2
- 229940035674 anesthetics Drugs 0.000 description 2
- 239000000730 antalgic agent Substances 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- SLUNEGLMXGHOLY-UHFFFAOYSA-N benzene;hexane Chemical compound CCCCCC.C1=CC=CC=C1 SLUNEGLMXGHOLY-UHFFFAOYSA-N 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 229910000019 calcium carbonate Inorganic materials 0.000 description 2
- 235000010216 calcium carbonate Nutrition 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 230000036461 convulsion Effects 0.000 description 2
- 238000006264 debenzylation reaction Methods 0.000 description 2
- 229960003529 diazepam Drugs 0.000 description 2
- AAOVKJBEBIDNHE-UHFFFAOYSA-N diazepam Chemical compound N=1CC(=O)N(C)C2=CC=C(Cl)C=C2C=1C1=CC=CC=C1 AAOVKJBEBIDNHE-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- BCURJLKUQHLLSZ-UHFFFAOYSA-N ethanol;1h-quinolin-2-one Chemical compound CCO.C1=CC=C2NC(=O)C=CC2=C1 BCURJLKUQHLLSZ-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000000499 gel Substances 0.000 description 2
- 239000003193 general anesthetic agent Substances 0.000 description 2
- 229940052308 general anesthetics halogenated hydrocarbons Drugs 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000008282 halocarbons Chemical class 0.000 description 2
- 238000005658 halogenation reaction Methods 0.000 description 2
- BCQZXOMGPXTTIC-UHFFFAOYSA-N halothane Chemical compound FC(F)(F)C(Cl)Br BCQZXOMGPXTTIC-UHFFFAOYSA-N 0.000 description 2
- UYXAWHWODHRRMR-UHFFFAOYSA-N hexobarbital Chemical compound O=C1N(C)C(=O)NC(=O)C1(C)C1=CCCCC1 UYXAWHWODHRRMR-UHFFFAOYSA-N 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 230000001965 increasing effect Effects 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 239000002198 insoluble material Substances 0.000 description 2
- 230000000968 intestinal effect Effects 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- WLGQPCPMMWTKDR-UHFFFAOYSA-N methanol;1h-quinolin-2-one Chemical compound OC.C1=CC=C2NC(=O)C=CC2=C1 WLGQPCPMMWTKDR-UHFFFAOYSA-N 0.000 description 2
- 239000003158 myorelaxant agent Substances 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000006408 oxalic acid Nutrition 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- 239000002798 polar solvent Substances 0.000 description 2
- 239000003755 preservative agent Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 230000001603 reducing effect Effects 0.000 description 2
- 230000011514 reflex Effects 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000000932 sedative agent Substances 0.000 description 2
- 229940125723 sedative agent Drugs 0.000 description 2
- 238000010898 silica gel chromatography Methods 0.000 description 2
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 239000003826 tablet Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 210000001519 tissue Anatomy 0.000 description 2
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- JNYAEWCLZODPBN-JGWLITMVSA-N (2r,3r,4s)-2-[(1r)-1,2-dihydroxyethyl]oxolane-3,4-diol Chemical class OC[C@@H](O)[C@H]1OC[C@H](O)[C@H]1O JNYAEWCLZODPBN-JGWLITMVSA-N 0.000 description 1
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 description 1
- MGGPPWUZJGYEMN-UHFFFAOYSA-N (8-bromo-2-oxo-3,4-dihydro-1h-quinolin-5-yl) acetate Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2OC(=O)C MGGPPWUZJGYEMN-UHFFFAOYSA-N 0.000 description 1
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 description 1
- OGFAWKRXZLGJSK-UHFFFAOYSA-N 1-(2,4-dihydroxyphenyl)-2-(4-nitrophenyl)ethanone Chemical compound OC1=CC(O)=CC=C1C(=O)CC1=CC=C([N+]([O-])=O)C=C1 OGFAWKRXZLGJSK-UHFFFAOYSA-N 0.000 description 1
- NWMYZJOAUNJTAN-UHFFFAOYSA-N 1-(3,4,5-trimethoxyphenyl)piperazine;hydrobromide Chemical compound Br.COC1=C(OC)C(OC)=CC(N2CCNCC2)=C1 NWMYZJOAUNJTAN-UHFFFAOYSA-N 0.000 description 1
- KIFCSMQTGWVMOD-UHFFFAOYSA-N 1-(3-fluorophenyl)piperazine Chemical compound FC1=CC=CC(N2CCNCC2)=C1 KIFCSMQTGWVMOD-UHFFFAOYSA-N 0.000 description 1
- VLRRPMQPJDBERH-UHFFFAOYSA-N 1-(3-methylbutyl)-5-(oxiran-2-ylmethoxy)-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(CCC(C)C)C(=O)CCC2=C1OCC1CO1 VLRRPMQPJDBERH-UHFFFAOYSA-N 0.000 description 1
- YOOLKLKIUUTLFC-UHFFFAOYSA-N 1-(4-chlorophenyl)-2-methylpiperazine Chemical compound CC1CNCCN1C1=CC=C(Cl)C=C1 YOOLKLKIUUTLFC-UHFFFAOYSA-N 0.000 description 1
- ONEYFZXGNFNRJH-UHFFFAOYSA-N 1-(4-methylphenyl)piperazine Chemical compound C1=CC(C)=CC=C1N1CCNCC1 ONEYFZXGNFNRJH-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- BLIQUJLAJXRXSG-UHFFFAOYSA-N 1-benzyl-3-(trifluoromethyl)pyrrolidin-1-ium-3-carboxylate Chemical compound C1C(C(=O)O)(C(F)(F)F)CCN1CC1=CC=CC=C1 BLIQUJLAJXRXSG-UHFFFAOYSA-N 0.000 description 1
- KQZMDCXAQGAVDB-UHFFFAOYSA-N 1-benzyl-5-[3-(4-benzylpiperazin-1-yl)propoxy]-3,4-dihydroquinolin-2-one Chemical compound C(C1=CC=CC=C1)N1C(=O)CCC2=C(C=CC=C12)OCCCN1CCN(CC1)CC1=CC=CC=C1 KQZMDCXAQGAVDB-UHFFFAOYSA-N 0.000 description 1
- ADTACPFYJCJJLE-UHFFFAOYSA-N 1-benzyl-5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(CC=3C=CC=CC=3)C(=O)CCC2=C1OCCCN(CC1)CCN1C1=CC=CC=C1 ADTACPFYJCJJLE-UHFFFAOYSA-N 0.000 description 1
- IQXXEPZFOOTTBA-UHFFFAOYSA-N 1-benzylpiperazine Chemical compound C=1C=CC=CC=1CN1CCNCC1 IQXXEPZFOOTTBA-UHFFFAOYSA-N 0.000 description 1
- IXPNQXFRVYWDDI-UHFFFAOYSA-N 1-methyl-2,4-dioxo-1,3-diazinane-5-carboximidamide Chemical compound CN1CC(C(N)=N)C(=O)NC1=O IXPNQXFRVYWDDI-UHFFFAOYSA-N 0.000 description 1
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 1
- FAJGKPMGLMWSKW-UHFFFAOYSA-N 1-phenyl-1,4-diazepane Chemical compound C1CCNCCN1C1=CC=CC=C1 FAJGKPMGLMWSKW-UHFFFAOYSA-N 0.000 description 1
- HTRHNJKNDSYOKP-UHFFFAOYSA-N 1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.C1=CC=C2NC(=O)C=CC2=C1 HTRHNJKNDSYOKP-UHFFFAOYSA-N 0.000 description 1
- ONGYDIMWAUSQQR-UHFFFAOYSA-N 1h-quinolin-2-one;hydrate;dihydrochloride Chemical compound O.Cl.Cl.C1=CC=C2NC(=O)C=CC2=C1 ONGYDIMWAUSQQR-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- ZFFBIQMNKOJDJE-UHFFFAOYSA-N 2-bromo-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(Br)C(=O)C1=CC=CC=C1 ZFFBIQMNKOJDJE-UHFFFAOYSA-N 0.000 description 1
- RRTLQRYOJOSPEA-UHFFFAOYSA-N 2-bromo-1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=C(Br)C(C)=C1 RRTLQRYOJOSPEA-UHFFFAOYSA-N 0.000 description 1
- 125000006276 2-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C(*)C([H])=C1[H] 0.000 description 1
- 125000004974 2-butenyl group Chemical group C(C=CC)* 0.000 description 1
- 125000000069 2-butynyl group Chemical group [H]C([H])([H])C#CC([H])([H])* 0.000 description 1
- WDZACGWEPQLKOM-UHFFFAOYSA-N 2-chloro-1,3,5-trimethylbenzene Chemical compound CC1=CC(C)=C(Cl)C(C)=C1 WDZACGWEPQLKOM-UHFFFAOYSA-N 0.000 description 1
- FZZMTSNZRBFGGU-UHFFFAOYSA-N 2-chloro-7-fluoroquinazolin-4-amine Chemical compound FC1=CC=C2C(N)=NC(Cl)=NC2=C1 FZZMTSNZRBFGGU-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- 125000004362 3,4,5-trichlorophenyl group Chemical group [H]C1=C(Cl)C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000004189 3,4-dichlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(Cl)C([H])=C1* 0.000 description 1
- 125000003762 3,4-dimethoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C(OC([H])([H])[H])C([H])=C1* 0.000 description 1
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 1
- HJOUKNYBMUTPAU-UHFFFAOYSA-N 3-[2-methyl-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound CC(COC1C(NC2=CC=CC=C2C1)=O)CN1CCN(CC1)C1=CC=CC=C1 HJOUKNYBMUTPAU-UHFFFAOYSA-N 0.000 description 1
- WNEODWDFDXWOLU-QHCPKHFHSA-N 3-[3-(hydroxymethyl)-4-[1-methyl-5-[[5-[(2s)-2-methyl-4-(oxetan-3-yl)piperazin-1-yl]pyridin-2-yl]amino]-6-oxopyridin-3-yl]pyridin-2-yl]-7,7-dimethyl-1,2,6,8-tetrahydrocyclopenta[3,4]pyrrolo[3,5-b]pyrazin-4-one Chemical compound C([C@@H](N(CC1)C=2C=NC(NC=3C(N(C)C=C(C=3)C=3C(=C(N4C(C5=CC=6CC(C)(C)CC=6N5CC4)=O)N=CC=3)CO)=O)=CC=2)C)N1C1COC1 WNEODWDFDXWOLU-QHCPKHFHSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- 125000006275 3-bromophenyl group Chemical group [H]C1=C([H])C(Br)=C([H])C(*)=C1[H] 0.000 description 1
- 125000004180 3-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(F)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- YNZNESKPSHZISM-UHFFFAOYSA-N 3-propoxy-1h-quinolin-2-one Chemical compound C1=CC=C2NC(=O)C(OCCC)=CC2=C1 YNZNESKPSHZISM-UHFFFAOYSA-N 0.000 description 1
- FVXYRXMYPXVHNY-UHFFFAOYSA-N 3-propoxy-3,4-dihydro-1H-quinolin-2-one Chemical compound C(CC)OC1C(NC2=CC=CC=C2C1)=O FVXYRXMYPXVHNY-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- 125000004800 4-bromophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Br 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- UZFMOKQJFYMBGY-UHFFFAOYSA-N 4-hydroxy-TEMPO Chemical compound CC1(C)CC(O)CC(C)(C)N1[O] UZFMOKQJFYMBGY-UHFFFAOYSA-N 0.000 description 1
- 125000006306 4-iodophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1I 0.000 description 1
- USLGUHHHDLYPEG-UHFFFAOYSA-N 4-methyl-6-[3-(4-phenylpiperazin-1-yl)propoxy]-1h-quinolin-2-one Chemical compound C1=C2C(C)=CC(=O)NC2=CC=C1OCCCN(CC1)CCN1C1=CC=CC=C1 USLGUHHHDLYPEG-UHFFFAOYSA-N 0.000 description 1
- WHFPSZACEHAKSG-UHFFFAOYSA-N 4-methyl-7-(oxiran-2-ylmethoxy)-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCC1CO1 WHFPSZACEHAKSG-UHFFFAOYSA-N 0.000 description 1
- QYYOIMPOXWFIGS-UHFFFAOYSA-N 4-methyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]-1h-quinolin-2-one Chemical compound C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1C1=CC=CC=C1 QYYOIMPOXWFIGS-UHFFFAOYSA-N 0.000 description 1
- WBQXQEYUTWYZAB-UHFFFAOYSA-N 4-methyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]-1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.C=1C=C2C(C)=CC(=O)NC2=CC=1OCCCN(CC1)CCN1C1=CC=CC=C1 WBQXQEYUTWYZAB-UHFFFAOYSA-N 0.000 description 1
- NEAQKRDPVKKECM-UHFFFAOYSA-N 4-methyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one dihydrochloride Chemical compound Cl.Cl.CC1CC(=O)Nc2cc(OCCCN3CCN(CC3)c3ccccc3)ccc12 NEAQKRDPVKKECM-UHFFFAOYSA-N 0.000 description 1
- 125000000590 4-methylphenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- DEBRKLHVSCAMGG-UHFFFAOYSA-N 4-phenyl-6-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound C1(=CC=CC=C1)C1CC(NC2=CC=C(C=C12)OCCCN1CCN(CC1)C1=CC=CC=C1)=O DEBRKLHVSCAMGG-UHFFFAOYSA-N 0.000 description 1
- XVZLCNDAYXZALB-UHFFFAOYSA-N 4-phenyl-7-[3-(4-phenylpiperazin-1-yl)propoxy]-1h-quinolin-2-one Chemical compound C12=CC=C(OCCCN3CCN(CC3)C=3C=CC=CC=3)C=C2NC(=O)C=C1C1=CC=CC=C1 XVZLCNDAYXZALB-UHFFFAOYSA-N 0.000 description 1
- BHKLXNQHJJHUCF-UHFFFAOYSA-N 5,6-dichloro-8-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C(Cl)=C(Cl)C=C2O BHKLXNQHJJHUCF-UHFFFAOYSA-N 0.000 description 1
- LDQUGEWXINSSHK-UHFFFAOYSA-N 5-(oxiran-2-ylmethoxy)-1-(3-phenylpropyl)-3,4-dihydroquinolin-2-one Chemical compound C1=CC=C2N(CCCC=3C=CC=CC=3)C(=O)CCC2=C1OCC1CO1 LDQUGEWXINSSHK-UHFFFAOYSA-N 0.000 description 1
- VQTWQOBNPISQPG-UHFFFAOYSA-N 5-(oxiran-2-ylmethoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCC1CO1 VQTWQOBNPISQPG-UHFFFAOYSA-N 0.000 description 1
- ABLQXHFFNBTRBN-UHFFFAOYSA-N 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-1-(3-methylbutyl)-3,4-dihydroquinolin-2-one;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC=C2N(CCC(C)C)C(=O)CCC2=C1OCC(O)CN(CC1)CCN1C1=CC=CC=C1 ABLQXHFFNBTRBN-UHFFFAOYSA-N 0.000 description 1
- BKLZJEDYTSEFQS-UHFFFAOYSA-N 5-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=CC=2NC(=O)CCC=2C=1OCC(O)CN(CC1)CCN1C1=CC=CC=C1 BKLZJEDYTSEFQS-UHFFFAOYSA-N 0.000 description 1
- FFOVXANNRSDIOZ-UHFFFAOYSA-N 5-[2-hydroxy-3-[4-(4-methylphenyl)piperazin-1-yl]propoxy]-1-(3-phenylpropyl)-3,4-dihydroquinolin-2-one;oxalic acid Chemical compound OC(=O)C(O)=O.C1=CC(C)=CC=C1N1CCN(CC(O)COC=2C=3CCC(=O)N(CCCC=4C=CC=CC=4)C=3C=CC=2)CC1 FFOVXANNRSDIOZ-UHFFFAOYSA-N 0.000 description 1
- KOXGUMRCRGCEHF-UHFFFAOYSA-N 5-[3-(4-acetylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(C(=O)C)CCN1CCCOC1=CC=CC2=C1CCC(=O)N2 KOXGUMRCRGCEHF-UHFFFAOYSA-N 0.000 description 1
- KHYXNLOFRIJCSQ-UHFFFAOYSA-N 5-[3-(4-acetylpiperazin-1-yl)propoxy]-3,4-dihydroxy-1h-quinolin-2-one Chemical compound C1CN(C(=O)C)CCN1CCCOC1=CC=CC2=C1C(O)=C(O)C(=O)N2 KHYXNLOFRIJCSQ-UHFFFAOYSA-N 0.000 description 1
- SZFDGAFMPHFFDD-UHFFFAOYSA-N 5-[3-(4-benzoylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CN(CCCOC=2C=3CCC(=O)NC=3C=CC=2)CCN1C(=O)C1=CC=CC=C1 SZFDGAFMPHFFDD-UHFFFAOYSA-N 0.000 description 1
- WWOBBQZLFKCLBO-UHFFFAOYSA-N 5-[3-(4-benzoylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C1CN(CCCOC=2C=3CCC(=O)NC=3C=CC=2)CCN1C(=O)C1=CC=CC=C1 WWOBBQZLFKCLBO-UHFFFAOYSA-N 0.000 description 1
- WKSOIJYFZBFIJE-UHFFFAOYSA-N 5-[3-(4-benzyl-1,4-diazepan-1-yl)propoxy]-6-chloro-3,4-dihydro-1H-quinolin-2-one Chemical compound ClC=1C(=C2CCC(NC2=CC=1)=O)OCCCN1CCN(CCC1)CC1=CC=CC=C1 WKSOIJYFZBFIJE-UHFFFAOYSA-N 0.000 description 1
- GCYXGYNYNJMGEM-UHFFFAOYSA-N 5-[3-(4-benzylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCN(CC1)CCN1CC1=CC=CC=C1 GCYXGYNYNJMGEM-UHFFFAOYSA-N 0.000 description 1
- FYLSBGSTHGTSMF-UHFFFAOYSA-N 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC=C2OCCCN(CC1)CCN1C1=CC=CC=C1 FYLSBGSTHGTSMF-UHFFFAOYSA-N 0.000 description 1
- DAYOMAQYQQGSOL-UHFFFAOYSA-N 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.N1C(=O)CCC2=C1C=CC=C2OCCCN(CC1)CCN1C1=CC=CC=C1 DAYOMAQYQQGSOL-UHFFFAOYSA-N 0.000 description 1
- JSRIHBJICUOJDK-UHFFFAOYSA-N 5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.N1C(=O)CCC2=C1C=CC=C2OCCCN(CC1)CCN1C1=CC=CC=C1 JSRIHBJICUOJDK-UHFFFAOYSA-N 0.000 description 1
- OGHVHWURQPBPBZ-UHFFFAOYSA-N 6,8-dichloro-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Cl)=CC(Cl)=C2O OGHVHWURQPBPBZ-UHFFFAOYSA-N 0.000 description 1
- KIOSOBUPSAUORJ-UHFFFAOYSA-N 6-(2-chloroethoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=CC(OCCCl)=CC=C21 KIOSOBUPSAUORJ-UHFFFAOYSA-N 0.000 description 1
- DYLLIXGCEBNMDQ-UHFFFAOYSA-N 6-(oxiran-2-ylmethoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2NC(=O)CCC2=CC=1OCC1CO1 DYLLIXGCEBNMDQ-UHFFFAOYSA-N 0.000 description 1
- HWXGXEJWOYVEDY-UHFFFAOYSA-N 6-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one hydrochloride Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1OCC(O)CN(CC1)CCN1C1=CC=CC=C1 HWXGXEJWOYVEDY-UHFFFAOYSA-N 0.000 description 1
- IVLDYECWPDUNFM-UHFFFAOYSA-N 6-[4-(4-phenylpiperazin-1-yl)butoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound C1(=CC=CC=C1)N1CCN(CC1)CCCCOC=1C=C2CCC(NC2=CC=1)=O IVLDYECWPDUNFM-UHFFFAOYSA-N 0.000 description 1
- HHNCHCFECWBWBU-UHFFFAOYSA-N 6-bromo-5-(3-chloropropoxy)-1H-quinolin-2-one Chemical compound BrC=1C(=C2C=CC(NC2=CC=1)=O)OCCCCl HHNCHCFECWBWBU-UHFFFAOYSA-N 0.000 description 1
- ZKFVTMXLLJWHIG-UHFFFAOYSA-N 6-bromo-5-[3-(4-phenylpiperazin-1-yl)propoxy]-1H-quinolin-2-one Chemical compound BrC=1C(=C2C=CC(NC2=CC=1)=O)OCCCN1CCN(CC1)C1=CC=CC=C1 ZKFVTMXLLJWHIG-UHFFFAOYSA-N 0.000 description 1
- WQKHERPPDYPMNX-UHFFFAOYSA-N 6-chloro-3,4-dihydro-2h-naphthalen-1-one Chemical compound O=C1CCCC2=CC(Cl)=CC=C21 WQKHERPPDYPMNX-UHFFFAOYSA-N 0.000 description 1
- ZMIBZTLZZULMNT-UHFFFAOYSA-N 6-chloro-5-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=CC(Cl)=C2O ZMIBZTLZZULMNT-UHFFFAOYSA-N 0.000 description 1
- KPUQMPJEVWQIBR-UHFFFAOYSA-N 6-chloro-7-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C=C(OC)C(Cl)=C2 KPUQMPJEVWQIBR-UHFFFAOYSA-N 0.000 description 1
- FYLWSKQQLBEWMU-UHFFFAOYSA-N 7-(3-chloro-2-hydroxypropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(OCC(CCl)O)=CC=C21 FYLWSKQQLBEWMU-UHFFFAOYSA-N 0.000 description 1
- GBMAJEPDNKTITQ-UHFFFAOYSA-N 7-(3-chloro-2-methylpropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(OCC(CCl)C)=CC=C21 GBMAJEPDNKTITQ-UHFFFAOYSA-N 0.000 description 1
- JNCIKJRSERAMOT-UHFFFAOYSA-N 7-(3-chloropropoxy)-4-methyl-1h-quinolin-2-one Chemical compound ClCCCOC1=CC=C2C(C)=CC(=O)NC2=C1 JNCIKJRSERAMOT-UHFFFAOYSA-N 0.000 description 1
- HHPUBKLBLHLUKK-UHFFFAOYSA-N 7-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one;hydrochloride Chemical compound Cl.C=1C=C2CCC(=O)NC2=CC=1OCC(O)CN(CC1)CCN1C1=CC=CC=C1 HHPUBKLBLHLUKK-UHFFFAOYSA-N 0.000 description 1
- LGPLIDOVQNKWEM-UHFFFAOYSA-N 7-[2-methyl-3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C=1C=C2CCC(=O)NC2=CC=1OCC(C)CN(CC1)CCN1C1=CC=CC=C1 LGPLIDOVQNKWEM-UHFFFAOYSA-N 0.000 description 1
- CQWVISCSKYGBFC-UHFFFAOYSA-N 7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-1h-quinolin-2-one Chemical compound ClC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)C=CC4=CC=3)CC2)=C1Cl CQWVISCSKYGBFC-UHFFFAOYSA-N 0.000 description 1
- FZNVIOULNRQSFK-UHFFFAOYSA-N 7-[3-[4-(2,3-dichlorophenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound ClC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1Cl FZNVIOULNRQSFK-UHFFFAOYSA-N 0.000 description 1
- WRLRYMBZQVFUSE-UHFFFAOYSA-N 7-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1C WRLRYMBZQVFUSE-UHFFFAOYSA-N 0.000 description 1
- LIQHBNMLBNFVCB-UHFFFAOYSA-N 7-[3-[4-(2-methoxyphenyl)piperazin-1-yl]propoxy]-1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.COC1=CC=CC=C1N1CCN(CCCOC=2C=C3NC(=O)C=CC3=CC=2)CC1 LIQHBNMLBNFVCB-UHFFFAOYSA-N 0.000 description 1
- UNGWHJZSVWYOTP-UHFFFAOYSA-N 7-[3-[4-(2-methylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound CC1=CC=CC=C1N1CCN(CCCOC=2C=C3NC(=O)CCC3=CC=2)CC1 UNGWHJZSVWYOTP-UHFFFAOYSA-N 0.000 description 1
- JUHGJQHJMUJTGH-UHFFFAOYSA-N 7-[3-[4-(3,4,5-trimethoxyphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one;dihydrochloride Chemical compound Cl.Cl.COC1=C(OC)C(OC)=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1 JUHGJQHJMUJTGH-UHFFFAOYSA-N 0.000 description 1
- DQNMOLMSOAEYIN-UHFFFAOYSA-N 7-[3-[4-(3,4-dichlorophenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound ClC=1C=C(C=CC=1Cl)N1CCN(CC1)CCCOC1=CC=C2CCC(NC2=C1)=O DQNMOLMSOAEYIN-UHFFFAOYSA-N 0.000 description 1
- ZVSUMWOZMCQRPZ-UHFFFAOYSA-N 7-[3-[4-(3,4-dimethylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(C)C(C)=CC=C1N1CCN(CCCOC=2C=C3NC(=O)CCC3=CC=2)CC1 ZVSUMWOZMCQRPZ-UHFFFAOYSA-N 0.000 description 1
- OGSRFGCTVHVWJF-UHFFFAOYSA-N 7-[3-[4-(3-chloro-2-methylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=C(Cl)C=CC=C1N1CCN(CCCOC=2C=C3NC(=O)CCC3=CC=2)CC1 OGSRFGCTVHVWJF-UHFFFAOYSA-N 0.000 description 1
- RGMNIZNKXUTXFF-UHFFFAOYSA-N 7-[3-[4-(3-chloro-4-methylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=C(Cl)C(C)=CC=C1N1CCN(CCCOC=2C=C3NC(=O)CCC3=CC=2)CC1 RGMNIZNKXUTXFF-UHFFFAOYSA-N 0.000 description 1
- XPJCMCJEUNELFP-UHFFFAOYSA-N 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]-2-hydroxypropoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound OC(COC1=CC=C2CCC(NC2=C1)=O)CN1CCN(CC1)C1=CC(=CC=C1)Cl XPJCMCJEUNELFP-UHFFFAOYSA-N 0.000 description 1
- SKIQFHAPHBOWKG-UHFFFAOYSA-N 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]-1h-quinolin-2-one Chemical compound ClC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)C=CC4=CC=3)CC2)=C1 SKIQFHAPHBOWKG-UHFFFAOYSA-N 0.000 description 1
- ZKAYRIOGIKAXJC-UHFFFAOYSA-N 7-[3-[4-(3-chlorophenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound ClC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1 ZKAYRIOGIKAXJC-UHFFFAOYSA-N 0.000 description 1
- JVNMPWKMTPMFSP-UHFFFAOYSA-N 7-[3-[4-(3-fluorophenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound FC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1 JVNMPWKMTPMFSP-UHFFFAOYSA-N 0.000 description 1
- DUVVQVPXUIDVCI-UHFFFAOYSA-N 7-[3-[4-(3-methylphenyl)piperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1=CC=CC(N2CCN(CCCOC=3C=C4NC(=O)CCC4=CC=3)CC2)=C1 DUVVQVPXUIDVCI-UHFFFAOYSA-N 0.000 description 1
- RQFOPAAUUFOLQY-UHFFFAOYSA-N 7-[3-[4-(4-chlorophenyl)-3-methylpiperazin-1-yl]propoxy]-3,4-dihydro-1h-quinolin-2-one Chemical compound CC1CN(CCCOC=2C=C3NC(=O)CCC3=CC=2)CCN1C1=CC=C(Cl)C=C1 RQFOPAAUUFOLQY-UHFFFAOYSA-N 0.000 description 1
- CCIMBZKQVFPGCF-UHFFFAOYSA-N 7-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=CC(OC)=CC=C21 CCIMBZKQVFPGCF-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- HEZSJVTZKUSOIZ-UHFFFAOYSA-N 8-bromo-5-(3-chloropropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2OCCCCl HEZSJVTZKUSOIZ-UHFFFAOYSA-N 0.000 description 1
- GNCHSWBYKKTHHC-UHFFFAOYSA-N 8-bromo-5-hydroxy-1h-quinolin-2-one Chemical compound N1C(=O)C=CC2=C1C(Br)=CC=C2O GNCHSWBYKKTHHC-UHFFFAOYSA-N 0.000 description 1
- ZHUQRXPCCVWKHW-UHFFFAOYSA-N 8-bromo-5-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound N1C(=O)CCC2=C1C(Br)=CC=C2OC ZHUQRXPCCVWKHW-UHFFFAOYSA-N 0.000 description 1
- JQIYRNJVUSDOHE-UHFFFAOYSA-N 8-bromo-6-chloro-7-(3-chloropropoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C(Br)C(OCCCCl)=C(Cl)C=C21 JQIYRNJVUSDOHE-UHFFFAOYSA-N 0.000 description 1
- DITDGNFEWLKAER-UHFFFAOYSA-N 8-bromo-6-chloro-7-hydroxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C(Br)C(O)=C(Cl)C=C21 DITDGNFEWLKAER-UHFFFAOYSA-N 0.000 description 1
- WSZVKIQNXHDDJQ-UHFFFAOYSA-N 8-chloro-5-(oxiran-2-ylmethoxy)-3,4-dihydro-1h-quinolin-2-one Chemical compound C1=2CCC(=O)NC=2C(Cl)=CC=C1OCC1CO1 WSZVKIQNXHDDJQ-UHFFFAOYSA-N 0.000 description 1
- VFCYYYIWSCXZOH-UHFFFAOYSA-N 8-chloro-5-[3-(4-phenylpiperazin-1-yl)propoxy]-3,4-dihydro-1H-quinolin-2-one Chemical compound ClC=1C=CC(=C2CCC(NC=12)=O)OCCCN1CCN(CC1)C1=CC=CC=C1 VFCYYYIWSCXZOH-UHFFFAOYSA-N 0.000 description 1
- ILTWLOPILDYCKW-UHFFFAOYSA-N 8-methoxy-3,4-dihydro-1h-quinolin-2-one Chemical compound C1CC(=O)NC2=C1C=CC=C2OC ILTWLOPILDYCKW-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 206010002198 Anaphylactic reaction Diseases 0.000 description 1
- 208000019901 Anxiety disease Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 102100030802 Beta-2-glycoprotein 1 Human genes 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- FNZFNHARJBFHTE-UHFFFAOYSA-N C(C)(C)N1C(=O)CCC2=C(C=CC=C12)OCCCN1CCN(CC1)C1=CC=CC=C1 Chemical compound C(C)(C)N1C(=O)CCC2=C(C=CC=C12)OCCCN1CCN(CC1)C1=CC=CC=C1 FNZFNHARJBFHTE-UHFFFAOYSA-N 0.000 description 1
- UTRMKMFSMLXFDR-UHFFFAOYSA-N C(C1=CC=CC=C1)N1C(=O)CCC2=C(C(=CC=C12)Cl)OCCCN1CCN(CCC1)CC1=CC=CC=C1 Chemical compound C(C1=CC=CC=C1)N1C(=O)CCC2=C(C(=CC=C12)Cl)OCCCN1CCN(CCC1)CC1=CC=CC=C1 UTRMKMFSMLXFDR-UHFFFAOYSA-N 0.000 description 1
- KTSDCDIZTBMRAB-UHFFFAOYSA-N C(C1=CC=CC=C1)N1C(=O)CCC2=CC(=CC=C12)OCCCN1CCN(CC1)C1=CC=CC=C1 Chemical compound C(C1=CC=CC=C1)N1C(=O)CCC2=CC(=CC=C12)OCCCN1CCN(CC1)C1=CC=CC=C1 KTSDCDIZTBMRAB-UHFFFAOYSA-N 0.000 description 1
- NUNJIYMSMCMDHL-UHFFFAOYSA-N C1(=CC=CC=C1)N1CCN(CC1)CCCCCOC1=CC=C2CCC(NC2=C1)=O Chemical compound C1(=CC=CC=C1)N1CCN(CC1)CCCCCOC1=CC=C2CCC(NC2=C1)=O NUNJIYMSMCMDHL-UHFFFAOYSA-N 0.000 description 1
- ZKQDCIXGCQPQNV-UHFFFAOYSA-N Calcium hypochlorite Chemical compound [Ca+2].Cl[O-].Cl[O-] ZKQDCIXGCQPQNV-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 208000009132 Catalepsy Diseases 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- NHRHVIZKGHMSQJ-UHFFFAOYSA-N Cl.C=1C=C2NC(=O)CCC2=CC=1OCCN(CC1)CCN1C1=CC=CC=C1 Chemical compound Cl.C=1C=C2NC(=O)CCC2=CC=1OCCN(CC1)CCN1C1=CC=CC=C1 NHRHVIZKGHMSQJ-UHFFFAOYSA-N 0.000 description 1
- 206010010744 Conjunctivitis allergic Diseases 0.000 description 1
- 229910021591 Copper(I) chloride Inorganic materials 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 206010012438 Dermatitis atopic Diseases 0.000 description 1
- 206010012442 Dermatitis contact Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 101100298295 Drosophila melanogaster flfl gene Proteins 0.000 description 1
- 206010051244 Dyschezia Diseases 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- 206010015150 Erythema Diseases 0.000 description 1
- DCXXMTOCNZCJGO-UHFFFAOYSA-N Glycerol trioctadecanoate Natural products CCCCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCCCC DCXXMTOCNZCJGO-UHFFFAOYSA-N 0.000 description 1
- 101000793425 Homo sapiens Beta-2-glycoprotein 1 Proteins 0.000 description 1
- 206010020751 Hypersensitivity Diseases 0.000 description 1
- 208000006877 Insect Bites and Stings Diseases 0.000 description 1
- QZRGKCOWNLSUDK-UHFFFAOYSA-N Iodochlorine Chemical compound ICl QZRGKCOWNLSUDK-UHFFFAOYSA-N 0.000 description 1
- APGWPUQMIBRIQN-UHFFFAOYSA-N O=C1NC2=CC(OCCCN(CC3)CCN3C(C=C3)=CC=C3F)=CC=C2CC1 Chemical compound O=C1NC2=CC(OCCCN(CC3)CCN3C(C=C3)=CC=C3F)=CC=C2CC1 APGWPUQMIBRIQN-UHFFFAOYSA-N 0.000 description 1
- RZQLZVKPVDZPPB-UHFFFAOYSA-N O=C1NC2=CC(OCCCN(CC3)CCN3C3=CC(Cl)=CC(Cl)=C3)=CC=C2CC1 Chemical compound O=C1NC2=CC(OCCCN(CC3)CCN3C3=CC(Cl)=CC(Cl)=C3)=CC=C2CC1 RZQLZVKPVDZPPB-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000027089 Parkinsonian disease Diseases 0.000 description 1
- 206010034010 Parkinsonism Diseases 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 229920001214 Polysorbate 60 Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 208000028017 Psychotic disease Diseases 0.000 description 1
- BERPCVULMUPOER-UHFFFAOYSA-N Quinolinediol Chemical class C1=CC=C2NC(=O)C(O)=CC2=C1 BERPCVULMUPOER-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 1
- 241000700159 Rattus Species 0.000 description 1
- 206010039085 Rhinitis allergic Diseases 0.000 description 1
- 206010048908 Seasonal allergy Diseases 0.000 description 1
- 229920001800 Shellac Polymers 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 208000001871 Tachycardia Diseases 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 206010047853 Waxy flexibility Diseases 0.000 description 1
- LXRZVMYMQHNYJB-UNXOBOICSA-N [(1R,2S,4R)-4-[[5-[4-[(1R)-7-chloro-1,2,3,4-tetrahydroisoquinolin-1-yl]-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate Chemical compound CC1=C(C=C(S1)C(=O)C1=C(N[C@H]2C[C@H](O)[C@@H](COS(N)(=O)=O)C2)N=CN=C1)[C@@H]1NCCC2=C1C=C(Cl)C=C2 LXRZVMYMQHNYJB-UNXOBOICSA-N 0.000 description 1
- ZJQHXCFDPZNALX-UHFFFAOYSA-N [1-[(2-oxo-3,4-dihydro-1h-quinolin-7-yl)oxy]-3-(4-phenylpiperazin-1-yl)propan-2-yl] acetate Chemical compound C=1C=C2CCC(=O)NC2=CC=1OCC(OC(=O)C)CN(CC1)CCN1C1=CC=CC=C1 ZJQHXCFDPZNALX-UHFFFAOYSA-N 0.000 description 1
- YGPZMMIGZREXJQ-UHFFFAOYSA-N [Na+].[Na+].CC[O-].CC[O-] Chemical compound [Na+].[Na+].CC[O-].CC[O-] YGPZMMIGZREXJQ-UHFFFAOYSA-N 0.000 description 1
- 239000003655 absorption accelerator Substances 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000007059 acute toxicity Effects 0.000 description 1
- 231100000403 acute toxicity Toxicity 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 208000002205 allergic conjunctivitis Diseases 0.000 description 1
- 230000000172 allergic effect Effects 0.000 description 1
- 201000010105 allergic rhinitis Diseases 0.000 description 1
- 230000007815 allergy Effects 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000036783 anaphylactic response Effects 0.000 description 1
- 208000003455 anaphylaxis Diseases 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 230000008485 antagonism Effects 0.000 description 1
- 230000001078 anti-cholinergic effect Effects 0.000 description 1
- 230000003561 anti-manic effect Effects 0.000 description 1
- 230000001754 anti-pyretic effect Effects 0.000 description 1
- 239000002221 antipyretic Substances 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 230000036506 anxiety Effects 0.000 description 1
- 239000002249 anxiolytic agent Substances 0.000 description 1
- VMWNQDUVQKEIOC-CYBMUJFWSA-N apomorphine Chemical compound C([C@H]1N(C)CC2)C3=CC=C(O)C(O)=C3C3=C1C2=CC=C3 VMWNQDUVQKEIOC-CYBMUJFWSA-N 0.000 description 1
- 229960004046 apomorphine Drugs 0.000 description 1
- 208000024998 atopic conjunctivitis Diseases 0.000 description 1
- 201000008937 atopic dermatitis Diseases 0.000 description 1
- 208000010668 atopic eczema Diseases 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 1
- 229940073608 benzyl chloride Drugs 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 208000028683 bipolar I disease Diseases 0.000 description 1
- 239000007844 bleaching agent Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 239000006172 buffering agent Substances 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 235000013877 carbamide Nutrition 0.000 description 1
- 150000001720 carbohydrates Chemical group 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000003065 cardioinhibitory effect Effects 0.000 description 1
- FYBXRCFPOTXTJF-UHFFFAOYSA-N carteolol hydrochloride Chemical compound [Cl-].N1C(=O)CCC2=C1C=CC=C2OCC(O)C[NH2+]C(C)(C)C FYBXRCFPOTXTJF-UHFFFAOYSA-N 0.000 description 1
- LGUTYLOOFOKOOY-UHFFFAOYSA-N chloroform;ethane Chemical compound CC.ClC(Cl)Cl LGUTYLOOFOKOOY-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 230000002860 competitive effect Effects 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 229940126214 compound 3 Drugs 0.000 description 1
- 208000010247 contact dermatitis Diseases 0.000 description 1
- OXBLHERUFWYNTN-UHFFFAOYSA-M copper(I) chloride Chemical compound [Cu]Cl OXBLHERUFWYNTN-UHFFFAOYSA-M 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000003111 delayed effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- CKQQMPJQZXIYMJ-UHFFFAOYSA-N dihydrate;dihydrochloride Chemical compound O.O.Cl.Cl CKQQMPJQZXIYMJ-UHFFFAOYSA-N 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 231100000673 dose–response relationship Toxicity 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- SRCZQMGIVIYBBJ-UHFFFAOYSA-N ethoxyethane;ethyl acetate Chemical compound CCOCC.CCOC(C)=O SRCZQMGIVIYBBJ-UHFFFAOYSA-N 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000002534 ethynyl group Chemical group [H]C#C* 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 235000003599 food sweetener Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 235000011087 fumaric acid Nutrition 0.000 description 1
- 108010025899 gelatin film Proteins 0.000 description 1
- 125000005456 glyceride group Chemical group 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 150000002366 halogen compounds Chemical class 0.000 description 1
- 229960003132 halothane Drugs 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QMEZUZOCLYUADC-UHFFFAOYSA-N hydrate;dihydrochloride Chemical compound O.Cl.Cl QMEZUZOCLYUADC-UHFFFAOYSA-N 0.000 description 1
- DKAGJZJALZXOOV-UHFFFAOYSA-N hydrate;hydrochloride Chemical compound O.Cl DKAGJZJALZXOOV-UHFFFAOYSA-N 0.000 description 1
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- FUKUFMFMCZIRNT-UHFFFAOYSA-N hydron;methanol;chloride Chemical compound Cl.OC FUKUFMFMCZIRNT-UHFFFAOYSA-N 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 230000002631 hypothermal effect Effects 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 230000001939 inductive effect Effects 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001972 isopentyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 230000007803 itching Effects 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 229960003511 macrogol Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000001630 malic acid Substances 0.000 description 1
- 235000011090 malic acid Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- 229940035363 muscle relaxants Drugs 0.000 description 1
- 229960002748 norepinephrine Drugs 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical class CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- AAQXQNYRCWFBIR-UHFFFAOYSA-N oxalic acid;1h-quinolin-2-one Chemical compound OC(=O)C(O)=O.C1=CC=C2NC(=O)C=CC2=C1 AAQXQNYRCWFBIR-UHFFFAOYSA-N 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 238000005192 partition Methods 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000002304 perfume Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 238000001050 pharmacotherapy Methods 0.000 description 1
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical compound NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 1
- 229940067157 phenylhydrazine Drugs 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- RPDAUEIUDPHABB-UHFFFAOYSA-N potassium ethoxide Chemical compound [K+].CC[O-] RPDAUEIUDPHABB-UHFFFAOYSA-N 0.000 description 1
- NTTOTNSKUYCDAV-UHFFFAOYSA-N potassium hydride Chemical compound [KH] NTTOTNSKUYCDAV-UHFFFAOYSA-N 0.000 description 1
- 229910000105 potassium hydride Inorganic materials 0.000 description 1
- 238000012746 preparative thin layer chromatography Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- DHAVNRJKBRMQMN-UHFFFAOYSA-N propan-2-ol;1h-quinolin-2-one Chemical compound CC(C)O.C1=CC=C2NC(=O)C=CC2=C1 DHAVNRJKBRMQMN-UHFFFAOYSA-N 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000001528 ptotic effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 210000000664 rectum Anatomy 0.000 description 1
- 230000002040 relaxant effect Effects 0.000 description 1
- 210000002345 respiratory system Anatomy 0.000 description 1
- 201000000980 schizophrenia Diseases 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 230000035945 sensitivity Effects 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- ZLGIYFNHBLSMPS-ATJNOEHPSA-N shellac Chemical compound OCCCCCC(O)C(O)CCCCCCCC(O)=O.C1C23[C@H](C(O)=O)CCC2[C@](C)(CO)[C@@H]1C(C(O)=O)=C[C@@H]3O ZLGIYFNHBLSMPS-ATJNOEHPSA-N 0.000 description 1
- 239000004208 shellac Substances 0.000 description 1
- 229940113147 shellac Drugs 0.000 description 1
- 235000013874 shellac Nutrition 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 206010041232 sneezing Diseases 0.000 description 1
- 235000010413 sodium alginate Nutrition 0.000 description 1
- 239000000661 sodium alginate Substances 0.000 description 1
- 229940005550 sodium alginate Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- RPACBEVZENYWOL-XFULWGLBSA-M sodium;(2r)-2-[6-(4-chlorophenoxy)hexyl]oxirane-2-carboxylate Chemical compound [Na+].C=1C=C(Cl)C=CC=1OCCCCCC[C@]1(C(=O)[O-])CO1 RPACBEVZENYWOL-XFULWGLBSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000000638 solvent extraction Methods 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000013599 spices Nutrition 0.000 description 1
- 230000002269 spontaneous effect Effects 0.000 description 1
- 210000002784 stomach Anatomy 0.000 description 1
- 125000005504 styryl group Chemical group 0.000 description 1
- 235000000346 sugar Nutrition 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 239000013589 supplement Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000003765 sweetening agent Substances 0.000 description 1
- 230000006794 tachycardia Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 230000035922 thirst Effects 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
- 150000004684 trihydrates Chemical class 0.000 description 1
- 230000002792 vascular Effects 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 239000003871 white petrolatum Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
- C07D215/227—Oxygen atoms attached in position 2 or 4 only one oxygen atom which is attached in position 2
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P29/00—Non-central analgesic, antipyretic or antiinflammatory agents, e.g. antirheumatic agents; Non-steroidal antiinflammatory drugs [NSAID]
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P37/00—Drugs for immunological or allergic disorders
- A61P37/08—Antiallergic agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/22—Oxygen atoms attached in position 2 or 4
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
- C07D215/24—Oxygen atoms attached in position 8
- C07D215/26—Alcohols; Ethers thereof
- C07D215/28—Alcohols; Ethers thereof with halogen atoms or nitro radicals in positions 5, 6 or 7
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Veterinary Medicine (AREA)
- Public Health (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Health & Medical Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Neurology (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Anesthesiology (AREA)
- Pain & Pain Management (AREA)
- Rheumatology (AREA)
- Pulmonology (AREA)
- Immunology (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Quinoline Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3778378A JPS54130587A (en) | 1978-03-30 | 1978-03-30 | Carbostyryl derivative |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| SE7902794L SE7902794L (sv) | 1979-10-01 |
| SE434945B true SE434945B (sv) | 1984-08-27 |
Family
ID=12507080
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SE7902794A SE434945B (sv) | 1978-03-30 | 1979-03-29 | Karbostyrilderivat |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US4734416A (enExample) |
| JP (1) | JPS54130587A (enExample) |
| AT (1) | AT376432B (enExample) |
| AU (1) | AU515531B2 (enExample) |
| BE (1) | BE875174A (enExample) |
| CA (1) | CA1117110A (enExample) |
| CH (2) | CH641455A5 (enExample) |
| DE (2) | DE2912105C2 (enExample) |
| DK (1) | DK158225C (enExample) |
| ES (4) | ES479134A1 (enExample) |
| FI (1) | FI70704C (enExample) |
| FR (1) | FR2421174A1 (enExample) |
| GB (1) | GB2017701B (enExample) |
| IT (1) | IT1119284B (enExample) |
| MX (1) | MX5862E (enExample) |
| NL (1) | NL183189C (enExample) |
| NO (1) | NO151321C (enExample) |
| PT (1) | PT69422A (enExample) |
| SE (1) | SE434945B (enExample) |
| SU (2) | SU1140687A3 (enExample) |
| ZA (1) | ZA791516B (enExample) |
Families Citing this family (88)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2827566A1 (de) * | 1978-06-23 | 1980-01-10 | Boehringer Mannheim Gmbh | 1,2-dihydro-chinolin-2-on-derivate und verfahren zu ihrer herstellung |
| DE3034237A1 (de) * | 1979-09-18 | 1981-04-16 | Otsuka Pharmaceutical Co. Ltd., Tokyo | Carbostyrilderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende, antihistaminisch wirkende mittel |
| PH17194A (en) * | 1980-03-06 | 1984-06-19 | Otsuka Pharma Co Ltd | Novel carbostyril derivatives,and pharmaceutical composition containing the same |
| JPS57193461A (en) * | 1981-05-22 | 1982-11-27 | Otsuka Pharmaceut Co Ltd | Benzazepine derivative |
| CN85108214A (zh) * | 1984-11-22 | 1986-08-20 | 赫彻斯特股份公司 | 新的取代的苯基哌嗪衍生物及其药物的制造方法 |
| JPS6129331A (ja) * | 1985-03-13 | 1986-02-10 | アラ−ガン・ハンフリ− | 検眼装置 |
| DK588486A (da) * | 1985-12-09 | 1987-06-10 | Otsuka Pharma Co Ltd | Anvendelse af en forbindelse til behandling af hypoxi |
| DK167187A (da) * | 1986-04-02 | 1987-10-03 | Otsuka Pharma Co Ltd | Carbostyrilderivater og salte deraf, fremgangsmaade til fremstilling af saadanne forbindelser og laegemiddel indeholdende disse |
| KR940000785B1 (ko) * | 1986-04-02 | 1994-01-31 | 오오쓰까세이야꾸 가부시끼가이샤 | 카르보스티릴 유도체 및 그의 염의 제조 방법 |
| EP0255134B1 (en) * | 1986-07-31 | 1993-03-03 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives and salts thereof, process for preparing them, and cardiotonic composition containing same |
| JPH0696555B2 (ja) * | 1986-07-31 | 1994-11-30 | 大塚製薬株式会社 | カルボスチリル誘導体 |
| US4803203A (en) * | 1986-11-05 | 1989-02-07 | Warner-Lambert Company | Phenyl and heterocyclic piperazinyl alkoxy-benzheterocyclic compounds as antipsychotic agents |
| EP0269383A3 (en) * | 1986-11-21 | 1990-05-02 | A.H. Robins Company, Incorporated | 1-Aryloxy-4-[(4-aryl)-1-piperazinyl]-2-butanols useful as antiallergy agents |
| FR2637591B1 (fr) * | 1988-10-11 | 1992-10-23 | Synthelabo | Derives de quinoleinone, leur preparation et leur application en therapeutique |
| JP2608788B2 (ja) * | 1988-10-31 | 1997-05-14 | 大塚製薬 株式会社 | 精神分裂病治療剤 |
| US5006528A (en) * | 1988-10-31 | 1991-04-09 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril derivatives |
| JP2900130B2 (ja) * | 1995-03-16 | 1999-06-02 | 大塚製薬株式会社 | カルボスチリル誘導体及び該誘導体を含有する精神分裂病治療剤 |
| US7053092B2 (en) * | 2001-01-29 | 2006-05-30 | Otsuka Pharmaceutical Co., Ltd. | 5-HT1a receptor subtype agonist |
| AR032641A1 (es) | 2001-01-29 | 2003-11-19 | Otsuka Pharma Co Ltd | Agonista de subtipo de receptor 5-ht 1a. |
| MY129350A (en) * | 2001-04-25 | 2007-03-30 | Bristol Myers Squibb Co | Aripiprazole oral solution |
| MY138669A (en) * | 2001-09-25 | 2009-07-31 | Otsuka Pharma Co Ltd | Low hygroscopic aripiprazole drug substance and processes for the preparation thereof |
| US8703772B2 (en) | 2001-09-25 | 2014-04-22 | Otsuka Pharmaceutical Co., Ltd. | Low hygroscopic aripiprazole drug substance and processes for the preparation thereof |
| AR033485A1 (es) * | 2001-09-25 | 2003-12-26 | Otsuka Pharma Co Ltd | Sustancia medicinal de aripiprazol de baja higroscopicidad y proceso para la preparacion de la misma |
| US20040185110A1 (en) * | 2002-11-08 | 2004-09-23 | Ronald Harland | Formulations of low solubility bioactive agents and processes for making the same |
| CA2676216A1 (en) * | 2003-01-09 | 2004-07-09 | Otsuka Pharmaceutical Co., Ltd. | Aripiprazole |
| US7658998B2 (en) * | 2003-01-22 | 2010-02-09 | Alkermes Controlled Therapeutics, Inc. | Method of preparing sustained release microparticles |
| CN1809545A (zh) * | 2003-06-20 | 2006-07-26 | 艾尼纳制药公司 | N-苯基-哌嗪衍生物和预防或者治疗5HT2c受体相关疾病的方法 |
| US6987111B2 (en) | 2003-08-06 | 2006-01-17 | Alkermes Controlled Therapeutics, Ii | Aripiprazole, olanzapine and haloperidol pamoate salts |
| US20050032781A1 (en) * | 2003-08-06 | 2005-02-10 | Elliot Ehrich | Methods for administering active agents to CYP 2D6 sensitive patients |
| AU2004285448C1 (en) * | 2003-10-23 | 2021-08-19 | Otsuka Pharmaceutical Co., Ltd. | Controlled release sterile injectable aripiprazole formulation and method |
| GB0326148D0 (en) | 2003-11-10 | 2003-12-17 | Lilly Co Eli | Morpholine derivatives |
| US7714129B2 (en) * | 2003-12-16 | 2010-05-11 | Teva Pharmaceutical Industries Ltd. | Methods of preparing anhydrous aripiprazole form II |
| US7504504B2 (en) * | 2003-12-16 | 2009-03-17 | Teva Pharmaceutical Industries Ltd. | Methods of preparing aripiprazole crystalline forms |
| MXPA06008828A (es) * | 2004-02-05 | 2007-04-25 | Teva Pharma | Proceso para preparar aripiprazol. |
| US7507823B2 (en) * | 2004-05-06 | 2009-03-24 | Bristol-Myers Squibb Company | Process of making aripiprazole particles |
| EP1753460A2 (en) * | 2004-05-11 | 2007-02-21 | Pfizer Products Inc. | Combination of atypical antipsychotics and 5-ht1b receptor antagonists |
| TW200616608A (en) * | 2004-07-09 | 2006-06-01 | Forest Laboratories | Memantine as adjunctive treatment to atypical antipsychotics in schizophrenia patients |
| US20060024362A1 (en) * | 2004-07-29 | 2006-02-02 | Pawan Seth | Composition comprising a benzimidazole and process for its manufacture |
| CN102627603A (zh) * | 2004-11-18 | 2012-08-08 | 斯索恩有限公司 | 制备结晶阿立哌唑的方法 |
| WO2006053780A1 (en) * | 2004-11-18 | 2006-05-26 | Synthon B.V. | Crystalline aripiprazole solvates |
| US20090069363A1 (en) * | 2004-12-14 | 2009-03-12 | Shionogi & Co. Ltd. A Legal Entity Of Japan | Therapeutic Agent for Constipation |
| EP1686126A1 (en) * | 2005-01-27 | 2006-08-02 | Sandoz AG | Salts of aripiprazole |
| US7884205B2 (en) * | 2005-01-27 | 2011-02-08 | Sandoz Ag | Salts of aripiprazole |
| CA2600542A1 (en) * | 2005-03-17 | 2006-09-21 | Synthon B.V. | Pharmaceutical tablets of crystalline type ii aripiprazole |
| TWI320783B (en) | 2005-04-14 | 2010-02-21 | Otsuka Pharma Co Ltd | Heterocyclic compound |
| GT200600161A (es) * | 2005-04-22 | 2007-03-14 | Nuevas combinaciones terapeuticas para el tratamiento o la prevencion de los trastornos psicoticos | |
| JP2009508859A (ja) * | 2005-09-15 | 2009-03-05 | エラン ファーマ インターナショナル リミテッド | ナノ粒子アリピプラゾール製剤 |
| BRPI0608185A2 (pt) * | 2005-12-22 | 2009-11-17 | Teva Pharma | processo para redução do tamanho de partìcula de aripiprazol |
| EP1988899A4 (en) * | 2006-02-03 | 2009-12-30 | Reddys Lab Ltd Dr | ARIPIPRAZOLE-CO-CRYSTALS |
| US20060223820A1 (en) * | 2006-03-21 | 2006-10-05 | Chemagis Ltd. | Crystalline aripiprazole salts and processes for preparation and purification thereof |
| EP1880714A1 (en) * | 2006-07-20 | 2008-01-23 | Helm AG | Amorphous Aripiprazole and Process for the Preparation thereof |
| US7799790B2 (en) * | 2006-07-20 | 2010-09-21 | Helm Ag | Amorphous aripiprazole and process for the preparation thereof |
| WO2008047340A1 (en) * | 2006-10-19 | 2008-04-24 | Mor Research Applications Ltd. | Combined therapies of antipsychotic drugs and tetracyclines in the treatment of psychiatric disorders |
| US8039621B2 (en) * | 2006-10-24 | 2011-10-18 | Cambrex Charles City, Inc. | Process for preparing anhydrous Aripirazole type I |
| EP1930396B1 (de) * | 2006-12-04 | 2011-07-06 | Merck Patent GmbH | Furochromanderivate |
| BRPI0811844A2 (pt) * | 2007-05-21 | 2014-11-18 | Reviva Pharmaceuticals Inc | Composto, e, método para tratar um paciente |
| WO2009017250A1 (en) * | 2007-07-31 | 2009-02-05 | Otsuka Pharmaceutical Co., Ltd. | Methods for producing aripiprazole suspension and freeze-dried formulation |
| PL2082735T3 (pl) | 2008-01-23 | 2011-05-31 | Helm Ag | Amorficzny arypiprazol i sposób jego wytwarzania |
| DE102008022221A1 (de) | 2008-05-06 | 2009-11-12 | Universität des Saarlandes | Inhibitoren der humanen Aldosteronsynthase CYP11B2 |
| CN102762207A (zh) * | 2008-05-09 | 2012-10-31 | 爱莫里大学 | 用于治疗神经精神疾患的nmda受体拮抗剂 |
| EP2321011A1 (en) * | 2008-06-25 | 2011-05-18 | Pfizer Inc. | Diaryl compounds and uses thereof |
| EP2445502B2 (en) | 2009-06-25 | 2022-09-28 | Alkermes Pharma Ireland Limited | Heterocyclic compounds for the treatment of neurological and psychological disorders |
| RU2555760C2 (ru) | 2009-09-11 | 2015-07-10 | Оцука Фармасьютикал Ко., Лтд. | Терапевтический агент против хронической боли |
| WO2011030213A1 (en) | 2009-09-14 | 2011-03-17 | Jubilant Organosys Limited | Improved process for the preparation of 7.(4-bromobutoxy) 3,4-dihydrocarbostyril, a precursor of aripiprazole |
| US8541404B2 (en) | 2009-11-09 | 2013-09-24 | Elexopharm Gmbh | Inhibitors of the human aldosterone synthase CYP11B2 |
| JP5916746B2 (ja) | 2010-11-15 | 2016-05-11 | エージンバイオ, インコーポレイテッド | 認知障害を処置するためのピリダジン誘導体、組成物、および方法 |
| ES2604558T3 (es) | 2011-03-18 | 2017-03-07 | Alkermes Pharma Ireland Limited | Composiciones farmacéuticas inyectables que comprenden un antipsicótico insoluble en agua, laurato de sorbitán y polisorbato 20 |
| WO2012131451A1 (en) | 2011-03-30 | 2012-10-04 | Jubilant Life Sciences Limited | Process for producing aripiprazole in anhydrous type i crystals |
| TW201309651A (zh) | 2011-06-29 | 2013-03-01 | Otsuka Pharma Co Ltd | 阿立哌唑(aripiprazole)無水物B形結晶微粒子之製造方法 |
| EP2827866B1 (en) | 2012-03-19 | 2023-05-03 | Alkermes Pharma Ireland Limited | Pharmaceutical compositions comprising benzyl alcohol |
| WO2013142202A1 (en) | 2012-03-19 | 2013-09-26 | Alkermes Pharma Ireland Limited | Pharmaceutical compositions comprising glycerol esters |
| NZ630643A (en) | 2012-03-19 | 2017-08-25 | Alkermes Pharma Ireland Ltd | Pharmaceutical compositions comprising fatty acid esters |
| CA2872883A1 (en) * | 2012-05-09 | 2013-11-14 | Sunovion Pharmaceuticals Inc. | Heteroaryl compounds and methods of use thereof |
| KR101571670B1 (ko) | 2012-08-08 | 2015-11-25 | 주식회사 씨엠지제약 | 아리피프라졸을 포함하는 경구용 속용 필름 제제 |
| EP3321254B1 (en) * | 2012-08-21 | 2020-08-12 | Janssen Pharmaceutica NV | Haptens of aripiprazole and their use in immunoassays |
| EP2897592B1 (en) | 2012-09-19 | 2020-02-19 | Alkermes Pharma Ireland Limited | Pharmaceutical compositions having improved storage stability |
| US10154988B2 (en) | 2012-11-14 | 2018-12-18 | The Johns Hopkins University | Methods and compositions for treating schizophrenia |
| US10525057B2 (en) | 2013-09-24 | 2020-01-07 | Otsuka Pharmaceutical Co., Ltd. | Method of providing aripiprazole to patients having impaired CYP2D6 or CYP3A4 enzyme function |
| EP3083569B1 (en) | 2013-12-20 | 2022-01-26 | Agenebio, Inc. | Benzodiazepine derivatives, compositions, and methods for treating cognitive impairment |
| JP6524110B2 (ja) | 2014-03-20 | 2019-06-05 | アルカームス ファーマ アイルランド リミテッド | 注射速度が増大したアリピプラゾール調合物 |
| KR20160139704A (ko) | 2015-05-28 | 2016-12-07 | 주식회사 씨엠지제약 | 아리피프라졸을 포함하는 경구용 속용 필름 제제, 및 이의 제조방법 |
| MX384734B (es) | 2015-06-19 | 2025-03-14 | Agenebio Inc | Derivados de benzodiazepina, composiciones y métodos para tratar deterioro cognitivo. |
| US11505555B2 (en) | 2016-12-19 | 2022-11-22 | Agenebio, Inc. | Benzodiazepine derivatives, compositions, and methods for treating cognitive impairment |
| US20180170941A1 (en) | 2016-12-19 | 2018-06-21 | Agenebio, Inc. | Benzodiazepine derivatives, compositions, and methods for treating cognitive impairment |
| AU2019230014B2 (en) | 2018-03-05 | 2024-11-28 | Alkermes Pharma Ireland Limited | Aripiprazole dosing strategy |
| WO2019246300A1 (en) | 2018-06-19 | 2019-12-26 | Agenebio, Inc. | Benzodiazepine derivatives, compositions, and methods for treating cognitive impairment |
| WO2024039886A1 (en) | 2022-08-19 | 2024-02-22 | Agenebio, Inc. | Benzazepine derivatives, compositions, and methods for treating cognitive impairment |
| ES2963237A1 (es) * | 2022-08-25 | 2024-03-25 | Consejo Superior Investigacion | Derivados de quinolina-2(1H)-ona para el tratamiento y prevención de enfermedades neurodegenerativas |
Family Cites Families (37)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA801037A (en) * | 1968-12-10 | Regnier Gilbert | Procede de preparation de nouveaux derives du piperazino-phenylethanol | |
| GB1021522A (en) * | 1963-05-10 | 1966-03-02 | Ici Ltd | 2-quinolone derivatives |
| GB1075156A (en) * | 1963-08-27 | 1967-07-12 | Luso Farmaco Inst | Substituted piperazines |
| NL131192C (enExample) * | 1965-06-16 | |||
| US3362956A (en) * | 1965-08-19 | 1968-01-09 | Sterling Drug Inc | 1-[(heterocyclyl)-lower-alkyl]-4-substituted-piperazines |
| US3706749A (en) * | 1967-03-30 | 1972-12-19 | Mcneilab Inc | N-acyl carbostyrils |
| US3703522A (en) * | 1967-03-30 | 1972-11-21 | Mcneilab Inc | Carbostyril derivatives |
| US3511841A (en) * | 1967-05-29 | 1970-05-12 | Sterling Drug Inc | 1-((4-,5-,6-,and 7-azaindolyl)-lower-alkyl)- 4-substituted-piperazines |
| US3635976A (en) * | 1967-12-20 | 1972-01-18 | Pennwalt Corp | 1 - heterocyclic alkyl-1 2 3 4-tetrahydroquinazolinones and analgesic intermediates thereof |
| CH523899A (de) * | 1968-07-05 | 1972-06-15 | Cassella Farbwerke Mainkur Ag | Verfahren zur Herstellung von Derivaten des 2-Oxo-1,2-dihydro-chinolins |
| DE1795362A1 (de) * | 1968-09-19 | 1972-01-05 | Boehringer Mannheim Gmbh | Basische AEther und Verfahren zur Herstellung derselben |
| DE2123923A1 (de) * | 1971-05-14 | 1972-11-23 | Boehringer Mannheim Gmbh, 6800 Mannheim | 4-eckige Klammer auf omega- (Flavon-7yl-oxy) -alkyl eckige Klammer zu -pigerazin-Derivate und Verfahren zu ihrer Herstellung |
| BE884459Q (fr) * | 1971-05-14 | 1981-01-26 | Boehringer Mannheim Gmbh | Derives de la 4-(omega-(coumarine-7-yl-oxy)-alkyl)-piperazine et procede de preparation |
| DE2335432A1 (de) * | 1973-07-12 | 1975-01-30 | Boehringer Mannheim Gmbh | 3,4-dihydro-2h-naphthalinon-(1)5-oxy-propyl-piperazin-derivate und verfahren zu ihrer herstellung |
| JPS517672B2 (enExample) * | 1972-04-13 | 1976-03-10 | ||
| US3910924A (en) * | 1972-04-13 | 1975-10-07 | Otsuka Pharma Co Ltd | 3,4-Dihydrocarbostyril derivatives and a process for preparing the same |
| US4256890A (en) * | 1972-09-14 | 1981-03-17 | Otsukapharmaceutical Co., Ltd. | 3,4-Dihydrocarbostyril derivatives and process for producing the same |
| NL7314812A (enExample) * | 1972-11-02 | 1974-05-06 | ||
| DE2334009A1 (de) * | 1973-07-04 | 1975-01-23 | Boehringer Mannheim Gmbh | Purin-derivate sowie verfahren zu ihrer herstellung |
| US4083853A (en) * | 1973-09-08 | 1978-04-11 | Eisai Co., Ltd. | 1,3-Benzodioxol derivatives |
| US4026895A (en) * | 1973-09-08 | 1977-05-31 | Eisai Co., Ltd. | 1,3-Benzodioxol derivatives |
| US3981864A (en) * | 1973-09-08 | 1976-09-21 | Eisai Co., Ltd. | 1,3-Benzodioxol derivatives |
| GB1451900A (en) * | 1973-10-30 | 1976-10-06 | Sandoz Ltd | Quinolin-2-1h-ones |
| JPS5089376A (enExample) * | 1973-12-19 | 1975-07-17 | ||
| US4032528A (en) * | 1974-03-25 | 1977-06-28 | Sandoz, Inc. | 1,4-substituted-quinolin-2(1h)-ones as cns agents |
| US3983121A (en) * | 1974-07-01 | 1976-09-28 | Council Of Scientific And Industrial Research | 1-Substituted 4-(β-2-quinolylethyl)piperazines and 1,2,3,4-tetrahydroquinolyl-ethyl analogues thereof |
| US3940397A (en) * | 1974-11-13 | 1976-02-24 | E. R. Squibb & Sons, Inc. | 2-[(Substituted-piperazinyl)alkyl]-1H-benz[de]isoquinoline-1,3(2H)-diones |
| DE2631317A1 (de) * | 1975-07-23 | 1977-02-17 | Sandoz Ag | Organische verbindungen, ihre verwendung und herstellung |
| US3994900A (en) * | 1976-01-23 | 1976-11-30 | E. R. Squibb & Sons, Inc. | 6-(Or 8)-[[(substituted amino)alkyl]oxy(or thio)]-3,4-dihydro-4-phenyl-2(1H)-quinolinones |
| ES456325A1 (es) * | 1976-02-27 | 1978-05-01 | Sandoz Ag | Un procedimiento para la preparacion de nuevos derivados delacido 4-hidroxi-2-quinolinon-3-carboxilico. |
| CH619453A5 (enExample) * | 1976-03-17 | 1980-09-30 | Otsuka Pharma Co Ltd | |
| US4210753A (en) * | 1976-03-17 | 1980-07-01 | Otsuka Pharmaceutical Co., Ltd. | Carbostyril compounds |
| DE2719562C2 (de) * | 1976-05-08 | 1986-05-07 | Otsuka Pharmaceutical Co. Ltd., Tokio/Tokyo | 3, 4-Dihydrocarbostyrilderivate, Verfahren zu deren Herstellung und Arzneimittel, welche diese enthalten |
| US4110449A (en) * | 1977-05-23 | 1978-08-29 | E. R. Squibb & Sons, Inc. | 2-substituted benzisothiazol-3-ones |
| US4166116A (en) * | 1977-11-11 | 1979-08-28 | Canadian Patents And Development Limited | Pharmaceutical compositions containing piperazinyl acylhydroxamic acid derivatives to treat inflammation or anaphylactic allergy conditions |
| DE2960178D1 (en) * | 1978-06-06 | 1981-04-09 | Hoechst Ag | New substituted phenylpiperazine derivatives, pharmaceutical compositions containing them and process for their preparation |
| DE2827566A1 (de) * | 1978-06-23 | 1980-01-10 | Boehringer Mannheim Gmbh | 1,2-dihydro-chinolin-2-on-derivate und verfahren zu ihrer herstellung |
-
1978
- 1978-03-30 JP JP3778378A patent/JPS54130587A/ja active Granted
-
1979
- 1979-03-27 DE DE2912105A patent/DE2912105C2/de not_active Expired
- 1979-03-27 CA CA000324227A patent/CA1117110A/en not_active Expired
- 1979-03-27 DE DE2953723A patent/DE2953723C2/de not_active Expired
- 1979-03-28 AU AU45480/79A patent/AU515531B2/en not_active Expired
- 1979-03-28 US US06/024,602 patent/US4734416A/en not_active Expired - Lifetime
- 1979-03-28 FI FI791034A patent/FI70704C/fi not_active IP Right Cessation
- 1979-03-29 NO NO791049A patent/NO151321C/no unknown
- 1979-03-29 AT AT0235179A patent/AT376432B/de not_active IP Right Cessation
- 1979-03-29 BE BE0/194281A patent/BE875174A/xx not_active IP Right Cessation
- 1979-03-29 DK DK128679A patent/DK158225C/da not_active IP Right Cessation
- 1979-03-29 CH CH295379A patent/CH641455A5/de not_active IP Right Cessation
- 1979-03-29 SU SU792745704A patent/SU1140687A3/ru active
- 1979-03-29 SE SE7902794A patent/SE434945B/sv not_active IP Right Cessation
- 1979-03-29 FR FR7907863A patent/FR2421174A1/fr active Granted
- 1979-03-30 ZA ZA791516A patent/ZA791516B/xx unknown
- 1979-03-30 ES ES479134A patent/ES479134A1/es not_active Expired
- 1979-03-30 GB GB7911155A patent/GB2017701B/en not_active Expired
- 1979-03-30 PT PT69422A patent/PT69422A/pt unknown
- 1979-03-30 NL NLAANVRAGE7902514,A patent/NL183189C/xx not_active IP Right Cessation
- 1979-03-30 MX MX797848U patent/MX5862E/es unknown
- 1979-03-30 IT IT67674/79A patent/IT1119284B/it active
- 1979-12-17 ES ES486990A patent/ES486990A1/es not_active Expired
- 1979-12-17 ES ES486991A patent/ES486991A1/es not_active Expired
- 1979-12-17 ES ES486992A patent/ES486992A1/es not_active Expired
-
1981
- 1981-09-08 SU SU813328599A patent/SU1232144A3/ru active
-
1982
- 1982-03-26 CH CH190082A patent/CH641350A5/de not_active IP Right Cessation
-
1987
- 1987-03-12 US US07/025,193 patent/US4824840A/en not_active Expired - Lifetime
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE434945B (sv) | Karbostyrilderivat | |
| DE3107601C2 (enExample) | ||
| IE903286A1 (en) | 3-(1-substituted-4-piperazinyl)-1h-indazoles, a process for¹their preparation and their use as medicaments | |
| FI76322C (fi) | Foerfarande foer framstaellning av nya, terapeutiskt anvaendbara karbostyrilderivat. | |
| JP2544939B2 (ja) | ベンゾヘテロ環誘導体 | |
| IE47139B1 (en) | 4-substituted-pyrazoles | |
| JPS6320226B2 (enExample) | ||
| PL110782B1 (en) | Method of producing new derivatives of aminopropanol | |
| JPH0212204B2 (enExample) | ||
| JPS6332069B2 (enExample) | ||
| CA1208643A (en) | 1,5-diphenyl-pyrazolin-3-one compounds, process and intermediates for preparation thereof and pharmaceutical compositions containing them | |
| US2935514A (en) | Benzimidazoles | |
| JPH0215537B2 (enExample) | ||
| JPS6331445B2 (enExample) | ||
| US4018793A (en) | Benzo (b) thiophene derivatives | |
| KR820002231B1 (ko) | 신규 카르보스티릴 유도체의 제조방법 | |
| KR850000024B1 (ko) | 카르보스티릴 유도체의 제조방법 | |
| JPS63119467A (ja) | カルボスチリル誘導体 | |
| US4056526A (en) | Benzo(b)thiophene derivatives | |
| JPS6320233B2 (enExample) | ||
| JPS6326753B2 (enExample) | ||
| AT376435B (de) | Verfahren zum herstellen von neuen carbostyrilderivaten und von deren saeureadditionssalzen | |
| KR840001938B1 (ko) | 카르보스티릴유도체 및 그의 염의 제조방법 | |
| JPS6254304B2 (enExample) | ||
| JPS628116B2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| NAL | Patent in force |
Ref document number: 7902794-2 Format of ref document f/p: F |
|
| NUG | Patent has lapsed |
Ref document number: 7902794-2 Format of ref document f/p: F |