RU2278860C2 - Производные триарил-содержащих кислот в качестве лигандов рецепторов ппар - Google Patents
Производные триарил-содержащих кислот в качестве лигандов рецепторов ппар Download PDFInfo
- Publication number
- RU2278860C2 RU2278860C2 RU2001132081/04A RU2001132081A RU2278860C2 RU 2278860 C2 RU2278860 C2 RU 2278860C2 RU 2001132081/04 A RU2001132081/04 A RU 2001132081/04A RU 2001132081 A RU2001132081 A RU 2001132081A RU 2278860 C2 RU2278860 C2 RU 2278860C2
- Authority
- RU
- Russia
- Prior art keywords
- methyl
- phenoxymethyl
- epi
- ylmethoxy
- substituted
- Prior art date
Links
- 239000003446 ligand Substances 0.000 title claims abstract description 19
- 239000002253 acid Substances 0.000 title description 41
- 150000007513 acids Chemical class 0.000 title description 6
- 101150014691 PPARA gene Proteins 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims abstract description 371
- 238000000034 method Methods 0.000 claims abstract description 113
- 150000003839 salts Chemical class 0.000 claims abstract description 75
- 230000027455 binding Effects 0.000 claims abstract description 12
- 239000008194 pharmaceutical composition Substances 0.000 claims abstract description 8
- NOESYZHRGYRDHS-UHFFFAOYSA-N insulin Chemical compound N1C(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(NC(=O)CN)C(C)CC)CSSCC(C(NC(CO)C(=O)NC(CC(C)C)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)NC(CCC(O)=O)C(=O)NC(CC(N)=O)C(=O)NC(CC=2C=CC(O)=CC=2)C(=O)NC(CSSCC(NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2C=CC(O)=CC=2)NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(CCC(O)=O)NC(=O)C(C(C)C)NC(=O)C(CC(C)C)NC(=O)C(CC=2NC=NC=2)NC(=O)C(CO)NC(=O)CNC2=O)C(=O)NCC(=O)NC(CCC(O)=O)C(=O)NC(CCCNC(N)=N)C(=O)NCC(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC=CC=3)C(=O)NC(CC=3C=CC(O)=CC=3)C(=O)NC(C(C)O)C(=O)N3C(CCC3)C(=O)NC(CCCCN)C(=O)NC(C)C(O)=O)C(=O)NC(CC(N)=O)C(O)=O)=O)NC(=O)C(C(C)CC)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C1CSSCC2NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CCC(N)=O)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)CC=1C=CC=CC=1)C(C)C)CC1=CN=CN1 NOESYZHRGYRDHS-UHFFFAOYSA-N 0.000 claims description 56
- 102000004877 Insulin Human genes 0.000 claims description 28
- 108090001061 Insulin Proteins 0.000 claims description 28
- 229940125396 insulin Drugs 0.000 claims description 28
- 102000003728 Peroxisome Proliferator-Activated Receptors Human genes 0.000 claims description 24
- 108090000029 Peroxisome Proliferator-Activated Receptors Proteins 0.000 claims description 24
- 208000001072 type 2 diabetes mellitus Diseases 0.000 claims description 24
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 23
- 201000010099 disease Diseases 0.000 claims description 17
- 206010012601 diabetes mellitus Diseases 0.000 claims description 14
- 206010022489 Insulin Resistance Diseases 0.000 claims description 13
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 claims description 12
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 claims description 12
- 239000008103 glucose Substances 0.000 claims description 12
- 235000021588 free fatty acids Nutrition 0.000 claims description 10
- 210000004369 blood Anatomy 0.000 claims description 9
- 239000008280 blood Substances 0.000 claims description 9
- 208000011580 syndromic disease Diseases 0.000 claims description 8
- 150000003626 triacylglycerols Chemical class 0.000 claims description 8
- 201000008980 hyperinsulinism Diseases 0.000 claims description 7
- 201000001320 Atherosclerosis Diseases 0.000 claims description 6
- 201000001421 hyperglycemia Diseases 0.000 claims description 6
- 208000030814 Eating disease Diseases 0.000 claims description 5
- 208000019454 Feeding and Eating disease Diseases 0.000 claims description 5
- 206010020772 Hypertension Diseases 0.000 claims description 5
- 235000014632 disordered eating Nutrition 0.000 claims description 5
- 201000005577 familial hyperlipidemia Diseases 0.000 claims description 3
- 208000024172 Cardiovascular disease Diseases 0.000 claims description 2
- 239000003937 drug carrier Substances 0.000 claims 1
- 239000000126 substance Substances 0.000 abstract description 34
- 238000011282 treatment Methods 0.000 abstract description 23
- 230000000694 effects Effects 0.000 abstract description 12
- 239000003814 drug Substances 0.000 abstract description 6
- 230000007721 medicinal effect Effects 0.000 abstract 1
- -1 R 8 Chemical compound 0.000 description 293
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 263
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 213
- 239000000243 solution Substances 0.000 description 150
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 146
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 130
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 128
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 125
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 106
- 239000011541 reaction mixture Substances 0.000 description 104
- 235000019439 ethyl acetate Nutrition 0.000 description 94
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 84
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 78
- 239000000203 mixture Substances 0.000 description 77
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 76
- 125000000217 alkyl group Chemical group 0.000 description 73
- 239000000741 silica gel Substances 0.000 description 71
- 229910002027 silica gel Inorganic materials 0.000 description 71
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 65
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 63
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 62
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 61
- 238000006243 chemical reaction Methods 0.000 description 60
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 59
- 239000000460 chlorine Substances 0.000 description 58
- 229910052739 hydrogen Inorganic materials 0.000 description 56
- 125000001072 heteroaryl group Chemical group 0.000 description 55
- 125000000623 heterocyclic group Chemical group 0.000 description 54
- 229910052757 nitrogen Inorganic materials 0.000 description 54
- 239000001257 hydrogen Substances 0.000 description 53
- 238000002330 electrospray ionisation mass spectrometry Methods 0.000 description 52
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 48
- 125000003118 aryl group Chemical group 0.000 description 48
- 239000002904 solvent Substances 0.000 description 45
- 239000012267 brine Substances 0.000 description 44
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 44
- 239000007787 solid Substances 0.000 description 43
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 39
- 238000003818 flash chromatography Methods 0.000 description 37
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 36
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 35
- 238000003756 stirring Methods 0.000 description 34
- 125000004432 carbon atom Chemical group C* 0.000 description 33
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 31
- 235000019341 magnesium sulphate Nutrition 0.000 description 31
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 30
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 30
- 229910000104 sodium hydride Inorganic materials 0.000 description 30
- 239000012044 organic layer Substances 0.000 description 29
- 239000002585 base Substances 0.000 description 28
- 239000000543 intermediate Substances 0.000 description 28
- 108010016731 PPAR gamma Proteins 0.000 description 27
- 238000004440 column chromatography Methods 0.000 description 27
- 229910052717 sulfur Inorganic materials 0.000 description 27
- 102100038825 Peroxisome proliferator-activated receptor gamma Human genes 0.000 description 26
- 125000004433 nitrogen atom Chemical group N* 0.000 description 25
- 102000023984 PPAR alpha Human genes 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 24
- 239000003921 oil Substances 0.000 description 24
- 235000019198 oils Nutrition 0.000 description 24
- 239000012074 organic phase Substances 0.000 description 24
- 108091008725 peroxisome proliferator-activated receptors alpha Proteins 0.000 description 24
- 125000006413 ring segment Chemical group 0.000 description 24
- 125000003710 aryl alkyl group Chemical group 0.000 description 23
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 23
- 229910052736 halogen Inorganic materials 0.000 description 23
- PCLIMKBDDGJMGD-UHFFFAOYSA-N N-bromosuccinimide Chemical compound BrN1C(=O)CCC1=O PCLIMKBDDGJMGD-UHFFFAOYSA-N 0.000 description 22
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 22
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 21
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 21
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 21
- 239000012312 sodium hydride Substances 0.000 description 21
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 20
- 230000015572 biosynthetic process Effects 0.000 description 20
- 125000000753 cycloalkyl group Chemical group 0.000 description 20
- 150000002367 halogens Chemical class 0.000 description 20
- 239000000047 product Substances 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 19
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 19
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 19
- 125000001424 substituent group Chemical group 0.000 description 19
- 239000000556 agonist Substances 0.000 description 18
- 239000003153 chemical reaction reagent Substances 0.000 description 18
- 150000003254 radicals Chemical class 0.000 description 18
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 17
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 17
- 239000012458 free base Substances 0.000 description 17
- 229920006395 saturated elastomer Polymers 0.000 description 17
- 125000004434 sulfur atom Chemical group 0.000 description 17
- 102100038824 Peroxisome proliferator-activated receptor delta Human genes 0.000 description 16
- 239000005557 antagonist Substances 0.000 description 16
- 229910052760 oxygen Inorganic materials 0.000 description 16
- 238000010992 reflux Methods 0.000 description 16
- 238000003786 synthesis reaction Methods 0.000 description 16
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 15
- 150000001204 N-oxides Chemical class 0.000 description 15
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 15
- 229910000027 potassium carbonate Inorganic materials 0.000 description 15
- 238000000746 purification Methods 0.000 description 15
- 238000009833 condensation Methods 0.000 description 14
- 230000005494 condensation Effects 0.000 description 14
- 108091008765 peroxisome proliferator-activated receptors β/δ Proteins 0.000 description 14
- 125000003545 alkoxy group Chemical group 0.000 description 13
- 125000004122 cyclic group Chemical group 0.000 description 13
- 150000002148 esters Chemical class 0.000 description 13
- 230000014509 gene expression Effects 0.000 description 13
- 125000004475 heteroaralkyl group Chemical group 0.000 description 13
- UDNSKBMNXZVXKW-UHFFFAOYSA-N methyl 2-(bromomethyl)-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1CBr UDNSKBMNXZVXKW-UHFFFAOYSA-N 0.000 description 13
- 239000001301 oxygen Substances 0.000 description 13
- KDLHZDBZIXYQEI-UHFFFAOYSA-N palladium Substances [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 13
- 102000005962 receptors Human genes 0.000 description 13
- 108020003175 receptors Proteins 0.000 description 13
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 12
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical class C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 150000001299 aldehydes Chemical class 0.000 description 12
- 239000003472 antidiabetic agent Substances 0.000 description 12
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 description 12
- 239000012634 fragment Substances 0.000 description 12
- 125000002252 acyl group Chemical group 0.000 description 11
- 125000004429 atom Chemical group 0.000 description 11
- 210000004027 cell Anatomy 0.000 description 11
- 238000001816 cooling Methods 0.000 description 11
- 125000000392 cycloalkenyl group Chemical group 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 125000004453 alkoxycarbonyl group Chemical group 0.000 description 10
- 150000001412 amines Chemical group 0.000 description 10
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 10
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 10
- 239000000706 filtrate Substances 0.000 description 10
- 125000005349 heteroarylcycloalkyl group Chemical group 0.000 description 10
- 229940126904 hypoglycaemic agent Drugs 0.000 description 10
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 10
- 235000017557 sodium bicarbonate Nutrition 0.000 description 10
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 10
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 10
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 10
- SWBPKWRVRIRWRL-UHFFFAOYSA-N 2-[2-(bromomethyl)-4-chloro-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(CBr)=C1OCC#N SWBPKWRVRIRWRL-UHFFFAOYSA-N 0.000 description 9
- WKZPEPYQSLALEE-UHFFFAOYSA-N 2-[2-(bromomethyl)-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(CBr)=C1OCC#N WKZPEPYQSLALEE-UHFFFAOYSA-N 0.000 description 9
- CHDBKJCPABWQEL-UHFFFAOYSA-N 2-[2-[(3-hydroxyphenoxy)methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(O)C=CC=2)=C1OCC#N CHDBKJCPABWQEL-UHFFFAOYSA-N 0.000 description 9
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 9
- 241000534944 Thia Species 0.000 description 9
- 210000001789 adipocyte Anatomy 0.000 description 9
- 239000013058 crude material Substances 0.000 description 9
- 230000009467 reduction Effects 0.000 description 9
- 238000006722 reduction reaction Methods 0.000 description 9
- 125000003831 tetrazolyl group Chemical group 0.000 description 9
- WDETYCRYUBGKCE-UHFFFAOYSA-N 2-(chloromethyl)quinolin-1-ium;chloride Chemical compound Cl.C1=CC=CC2=NC(CCl)=CC=C21 WDETYCRYUBGKCE-UHFFFAOYSA-N 0.000 description 8
- UFINMQZIYXBSNL-UHFFFAOYSA-N 3-(quinolin-2-ylmethoxy)phenol Chemical compound OC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 UFINMQZIYXBSNL-UHFFFAOYSA-N 0.000 description 8
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 8
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 8
- 239000012190 activator Substances 0.000 description 8
- 125000003342 alkenyl group Chemical group 0.000 description 8
- 230000029936 alkylation Effects 0.000 description 8
- 238000005804 alkylation reaction Methods 0.000 description 8
- 150000001408 amides Chemical class 0.000 description 8
- 235000019270 ammonium chloride Nutrition 0.000 description 8
- 125000004350 aryl cycloalkyl group Chemical group 0.000 description 8
- 238000009739 binding Methods 0.000 description 8
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 8
- 230000004069 differentiation Effects 0.000 description 8
- 230000007062 hydrolysis Effects 0.000 description 8
- 238000006460 hydrolysis reaction Methods 0.000 description 8
- RCCPEORTSYDPMB-UHFFFAOYSA-N hydroxy benzenecarboximidothioate Chemical compound OSC(=N)C1=CC=CC=C1 RCCPEORTSYDPMB-UHFFFAOYSA-N 0.000 description 8
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Chemical class C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 8
- 150000002500 ions Chemical class 0.000 description 8
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 8
- XZWYZXLIPXDOLR-UHFFFAOYSA-N metformin Chemical compound CN(C)C(=N)NC(N)=N XZWYZXLIPXDOLR-UHFFFAOYSA-N 0.000 description 8
- 229960003105 metformin Drugs 0.000 description 8
- 150000002825 nitriles Chemical class 0.000 description 8
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 8
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 8
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 8
- 239000002243 precursor Substances 0.000 description 8
- 230000002829 reductive effect Effects 0.000 description 8
- 238000004544 sputter deposition Methods 0.000 description 8
- 239000007858 starting material Substances 0.000 description 8
- 150000003573 thiols Chemical class 0.000 description 8
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 7
- 210000002237 B-cell of pancreatic islet Anatomy 0.000 description 7
- 239000005711 Benzoic acid Substances 0.000 description 7
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 7
- 235000011054 acetic acid Nutrition 0.000 description 7
- 235000010233 benzoic acid Nutrition 0.000 description 7
- 239000012153 distilled water Substances 0.000 description 7
- 238000001035 drying Methods 0.000 description 7
- 239000012039 electrophile Substances 0.000 description 7
- JAQOPDRJCNXCTH-UHFFFAOYSA-N ethyl 2-[2-(bromomethyl)-6-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1CBr JAQOPDRJCNXCTH-UHFFFAOYSA-N 0.000 description 7
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000007254 oxidation reaction Methods 0.000 description 7
- 238000002360 preparation method Methods 0.000 description 7
- 108090000623 proteins and genes Proteins 0.000 description 7
- 238000006467 substitution reaction Methods 0.000 description 7
- 125000001544 thienyl group Chemical group 0.000 description 7
- GXPHKUHSUJUWKP-UHFFFAOYSA-N troglitazone Chemical compound C1CC=2C(C)=C(O)C(C)=C(C)C=2OC1(C)COC(C=C1)=CC=C1CC1SC(=O)NC1=O GXPHKUHSUJUWKP-UHFFFAOYSA-N 0.000 description 7
- 229960001641 troglitazone Drugs 0.000 description 7
- GXPHKUHSUJUWKP-NTKDMRAZSA-N troglitazone Natural products C([C@@]1(OC=2C(C)=C(C(=C(C)C=2CC1)O)C)C)OC(C=C1)=CC=C1C[C@H]1SC(=O)NC1=O GXPHKUHSUJUWKP-NTKDMRAZSA-N 0.000 description 7
- ZHYUBXMNROZUMC-UHFFFAOYSA-N 1-[3-(2-methoxyethoxymethoxy)phenyl]-n-methylmethanamine Chemical compound CNCC1=CC=CC(OCOCCOC)=C1 ZHYUBXMNROZUMC-UHFFFAOYSA-N 0.000 description 6
- UGPQPVWABPCSIP-UHFFFAOYSA-N 2-(bromomethyl)-6-fluoroquinoline Chemical compound N1=C(CBr)C=CC2=CC(F)=CC=C21 UGPQPVWABPCSIP-UHFFFAOYSA-N 0.000 description 6
- ZCLGQOJKHGKPHW-UHFFFAOYSA-N 2-[2-[[3-(bromomethyl)phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CBr)C=CC=2)=C1OCC#N ZCLGQOJKHGKPHW-UHFFFAOYSA-N 0.000 description 6
- JKNOFAQOAIIQAD-UHFFFAOYSA-N 2-[[3-(chloromethyl)phenoxy]methyl]quinoline;hydrochloride Chemical compound Cl.ClCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JKNOFAQOAIIQAD-UHFFFAOYSA-N 0.000 description 6
- PJOOIAZRUIIQMU-UHFFFAOYSA-N 2-hydroxy-4-methoxy-6-methylbenzoic acid ethyl ester Chemical compound CCOC(=O)C1=C(C)C=C(OC)C=C1O PJOOIAZRUIIQMU-UHFFFAOYSA-N 0.000 description 6
- LIPCUWYOYHYHLB-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)phenol Chemical compound COCCOCOC1=CC=CC(O)=C1 LIPCUWYOYHYHLB-UHFFFAOYSA-N 0.000 description 6
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 6
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 6
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical compound CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 6
- 208000008589 Obesity Diseases 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical class C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 6
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 6
- 150000001350 alkyl halides Chemical class 0.000 description 6
- 150000001450 anions Chemical class 0.000 description 6
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 239000010410 layer Substances 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 125000001624 naphthyl group Chemical group 0.000 description 6
- 235000020824 obesity Nutrition 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Chemical class COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- 210000001519 tissue Anatomy 0.000 description 6
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 5
- OFUFXTHGZWIDDB-UHFFFAOYSA-N 2-chloroquinoline Chemical compound C1=CC=CC2=NC(Cl)=CC=C21 OFUFXTHGZWIDDB-UHFFFAOYSA-N 0.000 description 5
- 239000004342 Benzoyl peroxide Substances 0.000 description 5
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 5
- 229940123464 Thiazolidinedione Drugs 0.000 description 5
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 238000013459 approach Methods 0.000 description 5
- 125000003435 aroyl group Chemical group 0.000 description 5
- 235000019400 benzoyl peroxide Nutrition 0.000 description 5
- JHIWVOJDXOSYLW-UHFFFAOYSA-N butyl 2,2-difluorocyclopropane-1-carboxylate Chemical class CCCCOC(=O)C1CC1(F)F JHIWVOJDXOSYLW-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- 239000003054 catalyst Substances 0.000 description 5
- 230000007423 decrease Effects 0.000 description 5
- 208000035475 disorder Diseases 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- 229940079593 drug Drugs 0.000 description 5
- OAKJQQAXSVQMHS-UHFFFAOYSA-N hydrazine Substances NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 5
- 210000004185 liver Anatomy 0.000 description 5
- 229910052751 metal Inorganic materials 0.000 description 5
- 239000002184 metal Substances 0.000 description 5
- CXGXJNFJXPUDOV-UHFFFAOYSA-N methyl 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(O)=C1 CXGXJNFJXPUDOV-UHFFFAOYSA-N 0.000 description 5
- 239000007800 oxidant agent Substances 0.000 description 5
- 230000003647 oxidation Effects 0.000 description 5
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical group [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 5
- 230000000144 pharmacologic effect Effects 0.000 description 5
- 125000004076 pyridyl group Chemical group 0.000 description 5
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 description 5
- 125000001567 quinoxalinyl group Chemical group N1=C(C=NC2=CC=CC=C12)* 0.000 description 5
- DPKBAXPHAYBPRL-UHFFFAOYSA-M tetrabutylazanium;iodide Chemical compound [I-].CCCC[N+](CCCC)(CCCC)CCCC DPKBAXPHAYBPRL-UHFFFAOYSA-M 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 5
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 5
- 230000009466 transformation Effects 0.000 description 5
- SUNMBRGCANLOEG-UHFFFAOYSA-N 1,3-dichloroacetone Chemical compound ClCC(=O)CCl SUNMBRGCANLOEG-UHFFFAOYSA-N 0.000 description 4
- BIAAQBNMRITRDV-UHFFFAOYSA-N 1-(chloromethoxy)-2-methoxyethane Chemical compound COCCOCCl BIAAQBNMRITRDV-UHFFFAOYSA-N 0.000 description 4
- DDEAEWMDOSXKBX-UHFFFAOYSA-N 2-(chloromethyl)quinoline Chemical class C1=CC=CC2=NC(CCl)=CC=C21 DDEAEWMDOSXKBX-UHFFFAOYSA-N 0.000 description 4
- AAUVNJJBLOZTAO-UHFFFAOYSA-N 2-(chloromethyl)quinoxaline Chemical compound C1=CC=CC2=NC(CCl)=CN=C21 AAUVNJJBLOZTAO-UHFFFAOYSA-N 0.000 description 4
- XHYVBIXKORFHFM-UHFFFAOYSA-N 2-amino-6-methylbenzoic acid Chemical compound CC1=CC=CC(N)=C1C(O)=O XHYVBIXKORFHFM-UHFFFAOYSA-N 0.000 description 4
- REXUYBKPWIPONM-UHFFFAOYSA-N 2-bromoacetonitrile Chemical compound BrCC#N REXUYBKPWIPONM-UHFFFAOYSA-N 0.000 description 4
- JXNAIOCJWBJGFQ-UHFFFAOYSA-N 2-methyl-5-phenylpyridine Chemical compound C1=NC(C)=CC=C1C1=CC=CC=C1 JXNAIOCJWBJGFQ-UHFFFAOYSA-N 0.000 description 4
- VPDAGUVEZGEHJJ-UHFFFAOYSA-N 2-quinolin-2-ylethanol Chemical compound C1=CC=CC2=NC(CCO)=CC=C21 VPDAGUVEZGEHJJ-UHFFFAOYSA-N 0.000 description 4
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 4
- IAVREABSGIHHMO-UHFFFAOYSA-N 3-hydroxybenzaldehyde Chemical compound OC1=CC=CC(C=O)=C1 IAVREABSGIHHMO-UHFFFAOYSA-N 0.000 description 4
- OKVJCVWFVRATSG-UHFFFAOYSA-N 3-hydroxybenzyl alcohol Chemical compound OCC1=CC=CC(O)=C1 OKVJCVWFVRATSG-UHFFFAOYSA-N 0.000 description 4
- NICNTKXFRWNCMP-UHFFFAOYSA-N 3-methyl-5-(quinolin-2-ylmethoxy)phenol Chemical compound CC1=CC(O)=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 NICNTKXFRWNCMP-UHFFFAOYSA-N 0.000 description 4
- ANSKJZIDWXDAJW-UHFFFAOYSA-N 4-(chloromethyl)-2-phenyl-1,3-oxazole Chemical compound ClCC1=COC(C=2C=CC=CC=2)=N1 ANSKJZIDWXDAJW-UHFFFAOYSA-N 0.000 description 4
- WZADRYDUBBGITL-UHFFFAOYSA-N 6-hydroxy-1,3,3-trimethylindol-2-one Chemical compound C1=C(O)C=C2N(C)C(=O)C(C)(C)C2=C1 WZADRYDUBBGITL-UHFFFAOYSA-N 0.000 description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 4
- 102000015779 HDL Lipoproteins Human genes 0.000 description 4
- 108010010234 HDL Lipoproteins Proteins 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- 206010060378 Hyperinsulinaemia Diseases 0.000 description 4
- 208000013016 Hypoglycemia Diseases 0.000 description 4
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 4
- 108010029660 Intrinsically Disordered Proteins Proteins 0.000 description 4
- 102100039905 Isocitrate dehydrogenase [NADP] cytoplasmic Human genes 0.000 description 4
- 102000007330 LDL Lipoproteins Human genes 0.000 description 4
- 108010007622 LDL Lipoproteins Proteins 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- JGFZNNIVVJXRND-UHFFFAOYSA-N N,N-Diisopropylethylamine (DIPEA) Chemical compound CCN(C(C)C)C(C)C JGFZNNIVVJXRND-UHFFFAOYSA-N 0.000 description 4
- 102000008299 Nitric Oxide Synthase Human genes 0.000 description 4
- 108010021487 Nitric Oxide Synthase Proteins 0.000 description 4
- 108010015181 PPAR delta Proteins 0.000 description 4
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 4
- RJKFOVLPORLFTN-LEKSSAKUSA-N Progesterone Chemical compound C1CC2=CC(=O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H](C(=O)C)[C@@]1(C)CC2 RJKFOVLPORLFTN-LEKSSAKUSA-N 0.000 description 4
- 229940100389 Sulfonylurea Drugs 0.000 description 4
- BFYQBIZAJLWIQP-UHFFFAOYSA-N [1-(quinolin-2-ylmethyl)imidazol-4-yl]methanol Chemical compound C1=NC(CO)=CN1CC1=CC=C(C=CC=C2)C2=N1 BFYQBIZAJLWIQP-UHFFFAOYSA-N 0.000 description 4
- FARMNDXIOAHJMF-UHFFFAOYSA-N [3-(quinolin-2-ylmethoxy)phenyl]methanol Chemical compound OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 FARMNDXIOAHJMF-UHFFFAOYSA-N 0.000 description 4
- 230000004913 activation Effects 0.000 description 4
- 238000005917 acylation reaction Methods 0.000 description 4
- 239000003125 aqueous solvent Substances 0.000 description 4
- 125000004104 aryloxy group Chemical group 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 125000001164 benzothiazolyl group Chemical group S1C(=NC2=C1C=CC=C2)* 0.000 description 4
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 4
- 229910052794 bromium Inorganic materials 0.000 description 4
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 4
- 238000003776 cleavage reaction Methods 0.000 description 4
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 4
- 208000029078 coronary artery disease Diseases 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000002552 dosage form Substances 0.000 description 4
- ZEWPZEBGRPGDEP-UHFFFAOYSA-N ethyl 2-[2-(3-hydroxyphenyl)ethynyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1C#CC1=CC=CC(O)=C1 ZEWPZEBGRPGDEP-UHFFFAOYSA-N 0.000 description 4
- BNAGKEKBEJEVFJ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methyl-4-phenylmethoxybenzoate Chemical compound C1=C(O)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 BNAGKEKBEJEVFJ-UHFFFAOYSA-N 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 230000003451 hyperinsulinaemic effect Effects 0.000 description 4
- 230000002218 hypoglycaemic effect Effects 0.000 description 4
- 239000005457 ice water Substances 0.000 description 4
- 230000001771 impaired effect Effects 0.000 description 4
- 230000003914 insulin secretion Effects 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- 229910052744 lithium Inorganic materials 0.000 description 4
- UDWQWRFEUXUBHR-UHFFFAOYSA-N methyl 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)acetate Chemical compound O1C(C)=C(CC(=O)OC)N=C1C1=CC=CC=C1 UDWQWRFEUXUBHR-UHFFFAOYSA-N 0.000 description 4
- YRJIMTHQIPOSJR-UHFFFAOYSA-N methyl 2-hydroxy-6-methoxybenzoate Chemical compound COC(=O)C1=C(O)C=CC=C1OC YRJIMTHQIPOSJR-UHFFFAOYSA-N 0.000 description 4
- NYOQCBNWZJUEPS-UHFFFAOYSA-N methyl 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 NYOQCBNWZJUEPS-UHFFFAOYSA-N 0.000 description 4
- OSWPMRLSEDHDFF-UHFFFAOYSA-N methyl salicylate Chemical compound COC(=O)C1=CC=CC=C1O OSWPMRLSEDHDFF-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 230000036542 oxidative stress Effects 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- HXITXNWTGFUOAU-UHFFFAOYSA-N phenylboronic acid Chemical compound OB(O)C1=CC=CC=C1 HXITXNWTGFUOAU-UHFFFAOYSA-N 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 150000004892 pyridazines Chemical class 0.000 description 4
- 150000003222 pyridines Chemical class 0.000 description 4
- 229940044601 receptor agonist Drugs 0.000 description 4
- 239000000018 receptor agonist Substances 0.000 description 4
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 4
- 229960001860 salicylate Drugs 0.000 description 4
- 230000007017 scission Effects 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- 150000001467 thiazolidinediones Chemical class 0.000 description 4
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 4
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 4
- XUFXOAAUWZOOIT-SXARVLRPSA-N (2R,3R,4R,5S,6R)-5-[[(2R,3R,4R,5S,6R)-5-[[(2R,3R,4S,5S,6R)-3,4-dihydroxy-6-methyl-5-[[(1S,4R,5S,6S)-4,5,6-trihydroxy-3-(hydroxymethyl)-1-cyclohex-2-enyl]amino]-2-oxanyl]oxy]-3,4-dihydroxy-6-(hydroxymethyl)-2-oxanyl]oxy]-6-(hydroxymethyl)oxane-2,3,4-triol Chemical compound O([C@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O[C@H]1O[C@@H]([C@H]([C@H](O)[C@H]1O)N[C@@H]1[C@@H]([C@@H](O)[C@H](O)C(CO)=C1)O)C)[C@@H]1[C@@H](CO)O[C@@H](O)[C@H](O)[C@H]1O XUFXOAAUWZOOIT-SXARVLRPSA-N 0.000 description 3
- 125000004607 1,2,3,4-tetrahydroquinolinyl group Chemical group N1(CCCC2=CC=CC=C12)* 0.000 description 3
- UQSRXQMIXSZGLA-UHFFFAOYSA-N 2,4-dihydroxy-6-methylbenzoic acid ethyl ester Chemical compound CCOC(=O)C1=C(C)C=C(O)C=C1O UQSRXQMIXSZGLA-UHFFFAOYSA-N 0.000 description 3
- AXRVMKOHOIVYCO-UHFFFAOYSA-N 2-(4-chloro-2,6-dimethylphenoxy)acetonitrile Chemical compound CC1=CC(Cl)=CC(C)=C1OCC#N AXRVMKOHOIVYCO-UHFFFAOYSA-N 0.000 description 3
- OUJMXIPHUCDRAS-UHFFFAOYSA-N 2-(5-ethylpyridin-2-yl)ethanol Chemical compound CCC1=CC=C(CCO)N=C1 OUJMXIPHUCDRAS-UHFFFAOYSA-N 0.000 description 3
- IFOZFMPOHZGLBK-UHFFFAOYSA-N 2-(chloromethyl)-6-methoxyquinoline Chemical compound N1=C(CCl)C=CC2=CC(OC)=CC=C21 IFOZFMPOHZGLBK-UHFFFAOYSA-N 0.000 description 3
- YGYLYDPPSJSHDL-UHFFFAOYSA-N 2-[2-(bromomethyl)-4,6-dichlorophenoxy]acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(CBr)=C1 YGYLYDPPSJSHDL-UHFFFAOYSA-N 0.000 description 3
- SIZIZUJLNDIVKO-UHFFFAOYSA-N 2-[2-(hydroxymethyl)-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(CO)=C1OCC#N SIZIZUJLNDIVKO-UHFFFAOYSA-N 0.000 description 3
- VRUOYSZMHTWAHK-UHFFFAOYSA-N 2-[2-[3-(2-methoxyethoxymethoxy)phenyl]ethenyl]quinoline Chemical compound COCCOCOC1=CC=CC(C=CC=2N=C3C=CC=CC3=CC=2)=C1 VRUOYSZMHTWAHK-UHFFFAOYSA-N 0.000 description 3
- VTYJIEUZFGCIAR-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-quinolin-2-ylethenyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(C=CC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O VTYJIEUZFGCIAR-UHFFFAOYSA-N 0.000 description 3
- PSLFDJBNJYPLSW-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(quinolin-2-ylamino)methyl]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CNC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N PSLFDJBNJYPLSW-UHFFFAOYSA-N 0.000 description 3
- BORMBPIQGSCLLT-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N BORMBPIQGSCLLT-UHFFFAOYSA-N 0.000 description 3
- FKUGDVWLSKPQLV-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]pyridine Chemical compound COCCOCOC1=CC=CC(COCC=2N=CC=CC=2)=C1 FKUGDVWLSKPQLV-UHFFFAOYSA-N 0.000 description 3
- JPZPEJDBZKWALY-UHFFFAOYSA-N 2-[[3-[[2-(hydroxymethyl)-3-methylphenyl]methoxy]phenoxy]methyl]-3-methylquinazolin-4-one Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C(=O)C4=CC=CC=C4N=3)C)C=CC=2)=C1CO JPZPEJDBZKWALY-UHFFFAOYSA-N 0.000 description 3
- PFKMPZBEUUAELA-UHFFFAOYSA-N 2-amino-3,6-dimethylbenzoic acid Chemical compound CC1=CC=C(C)C(C(O)=O)=C1N PFKMPZBEUUAELA-UHFFFAOYSA-N 0.000 description 3
- NVWIRJHCQPDULZ-UHFFFAOYSA-N 2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzaldehyde Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C(=O)C4=CC=CC=C4N=3)C)C=CC=2)=C1C=O NVWIRJHCQPDULZ-UHFFFAOYSA-N 0.000 description 3
- BKZWROUPWSNZPA-UHFFFAOYSA-N 2-methylpropyl 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfanylmethyl]benzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CSC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 BKZWROUPWSNZPA-UHFFFAOYSA-N 0.000 description 3
- BXGYBSJAZFGIPX-UHFFFAOYSA-N 2-pyridin-2-ylethanol Chemical compound OCCC1=CC=CC=N1 BXGYBSJAZFGIPX-UHFFFAOYSA-N 0.000 description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 3
- VBUZAHLUWZTYIQ-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)benzaldehyde Chemical compound COCCOCOC1=CC=CC(C=O)=C1 VBUZAHLUWZTYIQ-UHFFFAOYSA-N 0.000 description 3
- GHUWCXKGPZWALP-UHFFFAOYSA-N 3-(2-pyridin-2-ylethoxy)phenol Chemical compound OC1=CC=CC(OCCC=2N=CC=CC=2)=C1 GHUWCXKGPZWALP-UHFFFAOYSA-N 0.000 description 3
- ISVBGXFYYGKQEZ-UHFFFAOYSA-N 3-(2-pyridin-2-yloxyethoxy)phenol Chemical compound OC1=CC=CC(OCCOC=2N=CC=CC=2)=C1 ISVBGXFYYGKQEZ-UHFFFAOYSA-N 0.000 description 3
- RZENAZZCHMPRHI-UHFFFAOYSA-N 3-(2-quinolin-2-ylethenyl)phenol Chemical compound OC1=CC=CC(C=CC=2N=C3C=CC=CC3=CC=2)=C1 RZENAZZCHMPRHI-UHFFFAOYSA-N 0.000 description 3
- HDPGVLSPCOHINY-UHFFFAOYSA-N 3-(quinolin-2-ylmethoxymethyl)phenol Chemical compound OC1=CC=CC(COCC=2N=C3C=CC=CC3=CC=2)=C1 HDPGVLSPCOHINY-UHFFFAOYSA-N 0.000 description 3
- HRQOCTMSQBYACS-UHFFFAOYSA-N 3-[(1,3-benzoxazol-2-ylamino)methyl]phenol Chemical compound OC1=CC=CC(CNC=2OC3=CC=CC=C3N=2)=C1 HRQOCTMSQBYACS-UHFFFAOYSA-N 0.000 description 3
- IPPQNXSAJZOTJZ-UHFFFAOYSA-N 3-methylsalicylaldehyde Chemical compound CC1=CC=CC(C=O)=C1O IPPQNXSAJZOTJZ-UHFFFAOYSA-N 0.000 description 3
- SVEGSFSFMLCNFF-UHFFFAOYSA-N 4-(chloromethyl)-2-phenyl-1,3-thiazole Chemical compound ClCC1=CSC(C=2C=CC=CC=2)=N1 SVEGSFSFMLCNFF-UHFFFAOYSA-N 0.000 description 3
- VWYKSJIPZHRLNO-UHFFFAOYSA-N 4-chloro-2,6-dimethylphenol Chemical compound CC1=CC(Cl)=CC(C)=C1O VWYKSJIPZHRLNO-UHFFFAOYSA-N 0.000 description 3
- BEDVIIYPOFMZRE-UHFFFAOYSA-N 4-chloro-2-(chloromethyl)quinoline Chemical compound C1=CC=CC2=NC(CCl)=CC(Cl)=C21 BEDVIIYPOFMZRE-UHFFFAOYSA-N 0.000 description 3
- HQAIROMRVBVWSK-UHFFFAOYSA-N 4-chloro-2-methylquinoline Chemical compound C1=CC=CC2=NC(C)=CC(Cl)=C21 HQAIROMRVBVWSK-UHFFFAOYSA-N 0.000 description 3
- NTSLROIKFLNUIJ-UHFFFAOYSA-N 5-Ethyl-2-methylpyridine Chemical compound CCC1=CC=C(C)N=C1 NTSLROIKFLNUIJ-UHFFFAOYSA-N 0.000 description 3
- KNCHDRLWPAKSII-UHFFFAOYSA-N 5-ethyl-2-methylpyridine Natural products CCC1=CC=NC(C)=C1 KNCHDRLWPAKSII-UHFFFAOYSA-N 0.000 description 3
- IDDIQDVSYHYORP-UHFFFAOYSA-N 6,7-difluoroquinoline Chemical compound C1=CN=C2C=C(F)C(F)=CC2=C1 IDDIQDVSYHYORP-UHFFFAOYSA-N 0.000 description 3
- UUURKCKHQXFBQP-UHFFFAOYSA-N 6,8-difluoro-2-methylquinoline Chemical compound C1=C(F)C=C(F)C2=NC(C)=CC=C21 UUURKCKHQXFBQP-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 229940077274 Alpha glucosidase inhibitor Drugs 0.000 description 3
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 3
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 3
- 208000005623 Carcinogenesis Diseases 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- RKWGIWYCVPQPMF-UHFFFAOYSA-N Chloropropamide Chemical compound CCCNC(=O)NS(=O)(=O)C1=CC=C(Cl)C=C1 RKWGIWYCVPQPMF-UHFFFAOYSA-N 0.000 description 3
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 3
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 3
- 206010061218 Inflammation Diseases 0.000 description 3
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- 238000006751 Mitsunobu reaction Methods 0.000 description 3
- 206010028980 Neoplasm Diseases 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- PCNDJXKNXGMECE-UHFFFAOYSA-N Phenazine Chemical class C1=CC=CC2=NC3=CC=CC=C3N=C21 PCNDJXKNXGMECE-UHFFFAOYSA-N 0.000 description 3
- LGRFSURHDFAFJT-UHFFFAOYSA-N Phthalic anhydride Natural products C1=CC=C2C(=O)OC(=O)C2=C1 LGRFSURHDFAFJT-UHFFFAOYSA-N 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 3
- DKGAVHZHDRPRBM-UHFFFAOYSA-N Tert-Butanol Chemical compound CC(C)(C)O DKGAVHZHDRPRBM-UHFFFAOYSA-N 0.000 description 3
- JLRGJRBPOGGCBT-UHFFFAOYSA-N Tolbutamide Chemical compound CCCCNC(=O)NS(=O)(=O)C1=CC=C(C)C=C1 JLRGJRBPOGGCBT-UHFFFAOYSA-N 0.000 description 3
- FMPAIVMIVVQUDZ-UHFFFAOYSA-N [3-(2-methoxyethoxymethoxy)phenyl]methanamine Chemical compound COCCOCOC1=CC=CC(CN)=C1 FMPAIVMIVVQUDZ-UHFFFAOYSA-N 0.000 description 3
- BBHQVXKRKNSJRS-UHFFFAOYSA-N [3-(2-methoxyethoxymethoxy)phenyl]methanol Chemical compound COCCOCOC1=CC=CC(CO)=C1 BBHQVXKRKNSJRS-UHFFFAOYSA-N 0.000 description 3
- JYYZLOXTAAZIRR-UHFFFAOYSA-N [3-(quinolin-2-ylmethyl)imidazol-4-yl]methanol Chemical compound OCC1=CN=CN1CC1=CC=C(C=CC=C2)C2=N1 JYYZLOXTAAZIRR-UHFFFAOYSA-N 0.000 description 3
- 229960002632 acarbose Drugs 0.000 description 3
- XUFXOAAUWZOOIT-UHFFFAOYSA-N acarviostatin I01 Natural products OC1C(O)C(NC2C(C(O)C(O)C(CO)=C2)O)C(C)OC1OC(C(C1O)O)C(CO)OC1OC1C(CO)OC(O)C(O)C1O XUFXOAAUWZOOIT-UHFFFAOYSA-N 0.000 description 3
- 229960001466 acetohexamide Drugs 0.000 description 3
- VGZSUPCWNCWDAN-UHFFFAOYSA-N acetohexamide Chemical compound C1=CC(C(=O)C)=CC=C1S(=O)(=O)NC(=O)NC1CCCCC1 VGZSUPCWNCWDAN-UHFFFAOYSA-N 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 150000001336 alkenes Chemical class 0.000 description 3
- 150000004703 alkoxides Chemical class 0.000 description 3
- 125000004414 alkyl thio group Chemical group 0.000 description 3
- 230000002152 alkylating effect Effects 0.000 description 3
- 150000001413 amino acids Chemical class 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 125000004659 aryl alkyl thio group Chemical group 0.000 description 3
- 125000005110 aryl thio group Chemical group 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 125000003785 benzimidazolyl group Chemical group N1=C(NC2=C1C=CC=C2)* 0.000 description 3
- 125000000499 benzofuranyl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 3
- KCXMKQUNVWSEMD-UHFFFAOYSA-N benzyl chloride Chemical compound ClCC1=CC=CC=C1 KCXMKQUNVWSEMD-UHFFFAOYSA-N 0.000 description 3
- 229940073608 benzyl chloride Drugs 0.000 description 3
- 230000033228 biological regulation Effects 0.000 description 3
- XSEUMFJMFFMCIU-UHFFFAOYSA-N buformin Chemical compound CCCC\N=C(/N)N=C(N)N XSEUMFJMFFMCIU-UHFFFAOYSA-N 0.000 description 3
- 229960004111 buformin Drugs 0.000 description 3
- BTANRVKWQNVYAZ-UHFFFAOYSA-N butan-2-ol Chemical compound CCC(C)O BTANRVKWQNVYAZ-UHFFFAOYSA-N 0.000 description 3
- 230000036952 cancer formation Effects 0.000 description 3
- 150000001721 carbon Chemical group 0.000 description 3
- 239000011203 carbon fibre reinforced carbon Substances 0.000 description 3
- 229910002091 carbon monoxide Inorganic materials 0.000 description 3
- 231100000504 carcinogenesis Toxicity 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 3
- 229960001761 chlorpropamide Drugs 0.000 description 3
- 238000004587 chromatography analysis Methods 0.000 description 3
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 3
- 238000002648 combination therapy Methods 0.000 description 3
- 125000004093 cyano group Chemical group *C#N 0.000 description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 3
- 238000011161 development Methods 0.000 description 3
- 230000018109 developmental process Effects 0.000 description 3
- 238000006193 diazotization reaction Methods 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 3
- UAOMVDZJSHZZME-UHFFFAOYSA-N diisopropylamine Chemical compound CC(C)NC(C)C UAOMVDZJSHZZME-UHFFFAOYSA-N 0.000 description 3
- 230000032050 esterification Effects 0.000 description 3
- 238000005886 esterification reaction Methods 0.000 description 3
- FZZMGSQVUQSEEI-UHFFFAOYSA-N ethyl 2-[[3-[(6-chloropyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(Cl)C=CC=2)=C1 FZZMGSQVUQSEEI-UHFFFAOYSA-N 0.000 description 3
- CXVHNOVIWFFVAP-UHFFFAOYSA-N ethyl 2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound C1=C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 CXVHNOVIWFFVAP-UHFFFAOYSA-N 0.000 description 3
- PQJJJMRNHATNKG-UHFFFAOYSA-N ethyl bromoacetate Chemical compound CCOC(=O)CBr PQJJJMRNHATNKG-UHFFFAOYSA-N 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 150000004665 fatty acids Chemical class 0.000 description 3
- 239000012467 final product Substances 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 238000007306 functionalization reaction Methods 0.000 description 3
- 229960004580 glibenclamide Drugs 0.000 description 3
- ZJJXGWJIGJFDTL-UHFFFAOYSA-N glipizide Chemical compound C1=NC(C)=CN=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZJJXGWJIGJFDTL-UHFFFAOYSA-N 0.000 description 3
- 229960001381 glipizide Drugs 0.000 description 3
- ZNNLBTZKUZBEKO-UHFFFAOYSA-N glyburide Chemical compound COC1=CC=C(Cl)C=C1C(=O)NCCC1=CC=C(S(=O)(=O)NC(=O)NC2CCCCC2)C=C1 ZNNLBTZKUZBEKO-UHFFFAOYSA-N 0.000 description 3
- 230000026030 halogenation Effects 0.000 description 3
- 238000005658 halogenation reaction Methods 0.000 description 3
- 125000005143 heteroarylsulfonyl group Chemical group 0.000 description 3
- 125000005368 heteroarylthio group Chemical group 0.000 description 3
- 125000005842 heteroatom Chemical group 0.000 description 3
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 206010020718 hyperplasia Diseases 0.000 description 3
- 208000006575 hypertriglyceridemia Diseases 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 125000001041 indolyl group Chemical group 0.000 description 3
- 208000027866 inflammatory disease Diseases 0.000 description 3
- 230000004054 inflammatory process Effects 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 150000002576 ketones Chemical class 0.000 description 3
- 150000002596 lactones Chemical class 0.000 description 3
- 239000012280 lithium aluminium hydride Substances 0.000 description 3
- XJMULMWDHLJUKP-UHFFFAOYSA-N methyl 2,6-dimethylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1C XJMULMWDHLJUKP-UHFFFAOYSA-N 0.000 description 3
- 125000002950 monocyclic group Chemical group 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 3
- 231100000252 nontoxic Toxicity 0.000 description 3
- 230000003000 nontoxic effect Effects 0.000 description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 3
- 150000007524 organic acids Chemical class 0.000 description 3
- 150000002924 oxiranes Chemical class 0.000 description 3
- 230000000737 periodic effect Effects 0.000 description 3
- 210000002824 peroxisome Anatomy 0.000 description 3
- WLJVXDMOQOGPHL-UHFFFAOYSA-N phenylacetic acid Chemical class OC(=O)CC1=CC=CC=C1 WLJVXDMOQOGPHL-UHFFFAOYSA-N 0.000 description 3
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 3
- 239000010452 phosphate Substances 0.000 description 3
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 3
- 125000003367 polycyclic group Chemical group 0.000 description 3
- 201000010065 polycystic ovary syndrome Diseases 0.000 description 3
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 3
- 150000003138 primary alcohols Chemical class 0.000 description 3
- 239000000651 prodrug Substances 0.000 description 3
- 229940002612 prodrug Drugs 0.000 description 3
- 125000003226 pyrazolyl group Chemical group 0.000 description 3
- 125000002294 quinazolinyl group Chemical group N1=C(N=CC2=CC=CC=C12)* 0.000 description 3
- 238000001953 recrystallisation Methods 0.000 description 3
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 3
- 238000012552 review Methods 0.000 description 3
- 238000006798 ring closing metathesis reaction Methods 0.000 description 3
- 239000000523 sample Substances 0.000 description 3
- 239000012047 saturated solution Substances 0.000 description 3
- 210000002027 skeletal muscle Anatomy 0.000 description 3
- 229910000029 sodium carbonate Inorganic materials 0.000 description 3
- UKLNMMHNWFDKNT-UHFFFAOYSA-M sodium chlorite Chemical compound [Na+].[O-]Cl=O UKLNMMHNWFDKNT-UHFFFAOYSA-M 0.000 description 3
- 229960002218 sodium chlorite Drugs 0.000 description 3
- 239000012453 solvate Substances 0.000 description 3
- 238000000638 solvent extraction Methods 0.000 description 3
- 230000004936 stimulating effect Effects 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- 239000011593 sulfur Substances 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- OUDSBRTVNLOZBN-UHFFFAOYSA-N tolazamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC(=O)NN1CCCCCC1 OUDSBRTVNLOZBN-UHFFFAOYSA-N 0.000 description 3
- 229960002277 tolazamide Drugs 0.000 description 3
- 229960005371 tolbutamide Drugs 0.000 description 3
- 150000003852 triazoles Chemical class 0.000 description 3
- ITMCEJHCFYSIIV-UHFFFAOYSA-M triflate Chemical compound [O-]S(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-M 0.000 description 3
- UFTFJSFQGQCHQW-UHFFFAOYSA-N triformin Chemical compound O=COCC(OC=O)COC=O UFTFJSFQGQCHQW-UHFFFAOYSA-N 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- GGWBQKOXLMPNMS-UHFFFAOYSA-N (4-tert-butylcyclohexyl)methanol Chemical compound CC(C)(C)C1CCC(CO)CC1 GGWBQKOXLMPNMS-UHFFFAOYSA-N 0.000 description 2
- KZPYGQFFRCFCPP-UHFFFAOYSA-N 1,1'-bis(diphenylphosphino)ferrocene Chemical compound [Fe+2].C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=C[C-]1P(C=1C=CC=CC=1)C1=CC=CC=C1 KZPYGQFFRCFCPP-UHFFFAOYSA-N 0.000 description 2
- SPEUIVXLLWOEMJ-UHFFFAOYSA-N 1,1-dimethoxyethane Chemical compound COC(C)OC SPEUIVXLLWOEMJ-UHFFFAOYSA-N 0.000 description 2
- 125000004605 1,2,3,4-tetrahydroisoquinolinyl group Chemical group C1(NCCC2=CC=CC=C12)* 0.000 description 2
- 125000004504 1,2,4-oxadiazolyl group Chemical group 0.000 description 2
- FMGGHNGKHRCJLL-UHFFFAOYSA-N 1,2-bis(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1CCl FMGGHNGKHRCJLL-UHFFFAOYSA-N 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 2
- YRIZYWQGELRKNT-UHFFFAOYSA-N 1,3,5-trichloro-1,3,5-triazinane-2,4,6-trione Chemical compound ClN1C(=O)N(Cl)C(=O)N(Cl)C1=O YRIZYWQGELRKNT-UHFFFAOYSA-N 0.000 description 2
- BCMCBBGGLRIHSE-UHFFFAOYSA-N 1,3-benzoxazole Chemical compound C1=CC=C2OC=NC2=C1 BCMCBBGGLRIHSE-UHFFFAOYSA-N 0.000 description 2
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 2
- OXGDKDFWZLJUSQ-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylcyclohexane Chemical compound CC(C)(C)C1CCC(CBr)CC1 OXGDKDFWZLJUSQ-UHFFFAOYSA-N 0.000 description 2
- QUYVTGFWFHQVRO-UHFFFAOYSA-N 1-(chloromethyl)-3-phenoxybenzene Chemical compound ClCC1=CC=CC(OC=2C=CC=CC=2)=C1 QUYVTGFWFHQVRO-UHFFFAOYSA-N 0.000 description 2
- CQJGEOKWGXZFBO-UHFFFAOYSA-N 1-[2-hydroxy-4-(quinolin-2-ylmethoxy)phenyl]ethanone Chemical compound C1=C(O)C(C(=O)C)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 CQJGEOKWGXZFBO-UHFFFAOYSA-N 0.000 description 2
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 2
- PKSOVKYXFHBKSE-UHFFFAOYSA-N 1-iodo-3-(2-methoxyethoxymethoxy)benzene Chemical compound COCCOCOC1=CC=CC(I)=C1 PKSOVKYXFHBKSE-UHFFFAOYSA-N 0.000 description 2
- 125000001088 1-naphthoyl group Chemical group C1(=CC=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- SULYEHHGGXARJS-UHFFFAOYSA-N 2',4'-dihydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1O SULYEHHGGXARJS-UHFFFAOYSA-N 0.000 description 2
- HBEDSQVIWPRPAY-UHFFFAOYSA-N 2,3-dihydrobenzofuran Chemical compound C1=CC=C2OCCC2=C1 HBEDSQVIWPRPAY-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- GRYVSQPYRHAJTG-UHFFFAOYSA-N 2-(2,4-dichloro-6-formylphenoxy)acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(C=O)=C1 GRYVSQPYRHAJTG-UHFFFAOYSA-N 0.000 description 2
- CTTDEBFGDMECPC-UHFFFAOYSA-N 2-(2-formyl-6-methylphenoxy)acetonitrile Chemical compound CC1=CC=CC(C=O)=C1OCC#N CTTDEBFGDMECPC-UHFFFAOYSA-N 0.000 description 2
- NLHGWRZNSSLVMD-UHFFFAOYSA-N 2-(2-tert-butyl-6-methylphenoxy)acetonitrile Chemical compound CC1=CC=CC(C(C)(C)C)=C1OCC#N NLHGWRZNSSLVMD-UHFFFAOYSA-N 0.000 description 2
- XDZCVHVCPDWSGH-UHFFFAOYSA-N 2-(4-chloro-2-formyl-6-methoxyphenoxy)acetonitrile Chemical compound COC1=CC(Cl)=CC(C=O)=C1OCC#N XDZCVHVCPDWSGH-UHFFFAOYSA-N 0.000 description 2
- JYWHQBLLIBQGCU-UHFFFAOYSA-N 2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethanol Chemical compound OCCC1=C(C)OC(C=2C=CC=CC=2)=N1 JYWHQBLLIBQGCU-UHFFFAOYSA-N 0.000 description 2
- HLDSBJZEFARTFR-UHFFFAOYSA-N 2-(bromomethyl)-1-methylquinolin-4-one Chemical compound C1=CC=C2N(C)C(CBr)=CC(=O)C2=C1 HLDSBJZEFARTFR-UHFFFAOYSA-N 0.000 description 2
- CJXKXXVHPLUATC-UHFFFAOYSA-N 2-(bromomethyl)-6,8-difluoroquinoline Chemical compound N1=C(CBr)C=CC2=CC(F)=CC(F)=C21 CJXKXXVHPLUATC-UHFFFAOYSA-N 0.000 description 2
- QGXNHCXKWFNKCG-UHFFFAOYSA-N 2-(bromomethyl)benzonitrile Chemical compound BrCC1=CC=CC=C1C#N QGXNHCXKWFNKCG-UHFFFAOYSA-N 0.000 description 2
- WCYUVJWITVNLCD-UHFFFAOYSA-N 2-(chloromethyl)-1-hydroxy-2h-quinoline Chemical compound C1=CC=C2N(O)C(CCl)C=CC2=C1 WCYUVJWITVNLCD-UHFFFAOYSA-N 0.000 description 2
- NDYMABNTFFJQLH-UHFFFAOYSA-N 2-(chloromethyl)-3-methylquinazolin-4-one Chemical compound C1=CC=C2C(=O)N(C)C(CCl)=NC2=C1 NDYMABNTFFJQLH-UHFFFAOYSA-N 0.000 description 2
- MXANKYKNKHBMTR-UHFFFAOYSA-N 2-(chloromethyl)-3-methylquinoxaline Chemical compound C1=CC=C2N=C(CCl)C(C)=NC2=C1 MXANKYKNKHBMTR-UHFFFAOYSA-N 0.000 description 2
- RFQANNQGIYHMHO-UHFFFAOYSA-N 2-(chloromethyl)-5-ethylpyridine Chemical compound CCC1=CC=C(CCl)N=C1 RFQANNQGIYHMHO-UHFFFAOYSA-N 0.000 description 2
- YJFTUIPJJBKOQG-UHFFFAOYSA-N 2-(chloromethyl)-5-phenylpyridine Chemical compound C1=NC(CCl)=CC=C1C1=CC=CC=C1 YJFTUIPJJBKOQG-UHFFFAOYSA-N 0.000 description 2
- SKGXEHSSDMYNPM-UHFFFAOYSA-N 2-(chloromethyl)-6,7-difluoroquinoline Chemical compound C1=C(CCl)N=C2C=C(F)C(F)=CC2=C1 SKGXEHSSDMYNPM-UHFFFAOYSA-N 0.000 description 2
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 2
- ZILVNHNSYBNLSZ-UHFFFAOYSA-N 2-(diaminomethylideneamino)guanidine Chemical compound NC(N)=NNC(N)=N ZILVNHNSYBNLSZ-UHFFFAOYSA-N 0.000 description 2
- DDXVLAFNBBIABP-UHFFFAOYSA-N 2-(hydroxymethyl)-1-methylquinolin-4-one Chemical compound C1=CC=C2N(C)C(CO)=CC(=O)C2=C1 DDXVLAFNBBIABP-UHFFFAOYSA-N 0.000 description 2
- DJVCUYVKSYCIIF-UHFFFAOYSA-N 2-[2,4-dichloro-6-(hydroxymethyl)phenoxy]acetonitrile Chemical compound OCC1=CC(Cl)=CC(Cl)=C1OCC#N DJVCUYVKSYCIIF-UHFFFAOYSA-N 0.000 description 2
- LNNVSOTXIKVWGT-UHFFFAOYSA-N 2-[2,4-dichloro-6-[(3-hydroxyphenoxy)methyl]phenoxy]acetonitrile Chemical compound OC1=CC=CC(OCC=2C(=C(Cl)C=C(Cl)C=2)OCC#N)=C1 LNNVSOTXIKVWGT-UHFFFAOYSA-N 0.000 description 2
- KMXRDJSJGPWUAY-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound ClC1=CC(Cl)=C(OCC#N)C(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 KMXRDJSJGPWUAY-UHFFFAOYSA-N 0.000 description 2
- HXJCBLIOQFONHM-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound C1=CC2=CC(F)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC(Cl)=CC(Cl)=C1OCC#N HXJCBLIOQFONHM-UHFFFAOYSA-N 0.000 description 2
- ZSQMTXRRBGIGQS-UHFFFAOYSA-N 2-[2-(bromomethyl)-4-chloro-6-methoxyphenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(CBr)=C1OCC#N ZSQMTXRRBGIGQS-UHFFFAOYSA-N 0.000 description 2
- ZNKLCJTVFCPJSR-UHFFFAOYSA-N 2-[2-[3-(2-methoxyethoxymethoxy)phenoxy]ethoxy]pyridine Chemical compound COCCOCOC1=CC=CC(OCCOC=2N=CC=CC=2)=C1 ZNKLCJTVFCPJSR-UHFFFAOYSA-N 0.000 description 2
- DUSMHVNEJBQRER-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-4-chloro-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC#N DUSMHVNEJBQRER-UHFFFAOYSA-N 0.000 description 2
- AMXONCBYWLTUTQ-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC#N AMXONCBYWLTUTQ-UHFFFAOYSA-N 0.000 description 2
- CPEREQSLHTWRNE-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC#N CPEREQSLHTWRNE-UHFFFAOYSA-N 0.000 description 2
- JWLGOTYHSFJPKM-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC#N JWLGOTYHSFJPKM-UHFFFAOYSA-N 0.000 description 2
- OTINJLUILHTQOL-UHFFFAOYSA-N 2-[2-[[3-[(6,7-dichloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C(Cl)=CC4=CC=3)C=CC=2)=C1OCC#N OTINJLUILHTQOL-UHFFFAOYSA-N 0.000 description 2
- VELKRVGZKQTRGV-UHFFFAOYSA-N 2-[2-[[3-[(6,7-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(F)C(F)=CC4=CC=3)C=CC=2)=C1OCC#N VELKRVGZKQTRGV-UHFFFAOYSA-N 0.000 description 2
- VWUXNZIVGVKCQA-UHFFFAOYSA-N 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C(F)=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N VWUXNZIVGVKCQA-UHFFFAOYSA-N 0.000 description 2
- ICPTVHSOSWAIMQ-UHFFFAOYSA-N 2-[2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N ICPTVHSOSWAIMQ-UHFFFAOYSA-N 0.000 description 2
- VSRZICINMFCWBJ-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N VSRZICINMFCWBJ-UHFFFAOYSA-N 0.000 description 2
- UYHRMXSULUMZKE-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N UYHRMXSULUMZKE-UHFFFAOYSA-N 0.000 description 2
- LUTIRPXXOVYXJB-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroisoquinolin-3-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC4=CC(Cl)=CC=C4C=3)C=CC=2)=C1OCC#N LUTIRPXXOVYXJB-UHFFFAOYSA-N 0.000 description 2
- QBFUKAMKHKQXRO-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1OCC#N QBFUKAMKHKQXRO-UHFFFAOYSA-N 0.000 description 2
- MVGHLDMDZLIKDI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-phenoxyethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3C=CC=CC=3)C=CC=2)=C1OCC#N MVGHLDMDZLIKDI-UHFFFAOYSA-N 0.000 description 2
- SYWRWYQAXUIVAI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC#N SYWRWYQAXUIVAI-UHFFFAOYSA-N 0.000 description 2
- JCVNSSXWYKBMJC-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1OCC#N JCVNSSXWYKBMJC-UHFFFAOYSA-N 0.000 description 2
- VXIXACNBVFOVLY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N VXIXACNBVFOVLY-UHFFFAOYSA-N 0.000 description 2
- DJMFGTGKFFXQBR-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC=CC=3)C=CC=2)=C1OCC#N DJMFGTGKFFXQBR-UHFFFAOYSA-N 0.000 description 2
- SOOBQIALUOBHOG-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-3-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=NC=CC=3)C=CC=2)=C1OCC#N SOOBQIALUOBHOG-UHFFFAOYSA-N 0.000 description 2
- LZPIHYYGBCSCEK-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-4-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CN=CC=3)C=CC=2)=C1OCC#N LZPIHYYGBCSCEK-UHFFFAOYSA-N 0.000 description 2
- OLXGRHULXZLQME-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O OLXGRHULXZLQME-UHFFFAOYSA-N 0.000 description 2
- HYHBBSYBHUNCPE-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N HYHBBSYBHUNCPE-UHFFFAOYSA-N 0.000 description 2
- LYONMDOUZKMBNY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N LYONMDOUZKMBNY-UHFFFAOYSA-N 0.000 description 2
- VUIOHECBJUSILI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinoxalin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=NC=3)C=CC=2)=C1OCC#N VUIOHECBJUSILI-UHFFFAOYSA-N 0.000 description 2
- SJIHWCYJFDYMTO-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1,3,3-trimethyl-2-oxoindol-6-yl)oxymethyl]phenoxy]methyl]phenoxy]acetonitrile Chemical compound C1=C2N(C)C(=O)C(C)(C)C2=CC=C1OCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC#N SJIHWCYJFDYMTO-UHFFFAOYSA-N 0.000 description 2
- KGUZHIOQDFSQQG-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1-methyl-4-oxoquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C4=CC=CC=C4C(=O)C=3)C)C=CC=2)=C1OCC#N KGUZHIOQDFSQQG-UHFFFAOYSA-N 0.000 description 2
- ASZXVYRRDIZLQV-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(SC=3)C=3C=CC=CC=3)C=CC=2)=C1OCC#N ASZXVYRRDIZLQV-UHFFFAOYSA-N 0.000 description 2
- LLAWYIQIYGFLTO-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(3-phenoxyphenyl)methoxy]phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(OC=4C=CC=CC=4)C=CC=3)C=CC=2)=C1OCC#N LLAWYIQIYGFLTO-UHFFFAOYSA-N 0.000 description 2
- KLNNLHMQGZKGAC-UHFFFAOYSA-N 2-[2-tert-butyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC(C)(C)C1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N KLNNLHMQGZKGAC-UHFFFAOYSA-N 0.000 description 2
- YEJCPSVKHBHRFC-UHFFFAOYSA-N 2-[3-(2-methoxyethoxymethoxy)phenyl]ethynyl-trimethylsilane Chemical compound COCCOCOC1=CC=CC(C#C[Si](C)(C)C)=C1 YEJCPSVKHBHRFC-UHFFFAOYSA-N 0.000 description 2
- RDNIYNUQRKFJGM-UHFFFAOYSA-N 2-[4-chloro-2-(hydroxymethyl)-6-methoxyphenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(CO)=C1OCC#N RDNIYNUQRKFJGM-UHFFFAOYSA-N 0.000 description 2
- BYFHGYCJJZACNU-UHFFFAOYSA-N 2-[4-chloro-2-[(3-hydroxyphenoxy)methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(O)C=CC=2)=C1OCC#N BYFHGYCJJZACNU-UHFFFAOYSA-N 0.000 description 2
- GIJREWRMYZNAQR-UHFFFAOYSA-N 2-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=C(Cl)C=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 GIJREWRMYZNAQR-UHFFFAOYSA-N 0.000 description 2
- ZIEJGRDYERCCOI-UHFFFAOYSA-N 2-[4-chloro-2-methoxy-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound COC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N ZIEJGRDYERCCOI-UHFFFAOYSA-N 0.000 description 2
- NSYREYJDRADFFH-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC#N NSYREYJDRADFFH-UHFFFAOYSA-N 0.000 description 2
- JZLXBYPJMJECDE-UHFFFAOYSA-N 2-[[3-(1h-indol-3-ylmethyl)phenoxy]methyl]quinoline Chemical compound C1=CC=CC2=NC(COC=3C=C(CC=4C5=CC=CC=C5NC=4)C=CC=3)=CC=C21 JZLXBYPJMJECDE-UHFFFAOYSA-N 0.000 description 2
- VHENHMZDUDYJGD-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxy]quinoline Chemical compound COCCOCOC1=CC=CC(COC=2N=C3C=CC=CC3=CC=2)=C1 VHENHMZDUDYJGD-UHFFFAOYSA-N 0.000 description 2
- QAMGVCXYKXXKHO-UHFFFAOYSA-N 2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC=CC3=CC=2)=C1 QAMGVCXYKXXKHO-UHFFFAOYSA-N 0.000 description 2
- MGTGAVXXGVYSEQ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzonitrile Chemical compound N#CC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 MGTGAVXXGVYSEQ-UHFFFAOYSA-N 0.000 description 2
- QIXDQHOPKLNEPW-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-6-(trifluoromethyl)benzaldehyde Chemical compound FC(F)(F)C1=CC=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C=O QIXDQHOPKLNEPW-UHFFFAOYSA-N 0.000 description 2
- LKBRSKGFDWYCQY-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzaldehyde Chemical compound O=CC1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LKBRSKGFDWYCQY-UHFFFAOYSA-N 0.000 description 2
- BRTWWLOCLQUDCP-UHFFFAOYSA-N 2-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC=CC=3)Cl)C=CC=2)=C1C(O)=O BRTWWLOCLQUDCP-UHFFFAOYSA-N 0.000 description 2
- NKNOGVREFCHVJA-UHFFFAOYSA-N 2-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(Cl)=CC=3)C=CC=2)=C1C(O)=O NKNOGVREFCHVJA-UHFFFAOYSA-N 0.000 description 2
- KGNOTIUQWRHRCU-UHFFFAOYSA-N 2-[[3-[[2-(chloromethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound ClCC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 KGNOTIUQWRHRCU-UHFFFAOYSA-N 0.000 description 2
- FXWFZIRWWNPPOV-UHFFFAOYSA-N 2-aminobenzaldehyde Chemical class NC1=CC=CC=C1C=O FXWFZIRWWNPPOV-UHFFFAOYSA-N 0.000 description 2
- HLCPWBZNUKCSBN-UHFFFAOYSA-N 2-aminobenzonitrile Chemical compound NC1=CC=CC=C1C#N HLCPWBZNUKCSBN-UHFFFAOYSA-N 0.000 description 2
- BBVQDWDBTWSGHQ-UHFFFAOYSA-N 2-chloro-1,3-benzoxazole Chemical compound C1=CC=C2OC(Cl)=NC2=C1 BBVQDWDBTWSGHQ-UHFFFAOYSA-N 0.000 description 2
- VHKDPJQJCMVQFZ-UHFFFAOYSA-N 2-chloro-6-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC(Cl)=N1 VHKDPJQJCMVQFZ-UHFFFAOYSA-N 0.000 description 2
- BKOOMYPCSUNDGP-UHFFFAOYSA-N 2-methylbut-2-ene Chemical compound CC=C(C)C BKOOMYPCSUNDGP-UHFFFAOYSA-N 0.000 description 2
- IYPLMIONUBKTHO-UHFFFAOYSA-N 2-methylpropyl 2-(bromomethyl)-6-methylbenzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CBr IYPLMIONUBKTHO-UHFFFAOYSA-N 0.000 description 2
- ZIMBOQBFCUHTRA-UHFFFAOYSA-N 2-methylpropyl 2-[(3-hydroxyphenyl)sulfanylmethyl]-6-methylbenzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CSC1=CC=CC(O)=C1 ZIMBOQBFCUHTRA-UHFFFAOYSA-N 0.000 description 2
- WWPMYEXZBXFQLB-UHFFFAOYSA-N 2-methylpropyl 2-[(3-methoxyphenyl)sulfanylmethyl]-6-methylbenzoate Chemical compound COC1=CC=CC(SCC=2C(=C(C)C=CC=2)C(=O)OCC(C)C)=C1 WWPMYEXZBXFQLB-UHFFFAOYSA-N 0.000 description 2
- FEZISSFLSPTJCF-UHFFFAOYSA-N 2-methylpropyl 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfinylmethyl]benzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CS(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 FEZISSFLSPTJCF-UHFFFAOYSA-N 0.000 description 2
- QHRWWYPZIKXCNZ-UHFFFAOYSA-N 2-methylpropyl 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoate Chemical compound CC(C)COC(=O)C1=C(C)C=CC=C1CS(=O)(=O)C1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 QHRWWYPZIKXCNZ-UHFFFAOYSA-N 0.000 description 2
- 125000001216 2-naphthoyl group Chemical group C1=C(C=CC2=CC=CC=C12)C(=O)* 0.000 description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical group C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 description 2
- AXNUZKSSQHTNPZ-UHFFFAOYSA-N 3,4-difluoroaniline Chemical compound NC1=CC=C(F)C(F)=C1 AXNUZKSSQHTNPZ-UHFFFAOYSA-N 0.000 description 2
- GHXJFONLLJZIQZ-UHFFFAOYSA-N 3-(2-methoxyethoxymethoxy)benzonitrile Chemical compound COCCOCOC1=CC=CC(C#N)=C1 GHXJFONLLJZIQZ-UHFFFAOYSA-N 0.000 description 2
- PLZYINXUABTZCT-UHFFFAOYSA-N 3-(chloromethyl)-2h-oxadiazole Chemical compound ClCN1NOC=C1 PLZYINXUABTZCT-UHFFFAOYSA-N 0.000 description 2
- PVOXPZFMSLPPKE-UHFFFAOYSA-N 3-(pyridin-2-ylmethoxymethyl)phenol Chemical compound OC1=CC=CC(COCC=2N=CC=CC=2)=C1 PVOXPZFMSLPPKE-UHFFFAOYSA-N 0.000 description 2
- CQSPRGHJTMPQKM-UHFFFAOYSA-N 3-(quinolin-2-yloxymethyl)phenol Chemical compound OC1=CC=CC(COC=2N=C3C=CC=CC3=CC=2)=C1 CQSPRGHJTMPQKM-UHFFFAOYSA-N 0.000 description 2
- UFKMMBOFOVKGHS-UHFFFAOYSA-N 3-[(4-chloroquinolin-2-yl)methoxymethyl]phenol Chemical compound OC1=CC=CC(COCC=2N=C3C=CC=CC3=C(Cl)C=2)=C1 UFKMMBOFOVKGHS-UHFFFAOYSA-N 0.000 description 2
- CWPFZVYVWJFVJF-UHFFFAOYSA-N 3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenol Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC1=CC=CC(O)=C1 CWPFZVYVWJFVJF-UHFFFAOYSA-N 0.000 description 2
- LKSUDSMBCAWGGX-UHFFFAOYSA-N 3-[(quinolin-2-ylamino)methyl]phenol Chemical compound OC1=CC=CC(CNC=2N=C3C=CC=CC3=CC=2)=C1 LKSUDSMBCAWGGX-UHFFFAOYSA-N 0.000 description 2
- IZRDAHXGGFFNQB-UHFFFAOYSA-N 3-[2-(5-ethylpyridin-2-yl)ethoxy]phenol Chemical compound N1=CC(CC)=CC=C1CCOC1=CC=CC(O)=C1 IZRDAHXGGFFNQB-UHFFFAOYSA-N 0.000 description 2
- ASRAZAZWZUNALX-UHFFFAOYSA-N 3-[[1,3-benzoxazol-2-yl(methyl)amino]methyl]phenol Chemical compound N=1C2=CC=CC=C2OC=1N(C)CC1=CC=CC(O)=C1 ASRAZAZWZUNALX-UHFFFAOYSA-N 0.000 description 2
- MGVDCJNVPDPACI-UHFFFAOYSA-N 3-[[2-(hydroxymethyl)-3-methylphenyl]methoxy]phenol Chemical compound CC1=CC=CC(COC=2C=C(O)C=CC=2)=C1CO MGVDCJNVPDPACI-UHFFFAOYSA-N 0.000 description 2
- KYSWPWKDAFDIDD-UHFFFAOYSA-N 3-[[methyl(quinolin-2-yl)amino]methyl]phenol Chemical compound C=1C=C2C=CC=CC2=NC=1N(C)CC1=CC=CC(O)=C1 KYSWPWKDAFDIDD-UHFFFAOYSA-N 0.000 description 2
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 2
- SGHBRHKBCLLVCI-UHFFFAOYSA-N 3-hydroxybenzonitrile Chemical compound OC1=CC=CC(C#N)=C1 SGHBRHKBCLLVCI-UHFFFAOYSA-N 0.000 description 2
- HJKGBRPNSJADMB-UHFFFAOYSA-N 3-phenylpyridine Chemical compound C1=CC=CC=C1C1=CC=CN=C1 HJKGBRPNSJADMB-UHFFFAOYSA-N 0.000 description 2
- AGMLELBIDWXNKF-UHFFFAOYSA-N 4-(chloromethyl)-2-(3-fluorophenyl)-1,3-oxazole Chemical compound FC1=CC=CC(C=2OC=C(CCl)N=2)=C1 AGMLELBIDWXNKF-UHFFFAOYSA-N 0.000 description 2
- GVPZSTFLDSJXRT-UHFFFAOYSA-N 4-(chloromethyl)-2-(4-fluorophenyl)-1,3-oxazole Chemical compound C1=CC(F)=CC=C1C1=NC(CCl)=CO1 GVPZSTFLDSJXRT-UHFFFAOYSA-N 0.000 description 2
- XIRGVEDJBFANTN-UHFFFAOYSA-N 4-(chloromethyl)-2-(5-methylthiophen-2-yl)-1,3-oxazole Chemical compound S1C(C)=CC=C1C1=NC(CCl)=CO1 XIRGVEDJBFANTN-UHFFFAOYSA-N 0.000 description 2
- BMFBHBSLWMGSRE-UHFFFAOYSA-N 4-(chloromethyl)-2-cyclohexyl-1,3-oxazole Chemical compound ClCC1=COC(C2CCCCC2)=N1 BMFBHBSLWMGSRE-UHFFFAOYSA-N 0.000 description 2
- NHWLMYADYHMXLT-UHFFFAOYSA-N 4-chloro-2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC=CC3=C(Cl)C=2)=C1 NHWLMYADYHMXLT-UHFFFAOYSA-N 0.000 description 2
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 2
- 125000004608 5,6,7,8-tetrahydroquinolinyl group Chemical group N1=C(C=CC=2CCCCC12)* 0.000 description 2
- CKOZVEHVVHCMGD-UHFFFAOYSA-N 5-[(4-fluorophenyl)methyl]-n,n-dimethyltetrazole-1-carboxamide Chemical compound CN(C)C(=O)N1N=NN=C1CC1=CC=C(F)C=C1 CKOZVEHVVHCMGD-UHFFFAOYSA-N 0.000 description 2
- PQKYPMGTDHNSRL-UHFFFAOYSA-N 5-chloro-2-hydroxy-3-methoxybenzaldehyde Chemical compound COC1=CC(Cl)=CC(C=O)=C1O PQKYPMGTDHNSRL-UHFFFAOYSA-N 0.000 description 2
- NUDXKJOCNHFUEZ-UHFFFAOYSA-N 5-ethyl-2-methyl-1-oxidopyridin-1-ium Chemical compound CCC1=CC=C(C)[N+]([O-])=C1 NUDXKJOCNHFUEZ-UHFFFAOYSA-N 0.000 description 2
- JUKPQDIFUMAWTD-UHFFFAOYSA-N 6,7-dichloro-2-(chloromethyl)quinoline Chemical compound C1=C(Cl)C(Cl)=CC2=NC(CCl)=CC=C21 JUKPQDIFUMAWTD-UHFFFAOYSA-N 0.000 description 2
- BBMZNBFIUFTOHL-UHFFFAOYSA-N 6-methoxy-1,3,3-trimethylindol-2-one Chemical compound COC1=CC=C2C(C)(C)C(=O)N(C)C2=C1 BBMZNBFIUFTOHL-UHFFFAOYSA-N 0.000 description 2
- AZUAKHVXBMTMRY-UHFFFAOYSA-N 6-methoxy-2-[[3-(2-methoxyethoxymethoxy)phenyl]methoxymethyl]quinoline Chemical compound COCCOCOC1=CC=CC(COCC=2N=C3C=CC(OC)=CC3=CC=2)=C1 AZUAKHVXBMTMRY-UHFFFAOYSA-N 0.000 description 2
- HUWLHNLABRKIED-UHFFFAOYSA-N 6-methoxy-3,3-dimethyl-1h-indol-2-one Chemical compound COC1=CC=C2C(C)(C)C(=O)NC2=C1 HUWLHNLABRKIED-UHFFFAOYSA-N 0.000 description 2
- XWCKMYJGFPERAV-UHFFFAOYSA-N 6-methoxy-3-methyl-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2C(C)C(=O)NC2=C1 XWCKMYJGFPERAV-UHFFFAOYSA-N 0.000 description 2
- VDRLGRBSQTUUOX-UHFFFAOYSA-N 7-chloro-2-(chloromethyl)quinoline Chemical compound C1=CC(Cl)=CC2=NC(CCl)=CC=C21 VDRLGRBSQTUUOX-UHFFFAOYSA-N 0.000 description 2
- 238000005664 Alder-Rickert cycloaddition reaction Methods 0.000 description 2
- 201000005670 Anovulation Diseases 0.000 description 2
- 206010002659 Anovulatory cycle Diseases 0.000 description 2
- 208000037260 Atherosclerotic Plaque Diseases 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 102100035882 Catalase Human genes 0.000 description 2
- 108010053835 Catalase Proteins 0.000 description 2
- VGCXGMAHQTYDJK-UHFFFAOYSA-N Chloroacetyl chloride Chemical compound ClCC(Cl)=O VGCXGMAHQTYDJK-UHFFFAOYSA-N 0.000 description 2
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 2
- 108010037462 Cyclooxygenase 2 Proteins 0.000 description 2
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 2
- AOJJSUZBOXZQNB-TZSSRYMLSA-N Doxorubicin Chemical compound O([C@H]1C[C@@](O)(CC=2C(O)=C3C(=O)C=4C=CC=C(C=4C(=O)C3=C(O)C=21)OC)C(=O)CO)[C@H]1C[C@H](N)[C@H](O)[C@H](C)O1 AOJJSUZBOXZQNB-TZSSRYMLSA-N 0.000 description 2
- 206010014561 Emphysema Diseases 0.000 description 2
- 101710107035 Gamma-glutamyltranspeptidase Proteins 0.000 description 2
- 101710173228 Glutathione hydrolase proenzyme Proteins 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- 241000282412 Homo Species 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 102000003746 Insulin Receptor Human genes 0.000 description 2
- 108010001127 Insulin Receptor Proteins 0.000 description 2
- 241001465754 Metazoa Species 0.000 description 2
- KWYHDKDOAIKMQN-UHFFFAOYSA-N N,N,N',N'-tetramethylethylenediamine Chemical compound CN(C)CCN(C)C KWYHDKDOAIKMQN-UHFFFAOYSA-N 0.000 description 2
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 2
- 229910002651 NO3 Inorganic materials 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 2
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 2
- KFSLWBXXFJQRDL-UHFFFAOYSA-N Peracetic acid Chemical compound CC(=O)OO KFSLWBXXFJQRDL-UHFFFAOYSA-N 0.000 description 2
- 101710117029 Peroxisome proliferator-activated receptor delta Proteins 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 102100038280 Prostaglandin G/H synthase 2 Human genes 0.000 description 2
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical class C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 2
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical class C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 108060008682 Tumor Necrosis Factor Proteins 0.000 description 2
- 102000000852 Tumor Necrosis Factor-alpha Human genes 0.000 description 2
- 230000002159 abnormal effect Effects 0.000 description 2
- 230000005856 abnormality Effects 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 230000000996 additive effect Effects 0.000 description 2
- 210000000577 adipose tissue Anatomy 0.000 description 2
- 238000006136 alcoholysis reaction Methods 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000004644 alkyl sulfinyl group Chemical group 0.000 description 2
- 239000002168 alkylating agent Substances 0.000 description 2
- 229940100198 alkylating agent Drugs 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 231100000552 anovulation Toxicity 0.000 description 2
- 230000003178 anti-diabetic effect Effects 0.000 description 2
- 230000003276 anti-hypertensive effect Effects 0.000 description 2
- 125000002102 aryl alkyloxo group Chemical group 0.000 description 2
- 125000005135 aryl sulfinyl group Chemical group 0.000 description 2
- 230000003143 atherosclerotic effect Effects 0.000 description 2
- 230000001363 autoimmune Effects 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 2
- 125000004618 benzofuryl group Chemical group O1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 125000004190 benzothiazol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N=C(*)SC2=C1[H] 0.000 description 2
- 125000004196 benzothienyl group Chemical group S1C(=CC2=C1C=CC=C2)* 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- ILAHWRKJUDSMFH-UHFFFAOYSA-N boron tribromide Chemical compound BrB(Br)Br ILAHWRKJUDSMFH-UHFFFAOYSA-N 0.000 description 2
- 244000309464 bull Species 0.000 description 2
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 238000006555 catalytic reaction Methods 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 230000010261 cell growth Effects 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- 235000012000 cholesterol Nutrition 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 235000008504 concentrate Nutrition 0.000 description 2
- 239000012141 concentrate Substances 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 2
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 2
- 125000000000 cycloalkoxy group Chemical group 0.000 description 2
- 125000002993 cycloalkylene group Chemical group 0.000 description 2
- HCAJEUSONLESMK-UHFFFAOYSA-N cyclohexylsulfamic acid Chemical compound OS(=O)(=O)NC1CCCCC1 HCAJEUSONLESMK-UHFFFAOYSA-N 0.000 description 2
- 239000012954 diazonium Substances 0.000 description 2
- 150000001989 diazonium salts Chemical class 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000009826 distribution Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 2
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 2
- QXQQEZSRMZQLEO-UHFFFAOYSA-N ethyl 2-(2,6-dimethylphenoxy)acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1C QXQQEZSRMZQLEO-UHFFFAOYSA-N 0.000 description 2
- HQLKCQMPAGJEFN-UHFFFAOYSA-N ethyl 2-[2-[3-(2-methoxyethoxymethoxy)phenyl]ethynyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1C#CC1=CC=CC(OCOCCOC)=C1 HQLKCQMPAGJEFN-UHFFFAOYSA-N 0.000 description 2
- CMBPNJAFCRLQPH-UHFFFAOYSA-N ethyl 2-[2-[[2-acetyl-5-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1COC1=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=C1C(C)=O CMBPNJAFCRLQPH-UHFFFAOYSA-N 0.000 description 2
- CMUQPASMWSWNJY-UHFFFAOYSA-N ethyl 2-[2-methyl-6-[[3-methyl-5-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1COC1=CC(C)=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 CMUQPASMWSWNJY-UHFFFAOYSA-N 0.000 description 2
- KNBQSOYSGLNBQP-UHFFFAOYSA-N ethyl 2-[[3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC(=CC=2)C(F)(F)F)C(F)(F)F)=C1 KNBQSOYSGLNBQP-UHFFFAOYSA-N 0.000 description 2
- YLZFDQDBNKEMCJ-UHFFFAOYSA-N ethyl 2-[[3-[[2-(cyanomethoxy)-3-methylphenyl]methoxy]phenyl]methoxy]-6-methyl-4-phenylmethoxybenzoate Chemical compound C1=C(OCC=2C=C(OCC=3C(=C(C)C=CC=3)OCC#N)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 YLZFDQDBNKEMCJ-UHFFFAOYSA-N 0.000 description 2
- YDJFALQUCGVCEB-UHFFFAOYSA-N ethyl 2-hydroxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound C1=C(O)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 YDJFALQUCGVCEB-UHFFFAOYSA-N 0.000 description 2
- KWXBNUYCDMPLEQ-UHFFFAOYSA-N ethyl 2-hydroxy-6-methylbenzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1O KWXBNUYCDMPLEQ-UHFFFAOYSA-N 0.000 description 2
- FMWVVHWNQSZRPI-UHFFFAOYSA-N ethyl 2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound C1=C(OC)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 FMWVVHWNQSZRPI-UHFFFAOYSA-N 0.000 description 2
- BNYFNBMJZGYVGY-UHFFFAOYSA-N ethyl 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(=CC=2)C=2C=CC=CC=2)=C1 BNYFNBMJZGYVGY-UHFFFAOYSA-N 0.000 description 2
- AYZDVUJUKAMHRC-UHFFFAOYSA-N ethyl 2-methyl-6-[[3-[(6-phenylpyridin-2-yl)methoxy]phenoxy]methyl]benzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(C=CC=2)C=2C=CC=CC=2)=C1 AYZDVUJUKAMHRC-UHFFFAOYSA-N 0.000 description 2
- NBZXHBWGHKMMBN-UHFFFAOYSA-N ethyl 2-methyl-6-[[3-[[5-methyl-2,4-di(propan-2-yl)phenyl]methoxy]phenoxy]methyl]benzoate Chemical compound CCOC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC(=C(C)C=2)C(C)C)C(C)C)=C1 NBZXHBWGHKMMBN-UHFFFAOYSA-N 0.000 description 2
- RKSZCNKKBCVRKD-UHFFFAOYSA-N ethyl 7-(bromomethyl)-1-benzofuran-2-carboxylate Chemical compound C1=CC(CBr)=C2OC(C(=O)OCC)=CC2=C1 RKSZCNKKBCVRKD-UHFFFAOYSA-N 0.000 description 2
- TXCDILNMVQWLIE-UHFFFAOYSA-N ethyl 7-methyl-1-benzofuran-2-carboxylate Chemical compound C1=CC(C)=C2OC(C(=O)OCC)=CC2=C1 TXCDILNMVQWLIE-UHFFFAOYSA-N 0.000 description 2
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 2
- 235000019197 fats Nutrition 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000001640 fractional crystallisation Methods 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical compound [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 125000002541 furyl group Chemical group 0.000 description 2
- 230000004927 fusion Effects 0.000 description 2
- 102000006640 gamma-Glutamyltransferase Human genes 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 230000014101 glucose homeostasis Effects 0.000 description 2
- 230000004190 glucose uptake Effects 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 230000035876 healing Effects 0.000 description 2
- 125000005150 heteroarylsulfinyl group Chemical group 0.000 description 2
- 238000004128 high performance liquid chromatography Methods 0.000 description 2
- 150000004677 hydrates Chemical class 0.000 description 2
- 150000002460 imidazoles Chemical class 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 125000002249 indol-2-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([*])=C([H])C2=C1[H] 0.000 description 2
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 2
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 2
- 125000003387 indolinyl group Chemical group N1(CCC2=CC=CC=C12)* 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 125000004551 isoquinolin-3-yl group Chemical group C1=NC(=CC2=CC=CC=C12)* 0.000 description 2
- 125000002183 isoquinolinyl group Chemical group C1(=NC=CC2=CC=CC=C12)* 0.000 description 2
- 125000001786 isothiazolyl group Chemical group 0.000 description 2
- 125000000842 isoxazolyl group Chemical group 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 150000002632 lipids Chemical class 0.000 description 2
- 206010024627 liposarcoma Diseases 0.000 description 2
- AMXOYNBUYSYVKV-UHFFFAOYSA-M lithium bromide Chemical compound [Li+].[Br-] AMXOYNBUYSYVKV-UHFFFAOYSA-M 0.000 description 2
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 2
- KWGKDLIKAYFUFQ-UHFFFAOYSA-M lithium chloride Chemical compound [Li+].[Cl-] KWGKDLIKAYFUFQ-UHFFFAOYSA-M 0.000 description 2
- 210000002540 macrophage Anatomy 0.000 description 2
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 2
- 230000001404 mediated effect Effects 0.000 description 2
- 230000009245 menopause Effects 0.000 description 2
- PYTWKHSLXNATOO-UHFFFAOYSA-N methyl 2-[2-(bromomethyl)-6-methylphenoxy]propanoate Chemical compound COC(=O)C(C)OC1=C(C)C=CC=C1CBr PYTWKHSLXNATOO-UHFFFAOYSA-N 0.000 description 2
- NERYXMCYIODOSZ-UHFFFAOYSA-N methyl 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoate Chemical compound COC(=O)C1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 NERYXMCYIODOSZ-UHFFFAOYSA-N 0.000 description 2
- DCDZQKQCKYWTFV-UHFFFAOYSA-N methyl 2-[[3-[(1,3-benzoxazol-2-ylmethylamino)methyl]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(CNCC=2OC3=CC=CC=C3N=2)=C1 DCDZQKQCKYWTFV-UHFFFAOYSA-N 0.000 description 2
- PIUSHKPCOPHPJF-UHFFFAOYSA-N methyl 2-[[3-[(2,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC(Cl)=CC=2)Cl)=C1 PIUSHKPCOPHPJF-UHFFFAOYSA-N 0.000 description 2
- WJMYZZHDCPTOPX-UHFFFAOYSA-N methyl 2-[[3-[(2,5-dimethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC=C(C)C=2)C)=C1 WJMYZZHDCPTOPX-UHFFFAOYSA-N 0.000 description 2
- HWKMLNOBBANACI-UHFFFAOYSA-N methyl 2-[[3-[(2-cyclohexyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C2CCCCC2)=C1 HWKMLNOBBANACI-UHFFFAOYSA-N 0.000 description 2
- GOSAGHMJTSKBOD-UHFFFAOYSA-N methyl 2-[[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC2=C(ON=C2C)C)=C1 GOSAGHMJTSKBOD-UHFFFAOYSA-N 0.000 description 2
- ONKMIOBXDYNNGK-UHFFFAOYSA-N methyl 2-[[3-[(3-bromophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=C(Br)C=CC=2)=C1 ONKMIOBXDYNNGK-UHFFFAOYSA-N 0.000 description 2
- LEXPHFBVTFXWHQ-UHFFFAOYSA-N methyl 2-[[3-[(4-ethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound C1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(=O)OC)=C1 LEXPHFBVTFXWHQ-UHFFFAOYSA-N 0.000 description 2
- WPBWVRJHOQRNEI-UHFFFAOYSA-N methyl 2-[[3-[(4-tert-butylcyclohexyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC2CCC(CC2)C(C)(C)C)=C1 WPBWVRJHOQRNEI-UHFFFAOYSA-N 0.000 description 2
- PYPQECUZMIYIGC-UHFFFAOYSA-N methyl 2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(=CC=2)C(C)(C)C)=C1 PYPQECUZMIYIGC-UHFFFAOYSA-N 0.000 description 2
- WKZLHOBHIIHJMJ-UHFFFAOYSA-N methyl 2-[[3-[(5-acetyl-2-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC=C(C=2)C(C)=O)OC)=C1 WKZLHOBHIIHJMJ-UHFFFAOYSA-N 0.000 description 2
- OVSILABHTPNMQM-UHFFFAOYSA-N methyl 2-[[3-[(5-ethylpyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound N1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(=O)OC)=C1 OVSILABHTPNMQM-UHFFFAOYSA-N 0.000 description 2
- BETKFKYGYMTJON-UHFFFAOYSA-N methyl 2-[[3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(ON=2)C(C)(C)C)=C1 BETKFKYGYMTJON-UHFFFAOYSA-N 0.000 description 2
- PWOPGERPVCAJPK-UHFFFAOYSA-N methyl 2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC(F)=CC3=CC=2)=C1 PWOPGERPVCAJPK-UHFFFAOYSA-N 0.000 description 2
- JXWUMZHFKAXCIT-UHFFFAOYSA-N methyl 2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC(OC)=CC3=CC=2)=C1 JXWUMZHFKAXCIT-UHFFFAOYSA-N 0.000 description 2
- AZQJFJKAUAJKKY-UHFFFAOYSA-N methyl 2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=C(Cl)C=CC3=CC=2)=C1 AZQJFJKAUAJKKY-UHFFFAOYSA-N 0.000 description 2
- KSKWRRYXMXHOSB-UHFFFAOYSA-N methyl 2-[[3-[2-(5-ethylpyridin-2-yl)ethoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound N1=CC(CC)=CC=C1CCOC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(=O)OC)=C1 KSKWRRYXMXHOSB-UHFFFAOYSA-N 0.000 description 2
- IJJUPNBBPYGZGR-UHFFFAOYSA-N methyl 2-[[3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=C(F)C=CC=2)=C1 IJJUPNBBPYGZGR-UHFFFAOYSA-N 0.000 description 2
- SVSSNKPHYQUAFF-UHFFFAOYSA-N methyl 2-[[3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=CC(F)=CC=2)=C1 SVSSNKPHYQUAFF-UHFFFAOYSA-N 0.000 description 2
- DIWDSBUPTUXHQD-UHFFFAOYSA-N methyl 2-[[3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=NOC=2C)C=2C(=CC=CC=2Cl)Cl)=C1 DIWDSBUPTUXHQD-UHFFFAOYSA-N 0.000 description 2
- BWRCJLJJIXYLNV-UHFFFAOYSA-N methyl 2-hydroxy-3-methoxybenzoate Chemical compound COC(=O)C1=CC=CC(OC)=C1O BWRCJLJJIXYLNV-UHFFFAOYSA-N 0.000 description 2
- ZICRWXFGZCVTBZ-UHFFFAOYSA-N methyl 2-hydroxy-4-methoxybenzoate Chemical compound COC(=O)C1=CC=C(OC)C=C1O ZICRWXFGZCVTBZ-UHFFFAOYSA-N 0.000 description 2
- DFNBGZODMHWKKK-UHFFFAOYSA-N methyl 2-hydroxy-5-methoxybenzoate Chemical compound COC(=O)C1=CC(OC)=CC=C1O DFNBGZODMHWKKK-UHFFFAOYSA-N 0.000 description 2
- IKMPYLXZCOHVDD-UHFFFAOYSA-N methyl 2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC=CC=2)=C1 IKMPYLXZCOHVDD-UHFFFAOYSA-N 0.000 description 2
- CQNSNESUAPDCJP-UHFFFAOYSA-N methyl 2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=C3C=CC=CC3=CC=2)=C1 CQNSNESUAPDCJP-UHFFFAOYSA-N 0.000 description 2
- SDMBKTYFSDHECZ-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C(OC=2)C=2C=CC=CC=2)=C1 SDMBKTYFSDHECZ-UHFFFAOYSA-N 0.000 description 2
- FHPSTJQFPVEYJT-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(3-methylquinoxalin-2-yl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=NC3=CC=CC=C3N=2)C)=C1 FHPSTJQFPVEYJT-UHFFFAOYSA-N 0.000 description 2
- ZPPQNSIQMGWSCQ-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[(4-propan-2-ylphenyl)methoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(=CC=2)C(C)C)=C1 ZPPQNSIQMGWSCQ-UHFFFAOYSA-N 0.000 description 2
- BBXCJXQTYTWFCW-UHFFFAOYSA-N methyl 2-methyl-6-[[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenoxy]methyl]benzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCCC2=C(OC(=N2)C=2C=CC=CC=2)C)=C1 BBXCJXQTYTWFCW-UHFFFAOYSA-N 0.000 description 2
- INQCGTXAYKWHGH-UHFFFAOYSA-N methyl 3-(bromomethyl)thiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1CBr INQCGTXAYKWHGH-UHFFFAOYSA-N 0.000 description 2
- HCBQTGAZENNMLM-UHFFFAOYSA-N methyl 4-bromo-3-oxopentanoate Chemical compound COC(=O)CC(=O)C(C)Br HCBQTGAZENNMLM-UHFFFAOYSA-N 0.000 description 2
- DCPIISVYWKGJEV-UHFFFAOYSA-N methyl 5-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]pyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 DCPIISVYWKGJEV-UHFFFAOYSA-N 0.000 description 2
- 229960001047 methyl salicylate Drugs 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 2
- 235000019799 monosodium phosphate Nutrition 0.000 description 2
- 238000010534 nucleophilic substitution reaction Methods 0.000 description 2
- 125000001715 oxadiazolyl group Chemical group 0.000 description 2
- 150000002916 oxazoles Chemical class 0.000 description 2
- 125000002971 oxazolyl group Chemical group 0.000 description 2
- 239000003614 peroxisome proliferator Substances 0.000 description 2
- 230000004526 pharmaceutical effect Effects 0.000 description 2
- LCPDWSOZIOUXRV-UHFFFAOYSA-N phenoxyacetic acid Chemical compound OC(=O)COC1=CC=CC=C1 LCPDWSOZIOUXRV-UHFFFAOYSA-N 0.000 description 2
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 2
- 229960003387 progesterone Drugs 0.000 description 2
- 239000000186 progesterone Substances 0.000 description 2
- 230000035755 proliferation Effects 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003216 pyrazines Chemical class 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical class C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 125000000168 pyrrolyl group Chemical group 0.000 description 2
- 238000010791 quenching Methods 0.000 description 2
- 125000004260 quinazolin-2-yl group Chemical group [H]C1=NC(*)=NC2=C1C([H])=C([H])C([H])=C2[H] 0.000 description 2
- JWVCLYRUEFBMGU-UHFFFAOYSA-N quinazoline Chemical compound N1=CN=CC2=CC=CC=C21 JWVCLYRUEFBMGU-UHFFFAOYSA-N 0.000 description 2
- 125000004159 quinolin-2-yl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C([H])C(*)=NC2=C1[H] 0.000 description 2
- 230000008707 rearrangement Effects 0.000 description 2
- 238000006268 reductive amination reaction Methods 0.000 description 2
- 230000001105 regulatory effect Effects 0.000 description 2
- GDESWOTWNNGOMW-UHFFFAOYSA-N resorcinol monobenzoate Chemical compound OC1=CC=CC(OC(=O)C=2C=CC=CC=2)=C1 GDESWOTWNNGOMW-UHFFFAOYSA-N 0.000 description 2
- 238000007363 ring formation reaction Methods 0.000 description 2
- 238000002390 rotary evaporation Methods 0.000 description 2
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 2
- 230000003248 secreting effect Effects 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000010532 solid phase synthesis reaction Methods 0.000 description 2
- 229910000080 stannane Inorganic materials 0.000 description 2
- 230000010009 steroidogenesis Effects 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 2
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 2
- 229950009390 symclosene Drugs 0.000 description 2
- 229940095064 tartrate Drugs 0.000 description 2
- FPGGTKZVZWFYPV-UHFFFAOYSA-M tetrabutylammonium fluoride Chemical compound [F-].CCCC[N+](CCCC)(CCCC)CCCC FPGGTKZVZWFYPV-UHFFFAOYSA-M 0.000 description 2
- 150000003536 tetrazoles Chemical class 0.000 description 2
- 150000003557 thiazoles Chemical class 0.000 description 2
- 125000000335 thiazolyl group Chemical group 0.000 description 2
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 2
- UMGDCJDMYOKAJW-UHFFFAOYSA-N thiourea Chemical compound NC(N)=S UMGDCJDMYOKAJW-UHFFFAOYSA-N 0.000 description 2
- 238000000844 transformation Methods 0.000 description 2
- 125000000876 trifluoromethoxy group Chemical group FC(F)(F)O* 0.000 description 2
- YFNKIDBQEZZDLK-UHFFFAOYSA-N triglyme Chemical compound COCCOCCOCCOC YFNKIDBQEZZDLK-UHFFFAOYSA-N 0.000 description 2
- PYOKUURKVVELLB-UHFFFAOYSA-N trimethyl orthoformate Chemical compound COC(OC)OC PYOKUURKVVELLB-UHFFFAOYSA-N 0.000 description 2
- BRHOKTBAFIQRFX-UHFFFAOYSA-M triphenyl(quinolin-2-ylmethyl)phosphanium;chloride Chemical compound [Cl-].C=1C=C2C=CC=CC2=NC=1C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BRHOKTBAFIQRFX-UHFFFAOYSA-M 0.000 description 2
- 238000001665 trituration Methods 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- ITYNGVSTWVVPIC-DHGKCCLASA-N (-)-allo-Aromadendrene Chemical compound C([C@@H]1[C@H]2C1(C)C)CC(=C)[C@@H]1[C@H]2[C@H](C)CC1 ITYNGVSTWVVPIC-DHGKCCLASA-N 0.000 description 1
- UKSZBOKPHAQOMP-SVLSSHOZSA-N (1e,4e)-1,5-diphenylpenta-1,4-dien-3-one;palladium Chemical compound [Pd].C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1.C=1C=CC=CC=1\C=C\C(=O)\C=C\C1=CC=CC=C1 UKSZBOKPHAQOMP-SVLSSHOZSA-N 0.000 description 1
- SHULEACXTONYPS-UHFFFAOYSA-N (3-hydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1 SHULEACXTONYPS-UHFFFAOYSA-N 0.000 description 1
- AAWZDTNXLSGCEK-LNVDRNJUSA-N (3r,5r)-1,3,4,5-tetrahydroxycyclohexane-1-carboxylic acid Chemical compound O[C@@H]1CC(O)(C(O)=O)C[C@@H](O)C1O AAWZDTNXLSGCEK-LNVDRNJUSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- DIOHEXPTUTVCNX-UHFFFAOYSA-N 1,1,1-trifluoro-n-phenyl-n-(trifluoromethylsulfonyl)methanesulfonamide Chemical compound FC(F)(F)S(=O)(=O)N(S(=O)(=O)C(F)(F)F)C1=CC=CC=C1 DIOHEXPTUTVCNX-UHFFFAOYSA-N 0.000 description 1
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 description 1
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical class C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 1
- 125000004514 1,2,4-thiadiazolyl group Chemical group 0.000 description 1
- 150000000178 1,2,4-triazoles Chemical class 0.000 description 1
- QFMZQPDHXULLKC-UHFFFAOYSA-N 1,2-bis(diphenylphosphino)ethane Chemical compound C=1C=CC=CC=1P(C=1C=CC=CC=1)CCP(C=1C=CC=CC=1)C1=CC=CC=C1 QFMZQPDHXULLKC-UHFFFAOYSA-N 0.000 description 1
- YZIFVWOCPGPNHB-UHFFFAOYSA-N 1,2-dichloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C(Cl)=C1 YZIFVWOCPGPNHB-UHFFFAOYSA-N 0.000 description 1
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- 150000005072 1,3,4-oxadiazoles Chemical class 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical compound C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- 125000004520 1,3,4-thiadiazolyl group Chemical group 0.000 description 1
- LVEYOSJUKRVCCF-UHFFFAOYSA-N 1,3-Bis(diphenylphosphino)propane Substances C=1C=CC=CC=1P(C=1C=CC=CC=1)CCCP(C=1C=CC=CC=1)C1=CC=CC=C1 LVEYOSJUKRVCCF-UHFFFAOYSA-N 0.000 description 1
- 125000005838 1,3-cyclopentylene group Chemical group [H]C1([H])C([H])([H])C([H])([*:2])C([H])([H])C1([H])[*:1] 0.000 description 1
- NQPJDJVGBDHCAD-UHFFFAOYSA-N 1,3-diazinan-2-one Chemical compound OC1=NCCCN1 NQPJDJVGBDHCAD-UHFFFAOYSA-N 0.000 description 1
- JPRPJUMQRZTTED-UHFFFAOYSA-N 1,3-dioxolanyl Chemical group [CH]1OCCO1 JPRPJUMQRZTTED-UHFFFAOYSA-N 0.000 description 1
- ZOBPZXTWZATXDG-UHFFFAOYSA-N 1,3-thiazolidine-2,4-dione Chemical compound O=C1CSC(=O)N1 ZOBPZXTWZATXDG-UHFFFAOYSA-N 0.000 description 1
- VBXZSFNZVNDOPB-UHFFFAOYSA-N 1,4,5,6-tetrahydropyrimidine Chemical compound C1CNC=NC1 VBXZSFNZVNDOPB-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- 125000005940 1,4-dioxanyl group Chemical group 0.000 description 1
- 125000000182 1,4-naphthoquinonyl group Chemical group C1(C(=CC(C2=CC=CC=C12)=O)*)=O 0.000 description 1
- SWFFFUJOWAJJCH-UHFFFAOYSA-N 1-(bromomethyl)-2,4-bis(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(CBr)C(C(F)(F)F)=C1 SWFFFUJOWAJJCH-UHFFFAOYSA-N 0.000 description 1
- WGVYCXYGPNNUQA-UHFFFAOYSA-N 1-(bromomethyl)-2-methylbenzene Chemical group CC1=CC=CC=C1CBr WGVYCXYGPNNUQA-UHFFFAOYSA-N 0.000 description 1
- QZNQSIHCDAGZIA-UHFFFAOYSA-N 1-(bromomethyl)-4-tert-butylbenzene Chemical compound CC(C)(C)C1=CC=C(CBr)C=C1 QZNQSIHCDAGZIA-UHFFFAOYSA-N 0.000 description 1
- YHMFTAUOYLECGZ-UHFFFAOYSA-N 1-(chloromethyl)-2,4,5-trimethylbenzene Chemical compound CC1=CC(C)=C(CCl)C=C1C YHMFTAUOYLECGZ-UHFFFAOYSA-N 0.000 description 1
- VGISFWWEOGVMED-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CCl)=C1 VGISFWWEOGVMED-UHFFFAOYSA-N 0.000 description 1
- HLQZCRVEEQKNMS-UHFFFAOYSA-N 1-(chloromethyl)-4-phenylbenzene Chemical compound C1=CC(CCl)=CC=C1C1=CC=CC=C1 HLQZCRVEEQKNMS-UHFFFAOYSA-N 0.000 description 1
- CYAKWEQUWJAHLW-UHFFFAOYSA-N 1-(chloromethyl)-4-propan-2-ylbenzene Chemical compound CC(C)C1=CC=C(CCl)C=C1 CYAKWEQUWJAHLW-UHFFFAOYSA-N 0.000 description 1
- WSAAMLRZZHNAGH-UHFFFAOYSA-N 1-(chloromethyl)-5-methyl-2,4-di(propan-2-yl)benzene Chemical compound CC(C)C1=CC(C(C)C)=C(CCl)C=C1C WSAAMLRZZHNAGH-UHFFFAOYSA-N 0.000 description 1
- XMWGTKZEDLCVIG-UHFFFAOYSA-N 1-(chloromethyl)naphthalene Chemical compound C1=CC=C2C(CCl)=CC=CC2=C1 XMWGTKZEDLCVIG-UHFFFAOYSA-N 0.000 description 1
- OOSZCNKVJAVHJI-UHFFFAOYSA-N 1-[(4-fluorophenyl)methyl]piperazine Chemical compound C1=CC(F)=CC=C1CN1CCNCC1 OOSZCNKVJAVHJI-UHFFFAOYSA-N 0.000 description 1
- BNLRVFJSVGTTGG-UHFFFAOYSA-N 1-[3-(chloromethyl)-4-methoxyphenyl]ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1CCl BNLRVFJSVGTTGG-UHFFFAOYSA-N 0.000 description 1
- BHKKSKOHRFHHIN-MRVPVSSYSA-N 1-[[2-[(1R)-1-aminoethyl]-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one Chemical compound N[C@H](C)C1=C(CN2C(NC(C3=C2C=CN3)=O)=S)C=CC(=C1)Cl BHKKSKOHRFHHIN-MRVPVSSYSA-N 0.000 description 1
- OFFSPAZVIVZPHU-UHFFFAOYSA-N 1-benzofuran-2-carboxylic acid Chemical class C1=CC=C2OC(C(=O)O)=CC2=C1 OFFSPAZVIVZPHU-UHFFFAOYSA-N 0.000 description 1
- ZPCJPJQUVRIILS-UHFFFAOYSA-N 1-bromo-3-(bromomethyl)benzene Chemical compound BrCC1=CC=CC(Br)=C1 ZPCJPJQUVRIILS-UHFFFAOYSA-N 0.000 description 1
- BASMANVIUSSIIM-UHFFFAOYSA-N 1-chloro-2-(chloromethyl)benzene Chemical compound ClCC1=CC=CC=C1Cl BASMANVIUSSIIM-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- NYTNYFUANIMNDU-UHFFFAOYSA-N 1-ethynyl-3-(2-methoxyethoxymethoxy)benzene Chemical compound COCCOCOC1=CC=CC(C#C)=C1 NYTNYFUANIMNDU-UHFFFAOYSA-N 0.000 description 1
- WAXIFMGAKWIFDQ-UHFFFAOYSA-N 1-tert-butyl-4-(chloromethyl)benzene Chemical compound CC(C)(C)C1=CC=C(CCl)C=C1 WAXIFMGAKWIFDQ-UHFFFAOYSA-N 0.000 description 1
- VHRUMKCAEVRUBK-GODQJPCRSA-N 15-deoxy-Delta(12,14)-prostaglandin J2 Chemical compound CCCCC\C=C\C=C1/[C@@H](C\C=C/CCCC(O)=O)C=CC1=O VHRUMKCAEVRUBK-GODQJPCRSA-N 0.000 description 1
- 125000005955 1H-indazolyl group Chemical group 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical group C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 1
- TXJUTRJFNRYTHH-UHFFFAOYSA-N 1h-3,1-benzoxazine-2,4-dione Chemical compound C1=CC=C2C(=O)OC(=O)NC2=C1 TXJUTRJFNRYTHH-UHFFFAOYSA-N 0.000 description 1
- AAILEWXSEQLMNI-UHFFFAOYSA-N 1h-pyridazin-6-one Chemical compound OC1=CC=CN=N1 AAILEWXSEQLMNI-UHFFFAOYSA-N 0.000 description 1
- DNCYBUMDUBHIJZ-UHFFFAOYSA-N 1h-pyrimidin-6-one Chemical compound O=C1C=CN=CN1 DNCYBUMDUBHIJZ-UHFFFAOYSA-N 0.000 description 1
- KGRVJHAUYBGFFP-UHFFFAOYSA-N 2,2'-Methylenebis(4-methyl-6-tert-butylphenol) Chemical compound CC(C)(C)C1=CC(C)=CC(CC=2C(=C(C=C(C)C=2)C(C)(C)C)O)=C1O KGRVJHAUYBGFFP-UHFFFAOYSA-N 0.000 description 1
- WEVFUSSJCGAVOH-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-carboxylic acid Chemical group C1=CC=C2OC(C(=O)O)CC2=C1 WEVFUSSJCGAVOH-UHFFFAOYSA-N 0.000 description 1
- ITMGMSZDAOAVNO-UHFFFAOYSA-N 2,3-dihydro-1-benzofuran-2-ylmethanol Chemical compound C1=CC=C2OC(CO)CC2=C1 ITMGMSZDAOAVNO-UHFFFAOYSA-N 0.000 description 1
- FKHNZQFCDGOQGV-UHFFFAOYSA-N 2,3-dimethylquinoxaline Chemical compound C1=CC=C2N=C(C)C(C)=NC2=C1 FKHNZQFCDGOQGV-UHFFFAOYSA-N 0.000 description 1
- IRSVDHPYXFLLDS-UHFFFAOYSA-N 2,4-dichloro-1-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1Cl IRSVDHPYXFLLDS-UHFFFAOYSA-N 0.000 description 1
- BTTNYQZNBZNDOR-UHFFFAOYSA-N 2,4-dichloropyrimidine Chemical compound ClC1=CC=NC(Cl)=N1 BTTNYQZNBZNDOR-UHFFFAOYSA-N 0.000 description 1
- CEPCPXLLFXPZGW-UHFFFAOYSA-N 2,4-difluoroaniline Chemical compound NC1=CC=C(F)C=C1F CEPCPXLLFXPZGW-UHFFFAOYSA-N 0.000 description 1
- WXTMDXOMEHJXQO-UHFFFAOYSA-N 2,5-dihydroxybenzoic acid Chemical class OC(=O)C1=CC(O)=CC=C1O WXTMDXOMEHJXQO-UHFFFAOYSA-N 0.000 description 1
- JSXTUKSOFJPTFV-UHFFFAOYSA-N 2,6-dibromo-1h-pyridazine Chemical compound BrN1NC(Br)=CC=C1 JSXTUKSOFJPTFV-UHFFFAOYSA-N 0.000 description 1
- FEYDZHNIIMENOB-UHFFFAOYSA-N 2,6-dibromopyridine Chemical compound BrC1=CC=CC(Br)=N1 FEYDZHNIIMENOB-UHFFFAOYSA-N 0.000 description 1
- HCBHQDKBSKYGCK-UHFFFAOYSA-N 2,6-dimethylbenzoic acid Chemical compound CC1=CC=CC(C)=C1C(O)=O HCBHQDKBSKYGCK-UHFFFAOYSA-N 0.000 description 1
- MJFBPZVOKMFINZ-UHFFFAOYSA-N 2-(aminomethyl)-6-methylbenzoic acid Chemical compound CC1=CC=CC(CN)=C1C(O)=O MJFBPZVOKMFINZ-UHFFFAOYSA-N 0.000 description 1
- WNKGWGYRZPIHSQ-UHFFFAOYSA-N 2-(bromomethyl)-3-methylnaphthalene Chemical compound C1=CC=C2C=C(CBr)C(C)=CC2=C1 WNKGWGYRZPIHSQ-UHFFFAOYSA-N 0.000 description 1
- JIFUUGHBYDMCDY-UHFFFAOYSA-N 2-(bromomethyl)-6-methoxyquinoline Chemical compound N1=C(CBr)C=CC2=CC(OC)=CC=C21 JIFUUGHBYDMCDY-UHFFFAOYSA-N 0.000 description 1
- WJOPLBNTJYROCF-UHFFFAOYSA-N 2-(bromomethyl)-7-chloroquinoline Chemical compound C1=CC(CBr)=NC2=CC(Cl)=CC=C21 WJOPLBNTJYROCF-UHFFFAOYSA-N 0.000 description 1
- PECXPZGFZFGDRD-UHFFFAOYSA-N 2-(chloromethyl)-1,4-dimethylbenzene Chemical compound CC1=CC=C(C)C(CCl)=C1 PECXPZGFZFGDRD-UHFFFAOYSA-N 0.000 description 1
- MPCHQYWZAVTABQ-UHFFFAOYSA-N 2-(chloromethyl)naphthalene Chemical compound C1=CC=CC2=CC(CCl)=CC=C21 MPCHQYWZAVTABQ-UHFFFAOYSA-N 0.000 description 1
- NJWIMFZLESWFIM-UHFFFAOYSA-N 2-(chloromethyl)pyridine Chemical compound ClCC1=CC=CC=N1 NJWIMFZLESWFIM-UHFFFAOYSA-N 0.000 description 1
- LDKLCVRBYMIFQX-UHFFFAOYSA-N 2-[(3-hydroxyphenoxy)methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(O)C=CC=2)=C1C(O)=O LDKLCVRBYMIFQX-UHFFFAOYSA-N 0.000 description 1
- JXUDLWAIUVLYTJ-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=C(Cl)C=C(Cl)C=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 JXUDLWAIUVLYTJ-UHFFFAOYSA-N 0.000 description 1
- YDLFBUNMTKSPEZ-UHFFFAOYSA-N 2-[2,4-dichloro-6-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=C(Cl)C=C(Cl)C=C1COC1=CC=CC(OCC=2N=C3C=CC(F)=CC3=CC=2)=C1 YDLFBUNMTKSPEZ-UHFFFAOYSA-N 0.000 description 1
- LXRWAZPUEYNOOG-UHFFFAOYSA-N 2-[2-(bromomethyl)-6-tert-butylphenoxy]acetonitrile Chemical compound CC(C)(C)C1=CC=CC(CBr)=C1OCC#N LXRWAZPUEYNOOG-UHFFFAOYSA-N 0.000 description 1
- NSRCCOXJCVBKTO-UHFFFAOYSA-N 2-[2-[[2-acetyl-5-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC(=O)C1=CC=C(OCC=2N=C3C=CC=CC3=CC=2)C=C1OCC1=CC=CC(C)=C1OCC(O)=O NSRCCOXJCVBKTO-UHFFFAOYSA-N 0.000 description 1
- PEUSGUNPDPAAAD-UHFFFAOYSA-N 2-[2-[[2-bromo-5-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C(=CC=C(OCC=3N=C4C=CC=CC4=CC=3)C=2)Br)=C1OCC(O)=O PEUSGUNPDPAAAD-UHFFFAOYSA-N 0.000 description 1
- MTVQCBMENFSDPQ-UHFFFAOYSA-N 2-[2-[[3-(hydroxymethyl)phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(CO)C=CC=2)=C1OCC#N MTVQCBMENFSDPQ-UHFFFAOYSA-N 0.000 description 1
- VNXZPMPOUBRNGE-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 VNXZPMPOUBRNGE-UHFFFAOYSA-N 0.000 description 1
- KAHYLWGDMIVWPV-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanedioic acid Chemical compound OC(=O)CCC(C(O)=O)OC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 KAHYLWGDMIVWPV-UHFFFAOYSA-N 0.000 description 1
- CBGHJTPDLOAKAP-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 CBGHJTPDLOAKAP-UHFFFAOYSA-N 0.000 description 1
- LNKSYKJFBRXQBE-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LNKSYKJFBRXQBE-UHFFFAOYSA-N 0.000 description 1
- PSPCKOYRUGINDF-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetonitrile Chemical compound N#CCC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 PSPCKOYRUGINDF-UHFFFAOYSA-N 0.000 description 1
- XTDMCDPZNMPKTG-UHFFFAOYSA-N 2-[2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 XTDMCDPZNMPKTG-UHFFFAOYSA-N 0.000 description 1
- GVSIHLPSTLCIOK-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-4-chloro-6-methylphenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC(O)=O GVSIHLPSTLCIOK-UHFFFAOYSA-N 0.000 description 1
- GEQXGIRHYBECGV-UHFFFAOYSA-N 2-[2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1OCC(O)=O GEQXGIRHYBECGV-UHFFFAOYSA-N 0.000 description 1
- MIZYNPXQUSLLIR-UHFFFAOYSA-N 2-[2-[[3-[(2-ethoxycarbonyl-3-methyl-5-phenylmethoxyphenoxy)methyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=C(OCC=2C=C(OCC=3C(=C(C)C=CC=3)OCC(O)=O)C=CC=2)C(C(=O)OCC)=C(C)C=C1OCC1=CC=CC=C1 MIZYNPXQUSLLIR-UHFFFAOYSA-N 0.000 description 1
- AWVZDLXASKSMNP-UHFFFAOYSA-N 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(Cl)C(Cl)=CC=3)C=CC=2)=C1OCC(O)=O AWVZDLXASKSMNP-UHFFFAOYSA-N 0.000 description 1
- WPDDBXJFMRUPHB-UHFFFAOYSA-N 2-[2-[[3-[(3,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(Cl)C(Cl)=CC=3)C=CC=2)=C1OCC#N WPDDBXJFMRUPHB-UHFFFAOYSA-N 0.000 description 1
- KMSKVCZBSBAIJQ-UHFFFAOYSA-N 2-[2-[[3-[(3-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound COC1=CC=CC(COC=2C=C(OCC=3C(=C(C)C=CC=3)OCC(O)=O)C=CC=2)=C1 KMSKVCZBSBAIJQ-UHFFFAOYSA-N 0.000 description 1
- OQVMFLXEPAELDQ-UHFFFAOYSA-N 2-[2-[[3-[(3-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound COC1=CC=CC(COC=2C=C(OCC=3C(=C(C)C=CC=3)OCC#N)C=CC=2)=C1 OQVMFLXEPAELDQ-UHFFFAOYSA-N 0.000 description 1
- JBZSDQCRNYKZFK-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC(O)=O JBZSDQCRNYKZFK-UHFFFAOYSA-N 0.000 description 1
- FQHOXIZRKSUHKS-UHFFFAOYSA-N 2-[2-[[3-[(4-chloroquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=C(Cl)C=3)C=CC=2)=C1OCC(O)=O FQHOXIZRKSUHKS-UHFFFAOYSA-N 0.000 description 1
- VAMFBAUHSXUISI-UHFFFAOYSA-N 2-[2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C(C)(C)C)C=CC=2)=C1OCC(O)=O VAMFBAUHSXUISI-UHFFFAOYSA-N 0.000 description 1
- FXBDARZLLNHQPQ-UHFFFAOYSA-N 2-[2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C(C)(C)C)C=CC=2)=C1OCC#N FXBDARZLLNHQPQ-UHFFFAOYSA-N 0.000 description 1
- RQQRTRVYZVCQDQ-UHFFFAOYSA-N 2-[2-[[3-[(6,7-dichloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C(Cl)=CC4=CC=3)C=CC=2)=C1OCC(O)=O RQQRTRVYZVCQDQ-UHFFFAOYSA-N 0.000 description 1
- PTOTVZAWEUUOGT-UHFFFAOYSA-N 2-[2-[[3-[(6,7-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(F)C(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O PTOTVZAWEUUOGT-UHFFFAOYSA-N 0.000 description 1
- FZOKDOIBEPOFEM-UHFFFAOYSA-N 2-[2-[[3-[(6,8-difluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C(F)=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O FZOKDOIBEPOFEM-UHFFFAOYSA-N 0.000 description 1
- IZZHJLUXOLYQDF-UHFFFAOYSA-N 2-[2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O IZZHJLUXOLYQDF-UHFFFAOYSA-N 0.000 description 1
- CYZMIBOQEHVEPJ-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC(O)=O CYZMIBOQEHVEPJ-UHFFFAOYSA-N 0.000 description 1
- WFYPQWQRAYVDAF-UHFFFAOYSA-N 2-[2-[[3-[(6-methoxyquinolin-2-yl)methoxymethyl]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC(O)=O WFYPQWQRAYVDAF-UHFFFAOYSA-N 0.000 description 1
- YYHNKPLJESGGDT-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroisoquinolin-3-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC4=CC(Cl)=CC=C4C=3)C=CC=2)=C1OCC(O)=O YYHNKPLJESGGDT-UHFFFAOYSA-N 0.000 description 1
- PUDXBHCYYZYANW-UHFFFAOYSA-N 2-[2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1OCC(O)=O PUDXBHCYYZYANW-UHFFFAOYSA-N 0.000 description 1
- HWHLIOOQULJULZ-UHFFFAOYSA-N 2-[2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 HWHLIOOQULJULZ-UHFFFAOYSA-N 0.000 description 1
- JRDDFVLZQUQAAD-UHFFFAOYSA-N 2-[2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetic acid Chemical compound OC(=O)CC1=CC=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 JRDDFVLZQUQAAD-UHFFFAOYSA-N 0.000 description 1
- YTQHVIUPACMBNF-UHFFFAOYSA-N 2-[2-[[4-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]propanoic acid Chemical compound OC(=O)C(C)OC1=CC=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC(Cl)=C2)C2=N1 YTQHVIUPACMBNF-UHFFFAOYSA-N 0.000 description 1
- FBPFNXFNASPKQR-UHFFFAOYSA-N 2-[2-[[4-bromo-3-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C(Br)=CC=2)=C1OCC(O)=O FBPFNXFNASPKQR-UHFFFAOYSA-N 0.000 description 1
- APXLUDYTLGTMOW-UHFFFAOYSA-N 2-[2-chloro-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)OC1=C(Cl)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 APXLUDYTLGTMOW-UHFFFAOYSA-N 0.000 description 1
- VQNOQOFUMAOXDO-UHFFFAOYSA-N 2-[2-chloro-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=C(Cl)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 VQNOQOFUMAOXDO-UHFFFAOYSA-N 0.000 description 1
- XTJCZDJWQDRBBT-UHFFFAOYSA-N 2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]-4-methylpentanoic acid Chemical compound CC(C)CC(C(O)=O)OC1=C(Cl)C=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 XTJCZDJWQDRBBT-UHFFFAOYSA-N 0.000 description 1
- GFDPTDDMIKEYAU-UHFFFAOYSA-N 2-[2-chloro-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=C(Cl)C=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 GFDPTDDMIKEYAU-UHFFFAOYSA-N 0.000 description 1
- IWEXAKGNIWPCAS-UHFFFAOYSA-N 2-[2-methoxycarbonyl-5-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound C1=C(OCC(O)=O)C(C(=O)OC)=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 IWEXAKGNIWPCAS-UHFFFAOYSA-N 0.000 description 1
- LEJZQWQPPAHBTF-UHFFFAOYSA-N 2-[2-methoxycarbonyl-5-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound C1=C(OCC(O)=O)C(C(=O)OC)=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 LEJZQWQPPAHBTF-UHFFFAOYSA-N 0.000 description 1
- NAYFPNRNQVXCLE-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-phenoxyethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3C=CC=CC=3)C=CC=2)=C1OCC(O)=O NAYFPNRNQVXCLE-UHFFFAOYSA-N 0.000 description 1
- LAPSQDJGJNGHRP-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O LAPSQDJGJNGHRP-UHFFFAOYSA-N 0.000 description 1
- FICVCSSCGIBJQQ-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O FICVCSSCGIBJQQ-UHFFFAOYSA-N 0.000 description 1
- UFFRZQPJCKJHDX-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-quinolin-2-ylethenyl)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(C=CC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC#N UFFRZQPJCKJHDX-UHFFFAOYSA-N 0.000 description 1
- QQBDDFVFQOPHGM-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(2-quinolin-2-ylethyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O QQBDDFVFQOPHGM-UHFFFAOYSA-N 0.000 description 1
- HADKUIXOVAOVLD-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(3-phenylpropoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCCC=3C=CC=CC=3)C=CC=2)=C1OCC(O)=O HADKUIXOVAOVLD-UHFFFAOYSA-N 0.000 description 1
- KGSCOSINGNGGGN-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(3-phenylpropoxy)phenoxy]methyl]phenoxy]acetonitrile Chemical compound CC1=CC=CC(COC=2C=C(OCCCC=3C=CC=CC=3)C=CC=2)=C1OCC#N KGSCOSINGNGGGN-UHFFFAOYSA-N 0.000 description 1
- SXHFXDYFENSLKY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O SXHFXDYFENSLKY-UHFFFAOYSA-N 0.000 description 1
- DCPXFINPOVRPQX-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O DCPXFINPOVRPQX-UHFFFAOYSA-N 0.000 description 1
- BHYAPQKSXFAWGU-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-3-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=NC=CC=3)C=CC=2)=C1OCC(O)=O BHYAPQKSXFAWGU-UHFFFAOYSA-N 0.000 description 1
- XYAUPRHFRMDLHA-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(pyridin-4-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CN=CC=3)C=CC=2)=C1OCC(O)=O XYAUPRHFRMDLHA-UHFFFAOYSA-N 0.000 description 1
- DJDQMNIWNMDOLS-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoic acid Chemical compound OC(=O)C(C)OC1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 DJDQMNIWNMDOLS-UHFFFAOYSA-N 0.000 description 1
- ZNJRCIRPAXGXGV-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O ZNJRCIRPAXGXGV-UHFFFAOYSA-N 0.000 description 1
- UFEUYIJWNFITTI-UHFFFAOYSA-N 2-[2-methyl-6-[[3-(quinoxalin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=NC=3)C=CC=2)=C1OCC(O)=O UFEUYIJWNFITTI-UHFFFAOYSA-N 0.000 description 1
- KHWRADQUJRJKFW-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1,3,3-trimethyl-2-oxoindol-6-yl)oxymethyl]phenoxy]methyl]phenoxy]acetic acid Chemical compound C1=C2N(C)C(=O)C(C)(C)C2=CC=C1OCC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1OCC(O)=O KHWRADQUJRJKFW-UHFFFAOYSA-N 0.000 description 1
- ACQAJMQUDVSGOA-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(1-methyl-4-oxoquinolin-2-yl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C4=CC=CC=C4C(=O)C=3)C)C=CC=2)=C1OCC(O)=O ACQAJMQUDVSGOA-UHFFFAOYSA-N 0.000 description 1
- PXSSXLXRFCBVMY-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(SC=3)C=3C=CC=CC=3)C=CC=2)=C1OCC(O)=O PXSSXLXRFCBVMY-UHFFFAOYSA-N 0.000 description 1
- ZCYHLBXZRLHXOD-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(3-phenoxyphenyl)methoxy]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(OC=4C=CC=CC=4)C=CC=3)C=CC=2)=C1OCC(O)=O ZCYHLBXZRLHXOD-UHFFFAOYSA-N 0.000 description 1
- ZEUSAOYJYGRVNX-UHFFFAOYSA-N 2-[2-methyl-6-[[3-[(quinolin-2-ylamino)methyl]phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O ZEUSAOYJYGRVNX-UHFFFAOYSA-N 0.000 description 1
- JUHKSIAZMQKMNW-UHFFFAOYSA-N 2-[2-methyl-6-[[3-methyl-5-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound C=1C(C)=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1OCC1=CC=CC(C)=C1OCC(O)=O JUHKSIAZMQKMNW-UHFFFAOYSA-N 0.000 description 1
- UNIAPNJRYOHUFC-UHFFFAOYSA-N 2-[2-methyl-6-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC=CC(COC=2C=CC(OCC=3N=C4C=CC=CC4=CC=3)=CC=2)=C1OCC(O)=O UNIAPNJRYOHUFC-UHFFFAOYSA-N 0.000 description 1
- KUUQQNWVQZGCHK-UHFFFAOYSA-N 2-[2-tert-butyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC(C)(C)C1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O KUUQQNWVQZGCHK-UHFFFAOYSA-N 0.000 description 1
- GGIUVOYFTQIODF-UHFFFAOYSA-N 2-[3-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound OC(=O)COC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 GGIUVOYFTQIODF-UHFFFAOYSA-N 0.000 description 1
- BKDKJEYVYVTSOP-UHFFFAOYSA-N 2-[3-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanedioic acid Chemical compound OC(=O)CCC(C(O)=O)OC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 BKDKJEYVYVTSOP-UHFFFAOYSA-N 0.000 description 1
- JLQAWOQAXYZZAX-UHFFFAOYSA-N 2-[3-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 JLQAWOQAXYZZAX-UHFFFAOYSA-N 0.000 description 1
- LRRVHUREWHDCSU-UHFFFAOYSA-N 2-[3-[[3-(quinolin-2-ylmethoxy)phenyl]methyl]indol-1-yl]acetic acid Chemical compound C12=CC=CC=C2N(CC(=O)O)C=C1CC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LRRVHUREWHDCSU-UHFFFAOYSA-N 0.000 description 1
- HGDQCAPHDOGTAX-UHFFFAOYSA-N 2-[4-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 HGDQCAPHDOGTAX-UHFFFAOYSA-N 0.000 description 1
- AQVLZLFLFANRSI-UHFFFAOYSA-N 2-[4-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]acetic acid Chemical compound C1=CC(CC(=O)O)=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 AQVLZLFLFANRSI-UHFFFAOYSA-N 0.000 description 1
- JSFHIQVFSSLNJE-UHFFFAOYSA-N 2-[4-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound C1=CC(OCC(=O)O)=CC=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 JSFHIQVFSSLNJE-UHFFFAOYSA-N 0.000 description 1
- OBZBGRXRCABBFR-UHFFFAOYSA-N 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]pentanoic acid Chemical compound CCCC(C(O)=O)OC1=CC=C(Cl)C=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 OBZBGRXRCABBFR-UHFFFAOYSA-N 0.000 description 1
- LOQGCRJVEZHAPT-UHFFFAOYSA-N 2-[4-chloro-2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LOQGCRJVEZHAPT-UHFFFAOYSA-N 0.000 description 1
- JBMBYXHELVQYIF-UHFFFAOYSA-N 2-[4-chloro-2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC(O)=O JBMBYXHELVQYIF-UHFFFAOYSA-N 0.000 description 1
- ZZEMBFRKBBQGPF-UHFFFAOYSA-N 2-[4-chloro-2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylphenoxy]acetonitrile Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1OCC#N ZZEMBFRKBBQGPF-UHFFFAOYSA-N 0.000 description 1
- GDPUAKUIIZBCQB-UHFFFAOYSA-N 2-[4-chloro-2-[[4-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1COC(C=C1)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 GDPUAKUIIZBCQB-UHFFFAOYSA-N 0.000 description 1
- LTXVRPJTPXSQET-UHFFFAOYSA-N 2-[4-chloro-2-methoxy-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound COC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O LTXVRPJTPXSQET-UHFFFAOYSA-N 0.000 description 1
- CQIPWMMTGUCRJU-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1OCC(O)=O CQIPWMMTGUCRJU-UHFFFAOYSA-N 0.000 description 1
- IZCKFAPIJXAPAH-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O IZCKFAPIJXAPAH-UHFFFAOYSA-N 0.000 description 1
- PGDAFULBXYIWGA-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]phenoxy]acetic acid Chemical compound CC1=CC(Cl)=CC(COCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC(O)=O PGDAFULBXYIWGA-UHFFFAOYSA-N 0.000 description 1
- RXHMGEJKWDSYPA-UHFFFAOYSA-N 2-[4-chloro-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]phenoxy]acetonitrile Chemical compound ClC1=CC(=C(OCC#N)C(=C1)COCC1=CC(=CC=C1)OCC1=NC2=CC=CC=C2C=C1)C RXHMGEJKWDSYPA-UHFFFAOYSA-N 0.000 description 1
- XSWFIFNDEPETPZ-UHFFFAOYSA-N 2-[6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]oxyacetic acid Chemical class OC(=O)COC1C=CC=CC1=C=O XSWFIFNDEPETPZ-UHFFFAOYSA-N 0.000 description 1
- KGARCNGWNSWMTG-UHFFFAOYSA-N 2-[6-acetyl-2-propyl-3-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenoxy]acetic acid Chemical compound C1=CC(C(C)=O)=C(OCC(O)=O)C(CCC)=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 KGARCNGWNSWMTG-UHFFFAOYSA-N 0.000 description 1
- GARZESVYOJAOQC-UHFFFAOYSA-N 2-[[2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenyl]methyl]propanedioic acid Chemical compound OC(=O)C(C(O)=O)CC1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 GARZESVYOJAOQC-UHFFFAOYSA-N 0.000 description 1
- QZQFCSAFZBNYHK-UHFFFAOYSA-N 2-[[3-(chloromethyl)phenoxy]methyl]quinoline Chemical compound ClCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 QZQFCSAFZBNYHK-UHFFFAOYSA-N 0.000 description 1
- RSQYGTQLMIFUFC-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]-3h-thiophene-2-carboxylic acid Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1OCC1(C(=O)O)CC=CS1 RSQYGTQLMIFUFC-UHFFFAOYSA-N 0.000 description 1
- HNNWHTLTSFDCHI-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 HNNWHTLTSFDCHI-UHFFFAOYSA-N 0.000 description 1
- BEGUYXNMALYINZ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]-6-(trifluoromethyl)benzoic acid Chemical compound C1=CC=C(C(F)(F)F)C(C(=O)O)=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 BEGUYXNMALYINZ-UHFFFAOYSA-N 0.000 description 1
- RCYJXQHSUHJUMJ-UHFFFAOYSA-N 2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 RCYJXQHSUHJUMJ-UHFFFAOYSA-N 0.000 description 1
- NHAFUWZMASOSOM-UHFFFAOYSA-N 2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(CNC=3OC4=CC=CC=C4N=3)C=CC=2)=C1C(O)=O NHAFUWZMASOSOM-UHFFFAOYSA-N 0.000 description 1
- SATOZKURYMDUKM-UHFFFAOYSA-N 2-[[3-[(1,3-benzoxazol-2-ylmethylamino)methyl]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(CNCC=3OC4=CC=CC=C4N=3)C=CC=2)=C1C(O)=O SATOZKURYMDUKM-UHFFFAOYSA-N 0.000 description 1
- KJZLZAZQYNWERR-UHFFFAOYSA-N 2-[[3-[(2,4-dichlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC(Cl)=CC=3)Cl)C=CC=2)=C1C(O)=O KJZLZAZQYNWERR-UHFFFAOYSA-N 0.000 description 1
- QSFBBGRNFCTVPP-UHFFFAOYSA-N 2-[[3-[(2,5-dimethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=C(C)C(COC=2C=C(OCC=3C(=C(C)C=CC=3)C(O)=O)C=CC=2)=C1 QSFBBGRNFCTVPP-UHFFFAOYSA-N 0.000 description 1
- GEENREOGYOEXOF-UHFFFAOYSA-N 2-[[3-[(2-cyclohexyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C3CCCCC3)C=CC=2)=C1C(O)=O GEENREOGYOEXOF-UHFFFAOYSA-N 0.000 description 1
- DLSFXWHOMLPHOU-UHFFFAOYSA-N 2-[[3-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=NOC(C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 DLSFXWHOMLPHOU-UHFFFAOYSA-N 0.000 description 1
- BRHGEGQEZZJQGV-UHFFFAOYSA-N 2-[[3-[(3-bromophenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(Br)C=CC=3)C=CC=2)=C1C(O)=O BRHGEGQEZZJQGV-UHFFFAOYSA-N 0.000 description 1
- DOENYFLVGSGWAK-UHFFFAOYSA-N 2-[[3-[(4-ethylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound C1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 DOENYFLVGSGWAK-UHFFFAOYSA-N 0.000 description 1
- HSDGVFGNLBGRIS-UHFFFAOYSA-N 2-[[3-[(4-tert-butylcyclohexyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC3CCC(CC3)C(C)(C)C)C=CC=2)=C1C(O)=O HSDGVFGNLBGRIS-UHFFFAOYSA-N 0.000 description 1
- FRJWYRVNZRHDFR-UHFFFAOYSA-N 2-[[3-[(4-tert-butylphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C(C)(C)C)C=CC=2)=C1C(O)=O FRJWYRVNZRHDFR-UHFFFAOYSA-N 0.000 description 1
- VCJYCSZQLKYFQA-UHFFFAOYSA-N 2-[[3-[(5-acetyl-2-methoxyphenyl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound COC1=CC=C(C(C)=O)C=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 VCJYCSZQLKYFQA-UHFFFAOYSA-N 0.000 description 1
- KCSKAVRXOOAYQF-UHFFFAOYSA-N 2-[[3-[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzaldehyde Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C3CCC3)C=CC=2)=C1C=O KCSKAVRXOOAYQF-UHFFFAOYSA-N 0.000 description 1
- MFOOWLHGQGQORI-UHFFFAOYSA-N 2-[[3-[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C3CCC3)C=CC=2)=C1C(O)=O MFOOWLHGQGQORI-UHFFFAOYSA-N 0.000 description 1
- ZMKUWXMZEGZWPS-UHFFFAOYSA-N 2-[[3-[(5-ethylpyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound N1=CC(CC)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 ZMKUWXMZEGZWPS-UHFFFAOYSA-N 0.000 description 1
- WENKSQXOAPQUPS-UHFFFAOYSA-N 2-[[3-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C(C)(C)C)C=CC=2)=C1C(O)=O WENKSQXOAPQUPS-UHFFFAOYSA-N 0.000 description 1
- JWVJBZKCCYGHTP-UHFFFAOYSA-N 2-[[3-[(6-chloropyridin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(Cl)C=CC=3)C=CC=2)=C1C(O)=O JWVJBZKCCYGHTP-UHFFFAOYSA-N 0.000 description 1
- VNHYZAOTVZACNZ-UHFFFAOYSA-N 2-[[3-[(6-fluoroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC(F)=CC4=CC=3)C=CC=2)=C1C(O)=O VNHYZAOTVZACNZ-UHFFFAOYSA-N 0.000 description 1
- DIDMHZSHGLQFPU-UHFFFAOYSA-N 2-[[3-[(6-methoxyquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound C1=CC2=CC(OC)=CC=C2N=C1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O DIDMHZSHGLQFPU-UHFFFAOYSA-N 0.000 description 1
- DRDVLUXBTXLAOL-UHFFFAOYSA-N 2-[[3-[(7-chloroquinolin-2-yl)methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=C(Cl)C=CC4=CC=3)C=CC=2)=C1C(O)=O DRDVLUXBTXLAOL-UHFFFAOYSA-N 0.000 description 1
- CSDNADBZCDYVAK-UHFFFAOYSA-N 2-[[3-[2-(5-ethylpyridin-2-yl)ethoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound N1=CC(CC)=CC=C1CCOC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 CSDNADBZCDYVAK-UHFFFAOYSA-N 0.000 description 1
- OFRVBYWREKKZSV-UHFFFAOYSA-N 2-[[3-[[2,4-bis(trifluoromethyl)phenyl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC(=CC=3)C(F)(F)F)C(F)(F)F)C=CC=2)=C1C(O)=O OFRVBYWREKKZSV-UHFFFAOYSA-N 0.000 description 1
- YVGZUKGDZUBUCK-UHFFFAOYSA-N 2-[[3-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=C(F)C=CC=3)C=CC=2)=C1C(O)=O YVGZUKGDZUBUCK-UHFFFAOYSA-N 0.000 description 1
- JYLHSTHXYVMLLU-UHFFFAOYSA-N 2-[[3-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=CC(F)=CC=3)C=CC=2)=C1C(O)=O JYLHSTHXYVMLLU-UHFFFAOYSA-N 0.000 description 1
- XMDXGGWAXCXIDS-UHFFFAOYSA-N 2-[[3-[[2-(carboxymethoxy)-3-methylphenyl]methoxy]phenyl]methoxy]-6-methyl-4-phenylmethoxybenzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COC=3C(=C(C)C=C(OCC=4C=CC=CC=4)C=3)C(O)=O)C=CC=2)=C1OCC(O)=O XMDXGGWAXCXIDS-UHFFFAOYSA-N 0.000 description 1
- KZSIKEBULXUPOH-UHFFFAOYSA-N 2-[[3-[[2-methoxy-4-(2h-tetrazol-5-yl)phenoxy]methyl]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(OC)=CC=1C1=NN=NN1 KZSIKEBULXUPOH-UHFFFAOYSA-N 0.000 description 1
- CHXQCLMOLYROJP-UHFFFAOYSA-N 2-[[3-[[2-methoxy-4-(2h-tetrazol-5-yl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=C(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(OC)=CC=1C1=NN=NN1 CHXQCLMOLYROJP-UHFFFAOYSA-N 0.000 description 1
- PPZZANPMCDROKJ-UHFFFAOYSA-N 2-[[3-[[2-methoxy-5-(2h-tetrazol-5-yl)phenoxy]methyl]phenoxy]methyl]quinoline Chemical compound C1=C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(OC)=CC=C1C1=NN=NN1 PPZZANPMCDROKJ-UHFFFAOYSA-N 0.000 description 1
- MJNDGSIQYZJGRX-UHFFFAOYSA-N 2-[[3-[[2-methoxy-5-(2h-tetrazol-5-yl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C1=C(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)C(OC)=CC=C1C1=NN=NN1 MJNDGSIQYZJGRX-UHFFFAOYSA-N 0.000 description 1
- IJBQXLGDMPMXAU-UHFFFAOYSA-N 2-[[3-[[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]methoxy]phenoxy]methyl]-6-methylbenzoic acid Chemical compound CC=1ON=C(C=2C(=CC=CC=2Cl)Cl)C=1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O IJBQXLGDMPMXAU-UHFFFAOYSA-N 0.000 description 1
- XMGVEHYWTGSGLB-UHFFFAOYSA-N 2-[[3-[[4-(2h-tetrazol-5-yl)phenoxy]methyl]phenoxy]methyl]quinoline Chemical compound C=1C=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=1COC(C=C1)=CC=C1C1=NN=NN1 XMGVEHYWTGSGLB-UHFFFAOYSA-N 0.000 description 1
- VNIBNZFHOYJNLU-UHFFFAOYSA-N 2-[[3-[[5-chloro-3-methyl-2-(2h-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound CC1=CC(Cl)=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1OCC1=NN=NN1 VNIBNZFHOYJNLU-UHFFFAOYSA-N 0.000 description 1
- MIYCVNSXYWJAQH-UHFFFAOYSA-N 2-[[4-[[2-(2h-tetrazol-5-ylmethoxy)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=CC=C(COC=2C=CC(OCC=3N=C4C=CC=CC4=CC=3)=CC=2)C=1OCC1=NN=NN1 MIYCVNSXYWJAQH-UHFFFAOYSA-N 0.000 description 1
- JELDFLOBXROBFH-UHFFFAOYSA-N 2-[[4-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=C2C=CC=CC2=NC=1COC(C=C1)=CC=C1OCC1=CC=CC=C1CC=1N=NNN=1 JELDFLOBXROBFH-UHFFFAOYSA-N 0.000 description 1
- MBYFCBOXXMTLFD-UHFFFAOYSA-N 2-[[4-[[2-methoxy-4-(2h-tetrazol-5-yl)phenoxy]methyl]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2C=CC(OCC=3N=C4C=CC=CC4=CC=3)=CC=2)C(OC)=CC=1C1=NN=NN1 MBYFCBOXXMTLFD-UHFFFAOYSA-N 0.000 description 1
- BDCSGHBPEQSNCN-UHFFFAOYSA-N 2-[[4-[[2-methoxy-5-(2h-tetrazol-5-yl)phenoxy]methyl]phenoxy]methyl]quinoline Chemical compound C1=C(OCC=2C=CC(OCC=3N=C4C=CC=CC4=CC=3)=CC=2)C(OC)=CC=C1C1=NN=NN1 BDCSGHBPEQSNCN-UHFFFAOYSA-N 0.000 description 1
- JEIMFLGAWUTGMF-UHFFFAOYSA-N 2-[[4-[[3-(2h-tetrazol-5-yl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1OCC(C=1)=CC=CC=1C1=NN=NN1 JEIMFLGAWUTGMF-UHFFFAOYSA-N 0.000 description 1
- FYEPTRMAXPQQGA-UHFFFAOYSA-N 2-[[4-[[3-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1OCC(C=1)=CC=CC=1CC1=NN=NN1 FYEPTRMAXPQQGA-UHFFFAOYSA-N 0.000 description 1
- GTBAXPIVLNRIOG-UHFFFAOYSA-N 2-[[4-[[4-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound C=1C=C(OCC=2N=C3C=CC=CC3=CC=2)C=CC=1OCC(C=C1)=CC=C1CC1=NN=NN1 GTBAXPIVLNRIOG-UHFFFAOYSA-N 0.000 description 1
- QIRNGVVZBINFMX-UHFFFAOYSA-N 2-allylphenol Chemical compound OC1=CC=CC=C1CC=C QIRNGVVZBINFMX-UHFFFAOYSA-N 0.000 description 1
- 125000004174 2-benzimidazolyl group Chemical group [H]N1C(*)=NC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- JJFOBACUIRKUPN-UHFFFAOYSA-N 2-bromoethoxybenzene Chemical compound BrCCOC1=CC=CC=C1 JJFOBACUIRKUPN-UHFFFAOYSA-N 0.000 description 1
- CKUVSPQGYLELRG-UHFFFAOYSA-N 2-chloro-6-methylpyrazine Chemical compound CC1=CN=CC(Cl)=N1 CKUVSPQGYLELRG-UHFFFAOYSA-N 0.000 description 1
- GXZDYRYYNXYPMQ-UHFFFAOYSA-N 2-chloro-6-methylpyridine Chemical compound CC1=CC=CC(Cl)=N1 GXZDYRYYNXYPMQ-UHFFFAOYSA-N 0.000 description 1
- FAKUGVHRTLCKHB-UHFFFAOYSA-N 2-fluoro-6-(trifluoromethyl)benzaldehyde Chemical compound FC1=CC=CC(C(F)(F)F)=C1C=O FAKUGVHRTLCKHB-UHFFFAOYSA-N 0.000 description 1
- ZWDVQMVZZYIAHO-UHFFFAOYSA-N 2-fluorobenzaldehyde Chemical class FC1=CC=CC=C1C=O ZWDVQMVZZYIAHO-UHFFFAOYSA-N 0.000 description 1
- MTAODLNXWYIKSO-UHFFFAOYSA-N 2-fluoropyridine Chemical compound FC1=CC=CC=N1 MTAODLNXWYIKSO-UHFFFAOYSA-N 0.000 description 1
- AAUQLHHARJUJEH-UHFFFAOYSA-N 2-hydroxy-5-methoxybenzoic acid Natural products COC1=CC=CC(O)=C1C(O)=O AAUQLHHARJUJEH-UHFFFAOYSA-N 0.000 description 1
- LIUCWHQVLKSECA-UHFFFAOYSA-N 2-hydroxyacetohydrazide Chemical group NNC(=O)CO LIUCWHQVLKSECA-UHFFFAOYSA-N 0.000 description 1
- CLNBOXAAONTXKB-UHFFFAOYSA-N 2-iodo-5-methylpyrazine Chemical compound CC1=CN=C(I)C=N1 CLNBOXAAONTXKB-UHFFFAOYSA-N 0.000 description 1
- OMGXZRMDHBCYOI-UHFFFAOYSA-N 2-methoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O OMGXZRMDHBCYOI-UHFFFAOYSA-N 0.000 description 1
- DJLXWIBENRCEAD-UHFFFAOYSA-N 2-methoxy-6-methyl-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound CC1=C(C(O)=O)C(OC)=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 DJLXWIBENRCEAD-UHFFFAOYSA-N 0.000 description 1
- VVFCAPHHZLEJLT-UHFFFAOYSA-N 2-methyl-4-phenylmethoxy-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound C=1C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C(C(O)=O)C(C)=CC=1OCC1=CC=CC=C1 VVFCAPHHZLEJLT-UHFFFAOYSA-N 0.000 description 1
- LEIOBPOJABRNMZ-UHFFFAOYSA-N 2-methyl-6-[(3-phenylmethoxyphenoxy)methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC=CC=3)C=CC=2)=C1C(O)=O LEIOBPOJABRNMZ-UHFFFAOYSA-N 0.000 description 1
- LFOSIRCLMDOWSS-UHFFFAOYSA-N 2-methyl-6-[2-[3-(quinolin-2-ylmethoxy)phenyl]ethynyl]benzoic acid Chemical compound CC1=C(C(=O)O)C(=CC=C1)C#CC1=CC(=CC=C1)OCC1=NC2=CC=CC=C2C=C1 LFOSIRCLMDOWSS-UHFFFAOYSA-N 0.000 description 1
- DWSHTEJLSRKMRV-UHFFFAOYSA-N 2-methyl-6-[[1-(quinolin-2-ylmethyl)imidazol-4-yl]methoxymethyl]benzoic acid Chemical compound CC1=CC=CC(COCC=2N=CN(CC=3N=C4C=CC=CC4=CC=3)C=2)=C1C(O)=O DWSHTEJLSRKMRV-UHFFFAOYSA-N 0.000 description 1
- CHZAQYBIRMWTLN-UHFFFAOYSA-N 2-methyl-6-[[3-(2-pyridin-2-ylethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=CC=CC=3)C=CC=2)=C1C(O)=O CHZAQYBIRMWTLN-UHFFFAOYSA-N 0.000 description 1
- SUSQZYRRFUDRPY-UHFFFAOYSA-N 2-methyl-6-[[3-(2-pyridin-2-yloxyethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCOC=3N=CC=CC=3)C=CC=2)=C1C(O)=O SUSQZYRRFUDRPY-UHFFFAOYSA-N 0.000 description 1
- VUPYBCBTINXJGB-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethenyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(C=CC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O VUPYBCBTINXJGB-UHFFFAOYSA-N 0.000 description 1
- TYEAMMWZYWMLDA-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O TYEAMMWZYWMLDA-UHFFFAOYSA-N 0.000 description 1
- IXBVGBKQVGOAJU-UHFFFAOYSA-N 2-methyl-6-[[3-(2-quinolin-2-ylethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(CCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O IXBVGBKQVGOAJU-UHFFFAOYSA-N 0.000 description 1
- SVXUAODUNFRDMC-UHFFFAOYSA-N 2-methyl-6-[[3-(naphthalen-1-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C4=CC=CC=C4C=CC=3)C=CC=2)=C1C(O)=O SVXUAODUNFRDMC-UHFFFAOYSA-N 0.000 description 1
- VCKAAGSCJHJERU-UHFFFAOYSA-N 2-methyl-6-[[3-(naphthalen-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O VCKAAGSCJHJERU-UHFFFAOYSA-N 0.000 description 1
- HNNOFFIPDRKUAR-UHFFFAOYSA-N 2-methyl-6-[[3-(pyridin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC=CC=3)C=CC=2)=C1C(O)=O HNNOFFIPDRKUAR-UHFFFAOYSA-N 0.000 description 1
- PTTCALYQFORLRO-UHFFFAOYSA-N 2-methyl-6-[[3-(pyridin-2-ylmethoxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=CC=CC=3)C=CC=2)=C1C(O)=O PTTCALYQFORLRO-UHFFFAOYSA-N 0.000 description 1
- XMXOIKWCPWJDMR-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O XMXOIKWCPWJDMR-UHFFFAOYSA-N 0.000 description 1
- BFEBUERRXPCNJB-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound CC1=CC=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O BFEBUERRXPCNJB-UHFFFAOYSA-N 0.000 description 1
- LERLTLHNYGABKN-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxymethyl]benzoic acid Chemical compound CC1=CC=CC(COCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O LERLTLHNYGABKN-UHFFFAOYSA-N 0.000 description 1
- FHTJHKRKYADKIT-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfanylmethyl]benzoic acid Chemical compound CC1=CC=CC(CSC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O FHTJHKRKYADKIT-UHFFFAOYSA-N 0.000 description 1
- JEMCECRQAGEHRW-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfinylmethyl]benzoic acid Chemical compound CC1=CC=CC(CS(=O)C=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O JEMCECRQAGEHRW-UHFFFAOYSA-N 0.000 description 1
- HZXKDTRSSUYMCV-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]sulfonylmethyl]benzoic acid Chemical compound CC1=CC=CC(CS(=O)(=O)C=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O HZXKDTRSSUYMCV-UHFFFAOYSA-N 0.000 description 1
- JZRICEMAQMOOSP-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethoxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O JZRICEMAQMOOSP-UHFFFAOYSA-N 0.000 description 1
- BWMHNQSGBXTCSP-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-ylmethyl)imidazol-4-yl]methoxymethyl]benzoic acid Chemical compound CC1=CC=CC(COCC=2N(C=NC=2)CC=2N=C3C=CC=CC3=CC=2)=C1C(O)=O BWMHNQSGBXTCSP-UHFFFAOYSA-N 0.000 description 1
- NWASEVYYUFQGDT-UHFFFAOYSA-N 2-methyl-6-[[3-(quinolin-2-yloxymethyl)phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(COC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1C(O)=O NWASEVYYUFQGDT-UHFFFAOYSA-N 0.000 description 1
- CGTLPQBZGZMXBM-UHFFFAOYSA-N 2-methyl-6-[[3-[(2,4,5-trimethylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=C(C)C(C)=CC(C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 CGTLPQBZGZMXBM-UHFFFAOYSA-N 0.000 description 1
- ZUIJVTIYWFJTRT-UHFFFAOYSA-N 2-methyl-6-[[3-[(2-methylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 ZUIJVTIYWFJTRT-UHFFFAOYSA-N 0.000 description 1
- SVEFCMFUFYKQJN-UHFFFAOYSA-N 2-methyl-6-[[3-[(2-phenyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(OC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O SVEFCMFUFYKQJN-UHFFFAOYSA-N 0.000 description 1
- ZJFGVJSVVUDGTQ-UHFFFAOYSA-N 2-methyl-6-[[3-[(2-phenyl-1,3-thiazol-4-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(SC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O ZJFGVJSVVUDGTQ-UHFFFAOYSA-N 0.000 description 1
- KVTLUKBYZMAFGG-UHFFFAOYSA-N 2-methyl-6-[[3-[(3-methyl-4-oxoquinazolin-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N(C(=O)C4=CC=CC=C4N=3)C)C=CC=2)=C1C(O)=O KVTLUKBYZMAFGG-UHFFFAOYSA-N 0.000 description 1
- YAPDCKNIFULUDU-UHFFFAOYSA-N 2-methyl-6-[[3-[(3-methylnaphthalen-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=CC4=CC=CC=C4C=3)C)C=CC=2)=C1C(O)=O YAPDCKNIFULUDU-UHFFFAOYSA-N 0.000 description 1
- CFPXYTOBHAKPGT-UHFFFAOYSA-N 2-methyl-6-[[3-[(3-methylquinoxalin-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C(=NC4=CC=CC=C4N=3)C)C=CC=2)=C1C(O)=O CFPXYTOBHAKPGT-UHFFFAOYSA-N 0.000 description 1
- FMOASBOPMDWUFU-UHFFFAOYSA-N 2-methyl-6-[[3-[(3-phenoxyphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=C(OC=4C=CC=CC=4)C=CC=3)C=CC=2)=C1C(O)=O FMOASBOPMDWUFU-UHFFFAOYSA-N 0.000 description 1
- XXISGLPLGYCRNR-UHFFFAOYSA-N 2-methyl-6-[[3-[(4-phenylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3C=CC(=CC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O XXISGLPLGYCRNR-UHFFFAOYSA-N 0.000 description 1
- KKXQCCMACGQTCJ-UHFFFAOYSA-N 2-methyl-6-[[3-[(4-propan-2-ylphenyl)methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=CC(C(C)C)=CC=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 KKXQCCMACGQTCJ-UHFFFAOYSA-N 0.000 description 1
- YPFAPHKKUVQNNY-UHFFFAOYSA-N 2-methyl-6-[[3-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC=1OC(C=2C=CC=CC=2)=NC=1COC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O YPFAPHKKUVQNNY-UHFFFAOYSA-N 0.000 description 1
- PRHCGBJFEGBGFZ-UHFFFAOYSA-N 2-methyl-6-[[3-[(5-phenyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O PRHCGBJFEGBGFZ-UHFFFAOYSA-N 0.000 description 1
- QCGNNCDEJQQLDJ-UHFFFAOYSA-N 2-methyl-6-[[3-[(5-phenylpyridin-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=CC(=CC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O QCGNNCDEJQQLDJ-UHFFFAOYSA-N 0.000 description 1
- HPGPJYHGBOYKNS-UHFFFAOYSA-N 2-methyl-6-[[3-[(6-phenylpyridin-2-yl)methoxy]phenoxy]methyl]benzoic acid Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(C=CC=3)C=3C=CC=CC=3)C=CC=2)=C1C(O)=O HPGPJYHGBOYKNS-UHFFFAOYSA-N 0.000 description 1
- GYFDHLLMQDABGH-UHFFFAOYSA-N 2-methyl-6-[[3-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenoxy]methyl]benzoic acid Chemical compound CC=1OC(C=2C=CC=CC=2)=NC=1CCOC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O GYFDHLLMQDABGH-UHFFFAOYSA-N 0.000 description 1
- PYDMWKLUXOIONG-UHFFFAOYSA-N 2-methyl-6-[[3-[[2-(5-methylthiophen-2-yl)-1,3-oxazol-4-yl]methoxy]phenoxy]methyl]benzoic acid Chemical compound S1C(C)=CC=C1C1=NC(COC=2C=C(OCC=3C(=C(C)C=CC=3)C(O)=O)C=CC=2)=CO1 PYDMWKLUXOIONG-UHFFFAOYSA-N 0.000 description 1
- XRMDXKOJBGEXNA-UHFFFAOYSA-N 2-methyl-6-[[3-[[5-methyl-2,4-di(propan-2-yl)phenyl]methoxy]phenoxy]methyl]benzoic acid Chemical compound C1=C(C)C(C(C)C)=CC(C(C)C)=C1COC1=CC=CC(OCC=2C(=C(C)C=CC=2)C(O)=O)=C1 XRMDXKOJBGEXNA-UHFFFAOYSA-N 0.000 description 1
- PFWSSNHDOGWBKL-UHFFFAOYSA-N 2-methyl-6-[[3-[[methyl(quinolin-2-yl)amino]methyl]phenoxy]methyl]benzoic acid Chemical compound C=1C=C2C=CC=CC2=NC=1N(C)CC(C=1)=CC=CC=1OCC1=CC=CC(C)=C1C(O)=O PFWSSNHDOGWBKL-UHFFFAOYSA-N 0.000 description 1
- SGXJFKLMCVIZGP-UHFFFAOYSA-N 2-methyl-6-phenylmethoxy-4-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C=1C(C)=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=CC=1OCC1=CC=CC=C1 SGXJFKLMCVIZGP-UHFFFAOYSA-N 0.000 description 1
- HDECRAPHCDXMIJ-UHFFFAOYSA-N 2-methylbenzenesulfonyl chloride Chemical compound CC1=CC=CC=C1S(Cl)(=O)=O HDECRAPHCDXMIJ-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical class CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- DUAYDERMVQWIJD-UHFFFAOYSA-N 2-n,2-n,6-trimethyl-1,3,5-triazine-2,4-diamine Chemical compound CN(C)C1=NC(C)=NC(N)=N1 DUAYDERMVQWIJD-UHFFFAOYSA-N 0.000 description 1
- 125000001622 2-naphthyl group Chemical group [H]C1=C([H])C([H])=C2C([H])=C(*)C([H])=C([H])C2=C1[H] 0.000 description 1
- 125000005979 2-naphthyloxy group Chemical group 0.000 description 1
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 1
- BKZXZGWHTRCFPX-UHFFFAOYSA-N 2-tert-butyl-6-methylphenol Chemical compound CC1=CC=CC(C(C)(C)C)=C1O BKZXZGWHTRCFPX-UHFFFAOYSA-N 0.000 description 1
- FABVMBDCVAJXMB-UHFFFAOYSA-N 3,5-dichloro-2-hydroxybenzaldehyde Chemical compound OC1=C(Cl)C=C(Cl)C=C1C=O FABVMBDCVAJXMB-UHFFFAOYSA-N 0.000 description 1
- VQAFMTSSCUETHA-UHFFFAOYSA-N 3,6-dibromopyridazine Chemical compound BrC1=CC=C(Br)N=N1 VQAFMTSSCUETHA-UHFFFAOYSA-N 0.000 description 1
- FQBABLFSLXFYOQ-UHFFFAOYSA-N 3-(bromomethyl)-7-chloroisoquinoline Chemical compound C1=C(CBr)N=CC2=CC(Cl)=CC=C21 FQBABLFSLXFYOQ-UHFFFAOYSA-N 0.000 description 1
- LEDZXMGYWIHHRS-UHFFFAOYSA-N 3-(carboxymethoxy)-4-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]benzoic acid Chemical compound OC(=O)COC1=CC(C(O)=O)=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LEDZXMGYWIHHRS-UHFFFAOYSA-N 0.000 description 1
- OHNJTQRSUDKTKX-UHFFFAOYSA-N 3-(chloromethyl)-5-cyclobutyl-1,2,4-oxadiazole Chemical compound ClCC1=NOC(C2CCC2)=N1 OHNJTQRSUDKTKX-UHFFFAOYSA-N 0.000 description 1
- XAQJDQZTSUYFGE-UHFFFAOYSA-N 3-[2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]phenyl]prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 XAQJDQZTSUYFGE-UHFFFAOYSA-N 0.000 description 1
- RACIHBXDZONTQJ-UHFFFAOYSA-N 3-bromo-6-methylpyridazine Chemical compound CC1=CC=C(Br)N=N1 RACIHBXDZONTQJ-UHFFFAOYSA-N 0.000 description 1
- XMZQWZJMTBCUFT-UHFFFAOYSA-N 3-bromopropylbenzene Chemical compound BrCCCC1=CC=CC=C1 XMZQWZJMTBCUFT-UHFFFAOYSA-N 0.000 description 1
- ILYSUJOMLYXAOC-UHFFFAOYSA-N 3-bromopyridazine Chemical class BrC1=CC=CN=N1 ILYSUJOMLYXAOC-UHFFFAOYSA-N 0.000 description 1
- VGSOCYWCRMXQAB-UHFFFAOYSA-N 3-chloro-4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1Cl VGSOCYWCRMXQAB-UHFFFAOYSA-N 0.000 description 1
- YPIGHNIIXYSPKF-UHFFFAOYSA-N 3-fluorobenzamide Chemical compound NC(=O)C1=CC=CC(F)=C1 YPIGHNIIXYSPKF-UHFFFAOYSA-N 0.000 description 1
- FXTKWBZFNQHAAO-UHFFFAOYSA-N 3-iodophenol Chemical compound OC1=CC=CC(I)=C1 FXTKWBZFNQHAAO-UHFFFAOYSA-N 0.000 description 1
- SBHYBLXUUYPZFK-UHFFFAOYSA-N 3-methoxy-2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC=CC(C(O)=O)=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 SBHYBLXUUYPZFK-UHFFFAOYSA-N 0.000 description 1
- QMVAZEHZOPDGHA-UHFFFAOYSA-N 3-methoxybenzenethiol Chemical compound COC1=CC=CC(S)=C1 QMVAZEHZOPDGHA-UHFFFAOYSA-N 0.000 description 1
- FTAHXMZRJCZXDL-UHFFFAOYSA-N 3-piperideine Chemical compound C1CC=CCN1 FTAHXMZRJCZXDL-UHFFFAOYSA-N 0.000 description 1
- MVLCWAAJDXMPMW-UHFFFAOYSA-N 3-pyridin-3-ylpropane-1-thiol Chemical compound SCCCC1=CC=CN=C1 MVLCWAAJDXMPMW-UHFFFAOYSA-N 0.000 description 1
- 125000004364 3-pyrrolinyl group Chemical group [H]C1=C([H])C([H])([H])N(*)C1([H])[H] 0.000 description 1
- XJPZKYIHCLDXST-UHFFFAOYSA-N 4,6-dichloropyrimidine Chemical group ClC1=CC(Cl)=NC=N1 XJPZKYIHCLDXST-UHFFFAOYSA-N 0.000 description 1
- CQQSQBRPAJSTFB-UHFFFAOYSA-N 4-(bromomethyl)benzoic acid Chemical compound OC(=O)C1=CC=C(CBr)C=C1 CQQSQBRPAJSTFB-UHFFFAOYSA-N 0.000 description 1
- NIFAUKBQIAURIM-UHFFFAOYSA-N 4-(chloromethyl)-3,5-dimethyl-1,2-oxazole Chemical compound CC1=NOC(C)=C1CCl NIFAUKBQIAURIM-UHFFFAOYSA-N 0.000 description 1
- PPUGTWAPVDDBEW-UHFFFAOYSA-N 4-(chloromethyl)-3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole Chemical compound ClCC1=C(C)ON=C1C1=C(Cl)C=CC=C1Cl PPUGTWAPVDDBEW-UHFFFAOYSA-N 0.000 description 1
- VCTKYTBWZTZPHF-UHFFFAOYSA-N 4-(chloromethyl)-5-methyl-2-phenyl-1,3-oxazole Chemical compound ClCC1=C(C)OC(C=2C=CC=CC=2)=N1 VCTKYTBWZTZPHF-UHFFFAOYSA-N 0.000 description 1
- NDLCXMUVSVJHCV-UHFFFAOYSA-N 4-(quinolin-2-ylmethoxy)phenol Chemical compound C1=CC(O)=CC=C1OCC1=CC=C(C=CC=C2)C2=N1 NDLCXMUVSVJHCV-UHFFFAOYSA-N 0.000 description 1
- ANWKUXBSSNCQIC-UHFFFAOYSA-N 4-bromo-2-methoxyfuran Chemical compound COC1=CC(Br)=CO1 ANWKUXBSSNCQIC-UHFFFAOYSA-N 0.000 description 1
- VNDHYTGVCGVETQ-UHFFFAOYSA-N 4-fluorobenzamide Chemical compound NC(=O)C1=CC=C(F)C=C1 VNDHYTGVCGVETQ-UHFFFAOYSA-N 0.000 description 1
- ROWJNJUUAJASTJ-UHFFFAOYSA-N 4-methoxy-2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC=C(C(O)=O)C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 ROWJNJUUAJASTJ-UHFFFAOYSA-N 0.000 description 1
- VEHPMWFIFYCDKL-UHFFFAOYSA-N 4-methoxy-2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound COC1=CC(C)=C(C(O)=O)C(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 VEHPMWFIFYCDKL-UHFFFAOYSA-N 0.000 description 1
- 125000004229 4H-chromen-2-yl group Chemical group [H]C1=C([H])C([H])=C2C(OC(*)=C([H])C2([H])[H])=C1[H] 0.000 description 1
- ZMGMDXCADSRNCX-UHFFFAOYSA-N 5,6-dihydroxy-1,3-diazepan-2-one Chemical compound OC1CNC(=O)NCC1O ZMGMDXCADSRNCX-UHFFFAOYSA-N 0.000 description 1
- SBLNJPPJMRNDJM-UHFFFAOYSA-N 5-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CN=CC(OCC=2C=C(OCC=3N=C4C=CC=CC4=CC=3)C=CC=2)=C1 SBLNJPPJMRNDJM-UHFFFAOYSA-N 0.000 description 1
- OFKWIQJLYCKDNY-UHFFFAOYSA-N 5-bromo-2-methylpyridine Chemical compound CC1=CC=C(Br)C=N1 OFKWIQJLYCKDNY-UHFFFAOYSA-N 0.000 description 1
- NEDJTEXNSTUKHW-UHFFFAOYSA-N 5-bromo-2-methylpyrimidine Chemical compound CC1=NC=C(Br)C=N1 NEDJTEXNSTUKHW-UHFFFAOYSA-N 0.000 description 1
- 125000006163 5-membered heteroaryl group Chemical group 0.000 description 1
- VWPXLLCWKFJQIH-UHFFFAOYSA-N 5-methoxy-2-[[3-(quinolin-2-ylmethoxy)phenyl]methoxy]benzoic acid Chemical compound OC(=O)C1=CC(OC)=CC=C1OCC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 VWPXLLCWKFJQIH-UHFFFAOYSA-N 0.000 description 1
- HKKCYMCHJZENJO-UHFFFAOYSA-N 5-methylthiophene-2-carboxamide Chemical compound CC1=CC=C(C(N)=O)S1 HKKCYMCHJZENJO-UHFFFAOYSA-N 0.000 description 1
- XYNNEGCJICWPFL-UHFFFAOYSA-N 6,7-dichloro-2-methylquinoline Chemical compound C1=C(Cl)C(Cl)=CC2=NC(C)=CC=C21 XYNNEGCJICWPFL-UHFFFAOYSA-N 0.000 description 1
- YWMOOBWNYVFLKH-UHFFFAOYSA-N 6,7-difluoro-2-methylquinoline Chemical compound C1=C(F)C(F)=CC2=NC(C)=CC=C21 YWMOOBWNYVFLKH-UHFFFAOYSA-N 0.000 description 1
- VOMMPWVMVDGZEM-UHFFFAOYSA-N 6-bromo-1h-pyridin-2-one Chemical compound OC1=CC=CC(Br)=N1 VOMMPWVMVDGZEM-UHFFFAOYSA-N 0.000 description 1
- GPIARMSVZOEZCV-UHFFFAOYSA-N 6-fluoro-2-methylquinoline Chemical compound C1=C(F)C=CC2=NC(C)=CC=C21 GPIARMSVZOEZCV-UHFFFAOYSA-N 0.000 description 1
- OXOQGUGIJKUSRP-UHFFFAOYSA-N 6-methoxy-1,3-dihydroindol-2-one Chemical compound COC1=CC=C2CC(=O)NC2=C1 OXOQGUGIJKUSRP-UHFFFAOYSA-N 0.000 description 1
- NAGJQQFMJKMXJQ-UHFFFAOYSA-N 6-methoxy-2-methylquinoline Chemical compound N1=C(C)C=CC2=CC(OC)=CC=C21 NAGJQQFMJKMXJQ-UHFFFAOYSA-N 0.000 description 1
- FSLPHQAXCJNXEU-UHFFFAOYSA-N 7-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]-1-benzofuran-2-carboxylic acid Chemical compound C1=CC=CC2=NC(COC=3C=CC=C(C=3)OCC=3C=CC=C4C=C(OC4=3)C(=O)O)=CC=C21 FSLPHQAXCJNXEU-UHFFFAOYSA-N 0.000 description 1
- CFOGMFANYLGVOW-UHFFFAOYSA-N 7-chloro-2-[[4-[[2-(2h-tetrazol-5-ylmethyl)phenyl]methoxy]phenoxy]methyl]quinoline Chemical compound N=1C2=CC(Cl)=CC=C2C=CC=1COC(C=C1)=CC=C1OCC1=CC=CC=C1CC1=NN=NN1 CFOGMFANYLGVOW-UHFFFAOYSA-N 0.000 description 1
- WQZQFYRSYLXBGP-UHFFFAOYSA-N 7-chloro-2-methylquinoline Chemical compound C1=CC(Cl)=CC2=NC(C)=CC=C21 WQZQFYRSYLXBGP-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- YCIPQJTZJGUXND-UHFFFAOYSA-N Aglaia odorata Alkaloid Natural products C1=CC(OC)=CC=C1C1(C(C=2C(=O)N3CCCC3=NC=22)C=3C=CC=CC=3)C2(O)C2=C(OC)C=C(OC)C=C2O1 YCIPQJTZJGUXND-UHFFFAOYSA-N 0.000 description 1
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 1
- 239000005695 Ammonium acetate Substances 0.000 description 1
- 208000000103 Anorexia Nervosa Diseases 0.000 description 1
- 239000004475 Arginine Substances 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- 206010006187 Breast cancer Diseases 0.000 description 1
- 208000026310 Breast neoplasm Diseases 0.000 description 1
- 206010006458 Bronchitis chronic Diseases 0.000 description 1
- 208000032841 Bulimia Diseases 0.000 description 1
- 206010006550 Bulimia nervosa Diseases 0.000 description 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 description 1
- UGFAIRIUMAVXCW-UHFFFAOYSA-N Carbon monoxide Chemical compound [O+]#[C-] UGFAIRIUMAVXCW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 208000006545 Chronic Obstructive Pulmonary Disease Diseases 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- 206010009944 Colon cancer Diseases 0.000 description 1
- 208000031288 Combined hyperlipidaemia Diseases 0.000 description 1
- 208000035473 Communicable disease Diseases 0.000 description 1
- 208000002330 Congenital Heart Defects Diseases 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- AAWZDTNXLSGCEK-UHFFFAOYSA-N Cordycepinsaeure Natural products OC1CC(O)(C(O)=O)CC(O)C1O AAWZDTNXLSGCEK-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Chemical class 0.000 description 1
- BUDQDWGNQVEFAC-UHFFFAOYSA-N Dihydropyran Chemical group C1COC=CC1 BUDQDWGNQVEFAC-UHFFFAOYSA-N 0.000 description 1
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 1
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical class CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 1
- 101100326341 Drosophila melanogaster brun gene Proteins 0.000 description 1
- 206010072268 Drug-induced liver injury Diseases 0.000 description 1
- 208000032928 Dyslipidaemia Diseases 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 229940123583 Factor Xa inhibitor Drugs 0.000 description 1
- 241000282326 Felis catus Species 0.000 description 1
- 238000005863 Friedel-Crafts acylation reaction Methods 0.000 description 1
- 208000002705 Glucose Intolerance Diseases 0.000 description 1
- 208000016988 Hemorrhagic Stroke Diseases 0.000 description 1
- 101000979342 Homo sapiens Nuclear factor NF-kappa-B p105 subunit Proteins 0.000 description 1
- 208000031226 Hyperlipidaemia Diseases 0.000 description 1
- 206010058490 Hyperoxia Diseases 0.000 description 1
- 208000032382 Ischaemic stroke Diseases 0.000 description 1
- 239000003810 Jones reagent Substances 0.000 description 1
- 229930194542 Keto Natural products 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical compound NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- ODKSFYDXXFIFQN-BYPYZUCNSA-P L-argininium(2+) Chemical compound NC(=[NH2+])NCCC[C@H]([NH3+])C(O)=O ODKSFYDXXFIFQN-BYPYZUCNSA-P 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- 208000017170 Lipid metabolism disease Diseases 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 239000012448 Lithium borohydride Substances 0.000 description 1
- 208000004852 Lung Injury Diseases 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- QPJVMBTYPHYUOC-UHFFFAOYSA-N Methyl benzoate Natural products COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 1
- 241000872931 Myoporum sandwicense Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- 208000028389 Nerve injury Diseases 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-N Nitrous acid Chemical compound ON=O IOVCWXUNBOPUCH-UHFFFAOYSA-N 0.000 description 1
- 102100023050 Nuclear factor NF-kappa-B p105 subunit Human genes 0.000 description 1
- 108020005497 Nuclear hormone receptor Proteins 0.000 description 1
- 108091028043 Nucleic acid sequence Proteins 0.000 description 1
- PCKPVGOLPKLUHR-UHFFFAOYSA-N OH-Indolxyl Natural products C1=CC=C2C(O)=CNC2=C1 PCKPVGOLPKLUHR-UHFFFAOYSA-N 0.000 description 1
- AHLPHDHHMVZTML-UHFFFAOYSA-N Orn-delta-NH2 Natural products NCCCC(N)C(O)=O AHLPHDHHMVZTML-UHFFFAOYSA-N 0.000 description 1
- UTJLXEIPEHZYQJ-UHFFFAOYSA-N Ornithine Natural products OC(=O)C(C)CCCN UTJLXEIPEHZYQJ-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-N Oxazole Chemical class C1=COC=N1 ZCQWOFVYLHDMMC-UHFFFAOYSA-N 0.000 description 1
- 102000000536 PPAR gamma Human genes 0.000 description 1
- 108010044210 PPAR-beta Proteins 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- SCKXCAADGDQQCS-UHFFFAOYSA-N Performic acid Chemical compound OOC=O SCKXCAADGDQQCS-UHFFFAOYSA-N 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 108010029485 Protein Isoforms Proteins 0.000 description 1
- 102000001708 Protein Isoforms Human genes 0.000 description 1
- AAWZDTNXLSGCEK-ZHQZDSKASA-N Quinic acid Natural products O[C@H]1CC(O)(C(O)=O)C[C@H](O)C1O AAWZDTNXLSGCEK-ZHQZDSKASA-N 0.000 description 1
- 241000283984 Rodentia Species 0.000 description 1
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical class C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 102000040945 Transcription factor Human genes 0.000 description 1
- 108091023040 Transcription factor Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Natural products NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 1
- 206010047513 Vision blurred Diseases 0.000 description 1
- 239000003875 Wang resin Substances 0.000 description 1
- 206010052428 Wound Diseases 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- UMAIMECXDAUWHD-UHFFFAOYSA-N [2-[[3-[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methoxy]phenoxy]methyl]-6-methylphenyl]methanol Chemical compound CC1=CC=CC(COC=2C=C(OCC=3N=C(ON=3)C3CCC3)C=CC=2)=C1CO UMAIMECXDAUWHD-UHFFFAOYSA-N 0.000 description 1
- VCVJSWDSNWXXJT-UHFFFAOYSA-N [4-(1-methylpyrazol-3-yl)phenyl]methanol Chemical compound CN1C=CC(C=2C=CC(CO)=CC=2)=N1 VCVJSWDSNWXXJT-UHFFFAOYSA-N 0.000 description 1
- NERFNHBZJXXFGY-UHFFFAOYSA-N [4-[(4-methylphenyl)methoxy]phenyl]methanol Chemical compound C1=CC(C)=CC=C1COC1=CC=C(CO)C=C1 NERFNHBZJXXFGY-UHFFFAOYSA-N 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- XPOLVIIHTDKJRY-UHFFFAOYSA-N acetic acid;methanimidamide Chemical compound NC=N.CC(O)=O XPOLVIIHTDKJRY-UHFFFAOYSA-N 0.000 description 1
- RBYGDVHOECIAFC-UHFFFAOYSA-L acetonitrile;palladium(2+);dichloride Chemical compound [Cl-].[Cl-].[Pd+2].CC#N.CC#N RBYGDVHOECIAFC-UHFFFAOYSA-L 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000005903 acid hydrolysis reaction Methods 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 210000003486 adipose tissue brown Anatomy 0.000 description 1
- 230000011759 adipose tissue development Effects 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 125000003158 alcohol group Chemical group 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 150000001345 alkine derivatives Chemical class 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 238000007083 alkoxycarbonylation reaction Methods 0.000 description 1
- 150000001347 alkyl bromides Chemical class 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 238000010640 amide synthesis reaction Methods 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- CHKQALUEEULCPZ-UHFFFAOYSA-N amino 2,4,6-trimethylbenzenesulfonate Chemical compound CC1=CC(C)=C(S(=O)(=O)ON)C(C)=C1 CHKQALUEEULCPZ-UHFFFAOYSA-N 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 235000019257 ammonium acetate Nutrition 0.000 description 1
- 229940043376 ammonium acetate Drugs 0.000 description 1
- 210000004102 animal cell Anatomy 0.000 description 1
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 1
- 230000002402 anti-lipaemic effect Effects 0.000 description 1
- 230000036528 appetite Effects 0.000 description 1
- 235000019789 appetite Nutrition 0.000 description 1
- YZXBAPSDXZZRGB-DOFZRALJSA-N arachidonic acid Chemical class CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(O)=O YZXBAPSDXZZRGB-DOFZRALJSA-N 0.000 description 1
- 125000005140 aralkylsulfonyl group Chemical group 0.000 description 1
- ODKSFYDXXFIFQN-UHFFFAOYSA-N arginine Natural products OC(=O)C(N)CCCNC(N)=N ODKSFYDXXFIFQN-UHFFFAOYSA-N 0.000 description 1
- 229960003121 arginine Drugs 0.000 description 1
- 238000005899 aromatization reaction Methods 0.000 description 1
- 150000001502 aryl halides Chemical class 0.000 description 1
- 125000004391 aryl sulfonyl group Chemical group 0.000 description 1
- 208000006673 asthma Diseases 0.000 description 1
- 230000000778 atheroprotective effect Effects 0.000 description 1
- 125000005334 azaindolyl group Chemical group N1N=C(C2=CC=CC=C12)* 0.000 description 1
- 150000007514 bases Chemical class 0.000 description 1
- 210000000227 basophil cell of anterior lobe of hypophysis Anatomy 0.000 description 1
- UPABQMWFWCMOFV-UHFFFAOYSA-N benethamine Chemical compound C=1C=CC=CC=1CNCCC1=CC=CC=C1 UPABQMWFWCMOFV-UHFFFAOYSA-N 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- OWCDMRFUFMERMZ-UHFFFAOYSA-N benzenesulfonamide;hydrochloride Chemical compound Cl.NS(=O)(=O)C1=CC=CC=C1 OWCDMRFUFMERMZ-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 125000005605 benzo group Chemical group 0.000 description 1
- 125000004244 benzofuran-2-yl group Chemical group [H]C1=C(*)OC2=C([H])C([H])=C([H])C([H])=C12 0.000 description 1
- KYZHGEFMXZOSJN-UHFFFAOYSA-N benzoic acid isobutyl ester Natural products CC(C)COC(=O)C1=CC=CC=C1 KYZHGEFMXZOSJN-UHFFFAOYSA-N 0.000 description 1
- XSCHRSMBECNVNS-UHFFFAOYSA-N benzopyrazine Natural products N1=CC=NC2=CC=CC=C21 XSCHRSMBECNVNS-UHFFFAOYSA-N 0.000 description 1
- 125000004541 benzoxazolyl group Chemical group O1C(=NC2=C1C=CC=C2)* 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229960000516 bezafibrate Drugs 0.000 description 1
- IIBYAHWJQTYFKB-UHFFFAOYSA-N bezafibrate Chemical compound C1=CC(OC(C)(C)C(O)=O)=CC=C1CCNC(=O)C1=CC=C(Cl)C=C1 IIBYAHWJQTYFKB-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 230000031018 biological processes and functions Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- OGODKNYCTJYXFF-UHFFFAOYSA-N bis(4-methylbenzoyl) 2,3-dihydroxybutanedioate Chemical class C1=CC(C)=CC=C1C(=O)OC(=O)C(O)C(O)C(=O)OC(=O)C1=CC=C(C)C=C1 OGODKNYCTJYXFF-UHFFFAOYSA-N 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- 238000007664 blowing Methods 0.000 description 1
- UWTDFICHZKXYAC-UHFFFAOYSA-N boron;oxolane Chemical compound [B].C1CCOC1 UWTDFICHZKXYAC-UHFFFAOYSA-N 0.000 description 1
- ZADPBFCGQRWHPN-UHFFFAOYSA-N boronic acid Chemical compound OBO ZADPBFCGQRWHPN-UHFFFAOYSA-N 0.000 description 1
- KDPAWGWELVVRCH-UHFFFAOYSA-N bromoacetic acid Chemical compound OC(=O)CBr KDPAWGWELVVRCH-UHFFFAOYSA-N 0.000 description 1
- 150000005752 bromopyridines Chemical class 0.000 description 1
- 150000005700 bromopyrimidines Chemical class 0.000 description 1
- 206010006451 bronchitis Diseases 0.000 description 1
- QNRMTGGDHLBXQZ-UHFFFAOYSA-N buta-1,2-diene Chemical compound CC=C=C QNRMTGGDHLBXQZ-UHFFFAOYSA-N 0.000 description 1
- YTIVTFGABIZHHX-UHFFFAOYSA-N butynedioic acid Chemical compound OC(=O)C#CC(O)=O YTIVTFGABIZHHX-UHFFFAOYSA-N 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- FATUQANACHZLRT-KMRXSBRUSA-L calcium glucoheptonate Chemical compound [Ca+2].OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)C([O-])=O FATUQANACHZLRT-KMRXSBRUSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N carbon dioxide Natural products O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 150000001728 carbonyl compounds Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000000747 cardiac effect Effects 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 238000004113 cell culture Methods 0.000 description 1
- 230000024245 cell differentiation Effects 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 208000026106 cerebrovascular disease Diseases 0.000 description 1
- PBAYDYUZOSNJGU-UHFFFAOYSA-N chelidonic acid Natural products OC(=O)C1=CC(=O)C=C(C(O)=O)O1 PBAYDYUZOSNJGU-UHFFFAOYSA-N 0.000 description 1
- KXZJHVJKXJLBKO-UHFFFAOYSA-N chembl1408157 Chemical compound N=1C2=CC=CC=C2C(C(=O)O)=CC=1C1=CC=C(O)C=C1 KXZJHVJKXJLBKO-UHFFFAOYSA-N 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- OEYIOHPDSNJKLS-UHFFFAOYSA-N choline Chemical compound C[N+](C)(C)CCO OEYIOHPDSNJKLS-UHFFFAOYSA-N 0.000 description 1
- 229960001231 choline Drugs 0.000 description 1
- 125000004617 chromonyl group Chemical group O1C(=CC(C2=CC=CC=C12)=O)* 0.000 description 1
- 208000007451 chronic bronchitis Diseases 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 125000000259 cinnolinyl group Chemical group N1=NC(=CC2=CC=CC=C12)* 0.000 description 1
- 235000015165 citric acid Nutrition 0.000 description 1
- 229960001214 clofibrate Drugs 0.000 description 1
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 208000029742 colonic neoplasm Diseases 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 239000002299 complementary DNA Substances 0.000 description 1
- 238000006482 condensation reaction Methods 0.000 description 1
- 208000028831 congenital heart disease Diseases 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- LEKPFOXEZRZPGW-UHFFFAOYSA-N copper;dicyanide Chemical compound [Cu+2].N#[C-].N#[C-] LEKPFOXEZRZPGW-UHFFFAOYSA-N 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000005676 cyclic carbonates Chemical class 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001162 cycloheptenyl group Chemical group C1(=CCCCCC1)* 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- PNZXMIKHJXIPEK-UHFFFAOYSA-N cyclohexanecarboxamide Chemical compound NC(=O)C1CCCCC1 PNZXMIKHJXIPEK-UHFFFAOYSA-N 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 125000002933 cyclohexyloxy group Chemical group C1(CCCCC1)O* 0.000 description 1
- WEPUZBYKXNKSDH-UHFFFAOYSA-N cyclopentanecarbonyl chloride Chemical compound ClC(=O)C1CCCC1 WEPUZBYKXNKSDH-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001887 cyclopentyloxy group Chemical group C1(CCCC1)O* 0.000 description 1
- 230000034994 death Effects 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 238000009795 derivation Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- XXTZHYXQVWRADW-UHFFFAOYSA-N diazomethanone Chemical compound [N]N=C=O XXTZHYXQVWRADW-UHFFFAOYSA-N 0.000 description 1
- YNHIGQDRGKUECZ-UHFFFAOYSA-N dichloropalladium;triphenylphosphanium Chemical compound Cl[Pd]Cl.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1[PH+](C=1C=CC=CC=1)C1=CC=CC=C1 YNHIGQDRGKUECZ-UHFFFAOYSA-N 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000004852 dihydrofuranyl group Chemical group O1C(CC=C1)* 0.000 description 1
- 125000005057 dihydrothienyl group Chemical group S1C(CC=C1)* 0.000 description 1
- 125000005072 dihydrothiopyranyl group Chemical group S1C(CCC=C1)* 0.000 description 1
- 229940043279 diisopropylamine Drugs 0.000 description 1
- ASQQEOXYFGEFKQ-UHFFFAOYSA-N dioxirane Chemical compound C1OO1 ASQQEOXYFGEFKQ-UHFFFAOYSA-N 0.000 description 1
- POULHZVOKOAJMA-UHFFFAOYSA-M dodecanoate Chemical compound CCCCCCCCCCCC([O-])=O POULHZVOKOAJMA-UHFFFAOYSA-M 0.000 description 1
- 229960004679 doxorubicin Drugs 0.000 description 1
- 230000002124 endocrine Effects 0.000 description 1
- 230000002255 enzymatic effect Effects 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-N ethanesulfonic acid Chemical class CCS(O)(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-N 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 1
- ZCHAZAORZUGANV-UHFFFAOYSA-N ethyl 2-[2-[[2-bromo-5-(quinolin-2-ylmethoxy)phenoxy]methyl]-6-methylphenoxy]acetate Chemical compound CCOC(=O)COC1=C(C)C=CC=C1COC1=CC(OCC=2N=C3C=CC=CC3=CC=2)=CC=C1Br ZCHAZAORZUGANV-UHFFFAOYSA-N 0.000 description 1
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 229960002297 fenofibrate Drugs 0.000 description 1
- YMTINGFKWWXKFG-UHFFFAOYSA-N fenofibrate Chemical compound C1=CC(OC(C)(C)C(=O)OC(C)C)=CC=C1C(=O)C1=CC=C(Cl)C=C1 YMTINGFKWWXKFG-UHFFFAOYSA-N 0.000 description 1
- 229940125753 fibrate Drugs 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 235000012631 food intake Nutrition 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 125000003838 furazanyl group Chemical group 0.000 description 1
- 238000002290 gas chromatography-mass spectrometry Methods 0.000 description 1
- 230000009229 glucose formation Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002140 halogenating effect Effects 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- 125000004404 heteroalkyl group Chemical group 0.000 description 1
- 125000004446 heteroarylalkyl group Chemical group 0.000 description 1
- IPCSVZSSVZVIGE-UHFFFAOYSA-M hexadecanoate Chemical compound CCCCCCCCCCCCCCCC([O-])=O IPCSVZSSVZVIGE-UHFFFAOYSA-M 0.000 description 1
- MUTGBJKUEZFXGO-UHFFFAOYSA-N hexahydrophthalic anhydride Chemical compound C1CCCC2C(=O)OC(=O)C21 MUTGBJKUEZFXGO-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 230000003054 hormonal effect Effects 0.000 description 1
- 210000005260 human cell Anatomy 0.000 description 1
- 235000003642 hunger Nutrition 0.000 description 1
- 238000009396 hybridization Methods 0.000 description 1
- WJRBRSLFGCUECM-UHFFFAOYSA-N hydantoin Chemical compound O=C1CNC(=O)N1 WJRBRSLFGCUECM-UHFFFAOYSA-N 0.000 description 1
- 150000002429 hydrazines Chemical class 0.000 description 1
- 150000004678 hydrides Chemical class 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000005984 hydrogenation reaction Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- WFNASTYGEKUMIY-UHFFFAOYSA-N hydron;1h-imidazol-5-ylmethanol;chloride Chemical compound Cl.OCC1=CN=CN1 WFNASTYGEKUMIY-UHFFFAOYSA-N 0.000 description 1
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 1
- 201000010066 hyperandrogenism Diseases 0.000 description 1
- 230000000222 hyperoxic effect Effects 0.000 description 1
- 230000000999 hypotriglyceridemic effect Effects 0.000 description 1
- UTCSSFWDNNEEBH-UHFFFAOYSA-N imidazo[1,2-a]pyridine Chemical compound C1=CC=CC2=NC=CN21 UTCSSFWDNNEEBH-UHFFFAOYSA-N 0.000 description 1
- 125000003037 imidazol-2-yl group Chemical group [H]N1C([*])=NC([H])=C1[H] 0.000 description 1
- YAMHXTCMCPHKLN-UHFFFAOYSA-N imidazolidin-2-one Chemical compound O=C1NCCN1 YAMHXTCMCPHKLN-UHFFFAOYSA-N 0.000 description 1
- 125000005945 imidazopyridyl group Chemical group 0.000 description 1
- 125000005462 imide group Chemical group 0.000 description 1
- 150000002466 imines Chemical class 0.000 description 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 description 1
- JYGFTBXVXVMTGB-UHFFFAOYSA-N indolin-2-one Chemical compound C1=CC=C2NC(=O)CC2=C1 JYGFTBXVXVMTGB-UHFFFAOYSA-N 0.000 description 1
- 239000000411 inducer Substances 0.000 description 1
- 230000028709 inflammatory response Effects 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 208000020658 intracerebral hemorrhage Diseases 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- 208000028867 ischemia Diseases 0.000 description 1
- 230000000302 ischemic effect Effects 0.000 description 1
- 125000000904 isoindolyl group Chemical group C=1(NC=C2C=CC=CC12)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- CTAPFRYPJLPFDF-UHFFFAOYSA-N isoxazole Chemical class C=1C=NOC=1 CTAPFRYPJLPFDF-UHFFFAOYSA-N 0.000 description 1
- 150000002545 isoxazoles Chemical class 0.000 description 1
- 208000017169 kidney disease Diseases 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940070765 laurate Drugs 0.000 description 1
- 125000005647 linker group Chemical group 0.000 description 1
- 230000004132 lipogenesis Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000004668 long chain fatty acids Chemical class 0.000 description 1
- 231100000515 lung injury Toxicity 0.000 description 1
- 229960003646 lysine Drugs 0.000 description 1
- VTHJTEIRLNZDEV-UHFFFAOYSA-L magnesium dihydroxide Chemical compound [OH-].[OH-].[Mg+2] VTHJTEIRLNZDEV-UHFFFAOYSA-L 0.000 description 1
- 239000000347 magnesium hydroxide Substances 0.000 description 1
- 229910001862 magnesium hydroxide Inorganic materials 0.000 description 1
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 1
- 230000003211 malignant effect Effects 0.000 description 1
- 210000001161 mammalian embryo Anatomy 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000004667 medium chain fatty acids Chemical class 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 description 1
- 108020004999 messenger RNA Proteins 0.000 description 1
- 208000030159 metabolic disease Diseases 0.000 description 1
- 230000002503 metabolic effect Effects 0.000 description 1
- 230000004060 metabolic process Effects 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-M methanesulfonate group Chemical class CS(=O)(=O)[O-] AFVFQIVMOAPDHO-UHFFFAOYSA-M 0.000 description 1
- 229940098779 methanesulfonic acid Drugs 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- KORCHOVGDCPLSX-UHFFFAOYSA-N methyl 2-[2-(hydroxymethyl)-6-methylphenoxy]propanoate Chemical compound COC(=O)C(C)OC1=C(C)C=CC=C1CO KORCHOVGDCPLSX-UHFFFAOYSA-N 0.000 description 1
- LFOROOKWYBROJA-UHFFFAOYSA-N methyl 2-[2-methyl-6-[[3-(quinolin-2-ylmethoxy)phenoxy]methyl]phenoxy]propanoate Chemical compound COC(=O)C(C)OC1=C(C)C=CC=C1COC1=CC=CC(OCC=2N=C3C=CC=CC3=CC=2)=C1 LFOROOKWYBROJA-UHFFFAOYSA-N 0.000 description 1
- XAQQKXWRTLIIHP-UHFFFAOYSA-N methyl 2-[[3-[(1,3-benzoxazol-2-ylamino)methyl]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(CNC=2OC3=CC=CC=C3N=2)=C1 XAQQKXWRTLIIHP-UHFFFAOYSA-N 0.000 description 1
- CZCSMEGSABDKQV-UHFFFAOYSA-N methyl 2-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C(=CC=CC=2)Cl)=C1 CZCSMEGSABDKQV-UHFFFAOYSA-N 0.000 description 1
- OXEWWNLHWUQWET-UHFFFAOYSA-N methyl 2-[[3-[(4-chlorophenyl)methoxy]phenoxy]methyl]-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1COC1=CC=CC(OCC=2C=CC(Cl)=CC=2)=C1 OXEWWNLHWUQWET-UHFFFAOYSA-N 0.000 description 1
- ACEONLNNWKIPTM-UHFFFAOYSA-N methyl 2-bromopropanoate Chemical compound COC(=O)C(C)Br ACEONLNNWKIPTM-UHFFFAOYSA-N 0.000 description 1
- BRWROFVPMUPMJQ-UHFFFAOYSA-N methyl 3-methylthiophene-2-carboxylate Chemical compound COC(=O)C=1SC=CC=1C BRWROFVPMUPMJQ-UHFFFAOYSA-N 0.000 description 1
- XJMIXEAZMCTAGH-UHFFFAOYSA-N methyl 3-oxopentanoate Chemical compound CCC(=O)CC(=O)OC XJMIXEAZMCTAGH-UHFFFAOYSA-N 0.000 description 1
- KJJSHOHQQHACLE-UHFFFAOYSA-N methyl 5-hydroxypyridine-3-carboxylate Chemical compound COC(=O)C1=CN=CC(O)=C1 KJJSHOHQQHACLE-UHFFFAOYSA-N 0.000 description 1
- 229940050176 methyl chloride Drugs 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- DVSDBMFJEQPWNO-UHFFFAOYSA-N methyllithium Chemical compound C[Li] DVSDBMFJEQPWNO-UHFFFAOYSA-N 0.000 description 1
- 230000027939 micturition Effects 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- HHQJWDKIRXRTLS-UHFFFAOYSA-N n'-bromobutanediamide Chemical compound NC(=O)CCC(=O)NBr HHQJWDKIRXRTLS-UHFFFAOYSA-N 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 125000004370 n-butenyl group Chemical group [H]\C([H])=C(/[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 125000005029 naphthylthio group Chemical group C1(=CC=CC2=CC=CC=C12)S* 0.000 description 1
- 125000004593 naphthyridinyl group Chemical group N1=C(C=CC2=CC=CN=C12)* 0.000 description 1
- 230000008764 nerve damage Effects 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000006396 nitration reaction Methods 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000002868 norbornyl group Chemical group C12(CCC(CC1)C2)* 0.000 description 1
- 102000006255 nuclear receptors Human genes 0.000 description 1
- 108020004017 nuclear receptors Proteins 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 125000003261 o-tolyl group Chemical group [H]C1=C([H])C(*)=C(C([H])=C1[H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-M oleate Chemical compound CCCCCCCC\C=C/CCCCCCCC([O-])=O ZQPPMHVWECSIRJ-KTKRTIGZSA-M 0.000 description 1
- 229940049964 oleate Drugs 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 239000006186 oral dosage form Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 230000008816 organ damage Effects 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000006053 organic reaction Methods 0.000 description 1
- 229960003104 ornithine Drugs 0.000 description 1
- JJVNINGBHGBWJH-UHFFFAOYSA-N ortho-vanillin Chemical compound COC1=CC=CC(C=O)=C1O JJVNINGBHGBWJH-UHFFFAOYSA-N 0.000 description 1
- 201000008968 osteosarcoma Diseases 0.000 description 1
- WCPAKWJPBJAGKN-UHFFFAOYSA-N oxadiazole Chemical class C1=CON=N1 WCPAKWJPBJAGKN-UHFFFAOYSA-N 0.000 description 1
- 229940039748 oxalate Drugs 0.000 description 1
- SJGALSBBFTYSBA-UHFFFAOYSA-N oxaziridine Chemical compound C1NO1 SJGALSBBFTYSBA-UHFFFAOYSA-N 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 125000001312 palmitoyl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 230000036961 partial effect Effects 0.000 description 1
- 230000008506 pathogenesis Effects 0.000 description 1
- 230000007170 pathology Effects 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 1
- 125000003538 pentan-3-yl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- RLOWWWKZYUNIDI-UHFFFAOYSA-N phosphinic chloride Chemical compound ClP=O RLOWWWKZYUNIDI-UHFFFAOYSA-N 0.000 description 1
- 125000004592 phthalazinyl group Chemical group C1(=NN=CC2=CC=CC=C12)* 0.000 description 1
- 125000005543 phthalimide group Chemical group 0.000 description 1
- IWELDVXSEVIIGI-UHFFFAOYSA-N piperazin-2-one Chemical class O=C1CNCCN1 IWELDVXSEVIIGI-UHFFFAOYSA-N 0.000 description 1
- 125000004193 piperazinyl group Chemical group 0.000 description 1
- 125000005936 piperidyl group Chemical group 0.000 description 1
- 230000036470 plasma concentration Effects 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- FYRHIOVKTDQVFC-UHFFFAOYSA-M potassium phthalimide Chemical compound [K+].C1=CC=C2C(=O)[N-]C(=O)C2=C1 FYRHIOVKTDQVFC-UHFFFAOYSA-M 0.000 description 1
- 230000003389 potentiating effect Effects 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 201000009104 prediabetes syndrome Diseases 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 108090000765 processed proteins & peptides Proteins 0.000 description 1
- POSICDHOUBKJKP-UHFFFAOYSA-N prop-2-enoxybenzene Chemical class C=CCOC1=CC=CC=C1 POSICDHOUBKJKP-UHFFFAOYSA-N 0.000 description 1
- 125000001325 propanoyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004368 propenyl group Chemical group C(=CC)* 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 150000003176 prostaglandin J2 derivatives Chemical class 0.000 description 1
- 150000003180 prostaglandins Chemical class 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 239000003586 protic polar solvent Substances 0.000 description 1
- 125000001042 pteridinyl group Chemical group N1=C(N=CC2=NC=CN=C12)* 0.000 description 1
- 150000003217 pyrazoles Chemical class 0.000 description 1
- 125000002098 pyridazinyl group Chemical group 0.000 description 1
- UBQKCCHYAOITMY-UHFFFAOYSA-N pyridin-2-ol Chemical class OC1=CC=CC=N1 UBQKCCHYAOITMY-UHFFFAOYSA-N 0.000 description 1
- 125000005344 pyridylmethyl group Chemical group [H]C1=C([H])C([H])=C([H])C(=N1)C([H])([H])* 0.000 description 1
- 125000005030 pyridylthio group Chemical group N1=C(C=CC=C1)S* 0.000 description 1
- VTGOHKSTWXHQJK-UHFFFAOYSA-N pyrimidin-2-ol Chemical compound OC1=NC=CC=N1 VTGOHKSTWXHQJK-UHFFFAOYSA-N 0.000 description 1
- 150000003230 pyrimidines Chemical class 0.000 description 1
- 238000000197 pyrolysis Methods 0.000 description 1
- 125000000719 pyrrolidinyl group Chemical group 0.000 description 1
- 125000006085 pyrrolopyridyl group Chemical group 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 150000003246 quinazolines Chemical class 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 125000004262 quinoxalin-2-yl group Chemical group [H]C1=NC2=C([H])C([H])=C([H])C([H])=C2N=C1* 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 230000001850 reproductive effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 230000000250 revascularization Effects 0.000 description 1
- 238000004007 reversed phase HPLC Methods 0.000 description 1
- 206010039073 rheumatoid arthritis Diseases 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- QBERHIJABFXGRZ-UHFFFAOYSA-M rhodium;triphenylphosphane;chloride Chemical compound [Cl-].[Rh].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 QBERHIJABFXGRZ-UHFFFAOYSA-M 0.000 description 1
- 150000003902 salicylic acid esters Chemical class 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 150000003333 secondary alcohols Chemical class 0.000 description 1
- 230000028327 secretion Effects 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000012279 sodium borohydride Substances 0.000 description 1
- 229910000033 sodium borohydride Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 description 1
- 229940074545 sodium dihydrogen phosphate dihydrate Drugs 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- HQAITFAUVZBHNB-UHFFFAOYSA-N sodium;pentahydrate Chemical compound O.O.O.O.O.[Na] HQAITFAUVZBHNB-UHFFFAOYSA-N 0.000 description 1
- 239000012265 solid product Substances 0.000 description 1
- 230000000392 somatic effect Effects 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000000638 stimulation Effects 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-M sulfamate Chemical compound NS([O-])(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-M 0.000 description 1
- PXQLVRUNWNTZOS-UHFFFAOYSA-N sulfanyl Chemical class [SH] PXQLVRUNWNTZOS-UHFFFAOYSA-N 0.000 description 1
- YROXIXLRRCOBKF-UHFFFAOYSA-N sulfonylurea Chemical class OC(=N)N=S(=O)=O YROXIXLRRCOBKF-UHFFFAOYSA-N 0.000 description 1
- 208000024891 symptom Diseases 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- 239000003826 tablet Substances 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- BNWCETAHAJSBFG-UHFFFAOYSA-N tert-butyl 2-bromoacetate Chemical compound CC(C)(C)OC(=O)CBr BNWCETAHAJSBFG-UHFFFAOYSA-N 0.000 description 1
- WMOVHXAZOJBABW-UHFFFAOYSA-N tert-butyl acetate Chemical compound CC(=O)OC(C)(C)C WMOVHXAZOJBABW-UHFFFAOYSA-N 0.000 description 1
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 1
- 125000003718 tetrahydrofuranyl group Chemical group 0.000 description 1
- 125000003507 tetrahydrothiofenyl group Chemical group 0.000 description 1
- 125000004632 tetrahydrothiopyranyl group Chemical group S1C(CCCC1)* 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical class C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000001984 thiazolidinyl group Chemical group 0.000 description 1
- 125000004588 thienopyridyl group Chemical group S1C(=CC2=C1C=CC=N2)* 0.000 description 1
- 125000005301 thienylmethyl group Chemical group [H]C1=C([H])C([H])=C(S1)C([H])([H])* 0.000 description 1
- 125000004568 thiomorpholinyl group Chemical group 0.000 description 1
- 125000000464 thioxo group Chemical group S=* 0.000 description 1
- 230000035922 thirst Effects 0.000 description 1
- 230000000451 tissue damage Effects 0.000 description 1
- 231100000827 tissue damage Toxicity 0.000 description 1
- 238000013518 transcription Methods 0.000 description 1
- 230000035897 transcription Effects 0.000 description 1
- 230000002103 transcriptional effect Effects 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000001052 transient effect Effects 0.000 description 1
- 230000032258 transport Effects 0.000 description 1
- 125000004306 triazinyl group Chemical group 0.000 description 1
- 125000001425 triazolyl group Chemical group 0.000 description 1
- IMNIMPAHZVJRPE-UHFFFAOYSA-N triethylenediamine Chemical compound C1CN2CCN1CC2 IMNIMPAHZVJRPE-UHFFFAOYSA-N 0.000 description 1
- CWMFRHBXRUITQE-UHFFFAOYSA-N trimethylsilylacetylene Chemical group C[Si](C)(C)C#C CWMFRHBXRUITQE-UHFFFAOYSA-N 0.000 description 1
- LENZDBCJOHFCAS-UHFFFAOYSA-N tris Chemical compound OCC(N)(CO)CO LENZDBCJOHFCAS-UHFFFAOYSA-N 0.000 description 1
- AQLJVWUFPCUVLO-UHFFFAOYSA-N urea hydrogen peroxide Chemical compound OO.NC(N)=O AQLJVWUFPCUVLO-UHFFFAOYSA-N 0.000 description 1
- 229940070710 valerate Drugs 0.000 description 1
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
- 239000011995 wilkinson's catalyst Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- UGZADUVQMDAIAO-UHFFFAOYSA-L zinc hydroxide Chemical compound [OH-].[OH-].[Zn+2] UGZADUVQMDAIAO-UHFFFAOYSA-L 0.000 description 1
- 229940007718 zinc hydroxide Drugs 0.000 description 1
- 229910021511 zinc hydroxide Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/06—Antihyperlipidemics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/08—Drugs for disorders of the metabolism for glucose homeostasis
- A61P3/10—Drugs for disorders of the metabolism for glucose homeostasis for hyperglycaemia, e.g. antidiabetics
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/10—Drugs for disorders of the cardiovascular system for treating ischaemic or atherosclerotic diseases, e.g. antianginal drugs, coronary vasodilators, drugs for myocardial infarction, retinopathy, cerebrovascula insufficiency, renal arteriosclerosis
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P9/00—Drugs for disorders of the cardiovascular system
- A61P9/12—Antihypertensives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C65/00—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C65/21—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups
- C07C65/24—Compounds having carboxyl groups bound to carbon atoms of six—membered aromatic rings and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups containing ether groups, groups, groups, or groups polycyclic
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/12—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D215/14—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/18—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/20—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/02—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom
- C07D215/16—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen atoms or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D215/38—Nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/58—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems with hetero atoms directly attached to the ring nitrogen atom
- C07D215/60—N-oxides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/74—Quinazolines; Hydrogenated quinazolines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, attached to ring carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D241/00—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings
- C07D241/36—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems
- C07D241/38—Heterocyclic compounds containing 1,4-diazine or hydrogenated 1,4-diazine rings condensed with carbocyclic rings or ring systems with only hydrogen or carbon atoms directly attached to the ring nitrogen atoms
- C07D241/40—Benzopyrazines
- C07D241/42—Benzopyrazines with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to carbon atoms of the hetero ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D261/00—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings
- C07D261/02—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings
- C07D261/06—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members
- C07D261/08—Heterocyclic compounds containing 1,2-oxazole or hydrogenated 1,2-oxazole rings not condensed with other rings having two or more double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/02—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings
- C07D263/30—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D263/32—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D263/00—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings
- C07D263/52—Heterocyclic compounds containing 1,3-oxazole or hydrogenated 1,3-oxazole rings condensed with carbocyclic rings or ring systems
- C07D263/54—Benzoxazoles; Hydrogenated benzoxazoles
- C07D263/58—Benzoxazoles; Hydrogenated benzoxazoles with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/24—Radicals substituted by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/60—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings condensed with carbocyclic rings or ring systems
- C07D277/62—Benzothiazoles
- C07D277/64—Benzothiazoles with only hydrocarbon or substituted hydrocarbon radicals attached in position 2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/12—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D405/00—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom
- C07D405/02—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings
- C07D405/12—Heterocyclic compounds containing both one or more hetero rings having oxygen atoms as the only ring hetero atoms, and one or more rings having nitrogen as the only ring hetero atom containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D409/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms
- C07D409/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings
- C07D409/12—Heterocyclic compounds containing two or more hetero rings, at least one ring having sulfur atoms as the only ring hetero atoms containing two hetero rings linked by a chain containing hetero atoms as chain links
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- General Chemical & Material Sciences (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Diabetes (AREA)
- Heart & Thoracic Surgery (AREA)
- Hematology (AREA)
- Obesity (AREA)
- Cardiology (AREA)
- Emergency Medicine (AREA)
- Endocrinology (AREA)
- Urology & Nephrology (AREA)
- Vascular Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Plural Heterocyclic Compounds (AREA)
- Catalysts (AREA)
- Quinoline Compounds (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Pyridine Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13145499P | 1999-04-28 | 1999-04-28 | |
| US60/131,454 | 1999-04-28 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| RU2001132081A RU2001132081A (ru) | 2003-08-27 |
| RU2278860C2 true RU2278860C2 (ru) | 2006-06-27 |
Family
ID=22449538
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| RU2001132081/04A RU2278860C2 (ru) | 1999-04-28 | 2000-04-28 | Производные триарил-содержащих кислот в качестве лигандов рецепторов ппар |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US7005440B1 (enExample) |
| EP (1) | EP1177176B1 (enExample) |
| JP (1) | JP2002543065A (enExample) |
| KR (1) | KR100693771B1 (enExample) |
| CN (1) | CN1183113C (enExample) |
| AT (1) | ATE323678T1 (enExample) |
| AU (1) | AU782404B2 (enExample) |
| BR (1) | BR0010126A (enExample) |
| CA (1) | CA2371308A1 (enExample) |
| CY (1) | CY1104899T1 (enExample) |
| CZ (1) | CZ20013834A3 (enExample) |
| DE (1) | DE60027420T2 (enExample) |
| DK (1) | DK1177176T3 (enExample) |
| EE (1) | EE200100558A (enExample) |
| ES (1) | ES2261202T3 (enExample) |
| HR (1) | HRP20010793A2 (enExample) |
| HU (1) | HUP0200997A3 (enExample) |
| IL (2) | IL145923A0 (enExample) |
| NO (1) | NO20015226L (enExample) |
| NZ (1) | NZ515087A (enExample) |
| PL (1) | PL351470A1 (enExample) |
| PT (1) | PT1177176E (enExample) |
| RU (1) | RU2278860C2 (enExample) |
| SK (1) | SK15522001A3 (enExample) |
| WO (1) | WO2000064876A1 (enExample) |
| YU (1) | YU74701A (enExample) |
| ZA (1) | ZA200108800B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2480453C2 (ru) * | 2007-03-08 | 2013-04-27 | Альбирео Аб | Новые соединения |
Families Citing this family (232)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE368037T1 (de) | 1999-04-28 | 2007-08-15 | Sanofi Aventis Deutschland | Di-aryl-säurederivate als ppar rezeptor liganden |
| US6414002B1 (en) | 1999-09-22 | 2002-07-02 | Bristol-Myers Squibb Company | Substituted acid derivatives useful as antidiabetic and antiobesity agents and method |
| TW200514783A (en) | 1999-09-22 | 2005-05-01 | Bristol Myers Squibb Co | Substituted acid derivatives useful as antiodiabetic and antiobesity agents and method |
| MXPA02007603A (es) * | 2000-03-09 | 2003-02-24 | Aventis Pharma Gmbh | Usos terapeuticos de mediadores ppar. |
| JP2001261654A (ja) * | 2000-03-21 | 2001-09-26 | Mitsui Chemicals Inc | キノリン誘導体およびそれを有効成分として含有する核内レセプター作動薬 |
| WO2002040458A1 (en) * | 2000-11-17 | 2002-05-23 | Takeda Chemical Industries, Ltd. | Isoxazole derivatives |
| GB0029974D0 (en) * | 2000-12-08 | 2001-01-24 | Glaxo Group Ltd | Chemical compounds |
| DE60139025D1 (de) * | 2000-12-28 | 2009-07-30 | Takeda Pharmaceutical | Alkansäurederivate, verfahren zu deren herstellung und deren verwendung |
| WO2002064632A2 (en) * | 2001-02-01 | 2002-08-22 | Smithkline Beecham Corporation | Crystallized ppar$g(a) ligand binding domain polypeptide and screening methods employing same |
| WO2002076959A1 (en) * | 2001-03-23 | 2002-10-03 | Takeda Chemical Industries, Ltd. | Five-membered heterocyclic alkanoic acid derivative |
| WO2002079162A1 (en) * | 2001-03-28 | 2002-10-10 | Eisai Co., Ltd. | Carboxylic acids |
| US7244861B2 (en) | 2001-03-30 | 2007-07-17 | Eisai Co., Ltd. | Benzene compound and salt thereof |
| TWI311133B (en) | 2001-04-20 | 2009-06-21 | Eisai R&D Man Co Ltd | Carboxylic acid derivativeand the salt thereof |
| US20030092736A1 (en) * | 2001-05-30 | 2003-05-15 | Cheng Peter T. | Substituted azole acid derivatives useful as antidiabetic and antiobesity agents and method |
| GB0113231D0 (en) | 2001-05-31 | 2001-07-25 | Glaxo Group Ltd | Chemical compounds |
| WO2002098840A1 (en) * | 2001-06-04 | 2002-12-12 | Eisai Co., Ltd. | Carboxylic acid derivative and medicine comprising salt or ester of the same |
| DK1397130T3 (da) | 2001-06-20 | 2007-11-12 | Wyeth Corp | Substituerede indolsyrederivater som inhibitorer af plasminogenaktivatorinhibitor-1 (PAI-1) |
| TWI224101B (en) | 2001-06-20 | 2004-11-21 | Wyeth Corp | Substituted naphthyl indole derivatives as inhibitors of plasminogen activator inhibitor type-1 (PAI-1) |
| US20110065129A1 (en) | 2001-07-27 | 2011-03-17 | Lowe Derek B | Indane acetic acid derivatives and their use as pharmaceutical agents, intermediates, and method of preparation |
| AR036237A1 (es) | 2001-07-27 | 2004-08-25 | Bayer Corp | Derivados del acido indan acetico, intermediarios, y metodo para su preparacion, composicion farmaceutica y el uso de dichos derivados para la manufactura de un medicamento |
| DE60131967D1 (de) * | 2001-08-13 | 2008-01-31 | Phenex Pharmaceuticals Ag | Nr1h4-kern-rezeptor-bindende verbindungen |
| JPWO2003016265A1 (ja) | 2001-08-17 | 2004-12-02 | エーザイ株式会社 | 環状化合物およびpparアゴニスト |
| AU2002333456B2 (en) * | 2001-08-31 | 2008-07-17 | Sanofi-Aventis Deutschland Gmbh | Diaryl cycloalkyl derivatives, method for producing the same and the use thereof as PPAR activators |
| US7399777B2 (en) | 2001-08-31 | 2008-07-15 | Sanofi-Aventis Deutschland Gmbh | Diarylcycloalkyl derivatives, processes for their preparation and their use as pharmceuticals |
| US6884812B2 (en) | 2001-08-31 | 2005-04-26 | Aventis Pharma Deutschland Gmbh | Diarylcycloalkyl derivatives, processes for their preparation and their use as pharmaceuticals |
| US6716842B2 (en) | 2002-04-05 | 2004-04-06 | Warner-Lambert Company, Llc | Antidiabetic agents |
| US7078404B2 (en) | 2002-04-11 | 2006-07-18 | Sanofi-Aventis Deutschland Gmbh | Acyl-3-carboxyphenylurea derivatives, processes for preparing them and their use |
| US7223796B2 (en) | 2002-04-11 | 2007-05-29 | Sanofi-Aventis Deutschland Gmbh | Acyl-4-carboxyphenylurea derivatives, processes for preparing them and their use |
| JP2004277397A (ja) * | 2002-05-24 | 2004-10-07 | Takeda Chem Ind Ltd | 1,2−アゾール誘導体 |
| EP1513817A1 (en) * | 2002-05-24 | 2005-03-16 | Takeda Pharmaceutical Company Limited | 1, 2-azole derivatives with hypoglycemic and hypolipidemic activity |
| US7049341B2 (en) | 2002-06-07 | 2006-05-23 | Aventis Pharma Deutschland Gmbh | N-benzoylureidocinnamic acid derivatives, processes for preparing them and their use |
| GB0214149D0 (en) * | 2002-06-19 | 2002-07-31 | Glaxo Group Ltd | Chemical compounds |
| TWI282784B (en) | 2002-06-20 | 2007-06-21 | Astrazeneca Ab | Therapeutic agents |
| US7351858B2 (en) | 2002-06-20 | 2008-04-01 | Astrazeneca Ab | Ortho-substituted benzoic acid derivatives for the treatment of insulin resistance |
| SE0201937D0 (sv) | 2002-06-20 | 2002-06-20 | Astrazeneca Ab | Therapeutic agents |
| PL374860A1 (en) | 2002-07-09 | 2005-11-14 | Bristol-Myers Squibb Company | Substituted heterocyclic derivatives useful as antidiabetic and antiobesity agents and method |
| WO2004007439A1 (ja) * | 2002-07-10 | 2004-01-22 | Sumitomo Pharmaceuticals Co., Ltd. | ビアリール誘導体 |
| US7262220B2 (en) | 2002-07-11 | 2007-08-28 | Sanofi-Aventis Deutschland Gmbh | Urea- and urethane-substituted acylureas, process for their preparation and their use |
| DE10231370B4 (de) | 2002-07-11 | 2006-04-06 | Sanofi-Aventis Deutschland Gmbh | Thiophenglycosidderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
| AU2003249937A1 (en) | 2002-07-12 | 2004-02-02 | Sanofi-Aventis Deutschland Gmbh | Heterocyclically substituted benzoylureas, method for their production and their use as medicaments |
| EP1539137B1 (en) * | 2002-07-30 | 2010-05-26 | Merck Sharp & Dohme Corp. | Ppar alpha selective compounds for the treatment of dyslipidemia and other lipid disorders |
| EP1541564A1 (en) | 2002-09-10 | 2005-06-15 | Takeda Pharmaceutical Company Limited | Five-membered heterocyclic compounds |
| JP2004123732A (ja) * | 2002-09-10 | 2004-04-22 | Takeda Chem Ind Ltd | 5員複素環化合物 |
| US20040157922A1 (en) | 2002-10-04 | 2004-08-12 | Aventis Pharma Deutschland Gmbh | Carboxyalkoxy-substituted acyl-carboxyphenylurea derivatives and their use as medicaments |
| US7208504B2 (en) | 2002-10-12 | 2007-04-24 | Sanofi-Aventis Deutschland Gmbh | Bicyclic inhibitors of hormone sensitive lipase |
| ES2350977T3 (es) | 2002-11-05 | 2011-01-28 | Glaxo Group Limited | Agentes antibacterianos. |
| AU2003277576A1 (en) | 2002-11-08 | 2004-06-07 | Takeda Pharmaceutical Company Limited | Receptor function controlling agent |
| AU2003290700A1 (en) | 2002-11-22 | 2004-06-18 | Smithkline Beecham Corporation | Farnesoid x receptor agonists |
| MXPA05006283A (es) | 2002-12-10 | 2005-08-19 | Wyeth Corp | Derivados de arilo, ariloxi, y alquiloxi del acido sustituido 1h-indol-3-il glicoxilico como inhibidores del inhibidor-1 activador de plasminogeno (pai-1). |
| CA2509170A1 (en) | 2002-12-10 | 2004-06-24 | Wyeth | Substituted 3-alkyl and 3-arylalkyl 1h-indol-1-yl acetic acid derivatives as inhibitors of plasminogen activator inhibitor-1 (pai-1) |
| EP1569900B1 (en) | 2002-12-10 | 2006-06-28 | Wyeth | Substituted 3-carbonyl-1-yl acetic acid derivatives as inhibitors of plasminogen activator inhibitor-1 (pai-1) |
| UA80453C2 (en) | 2002-12-10 | 2007-09-25 | Derivatives of substituted dyhydropyranoindol-3,4-dion as inhibitors of plasminogen activator inhibitor-1 (pai-1) | |
| DE10258007B4 (de) | 2002-12-12 | 2006-02-09 | Sanofi-Aventis Deutschland Gmbh | Aromatische Fluorglycosidderivate, diese Verbindungen enthaltende Arzneimittel und Verfahren zur Herstellung dieser Arzneimittel |
| US6653334B1 (en) * | 2002-12-27 | 2003-11-25 | Kowa Co., Ltd. | Benzoxazole compound and pharmaceutical composition containing the same |
| JP2006516254A (ja) | 2003-01-06 | 2006-06-29 | イーライ・リリー・アンド・カンパニー | Pparモジュレータとしての縮合ヘテロ環誘導体 |
| US20040242583A1 (en) | 2003-01-20 | 2004-12-02 | Aventis Pharma Deutschland Gmbh | Pyrimido[5,4-e][1,2,4]triazine-5,7-diones, processes for preparing them and their use |
| US7179941B2 (en) | 2003-01-23 | 2007-02-20 | Sanofi-Aventis Deutschland Gmbh | Carbonylamino-substituted acyl phenyl urea derivatives, process for their preparation and their use |
| US7196114B2 (en) | 2003-02-17 | 2007-03-27 | Sanofi-Aventis Deutschland Gmbh | Substituted 3-(benzoylureido) thiophene derivatives, processes for preparing them and their use |
| DE10308351A1 (de) * | 2003-02-27 | 2004-11-25 | Aventis Pharma Deutschland Gmbh | 1,3-substituierte Cycloalkylderivate mit sauren, meist heterocyclischen Gruppen, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| DE10308352A1 (de) | 2003-02-27 | 2004-09-09 | Aventis Pharma Deutschland Gmbh | Arylcycloalkylderivate mit verzweigten Seitenketten, Verfahren zu ihrer Herstellung und ihre Anwendung als Arzneimittel |
| DE10308350B4 (de) * | 2003-02-27 | 2006-06-01 | Sanofi-Aventis Deutschland Gmbh | Verfahren zur Herstellung der enantiomeren Formen von cis-konfigurierten 1,3-Cyclohexandiol-Derivaten |
| DE10308355A1 (de) | 2003-02-27 | 2004-12-23 | Aventis Pharma Deutschland Gmbh | Aryl-cycloalkyl substituierte Alkansäurederivate, Verfahren zu ihrer Herstellung und ihre Anwendung als Arzneimittel |
| DE10308353A1 (de) * | 2003-02-27 | 2004-12-02 | Aventis Pharma Deutschland Gmbh | Diarylcycloalkylderivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US7148246B2 (en) | 2003-02-27 | 2006-12-12 | Sanofi-Aventis Deutschland Gmbh | Cycloalkyl derivatives having bioisosteric carboxylic acid groups, processes for their preparation and their use as pharmaceuticals |
| DE10308354A1 (de) * | 2003-02-27 | 2004-12-23 | Aventis Pharma Deutschland Gmbh | Cycloalkylderivate mit biosteren Carbonsäure-Gruppen, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| US7501440B2 (en) | 2003-03-07 | 2009-03-10 | Sanofi-Aventis Deutschland Gmbh | Substituted benzoylureidopyridylpiperidine-and-pyrrolidinecarboxylic acid derivatives, processes for preparing them and their use |
| US6989462B2 (en) | 2003-03-25 | 2006-01-24 | Sanofi-Aventis Deutschland Gmbh | Synthesis of 2-chloromethyl-6-methylbenzoic ester |
| DE10313228A1 (de) * | 2003-03-25 | 2004-10-21 | Aventis Pharma Deutschland Gmbh | Synthese von 2-Chlormethyl-6-methylbenzoesäureestern |
| DE10314610A1 (de) | 2003-04-01 | 2004-11-04 | Aventis Pharma Deutschland Gmbh | Neues Diphenylazetidinon mit verbesserten physiologischen Eigenschaften, Verfahren zu dessen Herstellung, diese Verbindungen enthaltende Arzneimittel und dessen Verwendung |
| US7244763B2 (en) * | 2003-04-17 | 2007-07-17 | Warner Lambert Company Llc | Compounds that modulate PPAR activity and methods of preparation |
| WO2004106276A1 (ja) | 2003-05-30 | 2004-12-09 | Takeda Pharmaceutical Company Limited | 縮合環化合物 |
| WO2005009958A1 (en) | 2003-07-17 | 2005-02-03 | Plexxikon, Inc. | Ppar active compounds |
| US7348338B2 (en) | 2003-07-17 | 2008-03-25 | Plexxikon, Inc. | PPAR active compounds |
| US7094800B2 (en) | 2003-07-25 | 2006-08-22 | Sanofi-Aventis Deutschland Gmbh | Cyanopyrrolidides, process for their preparation and their use as medicaments |
| US7008957B2 (en) | 2003-07-25 | 2006-03-07 | Sanofi-Aventis Deutschland Gmbh | Bicyclic cyanoheterocycles, process for their preparation and their use as medicaments |
| US7094794B2 (en) | 2003-07-28 | 2006-08-22 | Sanofi-Aventis Deutschland Gmbh | Substituted thiazole-benzoisothiazole dioxide derivatives, process for their preparation and their use |
| DE10335092B3 (de) | 2003-08-01 | 2005-02-03 | Aventis Pharma Deutschland Gmbh | Substituierte Benzoylureido-o-benzoylamide, Verfahren zu deren Herstellung und deren Verwendung |
| AU2004264818B2 (en) * | 2003-08-01 | 2011-09-29 | Biocon, Ltd | Aryl carbamate oligomers for hydrolyzable prodrugs and prodrugs comprising same |
| DE10335450A1 (de) * | 2003-08-02 | 2005-02-17 | Bayer Ag | Indolin-Sulfanilsäureamide |
| US20100267778A1 (en) * | 2003-08-04 | 2010-10-21 | Shinya Kusuda | Diphenyl ether compound, process for producing the same, and use |
| ES2441206T3 (es) | 2003-09-03 | 2014-02-03 | Raqualia Pharma Inc. | Compuestos de fenil o piridilamida como antagonistas de la prostaglandina E2 |
| JP4531049B2 (ja) * | 2003-09-17 | 2010-08-25 | ノバルティス アーゲー | 有機化合物 |
| US7163954B2 (en) | 2003-09-25 | 2007-01-16 | Wyeth | Substituted naphthyl benzothiophene acids |
| US7268159B2 (en) | 2003-09-25 | 2007-09-11 | Wyeth | Substituted indoles |
| US7342039B2 (en) | 2003-09-25 | 2008-03-11 | Wyeth | Substituted indole oximes |
| US7442805B2 (en) | 2003-09-25 | 2008-10-28 | Wyeth | Substituted sulfonamide-indoles |
| US7351726B2 (en) | 2003-09-25 | 2008-04-01 | Wyeth | Substituted oxadiazolidinediones |
| US7446201B2 (en) | 2003-09-25 | 2008-11-04 | Wyeth | Substituted heteroaryl benzofuran acids |
| US7141592B2 (en) | 2003-09-25 | 2006-11-28 | Wyeth | Substituted oxadiazolidinediones |
| US7265148B2 (en) | 2003-09-25 | 2007-09-04 | Wyeth | Substituted pyrrole-indoles |
| US7411083B2 (en) | 2003-09-25 | 2008-08-12 | Wyeth | Substituted acetic acid derivatives |
| US7332521B2 (en) | 2003-09-25 | 2008-02-19 | Wyeth | Substituted indoles |
| US7534894B2 (en) | 2003-09-25 | 2009-05-19 | Wyeth | Biphenyloxy-acids |
| US7420083B2 (en) | 2003-09-25 | 2008-09-02 | Wyeth | Substituted aryloximes |
| US7582773B2 (en) | 2003-09-25 | 2009-09-01 | Wyeth | Substituted phenyl indoles |
| AU2004285530A1 (en) | 2003-10-31 | 2005-05-12 | Janssen Pharmaceutica N.V. | Phenoxyacetic acids derivatives useful as peroxisome proliferator-activated receptor (PPAR) dual agonists |
| WO2005051298A2 (en) | 2003-11-19 | 2005-06-09 | Metabasis Therapeutics, Inc. | Novel phosphorus-containing thyromimetics |
| WO2005051373A1 (ja) | 2003-11-26 | 2005-06-09 | Takeda Pharmaceutical Company Limited | 受容体機能調節剤 |
| US7238835B2 (en) | 2003-12-22 | 2007-07-03 | Sanofi-Aventis Deutschland Gmbh | Process for the preparation of substituted 2-(phenoxymethyl) benzoic acids |
| DE10360525B3 (de) * | 2003-12-22 | 2005-08-18 | Aventis Pharma Deutschland Gmbh | Verfahren zur Herstellung von substituierten 2-(Phenoxymethyl)-benzoesäuren |
| WO2005063729A1 (en) | 2003-12-25 | 2005-07-14 | Takeda Pharmaceutical Company Limited | 3-(4-benzyloxyphenyl)propanoic acid derivatives |
| JP4855777B2 (ja) * | 2003-12-26 | 2012-01-18 | 武田薬品工業株式会社 | フェニルプロパン酸誘導体 |
| US7498341B2 (en) | 2004-01-31 | 2009-03-03 | Sanofi Aventis Deutschland Gmbh | Heterocyclically substituted 7-amino-4-quinolone-3-carboxylic acid derivatives, process for their preparation and their use as medicaments |
| US7470706B2 (en) | 2004-01-31 | 2008-12-30 | Sanofi-Aventis Deutschland Gmbh | Cycloalkyl-substituted 7-amino-4-quinolone-3-carboxylic acid derivatives, process for their preparation and their use as medicaments |
| DE102004005172A1 (de) | 2004-02-02 | 2005-08-18 | Aventis Pharma Deutschland Gmbh | Indazolderivate als Inhibitoren der Hormon Sensitiven Lipase |
| BRPI0508098A (pt) | 2004-02-27 | 2007-07-17 | Amgen Inc | compostos, composições farmacêuticas e métodos para uso no tratamento de distúrbios metabólicos |
| EP1586573B1 (en) | 2004-04-01 | 2007-02-07 | Sanofi-Aventis Deutschland GmbH | Oxadiazolones, processes for their preparation and their use as pharmaceuticals |
| US7166738B2 (en) | 2004-04-23 | 2007-01-23 | Roche Palo Alto Llc | Non-nucleoside reverse transcriptase inhibitors |
| US7625949B2 (en) | 2004-04-23 | 2009-12-01 | Roche Palo Alto Llc | Methods for treating retroviral infections |
| CA2572872C (en) * | 2004-07-02 | 2013-10-22 | Sankyo Company Limited | Tissue factor production inhibitor |
| CN101014595A (zh) | 2004-08-11 | 2007-08-08 | 杏林制药株式会社 | 新型环状氨基苯甲酸衍生物 |
| DE102004039509B4 (de) | 2004-08-14 | 2006-09-21 | Sanofi-Aventis Deutschland Gmbh | Aryl-cycloalkyl substituierte Alkansäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| EP1794138A2 (en) | 2004-08-23 | 2007-06-13 | Wyeth | Thiazolo-naphthyl acids as inhibitors of plasminogen activator inhibitor-1 |
| AU2005277138A1 (en) | 2004-08-23 | 2006-03-02 | Wyeth Holdings Corporation | Oxazolo-naphthyl acids as plaminogen activator inhibtor type-1 (PAI-1) modulators useful in the treatment of thrombosis and cardiovascular diseases |
| AU2005277137A1 (en) | 2004-08-23 | 2006-03-02 | Wyeth | Pyrrolo-naphthyl acids as PAI-1 inhibitors |
| DE602005013272D1 (de) * | 2004-10-18 | 2009-04-23 | Merck & Co Inc | Diphenyl-substituierte alkane als flap-inhibitoren |
| MX2007005129A (es) | 2004-10-27 | 2007-09-11 | Daiichi Sankyo Co Ltd | Compuesto de benceno que tiene 2 o mas sustituyentes. |
| JPWO2006057448A1 (ja) * | 2004-11-26 | 2008-06-05 | 武田薬品工業株式会社 | アリールアルカン酸誘導体 |
| AU2005311925A1 (en) | 2004-11-30 | 2006-06-08 | Plexxikon, Inc. | Indole derivatives for use as PPAR PPAR active compounds |
| US20090036489A1 (en) * | 2005-03-22 | 2009-02-05 | Masahiro Nomura | Novel Cyclic Aminophenylalkanoic Acid Derivative |
| DE102005026762A1 (de) | 2005-06-09 | 2006-12-21 | Sanofi-Aventis Deutschland Gmbh | Azolopyridin-2-on-derivate als Inhibitoren von Lipasen und Phospholipasen |
| MX2008002117A (es) | 2005-08-17 | 2008-09-26 | Wyeth Corp | Indoles sustituidos y metodos de uso de estos. |
| JP2009507846A (ja) * | 2005-09-07 | 2009-02-26 | プレキシコン,インコーポレーテッド | Ppar活性化合物 |
| RU2008112198A (ru) | 2005-09-29 | 2009-10-10 | Санофи-Авентис (Fr) | Производные фенил-1,2,4-оксадиазолона, способы их получения и их применение в качестве фармацевтических средств |
| KR20080056220A (ko) | 2005-10-19 | 2008-06-20 | 에프. 호프만-라 로슈 아게 | 페닐-아세트아마이드 nnrt 저해제 |
| DE102006028862A1 (de) | 2006-06-23 | 2007-12-27 | Merck Patent Gmbh | 3-Amino-imidazo[1,2-a]pyridinderivate |
| JO2969B1 (en) | 2006-06-27 | 2016-03-15 | تاكيدا فارماسويتيكال كمبني ليمتد | Welded circular compounds |
| DE602007012299D1 (de) | 2006-09-21 | 2011-03-10 | Piramal Live Science Ltd | Pyridinderivate für die behandlung von stoffwechselstörungen, die mit insulinresistenz oder hyperglykämie in zusammenhang stehen |
| DE102007002260A1 (de) | 2007-01-16 | 2008-07-31 | Sanofi-Aventis | Verwendung von substituierten Pyranonsäurederivaten zur Herstellung von Medikamenten zur Behandlung des Metabolischen Syndroms |
| DE102007008420A1 (de) | 2007-02-21 | 2008-08-28 | Merck Patent Gmbh | Benzimidazolderivate |
| PE20090159A1 (es) | 2007-03-08 | 2009-02-21 | Plexxikon Inc | COMPUESTOS DERIVADOS DE ACIDO INDOL-PROPIONICO COMO MODULADORES PPARs |
| BRPI0701664A2 (pt) * | 2007-05-28 | 2009-01-13 | Fundacao Universidade Fed De Sco Carlos | 4-quinolinonas e quinolinas, processo de preparaÇço, formulaÇÕes farmacÊuticas e uso das mesmas |
| EP2025674A1 (de) | 2007-08-15 | 2009-02-18 | sanofi-aventis | Substituierte Tetrahydronaphthaline, Verfahren zu ihrer Herstellung und ihre Verwendung als Arzneimittel |
| CN101381302B (zh) * | 2007-09-07 | 2013-04-03 | 上海睿智化学研究有限公司 | 2-溴甲基-6-甲基苯甲酰氯/溴的制备方法 |
| DE102007048716A1 (de) | 2007-10-11 | 2009-04-23 | Merck Patent Gmbh | Imidazo[1,2-a]pyrimidinderivate |
| DE102007054497B3 (de) | 2007-11-13 | 2009-07-23 | Sanofi-Aventis Deutschland Gmbh | Neue kristalline Diphenylazetidinonhydrate und Verfahren zu deren Herstellung |
| WO2009075874A1 (en) * | 2007-12-13 | 2009-06-18 | Amgen Inc. | Gamma secretase modulators |
| US20090163481A1 (en) * | 2007-12-13 | 2009-06-25 | Murphy Brian J | Ppar-delta ligands and methods of their use |
| EP2257524B1 (en) * | 2008-02-01 | 2016-01-06 | Brickell Biotech, Inc. | N,n-disubstituted aminoalkylbiphenyl antagonists of prostaglandin d2 receptors |
| JP2011512359A (ja) * | 2008-02-14 | 2011-04-21 | アミラ ファーマシューティカルズ,インク. | プロスタグランジンd2受容体のアンタゴニストとしての環式ジアリールエーテル化合物 |
| US8497381B2 (en) | 2008-02-25 | 2013-07-30 | Panmira Pharmaceuticals, Llc | Antagonists of prostaglandin D2 receptors |
| JP2011518130A (ja) * | 2008-04-02 | 2011-06-23 | アミラ ファーマシューティカルズ,インク. | プロスタグランジンd2受容体のアミノアルキルフェニルアンタゴニスト |
| DE102008017590A1 (de) | 2008-04-07 | 2009-10-08 | Merck Patent Gmbh | Glucopyranosidderivate |
| DE102008018675A1 (de) | 2008-04-14 | 2009-10-15 | Bayer Schering Pharma Aktiengesellschaft | Oxo-heterocyclisch substituierte Carbonsäure-Derivate und ihre Verwendung |
| WO2010003120A2 (en) * | 2008-07-03 | 2010-01-07 | Amira Pharmaceuticals, Inc. | Antagonists of prostaglandin d2 receptors |
| WO2010003624A2 (en) | 2008-07-09 | 2010-01-14 | Sanofi-Aventis | Heterocyclic compounds, processes for their preparation, medicaments comprising these compounds, and the use thereof |
| EP2317845A4 (en) | 2008-07-18 | 2011-11-09 | Zafgen Inc | METHOD FOR TREATING AN OVERWEIGHT OR FATABLE PERSON |
| WO2010039977A2 (en) | 2008-10-01 | 2010-04-08 | Amira Pharmaceuticals, Inc. | Heteroaryl antagonists of prostaglandin d2 receptors |
| WO2010042652A2 (en) | 2008-10-08 | 2010-04-15 | Amira Pharmaceuticals, Inc. | Heteroalkyl biphenyl antagonists of prostaglandin d2 receptors |
| US8383654B2 (en) | 2008-11-17 | 2013-02-26 | Panmira Pharmaceuticals, Llc | Heterocyclic antagonists of prostaglandin D2 receptors |
| US8642650B2 (en) | 2008-12-04 | 2014-02-04 | Zafgen, Inc. | Methods of treating an overweight or obese subject |
| WO2010065877A2 (en) | 2008-12-04 | 2010-06-10 | Zafgen Corporation | Methods of treating an overweight or obese subject |
| WO2010068601A1 (en) | 2008-12-08 | 2010-06-17 | Sanofi-Aventis | A crystalline heteroaromatic fluoroglycoside hydrate, processes for making, methods of use and pharmaceutical compositions thereof |
| US20100173313A1 (en) * | 2009-01-08 | 2010-07-08 | Amira Pharmaceuticals, Inc. | Biomarkers of inflammation |
| WO2010093601A1 (en) | 2009-02-10 | 2010-08-19 | Metabasis Therapeutics, Inc. | Novel sulfonic acid-containing thyromimetics, and methods for their use |
| KR101457027B1 (ko) | 2009-06-09 | 2014-10-31 | 캘리포니아 캐피탈 에쿼티, 엘엘씨 | 트리아진 유도체와 이들의 치료적 용도 |
| JP2012529517A (ja) | 2009-06-09 | 2012-11-22 | アブラクシス バイオサイエンス リミテッド ライアビリティー カンパニー | ベンジル置換トリアジン誘導体類及びそれらの治療応用 |
| CA2765053C (en) | 2009-06-09 | 2015-08-18 | California Capital Equity, Llc | Isoquinoline, quinoline, and quinazoline derivatives as inhibitors of hedgehog signaling |
| CA2768587A1 (en) * | 2009-08-05 | 2011-02-10 | Panmira Pharmaceuticals, Llc | Dp2 antagonist and uses thereof |
| ES2443016T3 (es) | 2009-08-26 | 2014-02-17 | Sanofi | Nuevos hidratos cristalinos de fluoroglicósidos heteroaromáticos, productos farmacéuticos que comprenden estos compuestos, y su empleo |
| BR112012007349A2 (pt) | 2009-10-02 | 2019-09-24 | Sanofi Sa | uso de composto com atividade inibidora de sglt-1/sglt-2 para produção de medicamentos para tratamento de doenças ósseas. |
| AU2010303270A1 (en) | 2009-10-09 | 2012-05-03 | Zafgen Corporation | Sulphone compounds for use in the treatment of obesity |
| DE102009046115A1 (de) * | 2009-10-28 | 2011-09-08 | Bayer Schering Pharma Aktiengesellschaft | Substituierte 3-Phenylpropansäuren und ihre Verwendung |
| CA2782085A1 (en) | 2010-01-06 | 2011-07-14 | Panmira Pharmaceuticals, Llc | Dp2 antagonist and uses thereof |
| MX343135B (es) | 2010-01-08 | 2016-10-25 | Zafgen Corp * | Compuestos de tipo fumagilol y métodos de realización y uso de los mismos. |
| US8815309B2 (en) | 2010-01-08 | 2014-08-26 | Zafgen, Inc. | Methods of treating a subject with benign prostate hyperplasia |
| WO2011107494A1 (de) | 2010-03-03 | 2011-09-09 | Sanofi | Neue aromatische glykosidderivate, diese verbindungen enthaltende arzneimittel und deren verwendung |
| WO2011127304A2 (en) | 2010-04-07 | 2011-10-13 | Zafgen Corporation | Methods of treating an overweight subject |
| US8933024B2 (en) | 2010-06-18 | 2015-01-13 | Sanofi | Azolopyridin-3-one derivatives as inhibitors of lipases and phospholipases |
| US8530413B2 (en) | 2010-06-21 | 2013-09-10 | Sanofi | Heterocyclically substituted methoxyphenyl derivatives with an oxo group, processes for preparation thereof and use thereof as medicaments |
| TW201221505A (en) | 2010-07-05 | 2012-06-01 | Sanofi Sa | Aryloxyalkylene-substituted hydroxyphenylhexynoic acids, process for preparation thereof and use thereof as a medicament |
| TW201215387A (en) | 2010-07-05 | 2012-04-16 | Sanofi Aventis | Spirocyclically substituted 1,3-propane dioxide derivatives, processes for preparation thereof and use thereof as a medicament |
| TW201215388A (en) | 2010-07-05 | 2012-04-16 | Sanofi Sa | (2-aryloxyacetylamino)phenylpropionic acid derivatives, processes for preparation thereof and use thereof as medicaments |
| EP2590951B1 (en) | 2010-07-09 | 2015-01-07 | Pfizer Limited | Benzenesulfonamides useful as sodium channel inhibitors |
| CA2804716A1 (en) | 2010-07-12 | 2012-01-19 | Pfizer Limited | Chemical compounds |
| US9102621B2 (en) | 2010-07-12 | 2015-08-11 | Pfizer Limited | Acyl sulfonamide compounds |
| EP2593432B1 (en) | 2010-07-12 | 2014-10-22 | Pfizer Limited | N-sulfonylbenzamide derivatives useful as voltage gated sodium channel inhibitors |
| JP2013536165A (ja) | 2010-07-12 | 2013-09-19 | ファイザー・リミテッド | 痛みの処置のためのnav1.7阻害薬としてのスルホンアミド誘導体 |
| US8772343B2 (en) | 2010-07-12 | 2014-07-08 | Pfizer Limited | Chemical compounds |
| WO2012012642A1 (en) | 2010-07-22 | 2012-01-26 | Zafgen Corporation | Tricyclic compounds and methds of making and using same |
| PH12013500934A1 (en) | 2010-11-09 | 2022-10-24 | Zafgen Inc | Crystalline solids of a metap-2 inhibitor and methods of making and using same |
| CA2819251A1 (en) | 2010-11-29 | 2012-06-07 | Zafgen Corporation | Treatment of obesity using non-daily administration of 6 - 0 - (4 - dimethylaminoethoxy) cinnamoyl fumagillol |
| ES2544532T3 (es) | 2010-12-07 | 2015-09-01 | Bayer Intellectual Property Gmbh | Ácidos 1-bencilcicloalquilcarboxílicos sustituidos y su uso |
| CA2822017C (en) | 2010-12-23 | 2015-04-07 | Pfizer Inc. | Glucagon receptor modulators |
| WO2012103333A1 (en) | 2011-01-26 | 2012-08-02 | Zafgen Corporation | Tetrazole compounds and methods of making and using same |
| GEP20156351B (en) | 2011-02-08 | 2015-08-25 | Pfizer | Glucagon receptor modulator |
| EP2766349B1 (de) | 2011-03-08 | 2016-06-01 | Sanofi | Mit carbozyklen oder heterozyklen substituierte oxathiazinderivate, verfahren zu deren herstellung, diese verbindungen enthaltende arzneimittel und deren verwendung |
| US8828994B2 (en) | 2011-03-08 | 2014-09-09 | Sanofi | Di- and tri-substituted oxathiazine derivatives, method for the production thereof, use thereof as medicine and drug containing said derivatives and use thereof |
| WO2012120053A1 (de) | 2011-03-08 | 2012-09-13 | Sanofi | Verzweigte oxathiazinderivate, verfahren zu deren herstellung, ihre verwendung als medikament sowie sie enthaltendes arzneimittel und deren verwendung |
| US8871758B2 (en) | 2011-03-08 | 2014-10-28 | Sanofi | Tetrasubstituted oxathiazine derivatives, method for producing them, their use as medicine and drug containing said derivatives and the use thereof |
| WO2012120055A1 (de) | 2011-03-08 | 2012-09-13 | Sanofi | Di- und trisubstituierte oxathiazinderivate, verfahren zu deren herstellung, ihre verwendung als medikament sowie sie enthaltendes arzneimittel und deren verwendung |
| JP5876513B2 (ja) | 2011-03-08 | 2016-03-02 | ザフゲン,インコーポレイテッド | オキサスピロ[2.5]オクタン誘導体および類似体 |
| DE102011007272A1 (de) | 2011-04-13 | 2012-10-18 | Bayer Pharma Aktiengesellschaft | Verzweigte 3-Phenylpropionsäure-Derivate und ihre Verwendung |
| BR112013028665A2 (pt) | 2011-05-06 | 2016-09-06 | Zafgen Inc | compostos de sulfonamida tricíclicos e métodos para fazer e usar os mesmos |
| CN103764652B (zh) | 2011-05-06 | 2016-03-23 | 扎夫根股份有限公司 | 三环吡唑磺酰胺化合物及其制备和使用方法 |
| US9290472B2 (en) | 2011-05-06 | 2016-03-22 | Zafgen, Inc. | Partially saturated tricyclic compounds and methods of making and using same |
| CN103732578B (zh) | 2011-07-22 | 2015-08-12 | 辉瑞大药厂 | 喹啉基胰高血糖素受体调节剂 |
| PH12014500355A1 (en) | 2011-08-15 | 2014-03-31 | Intermune Inc | Lysophosphatidic acid receptor antagonists |
| EP2567959B1 (en) | 2011-09-12 | 2014-04-16 | Sanofi | 6-(4-hydroxy-phenyl)-3-styryl-1h-pyrazolo[3,4-b]pyridine-4-carboxylic acid amide derivatives as kinase inhibitors |
| WO2013037390A1 (en) | 2011-09-12 | 2013-03-21 | Sanofi | 6-(4-hydroxy-phenyl)-3-styryl-1h-pyrazolo[3,4-b]pyridine-4-carboxylic acid amide derivatives as kinase inhibitors |
| WO2013045413A1 (en) | 2011-09-27 | 2013-04-04 | Sanofi | 6-(4-hydroxy-phenyl)-3-alkyl-1h-pyrazolo[3,4-b]pyridine-4-carboxylic acid amide derivatives as kinase inhibitors |
| EP2763671A2 (en) | 2011-10-03 | 2014-08-13 | Zafgen, Inc. | Methods of treating age related disorders |
| CA2861381A1 (en) | 2012-01-18 | 2013-07-25 | Zafgen, Inc. | Tricyclic sulfone compounds and methods of making and using same |
| CA2861390A1 (en) | 2012-01-18 | 2013-07-25 | Zafgen, Inc. | Tricyclic sulfonamide compounds and methods of making and using same |
| WO2013169727A1 (en) | 2012-05-07 | 2013-11-14 | Zafgen, Inc. | Polymorphic salt of the oxalate salt of 6 - o - ( 4 - dimethylaminoethoxy) cinnarnoyl fumagillol and methods of making and using same |
| MX2014013599A (es) | 2012-05-08 | 2015-05-11 | Zafgen Inc | Tratamiento de la obesidad hipotalamica con inhibidores de metap2. |
| US9573918B2 (en) | 2012-05-09 | 2017-02-21 | Zafgen, Inc. | Fumigillol compounds and methods of making and using same |
| DE102012208530A1 (de) | 2012-05-22 | 2013-11-28 | Bayer Pharma AG | Substituierte Piperidinoacetamide und ihre Verwendung |
| MX2015005732A (es) | 2012-11-05 | 2015-12-16 | Zafgen Inc | Compuestos tricíclicos y métodos para hacer y utilizar los mismos. |
| NZ707773A (en) | 2012-11-05 | 2019-05-31 | Zafgen Inc | Methods of treating liver diseases |
| KR20150080614A (ko) | 2012-11-05 | 2015-07-09 | 자프겐 인크. | 비만의 치료 및/또는 제어에서 사용하기 위한 트리시클릭 화합물 |
| BR112015023390A2 (pt) | 2013-03-14 | 2017-07-18 | Zafgen Inc | métodos para tratar de doença renal e outros distúrbios |
| SG11201507320QA (en) | 2013-03-15 | 2015-10-29 | Global Blood Therapeutics Inc | Compounds and uses thereof for the modulation of hemoglobin |
| JP6483666B2 (ja) | 2013-10-14 | 2019-03-13 | エーザイ・アール・アンド・ディー・マネジメント株式会社 | 選択的に置換されたキノリン化合物 |
| WO2015057659A1 (en) | 2013-10-14 | 2015-04-23 | Eisai R&D Management Co., Ltd. | Selectively substituted quinoline compounds |
| EA201992707A1 (ru) | 2013-11-18 | 2020-06-30 | Глобал Блад Терапьютикс, Инк. | Соединения и их применения для модуляции гемоглобина |
| JP6699011B2 (ja) * | 2014-07-04 | 2020-05-27 | 国立大学法人 東京大学 | 脂肪酸サロゲートを含むリゾホスファチジルセリン誘導体 |
| EP2982667A1 (en) | 2014-08-04 | 2016-02-10 | Fraunhofer Gesellschaft zur Förderung der angewandten Forschung e.V. | Competitive PPAR-gamma antagonists |
| JP2017531039A (ja) | 2014-10-10 | 2017-10-19 | プルモシデ リミテド | 新規5,6−ジヒドロ−4H−ベンゾ[b]チエノ−[2,3−d]アゼピン誘導体 |
| US10160772B2 (en) | 2014-12-18 | 2018-12-25 | Pulmocide Limited | 5,6-dihydro-4H-benzo[b]thieno-[2,3-d]azepine derivatives |
| EP3233802A1 (en) | 2014-12-18 | 2017-10-25 | Bayer Pharma Aktiengesellschaft | Substituted pyridyl-cycloalkyl-carboxylic acids, compositions containing them and medical uses thereof |
| AR105671A1 (es) | 2015-08-11 | 2017-10-25 | Zafgen Inc | Compuestos heterocíclicos de fumagillol y sus métodos de elaboración y uso |
| CN106432255A (zh) | 2015-08-11 | 2017-02-22 | 扎夫根公司 | 烟曲霉素醇螺环化合物和制备和使用其的方法 |
| JP7277431B2 (ja) | 2017-07-11 | 2023-05-19 | バーテックス ファーマシューティカルズ インコーポレイテッド | ナトリウムチャネルのモジュレーターとしてのカルボキサミド |
| WO2019079222A1 (en) * | 2017-10-16 | 2019-04-25 | Board Of Regents Of The University Of Texas System | COMPOSITIONS FOR INHIBITING 3 'REPLACEMENT EXONUCLEASE 2 AND SCREENING METHODS FOR SUCH COMPOSITIONS |
| US10905667B2 (en) | 2018-07-24 | 2021-02-02 | Bayer Pharma Aktiengesellschaft | Orally administrable modified-release pharmaceutical dosage form |
| US12441703B2 (en) | 2019-01-10 | 2025-10-14 | Vertex Pharmaceuticals Incorporated | Carboxamides as modulators of sodium channels |
| US12440481B2 (en) | 2019-01-10 | 2025-10-14 | Vertex Pharmaceuticals Incorporated | Esters and carbamates as modulators of sodium channels |
| MX2022006865A (es) | 2019-12-06 | 2022-07-11 | Vertex Pharma | Tetrahidrofuranos sustituidos como moduladores de canales de sodio. |
| CN113912547B (zh) * | 2020-07-10 | 2024-04-30 | 成都凡诺西生物医药科技有限公司 | 取代苯丙咪唑类衍生物及其应用 |
| DK4347031T3 (da) | 2021-06-04 | 2025-12-01 | Vertex Pharma | N-(hydroxyalkyl-(hetero)aryl)-tetrahydrofuran-carboxamider som modulatorer af natriumkanaler |
| WO2024039864A1 (en) * | 2022-08-19 | 2024-02-22 | Purdue Research Foundation | Protein:protein interaction inhibitors |
Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1989005294A1 (en) * | 1987-12-01 | 1989-06-15 | Leo Pharmaceutical Products Ltd. A/S (Løvens Kemis | Substituted quinolines |
| WO1989012629A1 (en) * | 1988-06-20 | 1989-12-28 | Rorer International (Overseas) Inc. | Quinoline derivatives as antagonists of leukotriene d4 |
| WO1992022533A1 (en) * | 1991-06-14 | 1992-12-23 | The Upjohn Company | 4-aminoquinolines and pharmaceutical compositions thereof |
| EP0643045A1 (de) * | 1993-09-10 | 1995-03-15 | Ciba-Geigy Ag | Chinolin-Verbindungen als Leukotriene Antagonisten |
| WO1997031907A1 (en) * | 1996-02-28 | 1997-09-04 | Glaxo Group Limited | Substituted 4-hydroxy-phenylalcanoic acid derivatives with agonist activity to ppar-gamma |
Family Cites Families (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ATE111885T1 (de) * | 1987-09-09 | 1994-10-15 | Zeneca Ltd | Schimmelbekämpfungsmittel. |
| US4920132A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
| US4920133A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
| US5051427A (en) * | 1987-11-03 | 1991-09-24 | Rhone-Poulenc Rorer Pharmaceuticals Inc. | Quinoline derivatives as antagonists of leukotriene D4 |
| US4920131A (en) * | 1987-11-03 | 1990-04-24 | Rorer Pharmaceutical Corp. | Quinoline derivatives and use thereof as antagonists of leukotriene D4 |
| US5508408A (en) | 1993-09-10 | 1996-04-16 | Ciba-Geigy Corporation | Quinoline compound |
| ES2117551B1 (es) * | 1995-12-29 | 1999-04-01 | Menarini Lab | Quinolinas naftalenicas con accion antagonista de los leucotrienos, procedimiento para su preparacion y utilizacion de las mismas. |
| DE69728267T2 (de) * | 1996-02-02 | 2005-02-24 | Merck & Co., Inc. | Antidiabetisches mittel |
| WO1997028149A1 (en) * | 1996-02-02 | 1997-08-07 | Merck & Co., Inc. | Method for raising hdl cholesterol levels |
| WO1998027974A1 (en) * | 1996-12-23 | 1998-07-02 | Merck & Co., Inc. | Antidiabetic agents |
| WO1999007357A1 (en) * | 1997-08-08 | 1999-02-18 | Ono Pharmaceutical Co., Ltd. | η-TYPE REGULATORS FOR PEROXISOME PROLIFERATOR-ACTIVATED RECEPTOR |
| PL344977A1 (en) * | 1997-10-17 | 2001-11-19 | Aventis Pharm Prod Inc | Therapeutic uses of quinoline derivatives |
| DE69828445D1 (de) * | 1998-04-23 | 2005-02-03 | Reddys Lab Ltd Dr | Heterozyklische verbindungen,und deren verwendung in arzneimittel,verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammenstellungen |
| ATE368037T1 (de) | 1999-04-28 | 2007-08-15 | Sanofi Aventis Deutschland | Di-aryl-säurederivate als ppar rezeptor liganden |
-
2000
- 2000-04-28 NZ NZ515087A patent/NZ515087A/en unknown
- 2000-04-28 BR BR0010126-5A patent/BR0010126A/pt not_active Application Discontinuation
- 2000-04-28 JP JP2000613829A patent/JP2002543065A/ja active Pending
- 2000-04-28 RU RU2001132081/04A patent/RU2278860C2/ru not_active IP Right Cessation
- 2000-04-28 HR HR20010793A patent/HRP20010793A2/hr not_active Application Discontinuation
- 2000-04-28 CA CA002371308A patent/CA2371308A1/en not_active Abandoned
- 2000-04-28 AU AU48070/00A patent/AU782404B2/en not_active Ceased
- 2000-04-28 HU HU0200997A patent/HUP0200997A3/hu unknown
- 2000-04-28 CZ CZ20013834A patent/CZ20013834A3/cs unknown
- 2000-04-28 EE EEP200100558A patent/EE200100558A/xx unknown
- 2000-04-28 PT PT00930210T patent/PT1177176E/pt unknown
- 2000-04-28 PL PL00351470A patent/PL351470A1/xx not_active IP Right Cessation
- 2000-04-28 KR KR1020017013772A patent/KR100693771B1/ko not_active Expired - Fee Related
- 2000-04-28 CN CNB008068178A patent/CN1183113C/zh not_active Expired - Fee Related
- 2000-04-28 SK SK1552-2001A patent/SK15522001A3/sk unknown
- 2000-04-28 YU YU74701A patent/YU74701A/sh unknown
- 2000-04-28 AT AT00930210T patent/ATE323678T1/de not_active IP Right Cessation
- 2000-04-28 WO PCT/US2000/011490 patent/WO2000064876A1/en not_active Ceased
- 2000-04-28 DK DK00930210T patent/DK1177176T3/da active
- 2000-04-28 DE DE60027420T patent/DE60027420T2/de not_active Expired - Lifetime
- 2000-04-28 EP EP00930210A patent/EP1177176B1/en not_active Expired - Lifetime
- 2000-04-28 ES ES00930210T patent/ES2261202T3/es not_active Expired - Lifetime
- 2000-04-28 IL IL14592300A patent/IL145923A0/xx active IP Right Grant
- 2000-11-28 US US09/724,496 patent/US7005440B1/en not_active Expired - Lifetime
-
2001
- 2001-10-14 IL IL145923A patent/IL145923A/en not_active IP Right Cessation
- 2001-10-24 ZA ZA200108800A patent/ZA200108800B/en unknown
- 2001-10-25 NO NO20015226A patent/NO20015226L/no not_active Application Discontinuation
-
2006
- 2006-06-21 CY CY20061100831T patent/CY1104899T1/el unknown
Patent Citations (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1989005294A1 (en) * | 1987-12-01 | 1989-06-15 | Leo Pharmaceutical Products Ltd. A/S (Løvens Kemis | Substituted quinolines |
| WO1989012629A1 (en) * | 1988-06-20 | 1989-12-28 | Rorer International (Overseas) Inc. | Quinoline derivatives as antagonists of leukotriene d4 |
| WO1992022533A1 (en) * | 1991-06-14 | 1992-12-23 | The Upjohn Company | 4-aminoquinolines and pharmaceutical compositions thereof |
| EP0643045A1 (de) * | 1993-09-10 | 1995-03-15 | Ciba-Geigy Ag | Chinolin-Verbindungen als Leukotriene Antagonisten |
| WO1997031907A1 (en) * | 1996-02-28 | 1997-09-04 | Glaxo Group Limited | Substituted 4-hydroxy-phenylalcanoic acid derivatives with agonist activity to ppar-gamma |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| RU2480453C2 (ru) * | 2007-03-08 | 2013-04-27 | Альбирео Аб | Новые соединения |
Also Published As
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2278860C2 (ru) | Производные триарил-содержащих кислот в качестве лигандов рецепторов ппар | |
| RU2267484C2 (ru) | Производные диариловой кислоты и фармацевтическая композиция на их основе | |
| US20070072904A1 (en) | PPAR active compounds | |
| JP2012051937A (ja) | 代謝調節型グルタミン酸レセプタのモジュレータとしての新規アルキニル誘導体 | |
| JPWO1999046232A1 (ja) | カルボン酸誘導体およびその誘導体を有効成分として含有する薬剤 | |
| US20030073862A1 (en) | Compounds | |
| US20080207685A1 (en) | Heterocyclic Compounds As Modulators Of Peroxisome Proliferator Activated Receptors, Useful For The Treatment And/Or Prevention Of Disorders Modulated By A Ppar | |
| MXPA01010788A (en) | Tri-aryl acid derivatives as ppar receptor ligands | |
| HK1047098B (en) | Tri-aryl acid derivatives as ppar receptor ligands | |
| HK1109621A (en) | Di-aryl acid derivatives as ppar receptor ligands |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM4A | The patent is invalid due to non-payment of fees |
Effective date: 20070429 |